summaryrefslogtreecommitdiff
path: root/qpid/python
diff options
context:
space:
mode:
authorRobert Gemmell <robbie@apache.org>2015-06-25 10:22:51 +0000
committerRobert Gemmell <robbie@apache.org>2015-06-25 10:22:51 +0000
commit32ae758bc2e8fd962b66a4ab6341b14009f1907e (patch)
tree2f4d8174813284a6ea58bb6b7f6520aa92287476 /qpid/python
parent116d91ad7825a98af36a869fc751206fbce0c59f (diff)
parentf7e896076143de4572b4f1f67ef0765125f2498d (diff)
downloadqpid-python-32ae758bc2e8fd962b66a4ab6341b14009f1907e.tar.gz
NO-JIRA: create branch for qpid-cpp 0.34 RC process
git-svn-id: https://svn.apache.org/repos/asf/qpid/branches/qpid-cpp-0.34-rc@1687469 13f79535-47bb-0310-9956-ffa450edef68
Diffstat (limited to 'qpid/python')
-rw-r--r--qpid/python/LICENSE.txt203
-rw-r--r--qpid/python/MANIFEST.in3
-rw-r--r--qpid/python/NOTICE.txt5
-rw-r--r--qpid/python/README.txt65
-rw-r--r--qpid/python/doc/test-requirements.txt29
-rw-r--r--qpid/python/examples/README.txt42
-rwxr-xr-xqpid/python/examples/api/drain97
-rwxr-xr-xqpid/python/examples/api/hello52
-rwxr-xr-xqpid/python/examples/api/hello_xml77
-rwxr-xr-xqpid/python/examples/api/server95
-rwxr-xr-xqpid/python/examples/api/spout133
-rw-r--r--qpid/python/examples/api/statistics.py139
-rw-r--r--qpid/python/examples/reservations/common.py80
-rwxr-xr-xqpid/python/examples/reservations/inventory94
-rwxr-xr-xqpid/python/examples/reservations/machine-agent103
-rwxr-xr-xqpid/python/examples/reservations/reserve197
-rw-r--r--qpid/python/mllib/__init__.py86
-rw-r--r--qpid/python/mllib/dom.py310
-rw-r--r--qpid/python/mllib/parsers.py139
-rw-r--r--qpid/python/mllib/transforms.py164
-rwxr-xr-xqpid/python/qpid-python-test639
-rw-r--r--qpid/python/qpid-python-test-ant.xml192
-rw-r--r--qpid/python/qpid/__init__.py84
-rw-r--r--qpid/python/qpid/client.py277
-rw-r--r--qpid/python/qpid/codec.py701
-rw-r--r--qpid/python/qpid/codec010.py404
-rw-r--r--qpid/python/qpid/compat.py221
-rw-r--r--qpid/python/qpid/concurrency.py106
-rw-r--r--qpid/python/qpid/connection.py250
-rw-r--r--qpid/python/qpid/connection08.py555
-rw-r--r--qpid/python/qpid/content.py58
-rw-r--r--qpid/python/qpid/datatypes.py385
-rw-r--r--qpid/python/qpid/debug.py55
-rw-r--r--qpid/python/qpid/delegate.py53
-rw-r--r--qpid/python/qpid/delegates.py215
-rw-r--r--qpid/python/qpid/disp.py236
-rw-r--r--qpid/python/qpid/exceptions.py22
-rw-r--r--qpid/python/qpid/framer.py128
-rw-r--r--qpid/python/qpid/framing.py313
-rw-r--r--qpid/python/qpid/generator.py56
-rw-r--r--qpid/python/qpid/harness.py20
-rw-r--r--qpid/python/qpid/lexer.py118
-rw-r--r--qpid/python/qpid/log.py28
-rw-r--r--qpid/python/qpid/management.py922
-rw-r--r--qpid/python/qpid/managementdata.py773
-rw-r--r--qpid/python/qpid/message.py73
-rw-r--r--qpid/python/qpid/messaging/__init__.py35
-rw-r--r--qpid/python/qpid/messaging/address.py172
-rw-r--r--qpid/python/qpid/messaging/constants.py40
-rw-r--r--qpid/python/qpid/messaging/driver.py1432
-rw-r--r--qpid/python/qpid/messaging/endpoints.py1118
-rw-r--r--qpid/python/qpid/messaging/exceptions.py179
-rw-r--r--qpid/python/qpid/messaging/message.py173
-rw-r--r--qpid/python/qpid/messaging/transports.py235
-rw-r--r--qpid/python/qpid/messaging/util.py64
-rw-r--r--qpid/python/qpid/mimetype.py106
-rw-r--r--qpid/python/qpid/ops.py294
-rw-r--r--qpid/python/qpid/packer.py36
-rw-r--r--qpid/python/qpid/parser.py68
-rw-r--r--qpid/python/qpid/peer.py533
-rw-r--r--qpid/python/qpid/queue.py88
-rw-r--r--qpid/python/qpid/reference.py117
-rw-r--r--qpid/python/qpid/sasl.py119
-rw-r--r--qpid/python/qpid/saslmech/__init__.py22
-rw-r--r--qpid/python/qpid/saslmech/amqplain.py28
-rw-r--r--qpid/python/qpid/saslmech/anonymous.py27
-rw-r--r--qpid/python/qpid/saslmech/cram_md5.py27
-rw-r--r--qpid/python/qpid/saslmech/cram_md5_hex.py30
-rw-r--r--qpid/python/qpid/saslmech/external.py27
-rw-r--r--qpid/python/qpid/saslmech/finder.py66
