diff options
| author | Robert Gemmell <robbie@apache.org> | 2015-06-25 10:22:51 +0000 |
|---|---|---|
| committer | Robert Gemmell <robbie@apache.org> | 2015-06-25 10:22:51 +0000 |
| commit | 32ae758bc2e8fd962b66a4ab6341b14009f1907e (patch) | |
| tree | 2f4d8174813284a6ea58bb6b7f6520aa92287476 /qpid/python | |
| parent | 116d91ad7825a98af36a869fc751206fbce0c59f (diff) | |
| parent | f7e896076143de4572b4f1f67ef0765125f2498d (diff) | |
| download | qpid-python-32ae758bc2e8fd962b66a4ab6341b14009f1907e.tar.gz | |
NO-JIRA: create branch for qpid-cpp 0.34 RC process
git-svn-id: https://svn.apache.org/repos/asf/qpid/branches/qpid-cpp-0.34-rc@1687469 13f79535-47bb-0310-9956-ffa450edef68
Diffstat (limited to 'qpid/python')
110 files changed, 25387 insertions, 0 deletions
diff --git a/qpid/python/LICENSE.txt b/qpid/python/LICENSE.txt new file mode 100644 index 0000000000..6b0b1270ff --- /dev/null +++ b/qpid/python/LICENSE.txt @@ -0,0 +1,203 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. + diff --git a/qpid/python/MANIFEST.in b/qpid/python/MANIFEST.in new file mode 100644 index 0000000000..ca53073c04 --- /dev/null +++ b/qpid/python/MANIFEST.in @@ -0,0 +1,3 @@ +recursive-include examples * +recursive-exclude examples verify verify.in +include *.txt diff --git a/qpid/python/NOTICE.txt b/qpid/python/NOTICE.txt new file mode 100644 index 0000000000..4175a06c99 --- /dev/null +++ b/qpid/python/NOTICE.txt @@ -0,0 +1,5 @@ +Apache Qpid Python Client +Copyright 2006-2014 The Apache Software Foundation + +This product includes software developed at +The Apache Software Foundation (http://www.apache.org/). diff --git a/qpid/python/README.txt b/qpid/python/README.txt new file mode 100644 index 0000000000..e076e2d216 --- /dev/null +++ b/qpid/python/README.txt @@ -0,0 +1,65 @@ +This distribution contains the Python client libraries for Apache Qpid. + +Apache Qpid is a high-speed, language independent, platform +independent enterprise messaging system. It currently provides two +messaging brokers (one implemented in C++, one implemented in Java), +and messaging client libraries for Java JMS, C++, C# .NET, Python, +Ruby, and WCF. The messaging protocol for Apache Qpid is AMQP +(Advanced Message Queuing Protocol). You can read more about Qpid +here: + + http://qpid.apache.org/ + +Documentation can be found here: + + http://qpid.apache.org/documentation.html + += GETTING STARTED = + +1. Make sure the Qpid Python client libraries are on your +PYTHONPATH. If you have extracted the archive to the directory +INSTALLPATH, the following export will work: + +$ export PYTHONPATH=${PYTHONPATH}:${INSTALLPATH}/qpid-0.8/python + +2. Make sure a broker is running + +3. Run the 'hello' example from qpid-0.8/python/examples/api: + +$ ./hello +Hello world! + += EXAMPLES = + +The examples/api directory contains several examples. + +Read examples/README.txt for further details on these examples. + += RUNNING THE TESTS = + +The "tests" directory contains a collection of unit tests for the +python client. The "tests_0-10", "tests_0-9", and "tests_0-8" +directories contain protocol level conformance tests for AMQP brokers +of the specified version. + +The qpid-python-test script may be used to run these tests. It will by +default run the python unit tests and the 0-10 conformance tests: + + 1. Run a broker on the default port + + 2. ./qpid-python-test + +If you wish to run the 0-8 or 0-9 conformence tests, they may be +selected as follows: + + 1. Run a broker on the default port + + 2. ./qpid-python-test tests_0-8.* + + -- or -- + + ./qpid-python-test tests_0-9.* + +See the qpid-python-test usage for for additional options: + + ./qpid-python-test -h diff --git a/qpid/python/doc/test-requirements.txt b/qpid/python/doc/test-requirements.txt new file mode 100644 index 0000000000..5089b49dbe --- /dev/null +++ b/qpid/python/doc/test-requirements.txt @@ -0,0 +1,29 @@ +############################################################################### +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +############################################################################### + + * start and stop server, possibly in different configurations, should + at least be able to specify host and port + + * initiate multiple connections/server + + * initiate multiple channels/connection + + * enable positive and negative tests for any protocol interaction + + * test harness must be as robust as possible to spec changes diff --git a/qpid/python/examples/README.txt b/qpid/python/examples/README.txt new file mode 100644 index 0000000000..4395160fec --- /dev/null +++ b/qpid/python/examples/README.txt @@ -0,0 +1,42 @@ +The Python Examples +=================== + +README.txt -- This file. + +api -- Directory containing drain, spout, + sever, hello, and hello_xml examples. + +api/drain -- A simple messaging client that prints + messages from the source specified on + the command line. + +api/spout -- A simple messaging client that sends + messages to the target specified on the + command line. + +api/server -- An example server that process incoming + messages and sends replies. + +api/hello -- An example client that sends a message + and then receives it. + +api/hello_xml -- An example client that sends a message + to the xml exchange and then receives + it. + + +reservations -- Directory containing an example machine + reservation system. + +reservations/common.py -- Utility code used by reserve, + machine-agent, and inventory scripts. + +reservations/reserve -- Messaging client for listing, reserving, + and releasing machines. + +reservations/machine-agent -- Messaging server that tracks and reports + on the status of its host machine and + listens for reservation requests. + +reservations/inventory -- Messaging server that tracks the last + known status of machines. diff --git a/qpid/python/examples/api/drain b/qpid/python/examples/api/drain new file mode 100755 index 0000000000..5e30153bc2 --- /dev/null +++ b/qpid/python/examples/api/drain @@ -0,0 +1,97 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import optparse +from qpid.messaging import * +from qpid.util import URL +from qpid.log import enable, DEBUG, WARN + +parser = optparse.OptionParser(usage="usage: %prog [options] ADDRESS ...", + description="Drain messages from the supplied address.") +parser.add_option("-b", "--broker", default="localhost", + help="connect to specified BROKER (default %default)") +parser.add_option("-c", "--count", type="int", + help="number of messages to drain") +parser.add_option("-f", "--forever", action="store_true", + help="ignore timeout and wait forever") +parser.add_option("-r", "--reconnect", action="store_true", + help="enable auto reconnect") +parser.add_option("-i", "--reconnect-interval", type="float", default=3, + help="interval between reconnect attempts") +parser.add_option("-l", "--reconnect-limit", type="int", + help="maximum number of reconnect attempts") +parser.add_option("-t", "--timeout", type="float", default=0, + help="timeout in seconds to wait before exiting (default %default)") +parser.add_option("-p", "--print", dest="format", default="%(M)s", + help="format string for printing messages (default %default)") +parser.add_option("-v", dest="verbose", action="store_true", + help="enable logging") + +opts, args = parser.parse_args() + +if opts.verbose: + enable("qpid", DEBUG) +else: + enable("qpid", WARN) + +if args: + addr = args.pop(0) +else: + parser.error("address is required") +if opts.forever: + timeout = None +else: + timeout = opts.timeout + +class Formatter: + + def __init__(self, message): + self.message = message + self.environ = {"M": self.message, + "P": self.message.properties, + "C": self.message.content} + + def __getitem__(self, st): + return eval(st, self.environ) + +conn = Connection(opts.broker, + reconnect=opts.reconnect, + reconnect_interval=opts.reconnect_interval, + reconnect_limit=opts.reconnect_limit) +try: + conn.open() + ssn = conn.session() + rcv = ssn.receiver(addr) + + count = 0 + while not opts.count or count < opts.count: + try: + msg = rcv.fetch(timeout=timeout) + print opts.format % Formatter(msg) + count += 1 + ssn.acknowledge() + except Empty: + break +except ReceiverError, e: + print e +except KeyboardInterrupt: + pass + +conn.close() diff --git a/qpid/python/examples/api/hello b/qpid/python/examples/api/hello new file mode 100755 index 0000000000..ad314da19e --- /dev/null +++ b/qpid/python/examples/api/hello @@ -0,0 +1,52 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import sys +from qpid.messaging import * + +if len(sys.argv)<2: + broker = "localhost:5672" +else: + broker = sys.argv[1] + +if len(sys.argv)<3: + address = "amq.topic" +else: + address = sys.argv[2] + +connection = Connection(broker) + +try: + connection.open() + session = connection.session() + + sender = session.sender(address) + receiver = session.receiver(address) + + sender.send(Message("Hello world!")); + + message = receiver.fetch() + print message.content + session.acknowledge() + +except MessagingError,m: + print m + +connection.close() diff --git a/qpid/python/examples/api/hello_xml b/qpid/python/examples/api/hello_xml new file mode 100755 index 0000000000..ab567ec5dd --- /dev/null +++ b/qpid/python/examples/api/hello_xml @@ -0,0 +1,77 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import sys +from qpid.messaging import * + +broker = "localhost:5672" +connection = Connection(broker) + +try: + connection.open() + session = connection.session() + +# Set up the receiver + query = """ + let $w := ./weather + return $w/station = 'Raleigh-Durham International Airport (KRDU)' + and $w/temperature_f > 50 + and $w/temperature_f - $w/dewpoint > 5 + and $w/wind_speed_mph > 7 + and $w/wind_speed_mph < 20 """ + +# query="./weather" + + address = """ + xml; { + create: always, + node:{ type: queue }, + link: { + x-bindings: [{ exchange: xml, key: weather, arguments: { xquery: %r} }] + } + } + """ % query + + receiver = session.receiver(address) + +# Send an observation + + observations = """ + <weather> + <station>Raleigh-Durham International Airport (KRDU)</station> + <wind_speed_mph>16</wind_speed_mph> + <temperature_f>70</temperature_f> + <dewpoint>35</dewpoint> + </weather> """ + + message = Message(subject="weather", content=observations) + sender = session.sender("xml") + sender.send(message) + +# Retrieve matching message from the receiver and print it + + message = receiver.fetch(timeout=1) + print message.content + session.acknowledge() + +except MessagingError,m: + print m + +connection.close() diff --git a/qpid/python/examples/api/server b/qpid/python/examples/api/server new file mode 100755 index 0000000000..78d812bfd2 --- /dev/null +++ b/qpid/python/examples/api/server @@ -0,0 +1,95 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import optparse, sys, traceback +from qpid.messaging import * +from qpid.util import URL +from subprocess import Popen, STDOUT, PIPE +from qpid.log import enable, DEBUG, WARN + +parser = optparse.OptionParser(usage="usage: %prog [options] ADDRESS ...", + description="handle requests from the supplied address.") +parser.add_option("-b", "--broker", default="localhost", + help="connect to specified BROKER (default %default)") +parser.add_option("-r", "--reconnect", action="store_true", + help="enable auto reconnect") +parser.add_option("-i", "--reconnect-interval", type="float", default=3, + help="interval between reconnect attempts") +parser.add_option("-l", "--reconnect-limit", type="int", + help="maximum number of reconnect attempts") +parser.add_option("-v", dest="verbose", action="store_true", + help="enable logging") + +opts, args = parser.parse_args() + +if opts.verbose: + enable("qpid", DEBUG) +else: + enable("qpid", WARN) + +if args: + addr = args.pop(0) +else: + parser.error("address is required") + +conn = Connection(opts.broker, + reconnect=opts.reconnect, + reconnect_interval=opts.reconnect_interval, + reconnect_limit=opts.reconnect_limit) +def dispatch(msg): + msg_type = msg.properties.get("type") + if msg_type == "shell": + proc = Popen(msg.content, shell=True, stderr=STDOUT, stdin=PIPE, stdout=PIPE) + output, _ = proc.communicate() + result = Message(output) + result.properties["exit"] = proc.returncode + elif msg_type == "eval": + try: + content = eval(msg.content) + except: + content = traceback.format_exc() + result = Message(content) + else: + result = Message("unrecognized message type: %s" % msg_type) + return result + +try: + conn.open() + ssn = conn.session() + rcv = ssn.receiver(addr) + + while True: + msg = rcv.fetch() + response = dispatch(msg) + snd = None + try: + snd = ssn.sender(msg.reply_to) + snd.send(response) + except SendError, e: + print e + if snd is not None: + snd.close() + ssn.acknowledge() +except ReceiverError, e: + print e +except KeyboardInterrupt: + pass + +conn.close() diff --git a/qpid/python/examples/api/spout b/qpid/python/examples/api/spout new file mode 100755 index 0000000000..6584b853fc --- /dev/null +++ b/qpid/python/examples/api/spout @@ -0,0 +1,133 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import optparse, time +from qpid.messaging import * +from qpid.util import URL +from qpid.log import enable, DEBUG, WARN + +def nameval(st): + idx = st.find("=") + if idx >= 0: + name = st[0:idx] + value = st[idx+1:] + else: + name = st + value = None + return name, value + +parser = optparse.OptionParser(usage="usage: %prog [options] ADDRESS [ CONTENT ... ]", + description="Send messages to the supplied address.") +parser.add_option("-b", "--broker", default="localhost", + help="connect to specified BROKER (default %default)") +parser.add_option("-r", "--reconnect", action="store_true", + help="enable auto reconnect") +parser.add_option("-i", "--reconnect-interval", type="float", default=3, + help="interval between reconnect attempts") +parser.add_option("-l", "--reconnect-limit", type="int", + help="maximum number of reconnect attempts") +parser.add_option("-c", "--count", type="int", default=1, + help="stop after count messages have been sent, zero disables (default %default)") +parser.add_option("-d", "--durable", action="store_true", + help="make the message persistent") +parser.add_option("-t", "--timeout", type="float", default=None, + help="exit after the specified time") +parser.add_option("-I", "--id", help="use the supplied id instead of generating one") +parser.add_option("-S", "--subject", help="specify a subject") +parser.add_option("-R", "--reply-to", help="specify reply-to address") +parser.add_option("-P", "--property", dest="properties", action="append", default=[], + metavar="NAME=VALUE", help="specify message property") +parser.add_option("-M", "--map", dest="entries", action="append", default=[], + metavar="KEY=VALUE", + help="specify map entry for message body") +parser.add_option("-v", dest="verbose", action="store_true", + help="enable logging") + +opts, args = parser.parse_args() + +if opts.verbose: + enable("qpid", DEBUG) +else: + enable("qpid", WARN) + +if opts.id is None: + spout_id = str(uuid4()) +else: + spout_id = opts.id +if args: + addr = args.pop(0) +else: + parser.error("address is required") + +content = None +content_type = None + +if args: + text = " ".join(args) +else: + text = None + +if opts.entries: + content = {} + if text: + content["text"] = text + for e in opts.entries: + name, val = nameval(e) + content[name] = val +else: + content = text + # no entries were supplied, so assume text/plain for + # compatibility with java (and other) clients + content_type = "text/plain" + +conn = Connection(opts.broker, + reconnect=opts.reconnect, + reconnect_interval=opts.reconnect_interval, + reconnect_limit=opts.reconnect_limit) +try: + conn.open() + ssn = conn.session() + snd = ssn.sender(addr) + + count = 0 + start = time.time() + while (opts.count == 0 or count < opts.count) and \ + (opts.timeout is None or time.time() - start < opts.timeout): + msg = Message(subject=opts.subject, + reply_to=opts.reply_to, + content=content) + if opts.durable: + msg.durable = True + if content_type is not None: + msg.content_type = content_type + msg.properties["spout-id"] = "%s:%s" % (spout_id, count) + for p in opts.properties: + name, val = nameval(p) + msg.properties[name] = val + + snd.send(msg) + count += 1 + print msg +except SendError, e: + print e +except KeyboardInterrupt: + pass + +conn.close() diff --git a/qpid/python/examples/api/statistics.py b/qpid/python/examples/api/statistics.py new file mode 100644 index 0000000000..e095920e90 --- /dev/null +++ b/qpid/python/examples/api/statistics.py @@ -0,0 +1,139 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import time + +TS = "ts" +TIME_SEC = 1000000000 +MILLISECOND = 1000 + +class Statistic: + def message(self, msg): + return + def report(self): + return "" + def header(self): + return "" + + +class Throughput(Statistic): + def __init__(self): + self.messages = 0 + self.started = False + + def message(self, m): + self.messages += 1 + if not self.started: + self.start = time.time() + self.started = True + + def header(self): + return "tp(m/s)" + + def report(self): + if self.started: + elapsed = time.time() - self.start + return str(int(self.messages/elapsed)) + else: + return "0" + + +class ThroughputAndLatency(Throughput): + def __init__(self): + Throughput.__init__(self) + self.total = 0.0 + self.min = float('inf') + self.max = -float('inf') + self.samples = 0 + + def message(self, m): + Throughput.message(self, m) + if TS in m.properties: + self.samples+=1 + latency = MILLISECOND * (time.time() - float(m.properties[TS])/TIME_SEC) + if latency > 0: + self.total += latency + if latency < self.min: + self.min = latency + if latency > self.max: + self.max = latency + + def header(self): +# Throughput.header(self) + return "%s\tl-min\tl-max\tl-avg" % Throughput.header(self) + + def report(self): + output = Throughput.report(self) + if (self.samples > 0): + output += "\t%.2f\t%.2f\t%.2f" %(self.min, self.max, self.total/self.samples) + return output + + +# Report batch and overall statistics +class ReporterBase: + def __init__(self, batch, wantHeader): + self.batchSize = batch + self.batchCount = 0 + self.headerPrinted = not wantHeader + self.overall = None + self.batch = None + + def create(self): + return + + # Count message in the statistics + def message(self, m): + if self.overall == None: + self.overall = self.create() + self.overall.message(m) + if self.batchSize: + if self.batch == None: + self.batch = self.create() + self.batch.message(m) + self.batchCount+=1 + if self.batchCount == self.batchSize: + self.header() + print self.batch.report() + self.create() + self.batchCount = 0 + + # Print overall report. + def report(self): + if self.overall == None: + self.overall = self.create() + self.header() + print self.overall.report() + + def header(self): + if not self.headerPrinted: + if self.overall == None: + self.overall = self.create() + print self.overall.header() + self.headerPrinted = True + + +class Reporter(ReporterBase): + def __init__(self, batchSize, wantHeader, Stats): + ReporterBase.__init__(self, batchSize, wantHeader) + self.__stats = Stats + + def create(self): + ClassName = self.__stats.__class__ + return ClassName() diff --git a/qpid/python/examples/reservations/common.py b/qpid/python/examples/reservations/common.py new file mode 100644 index 0000000000..12f07e1c92 --- /dev/null +++ b/qpid/python/examples/reservations/common.py @@ -0,0 +1,80 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import traceback +from fnmatch import fnmatch +from qpid.messaging import * + +class Dispatcher: + + def unhandled(self, msg): + print "UNHANDLED MESSAGE: %s" % msg + + def ignored(self, msg): + return False + + def dispatch(self, msg): + try: + if self.ignored(msg): + return () + else: + type = msg.properties.get("type") + replies = getattr(self, "do_%s" % type, self.unhandled)(msg) + if replies is None: + return () + else: + return replies + except: + traceback.print_exc() + return () + + def run(self, session): + while self.running(): + msg = session.next_receiver().fetch() + replies = self.dispatch(msg) + + count = len(replies) + sequence = 1 + for to, r in replies: + r.correlation_id = msg.correlation_id + r.properties["count"] = count + r.properties["sequence"] = sequence + sequence += 1 + try: + snd = session.sender(to) + snd.send(r) + except SendError, e: + print e + finally: + snd.close() + + session.acknowledge(msg) + +def get_status(msg): + return msg.content["identity"], msg.content["status"], msg.content["owner"] + +FREE = "free" +BUSY = "busy" + +def match(value, patterns): + for p in patterns: + if fnmatch(value, p): + return True + return False diff --git a/qpid/python/examples/reservations/inventory b/qpid/python/examples/reservations/inventory new file mode 100755 index 0000000000..0a49643e5f --- /dev/null +++ b/qpid/python/examples/reservations/inventory @@ -0,0 +1,94 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import optparse, traceback +from qpid.messaging import * +from qpid.log import enable, DEBUG, WARN +from common import * + +parser = optparse.OptionParser(usage="usage: %prog [options]", + description="machine inventory agent") +parser.add_option("-b", "--broker", default="localhost", + help="connect to specified BROKER (default %default)") +parser.add_option("-d", "--database", + help="database file for persistent machine status") +parser.add_option("-a", "--address", default="reservations", + help="address for reservation requests") +parser.add_option("-v", dest="verbose", action="store_true", + help="enable verbose logging") + +opts, args = parser.parse_args() + +if opts.verbose: + enable("qpid", DEBUG) +else: + enable("qpid", WARN) + +conn = Connection.establish(opts.broker, reconnect=True, reconnect_interval=1) + +class Inventory(Dispatcher): + + def __init__(self): + self.agents = {} + + def running(self): + return True + + def do_status(self, msg): + id, status, owner = get_status(msg) + self.agents[id] = (status, owner) + + def do_query(self, msg): + patterns = msg.content["identity"] + result = [] + for id, (status, owner) in self.agents.items(): + if match(id, patterns): + r = Message(properties = { + "type": "status" + }, + content = { + "identity": id, + "status": status, + "owner": owner + }) + result.append((msg.reply_to, r)) + continue + if not result: + result.append((msg.reply_to, + Message(properties = {"type": "empty"}))) + return result + + def ignored(self, msg): + type = msg.properties.get("type") + return type not in ("status", "query") + +try: + ssn = conn.session() + rcv = ssn.receiver(opts.address, capacity = 10) + snd = ssn.sender(opts.address) + snd.send(Message(reply_to = opts.address, + properties = {"type": "discover", "identity": ["*"]})) + + inv = Inventory() + inv.run(ssn) +except KeyboardInterrupt: + pass +finally: + conn.close() diff --git a/qpid/python/examples/reservations/machine-agent b/qpid/python/examples/reservations/machine-agent new file mode 100755 index 0000000000..a221a8b6de --- /dev/null +++ b/qpid/python/examples/reservations/machine-agent @@ -0,0 +1,103 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import optparse, socket +from qpid.messaging import * +from qpid.log import enable, DEBUG, WARN +from common import * + +host = socket.gethostname() + +parser = optparse.OptionParser(usage="usage: %prog [options]", + description="machine reservation agent") +parser.add_option("-b", "--broker", default="localhost", + help="connect to specified BROKER (default %default)") +parser.add_option("-d", "--database", + help="database file for persistent machine status") +parser.add_option("-a", "--address", default="reservations", + help="address for reservation requests") +parser.add_option("-i", "--identity", default=host, + help="resource id (default %default)") +parser.add_option("-v", dest="verbose", action="store_true", + help="enable verbose logging") + +opts, args = parser.parse_args() + +if opts.verbose: + enable("qpid", DEBUG) +else: + enable("qpid", WARN) + +conn = Connection.establish(opts.broker, reconnect=True, reconnect_interval=1) + + +class Agent(Dispatcher): + + def __init__(self, identity): + self.identity = identity + self.status = FREE + self.owner = None + + def running(self): + return True + + def get_status(self): + msg = Message(properties = {"type": "status"}, + content = {"identity": self.identity, + "status": self.status, + "owner": self.owner}) + return msg + + def do_discover(self, msg): + r = self.get_status() + return [(msg.reply_to, r)] + + def do_reserve(self, msg): + if self.status == FREE: + self.owner = msg.content["owner"] + self.status = BUSY + return self.do_discover(msg) + + def do_release(self, msg): + if self.owner == msg.content["owner"]: + self.status = FREE + self.owner = None + return self.do_discover(msg) + + def ignored(self, msg): + patterns = msg.properties.get("identity") + type = msg.properties.get("type") + if patterns and match(self.identity, patterns): + return type == "status" + else: + return True + +try: + ssn = conn.session() + rcv = ssn.receiver(opts.address) + rcv.capacity = 10 + snd = ssn.sender(opts.address) + agent = Agent(opts.identity) + snd.send(agent.get_status()) + agent.run(ssn) +except KeyboardInterrupt: + pass +finally: + conn.close() diff --git a/qpid/python/examples/reservations/reserve b/qpid/python/examples/reservations/reserve new file mode 100755 index 0000000000..68e7fee912 --- /dev/null +++ b/qpid/python/examples/reservations/reserve @@ -0,0 +1,197 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import optparse, os, sys, time +from uuid import uuid4 +from qpid.messaging import * +from qpid.log import enable, DEBUG, WARN +from common import * + +parser = optparse.OptionParser(usage="usage: %prog [options] PATTERN ...", + description="reserve a machine") +parser.add_option("-b", "--broker", default="localhost", + help="connect to specified BROKER (default %default)") +parser.add_option("-a", "--address", default="reservations", + help="address for reservation requests") +parser.add_option("-r", "--release", action="store_true", + help="release any machines matching the pattern") +parser.add_option("-s", "--status", action="store_true", + help="list machine status") +parser.add_option("-d", "--discover", action="store_true", + help="use discovery instead of inventory") +parser.add_option("-o", "--owner", default=os.environ["USER"], + help="the holder of the reservation") +parser.add_option("-n", "--number", type=int, default=1, + help="the number of machines to reserve") +parser.add_option("-t", "--timeout", type=float, default=10, + help="timeout in seconds to wait for resources") +parser.add_option("-v", dest="verbose", action="store_true", + help="enable verbose logging") + +opts, args = parser.parse_args() + +if opts.verbose: + enable("qpid", DEBUG) +else: + enable("qpid", WARN) + +if args: + patterns = args +else: + patterns = ["*"] + +conn = Connection.establish(opts.broker) + +if opts.release: + request_type = "release" + candidate_status = BUSY + candidate_owner = opts.owner +else: + request_type = "reserve" + candidate_status = FREE + candidate_owner = None + +class Requester(Dispatcher): + + def __init__(self): + self.agents = {} + self.requests = set() + self.outstanding = set() + + def agent_status(self, id): + status, owner = self.agents[id] + if owner: + return "%s %s(%s)" % (id, status, owner) + else: + return "%s %s" % (id, status) + + def correlation(self, cid): + self.requests.add(cid) + self.outstanding.add(cid) + + def ignored(self, msg): + return msg.properties.get("type") not in ("status", "empty") or \ + msg.correlation_id not in self.requests + + def do_status(self, msg): + id, status, owner = get_status(msg) + self.agents[id] = (status, owner) + + if opts.status: + print self.agent_status(id) + + def do_empty(self, msg): + print "no matching resources" + + def candidates(self, candidate_status, candidate_owner): + for id, (status, owner) in self.agents.items(): + if status == candidate_status and owner == candidate_owner: + yield id + + def dispatch(self, msg): + result = Dispatcher.dispatch(self, msg) + count = msg.properties.get("count") + sequence = msg.properties.get("sequence") + if count and sequence == count: + self.outstanding.discard(msg.correlation_id) + return result + +try: + ssn = conn.session() + rcv = ssn.receiver(opts.address, capacity=10) + snd = ssn.sender(opts.address) + + correlation_id = str(uuid4()) + + if opts.discover: + properties = {"type": "discover", "identity": patterns} + content = None + else: + properties = {"type": "query"} + content = {"identity": patterns} + + snd.send(Message(reply_to = opts.address, + correlation_id = correlation_id, + properties = properties, + content = content)) + + req = Requester() + req.correlation(correlation_id) + + start = time.time() + ellapsed = 0 + requested = set() + discovering = opts.discover + + while ellapsed <= opts.timeout and (discovering or req.outstanding): + try: + msg = rcv.fetch(opts.timeout - ellapsed) + ssn.acknowledge(msg) + except Empty: + continue + finally: + ellapsed = time.time() - start + + req.dispatch(msg) + if not opts.status: + if len(requested) < opts.number: + for cid in req.candidates(candidate_status, candidate_owner): + if cid in requested: continue + req_msg = Message(reply_to = opts.address, + correlation_id = str(uuid4()), + properties = {"type": request_type, + "identity": [cid]}, + content = {"owner": opts.owner}) + if not requested: + print "requesting %s:" % request_type, + print cid, + sys.stdout.flush() + req.correlation(req_msg.correlation_id) + snd.send(req_msg) + requested.add(cid) + else: + discovering = False + + if requested: + print + owners = {} + for id in requested: + st, ow = req.agents[id] + if not owners.has_key(ow): + owners[ow] = [] + owners[ow].append(id) + keys = list(owners.keys()) + keys.sort() + for k in keys: + owners[k].sort() + v = ", ".join(owners[k]) + if k is None: + print "free: %s" % v + else: + print "owner %s: %s" % (k, v) + elif req.agents and not opts.status: + print "no available resources" + + if req.outstanding: + print "request timed out" +except KeyboardInterrupt: + pass +finally: + conn.close() diff --git a/qpid/python/mllib/__init__.py b/qpid/python/mllib/__init__.py new file mode 100644 index 0000000000..af192df1d1 --- /dev/null +++ b/qpid/python/mllib/__init__.py @@ -0,0 +1,86 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +This module provides document parsing and transformation utilities for +both SGML and XML. +""" + +import os, dom, transforms, parsers, sys +import xml.sax, types +from xml.sax.handler import ErrorHandler +from xml.sax.xmlreader import InputSource +from cStringIO import StringIO + +def transform(node, *args): + result = node + for t in args: + if isinstance(t, types.ClassType): + t = t() + result = result.dispatch(t) + return result + +def sgml_parse(source): + if isinstance(source, basestring): + source = StringIO(source) + fname = "<string>" + elif hasattr(source, "name"): + fname = source.name + p = parsers.SGMLParser() + num = 1 + for line in source: + p.feed(line) + p.parser.line(fname, num, None) + num += 1 + p.close() + return p.parser.tree + +class Resolver: + + def __init__(self, path): + self.path = path + + def resolveEntity(self, publicId, systemId): + for p in self.path: + fname = os.path.join(p, systemId) + if os.path.exists(fname): + source = InputSource(systemId) + source.setByteStream(open(fname)) + return source + return InputSource(systemId) + +def xml_parse(filename, path=()): + if sys.version_info[0:2] == (2,3): + # XXX: this is for older versions of python + from urllib import pathname2url + source = "file:%s" % pathname2url( os.path.abspath( filename ) ) + else: + source = filename + h = parsers.XMLParser() + p = xml.sax.make_parser() + p.setContentHandler(h) + p.setErrorHandler(ErrorHandler()) + p.setEntityResolver(Resolver(path)) + p.parse(source) + return h.parser.tree + +def sexp(node): + s = transforms.Sexp() + node.dispatch(s) + return s.out diff --git a/qpid/python/mllib/dom.py b/qpid/python/mllib/dom.py new file mode 100644 index 0000000000..486f7082e1 --- /dev/null +++ b/qpid/python/mllib/dom.py @@ -0,0 +1,310 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +Simple DOM for both SGML and XML documents. +""" + +from __future__ import division +from __future__ import generators +from __future__ import nested_scopes + +import transforms + +class Container: + + def __init__(self): + self.children = [] + + def add(self, child): + child.parent = self + self.children.append(child) + + def extend(self, children): + for child in children: + child.parent = self + self.children.append(child) + +class Component: + + def __init__(self): + self.parent = None + + def index(self): + if self.parent: + return self.parent.children.index(self) + else: + return 0 + + def _line(self, file, line, column): + self.file = file + self.line = line + self.column = column + +class DispatchError(Exception): + + def __init__(self, scope, f): + msg = "no such attribtue" + +class Dispatcher: + + def is_type(self, type): + cls = self + while cls != None: + if cls.type == type: + return True + cls = cls.base + return False + + def dispatch(self, f, attrs = ""): + cls = self + while cls != None: + if hasattr(f, cls.type): + return getattr(f, cls.type)(self) + else: + cls = cls.base + + cls = self + while cls != None: + if attrs: + sep = ", " + if cls.base == None: + sep += "or " + else: + sep = "" + attrs += "%s'%s'" % (sep, cls.type) + cls = cls.base + + raise AttributeError("'%s' object has no attribute %s" % + (f.__class__.__name__, attrs)) + +class Node(Container, Component, Dispatcher): + + type = "node" + base = None + + def __init__(self): + Container.__init__(self) + Component.__init__(self) + self.query = Query([self]) + + def __getitem__(self, name): + for nd in self.query[name]: + return nd + + def text(self): + return self.dispatch(transforms.Text()) + + def tag(self, name, *attrs, **kwargs): + t = Tag(name, *attrs, **kwargs) + self.add(t) + return t + + def data(self, s): + d = Data(s) + self.add(d) + return d + + def entity(self, s): + e = Entity(s) + self.add(e) + return e + +class Tree(Node): + + type = "tree" + base = Node + +class Tag(Node): + + type = "tag" + base = Node + + def __init__(self, _name, *attrs, **kwargs): + Node.__init__(self) + self.name = _name + self.attrs = list(attrs) + self.attrs.extend(kwargs.items()) + self.singleton = False + + def get_attr(self, name): + for k, v in self.attrs: + if name == k: + return v + + def _idx(self, attr): + idx = 0 + for k, v in self.attrs: + if k == attr: + return idx + idx += 1 + return None + + def set_attr(self, name, value): + idx = self._idx(name) + if idx is None: + self.attrs.append((name, value)) + else: + self.attrs[idx] = (name, value) + + def dispatch(self, f): + try: + attr = "do_" + self.name + method = getattr(f, attr) + except AttributeError: + return Dispatcher.dispatch(self, f, "'%s'" % attr) + return method(self) + +class Leaf(Component, Dispatcher): + + type = "leaf" + base = None + + def __init__(self, data): + assert isinstance(data, basestring) + self.data = data + +class Data(Leaf): + type = "data" + base = Leaf + +class Entity(Leaf): + type = "entity" + base = Leaf + +class Character(Leaf): + type = "character" + base = Leaf + +class Comment(Leaf): + type = "comment" + base = Leaf + +################### +## Query Classes ## +########################################################################### + +class Adder: + + def __add__(self, other): + return Sum(self, other) + +class Sum(Adder): + + def __init__(self, left, right): + self.left = left + self.right = right + + def __iter__(self): + for x in self.left: + yield x + for x in self.right: + yield x + +class View(Adder): + + def __init__(self, source): + self.source = source + +class Filter(View): + + def __init__(self, predicate, source): + View.__init__(self, source) + self.predicate = predicate + + def __iter__(self): + for nd in self.source: + if self.predicate(nd): yield nd + +class Flatten(View): + + def __iter__(self): + sources = [iter(self.source)] + while sources: + try: + nd = sources[-1].next() + if isinstance(nd, Tree): + sources.append(iter(nd.children)) + else: + yield nd + except StopIteration: + sources.pop() + +class Children(View): + + def __iter__(self): + for nd in self.source: + for child in nd.children: + yield child + +class Attributes(View): + + def __iter__(self): + for nd in self.source: + for a in nd.attrs: + yield a + +class Values(View): + + def __iter__(self): + for name, value in self.source: + yield value + +def flatten_path(path): + if isinstance(path, basestring): + for part in path.split("/"): + yield part + elif callable(path): + yield path + else: + for p in path: + for fp in flatten_path(p): + yield fp + +class Query(View): + + def __iter__(self): + for nd in self.source: + yield nd + + def __getitem__(self, path): + query = self.source + for p in flatten_path(path): + if callable(p): + select = Query + pred = p + source = query + elif isinstance(p, basestring): + if p[0] == "@": + select = Values + pred = lambda x, n=p[1:]: x[0] == n + source = Attributes(query) + elif p[0] == "#": + select = Query + pred = lambda x, t=p[1:]: x.is_type(t) + source = Children(query) + else: + select = Query + pred = lambda x, n=p: isinstance(x, Tag) and x.name == n + source = Flatten(Children(query)) + else: + raise ValueError(p) + query = select(Filter(pred, source)) + + return query diff --git a/qpid/python/mllib/parsers.py b/qpid/python/mllib/parsers.py new file mode 100644 index 0000000000..3e7cc10dc2 --- /dev/null +++ b/qpid/python/mllib/parsers.py @@ -0,0 +1,139 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +Parsers for SGML and XML to dom. +""" + +import sgmllib, xml.sax.handler +from dom import * + +class Parser: + + def __init__(self): + self.tree = Tree() + self.node = self.tree + self.nodes = [] + + def line(self, id, lineno, colno): + while self.nodes: + n = self.nodes.pop() + n._line(id, lineno, colno) + + def add(self, node): + self.node.add(node) + self.nodes.append(node) + + def start(self, name, attrs): + tag = Tag(name, *attrs) + self.add(tag) + self.node = tag + + def end(self, name): + self.balance(name) + self.node = self.node.parent + + def data(self, data): + children = self.node.children + if children and isinstance(children[-1], Data): + children[-1].data += data + else: + self.add(Data(data)) + + def comment(self, comment): + self.add(Comment(comment)) + + def entity(self, ref): + self.add(Entity(ref)) + + def character(self, ref): + self.add(Character(ref)) + + def balance(self, name = None): + while self.node != self.tree and name != self.node.name: + self.node.parent.extend(self.node.children) + del self.node.children[:] + self.node.singleton = True + self.node = self.node.parent + + +class SGMLParser(sgmllib.SGMLParser): + + def __init__(self, entitydefs = None): + sgmllib.SGMLParser.__init__(self) + if entitydefs == None: + self.entitydefs = {} + else: + self.entitydefs = entitydefs + self.parser = Parser() + + def unknown_starttag(self, name, attrs): + self.parser.start(name, attrs) + + def handle_data(self, data): + self.parser.data(data) + + def handle_comment(self, comment): + self.parser.comment(comment) + + def unknown_entityref(self, ref): + self.parser.entity(ref) + + def unknown_charref(self, ref): + self.parser.character(ref) + + def unknown_endtag(self, name): + self.parser.end(name) + + def close(self): + sgmllib.SGMLParser.close(self) + self.parser.balance() + assert self.parser.node == self.parser.tree + +class XMLParser(xml.sax.handler.ContentHandler): + + def __init__(self): + self.parser = Parser() + self.locator = None + + def line(self): + if self.locator != None: + self.parser.line(self.locator.getSystemId(), + self.locator.getLineNumber(), + self.locator.getColumnNumber()) + + def setDocumentLocator(self, locator): + self.locator = locator + + def startElement(self, name, attrs): + self.parser.start(name, attrs.items()) + self.line() + + def endElement(self, name): + self.parser.end(name) + self.line() + + def characters(self, content): + self.parser.data(content) + self.line() + + def skippedEntity(self, name): + self.parser.entity(name) + self.line() + diff --git a/qpid/python/mllib/transforms.py b/qpid/python/mllib/transforms.py new file mode 100644 index 0000000000..69d99125e3 --- /dev/null +++ b/qpid/python/mllib/transforms.py @@ -0,0 +1,164 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +Useful transforms for dom objects. +""" + +import dom +from cStringIO import StringIO + +class Visitor: + + def descend(self, node): + for child in node.children: + child.dispatch(self) + + def node(self, node): + self.descend(node) + + def leaf(self, leaf): + pass + +class Identity: + + def descend(self, node): + result = [] + for child in node.children: + result.append(child.dispatch(self)) + return result + + def default(self, tag): + result = dom.Tag(tag.name, *tag.attrs) + result.extend(self.descend(tag)) + return result + + def tree(self, tree): + result = dom.Tree() + result.extend(self.descend(tree)) + return result + + def tag(self, tag): + return self.default(tag) + + def leaf(self, leaf): + return leaf.__class__(leaf.data) + +class Sexp(Identity): + + def __init__(self): + self.stack = [] + self.level = 0 + self.out = "" + + def open(self, s): + self.out += "(%s" % s + self.level += len(s) + 1 + self.stack.append(s) + + def line(self, s = ""): + self.out = self.out.rstrip() + self.out += "\n" + " "*self.level + s + + def close(self): + s = self.stack.pop() + self.level -= len(s) + 1 + self.out = self.out.rstrip() + self.out += ")" + + def tree(self, tree): + self.open("+ ") + for child in tree.children: + self.line(); child.dispatch(self) + self.close() + + def tag(self, tag): + self.open("Node(%s) " % tag.name) + for child in tag.children: + self.line(); child.dispatch(self) + self.close() + + def leaf(self, leaf): + self.line("%s(%s)" % (leaf.__class__.__name__, leaf.data)) + +class Output: + + def descend(self, node): + out = StringIO() + for child in node.children: + out.write(child.dispatch(self)) + return out.getvalue() + + def default(self, tag): + out = StringIO() + out.write("<%s" % tag.name) + for k, v in tag.attrs: + out.write(' %s="%s"' % (k, v)) + out.write(">") + out.write(self.descend(tag)) + if not tag.singleton: + out.write("</%s>" % tag.name) + return out.getvalue() + + def tree(self, tree): + return self.descend(tree) + + def tag(self, tag): + return self.default(tag) + + def data(self, leaf): + return leaf.data + + def entity(self, leaf): + return "&%s;" % leaf.data + + def character(self, leaf): + raise Exception("TODO") + + def comment(self, leaf): + return "<!-- %s -->" % leaf.data + +class Empty(Output): + + def tag(self, tag): + return self.descend(tag) + + def data(self, leaf): + return "" + + def entity(self, leaf): + return "" + + def character(self, leaf): + return "" + + def comment(self, leaf): + return "" + +class Text(Empty): + + def data(self, leaf): + return leaf.data + + def entity(self, leaf): + return "&%s;" % leaf.data + + def character(self, leaf): + # XXX: is this right? + return "&#%s;" % leaf.data diff --git a/qpid/python/qpid-python-test b/qpid/python/qpid-python-test new file mode 100755 index 0000000000..dfe6a6fc7a --- /dev/null +++ b/qpid/python/qpid-python-test @@ -0,0 +1,639 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +# TODO: summarize, test harness preconditions (e.g. broker is alive) + +import logging, optparse, os, struct, sys, time, traceback, types +from fnmatch import fnmatchcase as match +from getopt import GetoptError +from logging import getLogger, StreamHandler, Formatter, Filter, \ + WARN, DEBUG, ERROR +from qpid.harness import Skipped +from qpid.util import URL + +levels = { + "DEBUG": DEBUG, + "WARN": WARN, + "ERROR": ERROR + } + +sorted_levels = [(v, k) for k, v in levels.items()] +sorted_levels.sort() +sorted_levels = [v for k, v in sorted_levels] + +parser = optparse.OptionParser(usage="usage: %prog [options] PATTERN ...", + description="Run tests matching the specified PATTERNs.") +parser.add_option("-l", "--list", action="store_true", default=False, + help="list tests instead of executing them") +parser.add_option("-b", "--broker", default="localhost", + help="run tests against BROKER (default %default)") +parser.add_option("-f", "--log-file", metavar="FILE", help="log output to FILE") +parser.add_option("-v", "--log-level", metavar="LEVEL", default="WARN", + help="only display log messages of LEVEL or higher severity: " + "%s (default %%default)" % ", ".join(sorted_levels)) +parser.add_option("-c", "--log-category", metavar="CATEGORY", action="append", + dest="log_categories", default=[], + help="log only categories matching CATEGORY pattern") +parser.add_option("-m", "--module", action="append", default=[], + dest="modules", help="add module to test search path") +parser.add_option("-i", "--ignore", action="append", default=[], + help="ignore tests matching IGNORE pattern") +parser.add_option("-I", "--ignore-file", metavar="IFILE", action="append", + default=[], + help="ignore tests matching patterns in IFILE") +parser.add_option("-H", "--halt-on-error", action="store_true", default=False, + dest="hoe", help="halt if an error is encountered") +parser.add_option("-t", "--time", action="store_true", default=False, + help="report timing information on test run") +parser.add_option("-D", "--define", metavar="DEFINE", dest="defines", + action="append", default=[], help="define test parameters") +parser.add_option("-x", "--xml", metavar="XML", dest="xml", + help="write test results in Junit style xml suitable for use by CI tools etc") + +class Config: + + def __init__(self): + self.broker = URL("localhost") + self.defines = {} + self.log_file = None + self.log_level = WARN + self.log_categories = [] + +opts, args = parser.parse_args() + +includes = [] +excludes = ["*__*__"] +config = Config() +list_only = opts.list +config.broker = URL(opts.broker) +for d in opts.defines: + try: + idx = d.index("=") + name = d[:idx] + value = d[idx+1:] + config.defines[name] = value + except ValueError: + config.defines[d] = None +config.log_file = opts.log_file +config.log_level = levels[opts.log_level.upper()] +config.log_categories = opts.log_categories +excludes.extend([v.strip() for v in opts.ignore]) +for v in opts.ignore_file: + f = open(v) + for line in f: + line = line.strip() + if line.startswith("#"): + continue + excludes.append(line) + f.close() + +for a in args: + includes.append(a.strip()) + +if not includes: + if opts.modules: + includes.append("*") + else: + includes.extend(["qpid.tests.*"]) + +def is_ignored(path): + for p in excludes: + if match(path, p): + return True + return False + +def is_included(path): + if is_ignored(path): + return False + for p in includes: + if match(path, p): + return True + return False + +def is_smart(): + return sys.stdout.isatty() and os.environ.get("TERM", "dumb") != "dumb" + +try: + import fcntl, termios + + def width(): + if is_smart(): + s = struct.pack("HHHH", 0, 0, 0, 0) + fd_stdout = sys.stdout.fileno() + x = fcntl.ioctl(fd_stdout, termios.TIOCGWINSZ, s) + rows, cols, xpx, ypx = struct.unpack("HHHH", x) + return cols + else: + try: + return int(os.environ.get("COLUMNS", "80")) + except ValueError: + return 80 + + WIDTH = width() + + def resize(sig, frm): + global WIDTH + WIDTH = width() + + import signal + signal.signal(signal.SIGWINCH, resize) + +except ImportError: + WIDTH = 80 + +def vt100_attrs(*attrs): + return "\x1B[%sm" % ";".join(map(str, attrs)) + +vt100_reset = vt100_attrs(0) + +KEYWORDS = {"pass": (32,), + "skip": (33,), + "fail": (31,), + "start": (34,), + "total": (34,), + "ignored": (33,), + "selected": (34,), + "elapsed": (34,), + "average": (34,)} + +COLORIZE = is_smart() + +def colorize_word(word, text=None): + if text is None: + text = word + return colorize(text, *KEYWORDS.get(word, ())) + +def colorize(text, *attrs): + if attrs and COLORIZE: + return "%s%s%s" % (vt100_attrs(*attrs), text, vt100_reset) + else: + return text + +def indent(text): + lines = text.split("\n") + return " %s" % "\n ".join(lines) + +# Write a 'minimal' Junit xml style report file suitable for use by CI tools such as Jenkins. +class JunitXmlStyleReporter: + + def __init__(self, file): + self.f = open(file, "w"); + + def begin(self): + self.f.write('<?xml version="1.0" encoding="UTF-8" ?>\n') + self.f.write('<testsuite>\n') + + def report(self, name, result): + parts = name.split(".") + method = parts[-1] + module = '.'.join(parts[0:-1]) + self.f.write('<testcase classname="%s" name="%s" time="%f">\n' % (module, method, result.time)) + if result.failed: + self.f.write('<failure>\n') + self.f.write('<![CDATA[\n') + self.f.write(result.exceptions) + self.f.write(']]>\n') + self.f.write('</failure>\n') + self.f.write('</testcase>\n') + + def end(self): + self.f.write('</testsuite>\n') + self.f.close() + +class Interceptor: + + def __init__(self): + self.newline = False + self.indent = False + self.passthrough = True + self.dirty = False + self.last = None + + def begin(self): + self.newline = True + self.indent = True + self.passthrough = False + self.dirty = False + self.last = None + + def reset(self): + self.newline = False + self.indent = False + self.passthrough = True + +class StreamWrapper: + + def __init__(self, interceptor, stream, prefix=" "): + self.interceptor = interceptor + self.stream = stream + self.prefix = prefix + + def fileno(self): + return self.stream.fileno() + + def isatty(self): + return self.stream.isatty() + + def write(self, s): + if self.interceptor.passthrough: + self.stream.write(s) + return + + if s: + self.interceptor.dirty = True + + if self.interceptor.newline: + self.interceptor.newline = False + self.stream.write(" %s\n" % colorize_word("start")) + self.interceptor.indent = True + if self.interceptor.indent: + self.stream.write(self.prefix) + if s.endswith("\n"): + s = s.replace("\n", "\n%s" % self.prefix)[:-2] + self.interceptor.indent = True + else: + s = s.replace("\n", "\n%s" % self.prefix) + self.interceptor.indent = False + self.stream.write(s) + + if s: + self.interceptor.last = s[-1] + + def flush(self): + self.stream.flush() + +interceptor = Interceptor() + +out_wrp = StreamWrapper(interceptor, sys.stdout) +err_wrp = StreamWrapper(interceptor, sys.stderr) + +out = sys.stdout +err = sys.stderr +sys.stdout = out_wrp +sys.stderr = err_wrp + +class PatternFilter(Filter): + + def __init__(self, *patterns): + Filter.__init__(self, patterns) + self.patterns = patterns + + def filter(self, record): + if not self.patterns: + return True + for p in self.patterns: + if match(record.name, p): + return True + return False + +root = getLogger() +handler = StreamHandler(sys.stdout) +filter = PatternFilter(*config.log_categories) +handler.addFilter(filter) +handler.setFormatter(Formatter("%(asctime)s %(levelname)s %(message)s")) +root.addHandler(handler) +root.setLevel(WARN) + +log = getLogger("qpid.test") + +PASS = "pass" +SKIP = "skip" +FAIL = "fail" + +class Runner: + + def __init__(self): + self.exceptions = [] + self.skip = False + + def passed(self): + return not self.exceptions + + def skipped(self): + return self.skip + + def failed(self): + return self.exceptions and not self.skip + + def halt(self): + return self.exceptions or self.skip + + def run(self, name, phase): + try: + phase() + except KeyboardInterrupt: + raise + except: + exi = sys.exc_info() + if issubclass(exi[0], Skipped): + self.skip = True + self.exceptions.append((name, exi)) + + def status(self): + if self.passed(): + return PASS + elif self.skipped(): + return SKIP + elif self.failed(): + return FAIL + else: + return None + + def get_formatted_exceptions(self): + for name, info in self.exceptions: + if issubclass(info[0], Skipped): + output = indent("".join(traceback.format_exception_only(*info[:2]))).rstrip() + else: + output = "Error during %s:" % name + output += indent("".join(traceback.format_exception(*info))).rstrip() + return output + +ST_WIDTH = 8 + +def run_test(name, test, config): + patterns = filter.patterns + level = root.level + filter.patterns = config.log_categories + root.setLevel(config.log_level) + + parts = name.split(".") + line = None + output = "" + for part in parts: + if line: + if len(line) + len(part) >= (WIDTH - ST_WIDTH - 1): + output += "%s. \\\n" % line + line = " %s" % part + else: + line = "%s.%s" % (line, part) + else: + line = part + + if line: + output += "%s %s" % (line, (((WIDTH - ST_WIDTH) - len(line))*".")) + sys.stdout.write(output) + sys.stdout.flush() + interceptor.begin() + start = time.time() + try: + runner = test() + finally: + interceptor.reset() + end = time.time() + if interceptor.dirty: + if interceptor.last != "\n": + sys.stdout.write("\n") + sys.stdout.write(output) + print " %s" % colorize_word(runner.status()) + if runner.failed() or runner.skipped(): + print runner.get_formatted_exceptions() + root.setLevel(level) + filter.patterns = patterns + return TestResult(end - start, runner.passed(), runner.skipped(), runner.failed(), runner.get_formatted_exceptions()) + +class TestResult: + + def __init__(self, time, passed, skipped, failed, exceptions): + self.time = time + self.passed = passed + self.skipped = skipped + self.failed = failed + self.exceptions = exceptions + +class FunctionTest: + + def __init__(self, test): + self.test = test + + def name(self): + return "%s.%s" % (self.test.__module__, self.test.__name__) + + def run(self): + return run_test(self.name(), self._run, config) + + def _run(self): + runner = Runner() + runner.run("test", lambda: self.test(config)) + return runner + + def __repr__(self): + return "FunctionTest(%r)" % self.test + +class MethodTest: + + def __init__(self, cls, method): + self.cls = cls + self.method = method + + def name(self): + return "%s.%s.%s" % (self.cls.__module__, self.cls.__name__, self.method) + + def run(self): + return run_test(self.name(), self._run, config) + + def _run(self): + runner = Runner() + inst = self.cls(self.method) + test = getattr(inst, self.method) + + if hasattr(inst, "configure"): + runner.run("configure", lambda: inst.configure(config)) + if runner.halt(): return runner + if hasattr(inst, "setUp"): + runner.run("setup", inst.setUp) + if runner.halt(): return runner + elif hasattr(inst, "setup"): + runner.run("setup", inst.setup) + if runner.halt(): return runner + + runner.run("test", test) + + if hasattr(inst, "tearDown"): + runner.run("teardown", inst.tearDown) + elif hasattr(inst, "teardown"): + runner.run("teardown", inst.teardown) + + return runner + + def __repr__(self): + return "MethodTest(%r, %r)" % (self.cls, self.method) + +class PatternMatcher: + + def __init__(self, *patterns): + self.patterns = patterns + + def matches(self, name): + for p in self.patterns: + if match(name, p): + return True + return False + +class FunctionScanner(PatternMatcher): + + def inspect(self, obj): + return type(obj) == types.FunctionType and self.matches(name) + + def descend(self, func): + # the None is required for older versions of python + return; yield None + + def extract(self, func): + yield FunctionTest(func) + +class ClassScanner(PatternMatcher): + + def inspect(self, obj): + return type(obj) in (types.ClassType, types.TypeType) and self.matches(obj.__name__) + + def descend(self, cls): + # the None is required for older versions of python + return; yield None + + def extract(self, cls): + names = dir(cls) + names.sort() + for name in names: + obj = getattr(cls, name) + t = type(obj) + if t == types.MethodType and name.startswith("test"): + yield MethodTest(cls, name) + +class ModuleScanner: + + def inspect(self, obj): + return type(obj) == types.ModuleType + + def descend(self, obj): + names = dir(obj) + names.sort() + for name in names: + yield getattr(obj, name) + + def extract(self, obj): + # the None is required for older versions of python + return; yield None + +class Harness: + + def __init__(self): + self.scanners = [ + ModuleScanner(), + ClassScanner("*Test", "*Tests", "*TestCase"), + FunctionScanner("test_*") + ] + self.tests = [] + self.scanned = [] + + def scan(self, *roots): + objects = list(roots) + + while objects: + obj = objects.pop(0) + for s in self.scanners: + if s.inspect(obj): + self.tests.extend(s.extract(obj)) + for child in s.descend(obj): + if not (child in self.scanned or child in objects): + objects.append(child) + self.scanned.append(obj) + +modules = opts.modules +if not modules: + modules.extend(["qpid.tests"]) +h = Harness() +for name in modules: + m = __import__(name, None, None, ["dummy"]) + h.scan(m) + +filtered = [t for t in h.tests if is_included(t.name())] +ignored = [t for t in h.tests if is_ignored(t.name())] +total = len(filtered) + len(ignored) + +if opts.xml and not list_only: + xmlr = JunitXmlStyleReporter(opts.xml); + xmlr.begin(); +else: + xmlr = None + +passed = 0 +failed = 0 +skipped = 0 +start = time.time() +for t in filtered: + if list_only: + print t.name() + else: + st = t.run() + if xmlr: + xmlr.report(t.name(), st) + if st.passed: + passed += 1 + elif st.skipped: + skipped += 1 + elif st.failed: + failed += 1 + if opts.hoe: + break +end = time.time() + +run = passed + failed + +if not list_only: + if passed: + _pass = "pass" + else: + _pass = "fail" + if failed: + outcome = "fail" + else: + outcome = "pass" + if ignored: + ign = "ignored" + else: + ign = "pass" + if skipped: + skip = "skip" + else: + skip = "pass" + print colorize("Totals:", 1), + totals = [colorize_word("total", "%s tests" % total), + colorize_word(_pass, "%s passed" % passed), + colorize_word(skip, "%s skipped" % skipped), + colorize_word(ign, "%s ignored" % len(ignored)), + colorize_word(outcome, "%s failed" % failed)] + print ", ".join(totals), + if opts.hoe and failed > 0: + print " -- (halted after %s)" % run + else: + print + if opts.time and run > 0: + print colorize("Timing:", 1), + timing = [colorize_word("elapsed", "%.2fs elapsed" % (end - start)), + colorize_word("average", "%.2fs average" % ((end - start)/run))] + print ", ".join(timing) + +if xmlr: + xmlr.end() + +if failed: + sys.exit(1) +else: + sys.exit(0) diff --git a/qpid/python/qpid-python-test-ant.xml b/qpid/python/qpid-python-test-ant.xml new file mode 100644 index 0000000000..f70e8923ed --- /dev/null +++ b/qpid/python/qpid-python-test-ant.xml @@ -0,0 +1,192 @@ +<!-- + - + - Licensed to the Apache Software Foundation (ASF) under one + - or more contributor license agreements. See the NOTICE file + - distributed with this work for additional information + - regarding copyright ownership. The ASF licenses this file + - to you under the Apache License, Version 2.0 (the + - "License"); you may not use this file except in compliance + - with the License. You may obtain a copy of the License at + - + - http://www.apache.org/licenses/LICENSE-2.0 + - + - Unless required by applicable law or agreed to in writing, + - software distributed under the License is distributed on an + - "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + - KIND, either express or implied. See the License for the + - specific language governing permissions and limitations + - under the License. + - + --> + +<project name="qpid-python-test-ant" default="test" > + + <!-- Ant wrapper around qpid-python-test. Starts Qpid broker; runs + qpid-python-test, and formats the test output. --> + + <!-- Directories etc --> + <property name="python.dir" value="${basedir}"/> + <property name="qpid.root.dir" value="${basedir}/.."/> + <property name="java.dir" value="${basedir}/../java"/> + <property name="cpp.dir" value="${basedir}/../cpp"/> + <property name="build.dir" value="${python.dir}/build"/> + <property name="test.results.dir" value="${build.dir}/results"/> + <property name="test.work.dir" value="${build.dir}/work"/> + + <!-- Qpid Broker Executable/Url/Port --> + <property name="qpid.port" value="15672"/> + <property name="qpid.python.broker.url" value="amqp://guest/guest@localhost:${qpid.port}"/> + <property name="qpid.executable" value="${java.dir}/build/bin/qpid-server"/> + <property name="qpid.executable.args" value="-p ${qpid.port}"/> + + <!-- Additional modules to be added to command. Property must include -M --> + <property name="python.test.modules" value=""/> + <!-- Ignore file. Property must include -I --> + <property name="python.test.ignore" value=""/> + + <!-- Time to wait for socket to be bound --> + <property name="ensurefree.maxwait" value="1000"/> + <property name="start.maxwait" value="20000"/> + <property name="stop.maxwait" value="10000"/> + <property name="socket.checkevery" value="1000"/> + + <!-- Success message --> + <property name="passed.message" value=" 0 failed"/> + + + <target name="test" depends="clean, init, ensure-port-free, start-broker, run-tests, stop-broker, kill-broker, report"/> + + <target name="init"> + <mkdir dir="${test.results.dir}"/> + <mkdir dir="${test.work.dir}"/> + </target> + + <target name="clean"> + <delete dir="${test.results.dir}"/> + <delete dir="${test.work.dir}"/> + </target> + + <target name="ensure-port-free" depends="init" unless="skip.ensure-port-free"> + <await-port-free port="${qpid.port}" maxwait="${ensurefree.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="ensurefree.timeout"/> + <fail message="Broker port ${qpid.port} is not free" if="ensurefree.timeout"/> + </target> + + <target name="start-broker" depends="init"> + <echo>Starting Qpid with ${qpid.executable} ${qpid.executable.args}</echo> + <exec executable="${qpid.executable}" spawn="true"> + <env key="QPID_WORK" value="${test.work.dir}"/> + <arg line="${qpid.executable.args}"/> + </exec> + + <await-port-bound port="${qpid.port}" maxwait="${start.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="start.timeout"/> + <antcall target="wait-for-broker-ready"/> + </target> + + <target name="wait-for-broker-ready" if="java.broker"> + <await-broker-log path="${test.work.dir}/log/qpid.log" entry="BRK-1004" maxwait="${start.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="start.timeout"/> + </target> + + <target name="stop-broker" depends="init"> + <get-pid port="${qpid.port}" targetProperty="pid" resultproperty="stopresultproperty"/> + <echo>Stopping Qpid with pid '${pid}'</echo> + <kill-pid pid="${pid}" signo="-15"/> + + <await-port-free port="${qpid.port}" maxwait="${stop.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="stop.timeout"/> + </target> + + <target name="kill-broker" depends="init" if="stop.timeout"> + <get-pid port="${qpid.port}" targetProperty="pid" resultproperty="killresultproperty"/> + <echo>Killing Qpid with pid '${pid}'</echo> + <kill-pid pid="${pid}" signo="-9"/> + </target> + + <target name="run-tests" depends="init" unless="start.timeout"> + <echo>Running test-suite</echo> + <exec executable="${python.dir}/qpid-python-test" output="${test.results.dir}/results.out" error="${test.results.dir}/results.err"> + <env key="PYTHONPATH" value="${qpid.root.dir}/tests/src/py:${qpid.root.dir}/extras/qmf/src/py:${qpid.root.dir}/tools/src/py"/> + <arg line="-b ${qpid.python.broker.url} -x ${test.results.dir}/TEST-python.xml ${python.test.modules} ${python.test.ignore}"/> + </exec> + + <condition property="tests.passed"> + <isfileselected file="${test.results.dir}/results.out"> + <contains text="${passed.message}"/> + </isfileselected> + </condition> + </target> + + <target name="report" depends="init" unless="tests.passed"> + <fail message="Test(s) failed" unless="tests.passed"/> + <echo message="Test(s) passed" if="tests.passed"/> + </target> + + <macrodef name="get-pid"> + <attribute name="targetProperty"/> + <attribute name="port"/> + <attribute name="resultproperty"/> + <sequential> + <exec executable="lsof" outputproperty="@{targetProperty}" resultproperty="@{resultproperty}"> + <arg value="-t"/> <!-- Terse output --> + <arg value="-i"/> <arg value=":@{port}"/> + </exec> + <fail message="lsof failed to determine the pid using port @{port}, exit status ${@{resultproperty}}"> + <condition> + <not> + <equals arg1="${@{resultproperty}}" arg2="0"/> + </not> + </condition> + </fail> + </sequential> + </macrodef> + + <macrodef name="kill-pid"> + <attribute name="pid"/> + <attribute name="signo"/> + <sequential> + <exec executable="kill"> + <arg value="@{signo}"/> + <arg value="@{pid}"/> + </exec> + </sequential> + </macrodef> + + <macrodef name="await-port-free"> + <attribute name="maxwait"/> + <attribute name="checkevery"/> + <attribute name="timeoutproperty"/> + <attribute name="port"/> + <sequential> + <waitfor maxwait="@{maxwait}" maxwaitunit="millisecond" checkevery="@{checkevery}" checkeveryunit="millisecond" timeoutproperty="@{timeoutproperty}"> + <not> + <socket server="localhost" port="@{port}"/> + </not> + </waitfor> + </sequential> + </macrodef> + + <macrodef name="await-port-bound"> + <attribute name="maxwait"/> + <attribute name="checkevery"/> + <attribute name="timeoutproperty"/> + <attribute name="port"/> + <sequential> + <waitfor maxwait="@{maxwait}" maxwaitunit="millisecond" checkevery="@{checkevery}" checkeveryunit="millisecond" timeoutproperty="@{timeoutproperty}"> + <socket server="localhost" port="@{port}"/> + </waitfor> + </sequential> + </macrodef> + + <macrodef name="await-broker-log"> + <attribute name="maxwait"/> + <attribute name="checkevery"/> + <attribute name="timeoutproperty"/> + <attribute name="entry"/> + <attribute name="path"/> + <sequential> + <echo message="Waiting for entry '@{entry}' in '@{path}' "/> + <waitfor maxwait="@{maxwait}" maxwaitunit="millisecond" checkevery="@{checkevery}" checkeveryunit="millisecond" timeoutproperty="@{timeoutproperty}"> + <resourcecontains resource="@{path}" substring="@{entry}"/> + </waitfor> + <echo message="Timeout @{timeoutproperty}"/> + </sequential> + </macrodef> +</project> diff --git a/qpid/python/qpid/__init__.py b/qpid/python/qpid/__init__.py new file mode 100644 index 0000000000..780cab46a0 --- /dev/null +++ b/qpid/python/qpid/__init__.py @@ -0,0 +1,84 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import connection + +class Struct: + + def __init__(self, type, *args, **kwargs): + self.__dict__["type"] = type + self.__dict__["_values"] = {} + + if len(args) > len(self.type.fields): + raise TypeError("too many args") + + for a, f in zip(args, self.type.fields): + self.set(f.name, a) + + for k, a in kwargs.items(): + self.set(k, a) + + def _check(self, attr): + field = self.type.fields.byname.get(attr) + if field == None: + raise AttributeError(attr) + return field + + def exists(self, attr): + return self.type.fields.byname.has_key(attr) + + def has(self, attr): + self._check(attr) + return self._values.has_key(attr) + + def set(self, attr, value): + self._check(attr) + self._values[attr] = value + + def get(self, attr): + field = self._check(attr) + return self._values.get(attr, field.default()) + + def clear(self, attr): + self._check(attr) + del self._values[attr] + + def __setattr__(self, attr, value): + self.set(attr, value) + + def __getattr__(self, attr): + return self.get(attr) + + def __delattr__(self, attr): + self.clear(attr) + + def __setitem__(self, attr, value): + self.set(attr, value) + + def __getitem__(self, attr): + return self.get(attr) + + def __delitem__(self, attr): + self.clear(attr) + + def __str__(self): + return "%s %s" % (self.type, self._values) + + def __repr__(self): + return str(self) diff --git a/qpid/python/qpid/client.py b/qpid/python/qpid/client.py new file mode 100644 index 0000000000..5fedaa2cb1 --- /dev/null +++ b/qpid/python/qpid/client.py @@ -0,0 +1,277 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +An AMQP client implementation that uses a custom delegate for +interacting with the server. +""" + +import os, threading +from peer import Peer, Channel, Closed +from delegate import Delegate +from util import get_client_properties_with_defaults +from connection08 import Connection, Frame, connect +from spec08 import load +from queue import Queue +from reference import ReferenceId, References +from saslmech.finder import get_sasl_mechanism +from saslmech.sasl import SaslException + + +class Client: + + def __init__(self, host, port, spec = None, vhost = None): + self.host = host + self.port = port + if spec: + self.spec = spec + else: + from specs_config import amqp_spec_0_9 + self.spec = load(amqp_spec_0_9) + self.structs = StructFactory(self.spec) + self.sessions = {} + + self.mechanism = None + self.response = None + self.locale = None + self.sasl = None + + self.vhost = vhost + if self.vhost == None: + self.vhost = "/" + + self.queues = {} + self.lock = threading.Lock() + + self.closed = False + self.reason = None + self.started = threading.Event() + self.peer = None + + def wait(self): + self.started.wait() + if self.closed: + raise Closed(self.reason) + + def queue(self, key): + self.lock.acquire() + try: + try: + q = self.queues[key] + except KeyError: + q = Queue(0) + self.queues[key] = q + finally: + self.lock.release() + return q + + def start(self, response=None, mechanism=None, locale="en_US", tune_params=None, + username=None, password=None, + client_properties=None, connection_options=None, sasl_options = None, + channel_options=None): + self.mechanism = mechanism + self.response = response + self.username = username + self.password = password + self.locale = locale + self.tune_params = tune_params + self.client_properties=get_client_properties_with_defaults(provided_client_properties=client_properties, version_property_key="version") + self.sasl_options = sasl_options + self.socket = connect(self.host, self.port, connection_options) + self.conn = Connection(self.socket, self.spec) + self.peer = Peer(self.conn, ClientDelegate(self), Session, channel_options) + + self.conn.init() + self.peer.start() + self.wait() + self.channel(0).connection_open(self.vhost) + + def channel(self, id): + self.lock.acquire() + try: + ssn = self.peer.channel(id) + ssn.client = self + self.sessions[id] = ssn + finally: + self.lock.release() + return ssn + + def session(self): + self.lock.acquire() + try: + id = None + for i in xrange(1, 64*1024): + if not self.sessions.has_key(i): + id = i + break + finally: + self.lock.release() + if id == None: + raise RuntimeError("out of channels") + else: + return self.channel(id) + + def close(self): + if self.peer: + try: + if not self.closed: + channel = self.channel(0); + if channel and not channel._closed: + try: + channel.connection_close(reply_code=200) + except: + pass + self.closed = True + finally: + self.peer.stop() + +class ClientDelegate(Delegate): + + def __init__(self, client): + Delegate.__init__(self) + self.client = client + + def connection_start(self, ch, msg): + + if self.client.mechanism is None: + if self.client.response is not None: + # Supports users passing the response argument alon + self.client.mechanism = "AMQPLAIN" + else: + supportedMechs = msg.frame.args[3].split() + + self.client.sasl = get_sasl_mechanism(supportedMechs, self.client.username, self.client.password, sasl_options=self.client.sasl_options) + + if self.client.sasl == None: + raise SaslException("sasl negotiation failed: no mechanism agreed. Server supports: %s " % supportedMechs) + + self.client.mechanism = self.client.sasl.mechanismName() + + if self.client.response is None: + self.client.response = self.client.sasl.initialResponse() + + msg.start_ok(mechanism=self.client.mechanism, + response=self.client.response or "", + locale=self.client.locale, + client_properties=self.client.client_properties) + + def connection_secure(self, ch, msg): + msg.secure_ok(response=self.client.sasl.response(msg.challenge)) + + def connection_tune(self, ch, msg): + if self.client.tune_params: + #todo: just override the params, i.e. don't require them + # all to be included in tune_params + msg.tune_ok(**self.client.tune_params) + else: + msg.tune_ok(*msg.frame.args) + self.client.started.set() + + def message_transfer(self, ch, msg): + self.client.queue(msg.destination).put(msg) + + def message_open(self, ch, msg): + ch.references.open(msg.reference) + + def message_close(self, ch, msg): + ch.references.close(msg.reference) + + def message_append(self, ch, msg): + ch.references.get(msg.reference).append(msg.bytes) + + def message_acquired(self, ch, msg): + ch.control_queue.put(msg) + + def basic_deliver(self, ch, msg): + self.client.queue(msg.consumer_tag).put(msg) + + def channel_pong(self, ch, msg): + msg.ok() + + def channel_close(self, ch, msg): + ch.closed(msg) + + def channel_flow(self, ch, msg): + # On resuming we don't want to send a message before flow-ok has been sent. + # Therefore, we send flow-ok before we set the flow_control flag. + if msg.active: + msg.flow_ok() + ch.set_flow_control(not msg.active) + # On suspending we don't want to send a message after flow-ok has been sent. + # Therefore, we send flow-ok after we set the flow_control flag. + if not msg.active: + msg.flow_ok() + + def session_ack(self, ch, msg): + pass + + def session_closed(self, ch, msg): + ch.closed(msg) + + def connection_close(self, ch, msg): + self.client.peer.closed(msg) + + def execution_complete(self, ch, msg): + ch.completion.complete(msg.cumulative_execution_mark) + + def execution_result(self, ch, msg): + future = ch.futures[msg.command_id] + future.put_response(ch, msg.data) + + def closed(self, reason): + self.client.closed = True + self.client.reason = reason + self.client.started.set() + +class StructFactory: + + def __init__(self, spec): + self.spec = spec + self.factories = {} + + def __getattr__(self, name): + if self.factories.has_key(name): + return self.factories[name] + elif self.spec.domains.byname.has_key(name): + f = lambda *args, **kwargs: self.struct(name, *args, **kwargs) + self.factories[name] = f + return f + else: + raise AttributeError(name) + + def struct(self, name, *args, **kwargs): + return self.spec.struct(name, *args, **kwargs) + +class Session(Channel): + + def __init__(self, *args): + Channel.__init__(self, *args) + self.references = References() + self.client = None + + def open(self): + self.session_open() + + def close(self): + self.session_close() + self.client.lock.acquire() + try: + del self.client.sessions[self.id] + finally: + self.client.lock.release() diff --git a/qpid/python/qpid/codec.py b/qpid/python/qpid/codec.py new file mode 100644 index 0000000000..a4c542415c --- /dev/null +++ b/qpid/python/qpid/codec.py @@ -0,0 +1,701 @@ +#!/usr/bin/env python + +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +Utility code to translate between python objects and AMQP encoded data +fields. + +The unit test for this module is located in tests/codec.py +""" + +import re, qpid, spec08, os +from cStringIO import StringIO +from struct import * +from reference import ReferenceId +from logging import getLogger + +log = getLogger("qpid.codec") + +class EOF(Exception): + pass + +# This code appears to be dead +TYPE_ALIASES = { + "long_string": "longstr", + "unsigned_int": "long" + } + +class Codec: + + """ + class that handles encoding/decoding of AMQP primitives + """ + + def __init__(self, stream, spec): + """ + initializing the stream/fields used + """ + self.stream = stream + self.spec = spec + self.nwrote = 0 + self.nread = 0 + self.incoming_bits = [] + self.outgoing_bits = [] + + # Before 0-91, the AMQP's set of types did not include the boolean type. However, + # the 0-8 and 0-9 Java client uses this type so we encode/decode it too. However, this + # can be turned off by setting the followng environment value. + if "QPID_CODEC_DISABLE_0_91_BOOLEAN" in os.environ: + self.understand_boolean = False + else: + self.understand_boolean = True + + log.debug("AMQP 0-91 boolean supported : %r", self.understand_boolean) + + self.types = {} + self.codes = {} + self.integertypes = [int, long] + self.encodings = { + float: "double", # python uses 64bit floats, send them as doubles + basestring: "longstr", + None.__class__:"void", + list: "sequence", + tuple: "sequence", + dict: "table" + } + + if self.understand_boolean: + self.encodings[bool] = "boolean" + + for constant in self.spec.constants: + # This code appears to be dead + if constant.klass == "field-table-type": + type = constant.name.replace("field_table_", "") + self.typecode(constant.id, TYPE_ALIASES.get(type, type)) + + if not self.types: + # long-string 'S' + self.typecode(ord('S'), "longstr") + # void 'V' + self.typecode(ord('V'), "void") + # long-int 'I' (32bit signed) + self.typecode(ord('I'), "signed_int") + # long-long-int 'l' (64bit signed) + # This is a long standing pre-0-91-spec type used by the Java + # client, 0-9-1 says it should be unsigned or use 'L') + self.typecode(ord('l'), "signed_long") + # double 'd' + self.typecode(ord('d'), "double") + # float 'f' + self.typecode(ord('f'), "float") + + if self.understand_boolean: + self.typecode(ord('t'), "boolean") + + ## The following are supported for decoding only ## + + # short-short-uint 'b' (8bit signed) + self.types[ord('b')] = "signed_octet" + # short-int 's' (16bit signed) + # This is a long standing pre-0-91-spec type code used by the Java + # client to send shorts, it should really be a short-string, or for 0-9-1 use 'U' + self.types[ord('s')] = "signed_short" + + def typecode(self, code, type): + self.types[code] = type + self.codes[type] = code + + def resolve(self, klass, value): + if(klass in self.integertypes): + if (value >= -2147483648 and value <= 2147483647): + return "signed_int" + elif (value >= -9223372036854775808 and value <= 9223372036854775807): + return "signed_long" + else: + raise ValueError('Integer value is outwith the supported 64bit signed range') + if self.encodings.has_key(klass): + return self.encodings[klass] + for base in klass.__bases__: + result = self.resolve(base, value) + if result != None: + return result + + def read(self, n): + """ + reads in 'n' bytes from the stream. Can raise EOF exception + """ + self.clearbits() + data = self.stream.read(n) + if n > 0 and len(data) == 0: + raise EOF() + self.nread += len(data) + return data + + def write(self, s): + """ + writes data 's' to the stream + """ + self.flushbits() + self.stream.write(s) + self.nwrote += len(s) + + def flush(self): + """ + flushes the bits and data present in the stream + """ + self.flushbits() + self.stream.flush() + + def flushbits(self): + """ + flushes the bits(compressed into octets) onto the stream + """ + if len(self.outgoing_bits) > 0: + bytes = [] + index = 0 + for b in self.outgoing_bits: + if index == 0: bytes.append(0) + if b: bytes[-1] |= 1 << index + index = (index + 1) % 8 + del self.outgoing_bits[:] + for byte in bytes: + self.encode_octet(byte) + + def clearbits(self): + if self.incoming_bits: + self.incoming_bits = [] + + def pack(self, fmt, *args): + """ + packs the data 'args' as per the format 'fmt' and writes it to the stream + """ + self.write(pack(fmt, *args)) + + def unpack(self, fmt): + """ + reads data from the stream and unpacks it as per the format 'fmt' + """ + size = calcsize(fmt) + data = self.read(size) + values = unpack(fmt, data) + if len(values) == 1: + return values[0] + else: + return values + + def encode(self, type, value): + """ + calls the appropriate encode function e.g. encode_octet, encode_short etc. + """ + if isinstance(type, spec08.Struct): + self.encode_struct(type, value) + else: + getattr(self, "encode_" + type)(value) + + def decode(self, type): + """ + calls the appropriate decode function e.g. decode_octet, decode_short etc. + """ + if isinstance(type, spec08.Struct): + return self.decode_struct(type) + else: + log.debug("Decoding using method: decode_" + type) + return getattr(self, "decode_" + type)() + + def encode_bit(self, o): + """ + encodes a bit + """ + if o: + self.outgoing_bits.append(True) + else: + self.outgoing_bits.append(False) + + def decode_bit(self): + """ + decodes a bit + """ + if len(self.incoming_bits) == 0: + bits = self.decode_octet() + for i in range(8): + self.incoming_bits.append(bits >> i & 1 != 0) + return self.incoming_bits.pop(0) + + def encode_octet(self, o): + """ + encodes an UNSIGNED octet (8 bits) data 'o' in network byte order + """ + + # octet's valid range is [0,255] + if (o < 0 or o > 255): + raise ValueError('Valid range of octet is [0,255]') + + self.pack("!B", int(o)) + + def decode_octet(self): + """ + decodes an UNSIGNED octet (8 bits) encoded in network byte order + """ + return self.unpack("!B") + + def decode_signed_octet(self): + """ + decodes a signed octet (8 bits) encoded in network byte order + """ + return self.unpack("!b") + + def encode_short(self, o): + """ + encodes an UNSIGNED short (16 bits) data 'o' in network byte order + AMQP 0-9-1 type: short-uint + """ + + # short int's valid range is [0,65535] + if (o < 0 or o > 65535): + raise ValueError('Valid range of short int is [0,65535]: %s' % o) + + self.pack("!H", int(o)) + + def decode_short(self): + """ + decodes an UNSIGNED short (16 bits) in network byte order + AMQP 0-9-1 type: short-uint + """ + return self.unpack("!H") + + def decode_signed_short(self): + """ + decodes a signed short (16 bits) in network byte order + AMQP 0-9-1 type: short-int + """ + return self.unpack("!h") + + def encode_long(self, o): + """ + encodes an UNSIGNED long (32 bits) data 'o' in network byte order + AMQP 0-9-1 type: long-uint + """ + + # we need to check both bounds because on 64 bit platforms + # struct.pack won't raise an error if o is too large + if (o < 0 or o > 4294967295): + raise ValueError('Valid range of long int is [0,4294967295]') + + self.pack("!L", int(o)) + + def decode_long(self): + """ + decodes an UNSIGNED long (32 bits) in network byte order + AMQP 0-9-1 type: long-uint + """ + return self.unpack("!L") + + def encode_signed_long(self, o): + """ + encodes a signed long (64 bits) in network byte order + AMQP 0-9-1 type: long-long-int + """ + self.pack("!q", o) + + def decode_signed_long(self): + """ + decodes a signed long (64 bits) in network byte order + AMQP 0-9-1 type: long-long-int + """ + return self.unpack("!q") + + def encode_signed_int(self, o): + """ + encodes a signed int (32 bits) in network byte order + AMQP 0-9-1 type: long-int + """ + self.pack("!l", o) + + def decode_signed_int(self): + """ + decodes a signed int (32 bits) in network byte order + AMQP 0-9-1 type: long-int + """ + return self.unpack("!l") + + def encode_longlong(self, o): + """ + encodes an UNSIGNED long long (64 bits) data 'o' in network byte order + AMQP 0-9-1 type: long-long-uint + """ + self.pack("!Q", o) + + def decode_longlong(self): + """ + decodes an UNSIGNED long long (64 bits) in network byte order + AMQP 0-9-1 type: long-long-uint + """ + return self.unpack("!Q") + + def encode_float(self, o): + self.pack("!f", o) + + def decode_float(self): + return self.unpack("!f") + + def encode_double(self, o): + self.pack("!d", o) + + def decode_double(self): + return self.unpack("!d") + + def encode_bin128(self, b): + for idx in range (0,16): + self.pack("!B", ord (b[idx])) + + def decode_bin128(self): + result = "" + for idx in range (0,16): + result = result + chr (self.unpack("!B")) + return result + + def encode_raw(self, len, b): + for idx in range (0,len): + self.pack("!B", b[idx]) + + def decode_raw(self, len): + result = "" + for idx in range (0,len): + result = result + chr (self.unpack("!B")) + return result + + def enc_str(self, fmt, s): + """ + encodes a string 's' in network byte order as per format 'fmt' + """ + size = len(s) + self.pack(fmt, size) + self.write(s) + + def dec_str(self, fmt): + """ + decodes a string in network byte order as per format 'fmt' + """ + size = self.unpack(fmt) + return self.read(size) + + def encode_shortstr(self, s): + """ + encodes a short string 's' in network byte order + """ + + # short strings are limited to 255 octets + if len(s) > 255: + raise ValueError('Short strings are limited to 255 octets') + + self.enc_str("!B", s) + + def decode_shortstr(self): + """ + decodes a short string in network byte order + """ + return self.dec_str("!B") + + def encode_longstr(self, s): + """ + encodes a long string 's' in network byte order + """ + if isinstance(s, dict): + self.encode_table(s) + else: + self.enc_str("!L", s) + + def decode_longstr(self): + """ + decodes a long string 's' in network byte order + """ + return self.dec_str("!L") + + def encode_table(self, tbl): + """ + encodes a table data structure in network byte order + """ + enc = StringIO() + codec = Codec(enc, self.spec) + if tbl: + for key, value in tbl.items(): + if self.spec.major == 8 and self.spec.minor == 0 and len(key) > 128: + raise ValueError("field table key too long: '%s'" % key) + type = self.resolve(value.