-rw-r--r--qpid/python/qpid/saslmech/plain.py28
-rw-r--r--qpid/python/qpid/saslmech/sasl.py44
-rw-r--r--qpid/python/qpid/saslmech/scram.py91
-rw-r--r--qpid/python/qpid/saslmech/scram_sha_1.py27
-rw-r--r--qpid/python/qpid/saslmech/scram_sha_256.py25
-rw-r--r--qpid/python/qpid/selector.py153
-rw-r--r--qpid/python/qpid/session.py308
-rw-r--r--qpid/python/qpid/spec08.py504
-rw-r--r--qpid/python/qpid/specs/amqp-0-10-qpid-errata-stripped.xml1203
-rw-r--r--qpid/python/qpid/specs/amqp-0-10-stripped.xml1200
-rw-r--r--qpid/python/qpid/specs/amqp-0-10.dtd246
-rw-r--r--qpid/python/qpid/specs/amqp-0-8-qpid-stripped.xml784
-rw-r--r--qpid/python/qpid/specs/amqp-0-9-1-stripped.xml477
-rw-r--r--qpid/python/qpid/specs/amqp-0-9-qpid-stripped.xml876
-rw-r--r--qpid/python/qpid/specs_config.py26
-rw-r--r--qpid/python/qpid/testlib.py241
-rw-r--r--qpid/python/qpid/tests/__init__.py62
-rw-r--r--qpid/python/qpid/tests/codec.py729
-rw-r--r--qpid/python/qpid/tests/codec010.py133
-rw-r--r--qpid/python/qpid/tests/connection.py227
-rw-r--r--qpid/python/qpid/tests/datatypes.py296
-rw-r--r--qpid/python/qpid/tests/framing.py289
-rw-r--r--qpid/python/qpid/tests/messaging/__init__.py204
-rw-r--r--qpid/python/qpid/tests/messaging/address.py321
-rw-r--r--qpid/python/qpid/tests/messaging/endpoints.py1387
-rw-r--r--qpid/python/qpid/tests/messaging/implementation.py28
-rw-r--r--qpid/python/qpid/tests/messaging/message.py187
-rw-r--r--qpid/python/qpid/tests/mimetype.py56
-rw-r--r--qpid/python/qpid/tests/parser.py37
-rw-r--r--qpid/python/qpid/tests/queue.py71
-rw-r--r--qpid/python/qpid/tests/saslmech/__init__.py19
-rw-r--r--qpid/python/qpid/tests/saslmech/finder.py71
-rw-r--r--qpid/python/qpid/tests/saslmech/my_sasl.py22
-rw-r--r--qpid/python/qpid/tests/saslmech/my_sasl2.py28
-rw-r--r--qpid/python/qpid/tests/spec010.py74
-rw-r--r--qpid/python/qpid/tests/util.py52
-rw-r--r--qpid/python/qpid/util.py208
-rw-r--r--qpid/python/qpid/validator.py107
-rwxr-xr-xqpid/python/setup.py316
-rw-r--r--qpid/python/todo.txt197
110 files changed, 25387 insertions, 0 deletions
diff --git a/qpid/python/LICENSE.txt b/qpid/python/LICENSE.txt
new file mode 100644
index 0000000000..6b0b1270ff
--- /dev/null
+++ b/qpid/python/LICENSE.txt
@@ -0,0 +1,203 @@
+
+ Apache License
+ Version 2.0, January 2004
+ http://www.apache.org/licenses/
+
+ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+ 1. Definitions.
+
+ "License" shall mean the terms and conditions for use, reproduction,
+ and distribution as defined by Sections 1 through 9 of this document.
+
+ "Licensor" shall mean the copyright owner or entity authorized by
+ the copyright owner that is granting the License.
+
+ "Legal Entity" shall mean the union of the acting entity and all
+ other entities that control, are controlled by, or are under common
+ control with that entity. For the purposes of this definition,
+ "control" means (i) the power, direct or indirect, to cause the
+ direction or management of such entity, whether by contract or
+ otherwise, or (ii) ownership of fifty percent (50%) or more of the
+ outstanding shares, or (iii) beneficial ownership of such entity.
+
+ "You" (or "Your") shall mean an individual or Legal Entity
+ exercising permissions granted by this License.
+
+ "Source" form shall mean the preferred form for making modifications,
+ including but not limited to software source code, documentation
+ source, and configuration files.
+
+ "Object" form shall mean any form resulting from mechanical
+ transformation or translation of a Source form, including but
+ not limited to compiled object code, generated documentation,
+ and conversions to other media types.
+
+ "Work" shall mean the work of authorship, whether in Source or
+ Object form, made available under the License, as indicated by a
+ copyright notice that is included in or attached to the work
+ (an example is provided in the Appendix below).