__class__, value) + if type == None: + raise ValueError("no encoding for: " + str(value.__class__)) + codec.encode_shortstr(key) + codec.encode_octet(self.codes[type]) + codec.encode(type, value) + s = enc.getvalue() + self.encode_long(len(s)) + self.write(s) + + def decode_table(self): + """ + decodes a table data structure in network byte order + """ + size = self.decode_long() + start = self.nread + result = {} + while self.nread - start < size: + key = self.decode_shortstr() + log.debug("Field table entry key: %r", key) + code = self.decode_octet() + log.debug("Field table entry type code: %r", code) + if self.types.has_key(code): + value = self.decode(self.types[code]) + else: + w = width(code) + if fixed(code): + value = self.read(w) + else: + value = self.read(self.dec_num(w)) + result[key] = value + log.debug("Field table entry value: %r", value) + return result + + def encode_timestamp(self, t): + """ + encodes a timestamp data structure in network byte order + """ + self.encode_longlong(t) + + def decode_timestamp(self): + """ + decodes a timestamp data structure in network byte order + """ + return self.decode_longlong() + + def encode_content(self, s): + """ + encodes a content data structure in network byte order + + content can be passed as a string in which case it is assumed to + be inline data, or as an instance of ReferenceId indicating it is + a reference id + """ + if isinstance(s, ReferenceId): + self.encode_octet(1) + self.encode_longstr(s.id) + else: + self.encode_octet(0) + self.encode_longstr(s) + + def decode_content(self): + """ + decodes a content data structure in network byte order + + return a string for inline data and a ReferenceId instance for + references + """ + type = self.decode_octet() + if type == 0: + return self.decode_longstr() + else: + return ReferenceId(self.decode_longstr()) + + # new domains for 0-10: + + def encode_rfc1982_long(self, s): + self.encode_long(s) + + def decode_rfc1982_long(self): + return self.decode_long() + + def encode_rfc1982_long_set(self, s): + self.encode_short(len(s) * 4) + for i in s: + self.encode_long(i) + + def decode_rfc1982_long_set(self): + count = self.decode_short() / 4 + set = [] + for i in range(0, count): + set.append(self.decode_long()) + return set; + + def encode_uuid(self, s): + self.pack("16s", s) + + def decode_uuid(self): + return self.unpack("16s") + + def encode_void(self,o): + #NO-OP, value is implicit in the type. + return + + def decode_void(self): + return None + + def enc_num(self, width, n): + if width == 1: + self.encode_octet(n) + elif width == 2: + self.encode_short(n) + elif width == 3: + self.encode_long(n) + else: + raise ValueError("invalid width: %s" % width) + + def dec_num(self, width): + if width == 1: + return self.decode_octet() + elif width == 2: + return self.decode_short() + elif width == 4: + return self.decode_long() + else: + raise ValueError("invalid width: %s" % width) + + def encode_struct(self, type, s): + if type.size: + enc = StringIO() + codec = Codec(enc, self.spec) + codec.encode_struct_body(type, s) + codec.flush() + body = enc.getvalue() + self.enc_num(type.size, len(body)) + self.write(body) + else: + self.encode_struct_body(type, s) + + def decode_struct(self, type): + if type.size: + size = self.dec_num(type.size) + if size == 0: + return None + return self.decode_struct_body(type) + + def encode_struct_body(self, type, s): + reserved = 8*type.pack - len(type.fields) + assert reserved >= 0 + + for f in type.fields: + if s == None: + self.encode_bit(False) + elif f.type == "bit": + self.encode_bit(s.get(f.name)) + else: + self.encode_bit(s.has(f.name)) + + for i in range(reserved): + self.encode_bit(False) + + for f in type.fields: + if f.type != "bit" and s != None and s.has(f.name): + self.encode(f.type, s.get(f.name)) + + self.flush() + + def decode_struct_body(self, type): + reserved = 8*type.pack - len(type.fields) + assert reserved >= 0 + + s = qpid.Struct(type) + + for f in type.fields: + if f.type == "bit": + s.set(f.name, self.decode_bit()) + elif self.decode_bit(): + s.set(f.name, None) + + for i in range(reserved): + if self.decode_bit(): + raise ValueError("expecting reserved flag") + + for f in type.fields: + if f.type != "bit" and s.has(f.name): + s.set(f.name, self.decode(f.type)) + + self.clearbits() + + return s + + def encode_long_struct(self, s): + enc = StringIO() + codec = Codec(enc, self.spec) + type = s.type + codec.encode_short(type.type) + codec.encode_struct_body(type, s) + self.encode_longstr(enc.getvalue()) + + def decode_long_struct(self): + codec = Codec(StringIO(self.decode_longstr()), self.spec) + type = self.spec.structs[codec.decode_short()] + return codec.decode_struct_body(type) + + def decode_array(self): + size = self.decode_long() + code = self.decode_octet() + count = self.decode_long() + result = [] + for i in range(0, count): + if self.types.has_key(code): + value = self.decode(self.types[code]) + else: + w = width(code) + if fixed(code): + value = self.read(w) + else: + value = self.read(self.dec_num(w)) + result.append(value) + return result + + def encode_boolean(self, s): + if (s): + self.pack("!c", "\x01") + else: + self.pack("!c", "\x00") + + def decode_boolean(self): + b = self.unpack("!c") + if b == "\x00": + return False + else: + # AMQP spec says anything else is True + return True + + + +def fixed(code): + return (code >> 6) != 2 + +def width(code): + # decimal + if code >= 192: + decsel = (code >> 4) & 3 + if decsel == 0: + return 5 + elif decsel == 1: + return 9 + elif decsel == 3: + return 0 + else: + raise ValueError(code) + # variable width + elif code < 192 and code >= 128: + lenlen = (code >> 4) & 3 + if lenlen == 3: raise ValueError(code) + return 2 ** lenlen + # fixed width + else: + return (code >> 4) & 7 diff --git a/qpid/python/qpid/codec010.py b/qpid/python/qpid/codec010.py new file mode 100644 index 0000000000..f4dc60fcc4 --- /dev/null +++ b/qpid/python/qpid/codec010.py @@ -0,0 +1,404 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import datetime, string +from packer import Packer +from datatypes import serial, timestamp, RangedSet, Struct, UUID +from ops import Compound, PRIMITIVE, COMPOUND + +class CodecException(Exception): pass + +def direct(t): + return lambda x: t + +def map_str(s): + for c in s: + if ord(c) >= 0x80: + return "vbin16" + return "str16" + +class Codec(Packer): + + ENCODINGS = { + bool: direct("boolean"), + unicode: direct("str16"), + str: map_str, + buffer: direct("vbin32"), + int: direct("int64"), + long: direct("int64"), + float: direct("double"), + None.__class__: direct("void"), + list: direct("list"), + tuple: direct("list"), + dict: direct("map"), + timestamp: direct("datetime"), + datetime.datetime: direct("datetime"), + UUID: direct("uuid"), + Compound: direct("struct32") + } + + def encoding(self, obj): + enc = self._encoding(obj.__class__, obj) + if enc is None: + raise CodecException("no encoding for %r" % obj) + return PRIMITIVE[enc] + + def _encoding(self, klass, obj): + if self.ENCODINGS.has_key(klass): + return self.ENCODINGS[klass](obj) + for base in klass.__bases__: + result = self._encoding(base, obj) + if result != None: + return result + + def read_primitive(self, type): + return getattr(self, "read_%s" % type.NAME)() + def write_primitive(self, type, v): + getattr(self, "write_%s" % type.NAME)(v) + + def read_void(self): + return None + def write_void(self, v): + assert v == None + + def read_bit(self): + return True + def write_bit(self, b): + if not b: raise ValueError(b) + + def read_uint8(self): + return self.unpack("!B") + def write_uint8(self, n): + if n < 0 or n > 255: + raise CodecException("Cannot encode %d as uint8" % n) + return self.pack("!B", n) + + def read_int8(self): + return self.unpack("!b") + def write_int8(self, n): + if n < -128 or n > 127: + raise CodecException("Cannot encode %d as int8" % n) + self.pack("!b", n) + + def read_char(self): + return self.unpack("!c") + def write_char(self, c): + self.pack("!c", c) + + def read_boolean(self): + return self.read_uint8() != 0 + def write_boolean(self, b): + if b: n = 1 + else: n = 0 + self.write_uint8(n) + + + def read_uint16(self): + return self.unpack("!H") + def write_uint16(self, n): + if n < 0 or n > 65535: + raise CodecException("Cannot encode %d as uint16" % n) + self.pack("!H", n) + + def read_int16(self): + return self.unpack("!h") + def write_int16(self, n): + if n < -32768 or n > 32767: + raise CodecException("Cannot encode %d as int16" % n) + self.pack("!h", n) + + + def read_uint32(self): + return self.unpack("!L") + def write_uint32(self, n): + if n < 0 or n > 4294967295: + raise CodecException("Cannot encode %d as uint32" % n) + self.pack("!L", n) + + def read_int32(self): + return self.unpack("!l") + def write_int32(self, n): + if n < -2147483648 or n > 2147483647: + raise CodecException("Cannot encode %d as int32" % n) + self.pack("!l", n) + + def read_float(self): + return self.unpack("!f") + def write_float(self, f): + self.pack("!f", f) + + def read_sequence_no(self): + return serial(self.read_uint32()) + def write_sequence_no(self, n): + self.write_uint32(n.value) + + + def read_uint64(self): + return self.unpack("!Q") + def write_uint64(self, n): + self.pack("!Q", n) + + def read_int64(self): + return self.unpack("!q") + def write_int64(self, n): + self.pack("!q", n) + + def read_datetime(self): + return timestamp(self.read_uint64()) + def write_datetime(self, t): + if isinstance(t, datetime.datetime): + t = timestamp(t) + self.write_uint64(t) + + def read_double(self): + return self.unpack("!d") + def write_double(self, d): + self.pack("!d", d) + + def read_vbin8(self): + return self.read(self.read_uint8()) + def write_vbin8(self, b): + if isinstance(b, buffer): + b = str(b) + self.write_uint8(len(b)) + self.write(b) + + def read_str8(self): + return self.read_vbin8().decode("utf8") + def write_str8(self, s): + self.write_vbin8(s.encode("utf8")) + + def read_str16(self): + return self.read_vbin16().decode("utf8") + def write_str16(self, s): + self.write_vbin16(s.encode("utf8")) + + def read_str16_latin(self): + return self.read_vbin16().decode("iso-8859-15") + def write_str16_latin(self, s): + self.write_vbin16(s.encode("iso-8859-15")) + + + def read_vbin16(self): + return self.read(self.read_uint16()) + def write_vbin16(self, b): + if isinstance(b, buffer): + b = str(b) + self.write_uint16(len(b)) + self.write(b) + + def read_sequence_set(self): + result = RangedSet() + size = self.read_uint16() + nranges = size/8 + while nranges > 0: + lower = self.read_sequence_no() + upper = self.read_sequence_no() + result.add(lower, upper) + nranges -= 1 + return result + def write_sequence_set(self, ss): + size = 8*len(ss.ranges) + self.write_uint16(size) + for range in ss.ranges: + self.write_sequence_no(range.lower) + self.write_sequence_no(range.upper) + + def read_vbin32(self): + return self.read(self.read_uint32()) + def write_vbin32(self, b): + if isinstance(b, buffer): + b = str(b) + # Allow unicode values in connection 'response' field + if isinstance(b, unicode): + b = b.encode('utf8') + self.write_uint32(len(b)) + self.write(b) + + def read_map(self): + sc = StringCodec(self.read_vbin32()) + if not sc.encoded: + return None + count = sc.read_uint32() + result = {} + while sc.encoded: + k = sc.read_str8() + code = sc.read_uint8() + type = PRIMITIVE[code] + v = sc.read_primitive(type) + result[k] = v + return result + + def _write_map_elem(self, k, v): + type = self.encoding(v) + sc = StringCodec() + sc.write_str8(k) + sc.write_uint8(type.CODE) + sc.write_primitive(type, v) + return sc.encoded + + def write_map(self, m): + sc = StringCodec() + if m is not None: + sc.write_uint32(len(m)) + sc.write(string.joinfields(map(self._write_map_elem, m.keys(), m.values()), "")) + self.write_vbin32(sc.encoded) + + def read_array(self): + sc = StringCodec(self.read_vbin32()) + if not sc.encoded: + return None + type = PRIMITIVE[sc.read_uint8()] + count = sc.read_uint32() + result = [] + while count > 0: + result.append(sc.read_primitive(type)) + count -= 1 + return result + def write_array(self, a): + sc = StringCodec() + if a is not None: + if len(a) > 0: + type = self.encoding(a[0]) + else: + type = self.encoding(None) + sc.write_uint8(type.CODE) + sc.write_uint32(len(a)) + for o in a: + sc.write_primitive(type, o) + self.write_vbin32(sc.encoded) + + def read_list(self): + sc = StringCodec(self.read_vbin32()) + if not sc.encoded: + return None + count = sc.read_uint32() + result = [] + while count > 0: + type = PRIMITIVE[sc.read_uint8()] + result.append(sc.read_primitive(type)) + count -= 1 + return result + def write_list(self, l): + sc = StringCodec() + if l is not None: + sc.write_uint32(len(l)) + for o in l: + type = self.encoding(o) + sc.write_uint8(type.CODE) + sc.write_primitive(type, o) + self.write_vbin32(sc.encoded) + + def read_struct32(self): + size = self.read_uint32() + code = self.read_uint16() + cls = COMPOUND[code] + op = cls() + self.read_fields(op) + return op + def write_struct32(self, value): + self.write_compound(value) + + def read_compound(self, cls): + size = self.read_size(cls.SIZE) + if cls.CODE is not None: + code = self.read_uint16() + assert code == cls.CODE + op = cls() + self.read_fields(op) + return op + def write_compound(self, op): + sc = StringCodec() + if op.CODE is not None: + sc.write_uint16(op.CODE) + sc.write_fields(op) + self.write_size(op.SIZE, len(sc.encoded)) + self.write(sc.encoded) + + def read_fields(self, op): + flags = 0 + for i in range(op.PACK): + flags |= (self.read_uint8() << 8*i) + + for i in range(len(op.FIELDS)): + f = op.FIELDS[i] + if flags & (0x1 << i): + if COMPOUND.has_key(f.type): + value = self.read_compound(COMPOUND[f.type]) + else: + value = getattr(self, "read_%s" % f.type)() + setattr(op, f.name, value) + def write_fields(self, op): + flags = 0 + for i in range(len(op.FIELDS)): + f = op.FIELDS[i] + value = getattr(op, f.name) + if f.type == "bit": + present = value + else: + present = value != None + if present: + flags |= (0x1 << i) + for i in range(op.PACK): + self.write_uint8((flags >> 8*i) & 0xFF) + for i in range(len(op.FIELDS)): + f = op.FIELDS[i] + if flags & (0x1 << i): + if COMPOUND.has_key(f.type): + enc = self.write_compound + else: + enc = getattr(self, "write_%s" % f.type) + value = getattr(op, f.name) + enc(value) + + def read_size(self, width): + if width > 0: + attr = "read_uint%d" % (width*8) + return getattr(self, attr)() + def write_size(self, width, n): + if width > 0: + attr = "write_uint%d" % (width*8) + getattr(self, attr)(n) + + def read_uuid(self): + return UUID(bytes=self.unpack("16s")) + def write_uuid(self, s): + if isinstance(s, UUID): + s = s.bytes + self.pack("16s", s) + + def read_bin128(self): + return self.unpack("16s") + def write_bin128(self, b): + self.pack("16s", b) + + + +class StringCodec(Codec): + + def __init__(self, encoded = ""): + self.encoded = encoded + + def read(self, n): + result = self.encoded[:n] + self.encoded = self.encoded[n:] + return result + + def write(self, s): + self.encoded += s diff --git a/qpid/python/qpid/compat.py b/qpid/python/qpid/compat.py new file mode 100644 index 0000000000..12966c2383 --- /dev/null +++ b/qpid/python/qpid/compat.py @@ -0,0 +1,221 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import sys +import errno +import time +from logging import getLogger +log = getLogger("qpid.messaging") + +try: + set = set +except NameError: + from sets import Set as set + +try: + from socket import SHUT_RDWR +except ImportError: + SHUT_RDWR = 2 + +try: + from traceback import format_exc +except ImportError: + import traceback + def format_exc(): + return "".join(traceback.format_exception(*sys.exc_info())) + +# QPID-5588: prefer poll() to select(), as it allows file descriptors with +# values > FD_SETSIZE +import select as _select_mod +try: + # QPID-5790: unless eventlet/greenthreads have monkey-patched the select + # module, as to date poll() is not properly supported by eventlet + import eventlet + _is_patched = eventlet.patcher.is_monkey_patched("select") +except ImportError: + _is_patched = False + +if hasattr(_select_mod, "poll") and not _is_patched: + from select import error as SelectError + def select(rlist, wlist, xlist, timeout=None): + fd_count = 0 + rset = set(rlist) + wset = set(wlist) + xset = set(xlist) + if timeout: + # select expects seconds, poll milliseconds + timeout = float(timeout) * 1000 + poller = _select_mod.poll() + + rwset = rset.intersection(wset) + for rw in rwset: + poller.register(rw, (_select_mod.POLLIN | _select_mod.POLLOUT)) + fd_count += 1 + for ro in rset.difference(rwset): + poller.register(ro, _select_mod.POLLIN) + fd_count += 1 + for wo in wset.difference(rwset): + poller.register(wo, _select_mod.POLLOUT) + fd_count += 1 + for x in xset: + poller.register(x, _select_mod.POLLPRI) + fd_count += 1 + + # select returns the objects passed in, but poll gives us back only the + # integer fds. Maintain a map to get back: + fd_map = {} + for o in rset | wset | xset: + if hasattr(o, "fileno"): + fd_map[o.fileno()] = o + + log.debug("poll(%d fds, timeout=%s)", fd_count, timeout) + active = poller.poll(timeout) + log.debug("poll() returned %s fds", len(active)) + + rfds = [] + wfds = [] + xfds = [] + # set the error conditions so we do a read(), which will report the error + rflags = (_select_mod.POLLIN | _select_mod.POLLERR | _select_mod.POLLHUP) + for fds, flags in active: + if fds in fd_map: + fds = fd_map[fds] + if (flags & rflags): + rfds.append(fds) + if (flags & _select_mod.POLLOUT): + wfds.append(fds) + if (flags & _select_mod.POLLPRI): + xfds.append(fds) + return (rfds, wfds, xfds) +else: + if tuple(sys.version_info[0:2]) < (2, 4): + from select import select as old_select + def select(rlist, wlist, xlist, timeout=None): + return old_select(list(rlist), list(wlist), list(xlist), timeout) + else: + from select import select + from select import error as SelectError + +class BaseWaiter: + + def wakeup(self): + self._do_write() + + def wait(self, timeout=None): + start = time.time() + if timeout is not None: + ready = False + while timeout > 0: + try: + ready, _, _ = select([self], [], [], timeout) + break + except SelectError, e: + if e[0] == errno.EINTR: + elapsed = time.time() - start + timeout = timeout - elapsed + else: + raise e + else: + ready = True + + if ready: + self._do_read() + return True + else: + return False + + def reading(self): + return True + + def readable(self): + self._do_read() + +if sys.platform in ('win32', 'cygwin'): + import socket + + class SockWaiter(BaseWaiter): + + def __init__(self, read_sock, write_sock): + self.read_sock = read_sock + self.write_sock = write_sock + + def _do_write(self): + self.write_sock.send("\0") + + def _do_read(self): + self.read_sock.recv(65536) + + def fileno(self): + return self.read_sock.fileno() + + def close(self): + if self.write_sock is not None: + self.write_sock.close() + self.write_sock = None + self.read_sock.close() + self.read_sock = None + + def __del__(self): + self.close() + + def __repr__(self): + return "SockWaiter(%r, %r)" % (self.read_sock, self.write_sock) + + def selectable_waiter(): + listener = socket.socket() + listener.bind(('', 0)) + listener.listen(1) + _, port = listener.getsockname() + write_sock = socket.socket() + write_sock.connect(("127.0.0.1", port)) + read_sock, _ = listener.accept() + listener.close() + return SockWaiter(read_sock, write_sock) +else: + import os + + class PipeWaiter(BaseWaiter): + + def __init__(self): + self.read_fd, self.write_fd = os.pipe() + + def _do_write(self): + os.write(self.write_fd, "\0") + + def _do_read(self): + os.read(self.read_fd, 65536) + + def fileno(self): + return self.read_fd + + def close(self): + if self.write_fd is not None: + os.close(self.write_fd) + self.write_fd = None + os.close(self.read_fd) + self.read_fd = None + + def __del__(self): + self.close() + + def __repr__(self): + return "PipeWaiter(%r, %r)" % (self.read_fd, self.write_fd) + + def selectable_waiter(): + return PipeWaiter() diff --git a/qpid/python/qpid/concurrency.py b/qpid/python/qpid/concurrency.py new file mode 100644 index 0000000000..eefe0d445f --- /dev/null +++ b/qpid/python/qpid/concurrency.py @@ -0,0 +1,106 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import compat, inspect, time + +def synchronized(meth): + args, vargs, kwargs, defs = inspect.getargspec(meth) + scope = {} + scope["meth"] = meth + exec """ +def %s%s: + %s + %s._lock.acquire() + try: + return meth%s + finally: + %s._lock.release() +""" % (meth.__name__, inspect.formatargspec(args, vargs, kwargs, defs), + repr(inspect.getdoc(meth)), args[0], + inspect.formatargspec(args, vargs, kwargs, defs, + formatvalue=lambda x: ""), + args[0]) in scope + return scope[meth.__name__] + +class Waiter(object): + + def __init__(self, condition): + self.condition = condition + + def wait(self, predicate, timeout=None): + passed = 0 + start = time.time() + while not predicate(): + if timeout is None: + # XXX: this timed wait thing is not necessary for the fast + # condition from this module, only for the condition impl from + # the threading module + + # using the timed wait prevents keyboard interrupts from being + # blocked while waiting + self.condition.wait(3) + elif passed < timeout: + self.condition.wait(timeout - passed) + else: + return bool(predicate()) + passed = time.time() - start + return True + + def notify(self): + self.condition.notify() + + def notifyAll(self): + self.condition.notifyAll() + +class Condition: + + def __init__(self, lock): + self.lock = lock + self.waiters = [] + self.waiting = [] + + def notify(self): + assert self.lock._is_owned() + if self.waiting: + self.waiting[0].wakeup() + + def notifyAll(self): + assert self.lock._is_owned() + for w in self.waiting: + w.wakeup() + + def wait(self, timeout=None): + assert self.lock._is_owned() + if not self.waiters: + self.waiters.append(compat.selectable_waiter()) + sw = self.waiters.pop(0) + self.waiting.append(sw) + try: + st = self.lock._release_save() + sw.wait(timeout) + finally: + self.lock._acquire_restore(st) + self.waiting.remove(sw) + self.waiters.append(sw) + + def gc(self): + assert self.lock._is_owned() + while self.waiters: + sw = self.waiters.pop(0) + sw.close() diff --git a/qpid/python/qpid/connection.py b/qpid/python/qpid/connection.py new file mode 100644 index 0000000000..2453f38c34 --- /dev/null +++ b/qpid/python/qpid/connection.py @@ -0,0 +1,250 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import datatypes, session +from threading import Thread, Condition, RLock +from util import wait, notify +from codec010 import StringCodec +from framing import * +from session import Session +from generator import control_invoker +from exceptions import * +from logging import getLogger +import delegates, socket +import sys + +class ChannelBusy(Exception): pass + +class ChannelsBusy(Exception): pass + +class SessionBusy(Exception): pass + +class ConnectionFailed(Exception): pass + +def client(*args, **kwargs): + return delegates.Client(*args, **kwargs) + +def server(*args, **kwargs): + return delegates.Server(*args, **kwargs) + +from framer import Framer + +class Connection(Framer): + + def __init__(self, sock, delegate=client, **args): + Framer.__init__(self, sock) + self.lock = RLock() + self.attached = {} + self.sessions = {} + + self.condition = Condition() + # XXX: we should combine this into a single comprehensive state + # model (whatever that means) + self.opened = False + self.failed = False + self.closed = False + self.close_code = (None, "connection aborted") + + self.thread = Thread(target=self.run) + self.thread.setDaemon(True) + + self.channel_max = 65535 + self.user_id = None + + self.op_enc = OpEncoder() + self.seg_enc = SegmentEncoder() + self.frame_enc = FrameEncoder() + + self.delegate = delegate(self, **args) + + def attach(self, name, ch, delegate, force=False): + self.lock.acquire() + try: + ssn = self.attached.get(ch.id) + if ssn is not None: + if ssn.name != name: + raise ChannelBusy(ch, ssn) + else: + ssn = self.sessions.get(name) + if ssn is None: + ssn = Session(name, delegate=delegate) + self.sessions[name] = ssn + elif ssn.channel is not None: + if force: + del self.attached[ssn.channel.id] + ssn.channel = None + else: + raise SessionBusy(ssn) + self.attached[ch.id] = ssn + ssn.channel = ch + ch.session = ssn + return ssn + finally: + self.lock.release() + + def detach(self, name, ch): + self.lock.acquire() + try: + self.attached.pop(ch.id, None) + ssn = self.sessions.pop(name, None) + if ssn is not None: + ssn.channel = None + ssn.closed() + return ssn + finally: + self.lock.release() + + def __channel(self): + for i in xrange(1, self.channel_max): + if not self.attached.has_key(i): + return i + else: + raise ChannelsBusy() + + def session(self, name, timeout=None, delegate=session.client): + self.lock.acquire() + try: + ch = Channel(self, self.__channel()) + ssn = self.attach(name, ch, delegate) + ssn.channel.session_attach(name) + if wait(ssn.condition, lambda: ssn.channel is not None, timeout): + return ssn + else: + self.detach(name, ch) + raise Timeout() + finally: + self.lock.release() + + def detach_all(self): + self.lock.acquire() + self.failed = True + try: + for ssn in self.attached.values(): + if self.close_code[0] != 200: + ssn.exceptions.append(self.close_code) + self.detach(ssn.name, ssn.channel) + finally: + self.lock.release() + + def start(self, timeout=None): + self.delegate.start() + self.thread.start() + if not wait(self.condition, lambda: self.opened or self.failed, timeout): + self.thread.join() + raise Timeout() + if self.failed: + self.thread.join() + raise ConnectionFailed(*self.close_code) + + def run(self): + frame_dec = FrameDecoder() + seg_dec = SegmentDecoder() + op_dec = OpDecoder() + + while not self.closed: + try: + data = self.sock.recv(64*1024) + if not data: + self.detach_all() + break + # If we have a security layer and it sends us no decoded data, + # that's OK as long as its return code is happy. + if self.security_layer_rx: + try: + data = self.security_layer_rx.decode(data) + except: + self.detach_all() + break + # When we do not use SSL transport, we get periodic + # spurious timeout events on the socket. When using SSL, + # these events show up as timeout *errors*. Both should be + # ignored unless we have aborted. + except socket.timeout: + if self.aborted(): + self.close_code = (None, "connection timed out") + self.detach_all() + break + else: + continue + except socket.error, e: + if self.aborted() or str(e) != "The read operation timed out": + self.close_code = (None, str(e)) + self.detach_all() + break + else: + continue + frame_dec.write(data) + seg_dec.write(*frame_dec.read()) + op_dec.write(*seg_dec.read()) + for op in op_dec.read(): + try: + self.delegate.received(op) + except Closed, e: + self.close_code = (None, str(e)) + if not self.opened: + self.failed = True + self.closed = True + notify(self.condition) + self.sock.close() + + def write_op(self, op): + self.sock_lock.acquire() + try: + self.op_enc.write(op) + self.seg_enc.write(*self.op_enc.read()) + self.frame_enc.write(*self.seg_enc.read()) + bytes = self.frame_enc.read() + self.write(bytes) + self.flush() + finally: + self.sock_lock.release() + + def close(self, timeout=None): + if not self.opened: return + Channel(self, 0).connection_close(200) + if not wait(self.condition, lambda: not self.opened, timeout): + raise Timeout() + self.thread.join(timeout=timeout) + + def __str__(self): + return "%s:%s" % self.sock.getsockname() + + def __repr__(self): + return str(self) + +log = getLogger("qpid.io.ctl") + +class Channel(control_invoker()): + + def __init__(self, connection, id): + self.connection = connection + self.id = id + self.session = None + + def invoke(self, op, args, kwargs): + ctl = op(*args, **kwargs) + ctl.channel = self.id + self.connection.write_op(ctl) + log.debug("SENT %s", ctl) + + def __str__(self): + return "%s[%s]" % (self.connection, self.id) + + def __repr__(self): + return str(self) diff --git a/qpid/python/qpid/connection08.py b/qpid/python/qpid/connection08.py new file mode 100644 index 0000000000..9565937a6e --- /dev/null +++ b/qpid/python/qpid/connection08.py @@ -0,0 +1,555 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +A Connection class containing socket code that uses the spec metadata +to read and write Frame objects. This could be used by a client, +server, or even a proxy implementation. +""" + +import socket, codec, errno, qpid +from cStringIO import StringIO +from codec import EOF +from compat import SHUT_RDWR +from exceptions import VersionError +from logging import getLogger, DEBUG + +log = getLogger("qpid.connection08") + +class SockIO: + + def __init__(self, sock): + self.sock = sock + + def write(self, buf): + if log.isEnabledFor(DEBUG): + log.debug("OUT: %r", buf) + self.sock.sendall(buf) + + def read(self, n): + data = "" + while len(data) < n: + try: + s = self.sock.recv(n - len(data)) + except socket.error: + break + if len(s) == 0: + break + data += s + if log.isEnabledFor(DEBUG): + log.debug("IN: %r", data) + return data + + def flush(self): + pass + + def close(self): + try: + try: + self.sock.shutdown(SHUT_RDWR) + except socket.error, e: + if (e.errno == errno.ENOTCONN): + pass + else: + raise + finally: + self.sock.close() + +def connect(host, port, options = None): + sock = socket.socket() + + if options and options.get("ssl", False): + log.debug("Wrapping socket for SSL") + from ssl import wrap_socket, CERT_REQUIRED, CERT_NONE + + ssl_certfile = options.get("ssl_certfile", None) + ssl_keyfile = options.get("ssl_keyfile", ssl_certfile) + ssl_trustfile = options.get("ssl_trustfile", None) + ssl_require_trust = options.get("ssl_require_trust", True) + + if ssl_require_trust: + validate = CERT_REQUIRED + else: + validate = CERT_NONE + + sock = wrap_socket(sock, + keyfile = ssl_keyfile, + certfile = ssl_certfile, + ca_certs = ssl_trustfile, + cert_reqs = validate) + + sock.connect((host, port)) + sock.setblocking(1) + return SockIO(sock) + +def listen(host, port, predicate = lambda: True): + sock = socket.socket() + sock.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) + sock.bind((host, port)) + sock.listen(5) + while predicate(): + s, a = sock.accept() + yield SockIO(s) + +class FramingError(Exception): + pass + +class Connection: + + def __init__(self, io, spec): + self.codec = codec.Codec(io, spec) + self.spec = spec + self.FRAME_END = self.spec.constants.byname["frame_end"].id + self.write = getattr(self, "write_%s_%s" % (self.spec.major, self.spec.minor)) + self.read = getattr(self, "read_%s_%s" % (self.spec.major, self.spec.minor)) + self.io = io + + def flush(self): + self.codec.flush() + + INIT="!4s4B" + + def init(self): + self.codec.pack(Connection.INIT, "AMQP", 1, 1, self.spec.major, + self.spec.minor) + + def tini(self): + self.codec.unpack(Connection.INIT) + + def write_8_0(self, frame): + c = self.codec + c.encode_octet(self.spec.constants.byname[frame.type].id) + c.encode_short(frame.channel) + body = StringIO() + enc = codec.Codec(body, self.spec) + frame.encode(enc) + enc.flush() + c.encode_longstr(body.getvalue()) + c.encode_octet(self.FRAME_END) + + def read_8_0(self): + c = self.codec + tid = c.decode_octet() + try: + type = self.spec.constants.byid[tid].name + except KeyError: + if tid == ord('A') and c.unpack("!3s") == "MQP": + _, _, major, minor = c.unpack("4B") + raise VersionError("client: %s-%s, server: %s-%s" % + (self.spec.major, self.spec.minor, major, minor)) + else: + raise FramingError("unknown frame type: %s" % tid) + try: + channel = c.decode_short() + body = c.decode_longstr() + dec = codec.Codec(StringIO(body), self.spec) + frame = Frame.DECODERS[type].decode(self.spec, dec, len(body)) + frame.channel = channel + end = c.decode_octet() + if end != self.FRAME_END: + garbage = "" + while end != self.FRAME_END: + garbage += chr(end) + end = c.decode_octet() + raise FramingError("frame error: expected %r, got %r" % (self.FRAME_END, garbage)) + return frame + except EOF: + # An EOF caught here can indicate an error decoding the frame, + # rather than that a disconnection occurred,so it's worth logging it. + log.exception("Error occurred when reading frame with tid %s" % tid) + raise + + def write_0_9(self, frame): + self.write_8_0(frame) + + def read_0_9(self): + return self.read_8_0() + + def write_0_91(self, frame): + self.write_8_0(frame) + + def read_0_91(self): + return self.read_8_0() + + def write_0_10(self, frame): + c = self.codec + flags = 0 + if frame.bof: flags |= 0x08 + if frame.eof: flags |= 0x04 + if frame.bos: flags |= 0x02 + if frame.eos: flags |= 0x01 + + c.encode_octet(flags) # TODO: currently fixed at ver=0, B=E=b=e=1 + c.encode_octet(self.spec.constants.byname[frame.type].id) + body = StringIO() + enc = codec.Codec(body, self.spec) + frame.encode(enc) + enc.flush() + frame_size = len(body.getvalue()) + 12 # TODO: Magic number (frame header size) + c.encode_short(frame_size) + c.encode_octet(0) # Reserved + c.encode_octet(frame.subchannel & 0x0f) + c.encode_short(frame.channel) + c.encode_long(0) # Reserved + c.write(body.getvalue()) + c.encode_octet(self.FRAME_END) + + def read_0_10(self): + c = self.codec + flags = c.decode_octet() # TODO: currently ignoring flags + framing_version = (flags & 0xc0) >> 6 + if framing_version != 0: + raise FramingError("frame error: unknown framing version") + type = self.spec.constants.byid[c.decode_octet()].name + frame_size = c.decode_short() + if frame_size < 12: # TODO: Magic number (frame header size) + raise FramingError("frame error: frame size too small") + reserved1 = c.decode_octet() + field = c.decode_octet() + subchannel = field & 0x0f + channel = c.decode_short() + reserved2 = c.decode_long() # TODO: reserved maybe need to ensure 0 + if (flags & 0x30) != 0 or reserved1 != 0 or (field & 0xf0) != 0: + raise FramingError("frame error: reserved bits not all zero") + body_size = frame_size - 12 # TODO: Magic number (frame header size) + body = c.read(body_size) + dec = codec.Codec(StringIO(body), self.spec) + try: + frame = Frame.DECODERS[type].decode(self.spec, dec, len(body)) + except EOF: + raise FramingError("truncated frame body: %r" % body) + frame.channel = channel + frame.subchannel = subchannel + end = c.decode_octet() + if end != self.FRAME_END: + garbage = "" + while end != self.FRAME_END: + garbage += chr(end) + end = c.decode_octet() + raise FramingError("frame error: expected %r, got %r" % (self.FRAME_END, garbage)) + return frame + + def write_99_0(self, frame): + self.write_0_10(frame) + + def read_99_0(self): + return self.read_0_10() + + def close(self): + self.io.close(); + +class Frame: + + DECODERS = {} + + class __metaclass__(type): + + def __new__(cls, name, bases, dict): + for attr in ("encode", "decode", "type"): + if not dict.has_key(attr): + raise TypeError("%s must define %s" % (name, attr)) + dict["decode"] = staticmethod(dict["decode"]) + if dict.has_key("__init__"): + __init__ = dict["__init__"] + def init(self, *args, **kwargs): + args = list(args) + self.init(args, kwargs) + __init__(self, *args, **kwargs) + dict["__init__"] = init + t = type.__new__(cls, name, bases, dict) + if t.type != None: + Frame.DECODERS[t.type] = t + return t + + type = None + + def init(self, args, kwargs): + self.channel = kwargs.pop("channel", 0) + self.subchannel = kwargs.pop("subchannel", 0) + self.bos = True + self.eos = True + self.bof = True + self.eof = True + + def encode(self, enc): abstract + + def decode(spec, dec, size): abstract + +class Method(Frame): + + type = "frame_method" + + def __init__(self, method, args): + if len(args) != len(method.fields): + argspec = ["%s: %s" % (f.name, f.type) + for f in method.fields] + raise TypeError("%s.%s expecting (%s), got %s" % + (method.klass.name, method.name, ", ".join(argspec), + args)) + self.method = method + self.method_type = method + self.args = args + self.eof = not method.content + + def encode(self, c): + version = (c.spec.major, c.spec.minor) + if version == (0, 10) or version == (99, 0): + c.encode_octet(self.method.klass.id) + c.encode_octet(self.method.id) + else: + c.encode_short(self.method.klass.id) + c.encode_short(self.method.id) + for field, arg in zip(self.method.fields, self.args): + c.encode(field.type, arg) + + def decode(spec, c, size): + version = (c.spec.major, c.spec.minor) + if version == (0, 10) or version == (99, 0): + klass = spec.classes.byid[c.decode_octet()] + meth = klass.methods.byid[c.decode_octet()] + else: + klass = spec.classes.byid[c.decode_short()] + meth = klass.methods.byid[c.decode_short()] + args = tuple([c.decode(f.type) for f in meth.fields]) + return Method(meth, args) + + def __str__(self): + return "[%s] %s %s" % (self.channel, self.method, + ", ".join([str(a) for a in self.args])) + +class Request(Frame): + + type = "frame_request" + + def __init__(self, id, response_mark, method): + self.id = id + self.response_mark = response_mark + self.method = method + self.method_type = method.method_type + self.args = method.args + + def encode(self, enc): + enc.encode_longlong(self.id) + enc.encode_longlong(self.response_mark) + # reserved + enc.encode_long(0) + self.method.encode(enc) + + def decode(spec, dec, size): + id = dec.decode_longlong() + mark = dec.decode_longlong() + # reserved + dec.decode_long() + method = Method.decode(spec, dec, size - 20) + return Request(id, mark, method) + + def __str__(self): + return "[%s] Request(%s) %s" % (self.channel, self.id, self.method) + +class Response(Frame): + + type = "frame_response" + + def __init__(self, id, request_id, batch_offset, method): + self.id = id + self.request_id = request_id + self.batch_offset = batch_offset + self.method = method + self.method_type = method.method_type + self.args = method.args + + def encode(self, enc): + enc.encode_longlong(self.id) + enc.encode_longlong(self.request_id) + enc.encode_long(self.batch_offset) + self.method.encode(enc) + + def decode(spec, dec, size): + id = dec.decode_longlong() + request_id = dec.decode_longlong() + batch_offset = dec.decode_long() + method = Method.decode(spec, dec, size - 20) + return Response(id, request_id, batch_offset, method) + + def __str__(self): + return "[%s] Response(%s,%s,%s) %s" % (self.channel, self.id, self.request_id, self.batch_offset, self.method) + +def uses_struct_encoding(spec): + return (spec.major == 0 and spec.minor == 10) or (spec.major == 99 and spec.minor == 0) + +class Header(Frame): + + type = "frame_header" + + def __init__(self, klass, weight, size, properties): + self.klass = klass + self.weight = weight + self.size = size + self.properties = properties + self.eof = size == 0 + self.bof = False + + def __getitem__(self, name): + return self.properties[name] + + def __setitem__(self, name, value): + self.properties[name] = value + + def __delitem__(self, name): + del self.properties[name] + + def encode(self, c): + if uses_struct_encoding(c.spec): + self.encode_structs(c) + else: + self.encode_legacy(c) + + def encode_structs(self, c): + # XXX + structs = [qpid.Struct(c.spec.domains.byname["delivery_properties"].type), + qpid.Struct(c.spec.domains.byname["message_properties"].type)] + + # XXX + props = self.properties.copy() + for k in self.properties: + for s in structs: + if s.exists(k): + s.set(k, props.pop(k)) + if props: + raise TypeError("no such property: %s" % (", ".join(props))) + + # message properties store the content-length now, and weight is + # deprecated + if self.size != None: + structs[1].content_length = self.size + + for s in structs: + c.encode_long_struct(s) + + def encode_legacy(self, c): + c.encode_short(self.klass.id) + c.encode_short(self.weight) + c.encode_longlong(self.size) + + # property flags + nprops = len(self.klass.fields) + flags = 0 + for i in range(nprops): + f = self.klass.fields.items[i] + flags <<= 1 + if self.properties.get(f.name) != None: + flags |= 1 + # the last bit indicates more flags + if i > 0 and (i % 15) == 0: + flags <<= 1 + if nprops > (i + 1): + flags |= 1 + c.encode_short(flags) + flags = 0 + flags <<= ((16 - (nprops % 15)) % 16) + c.encode_short(flags) + + # properties + for f in self.klass.fields: + v = self.properties.get(f.name) + if v != None: + c.encode(f.type, v) + + def decode(spec, c, size): + if uses_struct_encoding(spec): + return Header.decode_structs(spec, c, size) + else: + return Header.decode_legacy(spec, c, size) + + def decode_structs(spec, c, size): + structs = [] + start = c.nread + while c.nread - start < size: + structs.append(c.decode_long_struct()) + + # XXX + props = {} + length = None + for s in structs: + for f in s.type.fields: + if s.has(f.name): + props[f.name] = s.get(f.name) + if f.name == "content_length": + length = s.get(f.name) + return Header(None, 0, length, props) + + decode_structs = staticmethod(decode_structs) + + def decode_legacy(spec, c, size): + klass = spec.classes.byid[c.decode_short()] + weight = c.decode_short() + size = c.decode_longlong() + + # property flags + bits = [] + while True: + flags = c.decode_short() + for i in range(15, 0, -1): + if flags >> i & 0x1 != 0: + bits.append(True) + else: + bits.append(False) + if flags & 0x1 == 0: + break + + # properties + properties = {} + for b, f in zip(bits, klass.fields): + if b: + # Note: decode returns a unicode u'' string but only + # plain '' strings can be used as keywords so we need to + # stringify the names. + properties[str(f.name)] = c.decode(f.type) + return Header(klass, weight, size, properties) + + decode_legacy = staticmethod(decode_legacy) + + def __str__(self): + return "%s %s %s %s" % (self.klass, self.weight, self.size, + self.properties) + +class Body(Frame): + + type = "frame_body" + + def __init__(self, content): + self.content = content + self.eof = True + self.bof = False + + def encode(self, enc): + enc.write(self.content) + + def decode(spec, dec, size): + return Body(dec.read(size)) + + def __str__(self): + return "Body(%r)" % self.content + +# TODO: +# OOB_METHOD = "frame_oob_method" +# OOB_HEADER = "frame_oob_header" +# OOB_BODY = "frame_oob_body" +# TRACE = "frame_trace" +# HEARTBEAT = "frame_heartbeat" diff --git a/qpid/python/qpid/content.py b/qpid/python/qpid/content.py new file mode 100644 index 0000000000..9391f4f1a8 --- /dev/null +++ b/qpid/python/qpid/content.py @@ -0,0 +1,58 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +A simple python representation for AMQP content. +""" + +def default(val, defval): + if val == None: + return defval + else: + return val + +class Content: + + def __init__(self, body = "", children = None, properties = None): + self.body = body + self.children = default(children, []) + self.properties = default(properties, {}) + + def size(self): + return len(self.body) + + def weight(self): + return len(self.children) + + def __getitem__(self, name): + return self.properties[name] + + def __setitem__(self, name, value): + self.properties[name] = value + + def __delitem__(self, name): + del self.properties[name] + + def __str__(self): + if self.children: + return "%s [%s] %s" % (self.properties, + ", ".join(map(str, self.children)), + self.body) + else: + return "%s %s" % (self.properties, self.body) diff --git a/qpid/python/qpid/datatypes.py b/qpid/python/qpid/datatypes.py new file mode 100644 index 0000000000..ca1466c261 --- /dev/null +++ b/qpid/python/qpid/datatypes.py @@ -0,0 +1,385 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import threading, struct, datetime, time +from exceptions import Timeout + +class Struct: + + def __init__(self, _type, *args, **kwargs): + if len(args) > len(_type.fields): + raise TypeError("%s() takes at most %s arguments (%s given)" % + (_type.name, len(_type.fields), len(args))) + + self._type = _type + + idx = 0 + for field in _type.fields: + if idx < len(args): + arg = args[idx] + if kwargs.has_key(field.name): + raise TypeError("%s() got multiple values for keyword argument '%s'" % + (_type.name, field.name)) + elif kwargs.has_key(field.name): + arg = kwargs.pop(field.name) + else: + arg = field.default() + setattr(self, field.name, arg) + idx += 1 + + if kwargs: + unexpected = kwargs.keys()[0] + raise TypeError("%s() got an unexpected keyword argument '%s'" % + (_type.name, unexpected)) + + def __getitem__(self, name): + return getattr(self, name) + + def __setitem__(self, name, value): + if not hasattr(self, name): + raise AttributeError("'%s' object has no attribute '%s'" % + (self._type.name, name)) + setattr(self, name, value) + + def __repr__(self): + fields = [] + for f in self._type.fields: + v = self[f.name] + if f.type.is_present(v): + fields.append("%s=%r" % (f.name, v)) + return "%s(%s)" % (self._type.name, ", ".join(fields)) + +class Message: + + def __init__(self, *args): + if args: + self.body = args[-1] + else: + self.body = None + if len(args) > 1: + self.headers = list(args[:-1]) + else: + self.headers = None + self.id = None + + def has(self, name): + return self.get(name) != None + + def get(self, name): + if self.headers: + for h in self.headers: + if h.NAME == name: + return h + return None + + def set(self, header): + if self.headers is None: + self.headers = [] + idx = 0 + while idx < len(self.headers): + if self.headers[idx].NAME == header.NAME: + self.headers[idx] = header + return + idx += 1 + self.headers.append(header) + + def clear(self, name): + idx = 0 + while idx < len(self.headers): + if self.headers[idx].NAME == name: + del self.headers[idx] + return + idx += 1 + + def __repr__(self): + args = [] + if self.headers: + args.extend(map(repr, self.headers)) + if self.body: + args.append(repr(self.body)) + if self.id is not None: + args.append("id=%s" % self.id) + return "Message(%s)" % ", ".join(args) + +def serial(o): + if isinstance(o, Serial): + return o + else: + return Serial(o) + +class Serial: + + def __init__(self, value): + self.value = value & 0xFFFFFFFFL + + def __hash__(self): + return hash(self.value) + + def __cmp__(self, other): + if other.__class__ not in (int, long, Serial): + return 1 + + other = serial(other) + + delta = (self.value - other.value) & 0xFFFFFFFFL + neg = delta & 0x80000000L + mag = delta & 0x7FFFFFFF + + if neg: + return -mag + else: + return mag + + def __add__(self, other): + return Serial(self.value + other) + + def __sub__(self, other): + if isinstance(other, Serial): + return self.value - other.value + else: + return Serial(self.value - other) + + def __repr__(self): + return "serial(%s)" % self.value + + def __str__(self): + return str(self.value) + +class Range: + + def __init__(self, lower, upper = None): + self.lower = serial(lower) + if upper is None: + self.upper = self.lower + else: + self.upper = serial(upper) + + def __contains__(self, n): + return self.lower <= n and n <= self.upper + + def __iter__(self): + i = self.lower + while i <= self.upper: + yield i + i += 1 + + def touches(self, r): + # XXX: are we doing more checks than we need? + return (self.lower - 1 in r or + self.upper + 1 in r or + r.lower - 1 in self or + r.upper + 1 in self or + self.lower in r or + self.upper in r or + r.lower in self or + r.upper in self) + + def span(self, r): + return Range(min(self.lower, r.lower), max(self.upper, r.upper)) + + def intersect(self, r): + lower = max(self.lower, r.lower) + upper = min(self.upper, r.upper) + if lower > upper: + return None + else: + return Range(lower, upper) + + def __repr__(self): + return "%s-%s" % (self.lower, self.upper) + +class RangedSet: + + def __init__(self, *args): + self.ranges = [] + for n in args: + self.add(n) + + def __contains__(self, n): + for r in self.ranges: + if n in r: + return True + return False + + def add_range(self, range): + idx = 0 + while idx < len(self.ranges): + r = self.ranges[idx] + if range.touches(r): + del self.ranges[idx] + range = range.span(r) + elif range.upper < r.lower: + self.ranges.insert(idx, range) + return + else: + idx += 1 + self.ranges.append(range) + + def add(self, lower, upper = None): + self.add_range(Range(lower, upper)) + + def empty(self): + for r in self.ranges: + if r.lower <= r.upper: + return False + return True + + def max(self): + if self.ranges: + return self.ranges[-1].upper + else: + return None + + def min(self): + if self.ranges: + return self.ranges[0].lower + else: + return None + + def __iter__(self): + return iter(self.ranges) + + def __repr__(self): + return str(self.ranges) + +class Future: + def __init__(self, initial=None, exception=Exception): + self.value = initial + self._error = None + self._set = threading.Event() + self.exception = exception + + def error(self, error): + self._error = error + self._set.set() + + def set(self, value): + self.value = value + self._set.set() + + def get(self, timeout=None): + self._set.wait(timeout) + if self._set.isSet(): + if self._error != None: + raise self.exception(self._error) + return self.value + else: + raise Timeout() + + def is_set(self): + return self._set.isSet() + +try: + from uuid import uuid4 + from uuid import UUID +except ImportError: + class UUID: + def __init__(self, hex=None, bytes=None): + if [hex, bytes].count(None) != 1: + raise TypeErrror("need one of hex or bytes") + if bytes is not None: + self.bytes = bytes + elif hex is not None: + fields=hex.split("-") + fields[4:5] = [fields[4][:4], fields[4][4:]] + self.bytes = struct.pack("!LHHHHL", *[int(x,16) for x in fields]) + + def __cmp__(self, other): + if isinstance(other, UUID): + return cmp(self.bytes, other.bytes) + else: + return -1 + + def __str__(self): + return "%08x-%04x-%04x-%04x-%04x%08x" % struct.unpack("!LHHHHL", self.bytes) + + def __repr__(self): + return "UUID(%r)" % str(self) + + def __hash__(self): + return self.bytes.__hash__() + + import os, random, socket, time + rand = random.Random() + rand.seed((os.getpid(), time.time(), socket.gethostname())) + def random_uuid(): + bytes = [rand.randint(0, 255) for i in xrange(16)] + + # From RFC4122, the version bits are set to 0100 + bytes[7] &= 0x0F + bytes[7] |= 0x40 + + # From RFC4122, the top two bits of byte 8 get set to 01 + bytes[8] &= 0x3F + bytes[8] |= 0x80 + return "".join(map(chr, bytes)) + + def uuid4(): + return UUID(bytes=random_uuid()) + +def parseUUID(str): + return UUID(hex=str) + +class timestamp(float): + + def __new__(cls, obj=None): + if obj is None: + obj = time.time() + elif isinstance(obj, datetime.datetime): + obj = time.mktime(obj.timetuple()) + 1e-6 * obj.microsecond + return super(timestamp, cls).__new__(cls, obj) + + def datetime(self): + return datetime.datetime.fromtimestamp(self) + + def __add__(self, other): + if isinstance(other, datetime.timedelta): + return timestamp(self.datetime() + other) + else: + return timestamp(float(self) + other) + + def __sub__(self, other): + if isinstance(other, datetime.timedelta): + return timestamp(self.datetime() - other) + else: + return timestamp(float(self) - other) + + def __radd__(self, other): + if isinstance(other, datetime.timedelta): + return timestamp(self.datetime() + other) + else: + return timestamp(other + float(self)) + + def __rsub__(self, other): + if isinstance(other, datetime.timedelta): + return timestamp(self.datetime() - other) + else: + return timestamp(other - float(self)) + + def __neg__(self): + return timestamp(-float(self)) + + def __pos__(self): + return self + + def __abs__(self): + return timestamp(abs(float(self))) + + def __repr__(self): + return "timestamp(%r)" % float(self) diff --git a/qpid/python/qpid/debug.py b/qpid/python/qpid/debug.py new file mode 100644 index 0000000000..b5dbd4d9d9 --- /dev/null +++ b/qpid/python/qpid/debug.py @@ -0,0 +1,55 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import threading, traceback, signal, sys, time + +def stackdump(sig, frm): + code = [] + for threadId, stack in sys._current_frames().items(): + code.append("\n# ThreadID: %s" % threadId) + for filename, lineno, name, line in traceback.extract_stack(stack): + code.append('File: "%s", line %d, in %s' % (filename, lineno, name)) + if line: + code.append(" %s" % (line.strip())) + print "\n".join(code) + +signal.signal(signal.SIGQUIT, stackdump) + +class LoudLock: + + def __init__(self): + self.lock = threading.RLock() + + def acquire(self, blocking=1): + while not self.lock.acquire(blocking=0): + time.sleep(1) + print >> sys.out, "TRYING" + traceback.print_stack(None, None, out) + print >> sys.out, "TRYING" + print >> sys.out, "ACQUIRED" + traceback.print_stack(None, None, out) + print >> sys.out, "ACQUIRED" + return True + + def _is_owned(self): + return self.lock._is_owned() + + def release(self): + self.lock.release() + diff --git a/qpid/python/qpid/delegate.py b/qpid/python/qpid/delegate.py new file mode 100644 index 0000000000..b447c4aa29 --- /dev/null +++ b/qpid/python/qpid/delegate.py @@ -0,0 +1,53 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +Delegate implementation intended for use with the peer module. +""" + +import threading, inspect, traceback, sys +from connection08 import Method, Request, Response + +def _handler_name(method): + return "%s_%s" % (method.klass.name, method.name) + +class Delegate: + + def __init__(self): + self.handlers = {} + self.invokers = {} + + def __call__(self, channel, frame): + method = frame.method + + try: + handler = self.handlers[method] + except KeyError: + name = _handler_name(method) + handler = getattr(self, name) + self.handlers[method] = handler + + try: + return handler(channel, frame) + except: + print >> sys.stderr, "Error in handler: %s\n\n%s" % \ + (_handler_name(method), traceback.format_exc()) + + def closed(self, reason): + print "Connection closed: %s" % reason diff --git a/qpid/python/qpid/delegates.py b/qpid/python/qpid/delegates.py new file mode 100644 index 0000000000..ae7ed7f988 --- /dev/null +++ b/qpid/python/qpid/delegates.py @@ -0,0 +1,215 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import os, connection, session +from util import notify, get_client_properties_with_defaults +from datatypes import RangedSet +from exceptions import VersionError, Closed +from logging import getLogger +from ops import Control +import sys +from qpid import sasl + +log = getLogger("qpid.io.ctl") + +class Delegate: + + def __init__(self, connection, delegate=session.client): + self.connection = connection + self.delegate = delegate + + def received(self, op): + ssn = self.connection.attached.get(op.channel) + if ssn is None: + ch = connection.Channel(self.connection, op.channel) + else: + ch = ssn.channel + + if isinstance(op, Control): + log.debug("RECV %s", op) + getattr(self, op.NAME)(ch, op) + elif ssn is None: + ch.session_detached() + else: + ssn.received(op) + + def connection_close(self, ch, close): + self.connection.close_code = (close.reply_code, close.reply_text) + ch.connection_close_ok() + raise Closed(close.reply_text) + + def connection_close_ok(self, ch, close_ok): + self.connection.opened = False + self.connection.closed = True + notify(self.connection.condition) + + def connection_heartbeat(self, ch, hrt): + pass + + def session_attach(self, ch, a): + try: + self.connection.attach(a.name, ch, self.delegate, a.force) + ch.session_attached(a.name) + except connection.ChannelBusy: + ch.session_detached(a.name) + except connection.SessionBusy: + ch.session_detached(a.name) + + def session_attached(self, ch, a): + notify(ch.session.condition) + + def session_detach(self, ch, d): + #send back the confirmation of detachment before removing the + #channel from the attached set; this avoids needing to hold the + #connection lock during the sending of this control and ensures + #that if the channel is immediately reused for a new session the + #attach request will follow the detached notification. + ch.session_detached(d.name) + ssn = self.connection.detach(d.name, ch) + + def session_detached(self, ch, d): + self.connection.detach(d.name, ch) + + def session_request_timeout(self, ch, rt): + ch.session_timeout(rt.timeout); + + def session_command_point(self, ch, cp): + ssn = ch.session + ssn.receiver.next_id = cp.command_id + ssn.receiver.next_offset = cp.command_offset + + def session_completed(self, ch, cmp): + ch.session.sender.completed(cmp.commands) + if cmp.timely_reply: + ch.session_known_completed(cmp.commands) + notify(ch.session.condition) + + def session_known_completed(self, ch, kn_cmp): + ch.session.receiver.known_completed(kn_cmp.commands) + + def session_flush(self, ch, f): + rcv = ch.session.receiver + if f.expected: + if rcv.next_id == None: + exp = None + else: + exp = RangedSet(rcv.next_id) + ch.session_expected(exp) + if f.confirmed: + ch.session_confirmed(rcv._completed) + if f.completed: + ch.session_completed(rcv._completed) + +class Server(Delegate): + + def start(self): + self.connection.read_header() + # XXX + self.connection.write_header(0, 10) + connection.Channel(self.connection, 0).connection_start(mechanisms=["ANONYMOUS"]) + + def connection_start_ok(self, ch, start_ok): + ch.connection_tune(channel_max=65535) + + def connection_tune_ok(self, ch, tune_ok): + pass + + def connection_open(self, ch, open): + self.connection.opened = True + ch.connection_open_ok() + notify(self.connection.condition) + +class Client(Delegate): + + def __init__(self, connection, username=None, password=None, + mechanism=None, heartbeat=None, **kwargs): + Delegate.__init__(self, connection) + provided_client_properties = kwargs.get("client_properties") + self.client_properties=get_client_properties_with_defaults(provided_client_properties) + + ## + ## self.acceptableMechanisms is the list of SASL mechanisms that the client is willing to + ## use. If it's None, then any mechanism is acceptable. + ## + self.acceptableMechanisms = None + if mechanism: + self.acceptableMechanisms = mechanism.split(" ") + self.heartbeat = heartbeat + self.username = username + self.password = password + + self.sasl = sasl.Client() + if username and len(username) > 0: + self.sasl.setAttr("username", str(username)) + if password and len(password) > 0: + self.sasl.setAttr("password", str(password)) + self.sasl.setAttr("service", str(kwargs.get("service", "qpidd"))) + if "host" in kwargs: + self.sasl.setAttr("host", str(kwargs["host"])) + if "min_ssf" in kwargs: + self.sasl.setAttr("minssf", kwargs["min_ssf"]) + if "max_ssf" in kwargs: + self.sasl.setAttr("maxssf", kwargs["max_ssf"]) + self.sasl.init() + + def start(self): + # XXX + cli_major = 0 + cli_minor = 10 + self.connection.write_header(cli_major, cli_minor) + magic, _, _, major, minor = self.connection.read_header() + if not (magic == "AMQP" and major == cli_major and minor == cli_minor): + raise VersionError("client: %s-%s, server: %s-%s" % + (cli_major, cli_minor, major, minor)) + + def connection_start(self, ch, start): + mech_list = "" + for mech in start.mechanisms: + if (not self.acceptableMechanisms) or mech in self.acceptableMechanisms: + mech_list += str(mech) + " " + mech = None + initial = None + try: + mech, initial = self.sasl.start(mech_list) + except Exception, e: + raise Closed(str(e)) + ch.connection_start_ok(client_properties=self.client_properties, + mechanism=mech, response=initial) + + def connection_secure(self, ch, secure): + resp = None + try: + resp = self.sasl.step(secure.challenge) + except Exception, e: + raise Closed(str(e)) + ch.connection_secure_ok(response=resp) + + def connection_tune(self, ch, tune): + ch.connection_tune_ok(heartbeat=self.heartbeat) + ch.connection_open() + self.connection.user_id = self.sasl.auth_username() + self.connection.security_layer_tx = self.sasl + + def connection_open_ok(self, ch, open_ok): + self.connection.security_layer_rx = self.sasl + self.connection.opened = True + notify(self.connection.condition) + + def connection_heartbeat(self, ch, hrt): + ch.connection_heartbeat() diff --git a/qpid/python/qpid/disp.py b/qpid/python/qpid/disp.py new file mode 100644 index 0000000000..d1340b8a05 --- /dev/null +++ b/qpid/python/qpid/disp.py @@ -0,0 +1,236 @@ +#!/usr/bin/env python + +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from time import strftime, gmtime + +class Header: + """ """ + NONE = 1 + KMG = 2 + YN = 3 + Y = 4 + TIME_LONG = 5 + TIME_SHORT = 6 + DURATION = 7 + + def __init__(self, text, format=NONE): + self.text = text + self.format = format + + def __repr__(self): + return self.text + + def __str__(self): + return self.text + + def formatted(self, value): + try: + if value == None: + return '' + if self.format == Header.NONE: + return value + if self.format == Header.KMG: + return self.num(value) + if self.format == Header.YN: + if value: + return 'Y' + return 'N' + if self.format == Header.Y: + if value: + return 'Y' + return '' + if self.format == Header.TIME_LONG: + return strftime("%c", gmtime(value / 1000000000)) + if self.format == Header.TIME_SHORT: + return strftime("%X", gmtime(value / 1000000000)) + if self.format == Header.DURATION: + if value < 0: value = 0 + sec = value / 1000000000 + min = sec / 60 + hour = min / 60 + day = hour / 24 + result = "" + if day > 0: + result = "%dd " % day + if hour > 0 or result != "": + result += "%dh " % (hour % 24) + if min > 0 or result != "": + result += "%dm " % (min % 60) + result += "%ds" % (sec % 60) + return result + except: + return "?" + + def numCell(self, value, tag): + fp = float(value) / 1000. + if fp < 10.0: + return "%1.2f%c" % (fp, tag) + if fp < 100.0: + return "%2.1f%c" % (fp, tag) + return "%4d%c" % (value / 1000, tag) + + def num(self, value): + if value < 1000: + return "%4d" % value + if value < 1000000: + return self.numCell(value, 'k') + value /= 1000 + if value < 1000000: + return self.numCell(value, 'm') + value /= 1000 + return self.numCell(value, 'g') + + +class Display: + """ Display formatting for QPID Management CLI """ + + def __init__(self, spacing=2, prefix=" "): + self.tableSpacing = spacing + self.tablePrefix = prefix + self.timestampFormat = "%X" + + def formattedTable(self, title, heads, rows): + fRows = [] + for row in rows: + fRow = [] + col = 0 + for cell in row: + fRow.append(heads[col].formatted(cell)) + col += 1 + fRows.append(fRow) + headtext = [] + for head in heads: + headtext.append(head.text) + self.table(title, headtext, fRows) + + def table(self, title, heads, rows): + """ Print a table with autosized columns """ + + # Pad the rows to the number of heads + for row in rows: + diff = len(heads) - len(row) + for idx in range(diff): + row.append("") + + print title + if len (rows) == 0: + return + colWidth = [] + col = 0 + line = self.tablePrefix + for head in heads: + width = len (head) + for row in rows: + cellWidth = len (unicode (row[col])) + if cellWidth > width: + width = cellWidth + colWidth.append (width + self.tableSpacing) + line = line + head + if col < len (heads) - 1: + for i in range (colWidth[col] - len (head)): + line = line + " " + col = col + 1 + print line + line = self.tablePrefix + for width in colWidth: + line = line + "=" * width + line = line[:255] + print line + + for row in rows: + line = self.tablePrefix + col = 0 + for width in colWidth: + line = line + unicode (row[col]) + if col < len (heads) - 1: + for i in range (width - len (unicode (row[col]))): + line = line + " " + col = col + 1 + print line + + def do_setTimeFormat (self, fmt): + """ Select timestamp format """ + if fmt == "long": + self.timestampFormat = "%c" + elif fmt == "short": + self.timestampFormat = "%X" + + def timestamp (self, nsec): + """ Format a nanosecond-since-the-epoch timestamp for printing """ + return strftime (self.timestampFormat, gmtime (nsec / 1000000000)) + + def duration(self, nsec): + if nsec < 0: nsec = 0 + sec = nsec / 1000000000 + min = sec / 60 + hour = min / 60 + day = hour / 24 + result = "" + if day > 0: + result = "%dd " % day + if hour > 0 or result != "": + result += "%dh " % (hour % 24) + if min > 0 or result != "": + result += "%dm " % (min % 60) + result += "%ds" % (sec % 60) + return result + +class Sortable: + """ """ + def __init__(self, row, sortIndex): + self.row = row + self.sortIndex = sortIndex + if sortIndex >= len(row): + raise Exception("sort index exceeds row boundary") + + def __cmp__(self, other): + return cmp(self.row[self.sortIndex], other.row[self.sortIndex]) + + def getRow(self): + return self.row + +class Sorter: + """ """ + def __init__(self, heads, rows, sortCol, limit=0, inc=True): + col = 0 + for head in heads: + if head.text == sortCol: + break + col += 1 + if col == len(heads): + raise Exception("sortCol '%s', not found in headers" % sortCol) + + list = [] + for row in rows: + list.append(Sortable(row, col)) + list.sort() + if not inc: + list.reverse() + count = 0 + self.sorted = [] + for row in list: + self.sorted.append(row.getRow()) + count += 1 + if count == limit: + break + + def getSorted(self): + return self.sorted diff --git a/qpid/python/qpid/exceptions.py b/qpid/python/qpid/exceptions.py new file mode 100644 index 0000000000..2bd80b7ffe --- /dev/null +++ b/qpid/python/qpid/exceptions.py @@ -0,0 +1,22 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +class Closed(Exception): pass +class Timeout(Exception): pass +class VersionError(Exception): pass diff --git a/qpid/python/qpid/framer.py b/qpid/python/qpid/framer.py new file mode 100644 index 0000000000..08e172287f --- /dev/null +++ b/qpid/python/qpid/framer.py @@ -0,0 +1,128 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import struct, socket +from exceptions import Closed +from packer import Packer +from threading import RLock +from logging import getLogger + +raw = getLogger("qpid.io.raw") +frm = getLogger("qpid.io.frm") + +class FramingError(Exception): pass + +class Framer(Packer): + + HEADER="!4s4B" + + def __init__(self, sock): + self.sock = sock + self.sock_lock = RLock() + self.tx_buf = "" + self.rx_buf = "" + self.security_layer_tx = None + self.security_layer_rx = None + self.maxbufsize = 65535 + + def aborted(self): + return False + + def write(self, buf): + self.tx_buf += buf + + def flush(self): + self.sock_lock.acquire() + try: + if self.security_layer_tx: + try: + cipher_buf = self.security_layer_tx.encode(self.tx_buf) + except SASLError, e: + raise Closed(str(e)) + self._write(cipher_buf) + else: + self._write(self.tx_buf) + self.tx_buf = "" + frm.debug("FLUSHED") + finally: + self.sock_lock.release() + + def _write(self, buf): + while buf: + try: + n = self.sock.send(buf) + except socket.timeout: + if self.aborted(): + raise Closed() + else: + continue + raw.debug("SENT %r", buf[:n]) + buf = buf[n:] + + ## + ## Implementation Note: + ## + ## This function was modified to use the SASL security layer for content + ## decryption. As such, the socket read should read in "self.maxbufsize" + ## instead of "n" (the requested number of octets). However, since this + ## is one of two places in the code where the socket is read, the read + ## size had to be left at "n". This is because this function is + ## apparently only used to read the first 8 octets from a TCP socket. If + ## we read beyond "n" octets, the remaing octets won't be processed and + ## the connection handshake will fail. + ## + def read(self, n): + while len(self.rx_buf) < n: + try: + # QPID-5808: never consume more than n bytes from the socket, + # otherwise the extra bytes are discarded. + s = self.sock.recv(n - len(self.rx_buf)) + if self.security_layer_rx: + try: + s = self.security_layer_rx.decode(s) + except SASLError, e: + raise Closed(str(e)) + except socket.timeout: + if self.aborted(): + raise Closed() + else: + continue + except socket.error, e: + if self.rx_buf != "": + raise e + else: + raise Closed() + if len(s) == 0: + raise Closed() + self.rx_buf += s + raw.debug("RECV %r", s) + data = self.rx_buf[0:n] + self.rx_buf = self.rx_buf[n:] + return data + + def read_header(self): + return self.unpack(Framer.HEADER) + + def write_header(self, major, minor): + self.sock_lock.acquire() + try: + self.pack(Framer.HEADER, "AMQP", 1, 1, major, minor) + self.flush() + finally: + self.sock_lock.release() diff --git a/qpid/python/qpid/framing.py b/qpid/python/qpid/framing.py new file mode 100644 index 0000000000..389b607853 --- /dev/null +++ b/qpid/python/qpid/framing.py @@ -0,0 +1,313 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import struct + +FIRST_SEG = 0x08 +LAST_SEG = 0x04 +FIRST_FRM = 0x02 +LAST_FRM = 0x01 + +class Frame: + + HEADER = "!2BHxBH4x" + HEADER_SIZE = struct.calcsize(HEADER) + MAX_PAYLOAD = 65535 - struct.calcsize(HEADER) + + def __init__(self, flags, type, track, channel, payload): + if len(payload) > Frame.MAX_PAYLOAD: + raise ValueError("max payload size exceeded: %s" % len(payload)) + self.flags = flags + self.type = type + self.track = track + self.channel = channel + self.payload = payload + + def isFirstSegment(self): + return bool(FIRST_SEG & self.flags) + + def isLastSegment(self): + return bool(LAST_SEG & self.flags) + + def isFirstFrame(self): + return bool(FIRST_FRM & self.flags) + + def isLastFrame(self): + return bool(LAST_FRM & self.flags) + + def __repr__(self): + return "%s%s%s%s %s %s %s %r" % (int(self.isFirstSegment()), + int(self.isLastSegment()), + int(self.isFirstFrame()), + int(self.isLastFrame()), + self.type, + self.track, + self.channel, + self.payload) + +class Segment: + + def __init__(self, first, last, type, track, channel, payload): + self.id = None + self.offset = None + self.first = first + self.last = last + self.type = type + self.track = track + self.channel = channel + self.payload = payload + + def __repr__(self): + return "%s%s %s %s %s %r" % (int(self.first), int(self.last), self.type, + self.track, self.channel, self.payload) + +class FrameDecoder: + + def __init__(self): + self.input = "" + self.output = [] + self.parse = self.__frame_header + + def write(self, bytes): + self.input += bytes + while True: + next = self.parse() + if next is None: + break + else: + self.parse = next + + def __consume(self, n): + result = self.input[:n] + self.input = self.input[n:] + return result + + def __frame_header(self): + if len(self.input) >= Frame.HEADER_SIZE: + st = self.__consume(Frame.HEADER_SIZE) + self.flags, self.type, self.size, self.track, self.channel = \ + struct.unpack(Frame.HEADER, st) + return self.__frame_body + + def __frame_body(self): + size = self.size - Frame.HEADER_SIZE + if len(self.input) >= size: + payload = self.__consume(size) + frame = Frame(self.flags, self.type, self.track, self.channel, payload) + self.output.append(frame) + return self.__frame_header + + def read(self): + result = self.output + self.output = [] + return result + +class FrameEncoder: + + def __init__(self): + self.output = "" + + def write(self, *frames): + for frame in frames: + size = len(frame.payload) + Frame.HEADER_SIZE + track = frame.track & 0x0F + self.output += struct.pack(Frame.HEADER, frame.flags, frame.type, size, + track, frame.channel) + self.output += frame.payload + + def read(self): + result = self.output + self.output = "" + return result + +class SegmentDecoder: + + def __init__(self): + self.fragments = {} + self.segments = [] + + def write(self, *frames): + for frm in frames: + key = (frm.channel, frm.track) + seg = self.fragments.get(key) + + if seg == None: + seg = Segment(frm.isFirstSegment(), frm.isLastSegment(), + frm.type, frm.track, frm.channel, "") + self.fragments[key] = seg + + seg.payload += frm.payload + + if frm.isLastFrame(): + self.fragments.pop(key) + self.segments.append(seg) + + def read(self): + result = self.segments + self.segments = [] + return result + +class SegmentEncoder: + + def __init__(self, max_payload=Frame.MAX_PAYLOAD): + self.max_payload = max_payload + self.frames = [] + + def write(self, *segments): + for seg in segments: + remaining = seg.payload + + first = True + while first or remaining: + payload = remaining[:self.max_payload] + remaining = remaining[self.max_payload:] + + flags = 0 + if first: + flags |= FIRST_FRM + first = False + if not remaining: + flags |= LAST_FRM + if seg.first: + flags |= FIRST_SEG + if seg.last: + flags |= LAST_SEG + + frm = Frame(flags, seg.type, seg.track, seg.channel, payload) + self.frames.append(frm) + + def read(self): + result = self.frames + self.frames = [] + return result + +from ops import COMMANDS, CONTROLS, COMPOUND, Header, segment_type, track + +from codec010 import StringCodec + +class OpEncoder: + + def __init__(self): + self.segments = [] + + def write(self, *ops): + for op in ops: + if COMMANDS.has_key(op.NAME): + seg_type = segment_type.command + seg_track = track.command + enc = self.encode_command(op) + elif CONTROLS.has_key(op.NAME): + seg_type = segment_type.control + seg_track = track.control + enc = self.encode_compound(op) + else: + raise ValueError(op) + seg = Segment(True, False, seg_type, seg_track, op.channel, enc) + self.segments.append(seg) + if hasattr(op, "headers") and op.headers is not None: + hdrs = "" + for h in op.headers: + hdrs += self.encode_compound(h) + seg = Segment(False, False, segment_type.header, seg_track, op.channel, + hdrs) + self.segments.append(seg) + if hasattr(op, "payload") and op.payload is not None: + self.segments.append(Segment(False, False, segment_type.body, seg_track, + op.channel, op.payload)) + self.segments[-1].last = True + + def encode_command(self, cmd): + sc = StringCodec() + sc.write_uint16(cmd.CODE) + sc.write_compound(Header(sync=cmd.sync)) + sc.write_fields(cmd) + return sc.encoded + + def encode_compound(self, op): + sc = StringCodec() + sc.write_compound(op) + return sc.encoded + + def read(self): + result = self.segments + self.segments = [] + return result + +class OpDecoder: + + def __init__(self): + self.current_op = {} + self.ops = [] + + def write(self, *segments): + for seg in segments: + op = self.current_op.get(seg.track) + if seg.first: + if seg.type == segment_type.command: + op = self.decode_command(seg.payload) + elif seg.type == segment_type.control: + op = self.decode_control(seg.payload) + else: + raise ValueError(seg) + op.channel = seg.channel + elif seg.type == segment_type.header: + if op.headers is None: + op.headers = [] + op.headers.extend(self.decode_headers(seg.payload)) + elif seg.type == segment_type.body: + if op.payload is None: + op.payload = seg.payload + else: + op.payload += seg.payload + if seg.last: + self.ops.append(op) + if seg.track in self.current_op: + del self.current_op[seg.track] + else: + self.current_op[seg.track] = op + + def decode_command(self, encoded): + sc = StringCodec(encoded) + code = sc.read_uint16() + cls = COMMANDS[code] + hdr = sc.read_compound(Header) + cmd = cls() + sc.read_fields(cmd) + cmd.sync = hdr.sync + return cmd + + def decode_control(self, encoded): + sc = StringCodec(encoded) + code = sc.read_uint16() + cls = CONTROLS[code] + ctl = cls() + sc.read_fields(ctl) + return ctl + + def decode_headers(self, encoded): + sc = StringCodec(encoded) + result = [] + while sc.encoded: + result.append(sc.read_struct32()) + return result + + def read(self): + result = self.ops + self.ops = [] + return result diff --git a/qpid/python/qpid/generator.py b/qpid/python/qpid/generator.py new file mode 100644 index 0000000000..02d11e5005 --- /dev/null +++ b/qpid/python/qpid/generator.py @@ -0,0 +1,56 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import sys + +from ops import * + +def METHOD(module, op): + method = lambda self, *args, **kwargs: self.invoke(op, args, kwargs) + if sys.version_info[:2] > (2, 3): + method.__name__ = op.__name__ + method.__doc__ = op.__doc__ + method.__module__ = module + return method + +def generate(module, operations): + dict = {} + + for name, enum in ENUMS.items(): + if isinstance(name, basestring): + dict[name] = enum + + for name, op in COMPOUND.items(): + if isinstance(name, basestring): + dict[name] = METHOD(module, op) + + for name, op in operations.items(): + if isinstance(name, basestring): + dict[name] = METHOD(module, op) + + return dict + +def invoker(name, operations): + return type(name, (), generate(invoker.__module__, operations)) + +def command_invoker(): + return invoker("CommandInvoker", COMMANDS) + +def control_invoker(): + return invoker("ControlInvoker", CONTROLS) diff --git a/qpid/python/qpid/harness.py b/qpid/python/qpid/harness.py new file mode 100644 index 0000000000..ce48481612 --- /dev/null +++ b/qpid/python/qpid/harness.py @@ -0,0 +1,20 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +class Skipped(Exception): pass diff --git a/qpid/python/qpid/lexer.py b/qpid/python/qpid/lexer.py new file mode 100644 index 0000000000..ec28bbb91a --- /dev/null +++ b/qpid/python/qpid/lexer.py @@ -0,0 +1,118 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import re + +class Type: + + def __init__(self, name, pattern=None): + self.name = name + self.pattern = pattern + + def __repr__(self): + return self.name + +class Lexicon: + + def __init__(self): + self.types = [] + self._eof = None + + def define(self, name, pattern): + t = Type(name, pattern) + self.types.append(t) + return t + + def eof(self, name): + t = Type(name) + self._eof = t + return t + + def compile(self): + types = self.types[:] + joined = "|".join(["(%s)" % t.pattern for t in types]) + rexp = re.compile(joined) + return Lexer(types, self._eof, rexp) + +class Token: + + def __init__(self, type, value, input, position): + self.type = type + self.value = value + self.input = input + self.position = position + + def line_info(self): + return line_info(self.input, self.position) + + def __repr__(self): + if self.value is None: + return repr(self.type) + else: + return "%s(%s)" % (self.type, self.value) + + +class LexError(Exception): + pass + +def line_info(st, pos): + idx = 0 + lineno = 1 + column = 0 + line_pos = 0 + while idx < pos: + if st[idx] == "\n": + lineno += 1 + column = 0 + line_pos = idx + column += 1 + idx += 1 + + end = st.find("\n", line_pos) + if end < 0: + end = len(st) + line = st[line_pos:end] + + return line, lineno, column + +class Lexer: + + def __init__(self, types, eof, rexp): + self.types = types + self.eof = eof + self.rexp = rexp + self.byname = {} + for t in self.types + [eof]: + self.byname[t.name] = t + + def type(self, name): + return self.byname[name] + + def lex(self, st): + pos = 0 + while pos < len(st): + m = self.rexp.match(st, pos) + if m is None: + line, ln, col = line_info(st, pos) + raise LexError("unrecognized characters line:%s,%s: %s" % (ln, col, line)) + else: + idx = m.lastindex + t = Token(self.types[idx - 1], m.group(idx), st, pos) + yield t + pos = m.end() + yield Token(self.eof, None, st, pos) diff --git a/qpid/python/qpid/log.py b/qpid/python/qpid/log.py new file mode 100644 index 0000000000..1fd7d74136 --- /dev/null +++ b/qpid/python/qpid/log.py @@ -0,0 +1,28 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from logging import getLogger, StreamHandler, Formatter +from logging import DEBUG, INFO, WARN, ERROR, CRITICAL + +def enable(name=None, level=WARN, file=None): + log = getLogger(name) + handler = StreamHandler(file) + handler.setFormatter(Formatter("%(asctime)s %(levelname)s %(message)s")) + log.addHandler(handler) + log.setLevel(level) diff --git a/qpid/python/qpid/management.py b/qpid/python/qpid/management.py new file mode 100644 index 0000000000..3de8da9d49 --- /dev/null +++ b/qpid/python/qpid/management.py @@ -0,0 +1,922 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +############################################################################### +## This file is being obsoleted by qmf/console.py +############################################################################### + +""" +Management API for Qpid +""" + +import qpid +import struct +import socket +from threading import Thread +from datatypes import Message, RangedSet +from time import time +from cStringIO import StringIO +from codec010 import StringCodec as Codec +from threading import Lock, Condition + + +class SequenceManager: + """ Manage sequence numbers for asynchronous method calls """ + def __init__ (self): + self.lock = Lock () + self.sequence = 0 + self.pending = {} + + def reserve (self, data): + """ Reserve a unique sequence number """ + self.lock.acquire () + result = self.sequence + self.sequence = self.sequence + 1 + self.pending[result] = data + self.lock.release () + return result + + def release (self, seq): + """ Release a reserved sequence number """ + data = None + self.lock.acquire () + if seq in self.pending: + data = self.pending[seq] + del self.pending[seq] + self.lock.release () + return data + + +class mgmtObject (object): + """ Generic object that holds the contents of a management object with its + attributes set as object attributes. """ + + def __init__ (self, classKey, timestamps, row): + self.classKey = classKey + self.timestamps = timestamps + for cell in row: + setattr (self, cell[0], cell[1]) + +class objectId(object): + """ Object that represents QMF object identifiers """ + + def __init__(self, codec, first=0, second=0): + if codec: + self.first = codec.read_uint64() + self.second = codec.read_uint64() + else: + self.first = first + self.second = second + + def __cmp__(self, other): + if other == None: + return 1 + if self.first < other.first: + return -1 + if self.first > other.first: + return 1 + if self.second < other.second: + return -1 + if self.second > other.second: + return 1 + return 0 + + + def index(self): + return (self.first, self.second) + + def getFlags(self): + return (self.first & 0xF000000000000000) >> 60 + + def getSequence(self): + return (self.first & 0x0FFF000000000000) >> 48 + + def getBroker(self): + return (self.first & 0x0000FFFFF0000000) >> 28 + + def getBank(self): + return self.first & 0x000000000FFFFFFF + + def getObject(self): + return self.second + + def isDurable(self): + return self.getSequence() == 0 + + def encode(self, codec): + codec.write_uint64(self.first) + codec.write_uint64(self.second) + + +class methodResult: + """ Object that contains the result of a method call """ + + def __init__ (self, status, sText, args): + self.status = status + self.statusText = sText + for arg in args: + setattr (self, arg, args[arg]) + +class brokerInfo: + """ Object that contains information about a broker and the session to it """ + + def __init__ (self, brokerId, sessionId): + self.brokerId = brokerId + self.sessionId = sessionId + +class managementChannel: + """ This class represents a connection to an AMQP broker. """ + + def __init__ (self, ssn, topicCb, replyCb, exceptionCb, cbContext, _detlife=0): + """ Given a channel on an established AMQP broker connection, this method + opens a session and performs all of the declarations and bindings needed + to participate in the management protocol. """ + self.enabled = True + self.ssn = ssn + self.sessionId = ssn.name + self.topicName = "mgmt-%s" % self.sessionId + self.replyName = "repl-%s" % self.sessionId + self.qpidChannel = ssn + self.tcb = topicCb + self.rcb = replyCb + self.ecb = exceptionCb + self.context = cbContext + self.reqsOutstanding = 0 + self.brokerInfo = None + + ssn.auto_sync = False + ssn.queue_declare (queue=self.topicName, exclusive=True, auto_delete=True) + ssn.queue_declare (queue=self.replyName, exclusive=True, auto_delete=True) + + ssn.exchange_bind (exchange="amq.direct", + queue=self.replyName, binding_key=self.replyName) + ssn.message_subscribe (queue=self.topicName, destination="tdest", + accept_mode=ssn.accept_mode.none, + acquire_mode=ssn.acquire_mode.pre_acquired) + ssn.message_subscribe (queue=self.replyName, destination="rdest", + accept_mode=ssn.accept_mode.none, + acquire_mode=ssn.acquire_mode.pre_acquired) + + ssn.incoming ("tdest").listen (self.topicCb, self.exceptionCb) + ssn.incoming ("rdest").listen (self.replyCb) + + ssn.message_set_flow_mode (destination="tdest", flow_mode=1) + ssn.message_flow (destination="tdest", unit=0, value=0xFFFFFFFFL) + ssn.message_flow (destination="tdest", unit=1, value=0xFFFFFFFFL) + + ssn.message_set_flow_mode (destination="rdest", flow_mode=1) + ssn.message_flow (destination="rdest", unit=0, value=0xFFFFFFFFL) + ssn.message_flow (destination="rdest", unit=1, value=0xFFFFFFFFL) + + def setBrokerInfo (self, data): + self.brokerInfo = data + + def shutdown (self): + self.enabled = False + self.ssn.incoming("tdest").stop() + self.ssn.incoming("rdest").stop() + + def topicCb (self, msg): + """ Receive messages via the topic queue on this channel. """ + if self.enabled: + self.tcb (self, msg) + self.ssn.receiver._completed.add(msg.id) + self.ssn.channel.session_completed(self.ssn.receiver._completed) + + def replyCb (self, msg): + """ Receive messages via the reply queue on this channel. """ + if self.enabled: + self.rcb (self, msg) + self.ssn.receiver._completed.add(msg.id) + self.ssn.channel.session_completed(self.ssn.receiver._completed) + + def exceptionCb (self, data): + if self.ecb != None: + self.ecb (self, data) + + def send (self, exchange, msg): + if self.enabled: + self.qpidChannel.message_transfer (destination=exchange, message=msg) + + def message (self, body, routing_key="broker"): + dp = self.qpidChannel.delivery_properties() + dp.routing_key = routing_key + mp = self.qpidChannel.message_properties() + mp.content_type = "application/octet-stream" + mp.reply_to = self.qpidChannel.reply_to("amq.direct", self.replyName) + return Message(dp, mp, body) + + +class managementClient: + """ This class provides an API for access to management data on the AMQP + network. It implements the management protocol and manages the management + schemas as advertised by the various management agents in the network. """ + + CTRL_BROKER_INFO = 1 + CTRL_SCHEMA_LOADED = 2 + CTRL_USER = 3 + CTRL_HEARTBEAT = 4 + + SYNC_TIME = 10.0 + + #======================================================== + # User API - interacts with the class's user + #======================================================== + def __init__ (self, unused=None, ctrlCb=None, configCb=None, instCb=None, methodCb=None, closeCb=None): + self.ctrlCb = ctrlCb + self.configCb = configCb + self.instCb = instCb + self.methodCb = methodCb + self.closeCb = closeCb + self.schemaCb = None + self.eventCb = None + self.channels = [] + self.seqMgr = SequenceManager () + self.schema = {} + self.packages = {} + self.cv = Condition () + self.syncInFlight = False + self.syncSequence = 0 + self.syncResult = None + + def schemaListener (self, schemaCb): + """ Optionally register a callback to receive details of the schema of + managed objects in the network. """ + self.schemaCb = schemaCb + + def eventListener (self, eventCb): + """ Optionally register a callback to receive events from managed objects + in the network. """ + self.eventCb = eventCb + + def addChannel (self, channel, cbContext=None): + """ Register a new channel. """ + mch = managementChannel (channel, self.topicCb, self.replyCb, self.exceptCb, cbContext) + + self.channels.append (mch) + self.incOutstanding (mch) + codec = Codec () + self.setHeader (codec, ord ('B')) + msg = mch.message(codec.encoded) + mch.send ("qpid.management", msg) + return mch + + def removeChannel (self, mch): + """ Remove a previously added channel from management. """ + mch.shutdown () + self.channels.remove (mch) + + def callMethod (self, channel, userSequence, objId, className, methodName, args=None): + """ Invoke a method on a managed object. """ + self.method (channel, userSequence, objId, className, methodName, args) + + def getObjects (self, channel, userSequence, className, bank=0): + """ Request immediate content from broker """ + codec = Codec () + self.setHeader (codec, ord ('G'), userSequence) + ft = {} + ft["_class"] = className + codec.write_map (ft) + msg = channel.message(codec.encoded, routing_key="agent.1.%d" % bank) + channel.send ("qpid.management", msg) + + def syncWaitForStable (self, channel): + """ Synchronous (blocking) call to wait for schema stability on a channel """ + self.cv.acquire () + if channel.reqsOutstanding == 0: + self.cv.release () + return channel.brokerInfo + + self.syncInFlight = True + starttime = time () + while channel.reqsOutstanding != 0: + self.cv.wait (self.SYNC_TIME) + if time () - starttime > self.SYNC_TIME: + self.cv.release () + raise RuntimeError ("Timed out waiting for response on channel") + self.cv.release () + return channel.brokerInfo + + def syncCallMethod (self, channel, objId, className, methodName, args=None): + """ Synchronous (blocking) method call """ + self.cv.acquire () + self.syncInFlight = True + self.syncResult = None + self.syncSequence = self.seqMgr.reserve ("sync") + self.cv.release () + self.callMethod (channel, self.syncSequence, objId, className, methodName, args) + self.cv.acquire () + starttime = time () + while self.syncInFlight: + self.cv.wait (self.SYNC_TIME) + if time () - starttime > self.SYNC_TIME: + self.cv.release () + raise RuntimeError ("Timed out waiting for response on channel") + result = self.syncResult + self.cv.release () + return result + + def syncGetObjects (self, channel, className, bank=0): + """ Synchronous (blocking) get call """ + self.cv.acquire () + self.syncInFlight = True + self.syncResult = [] + self.syncSequence = self.seqMgr.reserve ("sync") + self.cv.release () + self.getObjects (channel, self.syncSequence, className, bank) + self.cv.acquire () + starttime = time () + while self.syncInFlight: + self.cv.wait (self.SYNC_TIME) + if time () - starttime > self.SYNC_TIME: + self.cv.release () + raise RuntimeError ("Timed out waiting for response on channel") + result = self.syncResult + self.cv.release () + return result + + #======================================================== + # Channel API - interacts with registered channel objects + #======================================================== + def topicCb (self, ch, msg): + """ Receive messages via the topic queue of a particular channel. """ + codec = Codec (msg.body) + while True: + hdr = self.checkHeader (codec) + if hdr == None: + return + + if hdr[0] == 'p': + self.handlePackageInd (ch, codec) + elif hdr[0] == 'q': + self.handleClassInd (ch, codec) + elif hdr[0] == 'h': + self.handleHeartbeat (ch, codec) + elif hdr[0] == 'e': + self.handleEvent (ch, codec) + else: + self.parse (ch, codec, hdr[0], hdr[1]) + + def replyCb (self, ch, msg): + """ Receive messages via the reply queue of a particular channel. """ + codec = Codec (msg.body) + while True: + hdr = self.checkHeader (codec) + if hdr == None: + return + + if hdr[0] == 'm': + self.handleMethodReply (ch, codec, hdr[1]) + elif hdr[0] == 'z': + self.handleCommandComplete (ch, codec, hdr[1]) + elif hdr[0] == 'b': + self.handleBrokerResponse (ch, codec) + elif hdr[0] == 'p': + self.handlePackageInd (ch, codec) + elif hdr[0] == 'q': + self.handleClassInd (ch, codec) + else: + self.parse (ch, codec, hdr[0], hdr[1]) + + def exceptCb (self, ch, data): + if self.closeCb != None: + self.closeCb (ch.context, data) + + #======================================================== + # Internal Functions + #======================================================== + def setHeader (self, codec, opcode, seq = 0): + """ Compose the header of a management message. """ + codec.write_uint8 (ord ('A')) + codec.write_uint8 (ord ('M')) + codec.write_uint8 (ord ('2')) + codec.write_uint8 (opcode) + codec.write_uint32 (seq) + + def checkHeader (self, codec): + """ Check the header of a management message and extract the opcode and class. """ + try: + octet = chr (codec.read_uint8 ()) + if octet != 'A': + return None + octet = chr (codec.read_uint8 ()) + if octet != 'M': + return None + octet = chr (codec.read_uint8 ()) + if octet != '2': + return None + opcode = chr (codec.read_uint8 ()) + seq = codec.read_uint32 () + return (opcode, seq) + except: + return None + + def encodeValue (self, codec, value, typecode): + """ Encode, into the codec, a value based on its typecode. """ + if typecode == 1: + codec.write_uint8 (int (value)) + elif typecode == 2: + codec.write_uint16 (int (value)) + elif typecode == 3: + codec.write_uint32 (long (value)) + elif typecode == 4: + codec.write_uint64 (long (value)) + elif typecode == 5: + codec.write_uint8 (int (value)) + elif typecode == 6: + codec.write_str8 (value) + elif typecode == 7: + codec.write_str16 (value) + elif typecode == 8: # ABSTIME + codec.write_uint64 (long (value)) + elif typecode == 9: # DELTATIME + codec.write_uint64 (long (value)) + elif typecode == 10: # REF + value.encode(codec) + elif typecode == 11: # BOOL + codec.write_uint8 (int (value)) + elif typecode == 12: # FLOAT + codec.write_float (float (value)) + elif typecode == 13: # DOUBLE + codec.write_double (float (value)) + elif typecode == 14: # UUID + codec.write_uuid (value) + elif typecode == 15: # FTABLE + codec.write_map (value) + elif typecode == 16: + codec.write_int8 (int(value)) + elif typecode == 17: + codec.write_int16 (int(value)) + elif typecode == 18: + codec.write_int32 (int(value)) + elif typecode == 19: + codec.write_int64 (int(value)) + else: + raise ValueError ("Invalid type code: %d" % typecode) + + def decodeValue (self, codec, typecode): + """ Decode, from the codec, a value based on its typecode. """ + if typecode == 1: + data = codec.read_uint8 () + elif typecode == 2: + data = codec.read_uint16 () + elif typecode == 3: + data = codec.read_uint32 () + elif typecode == 4: + data = codec.read_uint64 () + elif typecode == 5: + data = codec.read_uint8 () + elif typecode == 6: + data = codec.read_str8 () + elif typecode == 7: + data = codec.read_str16 () + elif typecode == 8: # ABSTIME + data = codec.read_uint64 () + elif typecode == 9: # DELTATIME + data = codec.read_uint64 () + elif typecode == 10: # REF + data = objectId(codec) + elif typecode == 11: # BOOL + data = codec.read_uint8 () + elif typecode == 12: # FLOAT + data = codec.read_float () + elif typecode == 13: # DOUBLE + data = codec.read_double () + elif typecode == 14: # UUID + data = codec.read_uuid () + elif typecode == 15: # FTABLE + data = codec.read_map () + elif typecode == 16: + data = codec.read_int8 () + elif typecode == 17: + data = codec.read_int16 () + elif typecode == 18: + data = codec.read_int32 () + elif typecode == 19: + data = codec.read_int64 () + else: + raise ValueError ("Invalid type code: %d" % typecode) + return data + + def incOutstanding (self, ch): + self.cv.acquire () + ch.reqsOutstanding = ch.reqsOutstanding + 1 + self.cv.release () + + def decOutstanding (self, ch): + self.cv.acquire () + ch.reqsOutstanding = ch.reqsOutstanding - 1 + if ch.reqsOutstanding == 0 and self.syncInFlight: + self.syncInFlight = False + self.cv.notify () + self.cv.release () + + if ch.reqsOutstanding == 0: + if self.ctrlCb != None: + self.ctrlCb (ch.context, self.CTRL_SCHEMA_LOADED, None) + ch.ssn.exchange_bind (exchange="qpid.management", + queue=ch.topicName, binding_key="console.#") + ch.ssn.exchange_bind (exchange="qpid.management", + queue=ch.topicName, binding_key="schema.#") + + + def handleMethodReply (self, ch, codec, sequence): + status = codec.read_uint32 () + sText = codec.read_str16 () + + data = self.seqMgr.release (sequence) + if data == None: + return + + (userSequence, classId, methodName) = data + args = {} + context = self.seqMgr.release (userSequence) + + if status == 0: + schemaClass = self.schema[classId] + ms = schemaClass['M'] + arglist = None + for mname in ms: + (mdesc, margs) = ms[mname] + if mname == methodName: + arglist = margs + if arglist == None: + return + + for arg in arglist: + if arg[2].find("O") != -1: + args[arg[0]] = self.decodeValue (codec, arg[1]) + + if context == "sync" and userSequence == self.syncSequence: + self.cv.acquire () + self.syncInFlight = False + self.syncResult = methodResult (status, sText, args) + self.cv.notify () + self.cv.release () + elif self.methodCb != None: + self.methodCb (ch.context, userSequence, status, sText, args) + + def handleCommandComplete (self, ch, codec, seq): + code = codec.read_uint32 () + text = codec.read_str8 () + data = (seq, code, text) + context = self.seqMgr.release (seq) + if context == "outstanding": + self.decOutstanding (ch) + elif context == "sync" and seq == self.syncSequence: + self.cv.acquire () + self.syncInFlight = False + self.cv.notify () + self.cv.release () + elif self.ctrlCb != None: + self.ctrlCb (ch.context, self.CTRL_USER, data) + + def handleBrokerResponse (self, ch, codec): + uuid = codec.read_uuid () + ch.brokerInfo = brokerInfo (uuid, ch.sessionId) + if self.ctrlCb != None: + self.ctrlCb (ch.context, self.CTRL_BROKER_INFO, ch.brokerInfo) + + # Send a package request + sendCodec = Codec () + seq = self.seqMgr.reserve ("outstanding") + self.setHeader (sendCodec, ord ('P'), seq) + smsg = ch.message(sendCodec.encoded) + ch.send ("qpid.management", smsg) + + def handlePackageInd (self, ch, codec): + pname = codec.read_str8 () + if pname not in self.packages: + self.packages[pname] = {} + + # Send a class request + sendCodec = Codec () + seq = self.seqMgr.reserve ("outstanding") + self.setHeader (sendCodec, ord ('Q'), seq) + self.incOutstanding (ch) + sendCodec.write_str8 (pname) + smsg = ch.message(sendCodec.encoded) + ch.send ("qpid.management", smsg) + + def handleClassInd (self, ch, codec): + kind = codec.read_uint8() + if kind != 1: # This API doesn't handle new-style events + return + pname = codec.read_str8() + cname = codec.read_str8() + hash = codec.read_bin128() + if pname not in self.packages: + return + + if (cname, hash) not in self.packages[pname]: + # Send a schema request + sendCodec = Codec () + seq = self.seqMgr.reserve ("outstanding") + self.setHeader (sendCodec, ord ('S'), seq) + self.incOutstanding (ch) + sendCodec.write_str8 (pname) + sendCodec.write_str8 (cname) + sendCodec.write_bin128 (hash) + smsg = ch.message(sendCodec.encoded) + ch.send ("qpid.management", smsg) + + def handleHeartbeat (self, ch, codec): + timestamp = codec.read_uint64() + if self.ctrlCb != None: + self.ctrlCb (ch.context, self.CTRL_HEARTBEAT, timestamp) + + def handleEvent (self, ch, codec): + if self.eventCb == None: + return + timestamp = codec.read_uint64() + objId = objectId(codec) + packageName = codec.read_str8() + className = codec.read_str8() + hash = codec.read_bin128() + name = codec.read_str8() + classKey = (packageName, className, hash) + if classKey not in self.schema: + return; + schemaClass = self.schema[classKey] + row = [] + es = schemaClass['E'] + arglist = None + for ename in es: + (edesc, eargs) = es[ename] + if ename == name: + arglist = eargs + if arglist == None: + return + for arg in arglist: + row.append((arg[0], self.decodeValue(codec, arg[1]))) + self.eventCb(ch.context, classKey, objId, name, row) + + def parseSchema (self, ch, codec): + """ Parse a received schema-description message. """ + self.decOutstanding (ch) + kind = codec.read_uint8() + if kind != 1: # This API doesn't handle new-style events + return + packageName = codec.read_str8 () + className = codec.read_str8 () + hash = codec.read_bin128 () + hasSupertype = 0 #codec.read_uint8() + configCount = codec.read_uint16 () + instCount = codec.read_uint16 () + methodCount = codec.read_uint16 () + if hasSupertype != 0: + supertypePackage = codec.read_str8() + supertypeClass = codec.read_str8() + supertypeHash = codec.read_bin128() + + if packageName not in self.packages: + return + if (className, hash) in self.packages[packageName]: + return + + classKey = (packageName, className, hash) + if classKey in self.schema: + return + + configs = [] + insts = [] + methods = {} + + configs.append (("id", 4, "", "", 1, 1, None, None, None, None, None)) + insts.append (("id", 4, None, None)) + + for idx in range (configCount): + ft = codec.read_map () + name = str (ft["name"]) + type = ft["type"] + access = ft["access"] + index = ft["index"] + optional = ft["optional"] + unit = None + min = None + max = None + maxlen = None + desc = None + + for key, value in ft.items (): + if key == "unit": + unit = str (value) + elif key == "min": + min = value + elif key == "max": + max = value + elif key == "maxlen": + maxlen = value + elif key == "desc": + desc = str (value) + + config = (name, type, unit, desc, access, index, min, max, maxlen, optional) + configs.append (config) + + for idx in range (instCount): + ft = codec.read_map () + name = str (ft["name"]) + type = ft["type"] + unit = None + desc = None + + for key, value in ft.items (): + if key == "unit": + unit = str (value) + elif key == "desc": + desc = str (value) + + inst = (name, type, unit, desc) + insts.append (inst) + + for idx in range (methodCount): + ft = codec.read_map () + mname = str (ft["name"]) + argCount = ft["argCount"] + if "desc" in ft: + mdesc = str (ft["desc"]) + else: + mdesc = None + + args = [] + for aidx in range (argCount): + ft = codec.read_map () + name = str (ft["name"]) + type = ft["type"] + dir = str (ft["dir"].upper ()) + unit = None + min = None + max = None + maxlen = None + desc = None + default = None + + for key, value in ft.items (): + if key == "unit": + unit = str (value) + elif key == "min": + min = value + elif key == "max": + max = value + elif key == "maxlen": + maxlen = value + elif key == "desc": + desc = str (value) + elif key == "default": + default = str (value) + + arg = (name, type, dir, unit, desc, min, max, maxlen, default) + args.append (arg) + methods[mname] = (mdesc, args) + + schemaClass = {} + schemaClass['C'] = configs + schemaClass['I'] = insts + schemaClass['M'] = methods + self.schema[classKey] = schemaClass + + if self.schemaCb != None: + self.schemaCb (ch.context, classKey, configs, insts, methods, {}) + + def parsePresenceMasks(self, codec, schemaClass): + """ Generate a list of not-present properties """ + excludeList = [] + bit = 0 + for element in schemaClass['C'][1:]: + if element[9] == 1: + if bit == 0: + mask = codec.read_uint8() + bit = 1 + if (mask & bit) == 0: + excludeList.append(element[0]) + bit = bit * 2 + if bit == 256: + bit = 0 + return excludeList + + def parseContent (self, ch, cls, codec, seq=0): + """ Parse a received content message. """ + if (cls == 'C' or (cls == 'B' and seq == 0)) and self.configCb == None: + return + if cls == 'I' and self.instCb == None: + return + + packageName = codec.read_str8 () + className = codec.read_str8 () + hash = codec.read_bin128 () + classKey = (packageName, className, hash) + + if classKey not in self.schema: + return + + row = [] + timestamps = [] + + timestamps.append (codec.read_uint64 ()) # Current Time + timestamps.append (codec.read_uint64 ()) # Create Time + timestamps.append (codec.read_uint64 ()) # Delete Time + objId = objectId(codec) + schemaClass = self.schema[classKey] + if cls == 'C' or cls == 'B': + notPresent = self.parsePresenceMasks(codec, schemaClass) + + if cls == 'C' or cls == 'B': + row.append(("id", objId)) + for element in schemaClass['C'][1:]: + tc = element[1] + name = element[0] + if name in notPresent: + row.append((name, None)) + else: + data = self.decodeValue(codec, tc) + row.append((name, data)) + + if cls == 'I' or cls == 'B': + if cls == 'I': + row.append(("id", objId)) + for element in schemaClass['I'][1:]: + tc = element[1] + name = element[0] + data = self.decodeValue (codec, tc) + row.append ((name, data)) + + if cls == 'C' or (cls == 'B' and seq != self.syncSequence): + self.configCb (ch.context, classKey, row, timestamps) + elif cls == 'B' and seq == self.syncSequence: + if timestamps[2] == 0: + obj = mgmtObject (classKey, timestamps, row) + self.syncResult.append (obj) + elif cls == 'I': + self.instCb (ch.context, classKey, row, timestamps) + + def parse (self, ch, codec, opcode, seq): + """ Parse a message received from the topic queue. """ + if opcode == 's': + self.parseSchema (ch, codec) + elif opcode == 'c': + self.parseContent (ch, 'C', codec) + elif opcode == 'i': + self.parseContent (ch, 'I', codec) + elif opcode == 'g': + self.parseContent (ch, 'B', codec, seq) + else: + raise ValueError ("Unknown opcode: %c" % opcode); + + def method (self, channel, userSequence, objId, classId, methodName, args): + """ Invoke a method on an object """ + codec = Codec () + sequence = self.seqMgr.reserve ((userSequence, classId, methodName)) + self.setHeader (codec, ord ('M'), sequence) + objId.encode(codec) + codec.write_str8 (classId[0]) + codec.write_str8 (classId[1]) + codec.write_bin128 (classId[2]) + codec.write_str8 (methodName) + bank = "%d.%d" % (objId.getBroker(), objId.getBank()) + + # Encode args according to schema + if classId not in self.schema: + self.seqMgr.release (sequence) + raise ValueError ("Unknown class name: %s" % classId) + + schemaClass = self.schema[classId] + ms = schemaClass['M'] + arglist = None + for mname in ms: + (mdesc, margs) = ms[mname] + if mname == methodName: + arglist = margs + if arglist == None: + self.seqMgr.release (sequence) + raise ValueError ("Unknown method name: %s" % methodName) + + for arg in arglist: + if arg[2].find("I") != -1: + value = arg[8] # default + if arg[0] in args: + value = args[arg[0]] + if value == None: + self.seqMgr.release (sequence) + raise ValueError ("Missing non-defaulted argument: %s" % arg[0]) + self.encodeValue (codec, value, arg[1]) + + packageName = classId[0] + className = classId[1] + msg = channel.message(codec.encoded, "agent." + bank) + channel.send ("qpid.management", msg) diff --git a/qpid/python/qpid/managementdata.py b/qpid/python/qpid/managementdata.py new file mode 100644 index 0000000000..61cb10c134 --- /dev/null +++ b/qpid/python/qpid/managementdata.py @@ -0,0 +1,773 @@ +#!/usr/bin/env python + +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + + +############################################################################### +## This file is being obsoleted by qmf/console.py +############################################################################### + +import qpid +import re +import socket +import struct +import os +import platform +import locale +from qpid.connection import Timeout +from qpid.management import managementChannel, managementClient +from threading import Lock +from disp import Display +from shlex import split +from qpid.connection import Connection +from qpid.util import connect + +class Broker: + def __init__ (self, text): + rex = re.compile(r""" + # [ <user> [ / <password> ] @] <host> [ :<port> ] + ^ (?: ([^/]*) (?: / ([^@]*) )? @)? ([^:]+) (?: :([0-9]+))?$""", re.X) + match = rex.match(text) + if not match: raise ValueError("'%s' is not a valid broker url" % (text)) + user, password, host, port = match.groups() + + if port: self.port = int(port) + else: self.port = 5672 + for addr in socket.getaddrinfo(host, self.port): + if addr[1] == socket.AF_INET: + self.host = addr[4][0] + self.username = user or "guest" + self.password = password or "guest" + + def name (self): + return self.host + ":" + str (self.port) + +class ManagementData: + + # + # Data Structure: + # + # Please note that this data structure holds only the most recent + # configuration and instrumentation data for each object. It does + # not hold the detailed historical data that is sent from the broker. + # The only historical data it keeps are the high and low watermarks + # for hi-lo statistics. + # + # tables :== {class-key} + # {<obj-id>} + # (timestamp, config-record, inst-record) + # class-key :== (<package-name>, <class-name>, <class-hash>) + # timestamp :== (<last-interval-time>, <create-time>, <delete-time>) + # config-record :== [element] + # inst-record :== [element] + # element :== (<element-name>, <element-value>) + # + + def registerObjId (self, objId): + if not objId.index() in self.idBackMap: + self.idBackMap[objId.index()] = self.nextId + self.idMap[self.nextId] = objId + self.nextId += 1 + + def displayObjId (self, objIdIndex): + if objIdIndex in self.idBackMap: + return self.idBackMap[objIdIndex] + else: + return 0 + + def rawObjId (self, displayId): + if displayId in self.idMap: + return self.idMap[displayId] + else: + return None + + def displayClassName (self, cls): + (packageName, className, hash) = cls + rev = self.schema[cls][4] + if rev == 0: + suffix = "" + else: + suffix = ".%d" % rev + return packageName + ":" + className + suffix + + def dataHandler (self, context, className, list, timestamps): + """ Callback for configuration and instrumentation data updates """ + self.lock.acquire () + try: + # If this class has not been seen before, create an empty dictionary to + # hold objects of this class + if className not in self.tables: + self.tables[className] = {} + + # Register the ID so a more friendly presentation can be displayed + objId = list[0][1] + oidx = objId.index() + self.registerObjId (objId) + + # If this object hasn't been seen before, create a new object record with + # the timestamps and empty lists for configuration and instrumentation data. + if oidx not in self.tables[className]: + self.tables[className][oidx] = (timestamps, [], []) + + (unused, oldConf, oldInst) = self.tables[className][oidx] + + # For config updates, simply replace old config list with the new one. + if context == 0: #config + self.tables[className][oidx] = (timestamps, list, oldInst) + + # For instrumentation updates, carry the minimum and maximum values for + # "hi-lo" stats forward. + elif context == 1: #inst + if len (oldInst) == 0: + newInst = list + else: + newInst = [] + for idx in range (len (list)): + (key, value) = list[idx] + if key.find ("High") == len (key) - 4: + if oldInst[idx][1] > value: + value = oldInst[idx][1] + if key.find ("Low") == len (key) - 3: + if oldInst[idx][1] < value: + value = oldInst[idx][1] + newInst.append ((key, value)) + self.tables[className][oidx] = (timestamps, oldConf, newInst) + + finally: + self.lock.release () + + def ctrlHandler (self, context, op, data): + if op == self.mclient.CTRL_BROKER_INFO: + pass + elif op == self.mclient.CTRL_HEARTBEAT: + pass + + def configHandler (self, context, className, list, timestamps): + self.dataHandler (0, className, list, timestamps); + + def instHandler (self, context, className, list, timestamps): + self.dataHandler (1, className, list, timestamps); + + def methodReply (self, broker, sequence, status, sText, args): + """ Callback for method-reply messages """ + self.lock.acquire () + try: + line = "Call Result: " + self.methodsPending[sequence] + \ + " " + str (status) + " (" + sText + ")" + print line, args + del self.methodsPending[sequence] + finally: + self.lock.release () + + def closeHandler (self, context, reason): + if self.operational: + print "Connection to broker lost:", reason + self.operational = False + if self.cli != None: + self.cli.setPromptMessage ("Broker Disconnected") + + def schemaHandler (self, context, classKey, configs, insts, methods, events): + """ Callback for schema updates """ + if classKey not in self.schema: + schemaRev = 0 + for key in self.schema: + if classKey[0] == key[0] and classKey[1] == key[1]: + schemaRev += 1 + self.schema[classKey] = (configs, insts, methods, events, schemaRev) + + def setCli (self, cliobj): + self.cli = cliobj + + def __init__ (self, disp, host, username="guest", password="guest"): + self.lock = Lock () + self.tables = {} + self.schema = {} + self.bootSequence = 0 + self.operational = False + self.disp = disp + self.cli = None + self.lastUnit = None + self.methodSeq = 1 + self.methodsPending = {} + self.sessionId = "%s.%d" % (platform.uname()[1], os.getpid()) + + self.broker = Broker (host) + sock = connect (self.broker.host, self.broker.port) + oldTimeout = sock.gettimeout() + sock.settimeout(10) + self.conn = Connection (sock, + username=self.broker.username, password=self.broker.password) + def aborted(): + raise Timeout("Waiting for connection to be established with broker") + oldAborted = self.conn.aborted + self.conn.aborted = aborted + + self.conn.start () + + sock.settimeout(oldTimeout) + self.conn.aborted = oldAborted + + self.mclient = managementClient ("unused", self.ctrlHandler, self.configHandler, + self.instHandler, self.methodReply, self.closeHandler) + self.mclient.schemaListener (self.schemaHandler) + self.mch = self.mclient.addChannel (self.conn.session(self.sessionId)) + self.operational = True + self.idMap = {} + self.idBackMap = {} + self.nextId = 101 + + def close (self): + pass + + def refName (self, oid): + if oid == None: + return "NULL" + return str (self.displayObjId (oid.index())) + + def valueDisplay (self, classKey, key, value): + if value == None: + return "<NULL>" + for kind in range (2): + schema = self.schema[classKey][kind] + for item in schema: + if item[0] == key: + typecode = item[1] + unit = item[2] + if (typecode >= 1 and typecode <= 5) or typecode == 12 or typecode == 13 or \ + (typecode >= 16 and typecode <= 19): + if unit == None or unit == self.lastUnit: + return str (value) + else: + self.lastUnit = unit + suffix = "" + if value != 1: + suffix = "s" + return str (value) + " " + unit + suffix + elif typecode == 6 or typecode == 7: # strings + return value + elif typecode == 8: + if value == 0: + return "--" + return self.disp.timestamp (value) + elif typecode == 9: + return str (value) + elif typecode == 10: + return self.refName (value) + elif typecode == 11: + if value == 0: + return "False" + else: + return "True" + elif typecode == 14: + return str (value) + elif typecode == 15: + return str (value) + return "*type-error*" + + def getObjIndex (self, classKey, config): + """ Concatenate the values from index columns to form a unique object name """ + result = "" + schemaConfig = self.schema[classKey][0] + for item in schemaConfig: + if item[5] == 1 and item[0] != "id": + if result != "": + result = result + "." + for key,val in config: + if key == item[0]: + result = result + self.valueDisplay (classKey, key, val) + return result + + def getClassKey (self, className): + delimPos = className.find(":") + if delimPos == -1: + schemaRev = 0 + delim = className.find(".") + if delim != -1: + schemaRev = int(className[delim + 1:]) + name = className[0:delim] + else: + name = className + for key in self.schema: + if key[1] == name and self.schema[key][4] == schemaRev: + return key + else: + package = className[0:delimPos] + name = className[delimPos + 1:] + schemaRev = 0 + delim = name.find(".") + if delim != -1: + schemaRev = int(name[delim + 1:]) + name = name[0:delim] + for key in self.schema: + if key[0] == package and key[1] == name: + if self.schema[key][4] == schemaRev: + return key + return None + + def classCompletions (self, prefix): + """ Provide a list of candidate class names for command completion """ + self.lock.acquire () + complist = [] + try: + for name in self.tables: + if name.find (prefix) == 0: + complist.append (name) + finally: + self.lock.release () + return complist + + def typeName (self, typecode): + """ Convert type-codes to printable strings """ + if typecode == 1: + return "uint8" + elif typecode == 2: + return "uint16" + elif typecode == 3: + return "uint32" + elif typecode == 4: + return "uint64" + elif typecode == 5: + return "bool" + elif typecode == 6: + return "short-string" + elif typecode == 7: + return "long-string" + elif typecode == 8: + return "abs-time" + elif typecode == 9: + return "delta-time" + elif typecode == 10: + return "reference" + elif typecode == 11: + return "boolean" + elif typecode == 12: + return "float" + elif typecode == 13: + return "double" + elif typecode == 14: + return "uuid" + elif typecode == 15: + return "field-table" + elif typecode == 16: + return "int8" + elif typecode == 17: + return "int16" + elif typecode == 18: + return "int32" + elif typecode == 19: + return "int64" + elif typecode == 20: + return "object" + elif typecode == 21: + return "list" + elif typecode == 22: + return "array" + else: + raise ValueError ("Invalid type code: %d" % typecode) + + def accessName (self, code): + """ Convert element access codes to printable strings """ + if code == 1: + return "ReadCreate" + elif code == 2: + return "ReadWrite" + elif code == 3: + return "ReadOnly" + else: + raise ValueError ("Invalid access code: %d" %code) + + def notNone (self, text): + if text == None: + return "" + else: + return text + + def isOid (self, id): + for char in str (id): + if not char.isdigit () and not char == '-': + return False + return True + + def listOfIds (self, classKey, tokens): + """ Generate a tuple of object ids for a classname based on command tokens. """ + list = [] + if len(tokens) == 0 or tokens[0] == "all": + for id in self.tables[classKey]: + list.append (self.displayObjId (id)) + + elif tokens[0] == "active": + for id in self.tables[classKey]: + if self.tables[classKey][id][0][2] == 0: + list.append (self.displayObjId (id)) + + else: + for token in tokens: + if self.isOid (token): + if token.find ("-") != -1: + ids = token.split("-", 2) + for id in range (int (ids[0]), int (ids[1]) + 1): + if self.getClassForId (self.rawObjId (long (id))) == classKey: + list.append (id) + else: + list.append (int(token)) + + list.sort () + result = () + for item in list: + result = result + (item,) + return result + + def listClasses (self): + """ Generate a display of the list of classes """ + self.lock.acquire () + try: + rows = [] + sorted = self.tables.keys () + sorted.sort () + for name in sorted: + active = 0 + deleted = 0 + for record in self.tables[name]: + isdel = False + ts = self.tables[name][record][0] + if ts[2] > 0: + isdel = True + if isdel: + deleted = deleted + 1 + else: + active = active + 1 + rows.append ((self.displayClassName (name), active, deleted)) + if len (rows) != 0: + self.disp.table ("Management Object Types:", + ("ObjectType", "Active", "Deleted"), rows) + else: + print "Waiting for next periodic update" + finally: + self.lock.release () + + def listObjects (self, tokens): + """ Generate a display of a list of objects in a class """ + if len(tokens) == 0: + print "Error - No class name provided" + return + + self.lock.acquire () + try: + classKey = self.getClassKey (tokens[0]) + if classKey == None: + print ("Object type %s not known" % tokens[0]) + else: + rows = [] + if classKey in self.tables: + ids = self.listOfIds(classKey, tokens[1:]) + for objId in ids: + (ts, config, inst) = self.tables[classKey][self.rawObjId(objId).index()] + createTime = self.disp.timestamp (ts[1]) + destroyTime = "-" + if ts[2] > 0: + destroyTime = self.disp.timestamp (ts[2]) + objIndex = self.getObjIndex (classKey, config) + row = (objId, createTime, destroyTime, objIndex) + rows.append (row) + self.disp.table ("Objects of type %s" % self.displayClassName(classKey), + ("ID", "Created", "Destroyed", "Index"), + rows) + finally: + self.lock.release () + + def showObjects (self, tokens): + """ Generate a display of object data for a particular class """ + self.lock.acquire () + try: + self.lastUnit = None + if self.isOid (tokens[0]): + if tokens[0].find ("-") != -1: + rootId = int (tokens[0][0:tokens[0].find ("-")]) + else: + rootId = int (tokens[0]) + + classKey = self.getClassForId (self.rawObjId (rootId)) + remaining = tokens + if classKey == None: + print "Id not known: %d" % int (tokens[0]) + raise ValueError () + else: + classKey = self.getClassKey (tokens[0]) + remaining = tokens[1:] + if classKey not in self.tables: + print "Class not known: %s" % tokens[0] + raise ValueError () + + userIds = self.listOfIds (classKey, remaining) + if len (userIds) == 0: + print "No object IDs supplied" + raise ValueError () + + ids = [] + for id in userIds: + if self.getClassForId (self.rawObjId (long (id))) == classKey: + ids.append (self.rawObjId (long (id))) + + rows = [] + timestamp = None + config = self.tables[classKey][ids[0].index()][1] + for eIdx in range (len (config)): + key = config[eIdx][0] + if key != "id": + row = ("property", key) + for id in ids: + if timestamp == None or \ + timestamp < self.tables[classKey][id.index()][0][0]: + timestamp = self.tables[classKey][id.index()][0][0] + (key, value) = self.tables[classKey][id.index()][1][eIdx] + row = row + (self.valueDisplay (classKey, key, value),) + rows.append (row) + + inst = self.tables[classKey][ids[0].index()][2] + for eIdx in range (len (inst)): + key = inst[eIdx][0] + if key != "id": + row = ("statistic", key) + for id in ids: + (key, value) = self.tables[classKey][id.index()][2][eIdx] + row = row + (self.valueDisplay (classKey, key, value),) + rows.append (row) + + titleRow = ("Type", "Element") + for id in ids: + titleRow = titleRow + (self.refName(id),) + caption = "Object of type %s:" % self.displayClassName(classKey) + if timestamp != None: + caption = caption + " (last sample time: " + self.disp.timestamp (timestamp) + ")" + self.disp.table (caption, titleRow, rows) + + except: + pass + self.lock.release () + + def schemaSummary (self): + """ Generate a display of the list of classes in the schema """ + self.lock.acquire () + try: + rows = [] + sorted = self.schema.keys () + sorted.sort () + for classKey in sorted: + tuple = self.schema[classKey] + row = (self.displayClassName(classKey), len (tuple[0]), len (tuple[1]), + len (tuple[2])) + rows.append (row) + self.disp.table ("Classes in Schema:", + ("Class", "Properties", "Statistics", "Methods"), + rows) + finally: + self.lock.release () + + def schemaTable (self, className): + """ Generate a display of details of the schema of a particular class """ + self.lock.acquire () + try: + classKey = self.getClassKey (className) + if classKey == None: + print ("Class name %s not known" % className) + raise ValueError () + + rows = [] + schemaRev = self.schema[classKey][4] + for config in self.schema[classKey][0]: + name = config[0] + if name != "id": + typename = self.typeName(config[1]) + unit = self.notNone (config[2]) + desc = self.notNone (config[3]) + access = self.accessName (config[4]) + extra = "" + if config[5] == 1: + extra += "index " + if config[6] != None: + extra += "Min: " + str(config[6]) + " " + if config[7] != None: + extra += "Max: " + str(config[7]) + " " + if config[8] != None: + extra += "MaxLen: " + str(config[8]) + " " + if config[9] == 1: + extra += "optional " + rows.append ((name, typename, unit, access, extra, desc)) + + for config in self.schema[classKey][1]: + name = config[0] + if name != "id": + typename = self.typeName(config[1]) + unit = self.notNone (config[2]) + desc = self.notNone (config[3]) + rows.append ((name, typename, unit, "", "", desc)) + + titles = ("Element", "Type", "Unit", "Access", "Notes", "Description") + self.disp.table ("Schema for class '%s':" % self.displayClassName(classKey), titles, rows) + + for mname in self.schema[classKey][2]: + (mdesc, args) = self.schema[classKey][2][mname] + caption = "\nMethod '%s' %s" % (mname, self.notNone (mdesc)) + rows = [] + for arg in args: + name = arg[0] + typename = self.typeName (arg[1]) + dir = arg[2] + unit = self.notNone (arg[3]) + desc = self.notNone (arg[4]) + extra = "" + if arg[5] != None: + extra = extra + "Min: " + str (arg[5]) + if arg[6] != None: + extra = extra + "Max: " + str (arg[6]) + if arg[7] != None: + extra = extra + "MaxLen: " + str (arg[7]) + if arg[8] != None: + extra = extra + "Default: " + str (arg[8]) + rows.append ((name, typename, dir, unit, extra, desc)) + titles = ("Argument", "Type", "Direction", "Unit", "Notes", "Description") + self.disp.table (caption, titles, rows) + + except Exception,e: + pass + self.lock.release () + + def getClassForId (self, objId): + """ Given an object ID, return the class key for the referenced object """ + for classKey in self.tables: + if objId.index() in self.tables[classKey]: + return classKey + return None + + def callMethod (self, userOid, methodName, args): + self.lock.acquire () + methodOk = True + try: + classKey = self.getClassForId (self.rawObjId (userOid)) + if classKey == None: + raise ValueError () + + if methodName not in self.schema[classKey][2]: + print "Method '%s' not valid for class '%s'" % (methodName, self.displayClassName(classKey)) + raise ValueError () + + schemaMethod = self.schema[classKey][2][methodName] + count = 0 + for arg in range(len(schemaMethod[1])): + if schemaMethod[1][arg][2].find("I") != -1: + count += 1 + if len (args) != count: + print "Wrong number of method args: Need %d, Got %d" % (count, len (args)) + raise ValueError () + + namedArgs = {} + idx = 0 + for arg in range(len(schemaMethod[1])): + if schemaMethod[1][arg][2].find("I") != -1: + namedArgs[schemaMethod[1][arg][0]] = args[idx] + idx += 1 + + self.methodSeq = self.methodSeq + 1 + self.methodsPending[self.methodSeq] = methodName + except Exception, e: + methodOk = False + self.lock.release () + if methodOk: +# try: + self.mclient.callMethod (self.mch, self.methodSeq, self.rawObjId (userOid), classKey, + methodName, namedArgs) +# except ValueError, e: +# print "Error invoking method:", e + + def makeIdRow (self, displayId): + if displayId in self.idMap: + objId = self.idMap[displayId] + else: + return None + if objId.getFlags() == 0: + flags = "" + else: + flags = str(objId.getFlags()) + seq = objId.getSequence() + if seq == 0: + seqText = "<durable>" + else: + seqText = str(seq) + return (displayId, flags, seqText, objId.getBroker(), objId.getBank(), hex(objId.getObject())) + + def listIds (self, select): + rows = [] + if select == 0: + sorted = self.idMap.keys() + sorted.sort() + for displayId in sorted: + row = self.makeIdRow (displayId) + rows.append(row) + else: + row = self.makeIdRow (select) + if row == None: + print "Display Id %d not known" % select + return + rows.append(row) + self.disp.table("Translation of Display IDs:", + ("DisplayID", "Flags", "BootSequence", "Broker", "Bank", "Object"), + rows) + + def do_list (self, data): + tokens = data.split () + if len (tokens) == 0: + self.listClasses () + else: + self.listObjects (tokens) + + def do_show (self, data): + tokens = data.split () + self.showObjects (tokens) + + def do_schema (self, data): + if data == "": + self.schemaSummary () + else: + self.schemaTable (data) + + def do_call (self, data): + encTokens = data.split () + try: + tokens = [a.decode(locale.getpreferredencoding()) for a in encArgs] + except: + tokens = encTokens + if len (tokens) < 2: + print "Not enough arguments supplied" + return + + displayId = long (tokens[0]) + methodName = tokens[1] + args = tokens[2:] + self.callMethod (displayId, methodName, args) + + def do_id (self, data): + if data == "": + select = 0 + else: + select = int(data) + self.listIds(select) + + def do_exit (self): + self.mclient.removeChannel (self.mch) diff --git a/qpid/python/qpid/message.py b/qpid/python/qpid/message.py new file mode 100644 index 0000000000..4d31da2846 --- /dev/null +++ b/qpid/python/qpid/message.py @@ -0,0 +1,73 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +from connection08 import Method, Request + +class Message: + + def __init__(self, channel, frame, content = None): + self.channel = channel + self.frame = frame + self.method = frame.method_type + self.content = content + if self.method.is_l4_command(): + self.command_id = self.channel.incoming_completion.sequence.next() + #print "allocated: ", self.command_id, "to ", self.method.klass.name, "_", self.method.name + + def __len__(self): + return len(self.frame.args) + + def _idx(self, idx): + if idx < 0: idx += len(self) + if idx < 0 or idx > len(self): + raise IndexError(idx) + return idx + + def __getitem__(self, idx): + return self.frame.args[idx] + + def __getattr__(self, attr): + fields = self.method.fields.byname + if fields.has_key(attr): + f = fields[attr] + result = self[self.method.fields.index(f)] + else: + for r in self.method.responses: + if attr == r.name: + def respond(*args, **kwargs): + batch=0 + if kwargs.has_key("batchoffset"): + batch=kwargs.pop("batchoffset") + self.channel.respond(Method(r, r.arguments(*args, **kwargs)), batch, self.frame) + result = respond + break + else: + raise AttributeError(attr) + return result + + STR = "%s %s content = %s" + REPR = STR.replace("%s", "%r") + + def __str__(self): + return Message.STR % (self.method, self.frame.args, self.content) + + def __repr__(self): + return Message.REPR % (self.method, self.frame.args, self.content) + + def complete(self, cumulative=True): + self.channel.incoming_completion.complete(mark=self.command_id, cumulative=cumulative) diff --git a/qpid/python/qpid/messaging/__init__.py b/qpid/python/qpid/messaging/__init__.py new file mode 100644 index 0000000000..f9ddda2e80 --- /dev/null +++ b/qpid/python/qpid/messaging/__init__.py @@ -0,0 +1,35 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +A candidate high level messaging API for python. + +Areas that still need work: + + - definition of the arguments for L{Session.sender} and L{Session.receiver} + - standard L{Message} properties + - L{Message} content encoding + - protocol negotiation/multiprotocol impl +""" + +from qpid.datatypes import timestamp, uuid4, Serial +from qpid.messaging.constants import * +from qpid.messaging.endpoints import * +from qpid.messaging.exceptions import * +from qpid.messaging.message import * diff --git a/qpid/python/qpid/messaging/address.py b/qpid/python/qpid/messaging/address.py new file mode 100644 index 0000000000..e423f09193 --- /dev/null +++ b/qpid/python/qpid/messaging/address.py @@ -0,0 +1,172 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import re +from qpid.lexer import Lexicon, LexError +from qpid.parser import Parser, ParseError + +l = Lexicon() + +LBRACE = l.define("LBRACE", r"\{") +RBRACE = l.define("RBRACE", r"\}") +LBRACK = l.define("LBRACK", r"\[") +RBRACK = l.define("RBRACK", r"\]") +COLON = l.define("COLON", r":") +SEMI = l.define("SEMI", r";") +SLASH = l.define("SLASH", r"/") +COMMA = l.define("COMMA", r",") +NUMBER = l.define("NUMBER", r'[+-]?[0-9]*\.?[0-9]+') +ID = l.define("ID", r'[a-zA-Z_](?:[a-zA-Z0-9_-]*[a-zA-Z0-9_])?') +STRING = l.define("STRING", r""""(?:[^\\"]|\\.)*"|'(?:[^\\']|\\.)*'""") +ESC = l.define("ESC", r"\\[^ux]|\\x[0-9a-fA-F][0-9a-fA-F]|\\u[0-9a-fA-F][0-9a-fA-F][0-9a-fA-F][0-9a-fA-F]") +SYM = l.define("SYM", r"[.#*%@$^!+-]") +WSPACE = l.define("WSPACE", r"[ \n\r\t]+") +EOF = l.eof("EOF") + +LEXER = l.compile() + +def lex(st): + return LEXER.lex(st) + +def tok2str(tok): + if tok.type is STRING: + return eval(tok.value) + elif tok.type is ESC: + if tok.value[1] == "x": + return eval('"%s"' % tok.value) + elif tok.value[1] == "u": + return eval('u"%s"' % tok.value) + else: + return tok.value[1] + else: + return tok.value + +CONSTANTS = { + "True": True, + "true": True, + "False": False, + "false": False, + "None": None + } + +def tok2obj(tok): + if tok.type == ID: + return CONSTANTS.get(tok.value, tok.value) + elif tok.type in (STRING, NUMBER): + return eval(tok.value) + else: + return tok.value + +def toks2str(toks): + if toks: + return "".join(map(tok2str, toks)) + else: + return None + +class AddressParser(Parser): + + def __init__(self, tokens): + Parser.__init__(self, [t for t in tokens if t.type is not WSPACE]) + + def parse(self): + result = self.address() + self.eat(EOF) + return result + + def address(self): + name = toks2str(self.eat_until(SLASH, SEMI, EOF)) + + if name is None: + raise ParseError(self.next()) + + if self.matches(SLASH): + self.eat(SLASH) + subject = toks2str(self.eat_until(SEMI, EOF)) + else: + subject = None + + if self.matches(SEMI): + self.eat(SEMI) + options = self.map() + else: + options = None + return name, subject, options + + def map(self): + self.eat(LBRACE) + + result = {} + while True: + if self.matches(NUMBER, STRING, ID, LBRACE, LBRACK): + n, v = self.keyval() + result[n] = v + if self.matches(COMMA): + self.eat(COMMA) + elif self.matches(RBRACE): + break + else: + raise ParseError(self.next(), COMMA, RBRACE) + elif self.matches(RBRACE): + break + else: + raise ParseError(self.next(), NUMBER, STRING, ID, LBRACE, LBRACK, + RBRACE) + + self.eat(RBRACE) + return result + + def keyval(self): + key = self.value() + self.eat(COLON) + val = self.value() + return (key, val) + + def value(self): + if self.matches(NUMBER, STRING, ID): + return tok2obj(self.eat()) + elif self.matches(LBRACE): + return self.map() + elif self.matches(LBRACK): + return self.list() + else: + raise ParseError(self.next(), NUMBER, STRING, ID, LBRACE, LBRACK) + + def list(self): + self.eat(LBRACK) + + result = [] + + while True: + if self.matches(RBRACK): + break + else: + result.append(self.value()) + if self.matches(COMMA): + self.eat(COMMA) + elif self.matches(RBRACK): + break + else: + raise ParseError(self.next(), COMMA, RBRACK) + + self.eat(RBRACK) + return result + +def parse(addr): + return AddressParser(lex(addr)).parse() + +__all__ = ["parse", "ParseError"] diff --git a/qpid/python/qpid/messaging/constants.py b/qpid/python/qpid/messaging/constants.py new file mode 100644 index 0000000000..f230c4def8 --- /dev/null +++ b/qpid/python/qpid/messaging/constants.py @@ -0,0 +1,40 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +__SELF__ = object() + +class Constant: + + def __init__(self, name, value=__SELF__): + self.name = name + if value is __SELF__: + self.value = self + else: + self.value = value + + def __repr__(self): + return self.name + +AMQP_PORT = 5672 +AMQPS_PORT = 5671 + +UNLIMITED = Constant("UNLIMITED", 0xFFFFFFFFL) + +REJECTED = Constant("REJECTED") +RELEASED = Constant("RELEASED") diff --git a/qpid/python/qpid/messaging/driver.py b/qpid/python/qpid/messaging/driver.py new file mode 100644 index 0000000000..74ed038b0e --- /dev/null +++ b/qpid/python/qpid/messaging/driver.py @@ -0,0 +1,1432 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import socket, struct, sys, time +from logging import getLogger, DEBUG +from qpid import compat +from qpid import sasl +from qpid.concurrency import synchronized +from qpid.datatypes import RangedSet, Serial +from qpid.framing import OpEncoder, SegmentEncoder, FrameEncoder, \ + FrameDecoder, SegmentDecoder, OpDecoder +from qpid.messaging import address, transports +from qpid.messaging.constants import UNLIMITED, REJECTED, RELEASED +from qpid.messaging.exceptions import * +from qpid.messaging.message import get_codec, Disposition, Message +from qpid.messaging.endpoints import MangledString +from qpid.ops import * +from qpid.selector import Selector +from qpid.util import URL, default,get_client_properties_with_defaults +from qpid.validator import And, Context, List, Map, Types, Values +from threading import Condition, Thread + +log = getLogger("qpid.messaging") +rawlog = getLogger("qpid.messaging.io.raw") +opslog = getLogger("qpid.messaging.io.ops") + +def addr2reply_to(addr): + name, subject, options = address.parse(addr) + if options: + type = options.get("node", {}).get("type") + else: + type = None + + if type == "topic": + return ReplyTo(name, subject) + else: + return ReplyTo(None, name) + +def reply_to2addr(reply_to): + if reply_to.exchange in (None, ""): + return reply_to.routing_key + elif reply_to.routing_key is None: + return "%s; {node: {type: topic}}" % reply_to.exchange + else: + return "%s/%s; {node: {type: topic}}" % (reply_to.exchange, reply_to.routing_key) + +class Attachment: + + def __init__(self, target): + self.target = target + +# XXX + +DURABLE_DEFAULT=False + +# XXX + +class Pattern: + """ + The pattern filter matches the supplied wildcard pattern against a + message subject. + """ + + def __init__(self, value): + self.value = value + + # XXX: this should become part of the driver + def _bind(self, sst, exchange, queue): + from qpid.ops import ExchangeBind + + sst.write_cmd(ExchangeBind(exchange=exchange, queue=queue, + binding_key=self.value.replace("*", "#"))) + +SUBJECT_DEFAULTS = { + "topic": "#" + } + +def noop(): pass +def sync_noop(): pass + +class SessionState: + + def __init__(self, driver, session, name, channel): + self.driver = driver + self.session = session + self.name = name + self.channel = channel + self.detached = False + self.committing = False + self.aborting = False + + # sender state + self.sent = Serial(0) + self.acknowledged = RangedSet() + self.actions = {} + self.min_completion = self.sent + self.max_completion = self.sent + self.results = {} + self.need_sync = False + + # receiver state + self.received = None + self.executed = RangedSet() + + # XXX: need to periodically exchange completion/known_completion + + self.destinations = {} + + def write_query(self, query, handler, obj): + id = self.sent + self.write_cmd(query, lambda: handler(self.results.pop(id), obj)) + + def apply_overrides(self, cmd, overrides): + for k, v in overrides.items(): + cmd[k.replace('-', '_')] = v + + def write_cmd(self, cmd, action=noop, overrides=None, sync=True): + if overrides: + self.apply_overrides(cmd, overrides) + + if action != noop: + cmd.sync = sync + if self.detached: + raise Exception("detached") + cmd.id = self.sent + self.sent += 1 + self.actions[cmd.id] = action + self.max_completion = cmd.id + self.write_op(cmd) + self.need_sync = not cmd.sync + + def write_cmds(self, cmds, action=noop): + if cmds: + for cmd in cmds[:-1]: + self.write_cmd(cmd) + self.write_cmd(cmds[-1], action) + else: + action() + + def write_op(self, op): + op.channel = self.channel + self.driver.write_op(op) + +POLICIES = Values("always", "sender", "receiver", "never") +RELIABILITY = Values("unreliable", "at-most-once", "at-least-once", + "exactly-once") + +DECLARE = Map({}, restricted=False) +BINDINGS = List(Map({ + "exchange": Types(basestring), + "queue": Types(basestring), + "key": Types(basestring), + "arguments": Map({}, restricted=False) + })) + +COMMON_OPTS = { + "create": POLICIES, + "delete": POLICIES, + "assert": POLICIES, + "node": Map({ + "type": Values("queue", "topic"), + "durable": Types(bool), + "x-declare": DECLARE, + "x-bindings": BINDINGS + }), + "link": Map({ + "name": Types(basestring), + "durable": Types(bool), + "reliability": RELIABILITY, + "x-declare": DECLARE, + "x-bindings": BINDINGS, + "x-subscribe": Map({}, restricted=False) + }) + } + +RECEIVE_MODES = Values("browse", "consume") + +SOURCE_OPTS = COMMON_OPTS.copy() +SOURCE_OPTS.update({ + "mode": RECEIVE_MODES + }) + +TARGET_OPTS = COMMON_OPTS.copy() + +class LinkIn: + + ADDR_NAME = "source" + DIR_NAME = "receiver" + VALIDATOR = Map(SOURCE_OPTS) + + def init_link(self, sst, rcv, _rcv): + _rcv.destination = str(rcv.id) + sst.destinations[_rcv.destination] = _rcv + _rcv.draining = False + _rcv.bytes_open = False + _rcv.on_unlink = [] + + def do_link(self, sst, rcv, _rcv, type, subtype, action): + link_opts = _rcv.options.get("link", {}) + if type == "topic": + default_reliability = "unreliable" + else: + default_reliability = "at-least-once" + reliability = link_opts.get("reliability", default_reliability) + declare = link_opts.get("x-declare", {}) + subscribe = link_opts.get("x-subscribe", {}) + acq_mode = acquire_mode.pre_acquired + if reliability in ("unreliable", "at-most-once"): + rcv._accept_mode = accept_mode.none + else: + rcv._accept_mode = accept_mode.explicit + + if type == "topic": + default_name = "%s.%s" % (rcv.session.name, _rcv.destination) + _rcv._queue = link_opts.get("name", default_name) + sst.write_cmd(QueueDeclare(queue=_rcv._queue, + durable=link_opts.get("durable", False), + exclusive=True, + auto_delete=(reliability == "unreliable")), + overrides=declare) + if declare.get("exclusive", True): _rcv.on_unlink = [QueueDelete(_rcv._queue)] + subject = _rcv.subject or SUBJECT_DEFAULTS.get(subtype) + bindings = get_bindings(link_opts, _rcv._queue, _rcv.name, subject) + if not bindings: + sst.write_cmd(ExchangeBind(_rcv._queue, _rcv.name, subject)) + + elif type == "queue": + _rcv._queue = _rcv.name + if _rcv.options.get("mode", "consume") == "browse": + acq_mode = acquire_mode.not_acquired + bindings = get_bindings(link_opts, queue=_rcv._queue) + + + sst.write_cmds(bindings) + sst.write_cmd(MessageSubscribe(queue=_rcv._queue, + destination=_rcv.destination, + acquire_mode = acq_mode, + accept_mode = rcv._accept_mode), + overrides=subscribe) + sst.write_cmd(MessageSetFlowMode(_rcv.destination, flow_mode.credit), action) + + def do_unlink(self, sst, rcv, _rcv, action=noop): + link_opts = _rcv.options.get("link", {}) + reliability = link_opts.get("reliability") + cmds = [MessageCancel(_rcv.destination)] + cmds.extend(_rcv.on_unlink) + msgs = [] #release back messages for the closing receiver + msg = rcv.session._pop(rcv) + while msg is not None: + msgs.append(msg) + msg = rcv.session._pop(rcv) + if len(msgs) > 0: + ids = RangedSet(*[m._transfer_id for m in msgs]) + log.debug("releasing back messages: %s, as receiver is closing", ids) + cmds.append(MessageRelease(ids, True)) + sst.write_cmds(cmds, action) + + def del_link(self, sst, rcv, _rcv): + del sst.destinations[_rcv.destination] + +class LinkOut: + + ADDR_NAME = "target" + DIR_NAME = "sender" + VALIDATOR = Map(TARGET_OPTS) + + def init_link(self, sst, snd, _snd): + _snd.closing = False + _snd.pre_ack = False + + def do_link(self, sst, snd, _snd, type, subtype, action): + link_opts = _snd.options.get("link", {}) + reliability = link_opts.get("reliability", "at-least-once") + _snd.pre_ack = reliability in ("unreliable", "at-most-once") + if type == "topic": + _snd._exchange = _snd.name + _snd._routing_key = _snd.subject + bindings = get_bindings(link_opts, exchange=_snd.name, key=_snd.subject) + elif type == "queue": + _snd._exchange = "" + _snd._routing_key = _snd.name + bindings = get_bindings(link_opts, queue=_snd.name) + sst.write_cmds(bindings, action) + + def do_unlink(self, sst, snd, _snd, action=noop): + action() + + def del_link(self, sst, snd, _snd): + pass + +class Cache: + + def __init__(self, ttl): + self.ttl = ttl + self.entries = {} + + def __setitem__(self, key, value): + self.entries[key] = time.time(), value + + def __getitem__(self, key): + tstamp, value = self.entries[key] + if time.time() - tstamp >= self.ttl: + del self.entries[key] + raise KeyError(key) + else: + return value + + def __delitem__(self, key): + del self.entries[key] + +# XXX +HEADER="!4s4B" + +EMPTY_DP = DeliveryProperties() +EMPTY_MP = MessageProperties() + +SUBJECT = "qpid.subject" + +CLOSED = "CLOSED" +READ_ONLY = "READ_ONLY" +WRITE_ONLY = "WRITE_ONLY" +OPEN = "OPEN" + +class Driver: + + def __init__(self, connection): + self.connection = connection + self.log_id = "%x" % id(self.connection) + self._lock = self.connection._lock + + self._selector = Selector.default() + self._attempts = 0 + self._delay = self.connection.reconnect_interval_min + self._reconnect_log = self.connection.reconnect_log + self._host = 0 + self._retrying = False + self._next_retry = None + self._transport = None + + self._timeout = None + + self.engine = None + + def _next_host(self): + urls = [URL(u) for u in self.connection.reconnect_urls] + hosts = [(self.connection.host, default(self.connection.port, 5672))] + \ + [(u.host, default(u.port, 5672)) for u in urls] + if self._host >= len(hosts): + self._host = 0 + self._last_host = hosts[self._host] + if self._host == 0: + self._attempts += 1 + self._host = self._host + 1 + return self._last_host + + def _num_hosts(self): + return len(self.connection.reconnect_urls) + 1 + + @synchronized + def wakeup(self): + self.dispatch() + self._selector.wakeup() + + def start(self): + self._selector.register(self) + + def stop(self): + self._selector.unregister(self) + if self._transport: + self.st_closed() + + def fileno(self): + return self._transport.fileno() + + @synchronized + def reading(self): + return self._transport is not None and \ + self._transport.reading(True) + + @synchronized + def writing(self): + return self._transport is not None and \ + self._transport.writing(self.engine.pending()) + + @synchronized + def timing(self): + return self._timeout + + def _check_retry_ok(self): + """We consider a reconnect to have suceeded only when we have received + open-ok from the peer. + + If we declared success as soon as the transport connected, then we could get + into an infinite heartbeat loop if the remote process is hung and never + sends us any data. We would fail the connection after 2 missed heartbeats, + reconnect the transport, declare the reconnect ok, then fail again after 2 + missed heartbeats and so on. + """ + if self._retrying and self.engine._connected: # Means we have received open-ok. + if self._reconnect_log: + log.warn("reconnect succeeded: %s:%s", *self._last_host) + self._next_retry = None + self._attempts = 0 + self._delay = self.connection.reconnect_interval_min + self._retrying = False + + @synchronized + def readable(self): + try: + data = self._transport.recv(64*1024) + if data is None: + return + elif data: + rawlog.debug("READ[%s]: %r", self.log_id, data) + self.engine.write(data) + self._check_retry_ok() + else: + self.close_engine() + except socket.error, e: + self.close_engine(ConnectionError(text=str(e))) + + self.update_status() + + self._notify() + + def _notify(self): + if self.connection.error: + self.connection._condition.gc() + self.connection._waiter.notifyAll() + + def close_engine(self, e=None): + if e is None: + e = ConnectionError(text="connection aborted") + + if (self.connection.reconnect and + (self.connection.reconnect_limit is None or + self.connection.reconnect_limit <= 0 or + self._attempts <= self.connection.reconnect_limit)): + if self._host < self._num_hosts(): + delay = 0 + else: + delay = self._delay + self._delay = min(2*self._delay, + self.connection.reconnect_interval_max) + self._next_retry = time.time() + delay + if self._reconnect_log: + log.warn("recoverable error[attempt %s]: %s" % (self._attempts, e)) + if delay > 0: + log.warn("sleeping %s seconds" % delay) + self._retrying = True + self.engine.close() + else: + self.engine.close(e) + + self.schedule() + + def update_status(self): + if not self.engine: return False + status = self.engine.status() + return getattr(self, "st_%s" % status.lower())() + + def st_closed(self): + # XXX: this log statement seems to sometimes hit when the socket is not connected + # XXX: rawlog.debug("CLOSE[%s]: %s", self.log_id, self._socket.getpeername()) + if self._transport: self._transport.close() + self._transport = None + self.engine = None + return True + + def st_open(self): + return False + + @synchronized + def writeable(self): + notify = False + try: + n = self._transport.send(self.engine.peek()) + if n == 0: return + sent = self.engine.read(n) + rawlog.debug("SENT[%s]: %r", self.log_id, sent) + except socket.error, e: + self.close_engine(e) + notify = True + + if self.update_status() or notify: + self._notify() + + @synchronized + def timeout(self): + self.dispatch() + self.update_status() + self._notify() + self.schedule() + + def schedule(self): + times = [] + if self.connection.heartbeat: + times.append(time.time() + self.connection.heartbeat) + if self._next_retry: + times.append(self._next_retry) + if times: + self._timeout = min(times) + else: + self._timeout = None + + def dispatch(self): + try: + if self._transport is None: + if self.connection._connected and not self.connection.error: + self.connect() + else: + self.engine.dispatch() + except HeartbeatTimeout, e: + self.close_engine(e) + except ContentError, e: + msg = compat.format_exc() + self.connection.error = ContentError(text=msg) + except: + # XXX: Does socket get leaked if this occurs? + msg = compat.format_exc() + self.connection.error = InternalError(text=msg) + + def connect(self): + if self._retrying and time.time() < self._next_retry: + return + + try: + # XXX: should make this non blocking + host, port = self._next_host() + if self._retrying and self._reconnect_log: + log.warn("trying: %s:%s", host, port) + self.engine = Engine(self.connection) + self.engine.open() + rawlog.debug("OPEN[%s]: %s:%s", self.log_id, host, port) + trans = transports.TRANSPORTS.get(self.connection.transport) + if trans: + self._transport = trans(self.connection, host, port) + else: + raise ConnectError("no such transport: %s" % self.connection.transport) + self.schedule() + except socket.error, e: + self.close_engine(ConnectError(text=str(e))) + +DEFAULT_DISPOSITION = Disposition(None) + +def get_bindings(opts, queue=None, exchange=None, key=None): + bindings = opts.get("x-bindings", []) + cmds = [] + for b in bindings: + exchange = b.get("exchange", exchange) + queue = b.get("queue", queue) + key = b.get("key", key) + args = b.get("arguments", {}) + cmds.append(ExchangeBind(queue, exchange, key, args)) + return cmds + +CONNECTION_ERRS = { + # anythong not here (i.e. everything right now) will default to + # connection error + } + +SESSION_ERRS = { + # anything not here will default to session error + error_code.unauthorized_access: UnauthorizedAccess, + error_code.not_found: NotFound, + error_code.resource_locked: ReceiverError, + error_code.resource_limit_exceeded: TargetCapacityExceeded, + error_code.internal_error: ServerError + } + +class Engine: + + def __init__(self, connection): + self.connection = connection + self.log_id = "%x" % id(self.connection) + self._closing = False + self._connected = False + self._reconnecting = bool(connection.sessions) + self._attachments = {} + + self._in = LinkIn() + self._out = LinkOut() + + self._channel_max = 65536 + self._channels = 0 + self._sessions = {} + + self.address_cache = Cache(self.connection.address_ttl) + + self._status = CLOSED + self._buf = "" + self._hdr = "" + # Set _last_in and _last_out here so heartbeats will be timed from the + # beginning of connection if no data is sent/received. + self._last_in = time.time() + self._last_out = time.time() + self._op_enc = OpEncoder() + self._seg_enc = SegmentEncoder() + self._frame_enc = FrameEncoder() + self._frame_dec = FrameDecoder() + self._seg_dec = SegmentDecoder() + self._op_dec = OpDecoder() + + self._sasl = sasl.Client() + if self.connection.username: + self._sasl.setAttr("username", self.connection.username) + if self.connection.password: + self._sasl.setAttr("password", self.connection.password) + if self.connection.host: + self._sasl.setAttr("host", self.connection.host) + self._sasl.setAttr("service", self.connection.sasl_service) + if self.connection.sasl_min_ssf is not None: + self._sasl.setAttr("minssf", self.connection.sasl_min_ssf) + if self.connection.sasl_max_ssf is not None: + self._sasl.setAttr("maxssf", self.connection.sasl_max_ssf) + self._sasl.init() + self._sasl_encode = False + self._sasl_decode = False + + def _reset(self): + self.connection._transport_connected = False + + for ssn in self.connection.sessions.values(): + for m in ssn.acked + ssn.unacked + ssn.incoming: + m._transfer_id = None + for snd in ssn.senders: + snd.linked = False + for rcv in ssn.receivers: + rcv.impending = rcv.received + rcv.linked = False + + def status(self): + return self._status + + def write(self, data): + self._last_in = time.time() + try: + if self._sasl_decode: + data = self._sasl.decode(data) + + if len(self._hdr) < 8: + r = 8 - len(self._hdr) + self._hdr += data[:r] + data = data[r:] + + if len(self._hdr) == 8: + self.do_header(self._hdr) + + self._frame_dec.write(data) + self._seg_dec.write(*self._frame_dec.read()) + self._op_dec.write(*self._seg_dec.read()) + for op in self._op_dec.read(): + self.assign_id(op) + opslog.debug("RCVD[%s]: %r", self.log_id, op) + op.dispatch(self) + self.dispatch() + except MessagingError, e: + self.close(e) + except: + self.close(InternalError(text=compat.format_exc())) + + def close(self, e=None): + self._reset() + # We cannot re-establish transactional sessions, they must be aborted. + # We could re-do transactional enqueues, but not dequeues. + for ssn in self.connection.sessions.values(): + if ssn.transactional: + if ssn.committing: + ssn.error = TransactionUnknown(text="Transaction outcome unknown due to transport failure") + else: + ssn.error = TransactionAborted(text="Transaction aborted due to transport failure") + ssn.closed = True + if e: + self.connection.error = e + self._status = CLOSED + + def assign_id(self, op): + if isinstance(op, Command): + sst = self.get_sst(op) + op.id = sst.received + sst.received += 1 + + def pending(self): + return len(self._buf) + + def read(self, n): + result = self._buf[:n] + self._buf = self._buf[n:] + return result + + def peek(self): + return self._buf + + def write_op(self, op): + opslog.debug("SENT[%s]: %r", self.log_id, op) + self._op_enc.write(op) + self._seg_enc.write(*self._op_enc.read()) + self._frame_enc.write(*self._seg_enc.read()) + bytes = self._frame_enc.read() + if self._sasl_encode: + bytes = self._sasl.encode(bytes) + self._buf += bytes + self._last_out = time.time() + + def do_header(self, hdr): + cli_major = 0; cli_minor = 10 + magic, _, _, major, minor = struct.unpack(HEADER, hdr) + if major != cli_major or minor != cli_minor: + raise VersionError(text="client: %s-%s, server: %s-%s" % + (cli_major, cli_minor, major, minor)) + + def do_connection_start(self, start): + if self.connection.sasl_mechanisms: + permitted = self.connection.sasl_mechanisms.split() + mechs = [m for m in start.mechanisms if m in permitted] + else: + mechs = start.mechanisms + try: + mech, initial = self._sasl.start(" ".join(mechs)) + except sasl.SASLError, e: + if "ANONYMOUS" not in mechs and self.connection.username is None: + _text="Anonymous connections disabled, missing credentials" + else: + _text=str(e) + raise AuthenticationFailure(text=_text) + + client_properties = get_client_properties_with_defaults(provided_client_properties=self.connection.client_properties); + self.write_op(ConnectionStartOk(client_properties=client_properties, + mechanism=mech, response=initial)) + + def do_connection_secure(self, secure): + resp = self._sasl.step(secure.challenge) + self.write_op(ConnectionSecureOk(response=resp)) + + def do_connection_tune(self, tune): + # XXX: is heartbeat protocol specific? + if tune.channel_max is not None: + self.channel_max = tune.channel_max + self.write_op(ConnectionTuneOk(heartbeat=self.connection.heartbeat, + channel_max=self.channel_max)) + self.write_op(ConnectionOpen()) + self._sasl_encode = True + + def do_connection_open_ok(self, open_ok): + self.connection.auth_username = self._sasl.auth_username() + self._connected = True + self._sasl_decode = True + self.connection._transport_connected = True + + def do_connection_heartbeat(self, hrt): + pass + + def do_connection_close(self, close): + self.write_op(ConnectionCloseOk()) + if close.reply_code != close_code.normal: + exc = CONNECTION_ERRS.get(close.reply_code, ConnectionError) + self.connection.error = exc(close.reply_code, close.reply_text) + # XXX: should we do a half shutdown on the socket here? + # XXX: we really need to test this, we may end up reporting a + # connection abort after this, if we were to do a shutdown on read + # and stop reading, then we wouldn't report the abort, that's + # probably the right thing to do + + def do_connection_close_ok(self, close_ok): + self.close() + + def do_session_attached(self, atc): + pass + + def do_session_command_point(self, cp): + sst = self.get_sst(cp) + sst.received = cp.command_id + + def do_session_completed(self, sc): + sst = self.get_sst(sc) + for r in sc.commands: + sst.acknowledged.add(r.lower, r.upper) + + if not sc.commands.empty(): + while sst.min_completion in sc.commands: + if sst.actions.has_key(sst.min_completion): + sst.actions.pop(sst.min_completion)() + sst.min_completion += 1 + + def session_known_completed(self, kcmp): + sst = self.get_sst(kcmp) + executed = RangedSet() + for e in sst.executed.ranges: + for ke in kcmp.ranges: + if e.lower in ke and e.upper in ke: + break + else: + executed.add_range(e) + sst.executed = completed + + def do_session_flush(self, sf): + sst = self.get_sst(sf) + if sf.expected: + if sst.received is None: + exp = None + else: + exp = RangedSet(sst.received) + sst.write_op(SessionExpected(exp)) + if sf.confirmed: + sst.write_op(SessionConfirmed(sst.executed)) + if sf.completed: + sst.write_op(SessionCompleted(sst.executed)) + + def do_session_request_timeout(self, rt): + sst = self.get_sst(rt) + sst.write_op(SessionTimeout(timeout=0)) + + def do_execution_result(self, er): + sst = self.get_sst(er) + sst.results[er.command_id] = er.value + sst.executed.add(er.id) + + def do_execution_exception(self, ex): + sst = self.get_sst(ex) + exc = SESSION_ERRS.get(ex.error_code, SessionError) + sst.session.error = exc(ex.error_code, ex.description) + + def dispatch(self): + if not self.connection._connected and not self._closing and self._status != CLOSED: + self.disconnect() + + if self._connected and not self._closing: + for ssn in self.connection.sessions.values(): + self.attach(ssn) + self.process(ssn) + + # We need to check heartbeat even if not self._connected since we may have + # heartbeat timeout before receiving an open-ok + if self.connection.heartbeat and self._status != CLOSED and not self._closing: + now = time.time() + if now - self._last_in > 2*self.connection.heartbeat: + raise HeartbeatTimeout(text="heartbeat timeout") + # Only send heartbeats if we are connected. + if self._connected and now - self._last_out >= self.connection.heartbeat/2.0: + self.write_op(ConnectionHeartbeat()) + + def open(self): + self._reset() + self._status = OPEN + self._buf += struct.pack(HEADER, "AMQP", 1, 1, 0, 10) + + def disconnect(self): + self.write_op(ConnectionClose(close_code.normal)) + self._closing = True + + def attach(self, ssn): + if ssn.closed: return + sst = self._attachments.get(ssn) + if sst is None: + for i in xrange(0, self.channel_max): + if not self._sessions.has_key(i): + ch = i + break + else: + raise RuntimeError("all channels used") + sst = SessionState(self, ssn, ssn.name, ch) + sst.write_op(SessionAttach(name=ssn.name, force=self._reconnecting)) + sst.write_op(SessionCommandPoint(sst.sent, 0)) + self._reconnecting = False + sst.outgoing_idx = 0 + sst.acked = [] + sst.acked_idx = 0 + if ssn.transactional: + sst.write_cmd(TxSelect()) + self._attachments[ssn] = sst + self._sessions[sst.channel] = sst + + for snd in ssn.senders: + self.link(snd, self._out, snd.target) + for rcv in ssn.receivers: + self.link(rcv, self._in, rcv.source) + + if sst is not None and ssn.closing and not sst.detached: + sst.detached = True + sst.write_op(SessionDetach(name=ssn.name)) + + def get_sst(self, op): + return self._sessions[op.channel] + + def do_session_detached(self, dtc): + sst = self._sessions.pop(dtc.channel) + ssn = sst.session + del self._attachments[ssn] + ssn.closed = True + + def do_session_detach(self, dtc): + sst = self.get_sst(dtc) + sst.write_op(SessionDetached(name=dtc.name)) + self.do_session_detached(dtc) + + def link(self, lnk, dir, addr): + sst = self._attachments.get(lnk.session) + _lnk = self._attachments.get(lnk) + + if _lnk is None and not lnk.closed: + _lnk = Attachment(lnk) + _lnk.closing = False + dir.init_link(sst, lnk, _lnk) + + err = self.parse_address(_lnk, dir, addr) or self.validate_options(_lnk, dir) + if err: + lnk.error = err + lnk.closed = True + return + + def linked(): + lnk.linked = True + + def resolved(type, subtype): + dir.do_link(sst, lnk, _lnk, type, subtype, linked) + + self.resolve_declare(sst, _lnk, dir.DIR_NAME, resolved) + self._attachments[lnk] = _lnk + + if lnk.linked and lnk.closing and not lnk.closed: + if not _lnk.closing: + def unlinked(): + dir.del_link(sst, lnk, _lnk) + del self._attachments[lnk] + lnk.closed = True + if _lnk.options.get("delete") in ("always", dir.DIR_NAME): + dir.do_unlink(sst, lnk, _lnk) + requested_type = _lnk.options.get("node", {}).get("type") + self.delete(sst, _lnk.name, unlinked, node_type=requested_type) + else: + dir.do_unlink(sst, lnk, _lnk, unlinked) + _lnk.closing = True + elif not lnk.linked and lnk.closing and not lnk.closed: + if lnk.error: lnk.closed = True + + def parse_address(self, lnk, dir, addr): + if addr is None: + return MalformedAddress(text="%s is None" % dir.ADDR_NAME) + else: + try: + lnk.name, lnk.subject, lnk.options = address.parse(addr) + # XXX: subject + if lnk.options is None: + lnk.options = {} + if isinstance(addr, MangledString): + lnk.options['create'] = "always" + if 'node' not in lnk.options: + lnk.options['node'] = {} + if 'x-declare' not in lnk.options['node']: + lnk.options['node']['x-declare'] = {} + xdeclare = lnk.options['node']['x-declare'] + if 'auto-delete' not in xdeclare: + xdeclare['auto-delete'] = "True" + if 'exclusive' not in xdeclare: + xdeclare['exclusive'] = "True" + except address.LexError, e: + return MalformedAddress(text=str(e)) + except address.ParseError, e: + return MalformedAddress(text=str(e)) + + def validate_options(self, lnk, dir): + ctx = Context() + err = dir.VALIDATOR.validate(lnk.options, ctx) + if err: return InvalidOption(text="error in options: %s" % err) + + def resolve_declare(self, sst, lnk, dir, action): + declare = lnk.options.get("create") in ("always", dir) + assrt = lnk.options.get("assert") in ("always", dir) + requested_type = lnk.options.get("node", {}).get("type") + def do_resolved(type, subtype): + err = None + if type is None: + if declare: + err = self.declare(sst, lnk, action, True) + else: + err = NotFound(text="no such %s: %s" % (requested_type or "queue", lnk.name)) + else: + if assrt: + expected = lnk.options.get("node", {}).get("type") + if expected and type != expected: + if declare: + err = self.declare(sst, lnk, action, True) + else: + err = AssertionFailed(text="expected %s, got %s" % (expected, type)) + if "node" in lnk.options and "x-bindings" in lnk.options["node"]: + err = self.declare(sst, lnk, action, False) + if err is None: + action(type, subtype) + + if err: + tgt = lnk.target + tgt.error = err + del self._attachments[tgt] + tgt.closed = True + return + self.resolve(sst, lnk.name, do_resolved, node_type=requested_type, force=declare) + + def resolve(self, sst, name, action, force=False, node_type=None, delete=False): + if not force and not node_type: + try: + type, subtype = self.address_cache[name] + action(type, subtype) + return + except KeyError: + pass + + args = { "topic":None, "queue":None } + def do_result(r, obj): + args[obj] = r + def do_action(): + er = args["topic"] + qr = args["queue"] + if node_type == "topic" and er and not er.not_found: + type, subtype = "topic", er.type + elif node_type == "queue" and qr and qr.queue: + type, subtype = "queue", None + elif (er and er.not_found) and qr and not qr.queue: + type, subtype = None, None + elif (qr and qr.queue): + if node_type == "topic" and force: + type, subtype = None, None + else: + type, subtype = "queue", None + elif (er and not er.not_found): + if node_type == "queue" and force: + type, subtype = None, None + else: + type, subtype = "topic", er.type + elif er: + if er.not_found: + type, subtype = None, None + else: + type, subtype = "topic", er.type + else: + type, subtype = None, None + if type is not None: + self.address_cache[name] = (type, subtype) + action(type, subtype) + def do_result_and_action(r, obj): + do_result(r, obj) + do_action() + if (node_type is None): # we don't know the type, let check broker + sst.write_query(ExchangeQuery(name), do_result, "topic") + sst.write_query(QueueQuery(name), do_result_and_action, "queue") + elif force and not delete: # we forcefully declare known type, dont ask broker + do_action() + elif node_type == "topic": + sst.write_query(ExchangeQuery(name), do_result_and_action, "topic") + else: + sst.write_query(QueueQuery(name), do_result_and_action, "queue") + + def declare(self, sst, lnk, action, create_node): + name = lnk.name + props = lnk.options.get("node", {}) + durable = props.get("durable", DURABLE_DEFAULT) + type = props.get("type", "queue") + declare = props.get("x-declare", {}) + + cmd = None + if type == "topic": + if create_node: cmd = ExchangeDeclare(exchange=name, durable=durable) + bindings = get_bindings(props, exchange=name) + elif type == "queue": + if create_node: cmd = QueueDeclare(queue=name, durable=durable) + bindings = get_bindings(props, queue=name) + else: + raise ValueError(type) + + if cmd is not None: + sst.apply_overrides(cmd, declare) + if type == "topic": + if cmd.type is None: + cmd.type = "topic" + subtype = cmd.type + else: + subtype = None + cmds = [cmd] + else: + cmds = [] + + cmds.extend(bindings) + + def declared(): + if create_node: + self.address_cache[name] = (type, subtype) + action(type, subtype) + + sst.write_cmds(cmds, declared) + + def delete(self, sst, name, action, node_type=None): + def deleted(): + del self.address_cache[name] + action() + + def do_delete(type, subtype): + if type == "topic": + sst.write_cmd(ExchangeDelete(name), deleted) + elif type == "queue": + sst.write_cmd(QueueDelete(name), deleted) + elif type is None: + action() + else: + raise ValueError(type) + self.resolve(sst, name, do_delete, force=True, node_type=node_type, delete=True) + + def process(self, ssn): + if ssn.closed or ssn.closing: return + + sst = self._attachments[ssn] + + while sst.outgoing_idx < len(ssn.outgoing): + msg = ssn.outgoing[sst.outgoing_idx] + snd = msg._sender + # XXX: should check for sender error here + _snd = self._attachments.get(snd) + if _snd and snd.linked: + self.send(snd, msg) + sst.outgoing_idx += 1 + else: + break + + for snd in ssn.senders: + # XXX: should included snd.acked in this + if snd.synced >= snd.queued and sst.need_sync: + sst.write_cmd(ExecutionSync(), sync_noop) + + for rcv in ssn.receivers: + self.process_receiver(rcv) + + if ssn.acked: + messages = ssn.acked[sst.acked_idx:] + if messages: + ids = RangedSet() + + disposed = [(DEFAULT_DISPOSITION, [])] + acked = [] + for m in messages: + # XXX: we're ignoring acks that get lost when disconnected, + # could we deal this via some message-id based purge? + if m._transfer_id is None: + acked.append(m) + continue + ids.add(m._transfer_id) + if m._receiver._accept_mode is accept_mode.explicit: + disp = m._disposition or DEFAULT_DISPOSITION + last, msgs = disposed[-1] + if disp.type is last.type and disp.options == last.options: + msgs.append(m) + else: + disposed.append((disp, [m])) + else: + acked.append(m) + + for range in ids: + sst.executed.add_range(range) + sst.write_op(SessionCompleted(sst.executed)) + + def ack_acker(msgs): + def ack_ack(): + for m in msgs: + ssn.acked.remove(m) + sst.acked_idx -= 1 + # XXX: should this check accept_mode too? + if not ssn.transactional: + sst.acked.remove(m) + return ack_ack + + for disp, msgs in disposed: + if not msgs: continue + if disp.type is None: + op = MessageAccept + elif disp.type is RELEASED: + op = MessageRelease + elif disp.type is REJECTED: + op = MessageReject + sst.write_cmd(op(RangedSet(*[m._transfer_id for m in msgs]), + **disp.options), + ack_acker(msgs)) + if log.isEnabledFor(DEBUG): + for m in msgs: + log.debug("SACK[%s]: %s, %s", ssn.log_id, m, m._disposition) + + sst.acked.extend(messages) + sst.acked_idx += len(messages) + ack_acker(acked)() + + if ssn.committing and not sst.committing: + def commit_ok(): + del sst.acked[:] + ssn.committing = False + ssn.committed = True + ssn.aborting = False + ssn.aborted = False + sst.committing = False + sst.write_cmd(TxCommit(), commit_ok) + sst.committing = True + + if ssn.aborting and not sst.aborting: + sst.aborting = True + def do_rb(): + messages = sst.acked + ssn.unacked + ssn.incoming + ids = RangedSet(*[m._transfer_id