+
+ "Derivative Works" shall mean any work, whether in Source or Object
+ form, that is based on (or derived from) the Work and for which the
+ editorial revisions, annotations, elaborations, or other modifications
+ represent, as a whole, an original work of authorship. For the purposes
+ of this License, Derivative Works shall not include works that remain
+ separable from, or merely link (or bind by name) to the interfaces of,
+ the Work and Derivative Works thereof.
+
+ "Contribution" shall mean any work of authorship, including
+ the original version of the Work and any modifications or additions
+ to that Work or Derivative Works thereof, that is intentionally
+ submitted to Licensor for inclusion in the Work by the copyright owner
+ or by an individual or Legal Entity authorized to submit on behalf of
+ the copyright owner. For the purposes of this definition, "submitted"
+ means any form of electronic, verbal, or written communication sent
+ to the Licensor or its representatives, including but not limited to
+ communication on electronic mailing lists, source code control systems,
+ and issue tracking systems that are managed by, or on behalf of, the
+ Licensor for the purpose of discussing and improving the Work, but
+ excluding communication that is conspicuously marked or otherwise
+ designated in writing by the copyright owner as "Not a Contribution."
+
+ "Contributor" shall mean Licensor and any individual or Legal Entity
+ on behalf of whom a Contribution has been received by Licensor and
+ subsequently incorporated within the Work.
+
+ 2. Grant of Copyright License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ copyright license to reproduce, prepare Derivative Works of,
+ publicly display, publicly perform, sublicense, and distribute the
+ Work and such Derivative Works in Source or Object form.
+
+ 3. Grant of Patent License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ (except as stated in this section) patent license to make, have made,
+ use, offer to sell, sell, import, and otherwise transfer the Work,
+ where such license applies only to those patent claims licensable
+ by such Contributor that are necessarily infringed by their
+ Contribution(s) alone or by combination of their Contribution(s)
+ with the Work to which such Contribution(s) was submitted. If You
+ institute patent litigation against any entity (including a
+ cross-claim or counterclaim in a lawsuit) alleging that the Work
+ or a Contribution incorporated within the Work constitutes direct
+ or contributory patent infringement, then any patent licenses
+ granted to You under this License for that Work shall terminate
+ as of the date such litigation is filed.
+
+ 4. Redistribution. You may reproduce and distribute copies of the
+ Work or Derivative Works thereof in any medium, with or without
+ modifications, and in Source or Object form, provided that You
+ meet the following conditions:
+
+ (a) You must give any other recipients of the Work or
+ Derivative Works a copy of this License; and
+
+ (b) You must cause any modified files to carry prominent notices
+ stating that You changed the files; and
+
+ (c) You must retain, in the Source form of any Derivative Works
+ that You distribute, all copyright, patent, trademark, and
+ attribution notices from the Source form of the Work,
+ excluding those notices that do not pertain to any part of
+ the Derivative Works; and
+
+ (d) If the Work includes a "NOTICE" text file as part of its
+ distribution, then any Derivative Works that You distribute must
+ include a readable copy of the attribution notices contained
+ within such NOTICE file, excluding those notices that do not
+ pertain to any part of the Derivative Works, in at least one
+ of the following places: within a NOTICE text file distributed
+ as part of the Derivative Works; within the Source form or
+ documentation, if provided along with the Derivative Works; or,
+ within a display generated by the Derivative Works, if and
+ wherever such third-party notices normally appear. The contents
+ of the NOTICE file are for informational purposes only and
+ do not modify the License. You may add Your own attribution
+ notices within Derivative Works that You distribute, alongside
+ or as an addendum to the NOTICE text from the Work, provided
+ that such additional attribution notices cannot be construed
+ as modifying the License.
+
+ You may add Your own copyright statement to Your modifications and
+ may provide additional or different license terms and conditions
+ for use, reproduction, or distribution of Your modifications, or
+ for any such Derivative Works as a whole, provided Your use,
+ reproduction, and distribution of the Work otherwise complies with
+ the conditions stated in this License.
+
+ 5. Submission of Contributions. Unless You explicitly state otherwise,
+ any Contribution intentionally submitted for inclusion in the Work
+ by You to the Licensor shall be under the terms and conditions of
+ this License, without any additional terms or conditions.
+ Notwithstanding the above, nothing herein shall supersede or modify
+ the terms of any separate license agreement you may have executed
+ with Licensor regarding such Contributions.
+
+ 6. Trademarks. This License does not grant permission to use the trade
+ names, trademarks, service marks, or product names of the Licensor,
+ except as required for reasonable and customary use in describing the
+ origin of the Work and reproducing the content of the NOTICE file.
+
+ 7. Disclaimer of Warranty. Unless required by applicable law or
+ agreed to in writing, Licensor provides the Work (and each
+ Contributor provides its Contributions) on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+ implied, including, without limitation, any warranties or conditions
+ of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+ PARTICULAR PURPOSE. You are solely responsible for determining the
+ appropriateness of using or redistributing the Work and assume any
+ risks associated with Your exercise of permissions under this License.