for m in messages]) + for range in ids: + sst.executed.add_range(range) + sst.write_op(SessionCompleted(sst.executed)) + sst.write_cmd(MessageRelease(ids, True)) + sst.write_cmd(TxRollback(), do_rb_ok) + + def do_rb_ok(): + del ssn.incoming[:] + del ssn.unacked[:] + del sst.acked[:] + + for rcv in ssn.receivers: + rcv.impending = rcv.received + rcv.returned = rcv.received + # XXX: do we need to update granted here as well? + + for rcv in ssn.receivers: + self.process_receiver(rcv) + + ssn.aborting = False + ssn.aborted = True + ssn.committing = False + ssn.committed = False + sst.aborting = False + + for rcv in ssn.receivers: + _rcv = self._attachments[rcv] + sst.write_cmd(MessageStop(_rcv.destination)) + sst.write_cmd(ExecutionSync(), do_rb) + + def grant(self, rcv): + sst = self._attachments[rcv.session] + _rcv = self._attachments.get(rcv) + if _rcv is None or not rcv.linked or _rcv.closing or _rcv.draining: + return + + if rcv.granted is UNLIMITED: + if rcv.impending is UNLIMITED: + delta = 0 + else: + delta = UNLIMITED + elif rcv.impending is UNLIMITED: + delta = -1 + else: + delta = max(rcv.granted, rcv.received) - rcv.impending + + if delta is UNLIMITED: + if not _rcv.bytes_open: + sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.byte, UNLIMITED.value)) + _rcv.bytes_open = True + sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.message, UNLIMITED.value)) + rcv.impending = UNLIMITED + elif delta > 0: + if not _rcv.bytes_open: + sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.byte, UNLIMITED.value)) + _rcv.bytes_open = True + sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.message, delta)) + rcv.impending += delta + elif delta < 0 and not rcv.draining: + _rcv.draining = True + def do_stop(): + rcv.impending = rcv.received + _rcv.draining = False + _rcv.bytes_open = False + self.grant(rcv) + sst.write_cmd(MessageStop(_rcv.destination), do_stop) + + if rcv.draining: + _rcv.draining = True + def do_flush(): + rcv.impending = rcv.received + rcv.granted = rcv.impending + _rcv.draining = False + _rcv.bytes_open = False + rcv.draining = False + sst.write_cmd(MessageFlush(_rcv.destination), do_flush) + + + def process_receiver(self, rcv): + if rcv.closed: return + self.grant(rcv) + + def send(self, snd, msg): + sst = self._attachments[snd.session] + _snd = self._attachments[snd] + + if msg.subject is None or _snd._exchange == "": + rk = _snd._routing_key + else: + rk = msg.subject + + if msg.subject is None: + subject = _snd.subject + else: + subject = msg.subject + + # XXX: do we need to query to figure out how to create the reply-to interoperably? + if msg.reply_to: + rt = addr2reply_to(msg.reply_to) + else: + rt = None + content_encoding = msg.properties.get("x-amqp-0-10.content-encoding") + dp = DeliveryProperties(routing_key=rk) + mp = MessageProperties(message_id=msg.id, + user_id=msg.user_id, + reply_to=rt, + correlation_id=msg.correlation_id, + app_id = msg.properties.get("x-amqp-0-10.app-id"), + content_type=msg.content_type, + content_encoding=content_encoding, + application_headers=msg.properties) + if subject is not None: + if mp.application_headers is None: + mp.application_headers = {} + mp.application_headers[SUBJECT] = subject + if msg.durable is not None: + if msg.durable: + dp.delivery_mode = delivery_mode.persistent + else: + dp.delivery_mode = delivery_mode.non_persistent + if msg.priority is not None: + dp.priority = msg.priority + if msg.ttl is not None: + dp.ttl = long(msg.ttl*1000) + enc, dec = get_codec(msg.content_type) + try: + body = enc(msg.content) + except AttributeError, e: + # convert to non-blocking EncodeError + raise EncodeError(e) + + # XXX: this is not safe for out of order, can this be triggered by pre_ack? + def msg_acked(): + # XXX: should we log the ack somehow too? + snd.acked += 1 + m = snd.session.outgoing.pop(0) + sst.outgoing_idx -= 1 + log.debug("RACK[%s]: %s", sst.session.log_id, msg) + assert msg == m + + xfr = MessageTransfer(destination=_snd._exchange, headers=(dp, mp), + payload=body) + + if _snd.pre_ack: + sst.write_cmd(xfr) + else: + sst.write_cmd(xfr, msg_acked, sync=msg._sync) + + log.debug("SENT[%s]: %s", sst.session.log_id, msg) + + if _snd.pre_ack: + msg_acked() + + def do_message_transfer(self, xfr): + sst = self.get_sst(xfr) + ssn = sst.session + + msg = self._decode(xfr) + rcv = sst.destinations[xfr.destination].target + msg._receiver = rcv + if rcv.closing or rcv.closed: # release message to a closing receiver + ids = RangedSet(*[msg._transfer_id]) + log.debug("releasing back %s message: %s, as receiver is closing", ids, msg) + sst.write_cmd(MessageRelease(ids, True)) + return + if rcv.impending is not UNLIMITED: + assert rcv.received < rcv.impending, "%s, %s" % (rcv.received, rcv.impending) + rcv.received += 1 + log.debug("RCVD[%s]: %s", ssn.log_id, msg) + ssn.message_received(msg) + + + def _decode(self, xfr): + dp = EMPTY_DP + mp = EMPTY_MP + + for h in xfr.headers: + if isinstance(h, DeliveryProperties): + dp = h + elif isinstance(h, MessageProperties): + mp = h + + ap = mp.application_headers + enc, dec = get_codec(mp.content_type) + try: + content = dec(xfr.payload) + except Exception, e: + raise DecodeError(e) + msg = Message(content) + msg.id = mp.message_id + if ap is not None: + msg.subject = ap.get(SUBJECT) + msg.user_id = mp.user_id + if mp.reply_to is not None: + msg.reply_to = reply_to2addr(mp.reply_to) + msg.correlation_id = mp.correlation_id + if dp.delivery_mode is not None: + msg.durable = dp.delivery_mode == delivery_mode.persistent + msg.priority = dp.priority + if dp.ttl is not None: + msg.ttl = dp.ttl/1000.0 + msg.redelivered = dp.redelivered + msg.properties = mp.application_headers or {} + if mp.app_id is not None: + msg.properties["x-amqp-0-10.app-id"] = mp.app_id + if mp.content_encoding is not None: + msg.properties["x-amqp-0-10.content-encoding"] = mp.content_encoding + if dp.routing_key is not None: + msg.properties["x-amqp-0-10.routing-key"] = dp.routing_key + if dp.timestamp is not None: + msg.properties["x-amqp-0-10.timestamp"] = dp.timestamp + msg.content_type = mp.content_type + msg._transfer_id = xfr.id + return msg diff --git a/qpid/python/qpid/messaging/endpoints.py b/qpid/python/qpid/messaging/endpoints.py new file mode 100644 index 0000000000..2797677b1d --- /dev/null +++ b/qpid/python/qpid/messaging/endpoints.py @@ -0,0 +1,1118 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +A candidate high level messaging API for python. + +Areas that still need work: + + - definition of the arguments for L{Session.sender} and L{Session.receiver} + - standard L{Message} properties + - L{Message} content encoding + - protocol negotiation/multiprotocol impl +""" + +from logging import getLogger +from math import ceil +from qpid.codec010 import StringCodec +from qpid.concurrency import synchronized, Waiter, Condition +from qpid.datatypes import Serial, uuid4 +from qpid.messaging.constants import * +from qpid.messaging.exceptions import * +from qpid.messaging.message import * +from qpid.ops import PRIMITIVE +from qpid.util import default, URL +from threading import Thread, RLock + +log = getLogger("qpid.messaging") + +static = staticmethod + +class Endpoint: + + def _ecwait(self, predicate, timeout=None): + result = self._ewait(lambda: self.closed or predicate(), timeout) + self.check_closed() + return result + +class Connection(Endpoint): + + """ + A Connection manages a group of L{Sessions<Session>} and connects + them with a remote endpoint. + """ + + @static + def establish(url=None, timeout=None, **options): + """ + Constructs a L{Connection} with the supplied parameters and opens + it. + """ + conn = Connection(url, **options) + conn.open(timeout=timeout) + return conn + + def __init__(self, url=None, **options): + """ + Creates a connection. A newly created connection must be opened + with the Connection.open() method before it can be used. + + @type url: str + @param url: [ <username> [ / <password> ] @ ] <host> [ : <port> ] + @type host: str + @param host: the name or ip address of the remote host (overriden by url) + @type port: int + @param port: the port number of the remote host (overriden by url) + @type transport: str + @param transport: one of tcp, tcp+tls, or ssl (alias for tcp+tls) + @type heartbeat: int + @param heartbeat: heartbeat interval in seconds + + @type username: str + @param username: the username for authentication (overriden by url) + @type password: str + @param password: the password for authentication (overriden by url) + @type sasl_mechanisms: str + @param sasl_mechanisms: space separated list of permitted sasl mechanisms + @type sasl_service: str + @param sasl_service: the service name if needed by the SASL mechanism in use + @type sasl_min_ssf: int + @param sasl_min_ssf: the minimum acceptable security strength factor + @type sasl_max_ssf: int + @param sasl_max_ssf: the maximum acceptable security strength factor + + @type reconnect: bool + @param reconnect: enable/disable automatic reconnect + @type reconnect_timeout: float + @param reconnect_timeout: total time to attempt reconnect + @type reconnect_interval_min: float + @param reconnect_interval_min: minimum interval between reconnect attempts + @type reconnect_interval_max: float + @param reconnect_interval_max: maximum interval between reconnect attempts + @type reconnect_interval: float + @param reconnect_interval: set both min and max reconnect intervals + @type reconnect_limit: int + @param reconnect_limit: limit the total number of reconnect attempts + @type reconnect_urls: list[str] + @param reconnect_urls: list of backup hosts specified as urls + + @type address_ttl: float + @param address_ttl: time until cached address resolution expires + + @type ssl_keyfile: str + @param ssl_keyfile: file with client's private key (PEM format) + @type ssl_certfile: str + @param ssl_certfile: file with client's public (eventually priv+pub) key (PEM format) + @type ssl_trustfile: str + @param ssl_trustfile: file trusted certificates to validate the server + @type ssl_skip_hostname_check: bool + @param ssl_skip_hostname_check: disable verification of hostname in + certificate. Use with caution - disabling hostname checking leaves you + vulnerable to Man-in-the-Middle attacks. + + @rtype: Connection + @return: a disconnected Connection + """ + # List of all attributes + opt_keys = ['host', 'transport', 'port', 'heartbeat', 'username', 'password', 'sasl_mechanisms', 'sasl_service', 'sasl_min_ssf', 'sasl_max_ssf', 'reconnect', 'reconnect_timeout', 'reconnect_interval', 'reconnect_interval_min', 'reconnect_interval_max', 'reconnect_limit', 'reconnect_urls', 'reconnect_log', 'address_ttl', 'tcp_nodelay', 'ssl_keyfile', 'ssl_certfile', 'ssl_trustfile', 'ssl_skip_hostname_check', 'client_properties', 'protocol' ] + # Create all attributes on self and set to None. + for key in opt_keys: + setattr(self, key, None) + # Get values from options, check for invalid options + for (key, value) in options.iteritems(): + if key in opt_keys: + setattr(self, key, value) + else: + raise ConnectionError("Unknown connection option %s with value %s" %(key, value)) + + # Now handle items that need special treatment or have speical defaults: + if self.host: + url = default(url, self.host) + if isinstance(url, basestring): + url = URL(url) + self.host = url.host + + if self.transport is None: + if url.scheme == url.AMQP: + self.transport = "tcp" + elif url.scheme == url.AMQPS: + self.transport = "ssl" + else: + self.transport = "tcp" + if self.transport in ("ssl", "tcp+tls"): + self.port = default(url.port, default(self.port, AMQPS_PORT)) + else: + self.port = default(url.port, default(self.port, AMQP_PORT)) + + if self.protocol and self.protocol != "amqp0-10": + raise ConnectionError("Connection option 'protocol' value '" + value + "' unsupported (must be amqp0-10)") + + self.username = default(url.user, self.username) + self.password = default(url.password, self.password) + self.auth_username = None + self.sasl_service = default(self.sasl_service, "qpidd") + + self.reconnect = default(self.reconnect, False) + self.reconnect_interval_min = default(self.reconnect_interval_min, + default(self.reconnect_interval, 1)) + self.reconnect_interval_max = default(self.reconnect_interval_max, + default(self.reconnect_interval, 2*60)) + self.reconnect_urls = default(self.reconnect_urls, []) + self.reconnect_log = default(self.reconnect_log, True) + + self.address_ttl = default(self.address_ttl, 60) + self.tcp_nodelay = default(self.tcp_nodelay, False) + + self.ssl_keyfile = default(self.ssl_keyfile, None) + self.ssl_certfile = default(self.ssl_certfile, None) + self.ssl_trustfile = default(self.ssl_trustfile, None) + # if ssl_skip_hostname_check was not explicitly set, this will be None + self._ssl_skip_hostname_check_actual = options.get("ssl_skip_hostname_check") + self.ssl_skip_hostname_check = default(self.ssl_skip_hostname_check, False) + self.client_properties = default(self.client_properties, {}) + + self.options = options + + + self.id = str(uuid4()) + self.session_counter = 0 + self.sessions = {} + self._open = False + self._connected = False + self._transport_connected = False + self._lock = RLock() + self._condition = Condition(self._lock) + self._waiter = Waiter(self._condition) + self._modcount = Serial(0) + self.error = None + from driver import Driver + self._driver = Driver(self) + + def _wait(self, predicate, timeout=None): + return self._waiter.wait(predicate, timeout=timeout) + + def _wakeup(self): + self._modcount += 1 + self._driver.wakeup() + + def check_error(self): + if self.error: + self._condition.gc() + e = self.error + if isinstance(e, ContentError): + """ forget the content error. It will be + raised this time but won't block future calls + """ + self.error = None + raise e + + def get_error(self): + return self.error + + def _ewait(self, predicate, timeout=None): + result = self._wait(lambda: self.error or predicate(), timeout) + self.check_error() + return result + + def check_closed(self): + if not self._connected: + self._condition.gc() + raise ConnectionClosed() + + @synchronized + def session(self, name=None, transactional=False): + """ + Creates or retrieves the named session. If the name is omitted or + None, then a unique name is chosen based on a randomly generated + uuid. + + @type name: str + @param name: the session name + @rtype: Session + @return: the named Session + """ + + if name is None: + name = "%s:%s" % (self.id, self.session_counter) + self.session_counter += 1 + else: + name = "%s:%s" % (self.id, name) + + if self.sessions.has_key(name): + return self.sessions[name] + else: + ssn = Session(self, name, transactional) + self.sessions[name] = ssn + self._wakeup() + return ssn + + @synchronized + def _remove_session(self, ssn): + self.sessions.pop(ssn.name, 0) + + @synchronized + def open(self, timeout=None): + """ + Opens a connection. + """ + if self._open: + raise ConnectionError("already open") + self._open = True + if self.reconnect and self.reconnect_timeout > 0: + timeout = self.reconnect_timeout + self.attach(timeout=timeout) + + @synchronized + def opened(self): + """ + Return true if the connection is open, false otherwise. + """ + return self._open + + @synchronized + def attach(self, timeout=None): + """ + Attach to the remote endpoint. + """ + if not self._connected: + self._connected = True + self._driver.start() + self._wakeup() + if not self._ewait(lambda: self._transport_connected and not self._unlinked(), timeout=timeout): + self.reconnect = False + raise Timeout("Connection attach timed out") + + def _unlinked(self): + return [l + for ssn in self.sessions.values() + if not (ssn.error or ssn.closed) + for l in ssn.senders + ssn.receivers + if not (l.linked or l.error or l.closed)] + + @synchronized + def detach(self, timeout=None): + """ + Detach from the remote endpoint. + """ + if self._connected: + self._connected = False + self._wakeup() + cleanup = True + else: + cleanup = False + try: + if not self._wait(lambda: not self._transport_connected, timeout=timeout): + raise Timeout("detach timed out") + finally: + if cleanup: + self._driver.stop() + self._condition.gc() + + @synchronized + def attached(self): + """ + Return true if the connection is attached, false otherwise. + """ + return self._connected + + @synchronized + def close(self, timeout=None): + """ + Close the connection and all sessions. + """ + try: + for ssn in self.sessions.values(): + ssn.close(timeout=timeout) + finally: + self.detach(timeout=timeout) + self._open = False + +class Session(Endpoint): + + """ + Sessions provide a linear context for sending and receiving + L{Messages<Message>}. L{Messages<Message>} are sent and received + using the L{Sender.send} and L{Receiver.fetch} methods of the + L{Sender} and L{Receiver} objects associated with a Session. + + Each L{Sender} and L{Receiver} is created by supplying either a + target or source address to the L{sender} and L{receiver} methods of + the Session. The address is supplied via a string syntax documented + below. + + Addresses + ========= + + An address identifies a source or target for messages. In its + simplest form this is just a name. In general a target address may + also be used as a source address, however not all source addresses + may be used as a target, e.g. a source might additionally have some + filtering criteria that would not be present in a target. + + A subject may optionally be specified along with the name. When an + address is used as a target, any subject specified in the address is + used as the default subject of outgoing messages for that target. + When an address is used as a source, any subject specified in the + address is pattern matched against the subject of available messages + as a filter for incoming messages from that source. + + The options map contains additional information about the address + including: + + - policies for automatically creating, and deleting the node to + which an address refers + + - policies for asserting facts about the node to which an address + refers + + - extension points that can be used for sender/receiver + configuration + + Mapping to AMQP 0-10 + -------------------- + The name is resolved to either an exchange or a queue by querying + the broker. + + The subject is set as a property on the message. Additionally, if + the name refers to an exchange, the routing key is set to the + subject. + + Syntax + ------ + The following regular expressions define the tokens used to parse + addresses:: + LBRACE: \\{ + RBRACE: \\} + LBRACK: \\[ + RBRACK: \\] + COLON: : + SEMI: ; + SLASH: / + COMMA: , + NUMBER: [+-]?[0-9]*\\.?[0-9]+ + ID: [a-zA-Z_](?:[a-zA-Z0-9_-]*[a-zA-Z0-9_])? + STRING: "(?:[^\\\\"]|\\\\.)*"|\'(?:[^\\\\\']|\\\\.)*\' + ESC: \\\\[^ux]|\\\\x[0-9a-fA-F][0-9a-fA-F]|\\\\u[0-9a-fA-F][0-9a-fA-F][0-9a-fA-F][0-9a-fA-F] + SYM: [.#*%@$^!+-] + WSPACE: [ \\n\\r\\t]+ + + The formal grammar for addresses is given below:: + address = name [ "/" subject ] [ ";" options ] + name = ( part | quoted )+ + subject = ( part | quoted | "/" )* + quoted = STRING / ESC + part = LBRACE / RBRACE / COLON / COMMA / NUMBER / ID / SYM + options = map + map = "{" ( keyval ( "," keyval )* )? "}" + keyval = ID ":" value + value = NUMBER / STRING / ID / map / list + list = "[" ( value ( "," value )* )? "]" + + This grammar resuls in the following informal syntax:: + + <name> [ / <subject> ] [ ; <options> ] + + Where options is:: + + { <key> : <value>, ... } + + And values may be: + - numbers + - single, double, or non quoted strings + - maps (dictionaries) + - lists + + Options + ------- + The options map permits the following parameters:: + + <name> [ / <subject> ] ; { + create: always | sender | receiver | never, + delete: always | sender | receiver | never, + assert: always | sender | receiver | never, + mode: browse | consume, + node: { + type: queue | topic, + durable: True | False, + x-declare: { ... <declare-overrides> ... }, + x-bindings: [<binding_1>, ... <binding_n>] + }, + link: { + name: <link-name>, + durable: True | False, + reliability: unreliable | at-most-once | at-least-once | exactly-once, + x-declare: { ... <declare-overrides> ... }, + x-bindings: [<binding_1>, ... <binding_n>], + x-subscribe: { ... <subscribe-overrides> ... } + } + } + + Bindings are specified as a map with the following options:: + + { + exchange: <exchange>, + queue: <queue>, + key: <key>, + arguments: <arguments> + } + + The create, delete, and assert policies specify who should perfom + the associated action: + + - I{always}: the action will always be performed + - I{sender}: the action will only be performed by the sender + - I{receiver}: the action will only be performed by the receiver + - I{never}: the action will never be performed (this is the default) + + The node-type is one of: + + - I{topic}: a topic node will default to the topic exchange, + x-declare may be used to specify other exchange types + - I{queue}: this is the default node-type + + The x-declare map permits protocol specific keys and values to be + specified when exchanges or queues are declared. These keys and + values are passed through when creating a node or asserting facts + about an existing node. + + Examples + -------- + A simple name resolves to any named node, usually a queue or a + topic:: + + my-queue-or-topic + + A simple name with a subject will also resolve to a node, but the + presence of the subject will cause a sender using this address to + set the subject on outgoing messages, and receivers to filter based + on the subject:: + + my-queue-or-topic/my-subject + + A subject pattern can be used and will cause filtering if used by + the receiver. If used for a sender, the literal value gets set as + the subject:: + + my-queue-or-topic/my-* + + In all the above cases, the address is resolved to an existing node. + If you want the node to be auto-created, then you can do the + following. By default nonexistent nodes are assumed to be queues:: + + my-queue; {create: always} + + You can customize the properties of the queue:: + + my-queue; {create: always, node: {durable: True}} + + You can create a topic instead if you want:: + + my-queue; {create: always, node: {type: topic}} + + You can assert that the address resolves to a node with particular + properties:: + + my-transient-topic; { + assert: always, + node: { + type: topic, + durable: False + } + } + """ + + def __init__(self, connection, name, transactional): + self.connection = connection + self.name = name + self.log_id = "%x" % id(self) + + self.transactional = transactional + + self.committing = False + self.committed = True + self.aborting = False + self.aborted = False + + self.next_sender_id = 0 + self.senders = [] + self.next_receiver_id = 0 + self.receivers = [] + self.outgoing = [] + self.incoming = [] + self.unacked = [] + self.acked = [] + # XXX: I hate this name. + self.ack_capacity = UNLIMITED + + self.error = None + self.closing = False + self.closed = False + + self._lock = connection._lock + self._msg_received = None + + def __repr__(self): + return "<Session %s>" % self.name + + def _wait(self, predicate, timeout=None): + return self.connection._wait(predicate, timeout=timeout) + + def _wakeup(self): + self.connection._wakeup() + + def check_error(self): + self.connection.check_error() + if self.error: + raise self.error + + def get_error(self): + err = self.connection.get_error() + if err: + return err + else: + return self.error + + def _ewait(self, predicate, timeout=None): + result = self.connection._ewait(lambda: self.error or predicate(), timeout) + self.check_error() + return result + + def check_closed(self): + if self.closed: + raise SessionClosed() + + def message_received(self, msg): + self.incoming.append(msg) + if self._msg_received: + self._msg_received() + + @synchronized + def sender(self, target, **options): + """ + Creates a L{Sender} that may be used to send L{Messages<Message>} + to the specified target. + + @type target: str + @param target: the target to which messages will be sent + @rtype: Sender + @return: a new Sender for the specified target + """ + target = _mangle(target) + sender = Sender(self, self.next_sender_id, target, options) + self.next_sender_id += 1 + self.senders.append(sender) + if not self.closed and self.connection._connected: + self._wakeup() + try: + sender._ewait(lambda: sender.linked) + except LinkError, e: + sender.close() + raise e + return sender + + @synchronized + def receiver(self, source, **options): + """ + Creates a receiver that may be used to fetch L{Messages<Message>} + from the specified source. + + @type source: str + @param source: the source of L{Messages<Message>} + @rtype: Receiver + @return: a new Receiver for the specified source + """ + source = _mangle(source) + receiver = Receiver(self, self.next_receiver_id, source, options) + self.next_receiver_id += 1 + self.receivers.append(receiver) + if not self.closed and self.connection._connected: + self._wakeup() + try: + receiver._ewait(lambda: receiver.linked) + except LinkError, e: + receiver.close() + raise e + return receiver + + @synchronized + def _count(self, predicate): + result = 0 + for msg in self.incoming: + if predicate(msg): + result += 1 + return result + + def _peek(self, receiver): + for msg in self.incoming: + if msg._receiver == receiver: + return msg + + def _pop(self, receiver): + i = 0 + while i < len(self.incoming): + msg = self.incoming[i] + if msg._receiver == receiver: + del self.incoming[i] + return msg + else: + i += 1 + + @synchronized + def _get(self, receiver, timeout=None): + if self._ewait(lambda: ((self._peek(receiver) is not None) or + self.closing or receiver.closed), + timeout): + msg = self._pop(receiver) + if msg is not None: + msg._receiver.returned += 1 + self.unacked.append(msg) + log.debug("RETR[%s]: %s", self.log_id, msg) + return msg + return None + + @synchronized + def set_message_received_handler(self, handler): + """Register a callback that will be invoked when a message arrives on the + session. Use with caution: since this callback is invoked in the context + of the driver thread, it is not safe to call any of the public messaging + APIs from within this callback. The intent of the handler is to provide + an efficient way to notify the application that a message has arrived. + This can be useful for those applications that need to schedule a task + to poll for received messages without blocking in the messaging API. + """ + self._msg_received = handler + + @synchronized + def next_receiver(self, timeout=None): + if self._ecwait(lambda: self.incoming, timeout): + return self.incoming[0]._receiver + else: + raise Empty + + @synchronized + def acknowledge(self, message=None, disposition=None, sync=True): + """ + Acknowledge the given L{Message}. If message is None, then all + unacknowledged messages on the session are acknowledged. + + @type message: Message + @param message: the message to acknowledge or None + @type sync: boolean + @param sync: if true then block until the message(s) are acknowledged + """ + if message is None: + messages = self.unacked[:] + else: + messages = [message] + + for m in messages: + if self.ack_capacity is not UNLIMITED: + if self.ack_capacity <= 0: + # XXX: this is currently a SendError, maybe it should be a SessionError? + raise InsufficientCapacity("ack_capacity = %s" % self.ack_capacity) + self._wakeup() + self._ecwait(lambda: len(self.acked) < self.ack_capacity) + m._disposition = disposition + self.unacked.remove(m) + self.acked.append(m) + + self._wakeup() + if sync: + self._ecwait(lambda: not [m for m in messages if m in self.acked]) + + @synchronized + def commit(self, timeout=None): + """ + Commit outstanding transactional work. This consists of all + message sends and receives since the prior commit or rollback. + """ + if not self.transactional: + raise NontransactionalSession() + self.committing = True + self._wakeup() + try: + if not self._ecwait(lambda: not self.committing, timeout=timeout): + raise Timeout("commit timed out") + except TransactionError: + raise + except Exception, e: + self.error = TransactionAborted(text="Transaction aborted: %s"%e) + raise self.error + if self.aborted: + raise TransactionAborted() + assert self.committed + + @synchronized + def rollback(self, timeout=None): + """ + Rollback outstanding transactional work. This consists of all + message sends and receives since the prior commit or rollback. + """ + if not self.transactional: + raise NontransactionalSession() + self.aborting = True + self._wakeup() + if not self._ecwait(lambda: not self.aborting, timeout=timeout): + raise Timeout("rollback timed out") + assert self.aborted + + @synchronized + def sync(self, timeout=None): + """ + Sync the session. + """ + for snd in self.senders: + snd.sync(timeout=timeout) + if not self._ewait(lambda: not self.outgoing and not self.acked, timeout=timeout): + raise Timeout("session sync timed out") + + @synchronized + def close(self, timeout=None): + """ + Close the session. + """ + if self.error: return + self.sync(timeout=timeout) + + for link in self.receivers + self.senders: + link.close(timeout=timeout) + + if not self.closing: + self.closing = True + self._wakeup() + + try: + if not self._ewait(lambda: self.closed, timeout=timeout): + raise Timeout("session close timed out") + finally: + self.connection._remove_session(self) + +class MangledString(str): pass + +def _mangle(addr): + if addr and addr.startswith("#"): + return MangledString(str(uuid4()) + addr) + else: + return addr + +class Sender(Endpoint): + + """ + Sends outgoing messages. + """ + + def __init__(self, session, id, target, options): + self.session = session + self.id = id + self.target = target + self.options = options + self.capacity = options.get("capacity", UNLIMITED) + self.threshold = 0.5 + self.durable = options.get("durable") + self.queued = Serial(0) + self.synced = Serial(0) + self.acked = Serial(0) + self.error = None + self.linked = False + self.closing = False + self.closed = False + self._lock = self.session._lock + + def _wakeup(self): + self.session._wakeup() + + def check_error(self): + self.session.check_error() + if self.error: + raise self.error + + def get_error(self): + err = self.session.get_error() + if err: + return err + else: + return self.error + + def _ewait(self, predicate, timeout=None): + result = self.session._ewait(lambda: self.error or predicate(), timeout) + self.check_error() + return result + + def check_closed(self): + if self.closed: + raise LinkClosed() + + @synchronized + def unsettled(self): + """ + Returns the number of messages awaiting acknowledgment. + @rtype: int + @return: the number of unacknowledged messages + """ + return self.queued - self.acked + + @synchronized + def available(self): + if self.capacity is UNLIMITED: + return UNLIMITED + else: + return self.capacity - self.unsettled() + + @synchronized + def send(self, object, sync=True, timeout=None): + """ + Send a message. If the object passed in is of type L{unicode}, + L{str}, L{list}, or L{dict}, it will automatically be wrapped in a + L{Message} and sent. If it is of type L{Message}, it will be sent + directly. If the sender capacity is not L{UNLIMITED} then send + will block until there is available capacity to send the message. + If the timeout parameter is specified, then send will throw an + L{InsufficientCapacity} exception if capacity does not become + available within the specified time. + + @type object: unicode, str, list, dict, Message + @param object: the message or content to send + + @type sync: boolean + @param sync: if true then block until the message is sent + + @type timeout: float + @param timeout: the time to wait for available capacity + """ + + if not self.session.connection._connected or self.session.closing: + raise Detached() + + self._ecwait(lambda: self.linked, timeout=timeout) + + if isinstance(object, Message): + message = object + else: + message = Message(object) + + if message.durable is None: + message.durable = self.durable + + if self.capacity is not UNLIMITED: + if self.capacity <= 0: + raise InsufficientCapacity("capacity = %s" % self.capacity) + if not self._ecwait(self.available, timeout=timeout): + raise InsufficientCapacity("capacity = %s" % self.capacity) + + # XXX: what if we send the same message to multiple senders? + message._sender = self + if self.capacity is not UNLIMITED: + message._sync = sync or self.available() <= int(ceil(self.threshold*self.capacity)) + else: + message._sync = sync + self.session.outgoing.append(message) + self.queued += 1 + + if sync: + self.sync(timeout=timeout) + assert message not in self.session.outgoing + else: + self._wakeup() + + @synchronized + def sync(self, timeout=None): + mno = self.queued + if self.synced < mno: + self.synced = mno + self._wakeup() + try: + if not self._ewait(lambda: self.acked >= mno, timeout=timeout): + raise Timeout("sender sync timed out") + except ContentError: + # clean bad message so we can continue + self.acked = mno + self.session.outgoing.pop(0) + raise + + @synchronized + def close(self, timeout=None): + """ + Close the Sender. + """ + # avoid erroring out when closing a sender that was never + # established + if self.acked < self.queued: + self.sync(timeout=timeout) + + if not self.closing: + self.closing = True + self._wakeup() + + try: + if not self.session._ewait(lambda: self.closed, timeout=timeout): + raise Timeout("sender close timed out") + finally: + try: + self.session.senders.remove(self) + except ValueError: + pass + +class Receiver(Endpoint, object): + + """ + Receives incoming messages from a remote source. Messages may be + fetched with L{fetch}. + """ + + def __init__(self, session, id, source, options): + self.session = session + self.id = id + self.source = source + self.options = options + + self.granted = Serial(0) + self.draining = False + self.impending = Serial(0) + self.received = Serial(0) + self.returned = Serial(0) + + self.error = None + self.linked = False + self.closing = False + self.closed = False + self._lock = self.session._lock + self._capacity = 0 + self._set_capacity(options.get("capacity", 0), False) + self.threshold = 0.5 + + @synchronized + def _set_capacity(self, c, wakeup=True): + if c is UNLIMITED: + self._capacity = c.value + else: + self._capacity = c + self._grant() + if wakeup: + self._wakeup() + + def _get_capacity(self): + if self._capacity == UNLIMITED.value: + return UNLIMITED + else: + return self._capacity + + capacity = property(_get_capacity, _set_capacity) + + def _wakeup(self): + self.session._wakeup() + + def check_error(self): + self.session.check_error() + if self.error: + raise self.error + + def get_error(self): + err = self.session.get_error() + if err: + return err + else: + return self.error + + def _ewait(self, predicate, timeout=None): + result = self.session._ewait(lambda: self.error or predicate(), timeout) + self.check_error() + return result + + def check_closed(self): + if self.closed: + raise LinkClosed() + + @synchronized + def unsettled(self): + """ + Returns the number of acknowledged messages awaiting confirmation. + """ + return len([m for m in self.session.acked if m._receiver is self]) + + @synchronized + def available(self): + """ + Returns the number of messages available to be fetched by the + application. + + @rtype: int + @return: the number of available messages + """ + return self.received - self.returned + + @synchronized + def fetch(self, timeout=None): + """ + Fetch and return a single message. A timeout of None will block + forever waiting for a message to arrive, a timeout of zero will + return immediately if no messages are available. + + @type timeout: float + @param timeout: the time to wait for a message to be available + """ + + self._ecwait(lambda: self.linked) + + if self._capacity == 0: + self.granted = self.returned + 1 + self._wakeup() + self._ecwait(lambda: self.impending >= self.granted) + msg = self.session._get(self, timeout=timeout) + if msg is None: + self.check_closed() + self.draining = True + self._wakeup() + self._ecwait(lambda: not self.draining) + msg = self.session._get(self, timeout=0) + self._grant() + self._wakeup() + if msg is None: + raise Empty() + elif self._capacity not in (0, UNLIMITED.value): + t = int(ceil(self.threshold * self._capacity)) + if self.received - self.returned <= t: + self.granted = self.returned + self._capacity + self._wakeup() + return msg + + def _grant(self): + if self._capacity == UNLIMITED.value: + self.granted = UNLIMITED + else: + self.granted = self.returned + self._capacity + + @synchronized + def close(self, timeout=None): + """ + Close the receiver. + """ + if not self.closing: + self.closing = True + self._wakeup() + + try: + if not self.session._ewait(lambda: self.closed, timeout=timeout): + raise Timeout("receiver close timed out") + finally: + try: + self.session.receivers.remove(self) + except ValueError: + pass + +__all__ = ["Connection", "Session", "Sender", "Receiver"] diff --git a/qpid/python/qpid/messaging/exceptions.py b/qpid/python/qpid/messaging/exceptions.py new file mode 100644 index 0000000000..2284d7cde9 --- /dev/null +++ b/qpid/python/qpid/messaging/exceptions.py @@ -0,0 +1,179 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +class Timeout(Exception): + pass + +## Messaging Errors + +class MessagingError(Exception): + + def __init__(self, code=None, text=None, **info): + self.code = code + self.text = text + self.info = info + if self.code is None: + msg = self.text + else: + msg = "%s(%s)" % (self.text, self.code) + if info: + msg += " " + ", ".join(["%s=%r" % (k, v) for k, v in self.info.items()]) + Exception.__init__(self, msg) +class InternalError(MessagingError): + pass + +## Connection Errors + +class ConnectionError(MessagingError): + """ + The base class for all connection related exceptions. + """ + pass + +class ConnectError(ConnectionError): + """ + Exception raised when there is an error connecting to the remote + peer. + """ + pass + +class VersionError(ConnectError): + pass + +class AuthenticationFailure(ConnectError): + pass + +class ConnectionClosed(ConnectionError): + pass + +class HeartbeatTimeout(ConnectionError): + pass + +## Session Errors + +class SessionError(MessagingError): + pass + +class Detached(SessionError): + """ + Exception raised when an operation is attempted that is illegal when + detached. + """ + pass + +class NontransactionalSession(SessionError): + """ + Exception raised when commit or rollback is attempted on a non + transactional session. + """ + pass + +class TransactionError(SessionError): + """Base class for transactional errors""" + pass + +class TransactionAborted(TransactionError): + """The transaction was automatically rolled back. This could be due to an error + on the broker, such as a store failure, or a connection failure during the + transaction""" + pass + +class TransactionUnknown(TransactionError): + """ The outcome of the transaction on the broker (commit or roll-back) is not + known. This occurs when the connection fails after we sent the commit but + before we received a response.""" + pass + +class UnauthorizedAccess(SessionError): + pass + +class ServerError(SessionError): + pass + +class SessionClosed(SessionError): + pass + +## Link Errors + +class LinkError(MessagingError): + pass + +class InsufficientCapacity(LinkError): + pass + +class AddressError(LinkError): + pass + +class MalformedAddress(AddressError): + pass + +class InvalidOption(AddressError): + pass + +class ResolutionError(AddressError): + pass + +class AssertionFailed(ResolutionError): + pass + +class NotFound(ResolutionError): + pass + +class LinkClosed(LinkError): + pass + +## Sender Errors + +class SenderError(LinkError): + pass + +class SendError(SenderError): + pass + +class TargetCapacityExceeded(SendError): + pass + +## Receiver Errors + +class ReceiverError(LinkError): + pass + +class FetchError(ReceiverError): + pass + +class Empty(FetchError): + """ + Exception raised by L{Receiver.fetch} when there is no message + available within the alloted time. + """ + pass + +## Message Content errors +class ContentError(MessagingError): + """ + This type of exception will be returned to the application + once, and will not block further requests + """ + pass + +class EncodeError(ContentError): + pass + +class DecodeError(ContentError): + pass diff --git a/qpid/python/qpid/messaging/message.py b/qpid/python/qpid/messaging/message.py new file mode 100644 index 0000000000..b70b365c16 --- /dev/null +++ b/qpid/python/qpid/messaging/message.py @@ -0,0 +1,173 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from qpid.codec010 import StringCodec +from qpid.ops import PRIMITIVE + +def codec(name): + type = PRIMITIVE[name] + + def encode(x): + sc = StringCodec() + sc.write_primitive(type, x) + return sc.encoded + + def decode(x): + sc = StringCodec(x) + return sc.read_primitive(type) + + return encode, decode + +# XXX: need to correctly parse the mime type and deal with +# content-encoding header + +TYPE_MAPPINGS={ + dict: "amqp/map", + list: "amqp/list", + unicode: "text/plain; charset=utf8", + unicode: "text/plain", + buffer: None, + str: None, + None.__class__: None + } + +DEFAULT_CODEC = (lambda x: x, lambda x: x) + +def encode_text_plain(x): + if x is None: + return None + else: + return x.encode("utf8") + +def decode_text_plain(x): + if x is None: + return None + else: + return x.decode("utf8") + +TYPE_CODEC={ + "amqp/map": codec("map"), + "amqp/list": codec("list"), + "text/plain; charset=utf8": (encode_text_plain, decode_text_plain), + "text/plain": (encode_text_plain, decode_text_plain), + "": DEFAULT_CODEC, + None: DEFAULT_CODEC + } + +def get_type(content): + return TYPE_MAPPINGS[content.__class__] + +def get_codec(content_type): + return TYPE_CODEC.get(content_type, DEFAULT_CODEC) + +UNSPECIFIED = object() + +class Message: + + """ + A message consists of a standard set of fields, an application + defined set of properties, and some content. + + @type id: str + @ivar id: the message id + @type subject: str + @ivar subject: message subject + @type user_id: str + @ivar user_id: the user-id of the message producer + @type reply_to: str + @ivar reply_to: the address to send replies + @type correlation_id: str + @ivar correlation_id: a correlation-id for the message + @type durable: bool + @ivar durable: message durability + @type priority: int + @ivar priority: message priority + @type ttl: float + @ivar ttl: time-to-live measured in seconds + @type properties: dict + @ivar properties: application specific message properties + @type content_type: str + @ivar content_type: the content-type of the message + @type content: str, unicode, buffer, dict, list + @ivar content: the message content + """ + + def __init__(self, content=None, content_type=UNSPECIFIED, id=None, + subject=None, user_id=None, reply_to=None, correlation_id=None, + durable=None, priority=None, ttl=None, properties=None): + """ + Construct a new message with the supplied content. The + content-type of the message will be automatically inferred from + type of the content parameter. + + @type content: str, unicode, buffer, dict, list + @param content: the message content + + @type content_type: str + @param content_type: the content-type of the message + """ + self.id = id + self.subject = subject + self.user_id = user_id + self.reply_to = reply_to + self.correlation_id = correlation_id + self.durable = durable + self.priority = priority + self.ttl = ttl + self.redelivered = False + if properties is None: + self.properties = {} + else: + self.properties = properties + if content_type is UNSPECIFIED: + self.content_type = get_type(content) + else: + self.content_type = content_type + self.content = content + + def __repr__(self): + args = [] + for name in ["id", "subject", "user_id", "reply_to", "correlation_id", + "priority", "ttl"]: + value = self.__dict__[name] + if value is not None: args.append("%s=%r" % (name, value)) + for name in ["durable", "redelivered", "properties"]: + value = self.__dict__[name] + if value: args.append("%s=%r" % (name, value)) + if self.content_type != get_type(self.content): + args.append("content_type=%r" % self.content_type) + if self.content is not None: + if args: + args.append("content=%r" % self.content) + else: + args.append(repr(self.content)) + return "Message(%s)" % ", ".join(args) + +class Disposition: + + def __init__(self, type, **options): + self.type = type + self.options = options + + def __repr__(self): + args = [str(self.type)] + \ + ["%s=%r" % (k, v) for k, v in self.options.items()] + return "Disposition(%s)" % ", ".join(args) + +__all__ = ["Message", "Disposition"] diff --git a/qpid/python/qpid/messaging/transports.py b/qpid/python/qpid/messaging/transports.py new file mode 100644 index 0000000000..f39c256d02 --- /dev/null +++ b/qpid/python/qpid/messaging/transports.py @@ -0,0 +1,235 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import socket +from qpid.util import connect + +TRANSPORTS = {} + +class SocketTransport: + + def __init__(self, conn, host, port): + self.socket = connect(host, port) + if conn.tcp_nodelay: + self.socket.setsockopt(socket.IPPROTO_TCP, socket.TCP_NODELAY, 1) + + def fileno(self): + return self.socket.fileno() + +class tcp(SocketTransport): + + def reading(self, reading): + return reading + + def writing(self, writing): + return writing + + def send(self, bytes): + return self.socket.send(bytes) + + def recv(self, n): + return self.socket.recv(n) + + def close(self): + self.socket.close() + +TRANSPORTS["tcp"] = tcp + +try: + from ssl import wrap_socket, SSLError, SSL_ERROR_WANT_READ, \ + SSL_ERROR_WANT_WRITE, CERT_REQUIRED, CERT_NONE +except ImportError: + + ## try the older python SSL api: + from socket import ssl + + class old_ssl(SocketTransport): + def __init__(self, conn, host, port): + SocketTransport.__init__(self, conn, host, port) + # Bug (QPID-4337): this is the "old" version of python SSL. + # The private key is required. If a certificate is given, but no + # keyfile, assume the key is contained in the certificate + ssl_keyfile = conn.ssl_keyfile + ssl_certfile = conn.ssl_certfile + if ssl_certfile and not ssl_keyfile: + ssl_keyfile = ssl_certfile + + # this version of SSL does NOT perform certificate validation. If the + # connection has been configured with CA certs (via ssl_trustfile), then + # the application expects the certificate to be validated against the + # supplied CA certs. Since this version cannot validate, the peer cannot + # be trusted. + if conn.ssl_trustfile: + raise socket.error("This version of Python does not support verification of the peer's certificate.") + + self.ssl = ssl(self.socket, keyfile=ssl_keyfile, certfile=ssl_certfile) + self.socket.setblocking(1) + + def reading(self, reading): + return reading + + def writing(self, writing): + return writing + + def recv(self, n): + return self.ssl.read(n) + + def send(self, s): + return self.ssl.write(s) + + def close(self): + self.socket.close() + + TRANSPORTS["ssl"] = old_ssl + TRANSPORTS["tcp+tls"] = old_ssl + +else: + class tls(SocketTransport): + + def __init__(self, conn, host, port): + SocketTransport.__init__(self, conn, host, port) + if conn.ssl_trustfile: + validate = CERT_REQUIRED + else: + validate = CERT_NONE + + # if user manually set flag to false then require cert + actual = getattr(conn, "_ssl_skip_hostname_check_actual", None) + if actual is not None and conn.ssl_skip_hostname_check is False: + validate = CERT_REQUIRED + + self.tls = wrap_socket(self.socket, keyfile=conn.ssl_keyfile, + certfile=conn.ssl_certfile, + ca_certs=conn.ssl_trustfile, + cert_reqs=validate) + + if validate == CERT_REQUIRED and not conn.ssl_skip_hostname_check: + match_found = False + peer_cert = self.tls.getpeercert() + if peer_cert: + peer_names = [] + if 'subjectAltName' in peer_cert: + for san in peer_cert['subjectAltName']: + if san[0] == 'DNS': + peer_names.append(san[1].lower()) + if 'subject' in peer_cert: + for sub in peer_cert['subject']: + while isinstance(sub, tuple) and isinstance(sub[0],tuple): + sub = sub[0] # why the extra level of indirection??? + if sub[0] == 'commonName': + peer_names.append(sub[1].lower()) + for pattern in peer_names: + if _match_dns_pattern( host.lower(), pattern ): + #print "Match found %s" % pattern + match_found = True + break + if not match_found: + raise SSLError("Connection hostname '%s' does not match names from peer certificate: %s" % (host, peer_names)) + + self.socket.setblocking(0) + self.state = None + # See qpid-4872: need to store the parameters last passed to tls.write() + # in case the calls fail with an SSL_ERROR_WANT_* error and we have to + # retry the call with the same parameters. + self.write_retry = None # buffer passed to last call of tls.write() + + def reading(self, reading): + if self.state is None: + return reading + else: + return self.state == SSL_ERROR_WANT_READ + + def writing(self, writing): + if self.state is None: + return writing + else: + return self.state == SSL_ERROR_WANT_WRITE + + def send(self, bytes): + if self.write_retry is None: + self.write_retry = bytes + self._clear_state() + try: + n = self.tls.write( self.write_retry ) + self.write_retry = None + return n + except SSLError, e: + if self._update_state(e.args[0]): + # will retry on next invokation + return 0 + self.write_retry = None + raise + except: + self.write_retry = None + raise + + def recv(self, n): + self._clear_state() + try: + return self.tls.read(n) + except SSLError, e: + if self._update_state(e.args[0]): + # will retry later: + return None + else: + raise + + def _clear_state(self): + self.state = None + + def _update_state(self, code): + if code in (SSL_ERROR_WANT_READ, SSL_ERROR_WANT_WRITE): + self.state = code + return True + else: + return False + + def close(self): + self.socket.setblocking(1) + # this closes the underlying socket + self.tls.close() + + def _match_dns_pattern( hostname, pattern ): + """ For checking the hostnames provided by the peer's certificate + """ + if pattern.find("*") == -1: + return hostname == pattern + + # DNS wildcarded pattern - see RFC2818 + h_labels = hostname.split(".") + p_labels = pattern.split(".") + + while h_labels and p_labels: + if p_labels[0].find("*") == -1: + if p_labels[0] != h_labels[0]: + return False + else: + p = p_labels[0].split("*") + if not h_labels[0].startswith(p[0]): + return False + if not h_labels[0].endswith(p[1]): + return False + h_labels.pop(0) + p_labels.pop(0) + + return not h_labels and not p_labels + + + TRANSPORTS["ssl"] = tls + TRANSPORTS["tcp+tls"] = tls diff --git a/qpid/python/qpid/messaging/util.py b/qpid/python/qpid/messaging/util.py new file mode 100644 index 0000000000..726cfd5172 --- /dev/null +++ b/qpid/python/qpid/messaging/util.py @@ -0,0 +1,64 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +Add-on utilities for the L{qpid.messaging} API. +""" + +from qpid.messaging import * +from logging import getLogger +from threading import Thread + +log = getLogger("qpid.messaging.util") + +def auto_fetch_reconnect_urls(conn): + ssn = conn.session("auto-fetch-reconnect-urls") + rcv = ssn.receiver("amq.failover") + rcv.capacity = 10 + + def main(): + while True: + try: + msg = rcv.fetch() + except LinkClosed: + return + set_reconnect_urls(conn, msg) + ssn.acknowledge(msg, sync=False) + + thread = Thread(name="auto-fetch-reconnect-urls", target=main) + thread.setDaemon(True) + thread.start() + + +def set_reconnect_urls(conn, msg): + reconnect_urls = [] + urls = msg.properties["amq.failover"] + for u in urls: + # FIXME aconway 2012-06-12: Nasty hack parsing of the C++ broker's URL format. + if u.startswith("amqp:"): + for a in u[5:].split(","): + parts = a.split(":") + # Handle IPv6 addresses which have : in the host part. + port = parts[-1] # Last : separated field is port + host = ":".join(parts[1:-1]) # First : separated field is protocol, host is the rest. + reconnect_urls.append("%s:%s" % (host, port)) + conn.reconnect_urls = reconnect_urls + log.warn("set reconnect_urls for conn %s: %s", conn, reconnect_urls) + +__all__ = ["auto_fetch_reconnect_urls", "set_reconnect_urls"] diff --git a/qpid/python/qpid/mimetype.py b/qpid/python/qpid/mimetype.py new file mode 100644 index 0000000000..f512996b9f --- /dev/null +++ b/qpid/python/qpid/mimetype.py @@ -0,0 +1,106 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import re, rfc822 +from lexer import Lexicon, LexError +from parser import Parser, ParseError + +l = Lexicon() + +LPAREN = l.define("LPAREN", r"\(") +RPAREN = l.define("LPAREN", r"\)") +SLASH = l.define("SLASH", r"/") +SEMI = l.define("SEMI", r";") +EQUAL = l.define("EQUAL", r"=") +TOKEN = l.define("TOKEN", r'[^()<>@,;:\\"/\[\]?= ]+') +STRING = l.define("STRING", r'"(?:[^\\"]|\\.)*"') +WSPACE = l.define("WSPACE", r"[ \n\r\t]+") +EOF = l.eof("EOF") + +LEXER = l.compile() + +def lex(st): + return LEXER.lex(st) + +class MimeTypeParser(Parser): + + def __init__(self, tokens): + Parser.__init__(self, [t for t in tokens if t.type is not WSPACE]) + + def parse(self): + result = self.mimetype() + self.eat(EOF) + return result + + def mimetype(self): + self.remove_comments() + self.reset() + + type = self.eat(TOKEN).value.lower() + self.eat(SLASH) + subtype = self.eat(TOKEN).value.lower() + + params = [] + while True: + if self.matches(SEMI): + params.append(self.parameter()) + else: + break + + return type, subtype, params + + def remove_comments(self): + while True: + self.eat_until(LPAREN, EOF) + if self.matches(LPAREN): + self.remove(*self.comment()) + else: + break + + def comment(self): + start = self.eat(LPAREN) + + while True: + self.eat_until(LPAREN, RPAREN) + if self.matches(LPAREN): + self.comment() + else: + break + + end = self.eat(RPAREN) + return start, end + + def parameter(self): + self.eat(SEMI) + name = self.eat(TOKEN).value + self.eat(EQUAL) + value = self.value() + return name, value + + def value(self): + if self.matches(TOKEN): + return self.eat().value + elif self.matches(STRING): + return rfc822.unquote(self.eat().value) + else: + raise ParseError(self.next(), TOKEN, STRING) + +def parse(addr): + return MimeTypeParser(lex(addr)).parse() + +__all__ = ["parse", "ParseError"] diff --git a/qpid/python/qpid/ops.py b/qpid/python/qpid/ops.py new file mode 100644 index 0000000000..390552be6d --- /dev/null +++ b/qpid/python/qpid/ops.py @@ -0,0 +1,294 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import os, mllib, cPickle as pickle, sys +from util import fill + +class Primitive(object): + pass + +class Enum(object): + + # XXX: for backwards compatibility + def values(cls): + print >> sys.stderr, "warning, please use .VALUES instead of .values()" + return cls.VALUES + # we can't use the backport preprocessor here because this code gets + # called by setup.py + values = classmethod(values) + +class Field: + + def __init__(self, name, type, default=None): + self.name = name + self.type = type + self.default = default + + def __repr__(self): + return "%s: %s" % (self.name, self.type) + +class Compound(object): + + UNENCODED=[] + + def __init__(self, *args, **kwargs): + args = list(args) + for f in self.ARGS: + if args: + a = args.pop(0) + else: + a = kwargs.pop(f.name, f.default) + setattr(self, f.name, a) + if args: + raise TypeError("%s takes at most %s arguments (%s given))" % + (self.__class__.__name__, len(self.ARGS), + len(self.ARGS) + len(args))) + if kwargs: + raise TypeError("got unexpected keyword argument '%s'" % kwargs.keys()[0]) + + def fields(self): + result = {} + for f in self.FIELDS: + result[f.name] = getattr(self, f.name) + return result + + def args(self): + result = {} + for f in self.ARGS: + result[f.name] = getattr(self, f.name) + return result + + def __getitem__(self, attr): + return getattr(self, attr) + + def __setitem__(self, attr, value): + setattr(self, attr, value) + + def dispatch(self, target, *args): + handler = "do_%s" % self.NAME + getattr(target, handler)(self, *args) + + def __repr__(self, extras=()): + return "%s(%s)" % (self.__class__.__name__, + ", ".join(["%s=%r" % (f.name, getattr(self, f.name)) + for f in self.ARGS + if getattr(self, f.name) != f.default])) + +class Command(Compound): + UNENCODED=[Field("channel", "uint16", 0), + Field("id", "sequence-no", None), + Field("sync", "bit", False), + Field("headers", None, None), + Field("payload", None, None)] + +class Control(Compound): + UNENCODED=[Field("channel", "uint16", 0)] + +def pythonize(st): + if st is None: + return None + else: + return str(st.replace("-", "_")) + +def pydoc(op, children=()): + doc = "\n\n".join([fill(p.text(), 0) for p in op.query["doc"]]) + for ch in children: + doc += "\n\n " + pythonize(ch["@name"]) + " -- " + str(ch["@label"]) + ch_descs ="\n\n".join([fill(p.text(), 4) for p in ch.query["doc"]]) + if ch_descs: + doc += "\n\n" + ch_descs + return doc + +def studly(st): + return "".join([p.capitalize() for p in st.split("-")]) + +def klass(nd): + while nd.parent is not None: + if hasattr(nd.parent, "name") and nd.parent.name == "class": + return nd.parent + else: + nd = nd.parent + +def included(nd): + cls = klass(nd) + if cls is None: + return True + else: + return cls["@name"] not in ("file", "stream") + +def num(s): + if s: return int(s, 0) + +def code(nd): + c = num(nd["@code"]) + if c is None: + return None + else: + cls = klass(nd) + if cls is None: + return c + else: + return c | (num(cls["@code"]) << 8) + +def default(f): + if f["@type"] == "bit": + return False + else: + return None + +def make_compound(decl, base, domains): + dict = {} + fields = decl.query["field"] + dict["__doc__"] = pydoc(decl, fields) + dict["NAME"] = pythonize(decl["@name"]) + dict["SIZE"] = num(decl["@size"]) + dict["CODE"] = code(decl) + dict["PACK"] = num(decl["@pack"]) + dict["FIELDS"] = [Field(pythonize(f["@name"]), resolve(f, domains), + default(f)) + for f in fields] + dict["ARGS"] = dict["FIELDS"] + base.UNENCODED + return str(studly(decl["@name"])), (base,), dict + +def make_restricted(decl, domains): + name = pythonize(decl["@name"]) + dict = {} + choices = decl.query["choice"] + dict["__doc__"] = pydoc(decl, choices) + dict["NAME"] = name + dict["TYPE"] = str(decl.parent["@type"]) + values = [] + for ch in choices: + val = int(ch["@value"], 0) + dict[pythonize(ch["@name"])] = val + values.append(val) + dict["VALUES"] = values + return name, (Enum,), dict + +def make_type(decl, domains): + name = pythonize(decl["@name"]) + dict = {} + dict["__doc__"] = pydoc(decl) + dict["NAME"] = name + dict["CODE"] = code(decl) + return str(studly(decl["@name"])), (Primitive,), dict + +def make_command(decl, domains): + decl.set_attr("name", "%s-%s" % (decl.parent["@name"], decl["@name"])) + decl.set_attr("size", "0") + decl.set_attr("pack", "2") + name, bases, dict = make_compound(decl, Command, domains) + dict["RESULT"] = pythonize(decl["result/@type"]) or pythonize(decl["result/struct/@name"]) + return name, bases, dict + +def make_control(decl, domains): + decl.set_attr("name", "%s-%s" % (decl.parent["@name"], decl["@name"])) + decl.set_attr("size", "0") + decl.set_attr("pack", "2") + return make_compound(decl, Control, domains) + +def make_struct(decl, domains): + return make_compound(decl, Compound, domains) + +def make_enum(decl, domains): + decl.set_attr("name", decl.parent["@name"]) + return make_restricted(decl, domains) + + +vars = globals() + +def make(nd, domains): + return vars["make_%s" % nd.name](nd, domains) + +def qualify(nd, field="@name"): + cls = klass(nd) + if cls is None: + return pythonize(nd[field]) + else: + return pythonize("%s.%s" % (cls["@name"], nd[field])) + +def resolve(nd, domains): + candidates = qualify(nd, "@type"), pythonize(nd["@type"]) + for c in candidates: + if domains.has_key(c): + while domains.has_key(c): + c = domains[c] + return c + else: + return c + +def load_types_from_xml(file): + spec = mllib.xml_parse(file) + domains = dict([(qualify(d), pythonize(d["@type"])) + for d in spec.query["amqp/domain", included] + \ + spec.query["amqp/class/domain", included]]) + type_decls = \ + spec.query["amqp/class/command", included] + \ + spec.query["amqp/class/control", included] + \ + spec.query["amqp/class/command/result/struct", included] + \ + spec.query["amqp/class/struct", included] + \ + spec.query["amqp/class/domain/enum", included] + \ + spec.query["amqp/domain/enum", included] + \ + spec.query["amqp/type"] + types = [make(nd, domains) for nd in type_decls] + return types + +def load_types(file): + base, ext = os.path.splitext(file) + pclfile = "%s.pcl" % base + if os.path.exists(pclfile) and \ + os.path.getmtime(pclfile) > os.path.getmtime(file): + f = open(pclfile, "rb") + types = pickle.load(f) + f.close() + else: + types = load_types_from_xml(file) + if os.access(os.path.dirname(os.path.abspath(pclfile)), os.W_OK): + f = open(pclfile, "wb") + pickle.dump(types, f) + f.close() + return types + +from specs_config import amqp_spec as file +types = load_types(file) + +ENUMS = {} +PRIMITIVE = {} +COMPOUND = {} +COMMANDS = {} +CONTROLS = {} + +for name, bases, _dict in types: + t = type(name, bases, _dict) + vars[name] = t + + if issubclass(t, Command): + COMMANDS[t.NAME] = t + COMMANDS[t.CODE] = t + elif issubclass(t, Control): + CONTROLS[t.NAME] = t + CONTROLS[t.CODE] = t + elif issubclass(t, Compound): + COMPOUND[t.NAME] = t + if t.CODE is not None: + COMPOUND[t.CODE] = t + elif issubclass(t, Primitive): + PRIMITIVE[t.NAME] = t + PRIMITIVE[t.CODE] = t + elif issubclass(t, Enum): + ENUMS[t.NAME] = t diff --git a/qpid/python/qpid/packer.py b/qpid/python/qpid/packer.py new file mode 100644 index 0000000000..22c16918dc --- /dev/null +++ b/qpid/python/qpid/packer.py @@ -0,0 +1,36 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import struct + +class Packer: + + def read(self, n): abstract + + def write(self, s): abstract + + def unpack(self, fmt): + values = struct.unpack(fmt, self.read(struct.calcsize(fmt))) + if len(values) == 1: + return values[0] + else: + return values + + def pack(self, fmt, *args): + self.write(struct.pack(fmt, *args)) diff --git a/qpid/python/qpid/parser.py b/qpid/python/qpid/parser.py new file mode 100644 index 0000000000..233f0a8469 --- /dev/null +++ b/qpid/python/qpid/parser.py @@ -0,0 +1,68 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +class ParseError(Exception): + + def __init__(self, token, *expected): + line, ln, col = token.line_info() + exp = ", ".join(map(str, expected)) + if len(expected) > 1: + exp = "(%s)" % exp + if expected: + msg = "expecting %s, got %s line:%s,%s:%s" % (exp, token, ln, col, line) + else: + msg = "unexpected token %s line:%s,%s:%s" % (token, ln, col, line) + Exception.__init__(self, msg) + self.token = token + self.expected = expected + +class Parser: + + def __init__(self, tokens): + self.tokens = tokens + self.idx = 0 + + def next(self): + return self.tokens[self.idx] + + def matches(self, *types): + return self.next().type in types + + def eat(self, *types): + if types and not self.matches(*types): + raise ParseError(self.next(), *types) + else: + t = self.next() + self.idx += 1 + return t + + def eat_until(self, *types): + result = [] + while not self.matches(*types): + result.append(self.eat()) + return result + + def remove(self, start, end): + start_idx = self.tokens.index(start) + end_idx = self.tokens.index(end) + 1 + del self.tokens[start_idx:end_idx] + self.idx -= end_idx - start_idx + + def reset(self): + self.idx = 0 diff --git a/qpid/python/qpid/peer.py b/qpid/python/qpid/peer.py new file mode 100644 index 0000000000..fcad0f3ae6 --- /dev/null +++ b/qpid/python/qpid/peer.py @@ -0,0 +1,533 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +This module contains a skeletal peer implementation useful for +implementing an AMQP server, client, or proxy. The peer implementation +sorts incoming frames to their intended channels, and dispatches +incoming method frames to a delegate. +""" + +import threading, traceback, socket, sys +from connection08 import EOF, Method, Header, Body, Request, Response, VersionError +from message import Message +from queue import Queue, Closed as QueueClosed +from content import Content +from cStringIO import StringIO +from time import time +from exceptions import Closed, Timeout +from logging import getLogger + +log = getLogger("qpid.peer") + +class Sequence: + + def __init__(self, start, step = 1): + # we should keep start for wrap around + self._next = start + self.step = step + self.lock = threading.Lock() + + def next(self): + self.lock.acquire() + try: + result = self._next + self._next += self.step + return result + finally: + self.lock.release() + +class Peer: + + def __init__(self, conn, delegate, channel_factory=None, channel_options=None): + self.conn = conn + self.delegate = delegate + self.outgoing = Queue(0) + self.work = Queue(0) + self.channels = {} + self.lock = threading.Lock() + if channel_factory: + self.channel_factory = channel_factory + else: + self.channel_factory = Channel + if channel_options is None: + channel_options = {} + self.channel_options = channel_options + + def channel(self, id): + self.lock.acquire() + try: + try: + ch = self.channels[id] + except KeyError: + ch = self.channel_factory(id, self.outgoing, self.conn.spec, self.channel_options) + self.channels[id] = ch + finally: + self.lock.release() + return ch + + def start(self): + self.writer_thread = threading.Thread(target=self.writer) + self.writer_thread.daemon = True + self.writer_thread.start() + + self.reader_thread = threading.Thread(target=self.reader) + self.reader_thread.daemon = True + self.reader_thread.start() + + self.worker_thread = threading.Thread(target=self.worker) + self.worker_thread.daemon = True + self.worker_thread.start() + + def fatal(self, message=None): + """Call when an unexpected exception occurs that will kill a thread.""" + self.closed("Fatal error: %s\n%s" % (message or "", traceback.format_exc())) + + def reader(self): + try: + while True: + try: + frame = self.conn.read() + except EOF, e: + self.work.close() + break + ch = self.channel(frame.channel) + ch.receive(frame, self.work) + except VersionError, e: + self.closed(e) + except: + self.fatal() + + def closed(self, reason): + # We must close the delegate first because closing channels + # may wake up waiting threads and we don't want them to see + # the delegate as open. + self.delegate.closed(reason) + for ch in self.channels.values(): + ch.closed(reason) + + def writer(self): + try: + while True: + try: + message = self.outgoing.get() + self.conn.write(message) + except socket.error, e: + self.closed(e) + break + self.conn.flush() + except QueueClosed: + pass + except: + self.fatal() + + def worker(self): + try: + while True: + queue = self.work.get() + frame = queue.get() + channel = self.channel(frame.channel) + if frame.method_type.content: + content = read_content(queue) + else: + content = None + + self.delegate(channel, Message(channel, frame, content)) + except QueueClosed: + self.closed("worker closed") + except: + self.fatal() + + def stop(self): + try: + self.work.close(); + self.outgoing.close(); + self.conn.close(); + finally: + timeout = 1; + self.worker_thread.join(timeout); + if self.worker_thread.isAlive(): + log.warn("Worker thread failed to shutdown within timeout") + self.reader_thread.join(timeout); + if self.reader_thread.isAlive(): + log.warn("Reader thread failed to shutdown within timeout") + self.writer_thread.join(timeout); + if self.writer_thread.isAlive(): + log.warn("Writer thread failed to shutdown within timeout") + +class Requester: + + def __init__(self, writer): + self.write = writer + self.sequence = Sequence(1) + self.mark = 0 + # request_id -> listener + self.outstanding = {} + + def request(self, method, listener, content = None): + frame = Request(self.sequence.next(), self.mark, method) + self.outstanding[frame.id] = listener + self.write(frame, content) + + def receive(self, channel, frame): + listener = self.outstanding.pop(frame.request_id) + listener(channel, frame) + +class Responder: + + def __init__(self, writer): + self.write = writer + self.sequence = Sequence(1) + + def respond(self, method, batch, request): + if isinstance(request, Method): + self.write(method) + else: + # allow batching from frame at either end + if batch<0: + frame = Response(self.sequence.next(), request.id+batch, -batch, method) + else: + frame = Response(self.sequence.next(), request.id, batch, method) + self.write(frame) + +class Channel: + + def __init__(self, id, outgoing, spec, options): + self.id = id + self.outgoing = outgoing + self.spec = spec + self.incoming = Queue(0) + self.responses = Queue(0) + self.queue = None + self.content_queue = None + self._closed = False + self.reason = None + + self.requester = Requester(self.write) + self.responder = Responder(self.write) + + self.completion = OutgoingCompletion() + self.incoming_completion = IncomingCompletion(self) + self.futures = {} + self.control_queue = Queue(0)#used for incoming methods that appas may want to handle themselves + + self.invoker = self.invoke_method + self.use_execution_layer = (spec.major == 0 and spec.minor == 10) or (spec.major == 99 and spec.minor == 0) + self.synchronous = True + + self._flow_control_wait_failure = options.get("qpid.flow_control_wait_failure", 60) + self._flow_control_wait_condition = threading.Condition() + self._flow_control = False + + def closed(self, reason): + if self._closed: + return + self._closed = True + self.reason = reason + self.incoming.close() + self.responses.close() + self.completion.close() + self.incoming_completion.reset() + for f in self.futures.values(): + f.put_response(self, reason) + + def write(self, frame, content = None): + if self._closed: + raise Closed(self.reason) + frame.channel = self.id + self.outgoing.put(frame) + if (isinstance(frame, (Method, Request)) + and content == None + and frame.method_type.content): + content = Content() + if content != None: + self.write_content(frame.method_type.klass, content) + + def write_content(self, klass, content): + header = Header(klass, content.weight(), content.size(), content.properties) + self.write(header) + for child in content.children: + self.write_content(klass, child) + # should split up if content.body exceeds max frame size + if content.body: + self.write(Body(content.body)) + + def receive(self, frame, work): + if isinstance(frame, Method): + if frame.method_type.content: + if frame.method.response: + self.content_queue = self.responses + else: + self.content_queue = self.incoming + if frame.method.response: + self.queue = self.responses + else: + self.queue = self.incoming + work.put(self.incoming) + elif isinstance(frame, Request): + self.queue = self.incoming + work.put(self.incoming) + elif isinstance(frame, Response): + self.requester.receive(self, frame) + if frame.method_type.content: + self.queue = self.responses + return + elif isinstance(frame, Body) or isinstance(frame, Header): + self.queue = self.content_queue + self.queue.put(frame) + + def queue_response(self, channel, frame): + channel.responses.put(frame.method) + + def request(self, method, listener, content = None): + self.requester.request(method, listener, content) + + def respond(self, method, batch, request): + self.responder.respond(method, batch, request) + + def invoke(self, type, args, kwargs): + if (type.klass.name in ["channel", "session"]) and (type.name in ["close", "open", "closed"]): + self.completion.reset() + self.incoming_completion.reset() + self.completion.next_command(type) + + content = kwargs.pop("content", None) + frame = Method(type, type.arguments(*args, **kwargs)) + return self.invoker(frame, content) + + # used for 0-9 + def invoke_reliable(self, frame, content = None): + if not self.synchronous: + future = Future() + self.request(frame, future.put_response, content) + if not frame.method.responses: return None + else: return future + + self.request(frame, self.queue_response, content) + if not frame.method.responses: + if self.use_execution_layer and frame.method_type.is_l4_command(): + self.execution_sync() + self.completion.wait() + if self._closed: + raise Closed(self.reason) + return None + try: + resp = self.responses.get() + if resp.method_type.content: + return Message(self, resp, read_content(self.responses)) + else: + return Message(self, resp) + except QueueClosed, e: + if self._closed: + raise Closed(self.reason) + else: + raise e + + # used for 0-8 and 0-10 + def invoke_method(self, frame, content = None): + if frame.method.result: + cmd_id = self.completion.command_id + future = Future() + self.futures[cmd_id] = future + + if frame.method.klass.name == "basic" and frame.method.name == "publish": + self._flow_control_wait_condition.acquire() + try: + self.check_flow_control() + self.write(frame, content) + finally: + self._flow_control_wait_condition.release() + else: + self.write(frame, content) + + try: + # here we depend on all nowait fields being named nowait + f = frame.method.fields.byname["nowait"] + nowait = frame.args[frame.method.fields.index(f)] + except KeyError: + nowait = False + + try: + if not nowait and frame.method.responses: + resp = self.responses.get() + if resp.method.content: + content = read_content(self.responses) + else: + content = None + if resp.method in frame.method.responses: + return Message(self, resp, content) + else: + raise ValueError(resp) + elif frame.method.result: + if self.synchronous: + fr = future.get_response(timeout=10) + if self._closed: + raise Closed(self.reason) + return fr + else: + return future + elif self.synchronous and not frame.method.response \ + and self.use_execution_layer and frame.method.is_l4_command(): + self.execution_sync() + completed = self.completion.wait(timeout=10) + if self._closed: + raise Closed(self.reason) + if not completed: + self.closed("Timed-out waiting for completion of %s" % frame) + except QueueClosed, e: + if self._closed: + raise Closed(self.reason) + else: + raise e + + # part of flow control for AMQP 0-8, 0-9, and 0-9-1 + def set_flow_control(self, value): + self._flow_control_wait_condition.acquire() + self._flow_control = value + if value == False: + self._flow_control_wait_condition.notify() + self._flow_control_wait_condition.release() + + # part of flow control for AMQP 0-8, 0-9, and 0-9-1 + def check_flow_control(self): + if self._flow_control: + self._flow_control_wait_condition.wait(self._flow_control_wait_failure) + if self._flow_control: + raise Timeout("Unable to send message for " + str(self._flow_control_wait_failure) + " seconds due to broker enforced flow control") + + def __getattr__(self, name): + type = self.spec.method(name) + if type == None: raise AttributeError(name) + method = lambda *args, **kwargs: self.invoke(type, args, kwargs) + self.__dict__[name] = method + return method + +def read_content(queue): + header = queue.get() + children = [] + for i in range(header.weight): + children.append(read_content(queue)) + buf = StringIO() + readbytes = 0 + while readbytes < header.size: + body = queue.get() + content = body.content + buf.write(content) + readbytes += len(content) + return Content(buf.getvalue(), children, header.properties.copy()) + +class Future: + def __init__(self): + self.completed = threading.Event() + + def put_response(self, channel, response): + self.response = response + self.completed.set() + + def get_response(self, timeout=None): + self.completed.wait(timeout) + if self.completed.isSet(): + return self.response + else: + return None + + def is_complete(self): + return self.completed.isSet() + +class OutgoingCompletion: + """ + Manages completion of outgoing commands i.e. command sent by this peer + """ + + def __init__(self): + self.condition = threading.Condition() + + #todo, implement proper wraparound + self.sequence = Sequence(0) #issues ids for outgoing commands + self.command_id = -1 #last issued id + self.mark = -1 #commands up to this mark are known to be complete + self._closed = False + + def next_command(self, method): + #the following test is a hack until the track/sub-channel is available + if method.is_l4_command(): + self.command_id = self.sequence.next() + + def reset(self): + self.sequence = Sequence(0) #reset counter + + def close(self): + self.reset() + self.condition.acquire() + try: + self._closed = True + self.condition.notifyAll() + finally: + self.condition.release() + + def complete(self, mark): + self.condition.acquire() + try: + self.mark = mark + #print "set mark to %s [%s] " % (self.mark, self) + self.condition.notifyAll() + finally: + self.condition.release() + + def wait(self, point_of_interest=-1, timeout=None): + if point_of_interest == -1: point_of_interest = self.command_id + start_time = time() + remaining = timeout + self.condition.acquire() + try: + while not self._closed and point_of_interest > self.mark: + #print "waiting for %s, mark = %s [%s]" % (point_of_interest, self.mark, self) + self.condition.wait(remaining) + if not self._closed and point_of_interest > self.mark and timeout: + if (start_time + timeout) < time(): break + else: remaining = timeout - (time() - start_time) + finally: + self.condition.release() + return point_of_interest <= self.mark + +class IncomingCompletion: + """ + Manages completion of incoming commands i.e. command received by this peer + """ + + def __init__(self, channel): + self.sequence = Sequence(0) #issues ids for incoming commands + self.mark = -1 #id of last command of whose completion notification was sent to the other peer + self.channel = channel + + def reset(self): + self.sequence = Sequence(0) #reset counter + + def complete(self, mark, cumulative=True): + if cumulative: + if mark > self.mark: + self.mark = mark + self.channel.execution_complete(cumulative_execution_mark=self.mark) + else: + #TODO: record and manage the ranges properly + range = [mark, mark] + if (self.mark == -1):#hack until wraparound is implemented + self.channel.execution_complete(cumulative_execution_mark=0xFFFFFFFFL, ranged_execution_set=range) + else: + self.channel.execution_complete(cumulative_execution_mark=self.mark, ranged_execution_set=range) diff --git a/qpid/python/qpid/queue.py b/qpid/python/qpid/queue.py new file mode 100644 index 0000000000..63a7684843 --- /dev/null +++ b/qpid/python/qpid/queue.py @@ -0,0 +1,88 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +This module augments the standard python multithreaded Queue +implementation to add a close() method so that threads blocking on the +content of a queue can be notified if the queue is no longer in use. +""" + +from Queue import Queue as BaseQueue, Empty, Full +from threading import Thread +from exceptions import Closed + +class Queue(BaseQueue): + + END = object() + STOP = object() + + def __init__(self, *args, **kwargs): + BaseQueue.__init__(self, *args, **kwargs) + self.error = None + self.listener = None + self.exc_listener = None + self.thread = None + + def close(self, error = None): + self.error = error + self.put(Queue.END) + if self.thread is not None: + self.thread.join() + self.thread = None + + def get(self, block = True, timeout = None): + result = BaseQueue.get(self, block, timeout) + if result == Queue.END: + # this guarantees that any other waiting threads or any future + # calls to get will also result in a Closed exception + self.put(Queue.END) + raise Closed(self.error) + else: + return result + + def listen(self, listener, exc_listener = None): + if listener is None and exc_listener is not None: + raise ValueError("cannot set exception listener without setting listener") + + if listener is None: + if self.thread is not None: + self.put(Queue.STOP) + # loop and timed join permit keyboard interrupts to work + while self.thread.isAlive(): + self.thread.join(3) + self.thread = None + + self.listener = listener + self.exc_listener = exc_listener + + if listener is not None and self.thread is None: + self.thread = Thread(target = self.run) + self.thread.setDaemon(True) + self.thread.start() + + def run(self): + while True: + try: + o = self.get() + if o == Queue.STOP: break + self.listener(o) + except Closed, e: + if self.exc_listener is not None: + self.exc_listener(e) + break diff --git a/qpid/python/qpid/reference.py b/qpid/python/qpid/reference.py new file mode 100644 index 0000000000..48ecb67656 --- /dev/null +++ b/qpid/python/qpid/reference.py @@ -0,0 +1,117 @@ +#!/usr/bin/env python + +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +Support for amqp 'reference' content (as opposed to inline content) +""" + +import threading +from queue import Queue, Closed + +class NotOpened(Exception): pass + +class AlreadyOpened(Exception): pass + +""" +A representation of a reference id; can be passed wherever amqp +content is required in place of inline data +""" +class ReferenceId: + + def __init__(self, id): + self.id = id + +""" +Holds content received through 'reference api'. Instances of this +class will be placed in the consumers queue on receiving a transfer +(assuming the reference has been opened). Data can be retrieved in +chunks (as append calls are received) or in full (after reference has +been closed signalling data s complete). +""" + +class Reference: + + def __init__(self, id): + self.id = id + self.chunks = Queue(0) + + def close(self): + self.chunks.close() + + def append(self, bytes): + self.chunks.put(bytes) + + def get_chunk(self): + return self.chunks.get() + + def get_complete(self): + data = "" + for chunk in self: + data += chunk + return data + + def next(self): + try: + return self.get_chunk() + except Closed, e: + raise StopIteration + + def __iter__(self): + return self + +""" +Manages a set of opened references. New references can be opened and +existing references can be retrieved or closed. +""" +class References: + + def __init__(self): + self.map = {} + self.lock = threading.Lock() + + def get(self, id): + self.lock.acquire() + try: + try: + ref = self.map[id] + except KeyError: + raise NotOpened() + finally: + self.lock.release() + return ref + + def open(self, id): + self.lock.acquire() + try: + if id in self.map: raise AlreadyOpened() + self.map[id] = Reference(id) + finally: + self.lock.release() + + + def close(self, id): + self.get(id).close() + self.lock.acquire() + try: + self.map.pop(id) + finally: + self.lock.release() + diff --git a/qpid/python/qpid/sasl.py b/qpid/python/qpid/sasl.py new file mode 100644 index 0000000000..a2147e3cc4 --- /dev/null +++ b/qpid/python/qpid/sasl.py @@ -0,0 +1,119 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import socket + +class SASLError(Exception): + pass + +class WrapperClient: + + def __init__(self): + self._cli = _Client() + + def setAttr(self, name, value): + # Allow unicode user names and passwords + if isinstance(value, unicode): + value = value.encode('utf8') + status = self._cli.setAttr(str(name), str(value)) + if status and name == 'username': + status = self._cli.setAttr('externaluser', str(value)) + + if not status: + raise SASLError(self._cli.getError()) + + def init(self): + status = self._cli.init() + if not status: + raise SASLError(self._cli.getError()) + + def start(self, mechanisms): + status, mech, initial = self._cli.start(str(mechanisms)) + if status: + return mech, initial + else: + raise SASLError(self._cli.getError()) + + def step(self, challenge): + status, response = self._cli.step(challenge) + if status: + return response + else: + raise SASLError(self._cli.getError()) + + def encode(self, bytes): + status, result = self._cli.encode(bytes) + if status: + return result + else: + raise SASLError(self._cli.getError()) + + def decode(self, bytes): + status, result = self._cli.decode(bytes) + if status: + return result + else: + raise SASLError(self._cli.getError()) + + def auth_username(self): + status, result = self._cli.getUserId() + if status: + return result + else: + raise SASLError(self._cli.getError()) + +class PlainClient: + + def __init__(self): + self.attrs = {} + + def setAttr(self, name, value): + self.attrs[name] = value + + def init(self): + pass + + def start(self, mechanisms): + mechs = mechanisms.split() + if self.attrs.get("username") and "PLAIN" in mechs: + return "PLAIN", "\0%s\0%s" % (self.attrs.get("username"), self.attrs.get("password")) + elif "ANONYMOUS" in mechs: + return "ANONYMOUS", "%s@%s" % (self.attrs.get("username"), socket.gethostname()) + elif "EXTERNAL" in mechs: + return "EXTERNAL", "%s" % (self.attrs.get("username")) + else: + raise SASLError("sasl negotiation failed: no mechanism agreed") + + def step(self, challenge): + pass + + def encode(self, bytes): + return bytes + + def decode(self, bytes): + return bytes + + def auth_username(self): + return self.attrs.get("username") + +try: + from saslwrapper import Client as _Client + Client = WrapperClient +except ImportError: + Client = PlainClient diff --git a/qpid/python/qpid/saslmech/__init__.py b/qpid/python/qpid/saslmech/__init__.py new file mode 100644 index 0000000000..ebcab03ca2 --- /dev/null +++ b/qpid/python/qpid/saslmech/__init__.py @@ -0,0 +1,22 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +"""Pure python implementations of SASL mechanisms""" + + diff --git a/qpid/python/qpid/saslmech/amqplain.py b/qpid/python/qpid/saslmech/amqplain.py new file mode 100644 index 0000000000..731f6b6628 --- /dev/null +++ b/qpid/python/qpid/saslmech/amqplain.py @@ -0,0 +1,28 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from sasl import Sasl + +class AMQPLAIN(Sasl): + + def initialResponse(self): + return {"LOGIN": self.user, "PASSWORD": self.password} + + def priority(self): + return 0