+
+ 8. Limitation of Liability. In no event and under no legal theory,
+ whether in tort (including negligence), contract, or otherwise,
+ unless required by applicable law (such as deliberate and grossly
+ negligent acts) or agreed to in writing, shall any Contributor be
+ liable to You for damages, including any direct, indirect, special,
+ incidental, or consequential damages of any character arising as a
+ result of this License or out of the use or inability to use the
+ Work (including but not limited to damages for loss of goodwill,
+ work stoppage, computer failure or malfunction, or any and all
+ other commercial damages or losses), even if such Contributor
+ has been advised of the possibility of such damages.
+
+ 9. Accepting Warranty or Additional Liability. While redistributing
+ the Work or Derivative Works thereof, You may choose to offer,
+ and charge a fee for, acceptance of support, warranty, indemnity,
+ or other liability obligations and/or rights consistent with this
+ License. However, in accepting such obligations, You may act only
+ on Your own behalf and on Your sole responsibility, not on behalf
+ of any other Contributor, and only if You agree to indemnify,
+ defend, and hold each Contributor harmless for any liability
+ incurred by, or claims asserted against, such Contributor by reason
+ of your accepting any such warranty or additional liability.
+
+ END OF TERMS AND CONDITIONS
+
+ APPENDIX: How to apply the Apache License to your work.
+
+ To apply the Apache License to your work, attach the following
+ boilerplate notice, with the fields enclosed by brackets "[]"
+ replaced with your own identifying information. (Don't include
+ the brackets!) The text should be enclosed in the appropriate
+ comment syntax for the file format. We also recommend that a
+ file or class name and description of purpose be included on the
+ same "printed page" as the copyright notice for easier
+ identification within third-party archives.
+
+ Copyright [yyyy] [name of copyright owner]
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+
diff --git a/qpid/python/MANIFEST.in b/qpid/python/MANIFEST.in
new file mode 100644
index 0000000000..ca53073c04
--- /dev/null
+++ b/qpid/python/MANIFEST.in
@@ -0,0 +1,3 @@
+recursive-include examples *
+recursive-exclude examples verify verify.in
+include *.txt
diff --git a/qpid/python/NOTICE.txt b/qpid/python/NOTICE.txt
new file mode 100644
index 0000000000..4175a06c99
--- /dev/null
+++ b/qpid/python/NOTICE.txt
@@ -0,0 +1,5 @@
+Apache Qpid Python Client
+Copyright 2006-2014 The Apache Software Foundation
+
+This product includes software developed at
+The Apache Software Foundation (http://www.apache.org/).
diff --git a/qpid/python/README.txt b/qpid/python/README.txt
new file mode 100644
index 0000000000..e076e2d216
--- /dev/null
+++ b/qpid/python/README.txt
@@ -0,0 +1,65 @@
+This distribution contains the Python client libraries for Apache Qpid.
+
+Apache Qpid is a high-speed, language independent, platform
+independent enterprise messaging system. It currently provides two
+messaging brokers (one implemented in C++, one implemented in Java),
+and messaging client libraries for Java JMS, C++, C# .NET, Python,
+Ruby, and WCF. The messaging protocol for Apache Qpid is AMQP
+(Advanced Message Queuing Protocol). You can read more about Qpid
+here:
+
+ http://qpid.apache.org/
+
+Documentation can be found here:
+
+ http://qpid.apache.org/documentation.html
+
+= GETTING STARTED =
+
+1. Make sure the Qpid Python client libraries are on your
+PYTHONPATH. If you have extracted the archive to the directory
+INSTALLPATH, the following export will work:
+
+$ export PYTHONPATH=${PYTHONPATH}:${INSTALLPATH}/qpid-0.8/python
+
+2. Make sure a broker is running
+
+3. Run the 'hello' example from qpid-0.8/python/examples/api:
+
+$ ./hello
+Hello world!
+
+= EXAMPLES =
+
+The examples/api directory contains several examples.
+
+Read examples/README.txt for further details on these examples.
+
+= RUNNING THE TESTS =
+
+The "tests" directory contains a collection of unit tests for the
+python client. The "tests_0-10", "tests_0-9", and "tests_0-8"
+directories contain protocol level conformance tests for AMQP brokers
+of the specified version.
+
+The qpid-python-test script may be used to run these tests. It will by
+default run the python unit tests and the 0-10 conformance tests:
+
+ 1. Run a broker on the default port
+
+ 2. ./qpid-python-test
+
+If you wish to run the 0-8 or 0-9 conformence tests, they may be
+selected as follows:
+
+ 1. Run a broker on the default port
+
+ 2. ./qpid-python-test tests_0-8.*
+
+ -- or --
+
+ ./qpid-python-test tests_0-9.*
+
+See the qpid-python-test usage for for additional options:
+
+ ./qpid-python-test -h
diff --git a/qpid/python/doc/test-requirements.txt b/qpid/python/doc/test-requirements.txt
new file mode 100644
index 0000000000..5089b49dbe
--- /dev/null
+++ b/qpid/python/doc/test-requirements.txt
@@ -0,0 +1,29 @@
+###############################################################################
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+###############################################################################
+
+ * start and stop server, possibly in different configurations, should
+ at least be able to specify host and port
+
+ * initiate multiple connections/server
+
+ * initiate multiple channels/connection
+
+ * enable positive and negative tests for any protocol interaction
+
+ * test harness must be as robust as possible to spec changes
diff --git a/qpid/python/examples/README.txt b/qpid/python/examples/README.txt
new file mode 100644
index 0000000000..4395160fec
--- /dev/null
+++ b/qpid/python/examples/README.txt
@@ -0,0 +1,42 @@
+The Python Examples
+===================
+
+README.txt -- This file.
+
+api -- Directory containing drain, spout,
+ sever, hello, and hello_xml examples.
+
+api/drain -- A simple messaging client that prints
+ messages from the source specified on
+ the command line.
+
+api/spout -- A simple messaging client that sends
+ messages to the target specified on the
+ command line.
+
+api/server -- An example server that process incoming
+ messages and sends replies.
+
+api/hello -- An example client that sends a message
+ and then receives it.
+
+api/hello_xml -- An example client that sends a message
+ to the xml exchange and then receives
+ it.
+
+
+reservations -- Directory containing an example machine
+ reservation system.
+
+reservations/common.py -- Utility code used by reserve,
+ machine-agent, and inventory scripts.
+
+reservations/reserve -- Messaging client for listing, reserving,
+ and releasing machines.
+
+reservations/machine-agent -- Messaging server that tracks and reports
+ on the status of its host machine and
+ listens for reservation requests.
+
+reservations/inventory -- Messaging server that tracks the last
+ known status of machines.
diff --git a/qpid/python/examples/api/drain b/qpid/python/examples/api/drain
new file mode 100755
index 0000000000..5e30153bc2
--- /dev/null
+++ b/qpid/python/examples/api/drain
@@ -0,0 +1,97 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import optparse
+from qpid.messaging import *
+from qpid.util import URL
+from qpid.log import enable, DEBUG, WARN
+
+parser = optparse.OptionParser(usage="usage: %prog [options] ADDRESS ...",
+ description="Drain messages from the supplied address.")
+parser.add_option("-b", "--broker", default="localhost",
+ help="connect to specified BROKER (default %default)")
+parser.add_option("-c", "--count", type="int",
+ help="number of messages to drain")
+parser.add_option("-f", "--forever", action="store_true",
+ help="ignore timeout and wait forever")
+parser.add_option("-r", "--reconnect", action="store_true",
+ help="enable auto reconnect")
+parser.add_option("-i", "--reconnect-interval", type="float", default=3,
+ help="interval between reconnect attempts")
+parser.add_option("-l", "--reconnect-limit", type="int",
+ help="maximum number of reconnect attempts")
+parser.add_option("-t", "--timeout", type="float", default=0,
+ help="timeout in seconds to wait before exiting (default %default)")
+parser.add_option("-p", "--print", dest="format", default="%(M)s",
+ help="format string for printing messages (default %default)")
+parser.add_option("-v", dest="verbose", action="store_true",
+ help="enable logging")
+
+opts, args = parser.parse_args()
+
+if opts.verbose:
+ enable("qpid", DEBUG)
+else:
+ enable("qpid", WARN)
+
+if args:
+ addr = args.pop(0)
+else:
+ parser.error("address is required")
+if opts.forever:
+ timeout = None
+else:
+ timeout = opts.timeout
+
+class Formatter:
+
+ def __init__(self, message):
+ self.message = message
+ self.environ = {"M": self.message,
+ "P": self.message.properties,
+ "C": self.message.content}
+
+ def __getitem__(self, st):
+ return eval(st, self.environ)
+
+conn = Connection(opts.broker,
+ reconnect=opts.reconnect,
+ reconnect_interval=opts.reconnect_interval,
+ reconnect_limit=opts.reconnect_limit)
+try:
+ conn.open()
+ ssn = conn.session()
+ rcv = ssn.receiver(addr)
+
+ count = 0
+ while not opts.count or count < opts.count:
+ try:
+ msg = rcv.fetch(timeout=timeout)
+ print opts.format % Formatter(msg)
+ count += 1
+ ssn.acknowledge()
+ except Empty:
+ break
+except ReceiverError, e:
+ print e
+except KeyboardInterrupt:
+ pass
+
+conn.close()
diff --git a/qpid/python/examples/api/hello b/qpid/python/examples/api/hello
new file mode 100755
index 0000000000..ad314da19e
--- /dev/null
+++ b/qpid/python/examples/api/hello
@@ -0,0 +1,52 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import sys
+from qpid.messaging import *
+
+if len(sys.argv)<2:
+ broker = "localhost:5672"
+else:
+ broker = sys.argv[1]
+
+if len(sys.argv)<3:
+ address = "amq.topic"
+else:
+ address = sys.argv[2]
+
+connection = Connection(broker)
+
+try:
+ connection.open()
+ session = connection.session()
+
+ sender = session.sender(address)
+ receiver = session.receiver(address)
+
+ sender.send(Message("Hello world!"));
+
+ message = receiver.fetch()
+ print message.content
+ session.acknowledge()
+
+except MessagingError,m:
+ print m
+
+connection.close()
diff --git a/qpid/python/examples/api/hello_xml b/qpid/python/examples/api/hello_xml