\ No newline at end of file diff --git a/qpid/python/qpid/saslmech/anonymous.py b/qpid/python/qpid/saslmech/anonymous.py new file mode 100644 index 0000000000..1002a3aa0a --- /dev/null +++ b/qpid/python/qpid/saslmech/anonymous.py @@ -0,0 +1,27 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from sasl import Sasl + +class ANONYMOUS(Sasl): + + def prerequisitesOk(self): + return True + + diff --git a/qpid/python/qpid/saslmech/cram_md5.py b/qpid/python/qpid/saslmech/cram_md5.py new file mode 100644 index 0000000000..a351f43838 --- /dev/null +++ b/qpid/python/qpid/saslmech/cram_md5.py @@ -0,0 +1,27 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from sasl import Sasl +from hmac import HMAC + +class CRAM_MD5(Sasl): + + def response(self, challenge): + digest = HMAC( self.password, challenge).hexdigest() + return "%s %s" % (self.user, digest) diff --git a/qpid/python/qpid/saslmech/cram_md5_hex.py b/qpid/python/qpid/saslmech/cram_md5_hex.py new file mode 100644 index 0000000000..03463db083 --- /dev/null +++ b/qpid/python/qpid/saslmech/cram_md5_hex.py @@ -0,0 +1,30 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from sasl import Sasl +from hmac import HMAC +from hashlib import md5 + +class CRAM_MD5_HEX(Sasl): + + def response(self, challenge): + m = md5() + m.update(self.password) + digest = HMAC( m.hexdigest(), challenge).hexdigest() + return "%s %s" % (self.user, digest) diff --git a/qpid/python/qpid/saslmech/external.py b/qpid/python/qpid/saslmech/external.py new file mode 100644 index 0000000000..51c8d97530 --- /dev/null +++ b/qpid/python/qpid/saslmech/external.py @@ -0,0 +1,27 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from sasl import Sasl + + +class EXTERNAL(Sasl): + """Sasl mechanism used when SSL with client-auth is in use""" + + def prerequisitesOk(self): + return True diff --git a/qpid/python/qpid/saslmech/finder.py b/qpid/python/qpid/saslmech/finder.py new file mode 100644 index 0000000000..1dda9ec48f --- /dev/null +++ b/qpid/python/qpid/saslmech/finder.py @@ -0,0 +1,66 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + + +from logging import getLogger + +log = getLogger("qpid.saslmech") + +def get_sasl_mechanism(mechanismNames, username, password, namespace="qpid.saslmech", sasl_options=None): + """Given a list of SASL mechanism names, dynamically loads a SASL implementation + from namespace qpid.sasl.mech respecting a mechanism priority""" + + log.debug("Supported mechanism : %s", mechanismNames) + + instances = [] + for mechanismName in mechanismNames: + convertedName = mechanismName.replace("-","_") + canonicalName = "%s.%s.%s" % (namespace, convertedName.lower(), convertedName) + try: + log.debug("Checking for SASL implementation %s for mechanism %s", canonicalName, mechanismName) + clazz = _get_class(canonicalName) + log.debug("Found SASL implementation") + instance = clazz(username, password, mechanismName, sasl_options) + if (instance.prerequisitesOk()): + instances.append(instance) + else: + log.debug("SASL mechanism %s unavailable as the prerequistes for this mechanism have not been met", mechanismName) + except (ImportError, AttributeError), e: + # Unknown mechanism - this is normal if the server supports mechanism that the client does not + log.debug("Could not load implementation for %s", canonicalName) + pass + + if instances: + instances.sort(key=lambda x : x.priority(), reverse=True) + sasl = instances[0] + log.debug("Selected SASL mechanism %s", sasl.mechanismName()) + return sasl + else: + return None + +def _get_class( kls ): + parts = kls.split('.') + module = ".".join(parts[:-1]) + m = __import__( module ) + for comp in parts[1:]: + m = getattr(m, comp) + return m + + + diff --git a/qpid/python/qpid/saslmech/plain.py b/qpid/python/qpid/saslmech/plain.py new file mode 100644 index 0000000000..8e6fb74f33 --- /dev/null +++ b/qpid/python/qpid/saslmech/plain.py @@ -0,0 +1,28 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from sasl import Sasl + +class PLAIN(Sasl): + + def initialResponse(self): + return "\x00" + self.user + "\x00" + self.password + + def priority(self): + return 0
\ No newline at end of file diff --git a/qpid/python/qpid/saslmech/sasl.py b/qpid/python/qpid/saslmech/sasl.py new file mode 100644 index 0000000000..7b1ae058db --- /dev/null +++ b/qpid/python/qpid/saslmech/sasl.py @@ -0,0 +1,44 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +class SaslException(Exception): pass + +class Sasl: + + def __init__(self, user, password, name, sasl_options = None): + self.user = user + self.password = password + self.name = name + self.sasl_options = sasl_options + + def prerequisitesOk(self): + return self.user is not None and self.password is not None + + def initialResponse(self): + return + + def response(self, challenge): + return + + def priority(self): + """Priority of the mechanism. Mechanism with a higher value will be chosen in preference to those with a lower priority""" + return 1 + + def mechanismName(self): + return self.name diff --git a/qpid/python/qpid/saslmech/scram.py b/qpid/python/qpid/saslmech/scram.py new file mode 100644 index 0000000000..11a2d2fbe4 --- /dev/null +++ b/qpid/python/qpid/saslmech/scram.py @@ -0,0 +1,91 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from hmac import HMAC +from binascii import b2a_hex +from sasl import Sasl +import os +import base64 + +class SCRAM_base(Sasl): + + def __init__(self, algorithm, user, password, name, sasl_options=None): + Sasl.__init__(self, user, password, name, sasl_options) + self.algorithm = algorithm + self.client_nonce = b2a_hex(os.urandom(16)) + self.server_signature = None + + def initialResponse(self): + name = self.user.replace("=","=3D").replace(",","=2C") + self.client_first_message = "n=" + name + ",r=" + self.client_nonce + return "n,," + self.client_first_message + + + def response(self, challenge): + if(self.server_signature): + self.evaluateOutcome(challenge) + return "" + else: + serverChallenge, salt, iterations = challenge.split(",") + self.server_nonce = serverChallenge[2:] + if self.server_nonce.find(self.client_nonce) != 0: + raise SaslException("Server nonce does not start with client nonce") + self.salt = base64.b64decode(salt[2:]) + + iterations = int(iterations[2:]) + + hmac = HMAC(key=self.password.replace("=","=3D").replace(",","=2C"),digestmod=self.algorithm) + + hmac.update(self.salt) + hmac.update("\x00\x00\x00\x01") + + saltedPassword = hmac.digest() + previous = saltedPassword + + for i in range(1,iterations): + hmac = HMAC(key=self.password.replace("=","=3D").replace(",","=2C"),digestmod=self.algorithm) + hmac.update(previous) + previous = hmac.digest() + saltedPassword = ''.join(chr(ord(a) ^ ord(b)) for a,b in zip(saltedPassword,previous)) + + clientFinalMessageWithoutProof = "c=" + base64.b64encode("n,,") + ",r=" + self.server_nonce + authMessage = self.client_first_message + "," + challenge + "," + clientFinalMessageWithoutProof + + clientKey = HMAC(key=saltedPassword,msg="Client Key",digestmod=self.algorithm).digest() + hashFunc = self.algorithm() + hashFunc.update(clientKey) + storedKey = hashFunc.digest() + + clientSignature = HMAC(key=storedKey, msg=authMessage, digestmod=self.algorithm).digest() + + clientProof = ''.join(chr(ord(a) ^ ord(b)) for a,b in zip(clientKey,clientSignature)) + + serverKey = HMAC(key=saltedPassword,msg="Server Key",digestmod=self.algorithm).digest() + + self.server_signature = HMAC(key=serverKey,msg=authMessage,digestmod=self.algorithm).digest() + return clientFinalMessageWithoutProof + ",p=" + base64.b64encode(clientProof) + + + def evaluateOutcome(self, challenge): + serverVerification = challenge.split(",")[0] + + serverSignature = base64.b64decode(serverVerification[2:]) + if serverSignature != self.server_signature: + raise SaslException("Server verification failed") + return diff --git a/qpid/python/qpid/saslmech/scram_sha_1.py b/qpid/python/qpid/saslmech/scram_sha_1.py new file mode 100644 index 0000000000..83f58f8e76 --- /dev/null +++ b/qpid/python/qpid/saslmech/scram_sha_1.py @@ -0,0 +1,27 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from scram import SCRAM_base +from hashlib import sha1 + +class SCRAM_SHA_1(SCRAM_base): + + def __init__(self, user, password, name, sasl_options=None): + SCRAM_base.__init__(self, sha1, user, password, name, sasl_options) + diff --git a/qpid/python/qpid/saslmech/scram_sha_256.py b/qpid/python/qpid/saslmech/scram_sha_256.py new file mode 100644 index 0000000000..cc894895c0 --- /dev/null +++ b/qpid/python/qpid/saslmech/scram_sha_256.py @@ -0,0 +1,25 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from scram import SCRAM_base +import hashlib + +class SCRAM_SHA_256(SCRAM_base): + def __init__(self, user, password, name, sasl_options=None): + SCRAM_base.__init__(self,hashlib.sha256,user,password, name, sasl_options)
\ No newline at end of file diff --git a/qpid/python/qpid/selector.py b/qpid/python/qpid/selector.py new file mode 100644 index 0000000000..d2f4c1fc88 --- /dev/null +++ b/qpid/python/qpid/selector.py @@ -0,0 +1,153 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import atexit, time, errno, os +from compat import select, set, selectable_waiter +from threading import Thread, Lock + +class Acceptor: + + def __init__(self, sock, handler): + self.sock = sock + self.handler = handler + + def fileno(self): + return self.sock.fileno() + + def reading(self): + return True + + def writing(self): + return False + + def readable(self): + sock, addr = self.sock.accept() + self.handler(sock) + +class Selector: + + lock = Lock() + DEFAULT = None + _current_pid = None + + @staticmethod + def default(): + Selector.lock.acquire() + try: + if Selector.DEFAULT is None or Selector._current_pid != os.getpid(): + sel = Selector() + atexit.register(sel.stop) + sel.start() + Selector.DEFAULT = sel + Selector._current_pid = os.getpid() + return Selector.DEFAULT + finally: + Selector.lock.release() + + def __init__(self): + self.selectables = set() + self.reading = set() + self.writing = set() + self.waiter = selectable_waiter() + self.reading.add(self.waiter) + self.stopped = False + self.thread = None + + def wakeup(self): + self.waiter.wakeup() + + def register(self, selectable): + self.selectables.add(selectable) + self.modify(selectable) + + def _update(self, selectable): + if selectable.reading(): + self.reading.add(selectable) + else: + self.reading.discard(selectable) + if selectable.writing(): + self.writing.add(selectable) + else: + self.writing.discard(selectable) + return selectable.timing() + + def modify(self, selectable): + self._update(selectable) + self.wakeup() + + def unregister(self, selectable): + self.reading.discard(selectable) + self.writing.discard(selectable) + self.selectables.discard(selectable) + self.wakeup() + + def start(self): + self.stopped = False + self.thread = Thread(target=self.run) + self.thread.setDaemon(True) + self.thread.start(); + + def run(self): + while not self.stopped: + wakeup = None + for sel in self.selectables.copy(): + t = self._update(sel) + if t is not None: + if wakeup is None: + wakeup = t + else: + wakeup = min(wakeup, t) + + rd = [] + wr = [] + ex = [] + + while True: + try: + if wakeup is None: + timeout = None + else: + timeout = max(0, wakeup - time.time()) + rd, wr, ex = select(self.reading, self.writing, (), timeout) + break + except Exception, (err, strerror): + # Repeat the select call if we were interrupted. + if err == errno.EINTR: + continue + else: + raise + + for sel in wr: + if sel.writing(): + sel.writeable() + + for sel in rd: + if sel.reading(): + sel.readable() + + now = time.time() + for sel in self.selectables.copy(): + w = sel.timing() + if w is not None and now > w: + sel.timeout() + + def stop(self, timeout=None): + self.stopped = True + self.wakeup() + self.thread.join(timeout) + self.thread = None diff --git a/qpid/python/qpid/session.py b/qpid/python/qpid/session.py new file mode 100644 index 0000000000..95714a128a --- /dev/null +++ b/qpid/python/qpid/session.py @@ -0,0 +1,308 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from threading import Condition, RLock, Lock, currentThread +from generator import command_invoker +from datatypes import RangedSet, Struct, Future +from codec010 import StringCodec +from queue import Queue +from datatypes import Message, serial +from ops import Command, MessageTransfer +from util import wait, notify +from exceptions import * +from logging import getLogger + +log = getLogger("qpid.io.cmd") +msg = getLogger("qpid.io.msg") + +class SessionException(Exception): pass +class SessionClosed(SessionException): pass +class SessionDetached(SessionException): pass + +def client(*args): + return Client(*args) + +def server(*args): + return Server(*args) + +INCOMPLETE = object() + +class Session(command_invoker()): + + def __init__(self, name, auto_sync=True, timeout=10, delegate=client): + self.name = name + self.auto_sync = auto_sync + self.need_sync = True + self.timeout = timeout + self.channel = None + self.invoke_lock = Lock() + self._closing = False + self._closed = False + + self.condition = Condition() + + self.send_id = True + self.receiver = Receiver(self) + self.sender = Sender(self) + + self.lock = RLock() + self._incoming = {} + self.results = {} + self.exceptions = [] + + self.delegate = delegate(self) + + def incoming(self, destination): + self.lock.acquire() + try: + queue = self._incoming.get(destination) + if queue == None: + queue = Incoming(self, destination) + self._incoming[destination] = queue + return queue + finally: + self.lock.release() + + def error(self): + exc = self.exceptions[:] + if len(exc) == 0: + return None + elif len(exc) == 1: + return exc[0] + else: + return tuple(exc) + + def sync(self, timeout=None): + ch = self.channel + if ch is not None and currentThread() == ch.connection.thread: + raise SessionException("deadlock detected") + if self.need_sync: + self.execution_sync(sync=True) + last = self.sender.next_id - 1 + if not wait(self.condition, lambda: + last in self.sender._completed or self.exceptions, + timeout): + raise Timeout() + if self.exceptions: + raise SessionException(self.error()) + + def close(self, timeout=None): + self.invoke_lock.acquire() + try: + self._closing = True + self.channel.session_detach(self.name) + finally: + self.invoke_lock.release() + if not wait(self.condition, lambda: self._closed, timeout): + raise Timeout() + + def closed(self): + self.lock.acquire() + try: + if self._closed: return + + error = self.error() + for id in self.results: + f = self.results[id] + f.error(error) + self.results.clear() + + for q in self._incoming.values(): + q.close(error) + + self._closed = True + notify(self.condition) + finally: + self.lock.release() + + def invoke(self, op, args, kwargs): + if issubclass(op, Command): + self.invoke_lock.acquire() + try: + return self.do_invoke(op, args, kwargs) + finally: + self.invoke_lock.release() + else: + return op(*args, **kwargs) + + def do_invoke(self, op, args, kwargs): + if self._closing: + raise SessionClosed() + + ch = self.channel + if ch == None: + raise SessionDetached() + + if op == MessageTransfer: + if len(args) == len(op.FIELDS) + 1: + message = args[-1] + args = args[:-1] + else: + message = kwargs.pop("message", None) + if message is not None: + kwargs["headers"] = message.headers + kwargs["payload"] = message.body + + cmd = op(*args, **kwargs) + cmd.sync = self.auto_sync or cmd.sync + self.need_sync = not cmd.sync + cmd.channel = ch.id + + if op.RESULT: + result = Future(exception=SessionException) + self.results[self.sender.next_id] = result + + self.send(cmd) + + log.debug("SENT %s", cmd) + if op == MessageTransfer: + msg.debug("SENT %s", cmd) + + if op.RESULT: + if self.auto_sync: + return result.get(self.timeout) + else: + return result + elif self.auto_sync: + self.sync(self.timeout) + + def received(self, cmd): + self.receiver.received(cmd) + self.dispatch(cmd) + + def dispatch(self, cmd): + log.debug("RECV %s", cmd) + + result = getattr(self.delegate, cmd.NAME)(cmd) + if result is INCOMPLETE: + return + elif result is not None: + self.execution_result(cmd.id, result) + + self.receiver.completed(cmd) + # XXX: don't forget to obey sync for manual completion as well + if cmd.sync: + self.channel.session_completed(self.receiver._completed) + + def send(self, cmd): + self.sender.send(cmd) + + def __repr__(self): + return '<Session: %s, %s>' % (self.name, self.channel) + +class Receiver: + + def __init__(self, session): + self.session = session + self.next_id = None + self._completed = RangedSet() + + def received(self, cmd): + if self.next_id == None: + raise Exception("todo") + cmd.id = self.next_id + self.next_id += 1 + + def completed(self, cmd): + if cmd.id == None: + raise ValueError("cannot complete unidentified command") + self._completed.add(cmd.id) + + def known_completed(self, commands): + completed = RangedSet() + for c in self._completed.ranges: + for kc in commands.ranges: + if c.lower in kc and c.upper in kc: + break + else: + completed.add_range(c) + self._completed = completed + +class Sender: + + def __init__(self, session): + self.session = session + self.next_id = serial(0) + self.commands = [] + self._completed = RangedSet() + + def send(self, cmd): + ch = self.session.channel + if ch is None: + raise SessionDetached() + cmd.id = self.next_id + self.next_id += 1 + if self.session.send_id: + self.session.send_id = False + ch.session_command_point(cmd.id, 0) + self.commands.append(cmd) + ch.connection.write_op(cmd) + + def completed(self, commands): + idx = 0 + while idx < len(self.commands): + cmd = self.commands[idx] + if cmd.id in commands: + del self.commands[idx] + else: + idx += 1 + for range in commands.ranges: + self._completed.add(range.lower, range.upper) + +class Incoming(Queue): + + def __init__(self, session, destination): + Queue.__init__(self) + self.session = session + self.destination = destination + + def start(self): + self.session.message_set_flow_mode(self.destination, self.session.flow_mode.credit) + for unit in self.session.credit_unit.VALUES: + self.session.message_flow(self.destination, unit, 0xFFFFFFFFL) + + def stop(self): + self.session.message_cancel(self.destination) + self.listen(None) + +class Delegate: + + def __init__(self, session): + self.session = session + + #XXX: do something with incoming accepts + def message_accept(self, ma): None + + def execution_result(self, er): + future = self.session.results.pop(er.command_id) + future.set(er.value) + + def execution_exception(self, ex): + self.session.exceptions.append(ex) + +class Client(Delegate): + + def message_transfer(self, cmd): + m = Message(cmd.payload) + m.headers = cmd.headers + m.id = cmd.id + messages = self.session.incoming(cmd.destination) + messages.put(m) + msg.debug("RECV %s", m) + return INCOMPLETE diff --git a/qpid/python/qpid/spec08.py b/qpid/python/qpid/spec08.py new file mode 100644 index 0000000000..a0047e7107 --- /dev/null +++ b/qpid/python/qpid/spec08.py @@ -0,0 +1,504 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +""" +This module loads protocol metadata into python objects. It provides +access to spec metadata via a python object model, and can also +dynamically creating python methods, classes, and modules based on the +spec metadata. All the generated methods have proper signatures and +doc strings based on the spec metadata so the python help system can +be used to browse the spec documentation. The generated methods all +dispatch to the self.invoke(meth, args) callback of the containing +class so that the generated code can be reused in a variety of +situations. +""" + +import re, new, mllib, qpid +from util import fill + +class SpecContainer: + + def __init__(self): + self.items = [] + self.byname = {} + self.byid = {} + self.indexes = {} + + def add(self, item): + if self.byname.has_key(item.name): + raise ValueError("duplicate name: %s" % item) + if item.id == None: + item.id = len(self) + elif self.byid.has_key(item.id): + raise ValueError("duplicate id: %s" % item) + self.indexes[item] = len(self.items) + self.items.append(item) + self.byname[item.name] = item + self.byid[item.id] = item + + def index(self, item): + try: + return self.indexes[item] + except KeyError: + raise ValueError(item) + + def __iter__(self): + return iter(self.items) + + def __len__(self): + return len(self.items) + +class Metadata: + + PRINT = [] + + def __init__(self): + pass + + def __str__(self): + args = map(lambda f: "%s=%s" % (f, getattr(self, f)), self.PRINT) + return "%s(%s)" % (self.__class__.__name__, ", ".join(args)) + + def __repr__(self): + return str(self) + +class Spec(Metadata): + + PRINT=["major", "minor", "file"] + + def __init__(self, major, minor, file): + Metadata.__init__(self) + self.major = major + self.minor = minor + self.file = file + self.constants = SpecContainer() + self.domains = SpecContainer() + self.classes = SpecContainer() + # methods indexed by classname_methname + self.methods = {} + # structs by type code + self.structs = {} + + def post_load(self): + self.module = self.define_module("amqp%s%s" % (self.major, self.minor)) + self.klass = self.define_class("Amqp%s%s" % (self.major, self.minor)) + + def method(self, name): + if not self.methods.has_key(name): + for cls in self.classes: + clen = len(cls.name) + if name.startswith(cls.name) and name[clen] == "_": + end = name[clen + 1:] + if cls.methods.byname.has_key(end): + self.methods[name] = cls.methods.byname[end] + return self.methods.get(name) + + def parse_method(self, name): + parts = re.split(r"\s*\.\s*", name) + if len(parts) != 2: + raise ValueError(name) + klass, meth = parts + return self.classes.byname[klass].methods.byname[meth] + + def struct(self, name, *args, **kwargs): + type = self.domains.byname[name].type + return qpid.Struct(type, *args, **kwargs) + + def define_module(self, name, doc = None): + module = new.module(name, doc) + module.__file__ = self.file + for c in self.classes: + cls = c.define_class(c.name) + cls.__module__ = module.__name__ + setattr(module, c.name, cls) + return module + + def define_class(self, name): + methods = {} + for c in self.classes: + for m in c.methods: + meth = m.klass.name + "_" + m.name + methods[meth] = m.define_method(meth) + return type(name, (), methods) + +class Constant(Metadata): + + PRINT=["name", "id"] + + def __init__(self, spec, name, id, klass, docs): + Metadata.__init__(self) + self.spec = spec + self.name = name + self.id = id + self.klass = klass + self.docs = docs + +class Domain(Metadata): + + PRINT=["name", "type"] + + def __init__(self, spec, name, type, description, docs): + Metadata.__init__(self) + self.spec = spec + self.id = None + self.name = name + self.type = type + self.description = description + self.docs = docs + +class Struct(Metadata): + + PRINT=["size", "type", "pack"] + + def __init__(self, size, type, pack): + Metadata.__init__(self) + self.size = size + self.type = type + self.pack = pack + self.fields = SpecContainer() + +class Class(Metadata): + + PRINT=["name", "id"] + + def __init__(self, spec, name, id, handler, docs): + Metadata.__init__(self) + self.spec = spec + self.name = name + self.id = id + self.handler = handler + self.fields = SpecContainer() + self.methods = SpecContainer() + self.docs = docs + + def define_class(self, name): + methods = {} + for m in self.methods: + methods[m.name] = m.define_method(m.name) + return type(name, (), methods) + +class Method(Metadata): + + PRINT=["name", "id"] + + def __init__(self, klass, name, id, content, responses, result, synchronous, + description, docs): + Metadata.__init__(self) + self.klass = klass + self.name = name + self.id = id + self.content = content + self.responses = responses + self.result = result + self.synchronous = synchronous + self.fields = SpecContainer() + self.description = description + self.docs = docs + self.response = False + + def is_l4_command(self): + return self.klass.name not in ["execution", "channel", "connection", "session"] + + def arguments(self, *args, **kwargs): + nargs = len(args) + len(kwargs) + maxargs = len(self.fields) + if nargs > maxargs: + self._type_error("takes at most %s arguments (%s) given", maxargs, nargs) + result = [] + for f in self.fields: + idx = self.fields.index(f) + if idx < len(args): + result.append(args[idx]) + elif kwargs.has_key(f.name): + result.append(kwargs.pop(f.name)) + else: + result.append(Method.DEFAULTS[f.type]) + for key, value in kwargs.items(): + if self.fields.byname.has_key(key): + self._type_error("got multiple values for keyword argument '%s'", key) + else: + self._type_error("got an unexpected keyword argument '%s'", key) + return tuple(result) + + def _type_error(self, msg, *args): + raise TypeError("%s %s" % (self.name, msg % args)) + + def docstring(self): + s = "\n\n".join([fill(d, 2) for d in [self.description] + self.docs]) + for f in self.fields: + if f.docs: + s += "\n\n" + "\n\n".join([fill(f.docs[0], 4, f.name)] + + [fill(d, 4) for d in f.docs[1:]]) + if self.responses: + s += "\n\nValid responses: " + for r in self.responses: + s += r.name + " " + return s + + METHOD = "__method__" + DEFAULTS = {"bit": False, + "shortstr": "", + "longstr": "", + "table": {}, + "array": [], + "octet": 0, + "short": 0, + "long": 0, + "longlong": 0, + "timestamp": 0, + "content": None, + "uuid": "", + "rfc1982_long": 0, + "rfc1982_long_set": [], + "long_struct": None} + + def define_method(self, name): + g = {Method.METHOD: self} + l = {} + args = [(f.name, Method.DEFAULTS[f.type]) for f in self.fields] + methargs = args[:] + if self.content: + args += [("content", None)] + code = "def %s(self, %s):\n" % \ + (name, ", ".join(["%s = %r" % a for a in args])) + code += " %r\n" % self.docstring() + argnames = ", ".join([a[0] for a in methargs]) + code += " return self.invoke(%s" % Method.METHOD + if argnames: + code += ", (%s,)" % argnames + else: + code += ", ()" + if self.content: + code += ", content" + code += ")" + exec code in g, l + return l[name] + +class Field(Metadata): + + PRINT=["name", "id", "type"] + + def __init__(self, name, id, type, domain, description, docs): + Metadata.__init__(self) + self.name = name + self.id = id + self.type = type + self.domain = domain + self.description = description + self.docs = docs + + def default(self): + if isinstance(self.type, Struct): + return None + else: + return Method.DEFAULTS[self.type] + +WIDTHS = { + "octet": 1, + "short": 2, + "long": 4 + } + +def width(st, default=None): + if st in (None, "none", ""): + return default + else: + return WIDTHS[st] + +def get_result(nd, spec): + result = nd["result"] + if not result: return None + name = result["@domain"] + if name != None: return spec.domains.byname[name] + st_nd = result["struct"] + st = Struct(width(st_nd["@size"]), int(result.parent.parent["@index"])*256 + + int(st_nd["@type"]), width(st_nd["@pack"], 2)) + spec.structs[st.type] = st + load_fields(st_nd, st.fields, spec.domains.byname) + return st + +def get_desc(nd): + label = nd["@label"] + if not label: + label = nd.text() + if label: + label = label.strip() + return label + +def get_docs(nd): + return [n.text() for n in nd.query["doc"]] + +def load_fields(nd, l, domains): + for f_nd in nd.query["field"]: + type = f_nd["@domain"] + if type == None: + type = f_nd["@type"] + type = pythonize(type) + domain = None + while domains.has_key(type) and domains[type].type != type: + domain = domains[type] + type = domain.type + l.add(Field(pythonize(f_nd["@name"]), f_nd.index(), type, domain, + get_desc(f_nd), get_docs(f_nd))) + +def load(specfile, *errata): + doc = mllib.xml_parse(specfile) + spec_root = doc["amqp"] + spec = Spec(int(spec_root["@major"]), int(spec_root["@minor"]), specfile) + + for root in [spec_root] + map(lambda x: mllib.xml_parse(x)["amqp"], errata): + # constants + for nd in root.query["constant"]: + val = nd["@value"] + if val.startswith("0x"): val = int(val, 16) + else: val = int(val) + const = Constant(spec, pythonize(nd["@name"]), val, nd["@class"], + get_docs(nd)) + try: + spec.constants.add(const) + except ValueError, e: + pass + #print "Warning:", e + + # domains are typedefs + structs = [] + for nd in root.query["domain"]: + type = nd["@type"] + if type == None: + st_nd = nd["struct"] + code = st_nd["@type"] + if code not in (None, "", "none"): + code = int(code) + type = Struct(width(st_nd["@size"]), code, width(st_nd["@pack"], 2)) + if type.type != None: + spec.structs[type.type] = type + structs.append((type, st_nd)) + else: + type = pythonize(type) + domain = Domain(spec, pythonize(nd["@name"]), type, get_desc(nd), + get_docs(nd)) + spec.domains.add(domain) + + # structs + for st, st_nd in structs: + load_fields(st_nd, st.fields, spec.domains.byname) + + # classes + for c_nd in root.query["class"]: + cname = pythonize(c_nd["@name"]) + if spec.classes.byname.has_key(cname): + klass = spec.classes.byname[cname] + else: + klass = Class(spec, cname, int(c_nd["@index"]), c_nd["@handler"], + get_docs(c_nd)) + spec.classes.add(klass) + + added_methods = [] + load_fields(c_nd, klass.fields, spec.domains.byname) + for m_nd in c_nd.query["method"]: + mname = pythonize(m_nd["@name"]) + if klass.methods.byname.has_key(mname): + meth = klass.methods.byname[mname] + else: + meth = Method(klass, mname, + int(m_nd["@index"]), + m_nd["@content"] == "1", + [pythonize(nd["@name"]) for nd in m_nd.query["response"]], + get_result(m_nd, spec), + m_nd["@synchronous"] == "1", + get_desc(m_nd), + get_docs(m_nd)) + klass.methods.add(meth) + added_methods.append(meth) + load_fields(m_nd, meth.fields, spec.domains.byname) + # resolve the responses + for m in added_methods: + m.responses = [klass.methods.byname[r] for r in m.responses] + for resp in m.responses: + resp.response = True + + spec.post_load() + return spec + +REPLACE = {" ": "_", "-": "_"} +KEYWORDS = {"global": "global_", + "return": "return_"} + +def pythonize(name): + name = str(name) + for key, val in REPLACE.items(): + name = name.replace(key, val) + try: + name = KEYWORDS[name] + except KeyError: + pass + return name + +class Rule(Metadata): + + PRINT = ["text", "implement", "tests"] + + def __init__(self, text, implement, tests, path): + self.text = text + self.implement = implement + self.tests = tests + self.path = path + +def find_rules(node, rules): + if node.name == "rule": + rules.append(Rule(node.text, node.get("@implement"), + [ch.text for ch in node if ch.name == "test"], + node.path())) + if node.name == "doc" and node.get("@name") == "rule": + tests = [] + if node.has("@test"): + tests.append(node["@test"]) + rules.append(Rule(node.text, None, tests, node.path())) + for child in node: + find_rules(child, rules) + +def load_rules(specfile): + rules = [] + find_rules(xmlutil.parse(specfile), rules) + return rules + +def test_summary(): + template = """ + <html><head><title>AMQP Tests</title></head> + <body> + <table width="80%%" align="center"> + %s + </table> + </body> + </html> + """ + rows = [] + for rule in load_rules("amqp.org/specs/amqp7.xml"): + if rule.tests: + tests = ", ".join(rule.tests) + else: + tests = " " + rows.append('<tr bgcolor="#EEEEEE"><td><b>Path:</b> %s</td>' + '<td><b>Implement:</b> %s</td>' + '<td><b>Tests:</b> %s</td></tr>' % + (rule.path[len("/root/amqp"):], rule.implement, tests)) + rows.append('<tr><td colspan="3">%s</td></tr>' % rule.text) + rows.append('<tr><td colspan="3"> </td></tr>') + + print template % "\n".join(rows) diff --git a/qpid/python/qpid/specs/amqp-0-10-qpid-errata-stripped.xml b/qpid/python/qpid/specs/amqp-0-10-qpid-errata-stripped.xml new file mode 100644 index 0000000000..83ddf709e9 --- /dev/null +++ b/qpid/python/qpid/specs/amqp-0-10-qpid-errata-stripped.xml @@ -0,0 +1,1203 @@ +<?xml version="1.0"?> + +<!-- +(c) Copyright Cisco Systems, Credit Suisse, Deutsche Borse Systems, +Envoy Technologies, Inc., Goldman Sachs, IONA Technologies PLC, iMatix +Corporation sprl.,JPMorgan Chase Bank Inc. N.A, Novell, Rabbit +Technologies Ltd., Red Hat, Inc., TWIST Process Innovations ltd, and +29West Inc. 2006, 2007. + +Copyright (c) 2009 AMQP Working Group. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +1. Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright +notice, this list of conditions and the following disclaimer in the +documentation and/or other materials provided with the distribution. +3. The name of the author may not be used to endorse or promote products +derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +--> + +<amqp major="0" xmlns="http://www.amqp.org/schema/amqp.xsd" port="5672" minor="10"> + <type name="bin8" code="0x00" fixed-width="1"/> + <type name="int8" code="0x01" fixed-width="1"/> + <type name="uint8" code="0x02" fixed-width="1"/> + <type name="char" code="0x04" fixed-width="1"/> + <type name="boolean" code="0x08" fixed-width="1"/> + <type name="bin16" code="0x10" fixed-width="2"/> + <type name="int16" code="0x11" fixed-width="2"/> + <type name="uint16" code="0x12" fixed-width="2"/> + <type name="bin32" code="0x20" fixed-width="4"/> + <type name="int32" code="0x21" fixed-width="4"/> + <type name="uint32" code="0x22" fixed-width="4"/> + <type name="float" code="0x23" fixed-width="4"/> + <type name="char-utf32" code="0x27" fixed-width="4"/> + <type name="sequence-no" fixed-width="4"/> + <type name="bin64" code="0x30" fixed-width="8"/> + <type name="int64" code="0x31" fixed-width="8"/> + <type name="uint64" code="0x32" fixed-width="8"/> + <type name="double" code="0x33" fixed-width="8"/> + <type name="datetime" code="0x38" fixed-width="8"/> + <type name="bin128" code="0x40" fixed-width="16"/> + <type name="uuid" code="0x48" fixed-width="16"/> + <type name="bin256" code="0x50" fixed-width="32"/> + <type name="bin512" code="0x60" fixed-width="64"/> + <type name="bin1024" code="0x70" fixed-width="128"/> + <type name="vbin8" code="0x80" variable-width="1"/> + <type name="str8-latin" code="0x84" variable-width="1"/> + <type name="str8" code="0x85" variable-width="1"/> + <type name="str8-utf16" code="0x86" variable-width="1"/> + <type name="vbin16" code="0x90" variable-width="2"/> + <type name="str16-latin" code="0x94" variable-width="2"/> + <type name="str16" code="0x95" variable-width="2"/> + <type name="str16-utf16" code="0x96" variable-width="2"/> + <type name="byte-ranges" variable-width="2"/> + <type name="sequence-set" variable-width="2"/> + <type name="vbin32" code="0xa0" variable-width="4"/> + <type name="map" code="0xa8" variable-width="4"/> + <type name="list" code="0xa9" variable-width="4"/> + <type name="array" code="0xaa" variable-width="4"/> + <type name="struct32" code="0xab" variable-width="4"/> + <type name="bin40" code="0xc0" fixed-width="5"/> + <type name="dec32" code="0xc8" fixed-width="5"/> + <type name="bin72" code="0xd0" fixed-width="9"/> + <type name="dec64" code="0xd8" fixed-width="9"/> + <type name="void" code="0xf0" fixed-width="0"/> + <type name="bit" code="0xf1" fixed-width="0"/> + <constant name="MIN-MAX-FRAME-SIZE" value="4096"/> + <domain name="segment-type" type="uint8"> + <enum> + <choice name="control" value="0"/> + <choice name="command" value="1"/> + <choice name="header" value="2"/> + <choice name="body" value="3"/> + </enum> + </domain> + <domain name="track" type="uint8"> + <enum> + <choice name="control" value="0"/> + <choice name="command" value="1"/> + </enum> + </domain> + <domain name="str16-array" type="array"/> + <class name="connection" code="0x1"> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="close-code" type="uint16"> + <enum> + <choice name="normal" value="200"/> + <choice name="connection-forced" value="320"/> + <choice name="invalid-path" value="402"/> + <choice name="framing-error" value="501"/> + </enum> + </domain> + <domain name="amqp-host-url" type="str16"/> + <domain name="amqp-host-array" type="array"/> + <control name="start" code="0x1"> + <rule name="protocol-name"/> + <rule name="client-support"/> + <implement role="client" handle="MUST"/> + <response name="start-ok"/> + <field name="server-properties" type="map"> + <rule name="required-fields"/> + </field> + <field name="mechanisms" type="str16-array" required="true"/> + <field name="locales" type="str16-array" required="true"> + <rule name="required-support"/> + </field> + </control> + <control name="start-ok" code="0x2"> + <implement role="server" handle="MUST"/> + <field name="client-properties" type="map"> + <rule name="required-fields"/> + </field> + <field name="mechanism" type="str8" required="true"> + <rule name="security"/> + <rule name="validity"/> + </field> + <field name="response" type="vbin32" required="true"/> + <field name="locale" type="str8" required="true"/> + </control> + <control name="secure" code="0x3"> + <implement role="client" handle="MUST"/> + <response name="secure-ok"/> + <field name="challenge" type="vbin32" required="true"/> + </control> + <control name="secure-ok" code="0x4"> + <implement role="server" handle="MUST"/> + <field name="response" type="vbin32" required="true"/> + </control> + <control name="tune" code="0x5"> + <implement role="client" handle="MUST"/> + <response name="tune-ok"/> + <field name="channel-max" type="uint16"/> + <field name="max-frame-size" type="uint16"> + <rule name="minimum"/> + </field> + <field name="heartbeat-min" type="uint16"/> + <field name="heartbeat-max" type="uint16"> + <rule name="permitted-range"/> + <rule name="no-heartbeat-min"/> + </field> + </control> + <control name="tune-ok" code="0x6"> + <implement role="server" handle="MUST"/> + <field name="channel-max" type="uint16" required="true"> + <rule name="upper-limit"/> + <rule name="available-channels"/> + </field> + <field name="max-frame-size" type="uint16"> + <rule name="minimum"/> + <rule name="upper-limit"/> + <rule name="max-frame-size"/> + </field> + <field name="heartbeat" type="uint16"> + <rule name="permitted-range"/> + <rule name="no-heartbeat-min"/> + </field> + </control> + <control name="open" code="0x7"> + <implement role="server" handle="MUST"/> + <response name="open-ok"/> + <response name="redirect"/> + <field name="virtual-host" type="str8" required="true"> + <rule name="separation"/> + <rule name="security"/> + </field> + <field name="capabilities" type="str16-array"/> + <field name="insist" type="bit"> + <rule name="behavior"/> + </field> + </control> + <control name="open-ok" code="0x8"> + <implement role="client" handle="MUST"/> + <field name="known-hosts" type="amqp-host-array"/> + </control> + <control name="redirect" code="0x9"> + <rule name="usage"/> + <implement role="client" handle="MUST"/> + <field name="host" type="amqp-host-url" required="true"/> + <field name="known-hosts" type="amqp-host-array"/> + </control> + <control name="heartbeat" code="0xa"> + <implement role="client" handle="MAY"/> + <implement role="server" handle="MAY"/> + </control> + <control name="close" code="0xb"> + <implement role="client" handle="MUST"/> + <implement role="server" handle="MUST"/> + <response name="close-ok"/> + <field name="reply-code" type="close-code" required="true"/> + <field name="reply-text" type="str8"/> + </control> + <control name="close-ok" code="0xc"> + <rule name="reporting"/> + <implement role="client" handle="MUST"/> + <implement role="server" handle="MUST"/> + </control> + </class> + <class name="session" code="0x2"> + <rule name="attachment"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <role name="sender" implement="MUST"/> + <role name="receiver" implement="MUST"/> + <domain name="name" type="vbin16"/> + <domain name="detach-code" type="uint8"> + <enum> + <choice name="normal" value="0"/> + <choice name="session-busy" value="1"/> + <choice name="transport-busy" value="2"/> + <choice name="not-attached" value="3"/> + <choice name="unknown-ids" value="4"/> + </enum> + </domain> + <domain name="commands" type="sequence-set"/> + <struct name="header" size="1" pack="1"> + <field name="sync" type="bit"/> + </struct> + <struct name="command-fragment" size="0" pack="0"> + <field name="command-id" type="sequence-no" required="true"/> + <field name="byte-ranges" type="byte-ranges" required="true"/> + </struct> + <domain name="command-fragments" type="array"/> + <control name="attach" code="0x1"> + <rule name="one-transport-per-session"/> + <rule name="one-session-per-transport"/> + <rule name="idempotence"/> + <rule name="scoping"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MAY"/> + <response name="attached"/> + <response name="detached"/> + <field name="name" type="name" required="true"/> + <field name="force" type="bit"/> + </control> + <control name="attached" code="0x2"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="name" type="name" required="true"/> + </control> + <control name="detach" code="0x3"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <response name="detached"/> + <field name="name" type="name" required="true"/> + </control> + <control name="detached" code="0x4"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="name" type="name" required="true"/> + <field name="code" type="detach-code" required="true"/> + </control> + <control name="request-timeout" code="0x5"> + <rule name="maximum-granted-timeout"/> + <implement role="sender" handle="MUST"/> + <implement role="receiver" handle="MUST"/> + <response name="timeout"/> + <field name="timeout" type="uint32"/> + </control> + <control name="timeout" code="0x6"> + <implement role="sender" handle="MUST"/> + <implement role="receiver" handle="MUST"/> + <field name="timeout" type="uint32"/> + </control> + <control name="command-point" code="0x7"> + <rule name="newly-attached-transports"/> + <rule name="zero-offset"/> + <rule name="nonzero-offset"/> + <implement role="receiver" handle="MUST"/> + <field name="command-id" type="sequence-no" required="true"/> + <field name="command-offset" type="uint64" required="true"/> + </control> + <control name="expected" code="0x8"> + <rule name="include-next-command"/> + <rule name="commands-empty-means-new-session"/> + <rule name="no-overlaps"/> + <rule name="minimal-fragments"/> + <implement role="sender" handle="MUST"/> + <field name="commands" type="commands" required="true"/> + <field name="fragments" type="command-fragments"/> + </control> + <control name="confirmed" code="0x9"> + <rule name="durability"/> + <rule name="no-overlaps"/> + <rule name="minimal-fragments"/> + <implement role="sender" handle="MUST"/> + <field name="commands" type="commands"> + <rule name="exclude-known-complete"/> + </field> + <field name="fragments" type="command-fragments"/> + </control> + <control name="completed" code="0xa"> + <rule name="known-completed-reply"/> + <rule name="delayed-reply"/> + <rule name="merged-reply"/> + <implement role="sender" handle="MUST"/> + <field name="commands" type="commands"> + <rule name="completed-implies-confirmed"/> + <rule name="exclude-known-complete"/> + </field> + <field name="timely-reply" type="bit"/> + </control> + <control name="known-completed" code="0xb"> + <rule name="stateless"/> + <implement role="receiver" handle="MUST"/> + <field name="commands" type="commands"> + <rule name="known-completed-implies-known-confirmed"/> + </field> + </control> + <control name="flush" code="0xc"> + <implement role="receiver" handle="MUST"/> + <field name="expected" type="bit"/> + <field name="confirmed" type="bit"/> + <field name="completed" type="bit"/> + </control> + <control name="gap" code="0xd"> + <rule name="gap-confirmation-and-completion"/> + <rule name="aborted-commands"/> + <rule name="completed-or-confirmed-commands"/> + <implement role="receiver" handle="MUST"/> + <field name="commands" type="commands"/> + </control> + </class> + <class name="execution" code="0x3"> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="error-code" type="uint16"> + <enum> + <choice name="unauthorized-access" value="403"/> + <choice name="not-found" value="404"/> + <choice name="resource-locked" value="405"/> + <choice name="precondition-failed" value="406"/> + <choice name="resource-deleted" value="408"/> + <choice name="illegal-state" value="409"/> + <choice name="command-invalid" value="503"/> + <choice name="resource-limit-exceeded" value="506"/> + <choice name="not-allowed" value="530"/> + <choice name="illegal-argument" value="531"/> + <choice name="not-implemented" value="540"/> + <choice name="internal-error" value="541"/> + <choice name="invalid-argument" value="542"/> + </enum> + </domain> + <command name="sync" code="0x1"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + </command> + <command name="result" code="0x2"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="command-id" type="sequence-no" required="true"/> + <field name="value" type="struct32"/> + </command> + <command name="exception" code="0x3"> + <implement role="client" handle="MUST"/> + <implement role="server" handle="MUST"/> + <field name="error-code" type="error-code" required="true"/> + <field name="command-id" type="sequence-no"/> + <field name="class-code" type="uint8"/> + <field name="command-code" type="uint8"/> + <field name="field-index" type="uint8"/> + <field name="description" type="str16"/> + <field name="error-info" type="map"/> + </command> + </class> + <class name="message" code="0x4"> + <rule name="persistent-message"/> + <rule name="no-persistent-message-discard"/> + <rule name="throttling"/> + <rule name="non-persistent-message-overflow"/> + <rule name="non-persistent-message-discard"/> + <rule name="min-priority-levels"/> + <rule name="priority-level-implementation"/> + <rule name="priority-delivery"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="destination" type="str8"/> + <domain name="accept-mode" type="uint8"> + <enum> + <choice name="explicit" value="0"/> + <choice name="none" value="1"/> + </enum> + </domain> + <domain name="acquire-mode" type="uint8"> + <enum> + <choice name="pre-acquired" value="0"/> + <choice name="not-acquired" value="1"/> + </enum> + </domain> + <domain name="reject-code" type="uint16"> + <enum> + <choice name="unspecified" value="0"/> + <choice name="unroutable" value="1"/> + <choice name="immediate" value="2"/> + </enum> + </domain> + <domain name="resume-id" type="str16"/> + <domain name="delivery-mode" type="uint8"> + <enum> + <choice name="non-persistent" value="1"/> + <choice name="persistent" value="2"/> + </enum> + </domain> + <domain name="delivery-priority" type="uint8"> + <enum> + <choice name="lowest" value="0"/> + <choice name="lower" value="1"/> + <choice name="low" value="2"/> + <choice name="below-average" value="3"/> + <choice name="medium" value="4"/> + <choice name="above-average" value="5"/> + <choice name="high" value="6"/> + <choice name="higher" value="7"/> + <choice name="very-high" value="8"/> + <choice name="highest" value="9"/> + </enum> + </domain> + <struct name="delivery-properties" code="0x1" size="4" pack="2"> + <field name="discard-unroutable" type="bit"/> + <field name="immediate" type="bit"/> + <field name="redelivered" type="bit"> + <rule name="implementation"/> + <rule name="hinting"/> + </field> + <field name="priority" type="delivery-priority" required="true"/> + <field name="delivery-mode" type="delivery-mode" required="true"/> + <field name="ttl" type="uint64"> + <rule name="ttl-decrement"/> + </field> + <field name="timestamp" type="datetime"/> + <field name="expiration" type="datetime"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <field name="resume-id" type="resume-id"/> + <field name="resume-ttl" type="uint64"/> + </struct> + <struct name="fragment-properties" code="0x2" size="4" pack="2"> + <field name="first" type="bit" default="1"/> + <field name="last" type="bit" default="1"/> + <field name="fragment-size" type="uint64"/> + </struct> + <struct name="reply-to" size="2" pack="2"> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + </struct> + <struct name="message-properties" code="0x3" size="4" pack="2"> + <field name="content-length" type="uint64"/> + <field name="message-id" type="uuid"> + <rule name="unique"/> + <rule name="immutable"/> + </field> + <field name="correlation-id" type="vbin16"/> + <field name="reply-to" type="reply-to"/> + <field name="content-type" type="str8"/> + <field name="content-encoding" type="str8"/> + <field name="user-id" type="vbin16"> + <rule name="authentication"/> + </field> + <field name="app-id" type="vbin16"/> + <field name="application-headers" type="map"/> + </struct> + <domain name="flow-mode" type="uint8"> + <enum> + <choice name="credit" value="0"/> + <choice name="window" value="1"/> + </enum> + </domain> + <domain name="credit-unit" type="uint8"> + <enum> + <choice name="message" value="0"/> + <choice name="byte" value="1"/> + </enum> + </domain> + <command name="transfer" code="0x1"> + <rule name="transactional-publish"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"> + <rule name="blank-destination"/> + <exception name="nonexistent-exchange" error-code="not-found"/> + </field> + <field name="accept-mode" type="accept-mode" required="true"/> + <field name="acquire-mode" type="acquire-mode" required="true"/> + <segments> + <header> + <entry type="delivery-properties"/> + <entry type="fragment-properties"/> + <entry type="message-properties"/> + </header> + <body/> + </segments> + </command> + <command name="accept" code="0x2"> + <rule name="acquisition"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="transfers" type="session.commands" required="true"/> + </command> + <command name="reject" code="0x3"> + <rule name="alternate-exchange"/> + <rule name="acquisition"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="transfers" type="session.commands" required="true"/> + <field name="code" type="reject-code" required="true"/> + <field name="text" type="str8"/> + </command> + <command name="release" code="0x4"> + <rule name="ordering"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MAY"/> + <field name="transfers" type="session.commands" required="true"/> + <field name="set-redelivered" type="bit"/> + </command> + <command name="acquire" code="0x5"> + <rule name="one-to-one"/> + <implement role="server" handle="MUST"/> + <field name="transfers" type="session.commands" required="true"/> + <result> + <struct name="acquired" code="0x4" size="4" pack="2"> + <field name="transfers" type="session.commands" required="true"/> + </struct> + </result> + </command> + <command name="resume" code="0x6"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"> + <exception name="destination-not-found" error-code="not-found"/> + </field> + <field name="resume-id" type="resume-id" required="true"> + <rule name="unknown-resume-id"/> + </field> + <result> + <struct name="message-resume-result" code="0x5" size="4" pack="2"> + <field name="offset" type="uint64"/> + </struct> + </result> + </command> + <command name="subscribe" code="0x7"> + <rule name="simultaneous-subscriptions"/> + <rule name="default-flow-mode"/> + <exception name="queue-deletion" error-code="resource-deleted"/> + <exception name="queue-not-found" error-code="not-found"/> + <rule name="initial-credit"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="queue.name" required="true"/> + <field name="destination" type="destination"> + <exception name="unique-subscriber-destination" error-code="not-allowed"/> + </field> + <field name="accept-mode" type="accept-mode" required="true"/> + <field name="acquire-mode" type="acquire-mode" required="true"/> + <field name="exclusive" type="bit"> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="resume-id" type="resume-id"/> + <field name="resume-ttl" type="uint64"/> + <field name="arguments" type="map"/> + </command> + <command name="cancel" code="0x8"> + <rule name="post-cancel-transfer-resolution"/> + <implement role="server" handle="MUST"/> + <field name="destination" type="destination" required="true"> + <exception name="subscription-not-found" error-code="not-found"/> + </field> + </command> + <command name="set-flow-mode" code="0x9"> + <rule name="byte-accounting"/> + <rule name="mode-switching"/> + <rule name="default-flow-mode"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"/> + <field name="flow-mode" type="flow-mode" required="true"/> + </command> + <command name="flow" code="0xa"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"/> + <field name="unit" type="credit-unit" required="true"/> + <field name="value" type="uint32"/> + </command> + <command name="flush" code="0xb"> + <implement role="server" handle="MUST"/> + <field name="destination" type="destination"/> + </command> + <command name="stop" code="0xc"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"/> + </command> + </class> + <class name="tx" code="0x5"> + <rule name="duplicate-tracking"/> + <role name="server" implement="SHOULD"/> + <command name="select" code="0x1"> + <exception name="exactly-once" error-code="illegal-state"/> + <exception name="no-dtx" error-code="illegal-state"/> + <exception name="explicit-accepts" error-code="not-allowed"/> + <implement role="server" handle="MUST"/> + </command> + <command name="commit" code="0x2"> + <exception name="select-required" error-code="illegal-state"/> + <implement role="server" handle="MUST"/> + </command> + <command name="rollback" code="0x3"> + <exception name="select-required" error-code="illegal-state"/> + <implement role="server" handle="MUST"/> + </command> + </class> + <class name="dtx" code="0x6"> + <rule name="transactionality"/> + <role name="server" implement="MAY"/> + <role name="client" implement="MAY"/> + <domain name="xa-status" type="uint16"> + <enum> + <choice name="xa-ok" value="0"/> + <choice name="xa-rbrollback" value="1"/> + <choice name="xa-rbtimeout" value="2"/> + <choice name="xa-heurhaz" value="3"/> + <choice name="xa-heurcom" value="4"/> + <choice name="xa-heurrb" value="5"/> + <choice name="xa-heurmix" value="6"/> + <choice name="xa-rdonly" value="7"/> + </enum> + </domain> + <struct name="xa-result" code="0x1" size="4" pack="2"> + <field name="status" type="xa-status" required="true"/> + </struct> + <struct name="xid" code="0x4" size="4" pack="2"> + <field name="format" type="uint32" required="true"/> + <field name="global-id" type="vbin8" required="true"/> + <field name="branch-id" type="vbin8" required="true"/> + </struct> + <command name="select" code="0x1"> + <implement role="server" handle="MAY"/> + </command> + <command name="start" code="0x2"> + <exception name="illegal-state" error-code="illegal-state"/> + <exception name="already-known" error-code="not-allowed"/> + <exception name="join-and-resume" error-code="not-allowed"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-allowed"/> + </field> + <field name="join" type="bit"> + <exception name="unsupported" error-code="not-implemented"/> + </field> + <field name="resume" type="bit"/> + <result type="xa-result"/> + </command> + <command name="end" code="0x3"> + <exception name="illegal-state" error-code="illegal-state"/> + <exception name="suspend-and-fail" error-code="not-allowed"/> + <rule name="success"/> + <rule name="session-closed"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="not-associated" error-code="illegal-state"/> + </field> + <field name="fail" type="bit"> + <rule name="failure"/> + </field> + <field name="suspend" type="bit"> + <rule name="resume"/> + </field> + <result type="xa-result"/> + </command> + <command name="commit" code="0x4"> + <exception name="illegal-state" error-code="illegal-state"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + <field name="one-phase" type="bit"> + <exception name="one-phase" error-code="illegal-state"/> + <exception name="two-phase" error-code="illegal-state"/> + </field> + <result type="xa-result"/> + </command> + <command name="forget" code="0x5"> + <exception name="illegal-state" error-code="illegal-state"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + </command> + <command name="get-timeout" code="0x6"> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + </field> + <result> + <struct name="get-timeout-result" code="0x2" size="4" pack="2"> + <field name="timeout" type="uint32" required="true"/> + </struct> + </result> + </command> + <command name="prepare" code="0x7"> + <exception name="illegal-state" error-code="illegal-state"/> + <rule name="obligation-1"/> + <rule name="obligation-2"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + <result type="xa-result"/> + </command> + <command name="recover" code="0x8"> + <implement role="server" handle="MAY"/> + <result> + <struct name="recover-result" code="0x3" size="4" pack="2"> + <field name="in-doubt" type="array" required="true"/> + </struct> + </result> + </command> + <command name="rollback" code="0x9"> + <exception name="illegal-state" error-code="illegal-state"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + <result type="xa-result"/> + </command> + <command name="set-timeout" code="0xa"> + <rule name="effective"/> + <rule name="reset"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + </field> + <field name="timeout" type="uint32" required="true"/> + </command> + </class> + <class name="exchange" code="0x7"> + <rule name="required-types"/> + <rule name="recommended-types"/> + <rule name="required-instances"/> + <rule name="default-exchange"/> + <rule name="default-access"/> + <rule name="extensions"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="name" type="str8"/> + <command name="declare" code="0x1"> + <rule name="minimum"/> + <implement role="server" handle="MUST"/> + <field name="exchange" type="name" required="true"> + <exception name="reserved-names" error-code="not-allowed"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + </field> + <field name="type" type="str8" required="true"> + <exception name="typed" error-code="not-allowed"/> + <exception name="exchange-type-not-found" error-code="not-found"/> + </field> + <field name="alternate-exchange" type="name"> + <rule name="empty-name"/> + <exception name="pre-existing-exchange" error-code="not-allowed"/> + <rule name="double-failure"/> + </field> + <field name="passive" type="bit"> + <exception name="not-found" error-code="not-found"/> + </field> + <field name="durable" type="bit"> + <rule name="support"/> + <rule name="sticky"/> + </field> + <field name="auto-delete" type="bit"> + <rule name="sticky"/> + </field> + <field name="arguments" type="map"> + <exception name="unknown-argument" error-code="not-implemented"/> + </field> + </command> + <command name="delete" code="0x2"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="name" required="true"> + <exception name="exists" error-code="not-found"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + <exception name="used-as-alternate" error-code="not-allowed"/> + </field> + <field name="if-unused" type="bit"> + <exception name="exchange-in-use" error-code="precondition-failed"/> + </field> + </command> + <command name="query" code="0x3"> + <implement role="server" handle="MUST"/> + <field name="name" type="str8"/> + <result> + <struct name="exchange-query-result" code="0x1" size="4" pack="2"> + <field name="type" type="str8"/> + <field name="durable" type="bit"/> + <field name="not-found" type="bit"/> + <field name="arguments" type="map"/> + </struct> + </result> + </command> + <command name="bind" code="0x4"> + <rule name="duplicates"/> + <rule name="durable-exchange"/> + <rule name="binding-count"/> + <rule name="multiple-bindings"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="queue.name" required="true"> + <exception name="empty-queue" error-code="invalid-argument"/> + <exception name="queue-existence" error-code="not-found"/> + </field> + <field name="exchange" type="name" required="true"> + <exception name="exchange-existence" error-code="not-found"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + </field> + <field name="binding-key" type="str8" required="true"/> + <field name="arguments" type="map"> + <exception name="unknown-argument" error-code="not-implemented"/> + </field> + </command> + <command name="unbind" code="0x5"> + <implement role="server" handle="MUST"/> + <field name="queue" type="queue.name" required="true"> + <exception name="non-existent-queue" error-code="not-found"/> + </field> + <field name="exchange" type="name" required="true"> + <exception name="non-existent-exchange" error-code="not-found"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + </field> + <field name="binding-key" type="str8" required="true"> + <exception name="non-existent-binding-key" error-code="not-found"/> + </field> + </command> + <command name="bound" code="0x6"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="str8"/> + <field name="queue" type="str8" required="true"/> + <field name="binding-key" type="str8"/> + <field name="arguments" type="map"/> + <result> + <struct name="exchange-bound-result" code="0x2" size="4" pack="2"> + <field name="exchange-not-found" type="bit"/> + <field name="queue-not-found" type="bit"/> + <field name="queue-not-matched" type="bit"/> + <field name="key-not-matched" type="bit"/> + <field name="args-not-matched" type="bit"/> + </struct> + </result> + </command> + </class> + <class name="queue" code="0x8"> + <rule name="any-content"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="name" type="str8"/> + <command name="declare" code="0x1"> + <rule name="default-binding"/> + <rule name="minimum-queues"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"> + <exception name="reserved-prefix" error-code="not-allowed"/> + </field> + <field name="alternate-exchange" type="exchange.name"> + <exception name="pre-existing-exchange" error-code="not-allowed"/> + <exception name="unknown-exchange" error-code="not-found"/> + </field> + <field name="passive" type="bit"> + <exception name="passive" error-code="not-found"/> + </field> + <field name="durable" type="bit"> + <rule name="persistence"/> + <rule name="types"/> + <rule name="pre-existence"/> + </field> + <field name="exclusive" type="bit"> + <rule name="types"/> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="auto-delete" type="bit"> + <rule name="pre-existence"/> + </field> + <field name="arguments" type="map"> + <exception name="unknown-argument" error-code="not-implemented"/> + </field> + </command> + <command name="delete" code="0x2"> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"> + <exception name="empty-name" error-code="invalid-argument"/> + <exception name="queue-exists" error-code="not-found"/> + </field> + <field name="if-unused" type="bit"> + <exception name="if-unused-flag" error-code="precondition-failed"/> + </field> + <field name="if-empty" type="bit"> + <exception name="not-empty" error-code="precondition-failed"/> + </field> + </command> + <command name="purge" code="0x3"> + <rule name="empty"/> + <rule name="pending-messages"/> + <rule name="purge-recovery"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"> + <exception name="empty-name" error-code="invalid-argument"/> + <exception name="queue-exists" error-code="not-found"/> + </field> + </command> + <command name="query" code="0x4"> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"/> + <result> + <struct name="queue-query-result" code="0x1" size="4" pack="2"> + <field name="queue" type="name" required="true"/> + <field name="alternate-exchange" type="exchange.name"/> + <field name="durable" type="bit"/> + <field name="exclusive" type="bit"/> + <field name="auto-delete" type="bit"/> + <field name="arguments" type="map"/> + <field name="message-count" type="uint32" required="true"/> + <field name="subscriber-count" type="uint32" required="true"/> + </struct> + </result> + </command> + </class> + <class name="file" code="0x9"> + <rule name="reliable-storage"/> + <rule name="no-discard"/> + <rule name="priority-levels"/> + <rule name="acknowledgement-support"/> + <role name="server" implement="MAY"/> + <role name="client" implement="MAY"/> + <struct name="file-properties" code="0x1" size="4" pack="2"> + <field name="content-type" type="str8"/> + <field name="content-encoding" type="str8"/> + <field name="headers" type="map"/> + <field name="priority" type="uint8"/> + <field name="reply-to" type="str8"/> + <field name="message-id" type="str8"/> + <field name="filename" type="str8"/> + <field name="timestamp" type="datetime"/> + <field name="cluster-id" type="str8"/> + </struct> + <domain name="return-code" type="uint16"> + <enum> + <choice name="content-too-large" value="311"/> + <choice name="no-route" value="312"/> + <choice name="no-consumers" value="313"/> + </enum> + </domain> + <command name="qos" code="0x1"> + <implement role="server" handle="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" type="uint32"/> + <field name="prefetch-count" type="uint16"> + <rule name="prefetch-discretion"/> + </field> + <field name="global" type="bit"/> + </command> + <command name="qos-ok" code="0x2"> + <implement role="client" handle="MUST"/> + </command> + <command name="consume" code="0x3"> + <rule name="min-consumers"/> + <implement role="server" handle="MUST"/> + <response name="consume-ok"/> + <field name="queue" type="queue.name"> + <exception name="queue-exists-if-empty" error-code="not-allowed"/> + </field> + <field name="consumer-tag" type="str8"> + <exception name="not-existing-consumer" error-code="not-allowed"/> + <exception name="not-empty-consumer-tag" error-code="not-allowed"/> + </field> + <field name="no-local" type="bit"/> + <field name="no-ack" type="bit"/> + <field name="exclusive" type="bit"> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="nowait" type="bit"/> + <field name="arguments" type="map"/> + </command> + <command name="consume-ok" code="0x4"> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="cancel" code="0x5"> + <implement role="server" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="open" code="0x6"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <response name="open-ok"/> + <field name="identifier" type="str8"/> + <field name="content-size" type="uint64"> + <rule name="content-size"/> + </field> + </command> + <command name="open-ok" code="0x7"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <response name="stage"/> + <field name="staged-size" type="uint64"> + <rule name="behavior"/> + <rule name="staging"/> + </field> + </command> + <command name="stage" code="0x8"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <segments> + <header required="true"> + <entry type="file-properties"/> + </header> + <body/> + </segments> + </command> + <command name="publish" code="0x9"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="exchange.name"> + <rule name="default"/> + <exception name="refusal" error-code="not-implemented"/> + </field> + <field name="routing-key" type="str8"/> + <field name="mandatory" type="bit"> + <rule name="implementation"/> + </field> + <field name="immediate" type="bit"> + <rule name="implementation"/> + </field> + <field name="identifier" type="str8"/> + </command> + <command name="return" code="0xa"> + <implement role="client" handle="MUST"/> + <field name="reply-code" type="return-code"/> + <field name="reply-text" type="str8"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <segments> + <header required="true"> + <entry type="file-properties"/> + </header> + <body/> + </segments> + </command> + <command name="deliver" code="0xb"> + <rule name="redelivery-tracking"/> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + <field name="delivery-tag" type="uint64"> + <rule name="non-zero"/> + </field> + <field name="redelivered" type="bit"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <field name="identifier" type="str8"/> + </command> + <command name="ack" code="0xc"> + <implement role="server" handle="MUST"/> + <field name="delivery-tag" type="uint64"> + <rule name="session-local"/> + </field> + <field name="multiple" type="bit"> + <rule name="validation"/> + </field> + </command> + <command name="reject" code="0xd"> + <rule name="server-interpretation"/> + <rule name="not-selection"/> + <implement role="server" handle="MUST"/> + <field name="delivery-tag" type="uint64"> + <rule name="session-local"/> + </field> + <field name="requeue" type="bit"> + <rule name="requeue-strategy"/> + </field> + </command> + </class> + <class name="stream" code="0xa"> + <rule name="overflow-discard"/> + <rule name="priority-levels"/> + <rule name="acknowledgement-support"/> + <role name="server" implement="MAY"/> + <role name="client" implement="MAY"/> + <struct name="stream-properties" code="0x1" size="4" pack="2"> + <field name="content-type" type="str8"/> + <field name="content-encoding" type="str8"/> + <field name="headers" type="map"/> + <field name="priority" type="uint8"/> + <field name="timestamp" type="datetime"/> + </struct> + <domain name="return-code" type="uint16"> + <enum> + <choice name="content-too-large" value="311"/> + <choice name="no-route" value="312"/> + <choice name="no-consumers" value="313"/> + </enum> + </domain> + <command name="qos" code="0x1"> + <implement role="server" handle="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" type="uint32"/> + <field name="prefetch-count" type="uint16"/> + <field name="consume-rate" type="uint32"> + <rule name="ignore-prefetch"/> + <rule name="drop-by-priority"/> + </field> + <field name="global" type="bit"/> + </command> + <command name="qos-ok" code="0x2"> + <implement role="client" handle="MUST"/> + </command> + <command name="consume" code="0x3"> + <rule name="min-consumers"/> + <rule name="priority-based-delivery"/> + <implement role="server" handle="MUST"/> + <response name="consume-ok"/> + <field name="queue" type="queue.name"> + <exception name="queue-exists-if-empty" error-code="not-allowed"/> + </field> + <field name="consumer-tag" type="str8"> + <exception name="not-existing-consumer" error-code="not-allowed"/> + <exception name="not-empty-consumer-tag" error-code="not-allowed"/> + </field> + <field name="no-local" type="bit"/> + <field name="exclusive" type="bit"> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="nowait" type="bit"/> + <field name="arguments" type="map"/> + </command> + <command name="consume-ok" code="0x4"> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="cancel" code="0x5"> + <implement role="server" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="publish" code="0x6"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="exchange.name"> + <rule name="default"/> + <exception name="refusal" error-code="not-implemented"/> + </field> + <field name="routing-key" type="str8"/> + <field name="mandatory" type="bit"> + <rule name="implementation"/> + </field> + <field name="immediate" type="bit"> + <rule name="implementation"/> + </field> + <segments> + <header required="true"> + <entry type="stream-properties"/> + </header> + <body/> + </segments> + </command> + <command name="return" code="0x7"> + <implement role="client" handle="MUST"/> + <field name="reply-code" type="return-code"/> + <field name="reply-text" type="str8"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <segments> + <header required="true"> + <entry type="stream-properties"/> + </header> + <body/> + </segments> + </command> + <command name="deliver" code="0x8"> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + <field name="delivery-tag" type="uint64"> + <rule name="session-local"/> + </field> + <field name="exchange" type="exchange.name"/> + <field name="queue" type="queue.name" required="true"/> + <segments> + <header required="true"> + <entry type="stream-properties"/> + </header> + <body/> + </segments> + </command> + </class> +</amqp> diff --git a/qpid/python/qpid/specs/amqp-0-10-stripped.xml b/qpid/python/qpid/specs/amqp-0-10-stripped.xml new file mode 100644 index 0000000000..1c53608138 --- /dev/null +++ b/qpid/python/qpid/specs/amqp-0-10-stripped.xml @@ -0,0 +1,1200 @@ +<?xml version="1.0"?> + +<!-- +(c) Copyright Cisco Systems, Credit Suisse, Deutsche Borse Systems, +Envoy Technologies, Inc., Goldman Sachs, IONA Technologies PLC, iMatix +Corporation sprl.,JPMorgan Chase Bank Inc. N.A, Novell, Rabbit +Technologies Ltd., Red Hat, Inc., TWIST Process Innovations ltd, and +29West Inc. 2006, 2007. + +Copyright (c) 2009 AMQP Working Group. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +1. Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright +notice, this list of conditions and the following disclaimer in the +documentation and/or other materials provided with the distribution. +3. The name of the author may not be used to endorse or promote products +derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +--> + +<amqp major="0" xmlns="http://www.amqp.org/schema/amqp.xsd" port="5672" minor="10"> + <type name="bin8" code="0x00" fixed-width="1"/> + <type name="int8" code="0x01" fixed-width="1"/> + <type name="uint8" code="0x02" fixed-width="1"/> + <type name="char" code="0x04" fixed-width="1"/> + <type name="boolean" code="0x08" fixed-width="1"/> + <type name="bin16" code="0x10" fixed-width="2"/> + <type name="int16" code="0x11" fixed-width="2"/> + <type name="uint16" code="0x12" fixed-width="2"/> + <type name="bin32" code="0x20" fixed-width="4"/> + <type name="int32" code="0x21" fixed-width="4"/> + <type name="uint32" code="0x22" fixed-width="4"/> + <type name="float" code="0x23" fixed-width="4"/> + <type name="char-utf32" code="0x27" fixed-width="4"/> + <type name="sequence-no" fixed-width="4"/> + <type name="bin64" code="0x30" fixed-width="8"/> + <type name="int64" code="0x31" fixed-width="8"/> + <type name="uint64" code="0x32" fixed-width="8"/> + <type name="double" code="0x33" fixed-width="8"/> + <type name="datetime" code="0x38" fixed-width="8"/> + <type name="bin128" code="0x40" fixed-width="16"/> + <type name="uuid" code="0x48" fixed-width="16"/> + <type name="bin256" code="0x50" fixed-width="32"/> + <type name="bin512" code="0x60" fixed-width="64"/> + <type name="bin1024" code="0x70" fixed-width="128"/> + <type name="vbin8" code="0x80" variable-width="1"/> + <type name="str8-latin" code="0x84" variable-width="1"/> + <type name="str8" code="0x85" variable-width="1"/> + <type name="str8-utf16" code="0x86" variable-width="1"/> + <type name="vbin16" code="0x90" variable-width="2"/> + <type name="str16-latin" code="0x94" variable-width="2"/> + <type name="str16" code="0x95" variable-width="2"/> + <type name="str16-utf16" code="0x96" variable-width="2"/> + <type name="byte-ranges" variable-width="2"/> + <type name="sequence-set" variable-width="2"/> + <type name="vbin32" code="0xa0" variable-width="4"/> + <type name="map" code="0xa8" variable-width="4"/> + <type name="list" code="0xa9" variable-width="4"/> + <type name="array" code="0xaa" variable-width="4"/> + <type name="struct32" code="0xab" variable-width="4"/> + <type name="bin40" code="0xc0" fixed-width="5"/> + <type name="dec32" code="0xc8" fixed-width="5"/> + <type name="bin72" code="0xd0" fixed-width="9"/> + <type name="dec64" code="0xd8" fixed-width="9"/> + <type name="void" code="0xf0" fixed-width="0"/> + <type name="bit" code="0xf1" fixed-width="0"/> + <constant name="MIN-MAX-FRAME-SIZE" value="4096"/> + <domain name="segment-type" type="uint8"> + <enum> + <choice name="control" value="0"/> + <choice name="command" value="1"/> + <choice name="header" value="2"/> + <choice name="body" value="3"/> + </enum> + </domain> + <domain name="track" type="uint8"> + <enum> + <choice name="control" value="0"/> + <choice name="command" value="1"/> + </enum> + </domain> + <domain name="str16-array" type="array"/> + <class name="connection" code="0x1"> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="close-code" type="uint16"> + <enum> + <choice name="normal" value="200"/> + <choice name="connection-forced" value="320"/> + <choice name="invalid-path" value="402"/> + <choice name="framing-error" value="501"/> + </enum> + </domain> + <domain name="amqp-host-url" type="str16"/> + <domain name="amqp-host-array" type="array"/> + <control name="start" code="0x1"> + <rule name="protocol-name"/> + <rule name="client-support"/> + <implement role="client" handle="MUST"/> + <response name="start-ok"/> + <field name="server-properties" type="map"> + <rule name="required-fields"/> + </field> + <field name="mechanisms" type="str16-array" required="true"/> + <field name="locales" type="str16-array" required="true"> + <rule name="required-support"/> + </field> + </control> + <control name="start-ok" code="0x2"> + <implement role="server" handle="MUST"/> + <field name="client-properties" type="map"> + <rule name="required-fields"/> + </field> + <field name="mechanism" type="str8" required="true"> + <rule name="security"/> + <rule name="validity"/> + </field> + <field name="response" type="vbin32" required="true"/> + <field name="locale" type="str8" required="true"/> + </control> + <control name="secure" code="0x3"> + <implement role="client" handle="MUST"/> + <response name="secure-ok"/> + <field name="challenge" type="vbin32" required="true"/> + </control> + <control name="secure-ok" code="0x4"> + <implement role="server" handle="MUST"/> + <field name="response" type="vbin32" required="true"/> + </control> + <control name="tune" code="0x5"> + <implement role="client" handle="MUST"/> + <response name="tune-ok"/> + <field name="channel-max" type="uint16"/> + <field name="max-frame-size" type="uint16"> + <rule name="minimum"/> + </field> + <field name="heartbeat-min" type="uint16"/> + <field name="heartbeat-max" type="uint16"> + <rule name="permitted-range"/> + <rule name="no-heartbeat-min"/> + </field> + </control> + <control name="tune-ok" code="0x6"> + <implement role="server" handle="MUST"/> + <field name="channel-max" type="uint16" required="true"> + <rule name="upper-limit"/> + <rule name="available-channels"/> + </field> + <field name="max-frame-size" type="uint16"> + <rule name="minimum"/> + <rule name="upper-limit"/> + <rule name="max-frame-size"/> + </field> + <field name="heartbeat" type="uint16"> + <rule name="permitted-range"/> + <rule name="no-heartbeat-min"/> + </field> + </control> + <control name="open" code="0x7"> + <implement role="server" handle="MUST"/> + <response name="open-ok"/> + <response name="redirect"/> + <field name="virtual-host" type="str8" required="true"> + <rule name="separation"/> + <rule name="security"/> + </field> + <field name="capabilities" type="str16-array"/> + <field name="insist" type="bit"> + <rule name="behavior"/> + </field> + </control> + <control name="open-ok" code="0x8"> + <implement role="client" handle="MUST"/> + <field name="known-hosts" type="amqp-host-array"/> + </control> + <control name="redirect" code="0x9"> + <rule name="usage"/> + <implement role="client" handle="MUST"/> + <field name="host" type="amqp-host-url" required="true"/> + <field name="known-hosts" type="amqp-host-array"/> + </control> + <control name="heartbeat" code="0xa"/> + <control name="close" code="0xb"> + <implement role="client" handle="MUST"/> + <implement role="server" handle="MUST"/> + <response name="close-ok"/> + <field name="reply-code" type="close-code" required="true"/> + <field name="reply-text" type="str8"/> + </control> + <control name="close-ok" code="0xc"> + <rule name="reporting"/> + <implement role="client" handle="MUST"/> + <implement role="server" handle="MUST"/> + </control> + </class> + <class name="session" code="0x2"> + <rule name="attachment"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <role name="sender" implement="MUST"/> + <role name="receiver" implement="MUST"/> + <domain name="name" type="vbin16"/> + <domain name="detach-code" type="uint8"> + <enum> + <choice name="normal" value="0"/> + <choice name="session-busy" value="1"/> + <choice name="transport-busy" value="2"/> + <choice name="not-attached" value="3"/> + <choice name="unknown-ids" value="4"/> + </enum> + </domain> + <domain name="commands" type="sequence-set"/> + <struct name="header" size="1" pack="1"> + <field name="sync" type="bit"/> + </struct> + <struct name="command-fragment" size="0" pack="0"> + <field name="command-id" type="sequence-no" required="true"/> + <field name="byte-ranges" type="byte-ranges" required="true"/> + </struct> + <domain name="command-fragments" type="array"/> + <control name="attach" code="0x1"> + <rule name="one-transport-per-session"/> + <rule name="one-session-per-transport"/> + <rule name="idempotence"/> + <rule name="scoping"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MAY"/> + <response name="attached"/> + <response name="detached"/> + <field name="name" type="name" required="true"/> + <field name="force" type="bit"/> + </control> + <control name="attached" code="0x2"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="name" type="name" required="true"/> + </control> + <control name="detach" code="0x3"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <response name="detached"/> + <field name="name" type="name" required="true"/> + </control> + <control name="detached" code="0x4"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="name" type="name" required="true"/> + <field name="code" type="detach-code" required="true"/> + </control> + <control name="request-timeout" code="0x5"> + <rule name="maximum-granted-timeout"/> + <implement role="sender" handle="MUST"/> + <implement role="receiver" handle="MUST"/> + <response name="timeout"/> + <field name="timeout" type="uint32"/> + </control> + <control name="timeout" code="0x6"> + <implement role="sender" handle="MUST"/> + <implement role="receiver" handle="MUST"/> + <field name="timeout" type="uint32"/> + </control> + <control name="command-point" code="0x7"> + <rule name="newly-attached-transports"/> + <rule name="zero-offset"/> + <rule name="nonzero-offset"/> + <implement role="receiver" handle="MUST"/> + <field name="command-id" type="sequence-no" required="true"/> + <field name="command-offset" type="uint64" required="true"/> + </control> + <control name="expected" code="0x8"> + <rule name="include-next-command"/> + <rule name="commands-empty-means-new-session"/> + <rule name="no-overlaps"/> + <rule name="minimal-fragments"/> + <implement role="sender" handle="MUST"/> + <field name="commands" type="commands" required="true"/> + <field name="fragments" type="command-fragments"/> + </control> + <control name="confirmed" code="0x9"> + <rule name="durability"/> + <rule name="no-overlaps"/> + <rule name="minimal-fragments"/> + <implement role="sender" handle="MUST"/> + <field name="commands" type="commands"> + <rule name="exclude-known-complete"/> + </field> + <field name="fragments" type="command-fragments"/> + </control> + <control name="completed" code="0xa"> + <rule name="known-completed-reply"/> + <rule name="delayed-reply"/> + <rule name="merged-reply"/> + <implement role="sender" handle="MUST"/> + <field name="commands" type="commands"> + <rule name="completed-implies-confirmed"/> + <rule name="exclude-known-complete"/> + </field> + <field name="timely-reply" type="bit"/> + </control> + <control name="known-completed" code="0xb"> + <rule name="stateless"/> + <implement role="receiver" handle="MUST"/> + <field name="commands" type="commands"> + <rule name="known-completed-implies-known-confirmed"/> + </field> + </control> + <control name="flush" code="0xc"> + <implement role="receiver" handle="MUST"/> + <field name="expected" type="bit"/> + <field name="confirmed" type="bit"/> + <field name="completed" type="bit"/> + </control> + <control name="gap" code="0xd"> + <rule name="gap-confirmation-and-completion"/> + <rule name="aborted-commands"/> + <rule name="completed-or-confirmed-commands"/> + <implement role="receiver" handle="MUST"/> + <field name="commands" type="commands"/> + </control> + </class> + <class name="execution" code="0x3"> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="error-code" type="uint16"> + <enum> + <choice name="unauthorized-access" value="403"/> + <choice name="not-found" value="404"/> + <choice name="resource-locked" value="405"/> + <choice name="precondition-failed" value="406"/> + <choice name="resource-deleted" value="408"/> + <choice name="illegal-state" value="409"/> + <choice name="command-invalid" value="503"/> + <choice name="resource-limit-exceeded" value="506"/> + <choice name="not-allowed" value="530"/> + <choice name="illegal-argument" value="531"/> + <choice name="not-implemented" value="540"/> + <choice name="internal-error" value="541"/> + <choice name="invalid-argument" value="542"/> + </enum> + </domain> + <command name="sync" code="0x1"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + </command> + <command name="result" code="0x2"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="command-id" type="sequence-no" required="true"/> + <field name="value" type="struct32"/> + </command> + <command name="exception" code="0x3"> + <implement role="client" handle="MUST"/> + <implement role="server" handle="MUST"/> + <field name="error-code" type="error-code" required="true"/> + <field name="command-id" type="sequence-no"/> + <field name="class-code" type="uint8"/> + <field name="command-code" type="uint8"/> + <field name="field-index" type="uint8"/> + <field name="description" type="str16"/> + <field name="error-info" type="map"/> + </command> + </class> + <class name="message" code="0x4"> + <rule name="persistent-message"/> + <rule name="no-persistent-message-discard"/> + <rule name="throttling"/> + <rule name="non-persistent-message-overflow"/> + <rule name="non-persistent-message-discard"/> + <rule name="min-priority-levels"/> + <rule name="priority-level-implementation"/> + <rule name="priority-delivery"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="destination" type="str8"/> + <domain name="accept-mode" type="uint8"> + <enum> + <choice name="explicit" value="0"/> + <choice name="none" value="1"/> + </enum> + </domain> + <domain name="acquire-mode" type="uint8"> + <enum> + <choice name="pre-acquired" value="0"/> + <choice name="not-acquired" value="1"/> + </enum> + </domain> + <domain name="reject-code" type="uint16"> + <enum> + <choice name="unspecified" value="0"/> + <choice name="unroutable" value="1"/> + <choice name="immediate" value="2"/> + </enum> + </domain> + <domain name="resume-id" type="str16"/> + <domain name="delivery-mode" type="uint8"> + <enum> + <choice name="non-persistent" value="1"/> + <choice name="persistent" value="2"/> + </enum> + </domain> + <domain name="delivery-priority" type="uint8"> + <enum> + <choice name="lowest" value="0"/> + <choice name="lower" value="1"/> + <choice name="low" value="2"/> + <choice name="below-average" value="3"/> + <choice name="medium" value="4"/> + <choice name="above-average" value="5"/> + <choice name="high" value="6"/> + <choice name="higher" value="7"/> + <choice name="very-high" value="8"/> + <choice name="highest" value="9"/> + </enum> + </domain> + <struct name="delivery-properties" code="0x1" size="4" pack="2"> + <field name="discard-unroutable" type="bit"/> + <field name="immediate" type="bit"/> + <field name="redelivered" type="bit"> + <rule name="implementation"/> + <rule name="hinting"/> + </field> + <field name="priority" type="delivery-priority" required="true"/> + <field name="delivery-mode" type="delivery-mode" required="true"/> + <field name="ttl" type="uint64"> + <rule name="ttl-decrement"/> + </field> + <field name="timestamp" type="datetime"/> + <field name="expiration" type="datetime"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <field name="resume-id" type="resume-id"/> + <field name="resume-ttl" type="uint64"/> + </struct> + <struct name="fragment-properties" code="0x2" size="4" pack="2"> + <field name="first" type="bit" default="1"/> + <field name="last" type="bit" default="1"/> + <field name="fragment-size" type="uint64"/> + </struct> + <struct name="reply-to" size="2" pack="2"> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + </struct> + <struct name="message-properties" code="0x3" size="4" pack="2"> + <field name="content-length" type="uint64"/> + <field name="message-id" type="uuid"> + <rule name="unique"/> + <rule name="immutable"/> + </field> + <field name="correlation-id" type="vbin16"/> + <field name="reply-to" type="reply-to"/> + <field name="content-type" type="str8"/> + <field name="content-encoding" type="str8"/> + <field name="user-id" type="vbin16"> + <rule name="authentication"/> + </field> + <field name="app-id" type="vbin16"/> + <field name="application-headers" type="map"/> + </struct> + <domain name="flow-mode" type="uint8"> + <enum> + <choice name="credit" value="0"/> + <choice name="window" value="1"/> + </enum> + </domain> + <domain name="credit-unit" type="uint8"> + <enum> + <choice name="message" value="0"/> + <choice name="byte" value="1"/> + </enum> + </domain> + <command name="transfer" code="0x1"> + <rule name="transactional-publish"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"> + <rule name="blank-destination"/> + <exception name="nonexistent-exchange" error-code="not-found"/> + </field> + <field name="accept-mode" type="accept-mode" required="true"/> + <field name="acquire-mode" type="acquire-mode" required="true"/> + <segments> + <header> + <entry type="delivery-properties"/> + <entry type="fragment-properties"/> + <entry type="message-properties"/> + </header> + <body/> + </segments> + </command> + <command name="accept" code="0x2"> + <rule name="acquisition"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="transfers" type="session.commands" required="true"/> + </command> + <command name="reject" code="0x3"> + <rule name="alternate-exchange"/> + <rule name="acquisition"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="transfers" type="session.commands" required="true"/> + <field name="code" type="reject-code" required="true"/> + <field name="text" type="str8"/> + </command> + <command name="release" code="0x4"> + <rule name="ordering"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MAY"/> + <field name="transfers" type="session.commands" required="true"/> + <field name="set-redelivered" type="bit"/> + </command> + <command name="acquire" code="0x5"> + <rule name="one-to-one"/> + <implement role="server" handle="MUST"/> + <field name="transfers" type="session.commands" required="true"/> + <result> + <struct name="acquired" code="0x4" size="4" pack="2"> + <field name="transfers" type="session.commands" required="true"/> + </struct> + </result> + </command> + <command name="resume" code="0x6"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"> + <exception name="destination-not-found" error-code="not-found"/> + </field> + <field name="resume-id" type="resume-id" required="true"> + <rule name="unknown-resume-id"/> + </field> + <result> + <struct name="message-resume-result" code="0x5" size="4" pack="2"> + <field name="offset" type="uint64"/> + </struct> + </result> + </command> + <command name="subscribe" code="0x7"> + <rule name="simultaneous-subscriptions"/> + <rule name="default-flow-mode"/> + <exception name="queue-deletion" error-code="resource-deleted"/> + <exception name="queue-not-found" error-code="not-found"/> + <rule name="initial-credit"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="queue.name" required="true"/> + <field name="destination" type="destination"> + <exception name="unique-subscriber-destination" error-code="not-allowed"/> + </field> + <field name="accept-mode" type="accept-mode" required="true"/> + <field name="acquire-mode" type="acquire-mode" required="true"/> + <field name="exclusive" type="bit"> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="resume-id" type="resume-id"/> + <field name="resume-ttl" type="uint64"/> + <field name="arguments" type="map"/> + </command> + <command name="cancel" code="0x8"> + <rule name="post-cancel-transfer-resolution"/> + <implement role="server" handle="MUST"/> + <field name="destination" type="destination" required="true"> + <exception name="subscription-not-found" error-code="not-found"/> + </field> + </command> + <command name="set-flow-mode" code="0x9"> + <rule name="byte-accounting"/> + <rule name="mode-switching"/> + <rule name="default-flow-mode"/> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"/> + <field name="flow-mode" type="flow-mode" required="true"/> + </command> + <command name="flow" code="0xa"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"/> + <field name="unit" type="credit-unit" required="true"/> + <field name="value" type="uint32"/> + </command> + <command name="flush" code="0xb"> + <implement role="server" handle="MUST"/> + <field name="destination" type="destination"/> + </command> + <command name="stop" code="0xc"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <field name="destination" type="destination"/> + </command> + </class> + <class name="tx" code="0x5"> + <rule name="duplicate-tracking"/> + <role name="server" implement="SHOULD"/> + <command name="select" code="0x1"> + <exception name="exactly-once" error-code="illegal-state"/> + <exception name="no-dtx" error-code="illegal-state"/> + <exception name="explicit-accepts" error-code="not-allowed"/> + <implement role="server" handle="MUST"/> + </command> + <command name="commit" code="0x2"> + <exception name="select-required" error-code="illegal-state"/> + <implement role="server" handle="MUST"/> + </command> + <command name="rollback" code="0x3"> + <exception name="select-required" error-code="illegal-state"/> + <implement role="server" handle="MUST"/> + </command> + </class> + <class name="dtx" code="0x6"> + <rule name="transactionality"/> + <role name="server" implement="MAY"/> + <role name="client" implement="MAY"/> + <domain name="xa-status" type="uint16"> + <enum> + <choice name="xa-ok" value="0"/> + <choice name="xa-rbrollback" value="1"/> + <choice name="xa-rbtimeout" value="2"/> + <choice name="xa-heurhaz" value="3"/> + <choice name="xa-heurcom" value="4"/> + <choice name="xa-heurrb" value="5"/> + <choice name="xa-heurmix" value="6"/> + <choice name="xa-rdonly" value="7"/> + </enum> + </domain> + <struct name="xa-result" code="0x1" size="4" pack="2"> + <field name="status" type="xa-status" required="true"/> + </struct> + <struct name="xid" size="2" pack="2"> + <field name="format" type="uint32" required="true"/> + <field name="global-id" type="vbin8" required="true"/> + <field name="branch-id" type="vbin8" required="true"/> + </struct> + <command name="select" code="0x1"> + <implement role="server" handle="MAY"/> + </command> + <command name="start" code="0x2"> + <exception name="illegal-state" error-code="illegal-state"/> + <exception name="already-known" error-code="not-allowed"/> + <exception name="join-and-resume" error-code="not-allowed"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-allowed"/> + </field> + <field name="join" type="bit"> + <exception name="unsupported" error-code="not-implemented"/> + </field> + <field name="resume" type="bit"/> + <result type="xa-result"/> + </command> + <command name="end" code="0x3"> + <exception name="illegal-state" error-code="illegal-state"/> + <exception name="suspend-and-fail" error-code="not-allowed"/> + <rule name="success"/> + <rule name="session-closed"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="not-associated" error-code="illegal-state"/> + </field> + <field name="fail" type="bit"> + <rule name="failure"/> + </field> + <field name="suspend" type="bit"> + <rule name="resume"/> + </field> + <result type="xa-result"/> + </command> + <command name="commit" code="0x4"> + <exception name="illegal-state" error-code="illegal-state"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + <field name="one-phase" type="bit"> + <exception name="one-phase" error-code="illegal-state"/> + <exception name="two-phase" error-code="illegal-state"/> + </field> + <result type="xa-result"/> + </command> + <command name="forget" code="0x5"> + <exception name="illegal-state" error-code="illegal-state"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + </command> + <command name="get-timeout" code="0x6"> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + </field> + <result> + <struct name="get-timeout-result" code="0x2" size="4" pack="2"> + <field name="timeout" type="uint32" required="true"/> + </struct> + </result> + </command> + <command name="prepare" code="0x7"> + <exception name="illegal-state" error-code="illegal-state"/> + <rule name="obligation-1"/> + <rule name="obligation-2"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + <result type="xa-result"/> + </command> + <command name="recover" code="0x8"> + <implement role="server" handle="MAY"/> + <result> + <struct name="recover-result" code="0x3" size="4" pack="2"> + <field name="in-doubt" type="array" required="true"/> + </struct> + </result> + </command> + <command name="rollback" code="0x9"> + <exception name="illegal-state" error-code="illegal-state"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + <exception name="not-disassociated" error-code="illegal-state"/> + </field> + <result type="xa-result"/> + </command> + <command name="set-timeout" code="0xa"> + <rule name="effective"/> + <rule name="reset"/> + <implement role="server" handle="MAY"/> + <field name="xid" type="xid" required="true"> + <exception name="unknown-xid" error-code="not-found"/> + </field> + <field name="timeout" type="uint32" required="true"/> + </command> + </class> + <class name="exchange" code="0x7"> + <rule name="required-types"/> + <rule name="recommended-types"/> + <rule name="required-instances"/> + <rule name="default-exchange"/> + <rule name="default-access"/> + <rule name="extensions"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="name" type="str8"/> + <command name="declare" code="0x1"> + <rule name="minimum"/> + <implement role="server" handle="MUST"/> + <field name="exchange" type="name" required="true"> + <exception name="reserved-names" error-code="not-allowed"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + </field> + <field name="type" type="str8" required="true"> + <exception name="typed" error-code="not-allowed"/> + <exception name="exchange-type-not-found" error-code="not-found"/> + </field> + <field name="alternate-exchange" type="name"> + <rule name="empty-name"/> + <exception name="pre-existing-exchange" error-code="not-allowed"/> + <rule name="double-failure"/> + </field> + <field name="passive" type="bit"> + <exception name="not-found" error-code="not-found"/> + </field> + <field name="durable" type="bit"> + <rule name="support"/> + <rule name="sticky"/> + </field> + <field name="auto-delete" type="bit"> + <rule name="sticky"/> + </field> + <field name="arguments" type="map"> + <exception name="unknown-argument" error-code="not-implemented"/> + </field> + </command> + <command name="delete" code="0x2"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="name" required="true"> + <exception name="exists" error-code="not-found"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + <exception name="used-as-alternate" error-code="not-allowed"/> + </field> + <field name="if-unused" type="bit"> + <exception name="exchange-in-use" error-code="precondition-failed"/> + </field> + </command> + <command name="query" code="0x3"> + <implement role="server" handle="MUST"/> + <field name="name" type="str8"/> + <result> + <struct name="exchange-query-result" code="0x1" size="4" pack="2"> + <field name="type" type="str8"/> + <field name="durable" type="bit"/> + <field name="not-found" type="bit"/> + <field name="arguments" type="map"/> + </struct> + </result> + </command> + <command name="bind" code="0x4"> + <rule name="duplicates"/> + <rule name="durable-exchange"/> + <rule name="binding-count"/> + <rule name="multiple-bindings"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="queue.name" required="true"> + <exception name="empty-queue" error-code="invalid-argument"/> + <exception name="queue-existence" error-code="not-found"/> + </field> + <field name="exchange" type="name" required="true"> + <exception name="exchange-existence" error-code="not-found"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + </field> + <field name="binding-key" type="str8" required="true"/> + <field name="arguments" type="map"> + <exception name="unknown-argument" error-code="not-implemented"/> + </field> + </command> + <command name="unbind" code="0x5"> + <implement role="server" handle="MUST"/> + <field name="queue" type="queue.name" required="true"> + <exception name="non-existent-queue" error-code="not-found"/> + </field> + <field name="exchange" type="name" required="true"> + <exception name="non-existent-exchange" error-code="not-found"/> + <exception name="exchange-name-required" error-code="invalid-argument"/> + </field> + <field name="binding-key" type="str8" required="true"> + <exception name="non-existent-binding-key" error-code="not-found"/> + </field> + </command> + <command name="bound" code="0x6"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="str8"/> + <field name="queue" type="str8" required="true"/> + <field name="binding-key" type="str8"/> + <field name="arguments" type="map"/> + <result> + <struct name="exchange-bound-result" code="0x2" size="4" pack="2"> + <field name="exchange-not-found" type="bit"/> + <field name="queue-not-found" type="bit"/> + <field name="queue-not-matched" type="bit"/> + <field name="key-not-matched" type="bit"/> + <field name="args-not-matched" type="bit"/> + </struct> + </result> + </command> + </class> + <class name="queue" code="0x8"> + <rule name="any-content"/> + <role name="server" implement="MUST"/> + <role name="client" implement="MUST"/> + <domain name="name" type="str8"/> + <command name="declare" code="0x1"> + <rule name="default-binding"/> + <rule name="minimum-queues"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"> + <exception name="reserved-prefix" error-code="not-allowed"/> + </field> + <field name="alternate-exchange" type="exchange.name"> + <exception name="pre-existing-exchange" error-code="not-allowed"/> + <exception name="unknown-exchange" error-code="not-found"/> + </field> + <field name="passive" type="bit"> + <exception name="passive" error-code="not-found"/> + </field> + <field name="durable" type="bit"> + <rule name="persistence"/> + <rule name="types"/> + <rule name="pre-existence"/> + </field> + <field name="exclusive" type="bit"> + <rule name="types"/> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="auto-delete" type="bit"> + <rule name="pre-existence"/> + </field> + <field name="arguments" type="map"> + <exception name="unknown-argument" error-code="not-implemented"/> + </field> + </command> + <command name="delete" code="0x2"> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"> + <exception name="empty-name" error-code="invalid-argument"/> + <exception name="queue-exists" error-code="not-found"/> + </field> + <field name="if-unused" type="bit"> + <exception name="if-unused-flag" error-code="precondition-failed"/> + </field> + <field name="if-empty" type="bit"> + <exception name="not-empty" error-code="precondition-failed"/> + </field> + </command> + <command name="purge" code="0x3"> + <rule name="empty"/> + <rule name="pending-messages"/> + <rule name="purge-recovery"/> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"> + <exception name="empty-name" error-code="invalid-argument"/> + <exception name="queue-exists" error-code="not-found"/> + </field> + </command> + <command name="query" code="0x4"> + <implement role="server" handle="MUST"/> + <field name="queue" type="name" required="true"/> + <result> + <struct name="queue-query-result" code="0x1" size="4" pack="2"> + <field name="queue" type="name" required="true"/> + <field name="alternate-exchange" type="exchange.name"/> + <field name="durable" type="bit"/> + <field name="exclusive" type="bit"/> + <field name="auto-delete" type="bit"/> + <field name="arguments" type="map"/> + <field name="message-count" type="uint32" required="true"/> + <field name="subscriber-count" type="uint32" required="true"/> + </struct> + </result> + </command> + </class> + <class name="file" code="0x9"> + <rule name="reliable-storage"/> + <rule name="no-discard"/> + <rule name="priority-levels"/> + <rule name="acknowledgement-support"/> + <role name="server" implement="MAY"/> + <role name="client" implement="MAY"/> + <struct name="file-properties" code="0x1" size="4" pack="2"> + <field name="content-type" type="str8"/> + <field name="content-encoding" type="str8"/> + <field name="headers" type="map"/> + <field name="priority" type="uint8"/> + <field name="reply-to" type="str8"/> + <field name="message-id" type="str8"/> + <field name="filename" type="str8"/> + <field name="timestamp" type="datetime"/> + <field name="cluster-id" type="str8"/> + </struct> + <domain name="return-code" type="uint16"> + <enum> + <choice name="content-too-large" value="311"/> + <choice name="no-route" value="312"/> + <choice name="no-consumers" value="313"/> + </enum> + </domain> + <command name="qos" code="0x1"> + <implement role="server" handle="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" type="uint32"/> + <field name="prefetch-count" type="uint16"> + <rule name="prefetch-discretion"/> + </field> + <field name="global" type="bit"/> + </command> + <command name="qos-ok" code="0x2"> + <implement role="client" handle="MUST"/> + </command> + <command name="consume" code="0x3"> + <rule name="min-consumers"/> + <implement role="server" handle="MUST"/> + <response name="consume-ok"/> + <field name="queue" type="queue.name"> + <exception name="queue-exists-if-empty" error-code="not-allowed"/> + </field> + <field name="consumer-tag" type="str8"> + <exception name="not-existing-consumer" error-code="not-allowed"/> + <exception name="not-empty-consumer-tag" error-code="not-allowed"/> + </field> + <field name="no-local" type="bit"/> + <field name="no-ack" type="bit"/> + <field name="exclusive" type="bit"> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="nowait" type="bit"/> + <field name="arguments" type="map"/> + </command> + <command name="consume-ok" code="0x4"> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="cancel" code="0x5"> + <implement role="server" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="open" code="0x6"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <response name="open-ok"/> + <field name="identifier" type="str8"/> + <field name="content-size" type="uint64"> + <rule name="content-size"/> + </field> + </command> + <command name="open-ok" code="0x7"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <response name="stage"/> + <field name="staged-size" type="uint64"> + <rule name="behavior"/> + <rule name="staging"/> + </field> + </command> + <command name="stage" code="0x8"> + <implement role="server" handle="MUST"/> + <implement role="client" handle="MUST"/> + <segments> + <header required="true"> + <entry type="file-properties"/> + </header> + <body/> + </segments> + </command> + <command name="publish" code="0x9"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="exchange.name"> + <rule name="default"/> + <exception name="refusal" error-code="not-implemented"/> + </field> + <field name="routing-key" type="str8"/> + <field name="mandatory" type="bit"> + <rule name="implementation"/> + </field> + <field name="immediate" type="bit"> + <rule name="implementation"/> + </field> + <field name="identifier" type="str8"/> + </command> + <command name="return" code="0xa"> + <implement role="client" handle="MUST"/> + <field name="reply-code" type="return-code"/> + <field name="reply-text" type="str8"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <segments> + <header required="true"> + <entry type="file-properties"/> + </header> + <body/> + </segments> + </command> + <command name="deliver" code="0xb"> + <rule name="redelivery-tracking"/> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + <field name="delivery-tag" type="uint64"> + <rule name="non-zero"/> + </field> + <field name="redelivered" type="bit"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <field name="identifier" type="str8"/> + </command> + <command name="ack" code="0xc"> + <implement role="server" handle="MUST"/> + <field name="delivery-tag" type="uint64"> + <rule name="session-local"/> + </field> + <field name="multiple" type="bit"> + <rule name="validation"/> + </field> + </command> + <command name="reject" code="0xd"> + <rule name="server-interpretation"/> + <rule name="not-selection"/> + <implement role="server" handle="MUST"/> + <field name="delivery-tag" type="uint64"> + <rule name="session-local"/> + </field> + <field name="requeue" type="bit"> + <rule name="requeue-strategy"/> + </field> + </command> + </class> + <class name="stream" code="0xa"> + <rule name="overflow-discard"/> + <rule name="priority-levels"/> + <rule name="acknowledgement-support"/> + <role name="server" implement="MAY"/> + <role name="client" implement="MAY"/> + <struct name="stream-properties" code="0x1" size="4" pack="2"> + <field name="content-type" type="str8"/> + <field name="content-encoding" type="str8"/> + <field name="headers" type="map"/> + <field name="priority" type="uint8"/> + <field name="timestamp" type="datetime"/> + </struct> + <domain name="return-code" type="uint16"> + <enum> + <choice name="content-too-large" value="311"/> + <choice name="no-route" value="312"/> + <choice name="no-consumers" value="313"/> + </enum> + </domain> + <command name="qos" code="0x1"> + <implement role="server" handle="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" type="uint32"/> + <field name="prefetch-count" type="uint16"/> + <field name="consume-rate" type="uint32"> + <rule name="ignore-prefetch"/> + <rule name="drop-by-priority"/> + </field> + <field name="global" type="bit"/> + </command> + <command name="qos-ok" code="0x2"> + <implement role="client" handle="MUST"/> + </command> + <command name="consume" code="0x3"> + <rule name="min-consumers"/> + <rule name="priority-based-delivery"/> + <implement role="server" handle="MUST"/> + <response name="consume-ok"/> + <field name="queue" type="queue.name"> + <exception name="queue-exists-if-empty" error-code="not-allowed"/> + </field> + <field name="consumer-tag" type="str8"> + <exception name="not-existing-consumer" error-code="not-allowed"/> + <exception name="not-empty-consumer-tag" error-code="not-allowed"/> + </field> + <field name="no-local" type="bit"/> + <field name="exclusive" type="bit"> + <exception name="in-use" error-code="resource-locked"/> + </field> + <field name="nowait" type="bit"/> + <field name="arguments" type="map"/> + </command> + <command name="consume-ok" code="0x4"> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="cancel" code="0x5"> + <implement role="server" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + </command> + <command name="publish" code="0x6"> + <implement role="server" handle="MUST"/> + <field name="exchange" type="exchange.name"> + <rule name="default"/> + <exception name="refusal" error-code="not-implemented"/> + </field> + <field name="routing-key" type="str8"/> + <field name="mandatory" type="bit"> + <rule name="implementation"/> + </field> + <field name="immediate" type="bit"> + <rule name="implementation"/> + </field> + <segments> + <header required="true"> + <entry type="stream-properties"/> + </header> + <body/> + </segments> + </command> + <command name="return" code="0x7"> + <implement role="client" handle="MUST"/> + <field name="reply-code" type="return-code"/> + <field name="reply-text" type="str8"/> + <field name="exchange" type="exchange.name"/> + <field name="routing-key" type="str8"/> + <segments> + <header required="true"> + <entry type="stream-properties"/> + </header> + <body/> + </segments> + </command> + <command name="deliver" code="0x8"> + <implement role="client" handle="MUST"/> + <field name="consumer-tag" type="str8"/> + <field name="delivery-tag" type="uint64"> + <rule name="session-local"/> + </field> + <field name="exchange" type="exchange.name"/> + <field name="queue" type="queue.name" required="true"/> + <segments> + <header required="true"> + <entry type="stream-properties"/> + </header> + <body/> + </segments> + </command> + </class> +</amqp> diff --git a/qpid/python/qpid/specs/amqp-0-10.dtd b/qpid/python/qpid/specs/amqp-0-10.dtd new file mode 100644 index 0000000000..2be198525a --- /dev/null +++ b/qpid/python/qpid/specs/amqp-0-10.dtd @@ -0,0 +1,246 @@ +<?xml version="1.0" encoding="UTF-8"?> + +<!-- + Copyright Notice + ================ + (c) Copyright Cisco Systems, Credit Suisse, Deutsche Börse Systems, Envoy Technologies, Inc., + Goldman Sachs, IONA Technologies PLC, iMatix Corporation sprl.,JPMorgan Chase Bank Inc. N.A, + Novell, Rabbit Technologies Ltd., Red Hat, Inc., TWIST Process Innovations ltd, and 29West Inc + 2006, 2007. All rights reserved. + + License + ======= + JPMorgan Chase Bank & Co., Cisco Systems, Inc., Envoy Technologies Inc., iMatix Corporation, IONA + Technologies, Red Hat, Inc., TWIST Process Innovations, and 29West Inc. (collectively, the + "Authors") each hereby grants to you a worldwide, perpetual, royalty-free, nontransferable, + nonexclusive license to (i) copy, display, distribute and implement the Advanced Messaging Queue + Protocol ("AMQP") Specification and (ii) the Licensed Claims that are held by the Authors, all for + the purpose of implementing the Advanced Messaging Queue Protocol Specification. Your license and + any rights under this Agreement will terminate immediately without notice from any Author if you + bring any claim, suit, demand, or action related to the Advanced Messaging Queue Protocol + Specification against any Author. Upon termination, you shall destroy all copies of the Advanced + Messaging Queue Protocol Specification in your possession or control. + + As used hereunder, "Licensed Claims" means those claims of a patent or patent application, + throughout the world, excluding design patents and design registrations, owned or controlled, or + that can be sublicensed without fee and in compliance with the requirements of this Agreement, by + an Author or its affiliates now or at any future time and which would necessarily be infringed by + implementation of the Advanced Messaging Queue Protocol Specification. A claim is necessarily + infringed hereunder only when it is not possible to avoid infringing it because there is no + plausible non-infringing alternative for implementing the required portions of the Advanced + Messaging Queue Protocol Specification. Notwithstanding the foregoing, Licensed Claims shall not + include any claims other than as set forth above even if contained in the same patent as Licensed + Claims; or that read solely on any implementations of any portion of the Advanced Messaging Queue + Protocol Specification that are not required by the Advanced Messaging Queue Protocol + Specification, or that, if licensed, would require a payment of royalties by the licensor to + unaffiliated third parties. Moreover, Licensed Claims shall not include (i) any enabling + technologies that may be necessary to make or use any Licensed Product but are not themselves + expressly set forth in the Advanced Messaging Queue Protocol Specification (e.g., semiconductor + manufacturing technology, compiler technology, object oriented technology, networking technology, + operating system technology, and the like); or (ii) the implementation of other published + standards developed elsewhere and merely referred to in the body of the Advanced Messaging Queue + Protocol Specification, or (iii) any Licensed Product and any combinations thereof the purpose or + function of which is not required for compliance with the Advanced Messaging Queue Protocol + Specification. For purposes of this definition, the Advanced Messaging Queue Protocol + Specification shall be deemed to include both architectural and interconnection requirements + essential for interoperability and may also include supporting source code artifacts where such + architectural, interconnection requirements and source code artifacts are expressly identified as + being required or documentation to achieve compliance with the Advanced Messaging Queue Protocol + Specification. + + As used hereunder, "Licensed Products" means only those specific portions of products (hardware, + software or combinations thereof) that implement and are compliant with all relevant portions of + the Advanced Messaging Queue Protocol Specification. + + The following disclaimers, which you hereby also acknowledge as to any use you may make of the + Advanced Messaging Queue Protocol Specification: + + THE ADVANCED MESSAGING QUEUE PROTOCOL SPECIFICATION IS PROVIDED "AS IS," AND THE AUTHORS MAKE NO + REPRESENTATIONS OR WARRANTIES, EXPRESS OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, WARRANTIES OF + MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, NON-INFRINGEMENT, OR TITLE; THAT THE CONTENTS + OF THE ADVANCED MESSAGING QUEUE PROTOCOL SPECIFICATION ARE SUITABLE FOR ANY PURPOSE; NOR THAT THE + IMPLEMENTATION OF THE ADVANCED MESSAGING QUEUE PROTOCOL SPECIFICATION WILL NOT INFRINGE ANY THIRD + PARTY PATENTS, COPYRIGHTS, TRADEMARKS OR OTHER RIGHTS. + + THE AUTHORS WILL NOT BE LIABLE FOR ANY DIRECT, INDIRECT, SPECIAL, INCIDENTAL OR CONSEQUENTIAL + DAMAGES ARISING OUT OF OR RELATING TO ANY USE, IMPLEMENTATION OR OF THE ADVANCED + MESSAGING QUEUE PROTOCOL SPECIFICATION. + + The name and trademarks of the Authors may NOT be used in any manner, including advertising or + publicity pertaining to the Advanced Messaging Queue Protocol Specification or its contents + without specific, written prior permission. Title to copyright in the Advanced Messaging Queue + Protocol Specification will at all times remain with the Authors. + + No other rights are granted by implication, estoppel or otherwise. + + Upon termination of your license or rights under this Agreement, you shall destroy all copies of + the Advanced Messaging Queue Protocol Specification in your possession or control. + + Trademarks + ========== + "JPMorgan", "JPMorgan Chase", "Chase", the JPMorgan Chase logo and the Octagon Symbol are + trademarks of JPMorgan Chase & Co. + + IMATIX and the iMatix logo are trademarks of iMatix Corporation sprl. + + IONA, IONA Technologies, and the IONA logos are trademarks of IONA Technologies PLC and/or its + subsidiaries. + + LINUX is a trademark of Linus Torvalds. RED HAT and JBOSS are registered trademarks of Red Hat, + Inc. in the US and other countries. + + Java, all Java-based trademarks and OpenOffice.org are trademarks of Sun Microsystems, Inc. in the + United States, other countries, or both. + + Other company, product, or service names may be trademarks or service marks of others. + + Links to full AMQP specification: + ================================= + http://www.envoytech.org/spec/amq/ + http://www.iona.com/opensource/amqp/ + http://www.redhat.com/solutions/specifications/amqp/ + http://www.twiststandards.org/tiki-index.php?page=AMQ + http://www.imatix.com/amqp +--> + +<!ELEMENT amqp (doc|type|struct|domain|constant|class)*> +<!ATTLIST amqp + xmlns CDATA #IMPLIED + major CDATA #REQUIRED + minor CDATA #REQUIRED + port CDATA #REQUIRED + comment CDATA #IMPLIED +> + +<!ELEMENT constant (doc|rule)*> +<!ATTLIST constant + name CDATA #REQUIRED + value CDATA #REQUIRED + label CDATA #IMPLIED +> + +<!ELEMENT type (doc|rule)*> +<!ATTLIST type + name CDATA #REQUIRED + label CDATA #IMPLIED + code CDATA #IMPLIED + fixed-width CDATA #IMPLIED + variable-width CDATA #IMPLIED +> + +<!ELEMENT domain (doc|rule|enum)*> +<!ATTLIST domain + name CDATA #REQUIRED + type CDATA #IMPLIED + label CDATA #IMPLIED +> + +<!ELEMENT struct (field|doc|rule)*> +<!ATTLIST struct + name CDATA #REQUIRED + label CDATA #IMPLIED + size (0|1|2|4) #IMPLIED + pack (0|1|2|4) #IMPLIED + code CDATA #IMPLIED> + +<!ELEMENT enum (choice)*> + +<!ELEMENT choice (doc|rule)*> +<!ATTLIST choice + name CDATA #REQUIRED + value CDATA #REQUIRED +> + +<!ELEMENT class (doc|role|rule|struct|domain|control|command)*> +<!ATTLIST class + name CDATA #REQUIRED + code CDATA #REQUIRED + label CDATA #IMPLIED +> + +<!ELEMENT role (doc|rule)*> +<!ATTLIST role + name CDATA #REQUIRED + implement (MAY|SHOULD|MUST) #REQUIRED +> + +<!ELEMENT control (doc|implement|rule|field|response)*> +<!ATTLIST control + name CDATA #REQUIRED + code CDATA #REQUIRED + label CDATA #IMPLIED +> + +<!ELEMENT command ((doc|implement|rule|exception|field|response)*, result?, segments?)> +<!ATTLIST command + name CDATA #REQUIRED + code CDATA #REQUIRED + label CDATA #IMPLIED +> + +<!ELEMENT implement (doc|rule)*> +<!ATTLIST implement + role CDATA #REQUIRED + handle (MAY|SHOULD|MUST) #REQUIRED + send (MAY|SHOULD|MUST) #IMPLIED +> + +<!ELEMENT field (doc|rule|exception)*> +<!ATTLIST field + name CDATA #REQUIRED + type CDATA #IMPLIED + default CDATA #IMPLIED + code CDATA #IMPLIED + label CDATA #IMPLIED + required CDATA #IMPLIED +> + +<!ELEMENT rule (doc*)> +<!ATTLIST rule + name CDATA #REQUIRED + label CDATA #IMPLIED +> + +<!ELEMENT exception (doc*)> +<!ATTLIST exception + name CDATA #REQUIRED + error-code CDATA #IMPLIED + label CDATA #IMPLIED +> + +<!ELEMENT response (doc|rule)*> +<!ATTLIST response + name CDATA #IMPLIED +> + +<!ELEMENT result (doc|rule|struct)*> +<!ATTLIST result + type CDATA #IMPLIED +> + +<!ELEMENT segments (doc|rule|header|body)*> + +<!ELEMENT header (doc|rule|entry)*> +<!ATTLIST header + required (true|false) #IMPLIED +> + +<!ELEMENT entry (doc|rule)*> +<!ATTLIST entry + type CDATA #REQUIRED +> + +<!ELEMENT body (doc|rule)*> +<!ATTLIST body + required (true|false) #IMPLIED +> + +<!ELEMENT doc (#PCDATA|xref)*> +<!ATTLIST doc + type (grammar|scenario|picture|bnf|todo) #IMPLIED + title CDATA #IMPLIED +> + +<!ELEMENT xref (#PCDATA)> +<!ATTLIST xref + ref CDATA #REQUIRED> diff --git a/qpid/python/qpid/specs/amqp-0-8-qpid-stripped.xml b/qpid/python/qpid/specs/amqp-0-8-qpid-stripped.xml new file mode 100644 index 0000000000..6975e17aa6 --- /dev/null +++ b/qpid/python/qpid/specs/amqp-0-8-qpid-stripped.xml @@ -0,0 +1,784 @@ +<?xml version="1.0"?> + +<!-- +(c) Copyright JPMorgan Chase Bank & Co., Cisco Systems, Inc., Envoy +Technologies Inc., iMatix Corporation, IONA\ufffd Technologies, Red +Hat, Inc., TWIST Process Innovations, and 29West Inc. 2006. + +Copyright (c) 2009 AMQP Working Group. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +1. Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright +notice, this list of conditions and the following disclaimer in the +documentation and/or other materials provided with the distribution. +3. The name of the author may not be used to endorse or promote products +derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +--> + +<amqp major="8" minor="0" port="5672"> + <constant name="frame method" value="1"/> + <constant name="frame header" value="2"/> + <constant name="frame body" value="3"/> + <constant name="frame oob method" value="4"/> + <constant name="frame oob header" value="5"/> + <constant name="frame oob body" value="6"/> + <constant name="frame trace" value="7"/> + <constant name="frame heartbeat" value="8"/> + <constant name="frame min size" value="4096"/> + <constant name="frame end" value="206"/> + <constant name="reply success" value="200"/> + <constant name="not delivered" value="310" class="soft error"/> + <constant name="content too large" value="311" class="soft error"/> + <constant name="connection forced" value="320" class="hard error"/> + <constant name="invalid path" value="402" class="hard error"/> + <constant name="access refused" value="403" class="soft error"/> + <constant name="not found" value="404" class="soft error"/> + <constant name="resource locked" value="405" class="soft error"/> + <constant name="frame error" value="501" class="hard error"/> + <constant name="syntax error" value="502" class="hard error"/> + <constant name="command invalid" value="503" class="hard error"/> + <constant name="channel error" value="504" class="hard error"/> + <constant name="resource error" value="506" class="hard error"/> + <constant name="not allowed" value="530" class="hard error"/> + <constant name="not implemented" value="540" class="hard error"/> + <constant name="internal error" value="541" class="hard error"/> + <domain name="access ticket" type="short"> + <assert check="ne" value="0"/> + </domain> + <domain name="class id" type="short"/> + <domain name="consumer tag" type="shortstr"/> + <domain name="delivery tag" type="longlong"/> + <domain name="exchange name" type="shortstr"> + <assert check="length" value="127"/> + </domain> + <domain name="known hosts" type="shortstr"/> + <domain name="method id" type="short"/> + <domain name="no ack" type="bit"/> + <domain name="no local" type="bit"/> + <domain name="path" type="shortstr"> + <assert check="notnull"/> + <assert check="syntax" rule="path"/> + <assert check="length" value="127"/> + </domain> + <domain name="peer properties" type="table"/> + <domain name="queue name" type="shortstr"> + <assert check="length" value="127"/> + </domain> + <domain name="redelivered" type="bit"/> + <domain name="reply code" type="short"> + <assert check="notnull"/> + </domain> + <domain name="reply text" type="shortstr"> + <assert check="notnull"/> + </domain> + <class name="connection" handler="connection" index="10"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="start" synchronous="1" index="10"> + <chassis name="client" implement="MUST"/> + <response name="start-ok"/> + <field name="version major" type="octet"/> + <field name="version minor" type="octet"/> + <field name="server properties" domain="peer properties"/> + <field name="mechanisms" type="longstr"> + <see name="security mechanisms"/> + <assert check="notnull"/> + </field> + <field name="locales" type="longstr"> + <assert check="notnull"/> + </field> + </method> + <method name="start-ok" synchronous="1" index="11"> + <chassis name="server" implement="MUST"/> + <field name="client properties" domain="peer properties"/> + <field name="mechanism" type="shortstr"> + <assert check="notnull"/> + </field> + <field name="response" type="longstr"> + <assert check="notnull"/> + </field> + <field name="locale" type="shortstr"> + <assert check="notnull"/> + </field> + </method> + <method name="secure" synchronous="1" index="20"> + <chassis name="client" implement="MUST"/> + <response name="secure-ok"/> + <field name="challenge" type="longstr"> + <see name="security mechanisms"/> + </field> + </method> + <method name="secure-ok" synchronous="1" index="21"> + <chassis name="server" implement="MUST"/> + <field name="response" type="longstr"> + <assert check="notnull"/> + </field> + </method> + <method name="tune" synchronous="1" index="30"> + <chassis name="client" implement="MUST"/> + <response name="tune-ok"/> + <field name="channel max" type="short"/> + <field name="frame max" type="long"/> + <field name="heartbeat" type="short"/> + </method> + <method name="tune-ok" synchronous="1" index="31"> + <chassis name="server" implement="MUST"/> + <field name="channel max" type="short"> + <assert check="notnull"/> + <assert check="le" method="tune" field="channel max"/> + </field> + <field name="frame max" type="long"/> + <field name="heartbeat" type="short"/> + </method> + <method name="open" synchronous="1" index="40"> + <chassis name="server" implement="MUST"/> + <response name="open-ok"/> + <response name="redirect"/> + <field name="virtual host" domain="path"> + <assert check="regexp" value="^[a-zA-Z0-9/-_]+$"/> + </field> + <field name="capabilities" type="shortstr"/> + <field name="insist" type="bit"/> + </method> + <method name="open-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <field name="known hosts" domain="known hosts"/> + </method> + <method name="redirect" synchronous="1" index="50"> + <chassis name="client" implement="MAY"/> + <field name="host" type="shortstr"> + <assert check="notnull"/> + </field> + <field name="known hosts" domain="known hosts"/> + </method> + <method name="close" synchronous="1" index="60"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="close-ok"/> + <field name="reply code" domain="reply code"/> + <field name="reply text" domain="reply text"/> + <field name="class id" domain="class id"/> + <!-- Qpid difference : correct the domain --> + <field name="method id" domain="method id"/> + </method> + <method name="close-ok" synchronous="1" index="61"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + </method> + </class> + <class name="channel" handler="channel" index="20"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="open" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="open-ok"/> + <field name="out of band" type="shortstr"> + <assert check="null"/> + </field> + </method> + <method name="open-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="flow" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="flow-ok"/> + <field name="active" type="bit"/> + </method> + <method name="flow-ok" index="21"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="active" type="bit"/> + </method> + <method name="alert" index="30"> + <chassis name="client" implement="MUST"/> + <field name="reply code" domain="reply code"/> + <field name="reply text" domain="reply text"/> + <field name="details" type="table"/> + </method> + <method name="close" synchronous="1" index="40"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="close-ok"/> + <field name="reply code" domain="reply code"/> + <field name="reply text" domain="reply text"/> + <field name="class id" domain="class id"/> + <field name="method id" domain="method id"/> + </method> + <method name="close-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + </method> + </class> + <class name="access" handler="connection" index="30"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="request" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="request-ok"/> + <field name="realm" domain="path"/> + <field name="exclusive" type="bit"/> + <field name="passive" type="bit"/> + <field name="active" type="bit"/> + <field name="write" type="bit"/> + <field name="read" type="bit"/> + </method> + <method name="request-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <field name="ticket" domain="access ticket"/> + </method> + </class> + <class name="exchange" handler="channel" index="40"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="declare" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="declare-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="exchange" domain="exchange name"> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/> + </field> + <field name="type" type="shortstr"> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/> + </field> + <field name="passive" type="bit"/> + <field name="durable" type="bit"/> + <field name="auto delete" type="bit"/> + <field name="internal" type="bit"/> + <field name="nowait" type="bit"/> + <field name="arguments" type="table"/> + </method> + <method name="declare-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="delete" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="delete-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="exchange" domain="exchange name"> + <assert check="notnull"/> + </field> + <field name="if unused" type="bit"/> + <field name="nowait" type="bit"/> + </method> + <method name="delete-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <!-- Qpid specific addition --> + <method name="bound" synchronous="1" index="22"> + <chassis name="server" implement="SHOULD"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + <field name="queue" domain="queue name"/> + </method> + <method name="bound-ok" synchronous="1" index="23"> + <field name="reply code" domain="reply code"/> + <field name="reply text" domain="reply text"/> + <chassis name="client" implement="SHOULD"/> + </method> + <!-- End Qpid specific addition --> + </class> + <class name="queue" handler="channel" index="50"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="declare" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="declare-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/> + </field> + <field name="passive" type="bit"/> + <field name="durable" type="bit"/> + <field name="exclusive" type="bit"/> + <field name="auto delete" type="bit"/> + <field name="nowait" type="bit"/> + <field name="arguments" type="table"/> + </method> + <method name="declare-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <field name="queue" domain="queue name"> + <assert check="notnull"/> + </field> + <field name="message count" type="long"/> + <field name="consumer count" type="long"/> + </method> + <method name="bind" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="bind-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + <field name="nowait" type="bit"/> + <field name="arguments" type="table"/> + </method> + <method name="bind-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <method name="purge" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="purge-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"/> + <field name="nowait" type="bit"/> + </method> + <method name="purge-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="message count" type="long"/> + </method> + <method name="delete" synchronous="1" index="40"> + <chassis name="server" implement="MUST"/> + <response name="delete-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"/> + <field name="if unused" type="bit"/> + <field name="if empty" type="bit"/> + <field name="nowait" type="bit"/> + </method> + <method name="delete-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <field name="message count" type="long"/> + </method> + </class> + <class name="basic" handler="channel" index="60"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MAY"/> + <field name="content type" type="shortstr"/> + <field name="content encoding" type="shortstr"/> + <field name="headers" type="table"/> + <field name="delivery mode" type="octet"/> + <field name="priority" type="octet"/> + <field name="correlation id" type="shortstr"/> + <field name="reply to" type="shortstr"/> + <field name="expiration" type="shortstr"/> + <field name="message id" type="shortstr"/> + <field name="timestamp" type="timestamp"/> + <field name="type" type="shortstr"/> + <field name="user id" type="shortstr"/> + <field name="app id" type="shortstr"/> + <field name="cluster id" type="shortstr"/> + <method name="qos" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="qos-ok"/> + <field name="prefetch size" type="long"/> + <field name="prefetch count" type="short"/> + <field name="global" type="bit"/> + </method> + <method name="qos-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="consume" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="consume-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="no local" domain="no local"/> + <field name="no ack" domain="no ack"/> + <field name="exclusive" type="bit"/> + <field name="nowait" type="bit"/> + <!-- Qpid specific addition : interop issue extra field --> + <field name="arguments" type="table"/> + </method> + <method name="consume-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + </method> + <method name="cancel" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="cancel-ok"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="nowait" type="bit"/> + </method> + <method name="cancel-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + </method> + <method name="publish" content="1" index="40"> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access ticket"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + <field name="mandatory" type="bit"/> + <field name="immediate" type="bit"/> + </method> + <method name="return" content="1" index="50"> + <chassis name="client" implement="MUST"/> + <field name="reply code" domain="reply code"/> + <field name="reply text" domain="reply text"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + </method> + <method name="deliver" content="1" index="60"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + </method> + <method name="get" synchronous="1" index="70"> + <response name="get-ok"/> + <response name="get-empty"/> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"/> + <field name="no ack" domain="no ack"/> + </method> + <method name="get-ok" synchronous="1" content="1" index="71"> + <chassis name="client" implement="MAY"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + <field name="message count" type="long"/> + </method> + <method name="get-empty" synchronous="1" index="72"> + <chassis name="client" implement="MAY"/> + <field name="cluster id" type="shortstr"/> + </method> + <method name="ack" index="80"> + <chassis name="server" implement="MUST"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="multiple" type="bit"/> + </method> + <method name="reject" index="90"> + <chassis name="server" implement="MUST"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="requeue" type="bit"/> + </method> + <!-- Qpid specific modification : interop issue, added synchronous reply --> + <method name="recover" index="100"> + <chassis name="server" implement="MUST"/> + <field name="requeue" type="bit"/> + <response name="recover-ok"/> + </method> + <method name="recover-ok" synchronous="1" index="101"> + <chassis name="client" implement="MUST"/> + </method> + <!-- End Qpid specific modification --> + </class> + <class name="file" handler="channel" index="70"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <field name="content type" type="shortstr"/> + <field name="content encoding" type="shortstr"/> + <field name="headers" type="table"/> + <field name="priority" type="octet"/> + <field name="reply to" type="shortstr"/> + <field name="message id" type="shortstr"/> + <field name="filename" type="shortstr"/> + <field name="timestamp" type="timestamp"/> + <field name="cluster id" type="shortstr"/> + <method name="qos" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="qos-ok"/> + <field name="prefetch size" type="long"/> + <field name="prefetch count" type="short"/> + <field name="global" type="bit"/> + </method> + <method name="qos-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="consume" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="consume-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="no local" domain="no local"/> + <field name="no ack" domain="no ack"/> + <field name="exclusive" type="bit"/> + <field name="nowait" type="bit"/> + </method> + <method name="consume-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + </method> + <method name="cancel" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="cancel-ok"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="nowait" type="bit"/> + </method> + <method name="cancel-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + </method> + <method name="open" synchronous="1" index="40"> + <response name="open-ok"/> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="identifier" type="shortstr"/> + <field name="content size" type="longlong"/> + </method> + <method name="open-ok" synchronous="1" index="41"> + <response name="stage"/> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="staged size" type="longlong"/> + </method> + <method name="stage" content="1" index="50"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + </method> + <method name="publish" index="60"> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access ticket"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + <field name="mandatory" type="bit"/> + <field name="immediate" type="bit"/> + <field name="identifier" type="shortstr"/> + </method> + <method name="return" content="1" index="70"> + <chassis name="client" implement="MUST"/> + <field name="reply code" domain="reply code"/> + <field name="reply text" domain="reply text"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + </method> + <method name="deliver" index="80"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + <field name="identifier" type="shortstr"/> + </method> + <method name="ack" index="90"> + <chassis name="server" implement="MUST"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="multiple" type="bit"/> + </method> + <method name="reject" index="100"> + <chassis name="server" implement="MUST"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="requeue" type="bit"/> + </method> + </class> + <class name="stream" handler="channel" index="80"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <field name="content type" type="shortstr"/> + <field name="content encoding" type="shortstr"/> + <field name="headers" type="table"/> + <field name="priority" type="octet"/> + <field name="timestamp" type="timestamp"/> + <method name="qos" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="qos-ok"/> + <field name="prefetch size" type="long"/> + <field name="prefetch count" type="short"/> + <field name="consume rate" type="long"/> + <field name="global" type="bit"/> + </method> + <method name="qos-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="consume" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="consume-ok"/> + <field name="ticket" domain="access ticket"/> + <field name="queue" domain="queue name"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="no local" domain="no local"/> + <field name="exclusive" type="bit"/> + <field name="nowait" type="bit"/> + </method> + <method name="consume-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + </method> + <method name="cancel" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="cancel-ok"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="nowait" type="bit"/> + </method> + <method name="cancel-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + </method> + <method name="publish" content="1" index="40"> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access ticket"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + <field name="mandatory" type="bit"/> + <field name="immediate" type="bit"/> + </method> + <method name="return" content="1" index="50"> + <chassis name="client" implement="MUST"/> + <field name="reply code" domain="reply code"/> + <field name="reply text" domain="reply text"/> + <field name="exchange" domain="exchange name"/> + <field name="routing key" type="shortstr"/> + </method> + <method name="deliver" content="1" index="60"> + <chassis name="client" implement="MUST"/> + <field name="consumer tag" domain="consumer tag"/> + <field name="delivery tag" domain="delivery tag"/> + <field name="exchange" domain="exchange name"/> + <field name="queue" domain="queue name"> + <assert check="notnull"/> + </field> + </method> + </class> + <class name="tx" handler="channel" index="90"> + <chassis name="server" implement="SHOULD"/> + <chassis name="client" implement="MAY"/> + <method name="select" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="select-ok"/> + </method> + <method name="select-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="commit" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="commit-ok"/> + </method> + <method name="commit-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <method name="rollback" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="rollback-ok"/> + </method> + <method name="rollback-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + </method> + </class> + <class name="dtx" handler="channel" index="100"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <method name="select" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="select-ok"/> + </method> + <method name="select-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="start" synchronous="1" index="20"> + <chassis name="server" implement="MAY"/> + <response name="start-ok"/> + <field name="dtx identifier" type="shortstr"> + <assert check="notnull"/> + </field> + </method> + <method name="start-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + </class> + <class name="tunnel" handler="tunnel" index="110"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <field name="headers" type="table"/> + <field name="proxy name" type="shortstr"/> + <field name="data name" type="shortstr"/> + <field name="durable" type="octet"/> + <field name="broadcast" type="octet"/> + <method name="request" content="1" index="10"> + <chassis name="server" implement="MUST"/> + <field name="meta data" type="table"/> + </method> + </class> + <class name="test" handler="channel" index="120"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="SHOULD"/> + <method name="integer" synchronous="1" index="10"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="integer-ok"/> + <field name="integer 1" type="octet"/> + <field name="integer 2" type="short"/> + <field name="integer 3" type="long"/> + <field name="integer 4" type="longlong"/> + <field name="operation" type="octet"> + <assert check="enum"> + <value name="add"/> + <value name="min"/> + <value name="max"/> + </assert> + </field> + </method> + <method name="integer-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <field name="result" type="longlong"/> + </method> + <method name="string" synchronous="1" index="20"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="string-ok"/> + <field name="string 1" type="shortstr"/> + <field name="string 2" type="longstr"/> + <field name="operation" type="octet"> + <assert check="enum"> + <value name="add"/> + <value name="min"/> + <value name="max"/> + </assert> + </field> + </method> + <method name="string-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <field name="result" type="longstr"/> + </method> + <method name="table" synchronous="1" index="30"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="table-ok"/> + <field name="table" type="table"/> + <field name="integer op" type="octet"> + <assert check="enum"> + <value name="add"/> + <value name="min"/> + <value name="max"/> + </assert> + </field> + <field name="string op" type="octet"> + <assert check="enum"> + <value name="add"/> + <value name="min"/> + <value name="max"/> + </assert> + </field> + </method> + <method name="table-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <field name="integer result" type="longlong"/> + <field name="string result" type="longstr"/> + </method> + <method name="content" synchronous="1" content="1" index="40"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="content-ok"/> + </method> + <method name="content-ok" synchronous="1" content="1" index="41"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <field name="content checksum" type="long"/> + </method> + </class> +</amqp> diff --git a/qpid/python/qpid/specs/amqp-0-9-1-stripped.xml b/qpid/python/qpid/specs/amqp-0-9-1-stripped.xml new file mode 100644 index 0000000000..ec55c8dd7a --- /dev/null +++ b/qpid/python/qpid/specs/amqp-0-9-1-stripped.xml @@ -0,0 +1,477 @@ +<?xml version="1.0"?> +<!-- +Copyright (c) 2009 AMQP Working Group. +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +1. Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright +notice, this list of conditions and the following disclaimer in the +documentation and/or other materials provided with the distribution. +3. The name of the author may not be used to endorse or promote products +derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +--> +<amqp major="0" minor="91" port="5672"> + <constant name="frame-method" value="1"/> + <constant name="frame-header" value="2"/> + <constant name="frame-body" value="3"/> + <constant name="frame-heartbeat" value="8"/> + <constant name="frame-min-size" value="4096"/> + <constant name="frame-end" value="206"/> + <constant name="reply-success" value="200"/> + <constant name="content-too-large" value="311" class="soft-error"/> + <constant name="no-consumers" value="313" class="soft-error"/> + <constant name="connection-forced" value="320" class="hard-error"/> + <constant name="invalid-path" value="402" class="hard-error"/> + <constant name="access-refused" value="403" class="soft-error"/> + <constant name="not-found" value="404" class="soft-error"/> + <constant name="resource-locked" value="405" class="soft-error"/> + <constant name="precondition-failed" value="406" class="soft-error"/> + <constant name="frame-error" value="501" class="hard-error"/> + <constant name="syntax-error" value="502" class="hard-error"/> + <constant name="command-invalid" value="503" class="hard-error"/> + <constant name="channel-error" value="504" class="hard-error"/> + <constant name="unexpected-frame" value="505" class="hard-error"/> + <constant name="resource-error" value="506" class="hard-error"/> + <constant name="not-allowed" value="530" class="hard-error"/> + <constant name="not-implemented" value="540" class="hard-error"/> + <constant name="internal-error" value="541" class="hard-error"/> + <domain name="class-id" type="short"/> + <domain name="consumer-tag" type="shortstr"/> + <domain name="delivery-tag" type="longlong"/> + <domain name="exchange-name" type="shortstr"> + <assert check="length" value="127"/> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/> + </domain> + <domain name="method-id" type="short"/> + <domain name="no-ack" type="bit"/> + <domain name="no-local" type="bit"/> + <domain name="nowait" type="bit"/> + <!-- Qpid: restore these so that the generation sees the methods aas the same --> + <domain name="known-hosts" type="shortstr"/> + <domain name="access-ticket" type="short"/> + <!-- end Qpid specific --> + <domain name="path" type="shortstr"> + <assert check="notnull"/> + <assert check="length" value="127"/> + </domain> + <domain name="peer-properties" type="table"/> + <domain name="queue-name" type="shortstr"> + <assert check="length" value="127"/> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/> + </domain> + <domain name="redelivered" type="bit"/> + <domain name="message-count" type="long"/> + <domain name="reply-code" type="short"> + <assert check="notnull"/> + </domain> + <domain name="reply-text" type="shortstr"> + <assert check="notnull"/> + </domain> + <domain name="bit" type="bit"/> + <domain name="octet" type="octet"/> + <domain name="short" type="short"/> + <domain name="long" type="long"/> + <domain name="longlong" type="longlong"/> + <domain name="shortstr" type="shortstr"/> + <domain name="longstr" type="longstr"/> + <domain name="timestamp" type="timestamp"/> + <domain name="table" type="table"/> + <class name="connection" handler="connection" index="10"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="start" synchronous="1" index="10"> + <chassis name="client" implement="MUST"/> + <response name="start-ok"/> + <field name="version-major" domain="octet"/> + <field name="version-minor" domain="octet"/> + <field name="server-properties" domain="peer-properties"/> + <field name="mechanisms" domain="longstr"> + <assert check="notnull"/> + </field> + <field name="locales" domain="longstr"> + <assert check="notnull"/> + </field> + </method> + <method name="start-ok" synchronous="1" index="11"> + <chassis name="server" implement="MUST"/> + <field name="client-properties" domain="peer-properties"/> + <field name="mechanism" domain="shortstr"> + <assert check="notnull"/> + </field> + <field name="response" domain="longstr"> + <assert check="notnull"/> + </field> + <field name="locale" domain="shortstr"> + <assert check="notnull"/> + </field> + </method> + <method name="secure" synchronous="1" index="20"> + <chassis name="client" implement="MUST"/> + <response name="secure-ok"/> + <field name="challenge" domain="longstr"/> + </method> + <method name="secure-ok" synchronous="1" index="21"> + <chassis name="server" implement="MUST"/> + <field name="response" domain="longstr"> + <assert check="notnull"/> + </field> + </method> + <method name="tune" synchronous="1" index="30"> + <chassis name="client" implement="MUST"/> + <response name="tune-ok"/> + <field name="channel-max" domain="short"/> + <field name="frame-max" domain="long"/> + <field name="heartbeat" domain="short"/> + </method> + <method name="tune-ok" synchronous="1" index="31"> + <chassis name="server" implement="MUST"/> + <field name="channel-max" domain="short"> + <assert check="notnull"/> + <assert check="le" method="tune" field="channel-max"/> + </field> + <field name="frame-max" domain="long"/> + <field name="heartbeat" domain="short"/> + </method> + <method name="open" synchronous="1" index="40"> + <chassis name="server" implement="MUST"/> + <response name="open-ok"/> + <field name="virtual-host" domain="path"/> + <field name="capabilities" type="shortstr" reserved="1"/> + <field name="insist" type="bit" reserved="1"/> + </method> + <method name="open-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <field name="known-hosts" domain="known-hosts" reserved="1"/> + </method> + <method name="close" synchronous="1" index="50"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="close-ok"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="class-id" domain="class-id"/> + <field name="method-id" domain="method-id"/> + </method> + <method name="close-ok" synchronous="1" index="51"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + </method> + </class> + <class name="channel" handler="channel" index="20"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="open" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="open-ok"/> + <field name="out-of-band" type="shortstr" reserved="1"/> + </method> + <method name="open-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <field name="channel-id" type="longstr" reserved="1"/> + </method> + <method name="flow" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="flow-ok"/> + <field name="active" domain="bit"/> + </method> + <method name="flow-ok" index="21"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="active" domain="bit"/> + </method> + <method name="close" synchronous="1" index="40"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="close-ok"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="class-id" domain="class-id"/> + <field name="method-id" domain="method-id"/> + </method> + <method name="close-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + </method> + </class> + <class name="exchange" handler="channel" index="40"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="declare" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="declare-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="exchange" domain="exchange-name"> + <assert check="notnull"/> + </field> + <field name="type" domain="shortstr"/> + <field name="passive" domain="bit"/> + <field name="durable" domain="bit"/> + <field name="auto-delete" type="bit" reserved="1"/> + <field name="internal" type="bit" reserved="1"/> + <field name="nowait" domain="bit"/> + <field name="arguments" domain="table"/> + </method> + <method name="declare-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="delete" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="delete-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="exchange" domain="exchange-name"> + <assert check="notnull"/> + </field> + <field name="if-unused" domain="bit"/> + <field name="nowait" domain="bit"/> + </method> + <method name="delete-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <!-- Qpid : Added Exchange.bound and Exchange.bound-ok --> + <method name="bound" synchronous="1" index="22"> + <chassis name="server" implement="SHOULD"/> + <response name="bound-ok"/> + <field name="exchange" domain="exchange-name"/> + <field name = "routing-key" type = "shortstr"/> + <field name = "queue" domain = "queue name"/> + </method> + <method name="bound-ok" synchronous="1" index="23"> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <chassis name="client" implement="SHOULD"/> + </method> + <!-- End Qpid addition --> + </class> + <class name="queue" handler="channel" index="50"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="declare" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="declare-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="queue" domain="queue-name"/> + <field name="passive" domain="bit"/> + <field name="durable" domain="bit"/> + <field name="exclusive" domain="bit"/> + <field name="auto-delete" domain="bit"/> + <field name="nowait" domain="bit"/> + <field name="arguments" domain="table"/> + </method> + <method name="declare-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <field name="queue" domain="queue-name"> + <assert check="notnull"/> + </field> + <field name="message-count" domain="long"/> + <field name="consumer-count" domain="long"/> + </method> + <method name="bind" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="bind-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="queue" domain="queue-name"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="nowait" domain="bit"/> + <field name="arguments" domain="table"/> + </method> + <method name="bind-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <method name="unbind" synchronous="1" index="50"> + <chassis name="server" implement="MUST"/> + <response name="unbind-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="queue" domain="queue-name"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="arguments" domain="table"/> + </method> + <method name="unbind-ok" synchronous="1" index="51"> + <chassis name="client" implement="MUST"/> + </method> + <method name="purge" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="purge-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="queue" domain="queue-name"/> + <field name="nowait" domain="bit"/> + </method> + <method name="purge-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="message-count" domain="long"/> + </method> + <method name="delete" synchronous="1" index="40"> + <chassis name="server" implement="MUST"/> + <response name="delete-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="queue" domain="queue-name"/> + <field name="if-unused" domain="bit"/> + <field name="if-empty" domain="bit"/> + <field name="nowait" domain="bit"/> + </method> + <method name="delete-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <field name="message-count" domain="long"/> + </method> + </class> + <class name="basic" handler="channel" index="60"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MAY"/> + <field name="content-type" domain="shortstr"/> + <field name="content-encoding" domain="shortstr"/> + <field name="headers" domain="table"/> + <field name="delivery-mode" domain="octet"/> + <field name="priority" domain="octet"/> + <field name="correlation-id" domain="shortstr"/> + <field name="reply-to" domain="shortstr"/> + <field name="expiration" domain="shortstr"/> + <field name="message-id" domain="shortstr"/> + <field name="timestamp" domain="timestamp"/> + <field name="type" domain="shortstr"/> + <field name="user-id" domain="shortstr"/> + <field name="app-id" domain="shortstr"/> + <field name="reserved" domain="shortstr"/> + <method name="qos" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" domain="long"/> + <field name="prefetch-count" domain="short"/> + <field name="global" domain="bit"/> + </method> + <method name="qos-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="consume" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="consume-ok"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="queue" domain="queue-name"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="no-local" domain="no-local"/> + <field name="no-ack" domain="no-ack"/> + <field name="exclusive" domain="bit"/> + <field name="nowait" domain="bit"/> + <field name="arguments" domain="table"/> + </method> + <method name="consume-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="cancel" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="cancel-ok"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="nowait" domain="bit"/> + </method> + <method name="cancel-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="publish" content="1" index="40"> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="mandatory" domain="bit"/> + <field name="immediate" domain="bit"/> + </method> + <method name="return" content="1" index="50"> + <chassis name="client" implement="MUST"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + </method> + <method name="deliver" content="1" index="60"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + </method> + <method name="get" synchronous="1" index="70"> + <response name="get-ok"/> + <response name="get-empty"/> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access-ticket" reserved="1"/> + <field name="queue" domain="queue-name"/> + <field name="no-ack" domain="no-ack"/> + </method> + <method name="get-ok" synchronous="1" content="1" index="71"> + <chassis name="client" implement="MAY"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="message-count" domain="long"/> + </method> + <method name="get-empty" synchronous="1" index="72"> + <chassis name="client" implement="MAY"/> + <field name="cluster-id" type="shortstr" reserved="1"/> + </method> + <method name="ack" index="80"> + <chassis name="server" implement="MUST"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="multiple" domain="bit"/> + </method> + <method name="reject" index="90"> + <chassis name="server" implement="MUST"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="requeue" domain="bit"/> + </method> + <method name="recover" index="100" deprecated="1"> + <chassis name="server" implement="MAY"/> + <field name="requeue" domain="bit"/> + </method> + <method name="recover-sync" index="110"> + <chassis name="server" implement="MUST"/> + <field name="requeue" domain="bit"/> + </method> + <method name="recover-sync-ok" synchronous="1" index="111"> + <chassis name="client" implement="MUST"/> + </method> + </class> + <class name="tx" handler="channel" index="90"> + <chassis name="server" implement="SHOULD"/> + <chassis name="client" implement="MAY"/> + <method name="select" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="select-ok"/> + </method> + <method name="select-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="commit" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="commit-ok"/> + </method> + <method name="commit-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <method name="rollback" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="rollback-ok"/> + </method> + <method name="rollback-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + </method> + </class> +</amqp> diff --git a/qpid/python/qpid/specs/amqp-0-9-qpid-stripped.xml b/qpid/python/qpid/specs/amqp-0-9-qpid-stripped.xml new file mode 100644 index 0000000000..e0075870de --- /dev/null +++ b/qpid/python/qpid/specs/amqp-0-9-qpid-stripped.xml @@ -0,0 +1,876 @@ +<?xml version="1.0"?> + +<!-- +(c) Copyright JPMorgan Chase Bank & Co., Cisco Systems, Inc., Envoy +Technologies Inc., iMatix Corporation, IONA\ufffd Technologies, Red +Hat, Inc., TWIST Process Innovations, and 29West Inc. 2006. + +Copyright (c) 2009 AMQP Working Group. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +1. Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright +notice, this list of conditions and the following disclaimer in the +documentation and/or other materials provided with the distribution. +3. The name of the author may not be used to endorse or promote products +derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +--> + +<amqp major="0" minor="9" port="5672"> + <constant name="frame-method" value="1"/> + <constant name="frame-header" value="2"/> + <constant name="frame-body" value="3"/> + <constant name="frame-oob-method" value="4"/> + <constant name="frame-oob-header" value="5"/> + <constant name="frame-oob-body" value="6"/> + <constant name="frame-trace" value="7"/> + <constant name="frame-heartbeat" value="8"/> + <constant name="frame-min-size" value="4096"/> + <constant name="frame-end" value="206"/> + <constant name="reply-success" value="200"/> + <constant name="not-delivered" value="310" class="soft-error"/> + <constant name="content-too-large" value="311" class="soft-error"/> + <constant name="no-route" value="312" class="soft-error"/> + <constant name="no-consumers" value="313" class="soft-error"/> + <constant name="connection-forced" value="320" class="hard-error"/> + <constant name="invalid-path" value="402" class="hard-error"/> + <constant name="access-refused" value="403" class="soft-error"/> + <constant name="not-found" value="404" class="soft-error"/> + <constant name="resource-locked" value="405" class="soft-error"/> + <constant name="precondition-failed" value="406" class="soft-error"/> + <constant name="frame-error" value="501" class="hard-error"/> + <constant name="syntax-error" value="502" class="hard-error"/> + <constant name="command-invalid" value="503" class="hard-error"/> + <constant name="channel-error" value="504" class="hard-error"/> + <constant name="resource-error" value="506" class="hard-error"/> + <constant name="not-allowed" value="530" class="hard-error"/> + <constant name="not-implemented" value="540" class="hard-error"/> + <constant name="internal-error" value="541" class="hard-error"/> + <domain name="access-ticket" type="short"> + <assert check="ne" value="0"/> + </domain> + <domain name="class-id" type="short"/> + <domain name="consumer-tag" type="shortstr"/> + <domain name="delivery-tag" type="longlong"/> + <domain name="exchange-name" type="shortstr"> + <assert check="length" value="127"/> + </domain> + <domain name="known-hosts" type="shortstr"/> + <domain name="method-id" type="short"/> + <domain name="no-ack" type="bit"/> + <domain name="no-local" type="bit"/> + <domain name="path" type="shortstr"> + <assert check="notnull"/> + <assert check="syntax" rule="path"/> + <assert check="length" value="127"/> + </domain> + <domain name="peer-properties" type="table"/> + <domain name="queue-name" type="shortstr"> + <assert check="length" value="127"/> + </domain> + <domain name="redelivered" type="bit"/> + <domain name="reply-code" type="short"> + <assert check="notnull"/> + </domain> + <domain name="reply-text" type="shortstr"> + <assert check="notnull"/> + </domain> + <domain name="channel-id" type="longstr"/> + <domain name="duration" type="longlong"/> + <domain name="offset" type="longlong"/> + <domain name="reference" type="longstr"/> + <domain name="destination" type="shortstr"/> + <domain name="reject-code" type="short"/> + <domain name="reject-text" type="shortstr"/> + <domain name="security-token" type="longstr"/> + <domain name="bit" type="bit"/> + <domain name="octet" type="octet"/> + <domain name="short" type="short"/> + <domain name="long" type="long"/> + <domain name="longlong" type="longlong"/> + <domain name="shortstr" type="shortstr"/> + <domain name="longstr" type="longstr"/> + <domain name="timestamp" type="timestamp"/> + <domain name="table" type="table"/> + <class name="connection" handler="connection" index="10"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="start" synchronous="1" index="10"> + <chassis name="client" implement="MUST"/> + <response name="start-ok"/> + <field name="version-major" domain="octet"/> + <field name="version-minor" domain="octet"/> + <field name="server-properties" domain="peer-properties"/> + <field name="mechanisms" domain="longstr"> + <assert check="notnull"/> + </field> + <field name="locales" domain="longstr"> + <assert check="notnull"/> + </field> + </method> + <method name="start-ok" synchronous="1" index="11"> + <chassis name="server" implement="MUST"/> + <field name="client-properties" domain="peer-properties"/> + <field name="mechanism" domain="shortstr"> + <assert check="notnull"/> + </field> + <field name="response" domain="longstr"> + <assert check="notnull"/> + </field> + <field name="locale" domain="shortstr"> + <assert check="notnull"/> + </field> + </method> + <method name="secure" synchronous="1" index="20"> + <chassis name="client" implement="MUST"/> + <response name="secure-ok"/> + <field name="challenge" domain="longstr"/> + </method> + <method name="secure-ok" synchronous="1" index="21"> + <chassis name="server" implement="MUST"/> + <field name="response" domain="longstr"> + <assert check="notnull"/> + </field> + </method> + <method name="tune" synchronous="1" index="30"> + <chassis name="client" implement="MUST"/> + <response name="tune-ok"/> + <field name="channel-max" domain="short"/> + <field name="frame-max" domain="long"/> + <field name="heartbeat" domain="short"/> + </method> + <method name="tune-ok" synchronous="1" index="31"> + <chassis name="server" implement="MUST"/> + <field name="channel-max" domain="short"> + <assert check="notnull"/> + <assert check="le" method="tune" field="channel-max"/> + </field> + <field name="frame-max" domain="long"/> + <field name="heartbeat" domain="short"/> + </method> + <method name="open" synchronous="1" index="40"> + <chassis name="server" implement="MUST"/> + <response name="open-ok"/> + <response name="redirect"/> + <field name="virtual-host" domain="path"> + <assert check="regexp" value="^[a-zA-Z0-9/-_]+$"/> + </field> + <field name="capabilities" domain="shortstr"/> + <field name="insist" domain="bit"/> + </method> + <method name="open-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <field name="known-hosts" domain="known-hosts"/> + </method> + <method name="redirect" synchronous="1" index="42"> + <chassis name="client" implement="MUST"/> + <field name="host" domain="shortstr"> + <assert check="notnull"/> + </field> + <field name="known-hosts" domain="known-hosts"/> + </method> + <method name="close" synchronous="1" index="50"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="close-ok"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="class-id" domain="class-id"/> + <field name="method-id" domain="method-id"/> + </method> + <method name="close-ok" synchronous="1" index="51"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + </method> + </class> + <class name="channel" handler="channel" index="20"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="open" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="open-ok"/> + <field name="out-of-band" domain="shortstr"> + <assert check="null"/> + </field> + </method> + <method name="open-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <field name="channel-id" domain="channel-id"/> + </method> + <method name="flow" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="flow-ok"/> + <field name="active" domain="bit"/> + </method> + <method name="flow-ok" index="21"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="active" domain="bit"/> + </method> + <method name="close" synchronous="1" index="40"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + <response name="close-ok"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="class-id" domain="class-id"/> + <field name="method-id" domain="method-id"/> + </method> + <method name="close-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <chassis name="server" implement="MUST"/> + </method> + <method name="resume" index="50"> + <response name="ok"/> + <chassis name="server" implement="MAY"/> + <field name="channel-id" domain="channel-id"/> + </method> + <method name="ping" index="60"> + <response name="ok"/> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + </method> + <method name="pong" index="70"> + <response name="ok"/> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + </method> + <method name="ok" index="80"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + </method> + </class> + <class name="access" handler="connection" index="30"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="request" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="request-ok"/> + <field name="realm" domain="shortstr"/> + <field name="exclusive" domain="bit"/> + <field name="passive" domain="bit"/> + <field name="active" domain="bit"/> + <field name="write" domain="bit"/> + <field name="read" domain="bit"/> + </method> + <method name="request-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <field name="ticket" domain="access-ticket"/> + </method> + </class> + <class name="exchange" handler="channel" index="40"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="declare" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="declare-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="exchange" domain="exchange-name"> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/> + </field> + <field name="type" domain="shortstr"> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/> + </field> + <field name="passive" domain="bit"/> + <field name="durable" domain="bit"/> + <field name="auto-delete" domain="bit"/> + <field name="internal" domain="bit"/> + <field name="nowait" domain="bit"/> + <field name="arguments" domain="table"/> + </method> + <method name="declare-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="delete" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="delete-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="exchange" domain="exchange-name"> + <assert check="notnull"/> + </field> + <field name="if-unused" domain="bit"/> + <field name="nowait" domain="bit"/> + </method> + <method name="delete-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <!-- Qpid specific addition --> + <method name="bound" synchronous="1" index="22"> + <chassis name="server" implement="SHOULD"/> + <response name="bound-ok"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" type="shortstr"/> + <field name="queue" domain="queue name"/> + </method> + <method name="bound-ok" synchronous="1" index="23"> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <chassis name="client" implement="SHOULD"/> + </method> + <!-- End Qpid specific addition --> + </class> + <class name="queue" handler="channel" index="50"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="declare" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="declare-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"> + <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/> + </field> + <field name="passive" domain="bit"/> + <field name="durable" domain="bit"/> + <field name="exclusive" domain="bit"/> + <field name="auto-delete" domain="bit"/> + <field name="nowait" domain="bit"/> + <!-- Qpid diff - this field is known as filter in the original 0-9, + however since the name does not go on the wire, there is no + interop implication --> + <field name="arguments" domain="table"/> + </method> + <method name="declare-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + <field name="queue" domain="queue-name"> + <assert check="notnull"/> + </field> + <field name="message-count" domain="long"/> + <field name="consumer-count" domain="long"/> + </method> + <method name="bind" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="bind-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="nowait" domain="bit"/> + <field name="arguments" domain="table"/> + </method> + <method name="bind-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <method name="unbind" synchronous="1" index="50"> + <chassis name="server" implement="MUST"/> + <response name="unbind-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="arguments" domain="table"/> + </method> + <method name="unbind-ok" synchronous="1" index="51"> + <chassis name="client" implement="MUST"/> + </method> + <method name="purge" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="purge-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="nowait" domain="bit"/> + </method> + <method name="purge-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="message-count" domain="long"/> + </method> + <method name="delete" synchronous="1" index="40"> + <chassis name="server" implement="MUST"/> + <response name="delete-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="if-unused" domain="bit"/> + <field name="if-empty" domain="bit"/> + <field name="nowait" domain="bit"/> + </method> + <method name="delete-ok" synchronous="1" index="41"> + <chassis name="client" implement="MUST"/> + <field name="message-count" domain="long"/> + </method> + </class> + <class name="basic" handler="channel" index="60"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MAY"/> + <field name="content-type" domain="shortstr"/> + <field name="content-encoding" domain="shortstr"/> + <field name="headers" domain="table"/> + <field name="delivery-mode" domain="octet"/> + <field name="priority" domain="octet"/> + <field name="correlation-id" domain="shortstr"/> + <field name="reply-to" domain="shortstr"/> + <field name="expiration" domain="shortstr"/> + <field name="message-id" domain="shortstr"/> + <field name="timestamp" domain="timestamp"/> + <field name="type" domain="shortstr"/> + <field name="user-id" domain="shortstr"/> + <field name="app-id" domain="shortstr"/> + <field name="cluster-id" domain="shortstr"/> + <method name="qos" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" domain="long"/> + <field name="prefetch-count" domain="short"/> + <field name="global" domain="bit"/> + </method> + <method name="qos-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="consume" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="consume-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="no-local" domain="no-local"/> + <field name="no-ack" domain="no-ack"/> + <field name="exclusive" domain="bit"/> + <field name="nowait" domain="bit"/> + <field name="arguments" domain="table"/> + </method> + <method name="consume-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="cancel" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="cancel-ok"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="nowait" domain="bit"/> + </method> + <method name="cancel-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="publish" content="1" index="40"> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access-ticket"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="mandatory" domain="bit"/> + <field name="immediate" domain="bit"/> + </method> + <method name="return" content="1" index="50"> + <chassis name="client" implement="MUST"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + </method> + <method name="deliver" content="1" index="60"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + </method> + <method name="get" synchronous="1" index="70"> + <response name="get-ok"/> + <response name="get-empty"/> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="no-ack" domain="no-ack"/> + </method> + <method name="get-ok" synchronous="1" content="1" index="71"> + <chassis name="client" implement="MAY"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="message-count" domain="long"/> + </method> + <method name="get-empty" synchronous="1" index="72"> + <chassis name="client" implement="MAY"/> + <field name="cluster-id" domain="shortstr"/> + </method> + <method name="ack" index="80"> + <chassis name="server" implement="MUST"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="multiple" domain="bit"/> + </method> + <method name="reject" index="90"> + <chassis name="server" implement="MUST"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="requeue" domain="bit"/> + </method> + <method name="recover" index="100"> + <chassis name="server" implement="MUST"/> + <field name="requeue" domain="bit"/> + </method> + <!-- Qpid specific addition --> + <method name="recover-sync" index="102"> + <chassis name="server" implement="MUST"/> + <field name="requeue" type="bit"/> + <response name="recover-sync-ok"/> + </method> + <method name="recover-sync-ok" synchronous="1" index="101"> + <chassis name="client" implement="MUST"/> + </method> + <!-- End Qpid specific addition --> + </class> + <class name="file" handler="channel" index="70"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <field name="content-type" domain="shortstr"/> + <field name="content-encoding" domain="shortstr"/> + <field name="headers" domain="table"/> + <field name="priority" domain="octet"/> + <field name="reply-to" domain="shortstr"/> + <field name="message-id" domain="shortstr"/> + <field name="filename" domain="shortstr"/> + <field name="timestamp" domain="timestamp"/> + <field name="cluster-id" domain="shortstr"/> + <method name="qos" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" domain="long"/> + <field name="prefetch-count" domain="short"/> + <field name="global" domain="bit"/> + </method> + <method name="qos-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="consume" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="consume-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="no-local" domain="no-local"/> + <field name="no-ack" domain="no-ack"/> + <field name="exclusive" domain="bit"/> + <field name="nowait" domain="bit"/> + <field name="filter" domain="table"/> + </method> + <method name="consume-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="cancel" synchronous="1" index="30"> + <response name="cancel-ok"/> + <chassis name="server" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="nowait" domain="bit"/> + </method> + <method name="cancel-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="open" synchronous="1" index="40"> + <response name="open-ok"/> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="identifier" domain="shortstr"/> + <field name="content-size" domain="longlong"/> + </method> + <method name="open-ok" synchronous="1" index="41"> + <response name="stage"/> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="staged-size" domain="longlong"/> + </method> + <method name="stage" content="1" index="50"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + </method> + <method name="publish" index="60"> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access-ticket"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="mandatory" domain="bit"/> + <field name="immediate" domain="bit"/> + <field name="identifier" domain="shortstr"/> + </method> + <method name="return" content="1" index="70"> + <chassis name="client" implement="MUST"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + </method> + <method name="deliver" index="80"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="redelivered" domain="redelivered"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="identifier" domain="shortstr"/> + </method> + <method name="ack" index="90"> + <chassis name="server" implement="MUST"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="multiple" domain="bit"/> + </method> + <method name="reject" index="100"> + <chassis name="server" implement="MUST"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="requeue" domain="bit"/> + </method> + </class> + <class name="stream" handler="channel" index="80"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <field name="content-type" domain="shortstr"/> + <field name="content-encoding" domain="shortstr"/> + <field name="headers" domain="table"/> + <field name="priority" domain="octet"/> + <field name="timestamp" domain="timestamp"/> + <method name="qos" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="qos-ok"/> + <field name="prefetch-size" domain="long"/> + <field name="prefetch-count" domain="short"/> + <field name="consume-rate" domain="long"/> + <field name="global" domain="bit"/> + </method> + <method name="qos-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="consume" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="consume-ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="no-local" domain="no-local"/> + <field name="exclusive" domain="bit"/> + <field name="nowait" domain="bit"/> + <field name="filter" domain="table"/> + </method> + <method name="consume-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="cancel" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="cancel-ok"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="nowait" domain="bit"/> + </method> + <method name="cancel-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + </method> + <method name="publish" content="1" index="40"> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access-ticket"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="mandatory" domain="bit"/> + <field name="immediate" domain="bit"/> + </method> + <method name="return" content="1" index="50"> + <chassis name="client" implement="MUST"/> + <field name="reply-code" domain="reply-code"/> + <field name="reply-text" domain="reply-text"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + </method> + <method name="deliver" content="1" index="60"> + <chassis name="client" implement="MUST"/> + <field name="consumer-tag" domain="consumer-tag"/> + <field name="delivery-tag" domain="delivery-tag"/> + <field name="exchange" domain="exchange-name"/> + <field name="queue" domain="queue-name"> + <assert check="notnull"/> + </field> + </method> + </class> + <class name="tx" handler="channel" index="90"> + <chassis name="server" implement="SHOULD"/> + <chassis name="client" implement="MAY"/> + <method name="select" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="select-ok"/> + </method> + <method name="select-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="commit" synchronous="1" index="20"> + <chassis name="server" implement="MUST"/> + <response name="commit-ok"/> + </method> + <method name="commit-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + <method name="rollback" synchronous="1" index="30"> + <chassis name="server" implement="MUST"/> + <response name="rollback-ok"/> + </method> + <method name="rollback-ok" synchronous="1" index="31"> + <chassis name="client" implement="MUST"/> + </method> + </class> + <class name="dtx" handler="channel" index="100"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <method name="select" synchronous="1" index="10"> + <chassis name="server" implement="MUST"/> + <response name="select-ok"/> + </method> + <method name="select-ok" synchronous="1" index="11"> + <chassis name="client" implement="MUST"/> + </method> + <method name="start" synchronous="1" index="20"> + <chassis name="server" implement="MAY"/> + <response name="start-ok"/> + <field name="dtx-identifier" domain="shortstr"> + <assert check="notnull"/> + </field> + </method> + <method name="start-ok" synchronous="1" index="21"> + <chassis name="client" implement="MUST"/> + </method> + </class> + <class name="tunnel" handler="tunnel" index="110"> + <chassis name="server" implement="MAY"/> + <chassis name="client" implement="MAY"/> + <field name="headers" domain="table"/> + <field name="proxy-name" domain="shortstr"/> + <field name="data-name" domain="shortstr"/> + <field name="durable" domain="octet"/> + <field name="broadcast" domain="octet"/> + <method name="request" content="1" index="10"> + <chassis name="server" implement="MUST"/> + <field name="meta-data" domain="table"/> + </method> + </class> + <class name="message" handler="channel" index="120"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <method name="transfer" index="10"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="ok"/> + <response name="reject"/> + <field name="ticket" domain="access-ticket"/> + <field name="destination" domain="destination"/> + <field name="redelivered" domain="redelivered"/> + <field name="immediate" domain="bit"/> + <field name="ttl" domain="duration"/> + <field name="priority" domain="octet"/> + <field name="timestamp" domain="timestamp"/> + <field name="delivery-mode" domain="octet"/> + <field name="expiration" domain="timestamp"/> + <field name="exchange" domain="exchange-name"/> + <field name="routing-key" domain="shortstr"/> + <field name="message-id" domain="shortstr"/> + <field name="correlation-id" domain="shortstr"/> + <field name="reply-to" domain="shortstr"/> + <field name="content-type" domain="shortstr"/> + <field name="content-encoding" domain="shortstr"/> + <field name="user-id" domain="shortstr"/> + <field name="app-id" domain="shortstr"/> + <field name="transaction-id" domain="shortstr"/> + <field name="security-token" domain="security-token"/> + <field name="application-headers" domain="table"/> + <field name="body" domain="content"/> + </method> + <method name="consume" index="20"> + <chassis name="server" implement="MUST"/> + <response name="ok"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="destination" domain="destination"/> + <field name="no-local" domain="no-local"/> + <field name="no-ack" domain="no-ack"/> + <field name="exclusive" domain="bit"/> + <field name="filter" domain="table"/> + </method> + <method name="cancel" index="30"> + <chassis name="server" implement="MUST"/> + <response name="ok"/> + <field name="destination" domain="destination"/> + </method> + <method name="get" index="40"> + <response name="ok"/> + <response name="empty"/> + <chassis name="server" implement="MUST"/> + <field name="ticket" domain="access-ticket"/> + <field name="queue" domain="queue-name"/> + <field name="destination" domain="destination"/> + <field name="no-ack" domain="no-ack"/> + </method> + <method name="recover" index="50"> + <chassis name="server" implement="MUST"/> + <response name="ok"/> + <field name="requeue" domain="bit"/> + </method> + <method name="open" index="60"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="ok"/> + <field name="reference" domain="reference"/> + </method> + <method name="close" index="70"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="ok"/> + <field name="reference" domain="reference"/> + </method> + <method name="append" index="80"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="ok"/> + <field name="reference" domain="reference"/> + <field name="bytes" domain="longstr"/> + </method> + <method name="checkpoint" index="90"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="ok"/> + <field name="reference" domain="reference"/> + <field name="identifier" domain="shortstr"/> + </method> + <method name="resume" index="100"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <response name="offset"/> + <field name="reference" domain="reference"/> + <field name="identifier" domain="shortstr"/> + </method> + <method name="qos" index="110"> + <chassis name="server" implement="MUST"/> + <response name="ok"/> + <field name="prefetch-size" domain="long"/> + <field name="prefetch-count" domain="short"/> + <field name="global" domain="bit"/> + </method> + <method name="ok" index="500"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + </method> + <method name="empty" index="510"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + </method> + <method name="reject" index="520"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="code" domain="reject-code"/> + <field name="text" domain="reject-text"/> + </method> + <method name="offset" index="530"> + <chassis name="server" implement="MUST"/> + <chassis name="client" implement="MUST"/> + <field name="value" domain="offset"/> + </method> + </class> +</amqp> diff --git a/qpid/python/qpid/specs_config.py b/qpid/python/qpid/specs_config.py new file mode 100644 index 0000000000..d991e8b084 --- /dev/null +++ b/qpid/python/qpid/specs_config.py @@ -0,0 +1,26 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import os + +AMQP_SPEC_DIR=os.path.join(os.path.dirname(os.path.abspath(__file__)), "specs") +amqp_spec = os.path.join(AMQP_SPEC_DIR, "amqp-0-10-qpid-errata-stripped.xml") +amqp_spec_0_8 = os.path.join(AMQP_SPEC_DIR, "amqp-0-8-qpid-stripped.xml") +amqp_spec_0_9 = os.path.join(AMQP_SPEC_DIR, "amqp-0-9-qpid-stripped.xml") +amqp_spec_0_9_1 = os.path.join(AMQP_SPEC_DIR, "amqp-0-9-1-stripped.xml") diff --git a/qpid/python/qpid/testlib.py b/qpid/python/qpid/testlib.py new file mode 100644 index 0000000000..256aa7b5e6 --- /dev/null +++ b/qpid/python/qpid/testlib.py @@ -0,0 +1,241 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +# +# Support library for qpid python tests. +# + +import string +import random + +import unittest, traceback, socket +import qpid.client, qmf.console +import Queue +from qpid.content import Content +from qpid.message import Message +from qpid.harness import Skipped +from qpid.exceptions import VersionError + +import qpid.messaging +from qpidtoollibs import BrokerAgent + +class TestBase(unittest.TestCase): + """Base class for Qpid test cases. + + self.client is automatically connected with channel 1 open before + the test methods are run. + + Deletes queues and exchanges after. Tests call + self.queue_declare(channel, ...) and self.exchange_declare(chanel, + ...) which are wrappers for the Channel functions that note + resources to clean up later. + """ + + def configure(self, config): + self.config = config + + def setUp(self): + self.queues = [] + self.exchanges = [] + self.client = self.connect() + self.channel = self.client.channel(1) + self.version = (self.client.spec.major, self.client.spec.minor) + if self.version == (8, 0) or self.version == (0, 9): + self.channel.channel_open() + else: + self.channel.session_open() + + def tearDown(self): + try: + for ch, q in self.queues: + ch.queue_delete(queue=q) + for ch, ex in self.exchanges: + ch.exchange_delete(exchange=ex) + except: + print "Error on tearDown:" + print traceback.print_exc() + + self.client.close() + + def connect(self, host=None, port=None, user=None, password=None, tune_params=None, client_properties=None, channel_options=None): + """Create a new connction, return the Client object""" + host = host or self.config.broker.host + port = port or self.config.broker.port or 5672 + user = user or self.config.broker.user or "guest" + password = password or self.config.broker.password or "guest" + client = qpid.client.Client(host, port) + try: + client.start(username = user, password=password, tune_params=tune_params, client_properties=client_properties, channel_options=channel_options) + except qpid.client.Closed, e: + if isinstance(e.args[0], VersionError): + raise Skipped(e.args[0]) + else: + raise e + except socket.error, e: + raise Skipped(e) + return client + + def queue_declare(self, channel=None, *args, **keys): + channel = channel or self.channel + reply = channel.queue_declare(*args, **keys) + self.queues.append((channel, keys["queue"])) + return reply + + def exchange_declare(self, channel=None, ticket=0, exchange='', + type='', passive=False, durable=False, + auto_delete=False, + arguments={}): + channel = channel or self.channel + reply = channel.exchange_declare(ticket=ticket, exchange=exchange, type=type, passive=passive,durable=durable, auto_delete=auto_delete, arguments=arguments) + self.exchanges.append((channel,exchange)) + return reply + + def uniqueString(self): + """Generate a unique string, unique for this TestBase instance""" + if not "uniqueCounter" in dir(self): self.uniqueCounter = 1; + return "Test Message " + str(self.uniqueCounter) + + def randomLongString(self, length=65535): + body = ''.join(random.choice(string.ascii_uppercase) for _ in range(length)) + return body + + def consume(self, queueName, no_ack=True): + """Consume from named queue returns the Queue object.""" + + reply = self.channel.basic_consume(queue=queueName, no_ack=no_ack) + return self.client.queue(reply.consumer_tag) + + def subscribe(self, channel=None, **keys): + channel = channel or self.channel + consumer_tag = keys["destination"] + channel.message_subscribe(**keys) + channel.message_flow(destination=consumer_tag, unit=0, value=0xFFFFFFFFL) + channel.message_flow(destination=consumer_tag, unit=1, value=0xFFFFFFFFL) + + def assertEmpty(self, queue): + """Assert that the queue is empty""" + try: + queue.get(timeout=1) + self.fail("Queue is not empty.") + except Queue.Empty: None # Ignore + + def assertPublishGet(self, queue, exchange="", routing_key="", properties=None): + """ + Publish to exchange and assert queue.get() returns the same message. + """ + body = self.uniqueString() + self.channel.basic_publish( + exchange=exchange, + content=Content(body, properties=properties), + routing_key=routing_key) + msg = queue.get(timeout=1) + self.assertEqual(body, msg.content.body) + if (properties): + self.assertEqual(properties, msg.content.properties) + + def assertPublishConsume(self, queue="", exchange="", routing_key="", properties=None): + """ + Publish a message and consume it, assert it comes back intact. + Return the Queue object used to consume. + """ + self.assertPublishGet(self.consume(queue), exchange, routing_key, properties) + + def assertChannelException(self, expectedCode, message): + if self.version == (8, 0) or self.version == (0, 9): + if not isinstance(message, Message): self.fail("expected channel_close method, got %s" % (message)) + self.assertEqual("channel", message.method.klass.name) + self.assertEqual("close", message.method.name) + else: + if not isinstance(message, Message): self.fail("expected session_closed method, got %s" % (message)) + self.assertEqual("session", message.method.klass.name) + self.assertEqual("closed", message.method.name) + self.assertEqual(expectedCode, message.reply_code) + + + def assertConnectionException(self, expectedCode, message): + if not isinstance(message, Message): self.fail("expected connection_close method, got %s" % (message)) + self.assertEqual("connection", message.method.klass.name) + self.assertEqual("close", message.method.name) + self.assertEqual(expectedCode, message.reply_code) + +#0-10 support +from qpid.connection import Connection +from qpid.util import connect, ssl, URL + +class TestBase010(unittest.TestCase): + """ + Base class for Qpid test cases. using the final 0-10 spec + """ + + def configure(self, config): + self.config = config + self.broker = config.broker + self.defines = self.config.defines + + def setUp(self): + self.conn = self.connect() + self.session = self.conn.session("test-session", timeout=10) + self.qmf = None + self.test_queue_name = self.id() + + def startQmf(self, handler=None): + self.qmf = qmf.console.Session(handler) + self.qmf_broker = self.qmf.addBroker(str(self.broker)) + + def startBrokerAccess(self): + """ + New-style management access to the broker. Can be used in lieu of startQmf. + """ + if 'broker_conn' not in self.__dict__: + self.broker_conn = qpid.messaging.Connection(str(self.broker)) + self.broker_conn.open() + self.broker_access = BrokerAgent(self.broker_conn) + + def connect(self, host=None, port=None): + url = self.broker + if url.scheme == URL.AMQPS: + default_port = 5671 + else: + default_port = 5672 + try: + sock = connect(host or url.host, port or url.port or default_port) + except socket.error, e: + raise Skipped(e) + if url.scheme == URL.AMQPS: + sock = ssl(sock) + conn = Connection(sock, username=url.user or "guest", + password=url.password or "guest") + try: + conn.start(timeout=10) + except VersionError, e: + raise Skipped(e) + return conn + + def tearDown(self): + if not self.session.error(): self.session.close(timeout=10) + self.conn.close(timeout=10) + if self.qmf: + self.qmf.delBroker(self.qmf_broker) + + def subscribe(self, session=None, **keys): + session = session or self.session + consumer_tag = keys["destination"] + session.message_subscribe(**keys) + session.message_flow(destination=consumer_tag, unit=0, value=0xFFFFFFFFL) + session.message_flow(destination=consumer_tag, unit=1, value=0xFFFFFFFFL) diff --git a/qpid/python/qpid/tests/__init__.py b/qpid/python/qpid/tests/__init__.py new file mode 100644 index 0000000000..85ab013b5a --- /dev/null +++ b/qpid/python/qpid/tests/__init__.py @@ -0,0 +1,62 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +class Test: + + def __init__(self, name): + self.name = name + + def configure(self, config): + self.config = config + +# API Tests +import qpid.tests.framing +import qpid.tests.mimetype +import qpid.tests.messaging + +# Legacy Tests +import qpid.tests.codec +import qpid.tests.queue +import qpid.tests.datatypes +import qpid.tests.connection +import qpid.tests.spec010 +import qpid.tests.codec010 +import qpid.tests.util +import qpid.tests.saslmech.finder + +class TestTestsXXX(Test): + + def testFoo(self): + print "this test has output" + + def testBar(self): + print "this test "*8 + print "has"*10 + print "a"*75 + print "lot of"*10 + print "output"*10 + + def testQux(self): + import sys + sys.stdout.write("this test has output with no newline") + + def testQuxFail(self): + import sys + sys.stdout.write("this test has output with no newline") + fdsa diff --git a/qpid/python/qpid/tests/codec.py b/qpid/python/qpid/tests/codec.py new file mode 100644 index 0000000000..8017f794fe --- /dev/null +++ b/qpid/python/qpid/tests/codec.py @@ -0,0 +1,729 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import unittest +from qpid.codec import Codec +from qpid.spec08 import load +from cStringIO import StringIO +from qpid.reference import ReferenceId + +__doc__ = """ + + This is a unit test script for qpid/codec.py + + It can be run standalone or as part of the existing test framework. + + To run standalone: + ------------------- + + Place in the qpid/python/tests/ directory and type... + + python codec.py + + A brief output will be printed on screen. The verbose output will be placed inn a file called + codec_unit_test_output.txt. [TODO: make this filename configurable] + + To run as part of the existing test framework: + ----------------------------------------------- + + python run-tests tests.codec + + Change History: + ----------------- + Jimmy John 05/19/2007 Initial draft + Jimmy John 05/22/2007 Implemented comments by Rafael Schloming + + +""" + +from qpid.specs_config import amqp_spec_0_8 +SPEC = load(amqp_spec_0_8) + +# -------------------------------------- +# -------------------------------------- +class BaseDataTypes(unittest.TestCase): + + + """ + Base class containing common functions + """ + + # --------------- + def setUp(self): + """ + standard setUp for unitetest (refer unittest documentation for details) + """ + self.codec = Codec(StringIO(), SPEC) + + # ------------------ + def tearDown(self): + """ + standard tearDown for unitetest (refer unittest documentation for details) + """ + self.codec.stream.flush() + self.codec.stream.close() + + # ---------------------------------------- + def callFunc(self, functionName, *args): + """ + helper function - given a function name and arguments, calls the function with the args and + returns the contents of the stream + """ + getattr(self.codec, functionName)(args[0]) + return self.codec.stream.getvalue() + + # ---------------------------------------- + def readFunc(self, functionName, *args): + """ + helper function - creates a input stream and then calls the function with arguments as have been + supplied + """ + self.codec.stream = StringIO(args[0]) + return getattr(self.codec, functionName)() + + +# ---------------------------------------- +# ---------------------------------------- +class IntegerTestCase(BaseDataTypes): + + """ + Handles octet, short, long, long long + + """ + + # ------------------------- + def __init__(self, *args): + """ + sets constants for use in tests + """ + + BaseDataTypes.__init__(self, *args) + self.const_integer = 2 + self.const_integer_octet_encoded = '\x02' + self.const_integer_short_encoded = '\x00\x02' + self.const_integer_long_encoded = '\x00\x00\x00\x02' + self.const_integer_long_long_encoded = '\x00\x00\x00\x00\x00\x00\x00\x02' + + # -------------------------- # + # Unsigned Octect - 8 bits # + # -------------------------- # + + # -------------------------- + def test_unsigned_octet(self): + """ + ubyte format requires 0<=number<=255 + """ + self.failUnlessEqual(self.callFunc('encode_octet', self.const_integer), self.const_integer_octet_encoded, 'octect encoding FAILED...') + + # ------------------------------------------- + def test_octet_out_of_upper_range(self): + """ + testing for input above acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_octet, 256) + + # ------------------------------------------- + def test_uoctet_out_of_lower_range(self): + """ + testing for input below acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_octet, -1) + + # --------------------------------- + def test_uoctet_with_fraction(self): + """ + the fractional part should be ignored... + """ + self.failUnlessEqual(self.callFunc('encode_octet', 2.5), self.const_integer_octet_encoded, 'octect encoding FAILED with fractions...') + + # ------------------------------------ + def test_unsigned_octet_decode(self): + """ + octet decoding + """ + self.failUnlessEqual(self.readFunc('decode_octet', self.const_integer_octet_encoded), self.const_integer, 'octect decoding FAILED...') + + # ----------------------------------- # + # Unsigned Short Integers - 16 bits # + # ----------------------------------- # + + # ----------------------- + def test_ushort_int(self): + """ + testing unsigned short integer + """ + self.failUnlessEqual(self.callFunc('encode_short', self.const_integer), self.const_integer_short_encoded, 'short encoding FAILED...') + + # ------------------------------------------- + def test_ushort_int_out_of_upper_range(self): + """ + testing for input above acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_short, 65536) + + # ------------------------------------------- + def test_ushort_int_out_of_lower_range(self): + """ + testing for input below acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_short, -1) + + # --------------------------------- + def test_ushort_int_with_fraction(self): + """ + the fractional part should be ignored... + """ + self.failUnlessEqual(self.callFunc('encode_short', 2.5), self.const_integer_short_encoded, 'short encoding FAILED with fractions...') + + # ------------------------------------ + def test_ushort_int_decode(self): + """ + unsigned short decoding + """ + self.failUnlessEqual(self.readFunc('decode_short', self.const_integer_short_encoded), self.const_integer, 'unsigned short decoding FAILED...') + + + # ---------------------------------- # + # Unsigned Long Integers - 32 bits # + # ---------------------------------- # + + # ----------------------- + def test_ulong_int(self): + """ + testing unsigned long iteger + """ + self.failUnlessEqual(self.callFunc('encode_long', self.const_integer), self.const_integer_long_encoded, 'long encoding FAILED...') + + # ------------------------------------------- + def test_ulong_int_out_of_upper_range(self): + """ + testing for input above acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_long, 4294967296) + + # ------------------------------------------- + def test_ulong_int_out_of_lower_range(self): + """ + testing for input below acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_long, -1) + + # --------------------------------- + def test_ulong_int_with_fraction(self): + """ + the fractional part should be ignored... + """ + self.failUnlessEqual(self.callFunc('encode_long', 2.5), self.const_integer_long_encoded, 'long encoding FAILED with fractions...') + + # ------------------------------- + def test_ulong_int_decode(self): + """ + unsigned long decoding + """ + self.failUnlessEqual(self.readFunc('decode_long', self.const_integer_long_encoded), self.const_integer, 'unsigned long decoding FAILED...') + + + # --------------------------------------- # + # Unsigned Long Long Integers - 64 bits # + # --------------------------------------- # + + # ----------------------- + def test_ulong_long_int(self): + """ + testing unsinged long long integer + """ + self.failUnlessEqual(self.callFunc('encode_longlong', self.const_integer), self.const_integer_long_long_encoded, 'long long encoding FAILED...') + + # ------------------------------------------- + def test_ulong_long_int_out_of_upper_range(self): + """ + testing for input above acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_longlong, 18446744073709551616) + + # ------------------------------------------- + def test_ulong_long_int_out_of_lower_range(self): + """ + testing for input below acceptable range + """ + self.failUnlessRaises(Exception, self.codec.encode_longlong, -1) + + # --------------------------------- + def test_ulong_long_int_with_fraction(self): + """ + the fractional part should be ignored... + """ + self.failUnlessEqual(self.callFunc('encode_longlong', 2.5), self.const_integer_long_long_encoded, 'long long encoding FAILED with fractions...') + + # ------------------------------------ + def test_ulong_long_int_decode(self): + """ + unsigned long long decoding + """ + self.failUnlessEqual(self.readFunc('decode_longlong', self.const_integer_long_long_encoded), self.const_integer, 'unsigned long long decoding FAILED...') + +# ----------------------------------- +# ----------------------------------- +class BitTestCase(BaseDataTypes): + + """ + Handles bits + """ + + # ---------------------------------------------- + def callFunc(self, functionName, *args): + """ + helper function + """ + for ele in args: + getattr(self.codec, functionName)(ele) + + self.codec.flush() + return self.codec.stream.getvalue() + + # ------------------- + def test_bit1(self): + """ + sends in 11 + """ + self.failUnlessEqual(self.callFunc('encode_bit', 1, 1), '\x03', '11 bit encoding FAILED...') + + # ------------------- + def test_bit2(self): + """ + sends in 10011 + """ + self.failUnlessEqual(self.callFunc('encode_bit', 1, 1, 0, 0, 1), '\x13', '10011 bit encoding FAILED...') + + # ------------------- + def test_bit3(self): + """ + sends in 1110100111 [10 bits(right to left), should be compressed into two octets] + """ + self.failUnlessEqual(self.callFunc('encode_bit', 1,1,1,0,0,1,0,1,1,1), '\xa7\x03', '1110100111(right to left) bit encoding FAILED...') + + # ------------------------------------ + def test_bit_decode_1(self): + """ + decode bit 1 + """ + self.failUnlessEqual(self.readFunc('decode_bit', '\x01'), 1, 'decode bit 1 FAILED...') + + # ------------------------------------ + def test_bit_decode_0(self): + """ + decode bit 0 + """ + self.failUnlessEqual(self.readFunc('decode_bit', '\x00'), 0, 'decode bit 0 FAILED...') + +# ----------------------------------- +# ----------------------------------- +class StringTestCase(BaseDataTypes): + + """ + Handles short strings, long strings + """ + + # ------------------------------------------------------------- # + # Short Strings - 8 bit length followed by zero or more octets # + # ------------------------------------------------------------- # + + # --------------------------------------- + def test_short_string_zero_length(self): + """ + 0 length short string + """ + self.failUnlessEqual(self.callFunc('encode_shortstr', ''), '\x00', '0 length short string encoding FAILED...') + + # ------------------------------------------- + def test_short_string_positive_length(self): + """ + positive length short string + """ + self.failUnlessEqual(self.callFunc('encode_shortstr', 'hello world'), '\x0bhello world', 'positive length short string encoding FAILED...') + + # ------------------------------------------- + def test_short_string_out_of_upper_range(self): + """ + string length > 255 + """ + self.failUnlessRaises(Exception, self.codec.encode_shortstr, 'x'*256) + + # ------------------------------------ + def test_short_string_decode(self): + """ + short string decode + """ + self.failUnlessEqual(self.readFunc('decode_shortstr', '\x0bhello world'), 'hello world', 'short string decode FAILED...') + + + # ------------------------------------------------------------- # + # Long Strings - 32 bit length followed by zero or more octets # + # ------------------------------------------------------------- # + + # --------------------------------------- + def test_long_string_zero_length(self): + """ + 0 length long string + """ + self.failUnlessEqual(self.callFunc('encode_longstr', ''), '\x00\x00\x00\x00', '0 length long string encoding FAILED...') + + # ------------------------------------------- + def test_long_string_positive_length(self): + """ + positive length long string + """ + self.failUnlessEqual(self.callFunc('encode_longstr', 'hello world'), '\x00\x00\x00\x0bhello world', 'positive length long string encoding FAILED...') + + # ------------------------------------ + def test_long_string_decode(self): + """ + long string decode + """ + self.failUnlessEqual(self.readFunc('decode_longstr', '\x00\x00\x00\x0bhello world'), 'hello world', 'long string decode FAILED...') + + +# -------------------------------------- +# -------------------------------------- +class TimestampTestCase(BaseDataTypes): + + """ + No need of any test cases here as timestamps are implemented as long long which is tested above + """ + pass + +# --------------------------------------- +# --------------------------------------- +class FieldTableTestCase(BaseDataTypes): + + """ + Handles Field Tables + + Only S/I type messages seem to be implemented currently + """ + + # ------------------------- + def __init__(self, *args): + """ + sets constants for use in tests + """ + + BaseDataTypes.__init__(self, *args) + self.const_field_table_dummy_dict = {'$key1':'value1','$key2':'value2'} + self.const_field_table_dummy_dict_encoded = '\x00\x00\x00\x22\x05$key2S\x00\x00\x00\x06value2\x05$key1S\x00\x00\x00\x06value1' + + # ------------------------------------------- + def test_field_table_name_value_pair(self): + """ + valid name value pair + """ + self.failUnlessEqual(self.callFunc('encode_table', {'$key1':'value1'}), '\x00\x00\x00\x11\x05$key1S\x00\x00\x00\x06value1', 'valid name value pair encoding FAILED...') + + # --------------------------------------------------- + def test_field_table_multiple_name_value_pair(self): + """ + multiple name value pair + """ + self.failUnlessEqual(self.callFunc('encode_table', self.const_field_table_dummy_dict), self.const_field_table_dummy_dict_encoded, 'multiple name value pair encoding FAILED...') + + # ------------------------------------ + def test_field_table_decode(self): + """ + field table decode + """ + self.failUnlessEqual(self.readFunc('decode_table', self.const_field_table_dummy_dict_encoded), self.const_field_table_dummy_dict, 'field table decode FAILED...') + + +# ------------------------------------ +# ------------------------------------ +class ContentTestCase(BaseDataTypes): + + """ + Handles Content data types + """ + + # ----------------------------- + def test_content_inline(self): + """ + inline content + """ + self.failUnlessEqual(self.callFunc('encode_content', 'hello inline message'), '\x00\x00\x00\x00\x14hello inline message', 'inline content encoding FAILED...') + + # -------------------------------- + def test_content_reference(self): + """ + reference content + """ + self.failUnlessEqual(self.callFunc('encode_content', ReferenceId('dummyId')), '\x01\x00\x00\x00\x07dummyId', 'reference content encoding FAILED...') + + # ------------------------------------ + def test_content_inline_decode(self): + """ + inline content decode + """ + self.failUnlessEqual(self.readFunc('decode_content', '\x00\x00\x00\x00\x14hello inline message'), 'hello inline message', 'inline content decode FAILED...') + + # ------------------------------------ + def test_content_reference_decode(self): + """ + reference content decode + """ + self.failUnlessEqual(self.readFunc('decode_content', '\x01\x00\x00\x00\x07dummyId').id, 'dummyId', 'reference content decode FAILED...') + +# ----------------------------------- +# ----------------------------------- +class BooleanTestCase(BaseDataTypes): + + # ------------------- + def test_true_encode(self): + self.failUnlessEqual(self.callFunc('encode_boolean', True), '\x01', 'True encoding FAILED...') + + # ------------------- + def test_true_decode(self): + self.failUnlessEqual(self.readFunc('decode_boolean', '\x01'), True, 'True decoding FAILED...') + self.failUnlessEqual(self.readFunc('decode_boolean', '\x02'), True, 'True decoding FAILED...') + self.failUnlessEqual(self.readFunc('decode_boolean', '\xFF'), True, 'True decoding FAILED...') + + # ------------------- + def test_false_encode(self): + self.failUnlessEqual(self.callFunc('encode_boolean', False), '\x00', 'False encoding FAILED...') + + # ------------------- + def test_false_decode(self): + self.failUnlessEqual(self.readFunc('decode_boolean', '\x00'), False, 'False decoding FAILED...') + +# ----------------------------------- +# ----------------------------------- +class ResolveTestCase(BaseDataTypes): + + # ------------------- + # Test resolving the value 1, which should implicitly be a python int + def test_resolve_int_1(self): + value = 1 + expected = "signed_int" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving the value -1, which should implicitly be a python int + def test_resolve_int_negative_1(self): + value = -1 + expected = "signed_int" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving the min signed 32bit integer value, -2^31 + def test_resolve_int_min(self): + value = -2147483648 #-2^31 + expected = "signed_int" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving the max signed 32bit integer value, 2^31 -1 + def test_resolve_int_max(self): + value = 2147483647 #2^31 -1 + expected = "signed_int" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving above the max signed 32bit integer value of 2^31 -1 + # Should be a python long, but should be classed as a signed 64bit long on the wire either way + def test_resolve_int_above_signed_32bit_max(self): + value = 2147483648 #2^31, i.e 1 above the 32bit signed max + expected = "signed_long" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving above the max signed 32bit integer value of 2^31 -1 + # As above except use an explicitly cast python long + def test_resolve_long_above_signed_32bit_max(self): + value = 2147483648L #2^31, i.e 1 above the 32bit signed max + expected = "signed_long" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving an explicitly cast python long of value 1, i.e less than the max signed 32bit integer value + # Should be encoded as a 32bit signed int on the wire + def test_resolve_long_1(self): + value = 1L + expected = "signed_int" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving the max signed 64bit integer value of 2^63 -1 + # Should be a python long, but should be classed as a signed 64bit long on the wire either way + def test_resolve_64bit_signed_max(self): + value = 9223372036854775807 #2^63 -1 + expected = "signed_long" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving the min signed 64bit integer value of -2^63 + # Should be a python long, but should be classed as a signed 64bit long on the wire either way + def test_resolve_64bit_signed_min(self): + value = -9223372036854775808 # -2^63 + expected = "signed_long" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving a value of 2^63, i.e more than the max a signed 64bit integer value can hold. + # Should throw an exception indicating the value can't be encoded. + def test_resolve_above_64bit_signed_max(self): + value = 9223372036854775808L #2^63 + self.failUnlessRaises(Exception, self.codec.resolve, value.__class__, value) + # ------------------- + # Test resolving a value of -2^63 -1, i.e less than the min a signed 64bit integer value can hold. + # Should throw an exception indicating the value can't be encoded. + def test_resolve_below_64bit_signed_min(self): + value = 9223372036854775808L # -2^63 -1 + self.failUnlessRaises(Exception, self.codec.resolve, value.__class__, value) + # ------------------- + # Test resolving a float. Should indicate use of double as python uses 64bit floats + def test_resolve_float(self): + value = 1.1 + expected = "double" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving a string. Should indicate use of long string encoding + def test_resolve_string(self): + value = "myString" + expected = "longstr" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + # ------------------- + # Test resolving None. Should indicate use of a void encoding. + def test_resolve_None(self): + value = None + expected = "void" + resolved = self.codec.resolve(value.__class__, value) + self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved)) + +# ------------------------ # +# Pre - existing test code # +# ------------------------ # + +# --------------------- +def test(type, value): + """ + old test function cut/copy/paste from qpid/codec.py + """ + if isinstance(value, (list, tuple)): + values = value + else: + values = [value] + stream = StringIO() + codec = Codec(stream, SPEC) + for v in values: + codec.encode(type, v) + codec.flush() + enc = stream.getvalue() + stream.reset() + dup = [] + for i in xrange(len(values)): + dup.append(codec.decode(type)) + if values != dup: + raise AssertionError("%r --> %r --> %r" % (values, enc, dup)) + +# ----------------------- +def dotest(type, value): + """ + old test function cut/copy/paste from qpid/codec.py + """ + args = (type, value) + test(*args) + +# ------------- +def oldtests(): + """ + old test function cut/copy/paste from qpid/codec.py + """ + for value in ("1", "0", "110", "011", "11001", "10101", "10011"): + for i in range(10): + dotest("bit", map(lambda x: x == "1", value*i)) + + for value in ({}, {"asdf": "fdsa", "fdsa": 1, "three": 3}, {"one": 1}): + dotest("table", value) + + for type in ("octet", "short", "long", "longlong"): + for value in range(0, 256): + dotest(type, value) + + for type in ("shortstr", "longstr"): + for value in ("", "a", "asdf"): + dotest(type, value) + +# ----------------------------------------- +class oldTests(unittest.TestCase): + + """ + class to handle pre-existing test cases + """ + + # --------------------------- + def test_oldtestcases(self): + """ + call the old tests + """ + return oldtests() + +# --------------------------- +# --------------------------- +if __name__ == '__main__': + + codec_test_suite = unittest.TestSuite() + + #adding all the test suites... + codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(IntegerTestCase)) + codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(BitTestCase)) + codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(StringTestCase)) + codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(TimestampTestCase)) + codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(FieldTableTestCase)) + codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(ContentTestCase)) + + #loading pre-existing test case from qpid/codec.py + codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(oldTests)) + + run_output_stream = StringIO() + test_runner = unittest.TextTestRunner(run_output_stream, '', '') + test_result = test_runner.run(codec_test_suite) + + print '\n%d test run...' % (test_result.testsRun) + + if test_result.wasSuccessful(): + print '\nAll tests successful\n' + + if test_result.failures: + print '\n----------' + print '%d FAILURES:' % (len(test_result.failures)) + print '----------\n' + for failure in test_result.failures: + print str(failure[0]) + ' ... FAIL' + + if test_result.errors: + print '\n---------' + print '%d ERRORS:' % (len(test_result.errors)) + print '---------\n' + + for error in test_result.errors: + print str(error[0]) + ' ... ERROR' + + f = open('codec_unit_test_output.txt', 'w') + f.write(str(run_output_stream.getvalue())) + f.close() diff --git a/qpid/python/qpid/tests/codec010.py b/qpid/python/qpid/tests/codec010.py new file mode 100644 index 0000000000..787ebc146f --- /dev/null +++ b/qpid/python/qpid/tests/codec010.py @@ -0,0 +1,133 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import time + +from unittest import TestCase +from qpid.codec010 import StringCodec +from qpid.datatypes import timestamp, uuid4 +from qpid.ops import PRIMITIVE + +class CodecTest(TestCase): + + def check(self, type, value, compare=True): + t = PRIMITIVE[type] + sc = StringCodec() + sc.write_primitive(t, value) + decoded = sc.read_primitive(t) + if compare: + assert decoded == value, "%s, %s" % (decoded, value) + return decoded + + def testMapString(self): + self.check("map", {"string": "this is a test"}) + + def testMapUnicode(self): + self.check("map", {"unicode": u"this is a unicode test"}) + + def testMapBinary(self): + self.check("map", {"binary": "\x7f\xb4R^\xe5\xf0:\x89\x96E1\xf6\xfe\xb9\x1b\xf5"}) + + def testMapBuffer(self): + s = "\x7f\xb4R^\xe5\xf0:\x89\x96E1\xf6\xfe\xb9\x1b\xf5" + dec = self.check("map", {"buffer": buffer(s)}, False) + assert dec["buffer"] == s + + def testMapInt(self): + self.check("map", {"int": 3}) + + def testMapLong(self): + self.check("map", {"long": 2**32}) + self.check("map", {"long": 1 << 34}) + self.check("map", {"long": -(1 << 34)}) + + def testMapTimestamp(self): + decoded = self.check("map", {"timestamp": timestamp(0)}) + assert isinstance(decoded["timestamp"], timestamp) + + def testMapDatetime(self): + decoded = self.check("map", {"datetime": timestamp(0).datetime()}, compare=False) + assert isinstance(decoded["datetime"], timestamp) + assert decoded["datetime"] == 0.0 + + def testMapNone(self): + self.check("map", {"none": None}) + + def testMapNested(self): + self.check("map", {"map": {"string": "nested test"}}) + + def testMapList(self): + self.check("map", {"list": [1, "two", 3.0, -4]}) + + def testMapUUID(self): + self.check("map", {"uuid": uuid4()}) + + def testMapAll(self): + decoded = self.check("map", {"string": "this is a test", + "unicode": u"this is a unicode test", + "binary": "\x7f\xb4R^\xe5\xf0:\x89\x96E1\xf6\xfe\xb9\x1b\xf5", + "int": 3, + "long": 2**32, + "timestamp": timestamp(0), + "none": None, + "map": {"string": "nested map"}, + "list": [1, "two", 3.0, -4], + "uuid": uuid4()}) + assert isinstance(decoded["timestamp"], timestamp) + + def testMapEmpty(self): + self.check("map", {}) + + def testMapNone(self): + self.check("map", None) + + def testList(self): + self.check("list", [1, "two", 3.0, -4]) + + def testListEmpty(self): + self.check("list", []) + + def testListNone(self): + self.check("list", None) + + def testArrayInt(self): + self.check("array", [1, 2, 3, 4]) + + def testArrayString(self): + self.check("array", ["one", "two", "three", "four"]) + + def testArrayEmpty(self): + self.check("array", []) + + def testArrayNone(self): + self.check("array", None) + + def testInt16(self): + self.check("int16", 3) + self.check("int16", -3) + + def testInt64(self): + self.check("int64", 3) + self.check("int64", -3) + self.check("int64", 1<<34) + self.check("int64", -(1<<34)) + + def testDatetime(self): + self.check("datetime", timestamp(0)) + self.check("datetime", timestamp(long(time.time()))) diff --git a/qpid/python/qpid/tests/connection.py b/qpid/python/qpid/tests/connection.py new file mode 100644 index 0000000000..6847285f69 --- /dev/null +++ b/qpid/python/qpid/tests/connection.py @@ -0,0 +1,227 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import time +from threading import * +from unittest import TestCase +from qpid.util import connect, listen +from qpid.connection import * +from qpid.datatypes import Message +from qpid.delegates import Server +from qpid.queue import Queue +from qpid.session import Delegate +from qpid.ops import QueueQueryResult + +PORT = 1234 + +class TestServer: + + def __init__(self, queue): + self.queue = queue + + def connection(self, connection): + return Server(connection, delegate=self.session) + + def session(self, session): + session.auto_sync = False + return TestSession(session, self.queue) + +class TestSession(Delegate): + + def __init__(self, session, queue): + self.session = session + self.queue = queue + + def execution_sync(self, es): + pass + + def queue_query(self, qq): + return QueueQueryResult(qq.queue) + + def message_transfer(self, cmd): + if cmd.destination == "echo": + m = Message(cmd.payload) + m.headers = cmd.headers + self.session.message_transfer(cmd.destination, cmd.accept_mode, + cmd.acquire_mode, m) + elif cmd.destination == "abort": + self.session.channel.connection.sock.close() + elif cmd.destination == "heartbeat": + self.session.channel.connection_heartbeat() + else: + self.queue.put(cmd) + +class ConnectionTest(TestCase): + + def setUp(self): + self.queue = Queue() + self.running = True + started = Event() + + def run(): + ts = TestServer(self.queue) + for s in listen("0.0.0.0", PORT, lambda: self.running, lambda: started.set()): + conn = Connection(s, delegate=ts.connection) + try: + conn.start(5) + except Closed: + pass + + self.server = Thread(target=run) + self.server.setDaemon(True) + self.server.start() + + started.wait(3) + assert started.isSet() + + def tearDown(self): + self.running = False + connect("127.0.0.1", PORT).close() + self.server.join(3) + + def connect(self, **kwargs): + return Connection(connect("127.0.0.1", PORT), **kwargs) + + def test(self): + c = self.connect() + c.start(10) + + ssn1 = c.session("test1", timeout=10) + ssn2 = c.session("test2", timeout=10) + + assert ssn1 == c.sessions["test1"] + assert ssn2 == c.sessions["test2"] + assert ssn1.channel != None + assert ssn2.channel != None + assert ssn1 in c.attached.values() + assert ssn2 in c.attached.values() + + ssn1.close(5) + + assert ssn1.channel == None + assert ssn1 not in c.attached.values() + assert ssn2 in c.sessions.values() + + ssn2.close(5) + + assert ssn2.channel == None + assert ssn2 not in c.attached.values() + assert ssn2 not in c.sessions.values() + + ssn = c.session("session", timeout=10) + + assert ssn.channel != None + assert ssn in c.sessions.values() + + destinations = ("one", "two", "three") + + for d in destinations: + ssn.message_transfer(d) + + for d in destinations: + cmd = self.queue.get(10) + assert cmd.destination == d + assert cmd.headers == None + assert cmd.payload == None + + msg = Message("this is a test") + ssn.message_transfer("four", message=msg) + cmd = self.queue.get(10) + assert cmd.destination == "four" + assert cmd.headers == None + assert cmd.payload == msg.body + + qq = ssn.queue_query("asdf") + assert qq.queue == "asdf" + c.close(5) + + def testCloseGet(self): + c = self.connect() + c.start(10) + ssn = c.session("test", timeout=10) + echos = ssn.incoming("echo") + + for i in range(10): + ssn.message_transfer("echo", message=Message("test%d" % i)) + + ssn.auto_sync=False + ssn.message_transfer("abort") + + for i in range(10): + m = echos.get(timeout=10) + assert m.body == "test%d" % i + + try: + m = echos.get(timeout=10) + assert False + except Closed, e: + pass + + def testCloseListen(self): + c = self.connect() + c.start(10) + ssn = c.session("test", timeout=10) + echos = ssn.incoming("echo") + + messages = [] + exceptions = [] + condition = Condition() + def listener(m): messages.append(m) + def exc_listener(e): + condition.acquire() + exceptions.append(e) + condition.notify() + condition.release() + + echos.listen(listener, exc_listener) + + for i in range(10): + ssn.message_transfer("echo", message=Message("test%d" % i)) + + ssn.auto_sync=False + ssn.message_transfer("abort") + + condition.acquire() + start = time.time() + elapsed = 0 + while not exceptions and elapsed < 10: + condition.wait(10 - elapsed) + elapsed = time.time() - start + condition.release() + + for i in range(10): + m = messages.pop(0) + assert m.body == "test%d" % i + + assert len(exceptions) == 1 + + def testSync(self): + c = self.connect() + c.start(10) + s = c.session("test") + s.auto_sync = False + s.message_transfer("echo", message=Message("test")) + s.sync(10) + + def testHeartbeat(self): + c = self.connect(heartbeat=10) + c.start(10) + s = c.session("test") + s.channel.connection_heartbeat() + s.message_transfer("heartbeat") diff --git a/qpid/python/qpid/tests/datatypes.py b/qpid/python/qpid/tests/datatypes.py new file mode 100644 index 0000000000..00e649d6cf --- /dev/null +++ b/qpid/python/qpid/tests/datatypes.py @@ -0,0 +1,296 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from unittest import TestCase +from qpid.datatypes import * +from qpid.ops import DeliveryProperties, FragmentProperties, MessageProperties + +class SerialTest(TestCase): + + def test(self): + for s in (serial(0), serial(0x8FFFFFFFL), serial(0xFFFFFFFFL)): + assert s + 1 > s + assert s - 1 < s + assert s < s + 1 + assert s > s - 1 + + assert serial(0xFFFFFFFFL) + 1 == serial(0) + + assert min(serial(0xFFFFFFFFL), serial(0x0)) == serial(0xFFFFFFFFL) + assert max(serial(0xFFFFFFFFL), serial(0x0)) == serial(0x0) + + def testIncr(self): + s = serial(0) + s += 1 + assert s == serial(1) + + def testIn(self): + l = [serial(1), serial(2), serial(3), serial(4)] + assert serial(1) in l + assert serial(0xFFFFFFFFL + 2) in l + assert 4 in l + + def testNone(self): + assert serial(0) != None + + def testHash(self): + d = {} + d[serial(0)] = "zero" + assert d[0] == "zero" + + def testAdd(self): + assert serial(2) + 2 == serial(4) + assert serial(2) + 2 == 4 + + def testSub(self): + delta = serial(4) - serial(2) + assert isinstance(delta, int) or isinstance(delta, long) + assert delta == 2 + + delta = serial(4) - 2 + assert isinstance(delta, Serial) + assert delta == serial(2) + +class RangedSetTest(TestCase): + + def check(self, ranges): + posts = [] + for range in ranges: + posts.append(range.lower) + posts.append(range.upper) + + sorted = posts[:] + sorted.sort() + + assert posts == sorted + + idx = 1 + while idx + 1 < len(posts): + assert posts[idx] + 1 != posts[idx+1] + idx += 2 + + def test(self): + rs = RangedSet() + + self.check(rs.ranges) + + rs.add(1) + + assert 1 in rs + assert 2 not in rs + assert 0 not in rs + self.check(rs.ranges) + + rs.add(2) + + assert 0 not in rs + assert 1 in rs + assert 2 in rs + assert 3 not in rs + self.check(rs.ranges) + + rs.add(0) + + assert -1 not in rs + assert 0 in rs + assert 1 in rs + assert 2 in rs + assert 3 not in rs + self.check(rs.ranges) + + rs.add(37) + + assert -1 not in rs + assert 0 in rs + assert 1 in rs + assert 2 in rs + assert 3 not in rs + assert 36 not in rs + assert 37 in rs + assert 38 not in rs + self.check(rs.ranges) + + rs.add(-1) + self.check(rs.ranges) + + rs.add(-3) + self.check(rs.ranges) + + rs.add(1, 20) + assert 21 not in rs + assert 20 in rs + self.check(rs.ranges) + + def testAddSelf(self): + a = RangedSet() + a.add(0, 8) + self.check(a.ranges) + a.add(0, 8) + self.check(a.ranges) + assert len(a.ranges) == 1 + range = a.ranges[0] + assert range.lower == 0 + assert range.upper == 8 + + def testEmpty(self): + s = RangedSet() + assert s.empty() + s.add(0, -1) + assert s.empty() + s.add(0, 0) + assert not s.empty() + + def testMinMax(self): + s = RangedSet() + assert s.max() is None + assert s.min() is None + s.add(0, 10) + assert s.max() == 10 + assert s.min() == 0 + s.add(0, 5) + assert s.max() == 10 + assert s.min() == 0 + s.add(0, 11) + assert s.max() == 11 + assert s.min() == 0 + s.add(15, 20) + assert s.max() == 20 + assert s.min() == 0 + s.add(-10, -5) + assert s.max() == 20 + assert s.min() == -10 + +class RangeTest(TestCase): + + def testIntersect1(self): + a = Range(0, 10) + b = Range(9, 20) + i1 = a.intersect(b) + i2 = b.intersect(a) + assert i1.upper == 10 + assert i2.upper == 10 + assert i1.lower == 9 + assert i2.lower == 9 + + def testIntersect2(self): + a = Range(0, 10) + b = Range(11, 20) + assert a.intersect(b) == None + assert b.intersect(a) == None + + def testIntersect3(self): + a = Range(0, 10) + b = Range(3, 5) + i1 = a.intersect(b) + i2 = b.intersect(a) + assert i1.upper == 5 + assert i2.upper == 5 + assert i1.lower == 3 + assert i2.lower == 3 + +class UUIDTest(TestCase): + + def test(self): + # this test is kind of lame, but it does excercise the basic + # functionality of the class + u = uuid4() + for i in xrange(1024): + assert u != uuid4() + +class MessageTest(TestCase): + + def setUp(self): + self.mp = MessageProperties() + self.dp = DeliveryProperties() + self.fp = FragmentProperties() + + def testHas(self): + m = Message(self.mp, self.dp, self.fp, "body") + assert m.has("message_properties") + assert m.has("delivery_properties") + assert m.has("fragment_properties") + + def testGet(self): + m = Message(self.mp, self.dp, self.fp, "body") + assert m.get("message_properties") == self.mp + assert m.get("delivery_properties") == self.dp + assert m.get("fragment_properties") == self.fp + + def testSet(self): + m = Message(self.mp, self.dp, "body") + assert m.get("fragment_properties") is None + m.set(self.fp) + assert m.get("fragment_properties") == self.fp + + def testSetOnEmpty(self): + m = Message("body") + assert m.get("delivery_properties") is None + m.set(self.dp) + assert m.get("delivery_properties") == self.dp + + def testSetReplace(self): + m = Message(self.mp, self.dp, self.fp, "body") + dp = DeliveryProperties() + assert m.get("delivery_properties") == self.dp + assert m.get("delivery_properties") != dp + m.set(dp) + assert m.get("delivery_properties") != self.dp + assert m.get("delivery_properties") == dp + + def testClear(self): + m = Message(self.mp, self.dp, self.fp, "body") + assert m.get("message_properties") == self.mp + assert m.get("delivery_properties") == self.dp + assert m.get("fragment_properties") == self.fp + m.clear("fragment_properties") + assert m.get("fragment_properties") is None + assert m.get("message_properties") == self.mp + assert m.get("delivery_properties") == self.dp + +class TimestampTest(TestCase): + + def check(self, expected, *values): + for v in values: + assert isinstance(v, timestamp) + assert v == expected + assert v == timestamp(expected) + + def testAdd(self): + self.check(4.0, + timestamp(2.0) + 2.0, + 2.0 + timestamp(2.0)) + + def testSub(self): + self.check(2.0, + timestamp(4.0) - 2.0, + 4.0 - timestamp(2.0)) + + def testNeg(self): + self.check(-4.0, -timestamp(4.0)) + + def testPos(self): + self.check(+4.0, +timestamp(4.0)) + + def testAbs(self): + self.check(4.0, abs(timestamp(-4.0))) + + def testConversion(self): + dt = timestamp(0).datetime() + t = timestamp(dt) + assert t == 0 diff --git a/qpid/python/qpid/tests/framing.py b/qpid/python/qpid/tests/framing.py new file mode 100644 index 0000000000..0b33df8b9a --- /dev/null +++ b/qpid/python/qpid/tests/framing.py @@ -0,0 +1,289 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +# setup, usage, teardown, errors(sync), errors(async), stress, soak, +# boundary-conditions, config + +from qpid.tests import Test +from qpid.framing import * + +class Base(Test): + + def cmp_frames(self, frm1, frm2): + assert frm1.flags == frm2.flags, "expected: %r, got %r" % (frm1, frm2) + assert frm1.type == frm2.type, "expected: %r, got %r" % (frm1, frm2) + assert frm1.track == frm2.track, "expected: %r, got %r" % (frm1, frm2) + assert frm1.channel == frm2.channel, "expected: %r, got %r" % (frm1, frm2) + assert frm1.payload == frm2.payload, "expected: %r, got %r" % (frm1, frm2) + + def cmp_segments(self, seg1, seg2): + assert seg1.first == seg2.first, "expected: %r, got %r" % (seg1, seg2) + assert seg1.last == seg2.last, "expected: %r, got %r" % (seg1, seg2) + assert seg1.type == seg2.type, "expected: %r, got %r" % (seg1, seg2) + assert seg1.track == seg2.track, "expected: %r, got %r" % (seg1, seg2) + assert seg1.channel == seg2.channel, "expected: %r, got %r" % (seg1, seg2) + assert seg1.payload == seg2.payload, "expected: %r, got %r" % (seg1, seg2) + + def cmp_list(self, l1, l2): + if l1 is None: + assert l2 is None + return + + assert len(l1) == len(l2) + for v1, v2 in zip(l1, l2): + if isinstance(v1, Compound): + self.cmp_ops(v1, v2) + else: + assert v1 == v2 + + def cmp_ops(self, op1, op2): + if op1 is None: + assert op2 is None + return + + assert op1.__class__ == op2.__class__ + cls = op1.__class__ + assert op1.NAME == op2.NAME + assert op1.CODE == op2.CODE + assert op1.FIELDS == op2.FIELDS + for f in cls.FIELDS: + v1 = getattr(op1, f.name) + v2 = getattr(op2, f.name) + if COMPOUND.has_key(f.type) or f.type == "struct32": + self.cmp_ops(v1, v2) + elif f.type in ("list", "array"): + self.cmp_list(v1, v2) + else: + assert v1 == v2, "expected: %r, got %r" % (v1, v2) + + if issubclass(cls, Command) or issubclass(cls, Control): + assert op1.channel == op2.channel + + if issubclass(cls, Command): + assert op1.sync == op2.sync, "expected: %r, got %r" % (op1.sync, op2.sync) + assert (op1.headers is None and op2.headers is None) or \ + (op1.headers is not None and op2.headers is not None) + if op1.headers is not None: + assert len(op1.headers) == len(op2.headers) + for h1, h2 in zip(op1.headers, op2.headers): + self.cmp_ops(h1, h2) + +class FrameTest(Base): + + def enc_dec(self, frames, encoded=None): + enc = FrameEncoder() + dec = FrameDecoder() + + enc.write(*frames) + bytes = enc.read() + if encoded is not None: + assert bytes == encoded, "expected %r, got %r" % (encoded, bytes) + dec.write(bytes) + dframes = dec.read() + + assert len(frames) == len(dframes) + for f, df, in zip(frames, dframes): + self.cmp_frames(f, df) + + def testEmpty(self): + self.enc_dec([Frame(0, 0, 0, 0, "")], + "\x00\x00\x00\x0c\x00\x00\x00\x00\x00\x00\x00\x00") + + def testSingle(self): + self.enc_dec([Frame(0, 0, 0, 1, "payload")], + "\x00\x00\x00\x13\x00\x00\x00\x01\x00\x00\x00\x00payload") + + def testMaxChannel(self): + self.enc_dec([Frame(0, 0, 0, 65535, "max-channel")], + "\x00\x00\x00\x17\x00\x00\xff\xff\x00\x00\x00\x00max-channel") + + def testMaxType(self): + self.enc_dec([Frame(0, 255, 0, 0, "max-type")], + "\x00\xff\x00\x14\x00\x00\x00\x00\x00\x00\x00\x00max-type") + + def testMaxTrack(self): + self.enc_dec([Frame(0, 0, 15, 0, "max-track")], + "\x00\x00\x00\x15\x00\x0f\x00\x00\x00\x00\x00\x00max-track") + + def testSequence(self): + self.enc_dec([Frame(0, 0, 0, 0, "zero"), + Frame(0, 0, 0, 1, "one"), + Frame(0, 0, 1, 0, "two"), + Frame(0, 0, 1, 1, "three"), + Frame(0, 1, 0, 0, "four"), + Frame(0, 1, 0, 1, "five"), + Frame(0, 1, 1, 0, "six"), + Frame(0, 1, 1, 1, "seven"), + Frame(1, 0, 0, 0, "eight"), + Frame(1, 0, 0, 1, "nine"), + Frame(1, 0, 1, 0, "ten"), + Frame(1, 0, 1, 1, "eleven"), + Frame(1, 1, 0, 0, "twelve"), + Frame(1, 1, 0, 1, "thirteen"), + Frame(1, 1, 1, 0, "fourteen"), + Frame(1, 1, 1, 1, "fifteen")]) + +class SegmentTest(Base): + + def enc_dec(self, segments, frames=None, interleave=None, max_payload=Frame.MAX_PAYLOAD): + enc = SegmentEncoder(max_payload) + dec = SegmentDecoder() + + enc.write(*segments) + frms = enc.read() + if frames is not None: + assert len(frames) == len(frms), "expected %s, got %s" % (frames, frms) + for f1, f2 in zip(frames, frms): + self.cmp_frames(f1, f2) + if interleave is not None: + ilvd = [] + for f in frms: + ilvd.append(f) + if interleave: + ilvd.append(interleave.pop(0)) + ilvd.extend(interleave) + dec.write(*ilvd) + else: + dec.write(*frms) + segs = dec.read() + assert len(segments) == len(segs) + for s1, s2 in zip(segments, segs): + self.cmp_segments(s1, s2) + + def testEmpty(self): + self.enc_dec([Segment(True, True, 0, 0, 0, "")], + [Frame(FIRST_FRM | LAST_FRM | FIRST_SEG | LAST_SEG, 0, 0, 0, + "")]) + + def testSingle(self): + self.enc_dec([Segment(True, True, 0, 0, 0, "payload")], + [Frame(FIRST_FRM | LAST_FRM | FIRST_SEG | LAST_SEG, 0, 0, 0, + "payload")]) + + def testMaxChannel(self): + self.enc_dec([Segment(False, False, 0, 0, 65535, "max-channel")], + [Frame(FIRST_FRM | LAST_FRM, 0, 0, 65535, "max-channel")]) + + def testMaxType(self): + self.enc_dec([Segment(False, False, 255, 0, 0, "max-type")], + [Frame(FIRST_FRM | LAST_FRM, 255, 0, 0, "max-type")]) + + def testMaxTrack(self): + self.enc_dec([Segment(False, False, 0, 15, 0, "max-track")], + [Frame(FIRST_FRM | LAST_FRM, 0, 15, 0, "max-track")]) + + def testSequence(self): + self.enc_dec([Segment(True, False, 0, 0, 0, "one"), + Segment(False, False, 0, 0, 0, "two"), + Segment(False, True, 0, 0, 0, "three")], + [Frame(FIRST_FRM | LAST_FRM | FIRST_SEG, 0, 0, 0, "one"), + Frame(FIRST_FRM | LAST_FRM, 0, 0, 0, "two"), + Frame(FIRST_FRM | LAST_FRM | LAST_SEG, 0, 0, 0, "three")]) + + def testInterleaveChannel(self): + frames = [Frame(0, 0, 0, 0, chr(ord("a") + i)) for i in range(7)] + frames[0].flags |= FIRST_FRM + frames[-1].flags |= LAST_FRM + + ilvd = [Frame(0, 0, 0, 1, chr(ord("a") + i)) for i in range(7)] + + self.enc_dec([Segment(False, False, 0, 0, 0, "abcdefg")], frames, ilvd, max_payload=1) + + def testInterleaveTrack(self): + frames = [Frame(0, 0, 0, 0, "%c%c" % (ord("a") + i, ord("a") + i + 1)) + for i in range(0, 8, 2)] + frames[0].flags |= FIRST_FRM + frames[-1].flags |= LAST_FRM + + ilvd = [Frame(0, 0, 1, 0, "%c%c" % (ord("a") + i, ord("a") + i + 1)) + for i in range(0, 8, 2)] + + self.enc_dec([Segment(False, False, 0, 0, 0, "abcdefgh")], frames, ilvd, max_payload=2) + +from qpid.ops import * + +class OpTest(Base): + + def enc_dec(self, ops): + enc = OpEncoder() + dec = OpDecoder() + enc.write(*ops) + segs = enc.read() + dec.write(*segs) + dops = dec.read() + assert len(ops) == len(dops) + for op1, op2 in zip(ops, dops): + self.cmp_ops(op1, op2) + + def testEmtpyMT(self): + self.enc_dec([MessageTransfer()]) + + def testEmptyMTSync(self): + self.enc_dec([MessageTransfer(sync=True)]) + + def testMT(self): + self.enc_dec([MessageTransfer(destination="asdf")]) + + def testSyncMT(self): + self.enc_dec([MessageTransfer(destination="asdf", sync=True)]) + + def testEmptyPayloadMT(self): + self.enc_dec([MessageTransfer(payload="")]) + + def testPayloadMT(self): + self.enc_dec([MessageTransfer(payload="test payload")]) + + def testHeadersEmptyPayloadMT(self): + self.enc_dec([MessageTransfer(headers=[DeliveryProperties()])]) + + def testHeadersPayloadMT(self): + self.enc_dec([MessageTransfer(headers=[DeliveryProperties()], payload="test payload")]) + + def testMultiHeadersEmptyPayloadMT(self): + self.enc_dec([MessageTransfer(headers=[DeliveryProperties(), MessageProperties()])]) + + def testMultiHeadersPayloadMT(self): + self.enc_dec([MessageTransfer(headers=[MessageProperties(), DeliveryProperties()], payload="test payload")]) + + def testContentTypeHeadersPayloadMT(self): + self.enc_dec([MessageTransfer(headers=[MessageProperties(content_type="text/plain")], payload="test payload")]) + + def testMulti(self): + self.enc_dec([MessageTransfer(), + MessageTransfer(sync=True), + MessageTransfer(destination="one"), + MessageTransfer(destination="two", sync=True), + MessageTransfer(destination="three", payload="test payload")]) + + def testControl(self): + self.enc_dec([SessionAttach(name="asdf")]) + + def testMixed(self): + self.enc_dec([SessionAttach(name="fdsa"), MessageTransfer(destination="test")]) + + def testChannel(self): + self.enc_dec([SessionAttach(name="asdf", channel=3), MessageTransfer(destination="test", channel=1)]) + + def testCompound(self): + self.enc_dec([MessageTransfer(headers=[MessageProperties(reply_to=ReplyTo(exchange="exch", routing_key="rk"))])]) + + def testListCompound(self): + self.enc_dec([ExecutionResult(value=RecoverResult(in_doubt=[Xid(global_id="one"), + Xid(global_id="two"), + Xid(global_id="three")]))]) diff --git a/qpid/python/qpid/tests/messaging/__init__.py b/qpid/python/qpid/tests/messaging/__init__.py new file mode 100644 index 0000000000..38a5b066d6 --- /dev/null +++ b/qpid/python/qpid/tests/messaging/__init__.py @@ -0,0 +1,204 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import time +from math import ceil +from qpid.harness import Skipped +from qpid.tests.messaging.implementation import * +from qpid.tests import Test + +class Base(Test): + + def setup_connection(self): + return None + + def setup_session(self): + return None + + def setup_sender(self): + return None + + def setup_receiver(self): + return None + + def setup(self): + self.test_id = uuid4() + self.broker = self.config.broker + try: + self.conn = self.setup_connection() + except ConnectError, e: + raise Skipped(e) + self.ssn = self.setup_session() + self.snd = self.setup_sender() + if self.snd is not None: + self.snd.durable = self.durable() + self.rcv = self.setup_receiver() + + def teardown(self): + if self.conn is not None and self.conn.attached(): + self.teardown_connection(self.conn) + self.conn = None + + def teardown_connection(self, conn): + conn.close(timeout=self.timeout()) + + def content(self, base, count = None): + if count is None: + return "%s[%s]" % (base, self.test_id) + else: + return "%s[%s, %s]" % (base, count, self.test_id) + + def message(self, base, count = None, **kwargs): + return Message(content=self.content(base, count), **kwargs) + + def ping(self, ssn): + PING_Q = 'ping-queue; {create: always, delete: always}' + # send a message + sender = ssn.sender(PING_Q, durable=self.durable()) + content = self.content("ping") + sender.send(content) + receiver = ssn.receiver(PING_Q) + msg = receiver.fetch(0) + ssn.acknowledge() + assert msg.content == content, "expected %r, got %r" % (content, msg.content) + + def drain(self, rcv, limit=None, timeout=0, expected=None, redelivered=False): + messages = [] + try: + while limit is None or len(messages) < limit: + messages.append(rcv.fetch(timeout=timeout)) + except Empty: + pass + if expected is not None: + self.assertEchos(expected, messages, redelivered) + return messages + + def diff(self, m1, m2, excluded_properties=()): + result = {} + for attr in ("id", "subject", "user_id", "reply_to", + "correlation_id", "durable", "priority", "ttl", + "redelivered", "content_type", "content"): + a1 = getattr(m1, attr) + a2 = getattr(m2, attr) + if a1 != a2: + result[attr] = (a1, a2) + p1 = dict(m1.properties) + p2 = dict(m2.properties) + for ep in excluded_properties: + p1.pop(ep, None) + p2.pop(ep, None) + if p1 != p2: + result["properties"] = (p1, p2) + return result + + def assertEcho(self, msg, echo, redelivered=False): + if not isinstance(msg, Message) or not isinstance(echo, Message): + if isinstance(msg, Message): + msg = msg.content + if isinstance(echo, Message): + echo = echo.content + assert msg == echo, "expected %s, got %s" % (msg, echo) + else: + delta = self.diff(msg, echo, ("x-amqp-0-10.routing-key","qpid.subject")) + mttl, ettl = delta.pop("ttl", (0, 0)) + if redelivered: + assert echo.redelivered, \ + "expected %s to be redelivered: %s" % (msg, echo) + if delta.has_key("redelivered"): + del delta["redelivered"] + assert mttl is not None and ettl is not None, "%s, %s" % (mttl, ettl) + assert mttl >= ettl, "%s, %s" % (mttl, ettl) + assert not delta, "expected %s, got %s, delta %s" % (msg, echo, delta) + + def assertEchos(self, msgs, echoes, redelivered=False): + assert len(msgs) == len(echoes), "%s, %s" % (msgs, echoes) + for m, e in zip(msgs, echoes): + self.assertEcho(m, e, redelivered) + + def assertEmpty(self, rcv): + contents = self.drain(rcv) + assert len(contents) == 0, "%s is supposed to be empty: %s" % (rcv, contents) + + def assertAvailable(self, rcv, expected=None, lower=None, upper=None): + if expected is not None: + if lower is not None or upper is not None: + raise ValueError("cannot specify lower or upper when specifying expected") + lower = expected + upper = expected + else: + if lower is None: + lower = int(ceil(rcv.threshold*rcv.capacity)) + if upper is None: + upper = rcv.capacity + + p = rcv.available() + if upper == lower: + assert p == lower, "expected %s, got %s" % (lower, p) + else: + assert lower <= p <= upper, "expected %s to be in range [%s, %s]" % (p, lower, upper) + + def sleep(self): + time.sleep(self.delay()) + + def delay(self): + return float(self.config.defines.get("delay", "2")) + + def timeout(self): + return float(self.config.defines.get("timeout", "60")) + + def get_bool(self, name): + return self.config.defines.get(name, "false").lower() in ("true", "yes", "1") + + def durable(self): + return self.get_bool("durable") + + def reconnect(self): + return self.get_bool("reconnect") + + + def transport(self): + if self.broker.scheme == self.broker.AMQPS: + return "ssl" + else: + return "tcp" + + def connection_options(self): + protocol_version = self.config.defines.get("protocol_version") + if protocol_version: + return {"reconnect": self.reconnect(), + "transport": self.transport(), + "protocol":protocol_version} + else: + return {"reconnect": self.reconnect(), + "transport": self.transport()} + +class VersionTest (Base): + def create_connection(self, version="amqp1.0", force=False): + opts = self.connection_options() + if force or not 'protocol' in opts: + opts['protocol'] = version; + return Connection.establish(self.broker, **opts) + + def setup_connection(self): + return self.create_connection() + + def setup_session(self): + return self.conn.session() + +import address, endpoints, message diff --git a/qpid/python/qpid/tests/messaging/address.py b/qpid/python/qpid/tests/messaging/address.py new file mode 100644 index 0000000000..aa9562a717 --- /dev/null +++ b/qpid/python/qpid/tests/messaging/address.py @@ -0,0 +1,321 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + + +from qpid.tests import Test +from qpid.messaging.address import lex, parse, ParseError, EOF, ID, NUMBER, \ + SYM, WSPACE, LEXER +from qpid.lexer import Token +from qpid.harness import Skipped +from qpid.tests.parser import ParserBase + +def indent(st): + return " " + st.replace("\n", "\n ") + +def pprint_address(name, subject, options): + return "NAME: %s\nSUBJECT: %s\nOPTIONS: %s" % \ + (pprint(name), pprint(subject), pprint(options)) + +def pprint(o): + if isinstance(o, dict): + return pprint_map(o) + elif isinstance(o, list): + return pprint_list(o) + elif isinstance(o, basestring): + return pprint_string(o) + else: + return repr(o) + +def pprint_map(m): + items = ["%s: %s" % (pprint(k), pprint(v)) for k, v in m.items()] + items.sort() + return pprint_items("{", items, "}") + +def pprint_list(l): + return pprint_items("[", [pprint(x) for x in l], "]") + +def pprint_items(start, items, end): + if items: + return "%s\n%s\n%s" % (start, ",\n".join([indent(i) for i in items]), end) + else: + return "%s%s" % (start, end) + +def pprint_string(s): + result = "'" + for c in s: + if c == "'": + result += "\\'" + elif c == "\n": + result += "\\n" + elif ord(c) >= 0x80: + result += "\\u%04x" % ord(c) + else: + result += c + result += "'" + return result + +class AddressTests(ParserBase, Test): + + EXCLUDE = (WSPACE, EOF) + + def fields(self, line, n): + result = line.split(":", n - 1) + result.extend([None]*(n - len(result))) + return result + + def call(self, parser, mode, input): + try: + from subprocess import Popen, PIPE, STDOUT + po = Popen([parser, mode], stdin=PIPE, stdout=PIPE, stderr=STDOUT) + except ImportError, e: + raise Skipped("%s" % e) + except OSError, e: + raise Skipped("%s: %s" % (e, parser)) + out, _ = po.communicate(input=input) + return out + + def parser(self): + return self.config.defines.get("address.parser") + + def do_lex(self, st): + parser = self.parser() + if parser: + out = self.call(parser, "lex", st) + lines = out.split("\n") + toks = [] + for line in lines: + if line.strip(): + name, position, value = self.fields(line, 3) + toks.append(Token(LEXER.type(name), value, position, st)) + return toks + else: + return lex(st) + + def do_parse(self, st): + return parse(st) + + def valid(self, addr, name=None, subject=None, options=None): + parser = self.parser() + if parser: + got = self.call(parser, "parse", addr) + expected = "%s\n" % pprint_address(name, subject, options) + assert expected == got, "expected\n<EXP>%s</EXP>\ngot\n<GOT>%s</GOT>" % (expected, got) + else: + ParserBase.valid(self, addr, (name, subject, options)) + + def invalid(self, addr, error=None): + parser = self.parser() + if parser: + got = self.call(parser, "parse", addr) + expected = "ERROR: %s\n" % error + assert expected == got, "expected %r, got %r" % (expected, got) + else: + ParserBase.invalid(self, addr, error) + + def testDashInId1(self): + self.lex("foo-bar", ID) + + def testDashInId2(self): + self.lex("foo-3", ID) + + def testDashAlone1(self): + self.lex("foo - bar", ID, SYM, ID) + + def testDashAlone2(self): + self.lex("foo - 3", ID, SYM, NUMBER) + + def testLeadingDash(self): + self.lex("-foo", SYM, ID) + + def testTrailingDash(self): + self.lex("foo-", ID, SYM) + + def testNegativeNum(self): + self.lex("-3", NUMBER) + + def testIdNum(self): + self.lex("id1", ID) + + def testIdSpaceNum(self): + self.lex("id 1", ID, NUMBER) + + def testHash(self): + self.valid("foo/bar.