new file mode 100755
index 0000000000..ab567ec5dd
--- /dev/null
+++ b/qpid/python/examples/api/hello_xml
@@ -0,0 +1,77 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import sys
+from qpid.messaging import *
+
+broker = "localhost:5672"
+connection = Connection(broker)
+
+try:
+ connection.open()
+ session = connection.session()
+
+# Set up the receiver
+ query = """
+ let $w := ./weather
+ return $w/station = 'Raleigh-Durham International Airport (KRDU)'
+ and $w/temperature_f > 50
+ and $w/temperature_f - $w/dewpoint > 5
+ and $w/wind_speed_mph > 7
+ and $w/wind_speed_mph < 20 """
+
+# query="./weather"
+
+ address = """
+ xml; {
+ create: always,
+ node:{ type: queue },
+ link: {
+ x-bindings: [{ exchange: xml, key: weather, arguments: { xquery: %r} }]
+ }
+ }
+ """ % query
+
+ receiver = session.receiver(address)
+
+# Send an observation
+
+ observations = """
+ <weather>
+ <station>Raleigh-Durham International Airport (KRDU)</station>
+ <wind_speed_mph>16</wind_speed_mph>
+ <temperature_f>70</temperature_f>
+ <dewpoint>35</dewpoint>
+ </weather> """
+
+ message = Message(subject="weather", content=observations)
+ sender = session.sender("xml")
+ sender.send(message)
+
+# Retrieve matching message from the receiver and print it
+
+ message = receiver.fetch(timeout=1)
+ print message.content
+ session.acknowledge()
+
+except MessagingError,m:
+ print m
+
+connection.close()
diff --git a/qpid/python/examples/api/server b/qpid/python/examples/api/server
new file mode 100755
index 0000000000..78d812bfd2
--- /dev/null
+++ b/qpid/python/examples/api/server
@@ -0,0 +1,95 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import optparse, sys, traceback
+from qpid.messaging import *
+from qpid.util import URL
+from subprocess import Popen, STDOUT, PIPE
+from qpid.log import enable, DEBUG, WARN
+
+parser = optparse.OptionParser(usage="usage: %prog [options] ADDRESS ...",
+ description="handle requests from the supplied address.")
+parser.add_option("-b", "--broker", default="localhost",
+ help="connect to specified BROKER (default %default)")
+parser.add_option("-r", "--reconnect", action="store_true",
+ help="enable auto reconnect")
+parser.add_option("-i", "--reconnect-interval", type="float", default=3,
+ help="interval between reconnect attempts")
+parser.add_option("-l", "--reconnect-limit", type="int",
+ help="maximum number of reconnect attempts")
+parser.add_option("-v", dest="verbose", action="store_true",
+ help="enable logging")
+
+opts, args = parser.parse_args()
+
+if opts.verbose:
+ enable("qpid", DEBUG)
+else:
+ enable("qpid", WARN)
+
+if args:
+ addr = args.pop(0)
+else:
+ parser.error("address is required")
+
+conn = Connection(opts.broker,
+ reconnect=opts.reconnect,
+ reconnect_interval=opts.reconnect_interval,
+ reconnect_limit=opts.reconnect_limit)
+def dispatch(msg):
+ msg_type = msg.properties.get("type")
+ if msg_type == "shell":
+ proc = Popen(msg.content, shell=True, stderr=STDOUT, stdin=PIPE, stdout=PIPE)
+ output, _ = proc.communicate()
+ result = Message(output)
+ result.properties["exit"] = proc.returncode
+ elif msg_type == "eval":
+ try:
+ content = eval(msg.content)
+ except:
+ content = traceback.format_exc()
+ result = Message(content)
+ else:
+ result = Message("unrecognized message type: %s" % msg_type)
+ return result
+
+try:
+ conn.open()
+ ssn = conn.session()
+ rcv = ssn.receiver(addr)
+
+ while True:
+ msg = rcv.fetch()
+ response = dispatch(msg)
+ snd = None
+ try:
+ snd = ssn.sender(msg.reply_to)
+ snd.send(response)
+ except SendError, e:
+ print e
+ if snd is not None:
+ snd.close()
+ ssn.acknowledge()
+except ReceiverError, e:
+ print e
+except KeyboardInterrupt:
+ pass
+
+conn.close()
diff --git a/qpid/python/examples/api/spout b/qpid/python/examples/api/spout
new file mode 100755
index 0000000000..6584b853fc
--- /dev/null
+++ b/qpid/python/examples/api/spout
@@ -0,0 +1,133 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import optparse, time
+from qpid.messaging import *
+from qpid.util import URL
+from qpid.log import enable, DEBUG, WARN
+
+def nameval(st):
+ idx = st.find("=")
+ if idx >= 0:
+ name = st[0:idx]
+ value = st[idx+1:]
+ else:
+ name = st
+ value = None
+ return name, value
+
+parser = optparse.OptionParser(usage="usage: %prog [options] ADDRESS [ CONTENT ... ]",
+ description="Send messages to the supplied address.")
+parser.add_option("-b", "--broker", default="localhost",
+ help="connect to specified BROKER (default %default)")
+parser.add_option("-r", "--reconnect", action="store_true",
+ help="enable auto reconnect")
+parser.add_option("-i", "--reconnect-interval", type="float", default=3,
+ help="interval between reconnect attempts")
+parser.add_option("-l", "--reconnect-limit", type="int",
+ help="maximum number of reconnect attempts")
+parser.add_option("-c", "--count", type="int", default=1,
+ help="stop after count messages have been sent, zero disables (default %default)")
+parser.add_option("-d", "--durable", action="store_true",
+ help="make the message persistent")
+parser.add_option("-t", "--timeout", type="float", default=None,
+ help="exit after the specified time")
+parser.add_option("-I", "--id", help="use the supplied id instead of generating one")
+parser.add_option("-S", "--subject", help="specify a subject")
+parser.add_option("-R", "--reply-to", help="specify reply-to address")
+parser.add_option("-P", "--property", dest="properties", action="append", default=[],
+ metavar="NAME=VALUE", help="specify message property")
+parser.add_option("-M", "--map", dest="entries", action="append", default=[],
+ metavar="KEY=VALUE",
+ help="specify map entry for message body")
+parser.add_option("-v", dest="verbose", action="store_true",
+ help="enable logging")
+
+opts, args = parser.parse_args()
+
+if opts.verbose:
+ enable("qpid", DEBUG)
+else:
+ enable("qpid", WARN)
+
+if opts.id is None:
+ spout_id = str(uuid4())
+else:
+ spout_id = opts.id
+if args:
+ addr = args.pop(0)
+else:
+ parser.error("address is required")
+
+content = None
+content_type = None
+
+if args:
+ text = " ".join(args)
+else:
+ text = None
+
+if opts.entries:
+ content = {}
+ if text:
+ content["text"] = text
+ for e in opts.entries:
+ name, val = nameval(e)
+ content[name] = val
+else:
+ content = text
+ # no entries were supplied, so assume text/plain for
+ # compatibility with java (and other) clients
+ content_type = "text/plain"
+
+conn = Connection(opts.broker,
+ reconnect=opts.reconnect,
+ reconnect_interval=opts.reconnect_interval,
+ reconnect_limit=opts.reconnect_limit)
+try:
+ conn.open()
+ ssn = conn.session()
+ snd = ssn.sender(addr)
+
+ count = 0
+ start = time.time()
+ while (opts.count == 0 or count < opts.count) and \
+ (opts.timeout is None or time.time() - start < opts.timeout):
+ msg = Message(subject=opts.subject,
+ reply_to=opts.reply_to,
+ content=content)
+ if opts.durable:
+ msg.durable = True
+ if content_type is not None:
+ msg.content_type = content_type
+ msg.properties["spout-id"] = "%s:%s" % (spout_id, count)
+ for p in opts.properties:
+ name, val = nameval(p)
+ msg.properties[name] = val
+
+ snd.send(msg)
+ count += 1
+ print msg
+except SendError, e:
+ print e
+except KeyboardInterrupt:
+ pass
+
+conn.close()
diff --git a/qpid/python/examples/api/statistics.py b/qpid/python/examples/api/statistics.py
new file mode 100644
index 0000000000..e095920e90
--- /dev/null
+++ b/qpid/python/examples/api/statistics.py
@@ -0,0 +1,139 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import time
+
+TS = "ts"
+TIME_SEC = 1000000000
+MILLISECOND = 1000
+
+class Statistic:
+ def message(self, msg):
+ return
+ def report(self):
+ return ""
+ def header(self):
+ return ""
+
+
+class Throughput(Statistic):
+ def __init__(self):
+ self.messages = 0
+ self.started = False
+
+ def message(self, m):
+ self.messages += 1
+ if not self.started:
+ self.start = time.time()
+ self.started = True
+
+ def header(self):
+ return "tp(m/s)"
+
+ def report(self):
+ if self.started:
+ elapsed = time.time() - self.start
+ return str(int(self.messages/elapsed))
+ else:
+ return "0"
+
+
+class ThroughputAndLatency(Throughput):
+ def __init__(self):
+ Throughput.__init__(self)
+ self.total = 0.0
+ self.min = float('inf')
+ self.max = -float('inf')
+ self.samples = 0
+
+ def message(self, m):
+ Throughput.message(self, m)
+ if TS in m.properties:
+ self.samples+=1
+ latency = MILLISECOND * (time.time() - float(m.properties[TS])/TIME_SEC)
+ if latency > 0:
+ self.total += latency
+ if latency < self.min:
+ self.min = latency
+ if latency > self.max:
+ self.max = latency
+
+ def header(self):
+# Throughput.header(self)
+ return "%s\tl-min\tl-max\tl-avg" % Throughput.header(self)
+
+ def report(self):
+ output = Throughput.report(self)
+ if (self.samples > 0):
+ output += "\t%.2f\t%.2f\t%.2f" %(self.min, self.max, self.total/self.samples)
+ return output
+
+
+# Report batch and overall statistics
+class ReporterBase:
+ def __init__(self, batch, wantHeader):
+ self.batchSize = batch
+ self.batchCount = 0
+ self.headerPrinted = not wantHeader
+ self.overall = None
+ self.batch = None
+
+ def create(self):
+ return
+
+ # Count message in the statistics
+ def message(self, m):
+ if self.overall == None:
+ self.overall = self.create()
+ self.overall.message(m)
+ if self.batchSize:
+ if self.batch == None:
+ self.batch = self.create()
+ self.batch.message(m)
+ self.batchCount+=1
+ if self.batchCount == self.batchSize:
+ self.header()
+ print self.batch.report()
+ self.create()
+ self.batchCount = 0
+
+ # Print overall report.