#", "foo", "bar.#") + + def testStar(self): + self.valid("foo/bar.*", "foo", "bar.*") + + def testColon(self): + self.valid("foo.bar/baz.qux:moo:arf", "foo.bar", "baz.qux:moo:arf") + + def testOptions(self): + self.valid("foo.bar/baz.qux:moo:arf; {key: value}", + "foo.bar", "baz.qux:moo:arf", {"key": "value"}) + + def testOptionsTrailingComma(self): + self.valid("name/subject; {key: value,}", "name", "subject", + {"key": "value"}) + + def testOptionsNone(self): + self.valid("name/subject; {key: None}", "name", "subject", + {"key": None}) + + def testSemiSubject(self): + self.valid("foo.bar/'baz.qux;moo:arf'; {key: value}", + "foo.bar", "baz.qux;moo:arf", {"key": "value"}) + + def testCommaSubject(self): + self.valid("foo.bar/baz.qux.{moo,arf}", "foo.bar", "baz.qux.{moo,arf}") + + def testCommaSubjectOptions(self): + self.valid("foo.bar/baz.qux.{moo,arf}; {key: value}", "foo.bar", + "baz.qux.{moo,arf}", {"key": "value"}) + + def testUnbalanced(self): + self.valid("foo.bar/baz.qux.{moo,arf; {key: value}", "foo.bar", + "baz.qux.{moo,arf", {"key": "value"}) + + def testSlashQuote(self): + self.valid("foo.bar\\/baz.qux.{moo,arf; {key: value}", + "foo.bar/baz.qux.{moo,arf", + None, {"key": "value"}) + + def testSlashHexEsc1(self): + self.valid("foo.bar\\x00baz.qux.{moo,arf; {key: value}", + "foo.bar\x00baz.qux.{moo,arf", + None, {"key": "value"}) + + def testSlashHexEsc2(self): + self.valid("foo.bar\\xffbaz.qux.{moo,arf; {key: value}", + "foo.bar\xffbaz.qux.{moo,arf", + None, {"key": "value"}) + + def testSlashHexEsc3(self): + self.valid("foo.bar\\xFFbaz.qux.{moo,arf; {key: value}", + "foo.bar\xFFbaz.qux.{moo,arf", + None, {"key": "value"}) + + def testSlashUnicode1(self): + self.valid("foo.bar\\u1234baz.qux.{moo,arf; {key: value}", + u"foo.bar\u1234baz.qux.{moo,arf", None, {"key": "value"}) + + def testSlashUnicode2(self): + self.valid("foo.bar\\u0000baz.qux.{moo,arf; {key: value}", + u"foo.bar\u0000baz.qux.{moo,arf", None, {"key": "value"}) + + def testSlashUnicode3(self): + self.valid("foo.bar\\uffffbaz.qux.{moo,arf; {key: value}", + u"foo.bar\uffffbaz.qux.{moo,arf", None, {"key": "value"}) + + def testSlashUnicode4(self): + self.valid("foo.bar\\uFFFFbaz.qux.{moo,arf; {key: value}", + u"foo.bar\uFFFFbaz.qux.{moo,arf", None, {"key": "value"}) + + def testNoName(self): + self.invalid("; {key: value}", + "unexpected token SEMI(;) line:1,0:; {key: value}") + + def testEmpty(self): + self.invalid("", "unexpected token EOF line:1,0:") + + def testNoNameSlash(self): + self.invalid("/asdf; {key: value}", + "unexpected token SLASH(/) line:1,0:/asdf; {key: value}") + + def testBadOptions1(self): + self.invalid("name/subject; {", + "expecting (NUMBER, STRING, ID, LBRACE, LBRACK, RBRACE), " + "got EOF line:1,15:name/subject; {") + + def testBadOptions2(self): + self.invalid("name/subject; { 3", + "expecting COLON, got EOF " + "line:1,17:name/subject; { 3") + + def testBadOptions3(self): + self.invalid("name/subject; { key:", + "expecting (NUMBER, STRING, ID, LBRACE, LBRACK), got EOF " + "line:1,20:name/subject; { key:") + + def testBadOptions4(self): + self.invalid("name/subject; { key: value", + "expecting (COMMA, RBRACE), got EOF " + "line:1,26:name/subject; { key: value") + + def testBadOptions5(self): + self.invalid("name/subject; { key: value asdf", + "expecting (COMMA, RBRACE), got ID(asdf) " + "line:1,27:name/subject; { key: value asdf") + + def testBadOptions6(self): + self.invalid("name/subject; { key: value,", + "expecting (NUMBER, STRING, ID, LBRACE, LBRACK, RBRACE), got EOF " + "line:1,27:name/subject; { key: value,") + + def testBadOptions7(self): + self.invalid("name/subject; { key: value } asdf", + "expecting EOF, got ID(asdf) " + "line:1,29:name/subject; { key: value } asdf") + + def testList1(self): + self.valid("name/subject; { key: [] }", "name", "subject", {"key": []}) + + def testList2(self): + self.valid("name/subject; { key: ['one'] }", "name", "subject", {"key": ['one']}) + + def testList3(self): + self.valid("name/subject; { key: [1, 2, 3] }", "name", "subject", + {"key": [1, 2, 3]}) + + def testList4(self): + self.valid("name/subject; { key: [1, [2, 3], 4] }", "name", "subject", + {"key": [1, [2, 3], 4]}) + + def testBadList1(self): + self.invalid("name/subject; { key: [ }", "expecting (NUMBER, STRING, ID, LBRACE, LBRACK), " + "got RBRACE(}) line:1,23:name/subject; { key: [ }") + + def testBadList2(self): + self.invalid("name/subject; { key: [ 1 }", "expecting (COMMA, RBRACK), " + "got RBRACE(}) line:1,25:name/subject; { key: [ 1 }") + + def testBadList3(self): + self.invalid("name/subject; { key: [ 1 2 }", "expecting (COMMA, RBRACK), " + "got NUMBER(2) line:1,25:name/subject; { key: [ 1 2 }") + + def testBadList4(self): + self.invalid("name/subject; { key: [ 1 2 ] }", "expecting (COMMA, RBRACK), " + "got NUMBER(2) line:1,25:name/subject; { key: [ 1 2 ] }") + + def testMap1(self): + self.valid("name/subject; { 'key': value }", + "name", "subject", {"key": "value"}) + + def testMap2(self): + self.valid("name/subject; { 1: value }", "name", "subject", {1: "value"}) + + def testMap3(self): + self.valid('name/subject; { "foo.bar": value }', + "name", "subject", {"foo.bar": "value"}) + + def testBoolean(self): + self.valid("name/subject; { true1: True, true2: true, " + "false1: False, false2: false }", + "name", "subject", {"true1": True, "true2": True, + "false1": False, "false2": False}) diff --git a/qpid/python/qpid/tests/messaging/endpoints.py b/qpid/python/qpid/tests/messaging/endpoints.py new file mode 100644 index 0000000000..d0103ee32c --- /dev/null +++ b/qpid/python/qpid/tests/messaging/endpoints.py @@ -0,0 +1,1387 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +# setup, usage, teardown, errors(sync), errors(async), stress, soak, +# boundary-conditions, config + +import errno, os, socket, sys, time +from qpid import compat +from qpid.compat import set +from qpid.messaging import * +from qpid.messaging.transports import TRANSPORTS +from qpid.tests.messaging import Base +from threading import Thread + +class SetupTests(Base): + + def testEstablish(self): + self.conn = Connection.establish(self.broker, **self.connection_options()) + self.ping(self.conn.session()) + + def testOpen(self): + self.conn = Connection(self.broker, **self.connection_options()) + self.conn.open() + self.ping(self.conn.session()) + + def testOpenReconnectURLs(self): + options = self.connection_options() + options["reconnect_urls"] = [self.broker, self.broker] + self.conn = Connection(self.broker, **options) + self.conn.open() + self.ping(self.conn.session()) + + def testTcpNodelay(self): + self.conn = Connection.establish(self.broker, tcp_nodelay=True) + assert self.conn._driver._transport.socket.getsockopt(socket.IPPROTO_TCP, socket.TCP_NODELAY) + + def testConnectError(self): + try: + # Specifying port 0 yields a bad address on Windows; port 4 is unassigned + self.conn = Connection.establish("localhost:4") + assert False, "connect succeeded" + except ConnectError, e: + assert "refused" in str(e) + + def testGetError(self): + self.conn = Connection("localhost:0") + try: + self.conn.open() + assert False, "connect succeeded" + except ConnectError, e: + assert self.conn.get_error() == e + + def use_fds(self): + fds = [] + try: + while True: + fds.append(os.open(getattr(os, "devnull", "/dev/null"), os.O_RDONLY)) + except OSError, e: + if e.errno != errno.EMFILE: + raise e + else: + return fds + + def testOpenCloseResourceLeaks(self): + fds = self.use_fds() + try: + for i in range(32): + if fds: os.close(fds.pop()) + for i in xrange(64): + conn = Connection.establish(self.broker, **self.connection_options()) + conn.close() + finally: + while fds: + os.close(fds.pop()) + + def testOpenFailResourceLeaks(self): + fds = self.use_fds() + try: + for i in range(32): + if fds: os.close(fds.pop()) + for i in xrange(64): + conn = Connection("localhost:0", **self.connection_options()) + # XXX: we need to force a waiter to be created for this test + # to work + conn._lock.acquire() + conn._wait(lambda: False, timeout=0.001) + conn._lock.release() + try: + conn.open() + except ConnectError, e: + pass + finally: + while fds: + os.close(fds.pop()) + + def testReconnect(self): + options = self.connection_options() + real = TRANSPORTS["tcp"] + + class flaky: + + def __init__(self, conn, host, port): + self.real = real(conn, host, port) + self.sent_count = 0 + self.recv_count = 0 + + def fileno(self): + return self.real.fileno() + + def reading(self, reading): + return self.real.reading(reading) + + def writing(self, writing): + return self.real.writing(writing) + + def send(self, bytes): + if self.sent_count > 2048: + raise socket.error("fake error") + n = self.real.send(bytes) + self.sent_count += n + return n + + def recv(self, n): + if self.recv_count > 2048: + return "" + bytes = self.real.recv(n) + self.recv_count += len(bytes) + return bytes + + def close(self): + self.real.close() + + TRANSPORTS["flaky"] = flaky + + options["reconnect"] = True + options["reconnect_interval"] = 0 + options["reconnect_limit"] = 100 + options["reconnect_log"] = False + options["transport"] = "flaky" + + self.conn = Connection.establish(self.broker, **options) + ssn = self.conn.session() + snd = ssn.sender("test-reconnect-queue; {create: always, delete: always}") + rcv = ssn.receiver(snd.target) + + msgs = [self.message("testReconnect", i) for i in range(20)] + for m in msgs: + snd.send(m) + + content = set() + drained = [] + duplicates = [] + try: + while True: + m = rcv.fetch(timeout=0) + if m.content not in content: + content.add(m.content) + drained.append(m) + else: + duplicates.append(m) + ssn.acknowledge(m) + except Empty: + pass + # XXX: apparently we don't always get duplicates, should figure out why + #assert duplicates, "no duplicates" + assert len(drained) == len(msgs) + for m, d in zip(msgs, drained): + # XXX: we should figure out how to provide proper end to end + # redelivered + self.assertEcho(m, d, d.redelivered) + +class ConnectionTests(Base): + + def setup_connection(self): + return Connection.establish(self.broker, **self.connection_options()) + + def testCheckClosed(self): + assert not self.conn.check_closed() + + def testSessionAnon(self): + ssn1 = self.conn.session() + ssn2 = self.conn.session() + self.ping(ssn1) + self.ping(ssn2) + assert ssn1 is not ssn2 + + def testSessionNamed(self): + ssn1 = self.conn.session("one") + ssn2 = self.conn.session("two") + self.ping(ssn1) + self.ping(ssn2) + assert ssn1 is not ssn2 + assert ssn1 is self.conn.session("one") + assert ssn2 is self.conn.session("two") + + def testDetach(self): + ssn = self.conn.session() + self.ping(ssn) + self.conn.detach() + try: + self.ping(ssn) + assert False, "ping succeeded" + except Detached: + # this is the expected failure when pinging on a detached + # connection + pass + self.conn.attach() + self.ping(ssn) + + def testClose(self): + self.conn.close() + assert not self.conn.attached() + + def testSimultaneousClose(self): + ssns = [self.conn.session() for i in range(3)] + for s in ssns: + for i in range(3): + s.receiver("amq.topic") + s.sender("amq.topic") + + def closer(errors): + try: + self.conn.close() + except: + _, e, _ = sys.exc_info() + errors.append(compat.format_exc(e)) + + t1_errors = [] + t2_errors = [] + t1 = Thread(target=lambda: closer(t1_errors)) + t2 = Thread(target=lambda: closer(t2_errors)) + t1.start() + t2.start() + t1.join(self.delay()) + t2.join(self.delay()) + + assert not t1_errors, t1_errors[0] + assert not t2_errors, t2_errors[0] + +class hangable: + + def __init__(self, conn, host, port): + self.tcp = TRANSPORTS["tcp"](conn, host, port) + self.hung = False + + def hang(self): + self.hung = True + + def fileno(self): + return self.tcp.fileno() + + def reading(self, reading): + if self.hung: + return True + else: + return self.tcp.reading(reading) + + def writing(self, writing): + if self.hung: + return False + else: + return self.tcp.writing(writing) + + def send(self, bytes): + if self.hung: + return 0 + else: + return self.tcp.send(bytes) + + def recv(self, n): + if self.hung: + return "" + else: + return self.tcp.recv(n) + + def close(self): + self.tcp.close() + +TRANSPORTS["hangable"] = hangable + +class TimeoutTests(Base): + + def setup_connection(self): + options = self.connection_options() + options["transport"] = "hangable" + return Connection.establish(self.broker, **options) + + def setup_session(self): + return self.conn.session() + + def setup_sender(self): + return self.ssn.sender("amq.topic") + + def setup_receiver(self): + return self.ssn.receiver("amq.topic; {link: {reliability: unreliable}}") + + def teardown_connection(self, conn): + try: + conn.detach(timeout=0) + except Timeout: + pass + + def hang(self): + self.conn._driver._transport.hang() + + def timeoutTest(self, method): + self.hang() + try: + method(timeout=self.delay()) + assert False, "did not time out" + except Timeout: + pass + + def testSenderSync(self): + self.snd.send(self.content("testSenderSync"), sync=False) + self.timeoutTest(self.snd.sync) + + def testSenderClose(self): + self.snd.send(self.content("testSenderClose"), sync=False) + self.timeoutTest(self.snd.close) + + def testReceiverClose(self): + self.timeoutTest(self.rcv.close) + + def testSessionSync(self): + self.snd.send(self.content("testSessionSync"), sync=False) + self.timeoutTest(self.ssn.sync) + + def testSessionClose(self): + self.timeoutTest(self.ssn.close) + + def testConnectionDetach(self): + self.timeoutTest(self.conn.detach) + + def testConnectionClose(self): + self.timeoutTest(self.conn.close) + + def testConnectionOpen(self): + options = self.connection_options() + options["reconnect"] = True + options["reconnect_timeout"] = self.delay() + try: + bad_conn = Connection.establish("badhostname", **options) + assert False, "did not time out" + except Timeout: + pass + +ACK_QC = 'test-ack-queue; {create: always}' +ACK_QD = 'test-ack-queue; {delete: always}' + +class SessionTests(Base): + + def setup_connection(self): + return Connection.establish(self.broker, **self.connection_options()) + + def setup_session(self): + return self.conn.session() + + def testSender(self): + snd = self.ssn.sender('test-snd-queue; {create: sender, delete: receiver}', + durable=self.durable()) + snd2 = self.ssn.sender(snd.target, durable=self.durable()) + assert snd is not snd2 + snd2.close() + + content = self.content("testSender") + snd.send(content) + rcv = self.ssn.receiver(snd.target) + msg = rcv.fetch(0) + assert msg.content == content + self.ssn.acknowledge(msg) + + def testReceiver(self): + rcv = self.ssn.receiver('test-rcv-queue; {create: always}') + rcv2 = self.ssn.receiver(rcv.source) + assert rcv is not rcv2 + rcv2.close() + + content = self.content("testReceiver") + snd = self.ssn.sender(rcv.source, durable=self.durable()) + snd.send(content) + msg = rcv.fetch(0) + assert msg.content == content + self.ssn.acknowledge(msg) + snd2 = self.ssn.receiver('test-rcv-queue; {delete: always}') + + def testDetachedReceiver(self): + self.conn.detach() + rcv = self.ssn.receiver("test-dis-rcv-queue; {create: always, delete: always}") + m = self.content("testDetachedReceiver") + self.conn.attach() + snd = self.ssn.sender("test-dis-rcv-queue") + snd.send(m) + self.drain(rcv, expected=[m]) + + def testNextReceiver(self): + ADDR = 'test-next-rcv-queue; {create: always, delete: always}' + rcv1 = self.ssn.receiver(ADDR, capacity=UNLIMITED) + rcv2 = self.ssn.receiver(ADDR, capacity=UNLIMITED) + rcv3 = self.ssn.receiver(ADDR, capacity=UNLIMITED) + + snd = self.ssn.sender(ADDR) + + msgs = [] + for i in range(10): + content = self.content("testNextReceiver", i) + snd.send(content) + msgs.append(content) + + fetched = [] + try: + while True: + rcv = self.ssn.next_receiver(timeout=self.delay()) + assert rcv in (rcv1, rcv2, rcv3) + assert rcv.available() > 0 + fetched.append(rcv.fetch().content) + except Empty: + pass + assert msgs == fetched, "expecting %s, got %s" % (msgs, fetched) + self.ssn.acknowledge() + #we set the capacity to 0 to prevent the deletion of the queue - + #triggered the deletion policy when the first receiver is closed - + #resulting in session exceptions being issued for the remaining + #active subscriptions: + for r in [rcv1, rcv2, rcv3]: + r.capacity = 0 + + # XXX, we need a convenient way to assert that required queues are + # empty on setup, and possibly also to drain queues on teardown + def ackTest(self, acker, ack_capacity=None): + # send a bunch of messages + snd = self.ssn.sender(ACK_QC, durable=self.durable()) + contents = [self.content("ackTest", i) for i in range(15)] + for c in contents: + snd.send(c) + + # drain the queue, verify the messages are there and then close + # without acking + rcv = self.ssn.receiver(ACK_QC) + self.drain(rcv, expected=contents) + self.ssn.close() + + # drain the queue again, verify that they are all the messages + # were requeued, and ack this time before closing + self.ssn = self.conn.session() + if ack_capacity is not None: + self.ssn.ack_capacity = ack_capacity + rcv = self.ssn.receiver(ACK_QC) + self.drain(rcv, expected=contents) + acker(self.ssn) + self.ssn.close() + + # drain the queue a final time and verify that the messages were + # dequeued + self.ssn = self.conn.session() + rcv = self.ssn.receiver(ACK_QD) + self.assertEmpty(rcv) + + def testAcknowledge(self): + self.ackTest(lambda ssn: ssn.acknowledge()) + + def testAcknowledgeAsync(self): + self.ackTest(lambda ssn: ssn.acknowledge(sync=False)) + + def testAcknowledgeAsyncAckCap0(self): + try: + try: + self.ackTest(lambda ssn: ssn.acknowledge(sync=False), 0) + assert False, "acknowledge shouldn't succeed with ack_capacity of zero" + except InsufficientCapacity: + pass + finally: + self.ssn.ack_capacity = UNLIMITED + self.drain(self.ssn.receiver(ACK_QD)) + self.ssn.acknowledge() + + def testAcknowledgeAsyncAckCap1(self): + self.ackTest(lambda ssn: ssn.acknowledge(sync=False), 1) + + def testAcknowledgeAsyncAckCap5(self): + self.ackTest(lambda ssn: ssn.acknowledge(sync=False), 5) + + def testAcknowledgeAsyncAckCapUNLIMITED(self): + self.ackTest(lambda ssn: ssn.acknowledge(sync=False), UNLIMITED) + + def testRelease(self): + msgs = [self.message("testRelease", i) for i in range(3)] + snd = self.ssn.sender("test-release-queue; {create: always, delete: always}") + for m in msgs: + snd.send(m) + rcv = self.ssn.receiver(snd.target) + echos = self.drain(rcv, expected=msgs) + self.ssn.acknowledge(echos[0]) + self.ssn.acknowledge(echos[1], Disposition(RELEASED, set_redelivered=True)) + self.ssn.acknowledge(echos[2], Disposition(RELEASED)) + self.drain(rcv, limit=1, expected=msgs[1:2], redelivered=True) + self.drain(rcv, expected=msgs[2:3]) + self.ssn.acknowledge() + + def testReject(self): + msgs = [self.message("testReject", i) for i in range(3)] + snd = self.ssn.sender(""" + test-reject-queue; { + create: always, + delete: always, + node: { + x-declare: { + alternate-exchange: 'amq.topic' + } + } + } +""") + for m in msgs: + snd.send(m) + rcv = self.ssn.receiver(snd.target) + rej = self.ssn.receiver("amq.topic") + echos = self.drain(rcv, expected=msgs) + self.ssn.acknowledge(echos[0]) + self.ssn.acknowledge(echos[1], Disposition(REJECTED)) + self.ssn.acknowledge(echos[2], + Disposition(REJECTED, code=0, text="test-reject")) + self.drain(rej, expected=msgs[1:]) + self.ssn.acknowledge() + + def send(self, ssn, target, base, count=1): + snd = ssn.sender(target, durable=self.durable()) + messages = [] + for i in range(count): + c = self.message(base, i) + snd.send(c) + messages.append(c) + snd.close() + return messages + + def txTest(self, commit): + TX_Q = 'test-tx-queue; {create: sender, delete: receiver}' + TX_Q_COPY = 'test-tx-queue-copy; {create: always, delete: always}' + txssn = self.conn.session(transactional=True) + messages = self.send(self.ssn, TX_Q, "txTest", 3) + txrcv = txssn.receiver(TX_Q) + txsnd = txssn.sender(TX_Q_COPY, durable=self.durable()) + rcv = self.ssn.receiver(txrcv.source) + copy_rcv = self.ssn.receiver(txsnd.target) + self.assertEmpty(copy_rcv) + for i in range(3): + m = txrcv.fetch(0) + txsnd.send(m) + self.assertEmpty(copy_rcv) + txssn.acknowledge() + if commit: + txssn.commit() + self.assertEmpty(rcv) + self.drain(copy_rcv, expected=messages) + else: + txssn.rollback() + self.drain(rcv, expected=messages, redelivered=True) + self.assertEmpty(copy_rcv) + self.ssn.acknowledge() + + def testCommit(self): + self.txTest(True) + + def testRollback(self): + self.txTest(False) + + def txTestSend(self, commit): + TX_SEND_Q = 'test-tx-send-queue; {create: sender, delete: receiver}' + txssn = self.conn.session(transactional=True) + messages = self.send(txssn, TX_SEND_Q, "txTestSend", 3) + rcv = self.ssn.receiver(TX_SEND_Q) + self.assertEmpty(rcv) + + if commit: + txssn.commit() + self.drain(rcv, expected=messages) + self.ssn.acknowledge() + else: + txssn.rollback() + self.assertEmpty(rcv) + txssn.commit() + self.assertEmpty(rcv) + + def testCommitSend(self): + self.txTestSend(True) + + def testRollbackSend(self): + self.txTestSend(False) + + def txTestAck(self, commit): + TX_ACK_QC = 'test-tx-ack-queue; {create: always}' + TX_ACK_QD = 'test-tx-ack-queue; {delete: always}' + txssn = self.conn.session(transactional=True) + txrcv = txssn.receiver(TX_ACK_QC) + self.assertEmpty(txrcv) + messages = self.send(self.ssn, TX_ACK_QC, "txTestAck", 3) + self.drain(txrcv, expected=messages) + + if commit: + txssn.acknowledge() + else: + txssn.rollback() + self.drain(txrcv, expected=messages, redelivered=True) + txssn.acknowledge() + txssn.rollback() + self.drain(txrcv, expected=messages, redelivered=True) + txssn.commit() # commit without ack + self.assertEmpty(txrcv) + + txssn.close() + + txssn = self.conn.session(transactional=True) + txrcv = txssn.receiver(TX_ACK_QC) + self.drain(txrcv, expected=messages, redelivered=True) + txssn.acknowledge() + txssn.commit() + rcv = self.ssn.receiver(TX_ACK_QD) + self.assertEmpty(rcv) + txssn.close() + self.assertEmpty(rcv) + + def testCommitAck(self): + self.txTestAck(True) + + def testRollbackAck(self): + self.txTestAck(False) + + def testDoubleCommit(self): + ssn = self.conn.session(transactional=True) + snd = ssn.sender("amq.direct/doubleCommit") + rcv = ssn.receiver("amq.direct/doubleCommit") + msgs = [self.message("testDoubleCommit", i, subject="doubleCommit") for i in range(3)] + for m in msgs: + snd.send(m) + ssn.commit() + self.drain(rcv, expected=msgs) + ssn.acknowledge() + ssn.commit() + + def testClose(self): + self.ssn.close() + try: + self.ping(self.ssn) + assert False, "ping succeeded" + except Detached: + pass + + def testRxCallback(self): + """Verify that the callback is invoked when a message is received. + """ + ADDR = 'test-rx_callback-queue; {create: always, delete: receiver}' + class CallbackHandler: + def __init__(self): + self.handler_called = False + def __call__(self): + self.handler_called = True + cb = CallbackHandler() + self.ssn.set_message_received_handler(cb) + rcv = self.ssn.receiver(ADDR) + rcv.capacity = UNLIMITED + snd = self.ssn.sender(ADDR) + assert not cb.handler_called + snd.send("Ping") + deadline = time.time() + self.timeout() + while time.time() < deadline: + if cb.handler_called: + break; + assert cb.handler_called + snd.close() + rcv.close() + + +RECEIVER_Q = 'test-receiver-queue; {create: always, delete: always}' + +class ReceiverTests(Base): + + def setup_connection(self): + return Connection.establish(self.broker, **self.connection_options()) + + def setup_session(self): + return self.conn.session() + + def setup_sender(self): + return self.ssn.sender(RECEIVER_Q) + + def setup_receiver(self): + return self.ssn.receiver(RECEIVER_Q) + + def send(self, base, count = None, sync=True): + content = self.content(base, count) + self.snd.send(content, sync=sync) + return content + + def testFetch(self): + try: + msg = self.rcv.fetch(0) + assert False, "unexpected message: %s" % msg + except Empty: + pass + try: + start = time.time() + msg = self.rcv.fetch(self.delay()) + assert False, "unexpected message: %s" % msg + except Empty: + elapsed = time.time() - start + assert elapsed >= self.delay() + + one = self.send("testFetch", 1) + two = self.send("testFetch", 2) + three = self.send("testFetch", 3) + msg = self.rcv.fetch(0) + assert msg.content == one + msg = self.rcv.fetch(self.delay()) + assert msg.content == two + msg = self.rcv.fetch() + assert msg.content == three + self.ssn.acknowledge() + + def fetchFromClosedTest(self, entry): + entry.close() + try: + msg = self.rcv.fetch(0) + assert False, "unexpected result: %s" % msg + except Empty, e: + assert False, "unexpected exception: %s" % e + except LinkClosed, e: + pass + + def testFetchFromClosedReceiver(self): + self.fetchFromClosedTest(self.rcv) + + def testFetchFromClosedSession(self): + self.fetchFromClosedTest(self.ssn) + + def testFetchFromClosedConnection(self): + self.fetchFromClosedTest(self.conn) + + def fetchFromConcurrentCloseTest(self, entry): + def closer(): + self.sleep() + entry.close() + t = Thread(target=closer) + t.start() + try: + msg = self.rcv.fetch() + assert False, "unexpected result: %s" % msg + except Empty, e: + assert False, "unexpected exception: %s" % e + except LinkClosed, e: + pass + t.join() + + def testFetchFromConcurrentCloseReceiver(self): + self.fetchFromConcurrentCloseTest(self.rcv) + + def testFetchFromConcurrentCloseSession(self): + self.fetchFromConcurrentCloseTest(self.ssn) + + def testFetchFromConcurrentCloseConnection(self): + self.fetchFromConcurrentCloseTest(self.conn) + + def testCapacityIncrease(self): + content = self.send("testCapacityIncrease") + self.sleep() + assert self.rcv.available() == 0 + self.rcv.capacity = UNLIMITED + self.sleep() + assert self.rcv.available() == 1 + msg = self.rcv.fetch(0) + assert msg.content == content + assert self.rcv.available() == 0 + self.ssn.acknowledge() + + def testCapacityDecrease(self): + self.rcv.capacity = UNLIMITED + one = self.send("testCapacityDecrease", 1) + self.sleep() + assert self.rcv.available() == 1 + msg = self.rcv.fetch(0) + assert msg.content == one + + self.rcv.capacity = 0 + + two = self.send("testCapacityDecrease", 2) + self.sleep() + assert self.rcv.available() == 0 + msg = self.rcv.fetch(0) + assert msg.content == two + + self.ssn.acknowledge() + + def capacityTest(self, capacity, threshold=None): + if threshold is not None: + self.rcv.threshold = threshold + self.rcv.capacity = capacity + self.assertAvailable(self.rcv, 0) + + for i in range(2*capacity): + self.send("capacityTest(%s, %s)" % (capacity, threshold), i, sync=False) + self.snd.sync() + self.sleep() + self.assertAvailable(self.rcv) + + first = capacity/2 + second = capacity - first + self.drain(self.rcv, limit = first) + self.sleep() + self.assertAvailable(self.rcv) + self.drain(self.rcv, limit = second) + self.sleep() + self.assertAvailable(self.rcv) + + drained = self.drain(self.rcv) + assert len(drained) == capacity, "%s, %s" % (len(drained), drained) + self.assertAvailable(self.rcv, 0) + + self.ssn.acknowledge() + + def testCapacity5(self): + self.capacityTest(5) + + def testCapacity5Threshold1(self): + self.capacityTest(5, 1) + + def testCapacity10(self): + self.capacityTest(10) + + def testCapacity10Threshold1(self): + self.capacityTest(10, 1) + + def testCapacity100(self): + self.capacityTest(100) + + def testCapacity100Threshold1(self): + self.capacityTest(100, 1) + + def testCapacityUNLIMITED(self): + self.rcv.capacity = UNLIMITED + self.assertAvailable(self.rcv, 0) + + for i in range(10): + self.send("testCapacityUNLIMITED", i) + self.sleep() + self.assertAvailable(self.rcv, 10) + + self.drain(self.rcv) + self.assertAvailable(self.rcv, 0) + + self.ssn.acknowledge() + + def testAvailable(self): + self.rcv.capacity = UNLIMITED + assert self.rcv.available() == 0 + + for i in range(3): + self.send("testAvailable", i) + self.sleep() + assert self.rcv.available() == 3 + + for i in range(3, 10): + self.send("testAvailable", i) + self.sleep() + assert self.rcv.available() == 10 + + self.drain(self.rcv, limit=3) + assert self.rcv.available() == 7 + + self.drain(self.rcv) + assert self.rcv.available() == 0 + + self.ssn.acknowledge() + + def testDoubleClose(self): + m1 = self.content("testDoubleClose", 1) + m2 = self.content("testDoubleClose", 2) + + snd = self.ssn.sender("""test-double-close; { + create: always, + delete: sender, + node: { + type: topic + } +} +""") + r1 = self.ssn.receiver(snd.target) + r2 = self.ssn.receiver(snd.target) + snd.send(m1) + self.drain(r1, expected=[m1]) + self.drain(r2, expected=[m1]) + r1.close() + snd.send(m2) + self.drain(r2, expected=[m2]) + r2.close() + + # XXX: need testClose + + def testMode(self): + msgs = [self.content("testMode", 1), + self.content("testMode", 2), + self.content("testMode", 3)] + + for m in msgs: + self.snd.send(m) + + rb = self.ssn.receiver('test-receiver-queue; {mode: browse}') + rc = self.ssn.receiver('test-receiver-queue; {mode: consume}') + self.drain(rb, expected=msgs) + self.drain(rc, expected=msgs) + rb2 = self.ssn.receiver(rb.source) + self.assertEmpty(rb2) + self.drain(self.rcv, expected=[]) + + def testUnsettled(self): + # just tests the code path and not the value + rcv = self.ssn.receiver('test-receiver-unsettled-queue; {create: always, delete: always}') + rcv.unsettled() + + def unreliabilityTest(self, mode="unreliable"): + msgs = [self.message("testUnreliable", i) for i in range(3)] + snd = self.ssn.sender("test-unreliability-queue; {create: sender, delete: receiver}") + rcv = self.ssn.receiver(snd.target) + for m in msgs: + snd.send(m) + + # close without ack on reliable receiver, messages should be requeued + ssn = self.conn.session() + rrcv = ssn.receiver("test-unreliability-queue") + self.drain(rrcv, expected=msgs) + ssn.close() + + # close without ack on unreliable receiver, messages should not be requeued + ssn = self.conn.session() + urcv = ssn.receiver("test-unreliability-queue; {link: {reliability: %s}}" % mode) + self.drain(urcv, expected=msgs, redelivered=True) + ssn.close() + + self.assertEmpty(rcv) + + def testUnreliable(self): + self.unreliabilityTest(mode="unreliable") + + def testAtMostOnce(self): + self.unreliabilityTest(mode="at-most-once") + +class AddressTests(Base): + + def setup_connection(self): + return Connection.establish(self.broker, **self.connection_options()) + + def setup_session(self): + return self.conn.session() + + def badOption(self, options, error): + try: + self.ssn.sender("test-bad-options-snd; %s" % options) + assert False + except InvalidOption, e: + assert "error in options: %s" % error == str(e), e + + try: + self.ssn.receiver("test-bad-options-rcv; %s" % options) + assert False + except InvalidOption, e: + assert "error in options: %s" % error == str(e), e + + def testIllegalKey(self): + self.badOption("{create: always, node: " + "{this-property-does-not-exist: 3}}", + "node: this-property-does-not-exist: " + "illegal key") + + def testWrongValue(self): + self.badOption("{create: asdf}", "create: asdf not in " + "('always', 'sender', 'receiver', 'never')") + + def testWrongType1(self): + self.badOption("{node: asdf}", + "node: asdf is not a map") + + def testWrongType2(self): + self.badOption("{node: {durable: []}}", + "node: durable: [] is not a bool") + + def testCreateQueue(self): + snd = self.ssn.sender("test-create-queue; {create: always, delete: always, " + "node: {type: queue, durable: False, " + "x-declare: {auto_delete: true}}}") + content = self.content("testCreateQueue") + snd.send(content) + rcv = self.ssn.receiver("test-create-queue") + self.drain(rcv, expected=[content]) + + def createExchangeTest(self, props=""): + addr = """test-create-exchange; { + create: always, + delete: always, + node: { + type: topic, + durable: False, + x-declare: {auto_delete: true, %s} + } + }""" % props + snd = self.ssn.sender(addr) + snd.send("ping") + rcv1 = self.ssn.receiver("test-create-exchange/first") + rcv2 = self.ssn.receiver("test-create-exchange/first") + rcv3 = self.ssn.receiver("test-create-exchange/second") + for r in (rcv1, rcv2, rcv3): + try: + r.fetch(0) + assert False + except Empty: + pass + msg1 = Message(self.content("testCreateExchange", 1), subject="first") + msg2 = Message(self.content("testCreateExchange", 2), subject="second") + snd.send(msg1) + snd.send(msg2) + self.drain(rcv1, expected=[msg1.content]) + self.drain(rcv2, expected=[msg1.content]) + self.drain(rcv3, expected=[msg2.content]) + + def testCreateExchange(self): + self.createExchangeTest() + + def testCreateExchangeDirect(self): + self.createExchangeTest("type: direct") + + def testCreateExchangeTopic(self): + self.createExchangeTest("type: topic") + + def testDeleteBySender(self): + snd = self.ssn.sender("test-delete; {create: always}") + snd.send("ping") + snd.close() + snd = self.ssn.sender("test-delete; {delete: always}") + snd.send("ping") + snd.close() + try: + self.ssn.sender("test-delete") + except NotFound, e: + assert "no such queue" in str(e) + + def testDeleteByReceiver(self): + rcv = self.ssn.receiver("test-delete; {create: always, delete: always}") + try: + rcv.fetch(0) + except Empty: + pass + rcv.close() + + try: + self.ssn.receiver("test-delete") + assert False + except NotFound, e: + assert "no such queue" in str(e) + + def testDeleteSpecial(self): + snd = self.ssn.sender("amq.topic; {delete: always}") + snd.send("asdf") + try: + snd.close() + assert False, "successfully deleted amq.topic" + except SessionError, e: + assert e.code == 530 + # XXX: need to figure out close after error + self.conn._remove_session(self.ssn) + + def testNodeBindingsQueue(self): + snd = self.ssn.sender(""" +test-node-bindings-queue; { + create: always, + delete: always, + node: { + x-bindings: [{exchange: "amq.topic", key: "a.#"}, + {exchange: "amq.direct", key: "b"}, + {exchange: "amq.topic", key: "c.*"}] + } +} +""") + snd.send("one") + snd_a = self.ssn.sender("amq.topic/a.foo") + snd_b = self.ssn.sender("amq.direct/b") + snd_c = self.ssn.sender("amq.topic/c.bar") + snd_a.send("two") + snd_b.send("three") + snd_c.send("four") + rcv = self.ssn.receiver("test-node-bindings-queue") + self.drain(rcv, expected=["one", "two", "three", "four"]) + + def testNodeBindingsTopic(self): + rcv = self.ssn.receiver("test-node-bindings-topic-queue; {create: always, delete: always}") + rcv_a = self.ssn.receiver("test-node-bindings-topic-queue-a; {create: always, delete: always}") + rcv_b = self.ssn.receiver("test-node-bindings-topic-queue-b; {create: always, delete: always}") + rcv_c = self.ssn.receiver("test-node-bindings-topic-queue-c; {create: always, delete: always}") + snd = self.ssn.sender(""" +test-node-bindings-topic; { + create: always, + delete: always, + node: { + type: topic, + x-bindings: [{queue: test-node-bindings-topic-queue, key: "#"}, + {queue: test-node-bindings-topic-queue-a, key: "a.#"}, + {queue: test-node-bindings-topic-queue-b, key: "b"}, + {queue: test-node-bindings-topic-queue-c, key: "c.*"}] + } +} +""") + m1 = Message("one") + m2 = Message(subject="a.foo", content="two") + m3 = Message(subject="b", content="three") + m4 = Message(subject="c.bar", content="four") + snd.send(m1) + snd.send(m2) + snd.send(m3) + snd.send(m4) + self.drain(rcv, expected=[m1, m2, m3, m4]) + self.drain(rcv_a, expected=[m2]) + self.drain(rcv_b, expected=[m3]) + self.drain(rcv_c, expected=[m4]) + + def testLinkBindings(self): + m_a = self.message("testLinkBindings", 1, subject="a") + m_b = self.message("testLinkBindings", 2, subject="b") + + self.ssn.sender("test-link-bindings-queue; {create: always, delete: always}") + snd = self.ssn.sender("amq.topic") + + snd.send(m_a) + snd.send(m_b) + snd.close() + + rcv = self.ssn.receiver("test-link-bindings-queue") + self.assertEmpty(rcv) + + snd = self.ssn.sender(""" +amq.topic; { + link: { + x-bindings: [{queue: test-link-bindings-queue, key: a}] + } +} +""") + + snd.send(m_a) + snd.send(m_b) + + self.drain(rcv, expected=[m_a]) + rcv.close() + + rcv = self.ssn.receiver(""" +test-link-bindings-queue; { + link: { + x-bindings: [{exchange: "amq.topic", key: b}] + } +} +""") + + snd.send(m_a) + snd.send(m_b) + + self.drain(rcv, expected=[m_a, m_b]) + + def testSubjectOverride(self): + snd = self.ssn.sender("amq.topic/a") + rcv_a = self.ssn.receiver("amq.topic/a") + rcv_b = self.ssn.receiver("amq.topic/b") + m1 = self.content("testSubjectOverride", 1) + m2 = self.content("testSubjectOverride", 2) + snd.send(m1) + snd.send(Message(subject="b", content=m2)) + self.drain(rcv_a, expected=[m1]) + self.drain(rcv_b, expected=[m2]) + + def testSubjectDefault(self): + m1 = self.content("testSubjectDefault", 1) + m2 = self.content("testSubjectDefault", 2) + snd = self.ssn.sender("amq.topic/a") + rcv = self.ssn.receiver("amq.topic") + snd.send(m1) + snd.send(Message(subject="b", content=m2)) + e1 = rcv.fetch(timeout=0) + e2 = rcv.fetch(timeout=0) + assert e1.subject == "a", "subject: %s" % e1.subject + assert e2.subject == "b", "subject: %s" % e2.subject + self.assertEmpty(rcv) + + def doReliabilityTest(self, reliability, messages, expected): + snd = self.ssn.sender("amq.topic") + rcv = self.ssn.receiver("amq.topic; {link: {reliability: %s}}" % reliability) + for m in messages: + snd.send(m) + self.conn.detach() + self.conn.attach() + self.drain(rcv, expected=expected) + + def testReliabilityUnreliable(self): + msgs = [self.message("testReliabilityUnreliable", i) for i in range(3)] + self.doReliabilityTest("unreliable", msgs, []) + + def testReliabilityAtLeastOnce(self): + msgs = [self.message("testReliabilityAtLeastOnce", i) for i in range(3)] + self.doReliabilityTest("at-least-once", msgs, msgs) + + def testLinkName(self): + msgs = [self.message("testLinkName", i) for i in range(3)] + snd = self.ssn.sender("amq.topic") + trcv = self.ssn.receiver("amq.topic; {link: {name: test-link-name}}") + qrcv = self.ssn.receiver("test-link-name") + for m in msgs: + snd.send(m) + self.drain(qrcv, expected=msgs) + + def testAssert1(self): + try: + snd = self.ssn.sender("amq.topic; {assert: always, node: {type: queue}}") + assert 0, "assertion failed to trigger" + except AssertionFailed, e: + pass + except NotFound, e: # queue named amp.topic not found + pass + + def testAssert2(self): + snd = self.ssn.sender("amq.topic; {assert: always}") + +NOSUCH_Q = "this-queue-should-not-exist" +UNPARSEABLE_ADDR = "name/subject; {bad options" +UNLEXABLE_ADDR = "\0x0\0x1\0x2\0x3" + +class AddressErrorTests(Base): + + def setup_connection(self): + return Connection.establish(self.broker, **self.connection_options()) + + def setup_session(self): + return self.conn.session() + + def senderErrorTest(self, addr, exc, check=lambda e: True): + try: + self.ssn.sender(addr, durable=self.durable()) + assert False, "sender creation succeeded" + except exc, e: + assert check(e), "unexpected error: %s" % compat.format_exc(e) + + def receiverErrorTest(self, addr, exc, check=lambda e: True): + try: + self.ssn.receiver(addr) + assert False, "receiver creation succeeded" + except exc, e: + assert check(e), "unexpected error: %s" % compat.format_exc(e) + + def testNoneTarget(self): + self.senderErrorTest(None, MalformedAddress) + + def testNoneSource(self): + self.receiverErrorTest(None, MalformedAddress) + + def testNoTarget(self): + self.senderErrorTest(NOSUCH_Q, NotFound, lambda e: NOSUCH_Q in str(e)) + + def testNoSource(self): + self.receiverErrorTest(NOSUCH_Q, NotFound, lambda e: NOSUCH_Q in str(e)) + + def testUnparseableTarget(self): + self.senderErrorTest(UNPARSEABLE_ADDR, MalformedAddress, + lambda e: "expecting COLON" in str(e)) + + def testUnparseableSource(self): + self.receiverErrorTest(UNPARSEABLE_ADDR, MalformedAddress, + lambda e: "expecting COLON" in str(e)) + + def testUnlexableTarget(self): + self.senderErrorTest(UNLEXABLE_ADDR, MalformedAddress, + lambda e: "unrecognized characters" in str(e)) + + def testUnlexableSource(self): + self.receiverErrorTest(UNLEXABLE_ADDR, MalformedAddress, + lambda e: "unrecognized characters" in str(e)) + + def testInvalidMode(self): + self.receiverErrorTest('name; {mode: "this-is-a-bad-receiver-mode"}', + InvalidOption, + lambda e: "not in ('browse', 'consume')" in str(e)) + +SENDER_Q = 'test-sender-q; {create: always, delete: always}' + +class SenderTests(Base): + + def setup_connection(self): + return Connection.establish(self.broker, **self.connection_options()) + + def setup_session(self): + return self.conn.session() + + def setup_sender(self): + return self.ssn.sender(SENDER_Q) + + def setup_receiver(self): + return self.ssn.receiver(SENDER_Q) + + def checkContent(self, content): + self.snd.send(content) + msg = self.rcv.fetch(0) + assert msg.content == content + + out = Message(content) + self.snd.send(out) + echo = self.rcv.fetch(0) + assert out.content == echo.content + assert echo.content == msg.content + self.ssn.acknowledge() + + def testSendString(self): + self.checkContent(self.content("testSendString")) + + def testSendList(self): + self.checkContent(["testSendList", 1, 3.14, self.test_id]) + + def testSendMap(self): + self.checkContent({"testSendMap": self.test_id, "pie": "blueberry", "pi": 3.14}) + + def asyncTest(self, capacity): + self.snd.capacity = capacity + msgs = [self.content("asyncTest", i) for i in range(15)] + for m in msgs: + self.snd.send(m, sync=False) + self.drain(self.rcv, timeout=self.delay(), expected=msgs) + self.ssn.acknowledge() + + def testSendAsyncCapacity0(self): + try: + self.asyncTest(0) + assert False, "send shouldn't succeed with zero capacity" + except InsufficientCapacity: + # this is expected + pass + + def testSendAsyncCapacity1(self): + self.asyncTest(1) + + def testSendAsyncCapacity5(self): + self.asyncTest(5) + + def testSendAsyncCapacityUNLIMITED(self): + self.asyncTest(UNLIMITED) + + def testCapacityTimeout(self): + self.snd.capacity = 1 + msgs = [] + caught = False + while len(msgs) < 100: + m = self.content("testCapacity", len(msgs)) + try: + self.snd.send(m, sync=False, timeout=0) + msgs.append(m) + except InsufficientCapacity: + caught = True + break + self.snd.sync() + self.drain(self.rcv, expected=msgs) + self.ssn.acknowledge() + assert caught, "did not exceed capacity" + + def testEINTR(self): + m1 = self.content("testEINTR", 0) + m2 = self.content("testEINTR", 1) + + self.snd.send(m1, timeout=self.timeout()) + try: + os.setuid(500) + assert False, "setuid should fail" + except: + pass + self.snd.send(m2, timeout=self.timeout()) diff --git a/qpid/python/qpid/tests/messaging/implementation.py b/qpid/python/qpid/tests/messaging/implementation.py new file mode 100644 index 0000000000..fce60c6f38 --- /dev/null +++ b/qpid/python/qpid/tests/messaging/implementation.py @@ -0,0 +1,28 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import os +if 'QPID_USE_SWIG_CLIENT' in os.environ and os.environ['QPID_USE_SWIG_CLIENT']: + try: + from qpid_messaging import * + from qpid.datatypes import uuid4 + except ImportError, e: + print "Swigged client not found. Falling back to pure bindings, %s\n" % e + from qpid.messaging import * +else: + from qpid.messaging import * diff --git a/qpid/python/qpid/tests/messaging/message.py b/qpid/python/qpid/tests/messaging/message.py new file mode 100644 index 0000000000..bfdd2c79e5 --- /dev/null +++ b/qpid/python/qpid/tests/messaging/message.py @@ -0,0 +1,187 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from qpid.tests.messaging.implementation import * +from qpid.messaging.address import parse +from qpid.tests.messaging import Base + +class MessageTests(Base): + + def testCreateString(self): + m = Message("string") + assert m.content == "string" + assert m.content_type is None + + def testCreateUnicode(self): + m = Message(u"unicode") + assert m.content == u"unicode" + assert m.content_type == "text/plain" + + def testCreateMap(self): + m = Message({}) + assert m.content == {} + assert m.content_type == "amqp/map" + + def testCreateList(self): + m = Message([]) + assert m.content == [] + assert m.content_type == "amqp/list" + + def testContentTypeOverride(self): + m = Message() + m.content_type = "text/html; charset=utf8" + m.content = u"<html/>" + assert m.content_type == "text/html; charset=utf8" + +ECHO_Q = 'test-message-echo-queue; {create: always, delete: always}' + +class MessageEchoTests(Base): + + def setup_connection(self): + return Connection.establish(self.broker, **self.connection_options()) + + def setup_session(self): + return self.conn.session() + + def setup_sender(self): + return self.ssn.sender(ECHO_Q) + + def setup_receiver(self): + return self.ssn.receiver(ECHO_Q) + + def check(self, msg): + self.snd.send(msg) + echo = self.rcv.fetch(0) + self.assertEcho(msg, echo) + self.ssn.acknowledge(echo) + + def testStringContent(self): + self.check(Message("string")) + + def testUnicodeContent(self): + self.check(Message(u"unicode")) + + + TEST_MAP = {"key1": "string", + "key2": u"unicode", + "key3": 3, + "key4": -3, + "key5": 3.14, + "key6": -3.14, + "key7": ["one", 2, 3.14], + "key8": [], + "key9": {"sub-key0": 3}, + "key10": True, + "key11": False, + "x-amqp-0-10.app-id": "test-app-id", + "x-amqp-0-10.content-encoding": "test-content-encoding"} + + def testMapContent(self): + self.check(Message(MessageEchoTests.TEST_MAP)) + + def testListContent(self): + self.check(Message([])) + self.check(Message([1, 2, 3])) + self.check(Message(["one", 2, 3.14, {"four": 4}])) + + def testProperties(self): + msg = Message() + msg.subject = "subject" + msg.correlation_id = str(self.test_id) + msg.durable = True + msg.priority = 7 + msg.ttl = 60 + msg.properties = MessageEchoTests.TEST_MAP + msg.reply_to = "reply-address" + self.check(msg) + + def testApplicationProperties(self): + msg = Message() + msg.properties["a"] = u"A" + msg.properties["b"] = 1 + msg.properties["c"] = ["x", 2] + msg.properties["d"] = "D" + #make sure deleting works as expected + msg.properties["foo"] = "bar" + del msg.properties["foo"] + self.check(msg) + + def testContentTypeUnknown(self): + msg = Message(content_type = "this-content-type-does-not-exist") + self.check(msg) + + def testTextPlain(self): + self.check(Message(content_type="text/plain", content="asdf")) + + def testTextPlainEmpty(self): + self.check(Message(content_type="text/plain")) + + def check_rt(self, addr, expected=None): + if expected is None: + expected = addr + msg = Message(reply_to=addr) + self.snd.send(msg) + echo = self.rcv.fetch(0) + #reparse addresses and check individual parts as this avoids + #failing due to differenecs in whitespace when running over + #swigged client: + (actual_name, actual_subject, actual_options) = parse(echo.reply_to) + (expected_name, expected_subject, expected_options) = parse(expected) + assert actual_name == expected_name, (actual_name, expected_name) + assert actual_subject == expected_subject, (actual_subject, expected_subject) + assert actual_options == expected_options, (actual_options, expected_options) + self.ssn.acknowledge(echo) + + def testReplyTo(self): + self.check_rt("name") + + def testReplyToQueue(self): + self.check_rt("name; {node: {type: queue}}", "name") + + def testReplyToQueueSubject(self): + self.check_rt("name/subject; {node: {type: queue}}", "name") + + def testReplyToTopic(self): + self.check_rt("name; {node: {type: topic}}") + + def testReplyToTopicSubject(self): + self.check_rt("name/subject; {node: {type: topic}}") + + def testBooleanEncoding(self): + msg = Message({"true": True, "false": False}) + self.snd.send(msg) + echo = self.rcv.fetch(0) + self.assertEcho(msg, echo) + t = echo.content["true"] + f = echo.content["false"] + assert isinstance(t, bool), t + assert isinstance(f, bool), f + + def testExceptionRaisedMismatchedContentType(self): + msg = Message(content_type="amqp/map", content="asdf") + try: + self.snd.send(msg) + self.rcv.fetch(0) + assert False, "Exception not raised on mismatched content/content_type" + except Exception, e: + pass + + def testRecoverAfterException(self): + self.testExceptionRaisedMismatchedContentType() + self.testTextPlain() diff --git a/qpid/python/qpid/tests/mimetype.py b/qpid/python/qpid/tests/mimetype.py new file mode 100644 index 0000000000..22760316f0 --- /dev/null +++ b/qpid/python/qpid/tests/mimetype.py @@ -0,0 +1,56 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from qpid.tests import Test +from qpid.mimetype import lex, parse, ParseError, EOF, WSPACE +from parser import ParserBase + +class MimeTypeTests(ParserBase, Test): + + EXCLUDE = (WSPACE, EOF) + + def do_lex(self, st): + return lex(st) + + def do_parse(self, st): + return parse(st) + + def valid(self, addr, type=None, subtype=None, parameters=None): + ParserBase.valid(self, addr, (type, subtype, parameters)) + + def testTypeOnly(self): + self.invalid("type", "expecting SLASH, got EOF line:1,4:type") + + def testTypeSubtype(self): + self.valid("type/subtype", "type", "subtype", []) + + def testTypeSubtypeParam(self): + self.valid("type/subtype ; name=value", + "type", "subtype", [("name", "value")]) + + def testTypeSubtypeParamComment(self): + self.valid("type/subtype ; name(This is a comment.)=value", + "type", "subtype", [("name", "value")]) + + def testMultipleParams(self): + self.valid("type/subtype ; name1=value1 ; name2=value2", + "type", "subtype", [("name1", "value1"), ("name2", "value2")]) + + def testCaseInsensitivity(self): + self.valid("Type/Subtype", "type", "subtype", []) diff --git a/qpid/python/qpid/tests/parser.py b/qpid/python/qpid/tests/parser.py new file mode 100644 index 0000000000..a4865cc9fe --- /dev/null +++ b/qpid/python/qpid/tests/parser.py @@ -0,0 +1,37 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from qpid.parser import ParseError + +class ParserBase: + + def lex(self, addr, *types): + toks = [t.type for t in self.do_lex(addr) if t.type not in self.EXCLUDE] + assert list(types) == toks, "expected %s, got %s" % (types, toks) + + def valid(self, addr, expected): + got = self.do_parse(addr) + assert expected == got, "expected %s, got %s" % (expected, got) + + def invalid(self, addr, error=None): + try: + p = self.do_parse(addr) + assert False, "invalid address parsed: %s" % p + except ParseError, e: + assert error == str(e), "expected %r, got %r" % (error, str(e)) diff --git a/qpid/python/qpid/tests/queue.py b/qpid/python/qpid/tests/queue.py new file mode 100644 index 0000000000..e12354eb43 --- /dev/null +++ b/qpid/python/qpid/tests/queue.py @@ -0,0 +1,71 @@ +# Do not delete - marks this directory as a python package. + +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import threading, time +from unittest import TestCase +from qpid.queue import Queue, Empty, Closed + + +class QueueTest (TestCase): + + # The qpid queue class just provides sime simple extensions to + # python's standard queue data structure, so we don't need to test + # all the queue functionality. + + def test_listen(self): + values = [] + heard = threading.Event() + def listener(x): + values.append(x) + heard.set() + + q = Queue(0) + q.listen(listener) + heard.clear() + q.put(1) + heard.wait() + assert values[-1] == 1 + heard.clear() + q.put(2) + heard.wait() + assert values[-1] == 2 + + q.listen(None) + q.put(3) + assert q.get(3) == 3 + q.listen(listener) + + heard.clear() + q.put(4) + heard.wait() + assert values[-1] == 4 + + def test_close(self): + q = Queue(0) + q.put(1); q.put(2); q.put(3); q.close() + assert q.get() == 1 + assert q.get() == 2 + assert q.get() == 3 + for i in range(10): + try: + q.get() + raise AssertionError("expected Closed") + except Closed: + pass diff --git a/qpid/python/qpid/tests/saslmech/__init__.py b/qpid/python/qpid/tests/saslmech/__init__.py new file mode 100644 index 0000000000..d8a500d9d8 --- /dev/null +++ b/qpid/python/qpid/tests/saslmech/__init__.py @@ -0,0 +1,19 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + diff --git a/qpid/python/qpid/tests/saslmech/finder.py b/qpid/python/qpid/tests/saslmech/finder.py new file mode 100644 index 0000000000..3ad5e727ba --- /dev/null +++ b/qpid/python/qpid/tests/saslmech/finder.py @@ -0,0 +1,71 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from unittest import TestCase +from qpid.saslmech.finder import get_sasl_mechanism +from my_sasl import MY_SASL +from my_sasl2 import MY_SASL2 + +class SaslFinderTests (TestCase): + """Tests the ability to chose the a sasl mechanism from those available to be loaded""" + + def test_known_mechansim(self): + + supportedMechs = ["MY-SASL"] + + mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech") + + self.assertTrue(isinstance(mech, MY_SASL), "Mechanism %s is of unexpected type" % mech) + self.assertEquals("MY-SASL", mech.mechanismName()) + self.assertTrue(mech.sasl_options is None) + + def test_unknown_mechansim(self): + + supportedMechs = ["not_a_mech"] + + mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech") + + self.assertTrue(mech == None, "Mechanism instance should be none") + + def test_sasl_mechanism_with_higher_priority_prefered(self): + + supportedMechs = ["MY-SASL", "MY-SASL2"] + + mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech") + + self.assertTrue(isinstance(mech, MY_SASL), "Mechanism %s is of unexpected type" % mech) + + def test_sasl_mechanism_fallback_without_credentials(self): + + # MY-SASL requires username/password, MY-SASL2 does not + supportedMechs = ["MY-SASL", "MY-SASL2"] + + mech = get_sasl_mechanism(supportedMechs, None, None, namespace="qpid.tests.saslmech") + + self.assertTrue(isinstance(mech, MY_SASL2), "Mechanism %s is of unexpected type" % mech) + + def test_sasl_mechansim_options(self): + + supportedMechs = ["MY-SASL"] + + sasl_options = {'hello': 'world'} + mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech", sasl_options=sasl_options) + + self.assertTrue(isinstance(mech, MY_SASL), "Mechanism %s is of unexpected type" % mech) + self.assertEquals(sasl_options, mech.sasl_options) diff --git a/qpid/python/qpid/tests/saslmech/my_sasl.py b/qpid/python/qpid/tests/saslmech/my_sasl.py new file mode 100644 index 0000000000..c15fe4451c --- /dev/null +++ b/qpid/python/qpid/tests/saslmech/my_sasl.py @@ -0,0 +1,22 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from qpid.saslmech.sasl import Sasl + +class MY_SASL(Sasl): pass diff --git a/qpid/python/qpid/tests/saslmech/my_sasl2.py b/qpid/python/qpid/tests/saslmech/my_sasl2.py new file mode 100644 index 0000000000..e0b3dfa56f --- /dev/null +++ b/qpid/python/qpid/tests/saslmech/my_sasl2.py @@ -0,0 +1,28 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +from qpid.saslmech.sasl import Sasl + +class MY_SASL2(Sasl): + + def priority(self): + return 0 + + def prerequisitesOk(self): + return True diff --git a/qpid/python/qpid/tests/spec010.py b/qpid/python/qpid/tests/spec010.py new file mode 100644 index 0000000000..ac04e1ee02 --- /dev/null +++ b/qpid/python/qpid/tests/spec010.py @@ -0,0 +1,74 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import os, tempfile, shutil, stat +from unittest import TestCase +from qpid.codec010 import Codec, StringCodec +from qpid.ops import * + +class SpecTest(TestCase): + + def testSessionHeader(self): + sc = StringCodec() + sc.write_compound(Header(sync=True)) + assert sc.encoded == "\x01\x01" + + sc = StringCodec() + sc.write_compound(Header(sync=False)) + assert sc.encoded == "\x01\x00" + + def encdec(self, value): + sc = StringCodec() + sc.write_compound(value) + decoded = sc.read_compound(value.__class__) + return decoded + + def testMessageProperties(self): + props = MessageProperties(content_length=3735928559L, + reply_to=ReplyTo(exchange="the exchange name", + routing_key="the routing key")) + dec = self.encdec(props) + assert props.content_length == dec.content_length + assert props.reply_to.exchange == dec.reply_to.exchange + assert props.reply_to.routing_key == dec.reply_to.routing_key + + def testMessageSubscribe(self): + cmd = MessageSubscribe(exclusive=True, destination="this is a test") + dec = self.encdec(cmd) + assert cmd.exclusive == dec.exclusive + assert cmd.destination == dec.destination + + def testXid(self): + sc = StringCodec() + xid = Xid(format=0, global_id="gid", branch_id="bid") + sc.write_compound(xid) + assert sc.encoded == '\x00\x00\x00\x10\x06\x04\x07\x00\x00\x00\x00\x00\x03gid\x03bid' + dec = sc.read_compound(Xid) + assert xid.__dict__ == dec.__dict__ + +# def testLoadReadOnly(self): +# spec = "amqp.0-10-qpid-errata.xml" +# f = testrunner.get_spec_file(spec) +# dest = tempfile.mkdtemp() +# shutil.copy(f, dest) +# shutil.copy(os.path.join(os.path.dirname(f), "amqp.0-10.dtd"), dest) +# os.chmod(dest, stat.S_IRUSR | stat.S_IXUSR) +# fname = os.path.join(dest, spec) +# load(fname) +# assert not os.path.exists("%s.pcl" % fname) diff --git a/qpid/python/qpid/tests/util.py b/qpid/python/qpid/tests/util.py new file mode 100644 index 0000000000..4e901218c2 --- /dev/null +++ b/qpid/python/qpid/tests/util.py @@ -0,0 +1,52 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +from unittest import TestCase +from qpid.util import get_client_properties_with_defaults + +class UtilTest (TestCase): + + def test_default_client_properties_08091(self): + client_properties = get_client_properties_with_defaults(version_property_key="version") + self.assertTrue("product" in client_properties) + self.assertTrue("version" in client_properties) + self.assertTrue("platform" in client_properties) + + def test_default_client_properties_010(self): + client_properties = get_client_properties_with_defaults(version_property_key="qpid.client_version") + self.assertTrue("product" in client_properties) + self.assertTrue("qpid.client_version" in client_properties) + self.assertTrue("platform" in client_properties) + + def test_client_properties_with_provided_value(self): + client_properties = get_client_properties_with_defaults(provided_client_properties={"mykey":"myvalue"}) + self.assertTrue("product" in client_properties) + self.assertTrue("mykey" in client_properties) + self.assertEqual("myvalue", client_properties["mykey"]) + + def test_client_properties_with_provided_value_that_overrides_default(self): + client_properties = get_client_properties_with_defaults(provided_client_properties={"product":"myproduct"}) + self.assertEqual("myproduct", client_properties["product"]) + + def test_client_properties_with_no_provided_values(self): + client_properties = get_client_properties_with_defaults(provided_client_properties=None) + self.assertTrue("product" in client_properties) + + client_properties = get_client_properties_with_defaults() + self.assertTrue("product" in client_properties) + diff --git a/qpid/python/qpid/util.py b/qpid/python/qpid/util.py new file mode 100644 index 0000000000..b17f13e6e6 --- /dev/null +++ b/qpid/python/qpid/util.py @@ -0,0 +1,208 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +import os, socket, time, textwrap, re, sys + +try: + from ssl import wrap_socket as ssl +except ImportError: + from socket import ssl as wrap_socket + class ssl: + def __init__(self, sock, keyfile=None, certfile=None, trustfile=None): + # Bug (QPID-4337): this is the "old" version of python SSL. + # The private key is required. If a certificate is given, but no + # keyfile, assume the key is contained in the certificate + if certfile and not keyfile: + keyfile = certfile + self.sock = sock + self.ssl = wrap_socket(sock, keyfile=keyfile, certfile=certfile) + + def recv(self, n): + return self.ssl.read(n) + + def send(self, s): + return self.ssl.write(s) + + def close(self): + self.sock.close() + +def get_client_properties_with_defaults(provided_client_properties={}, version_property_key="qpid.client_version"): + ppid = 0 + version = "unidentified" + try: + ppid = os.getppid() + except: + pass + + try: + import pkg_resources + pkg = pkg_resources.require("qpid-python") + if pkg and pkg[0] and pkg[0].version: + version = pkg[0].version + except: + pass + + client_properties = {"product": "qpid python client", + version_property_key : version, + "platform": os.name, + "qpid.client_process": os.path.basename(sys.argv and sys.argv[0] or ''), + "qpid.client_pid": os.getpid(), + "qpid.client_ppid": ppid} + + if provided_client_properties: + client_properties.update(provided_client_properties) + return client_properties + +def connect(host, port): + for res in socket.getaddrinfo(host, port, 0, socket.SOCK_STREAM): + af, socktype, proto, canonname, sa = res + sock = socket.socket(af, socktype, proto) + try: + sock.connect(sa) + break + except socket.error, msg: + sock.close() + else: + # If we got here then we couldn't connect (yet) + raise + return sock + +def listen(host, port, predicate = lambda: True, bound = lambda: None): + sock = socket.socket() + sock.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) + sock.bind((host, port)) + sock.listen(5) + bound() + while predicate(): + s, a = sock.accept() + yield s + +def mtime(filename): + return os.stat(filename).st_mtime + +def wait(condition, predicate, timeout=None): + condition.acquire() + try: + passed = 0 + start = time.time() + while not predicate(): + if timeout is None: + # using the timed wait prevents keyboard interrupts from being + # blocked while waiting + condition.wait(3) + elif passed < timeout: + condition.wait(timeout - passed) + else: + return False + passed = time.time() - start + return True + finally: + condition.release() + +def notify(condition, action=lambda: None): + condition.acquire() + try: + action() + condition.notifyAll() + finally: + condition.release() + +def fill(text, indent, heading = None): + sub = indent * " " + if heading: + if not text: + return (indent - 2) * " " + heading + init = (indent - 2) * " " + heading + " -- " + else: + init = sub + w = textwrap.TextWrapper(initial_indent = init, subsequent_indent = sub) + return w.fill(" ".join(text.split())) + +class URL: + + RE = re.compile(r""" + # [ <scheme>:// ] [ <user> [ / <password> ] @] ( <host4> | \[ <host6> \] ) [ :<port> ] + ^ (?: ([^:/@]+)://)? (?: ([^:/@]+) (?: / ([^:/@]+) )? @)? (?: ([^@:/\[]+) | \[ ([a-f0-9:.]+) \] ) (?: :([0-9]+))?$ +""", re.X | re.I) + + AMQPS = "amqps" + AMQP = "amqp" + + def __init__(self, s=None, **kwargs): + if s is None: + self.scheme = kwargs.get('scheme', None) + self.user = kwargs.get('user', None) + self.password = kwargs.get('password', None) + self.host = kwargs.get('host', None) + self.port = kwargs.get('port', None) + if self.host is None: + raise ValueError('Host required for url') + elif isinstance(s, URL): + self.scheme = s.scheme + self.user = s.user + self.password = s.password + self.host = s.host + self.port = s.port + else: + match = URL.RE.match(s) + if match is None: + raise ValueError(s) + self.scheme, self.user, self.password, host4, host6, port = match.groups() + self.host = host4 or host6 + if port is None: + self.port = None + else: + self.port = int(port) + + def __repr__(self): + return "URL(%r)" % str(self) + + def __str__(self): + s = "" + if self.scheme: + s += "%s://" % self.scheme + if self.user: + s += self.user + if self.password: + s += "/%s" % self.password + s += "@" + if ':' not in self.host: + s += self.host + else: + s += "[%s]" % self.host + if self.port: + s += ":%s" % self.port + return s + + def __eq__(self, url): + if isinstance(url, basestring): + url = URL(url) + return \ + self.scheme==url.scheme and \ + self.user==url.user and self.password==url.password and \ + self.host==url.host and self.port==url.port + + def __ne__(self, url): + return not self.__eq__(url) + +def default(value, default): + if value is None: + return default + else: + return value diff --git a/qpid/python/qpid/validator.py b/qpid/python/qpid/validator.py new file mode 100644 index 0000000000..d234642b3e --- /dev/null +++ b/qpid/python/qpid/validator.py @@ -0,0 +1,107 @@ +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# + +class Context: + + def __init__(self): + self.containers = [] + + def push(self, o): + self.containers.append(o) + + def pop(self): + return self.containers.pop() + +class Values: + + def __init__(self, *values): + self.values = values + + def validate(self, o, ctx): + if not o in self.values: + return "%s not in %s" % (o, self.values) + + def __str__(self): + return self.value + +class Types: + + def __init__(self, *types): + self.types = types + + def validate(self, o, ctx): + for t in self.types: + if isinstance(o, t): + return + if len(self.types) == 1: + return "%s is not a %s" % (o, self.types[0].__name__) + else: + return "%s is not one of: %s" % (o, ", ".join([t.__name__ for t in self.types])) + +class List: + + def __init__(self, condition): + self.condition = condition + + def validate(self, o, ctx): + if not isinstance(o, list): + return "%s is not a list" % o + + ctx.push(o) + for v in o: + err = self.condition.validate(v, ctx) + if err: return err + +class Map: + + def __init__(self, map, restricted=True): + self.map = map + self.restricted = restricted + + def validate(self, o, ctx): + errors = [] + + if not hasattr(o, "get"): + return "%s is not a map" % o + + ctx.push(o) + for k, t in self.map.items(): + v = o.get(k) + if v is not None: + err = t.validate(v, ctx) + if err: errors.append("%s: %s" % (k, err)) + if self.restricted: + for k in o: + if not k in self.map: + errors.append("%s: illegal key" % k) + ctx.pop() + + if errors: + return ", ".join(errors) + +class And: + + def __init__(self, *conditions): + self.conditions = conditions + + def validate(self, o, ctx): + for c in self.conditions: + err = c.validate(o, ctx) + if err: + return err diff --git a/qpid/python/setup.py b/qpid/python/setup.py new file mode 100755 index 0000000000..9b71a98536 --- /dev/null +++ b/qpid/python/setup.py @@ -0,0 +1,316 @@ +#!/usr/bin/env python +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +import os, re, sys, string +from distutils.core import setup, Command +from distutils.command.build import build as _build +from distutils.command.build_py import build_py as _build_py +from distutils.command.clean import clean as _clean +from distutils.command.install_lib import install_lib as _install_lib +from distutils.dep_util import newer +from distutils.dir_util import remove_tree +from distutils.dist import Distribution +from distutils.errors import DistutilsFileError, DistutilsOptionError +from distutils import log +from stat import ST_ATIME, ST_MTIME, ST_MODE, S_IMODE + +MAJOR, MINOR = sys.version_info[0:2] + +class preprocessor: + + def copy_file(self, src, dst, preserve_mode=1, preserve_times=1, + link=None, level=1): + name, actor = self.actor(src, dst) + if actor: + if not os.path.isfile(src): + raise DistutilsFileError, \ + "can't copy '%s': doesn't exist or not a regular file" % src + + if os.path.isdir(dst): + dir = dst + dst = os.path.join(dst, os.path.basename(src)) + else: + dir = os.path.dirname(dst) + + if not self.force and not newer(src, dst): + return dst, 0 + + if os.path.basename(dst) == os.path.basename(src): + log.info("%s %s -> %s", name, src, dir) + else: + log.info("%s %s -> %s", name, src, dst) + + if self.dry_run: + return (dst, 1) + else: + try: + fsrc = open(src, 'rb') + except os.error, (errno, errstr): + raise DistutilsFileError, \ + "could not open '%s': %s" % (src, errstr) + + if os.path.exists(dst): + try: + os.unlink(dst) + except os.error, (errno, errstr): + raise DistutilsFileError, \ + "could not delete '%s': %s" % (dst, errstr) + + try: + fdst = open(dst, 'wb') + except os.error, (errno, errstr): + raise DistutilsFileError, \ + "could not create '%s': %s" % (dst, errstr) + + try: + fdst.write(actor(fsrc.read())) + finally: + fsrc.close() + fdst.close() + + if preserve_mode or preserve_times: + st = os.stat(src) + + if preserve_times: + os.utime(dst, (st[ST_ATIME], st[ST_MTIME])) + if preserve_mode: + os.chmod(dst, S_IMODE(st[ST_MODE])) + + return (dst, 1) + else: + return Command.copy_file(self, src, dst, preserve_mode, preserve_times, + link, level) + +doc_option = [('build-doc', None, 'build directory for documentation')] + +class build(_build): + + user_options = _build.user_options + doc_option + + def initialize_options(self): + _build.initialize_options(self) + self.build_doc = None + + def finalize_options(self): + _build.finalize_options(self) + if self.build_doc is None: + self.build_doc = "%s/doc" % self.build_base + + def get_sub_commands(self): + return _build.get_sub_commands(self) + ["build_doc"] + +class build_doc(Command): + + user_options = doc_option + + def initialize_options(self): + self.build_doc = None + + def finalize_options(self): + self.set_undefined_options('build', ('build_doc', 'build_doc')) + + def run(self): + try: + from epydoc.docbuilder import build_doc_index + from epydoc.docwriter.html import HTMLWriter + except ImportError, e: + log.warn('%s -- skipping build_doc', e) + return + + names = ["qpid.messaging"] + doc_index = build_doc_index(names, True, True) + html_writer = HTMLWriter(doc_index) + self.mkpath(self.build_doc) + log.info('epydoc %s to %s' % (", ".join(names), self.build_doc)) + html_writer.write(self.build_doc) + +class clean(_clean): + + user_options = _clean.user_options + doc_option + + def initialize_options(self): + _clean.initialize_options(self) + self.build_doc = None + + def finalize_options(self): + _clean.finalize_options(self) + self.set_undefined_options('build', ('build_doc', 'build_doc')) + + def run(self): + if self.all: + if os.path.exists(self.build_doc): + remove_tree(self.build_doc, dry_run=self.dry_run) + else: + log.debug("%s doesn't exist -- can't clean it", self.build_doc) + _clean.run(self) + +if MAJOR <= 2 and MINOR <= 3: + from glob import glob + from distutils.util import convert_path + class distclass(Distribution): + + def __init__(self, *args, **kwargs): + self.package_data = None + Distribution.__init__(self, *args, **kwargs) +else: + distclass = Distribution + +ann = re.compile(r"([ \t]*)@([_a-zA-Z][_a-zA-Z0-9]*)([ \t\n\r]+def[ \t]+)([_a-zA-Z][_a-zA-Z0-9]*)") +line = re.compile(r"\n([ \t]*)[^ \t\n#]+") + +class build_py(preprocessor, _build_py): + + if MAJOR <= 2 and MINOR <= 3: + def initialize_options(self): + _build_py.initialize_options(self) + self.package_data = None + + def finalize_options(self): + _build_py.finalize_options(self) + self.package_data = self.distribution.package_data + self.data_files = self.get_data_files() + + def get_data_files (self): + data = [] + if not self.packages: + return data + for package in self.packages: + # Locate package source directory + src_dir = self.get_package_dir(package) + + # Compute package build directory + build_dir = os.path.join(*([self.build_lib] + package.split('.'))) + + # Length of path to strip from found files + plen = 0 + if src_dir: + plen = len(src_dir)+1 + + # Strip directory from globbed filenames + filenames = [file[plen:] + for file in self.find_data_files(package, src_dir)] + data.append((package, src_dir, build_dir, filenames)) + return data + + def find_data_files (self, package, src_dir): + globs = (self.package_data.get('', []) + + self.package_data.get(package, [])) + files = [] + for pattern in globs: + # Each pattern has to be converted to a platform-specific path + filelist = glob(os.path.join(src_dir, convert_path(pattern))) + # Files that match more than one pattern are only added once + files.extend([fn for fn in filelist if fn not in files]) + return files + + def build_package_data (self): + lastdir = None + for package, src_dir, build_dir, filenames in self.data_files: + for filename in filenames: + target = os.path.join(build_dir, filename) + self.mkpath(os.path.dirname(target)) + self.copy_file(os.path.join(src_dir, filename), target, + preserve_mode=False) + + def build_packages(self): + _build_py.build_packages(self) + self.build_package_data() + + # end if MAJOR <= 2 and MINOR <= 3 + + def backport(self, input): + output = "" + pos = 0 + while True: + m = ann.search(input, pos) + if m: + indent, decorator, idef, function = m.groups() + output += input[pos:m.start()] + output += "%s#@%s%s%s" % (indent, decorator, idef, function) + pos = m.end() + + subst = "\n%s%s = %s(%s)\n" % (indent, function, decorator, function) + npos = pos + while True: + n = line.search(input, npos) + if not n: + input += subst + break + if len(n.group(1)) <= len(indent): + idx = n.start() + input = input[:idx] + subst + input[idx:] + break + npos = n.end() + else: + break + + output += input[pos:] + return output + + def actor(self, src, dst): + base, ext = os.path.splitext(src) + if ext == ".py" and MAJOR <= 2 and MINOR <= 3: + return "backporting", self.backport + else: + return None, None + +def pclfile(xmlfile): + return "%s.pcl" % os.path.splitext(xmlfile)[0] + +class install_lib(_install_lib): + + def get_outputs(self): + outputs = _install_lib.get_outputs(self) + extra = [] + for of in outputs: + if os.path.basename(of) == "amqp-0-10-qpid-errata-stripped.xml": + extra.append(pclfile(of)) + return outputs + extra + + def install(self): + outfiles = _install_lib.install(self) + extra = [] + for of in outfiles: + if os.path.basename(of) == "amqp-0-10-qpid-errata-stripped.xml": + tgt = pclfile(of) + if self.force or newer(of, tgt): + log.info("caching %s to %s" % (of, os.path.basename(tgt))) + if not self.dry_run: + from qpid.ops import load_types + load_types(of) + extra.append(tgt) + return outfiles + extra + +setup(name="qpid-python", + version="0.31", + author="Apache Qpid", + author_email="dev@qpid.apache.org", + packages=["mllib", "qpid", "qpid.messaging", "qpid.tests", + "qpid.tests.messaging", "qpid.saslmech", "qpid.tests.saslmech"], + package_data={"qpid": ["specs/*.dtd", "specs/*.xml"]}, + scripts=["qpid-python-test"], + url="http://qpid.apache.org/", + license="Apache Software License", + description="Python client implementation for Apache Qpid", + cmdclass={"build": build, + "build_py": build_py, + "build_doc": build_doc, + "clean": clean, + "install_lib": install_lib}, + distclass=distclass) diff --git a/qpid/python/todo.txt b/qpid/python/todo.txt new file mode 100644 index 0000000000..8dbe9c7cc4 --- /dev/null +++ b/qpid/python/todo.txt @@ -0,0 +1,197 @@ +Key: + F = Functional + PF = Partially Functional + NR = Needs Additional Review + ND = Needs Additional Design + NF = Not Functional + +Connection: + + variables/configuration: + + - reconnect: F, NR, ND + + reconnect functionality is done and the API semantics provided + are ready for review + + reconnect policies need to be finished, there is currently + only one hardcoded reconnect policy (retry every three + seconds), we need to define the pre-canned policies that we + want to support and a means to configure them, as well as a + very simple plugin/callback for defining ad-hoc policies + + need to feed failover exchange into the reconnect policy + + acks can be lost on reconnect + + handle reconnect during commit/rollback + + - timeout: NF + + some sort of timeout threshold for killing the connection + + methods: + + - open/__init__: F, ND + + need to support kerberos + + need a better way of supplying various kinds of configuration: + - authentication info + - transport specific configuration options, e.g + - heartbeat + - socket options + - tcp-nodelay + - multiple brokers + + - session: F, NR + + - connect: F, NR + + - disconnect: F, NR + + - connected: F, NR + + - close: F, NR, ND + + currently there is no distinction between a "close" that does + a complete handshake with the remote broker, and a "close" + that reclaims resources, this means that close can fail with + an exception, I don't like this as it is unclear to the user + if there is a responsibility to do further cleanup in this + case + + errors: + + - ConnectionError: F, NR + + ConnectError F, NR + + Disconnected F, NR + + - notification of disconnect? + +Session: + + methods: + + - sender: F, NR, ND + + need to detail address options + + need to define subject pattern semantics + + consider providing convenience for sender/receiver caching + + need to provide sync option, possibly change default + + - receiver: F, NR, ND + + need to detail address options + + need to define filter syntax/semantics + + consider providing convenience for sender/receiver caching + + need to provide sync option, possibly change default + + - acknowledge: F, NR + + - reject: NF + + - release: NF + + - commit: F, NR + + - rollback: F, NR + + - next_receiver: F, NR + + - close: F, ND + + see comment on Connection.close + + errors: + + - SessionError: F, NR, ND + + SendError: F, NR, ND + + ReceiveError: F, NR, ND + + should there be fatal/non fatal variants? + +Sender: + + methods: + + - pending: F, NR + + - send: F, NR + + - sync: F, NR, ND + + currently this blocks until pending == 0, I'm thinking of + renaming this to wait and adding a slightly richer interface + that would let you wait for something like pending < n + + - close: F, NR + + errors: + + - SendError + + InsufficientCapacity + + need specific subhierarchy for certain conditions, e.g. no such queue + +Receiver: + + methods: + + - pending: F, NR + + - listen: F, ND + + see comment on Session.fetch + + - fetch: F, NR, ND + + explicit grant for receiver + + changing capacity/prefetch to issue credit on ack rather than + fetch return + + - sync/wait: NF + + - close: F, NR + + errors: + + - ReceiveError + + Empty + + need specific subhierarchy for certain conditions, e.g. no such queue + +Message: + + - standard message properties: F, NR, ND + + - map messages: F, NR + + needs interop testing: NF + + needs java impl: NF + + - list messages: F, NR, NI + + needs interop testing: NF + + needs java impl: NF + + - boxed types: NF + +Address: + + - syntax: F, NR + + need to consider whitespace in name/subject + + consider unquoted string concept + - subject related changes, e.g. allowing patterns on both ends: NF + - creating/deleting queues/exchanges F, NR + + need to handle cleanup of temp queues/topics: F, NR + + passthrough options for creating exchanges/queues: F, NR + - integration with java: NF + - queue browsing: F, NR + - temporary queues: NF + - xquery: NF + +Testing: + - stress/soak testing for async: NF + - stress/soak testing for reconnect: NF + - interop testing: NF + - multi session and multi connection client tests: NF + +Documentation: + - api level docs largely present but need updating and elaboration + - tutorial: NF + +Examples: + - drain: F, NR + - spout: F, NR + - server: F, NR + - client: NF + - reservations: F, NR + + code: F, NR + + doc: NF + - other examples, e.g. async? + +Miscellaneous: + - standard ping-like (drain/spout) utilities for all clients: NF + - caching of resolved addresses: F, NR + - consider using separate session for query/deletion/creation of addresses |