+ def report(self):
+ if self.overall == None:
+ self.overall = self.create()
+ self.header()
+ print self.overall.report()
+
+ def header(self):
+ if not self.headerPrinted:
+ if self.overall == None:
+ self.overall = self.create()
+ print self.overall.header()
+ self.headerPrinted = True
+
+
+class Reporter(ReporterBase):
+ def __init__(self, batchSize, wantHeader, Stats):
+ ReporterBase.__init__(self, batchSize, wantHeader)
+ self.__stats = Stats
+
+ def create(self):
+ ClassName = self.__stats.__class__
+ return ClassName()
diff --git a/qpid/python/examples/reservations/common.py b/qpid/python/examples/reservations/common.py
new file mode 100644
index 0000000000..12f07e1c92
--- /dev/null
+++ b/qpid/python/examples/reservations/common.py
@@ -0,0 +1,80 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import traceback
+from fnmatch import fnmatch
+from qpid.messaging import *
+
+class Dispatcher:
+
+ def unhandled(self, msg):
+ print "UNHANDLED MESSAGE: %s" % msg
+
+ def ignored(self, msg):
+ return False
+
+ def dispatch(self, msg):
+ try:
+ if self.ignored(msg):
+ return ()
+ else:
+ type = msg.properties.get("type")
+ replies = getattr(self, "do_%s" % type, self.unhandled)(msg)
+ if replies is None:
+ return ()
+ else:
+ return replies
+ except:
+ traceback.print_exc()
+ return ()
+
+ def run(self, session):
+ while self.running():
+ msg = session.next_receiver().fetch()
+ replies = self.dispatch(msg)
+
+ count = len(replies)
+ sequence = 1
+ for to, r in replies:
+ r.correlation_id = msg.correlation_id
+ r.properties["count"] = count
+ r.properties["sequence"] = sequence
+ sequence += 1
+ try:
+ snd = session.sender(to)
+ snd.send(r)
+ except SendError, e:
+ print e
+ finally:
+ snd.close()
+
+ session.acknowledge(msg)
+
+def get_status(msg):
+ return msg.content["identity"], msg.content["status"], msg.content["owner"]
+
+FREE = "free"
+BUSY = "busy"
+
+def match(value, patterns):
+ for p in patterns:
+ if fnmatch(value, p):
+ return True
+ return False
diff --git a/qpid/python/examples/reservations/inventory b/qpid/python/examples/reservations/inventory
new file mode 100755
index 0000000000..0a49643e5f
--- /dev/null
+++ b/qpid/python/examples/reservations/inventory
@@ -0,0 +1,94 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import optparse, traceback
+from qpid.messaging import *
+from qpid.log import enable, DEBUG, WARN
+from common import *
+
+parser = optparse.OptionParser(usage="usage: %prog [options]",
+ description="machine inventory agent")
+parser.add_option("-b", "--broker", default="localhost",
+ help="connect to specified BROKER (default %default)")
+parser.add_option("-d", "--database",
+ help="database file for persistent machine status")
+parser.add_option("-a", "--address", default="reservations",
+ help="address for reservation requests")
+parser.add_option("-v", dest="verbose", action="store_true",
+ help="enable verbose logging")
+
+opts, args = parser.parse_args()
+
+if opts.verbose:
+ enable("qpid", DEBUG)
+else:
+ enable("qpid", WARN)
+
+conn = Connection.establish(opts.broker, reconnect=True, reconnect_interval=1)
+
+class Inventory(Dispatcher):
+
+ def __init__(self):
+ self.agents = {}
+
+ def running(self):
+ return True
+
+ def do_status(self, msg):
+ id, status, owner = get_status(msg)
+ self.agents[id] = (status, owner)
+
+ def do_query(self, msg):
+ patterns = msg.content["identity"]
+ result = []
+ for id, (status, owner) in self.agents.items():
+ if match(id, patterns):
+ r = Message(properties = {
+ "type": "status"
+ },
+ content = {
+ "identity": id,
+ "status": status,
+ "owner": owner
+ })
+ result.append((msg.reply_to, r))
+ continue
+ if not result:
+ result.append((msg.reply_to,
+ Message(properties = {"type": "empty"})))
+ return result
+
+ def ignored(self, msg):
+ type = msg.properties.get("type")
+ return type not in ("status", "query")
+
+try:
+ ssn = conn.session()
+ rcv = ssn.receiver(opts.address, capacity = 10)
+ snd = ssn.sender(opts.address)
+ snd.send(Message(reply_to = opts.address,
+ properties = {"type": "discover", "identity": ["*"]}))
+
+ inv = Inventory()
+ inv.run(ssn)
+except KeyboardInterrupt:
+ pass
+finally:
+ conn.close()
diff --git a/qpid/python/examples/reservations/machine-agent b/qpid/python/examples/reservations/machine-agent
new file mode 100755
index 0000000000..a221a8b6de
--- /dev/null
+++ b/qpid/python/examples/reservations/machine-agent
@@ -0,0 +1,103 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import optparse, socket
+from qpid.messaging import *
+from qpid.log import enable, DEBUG, WARN
+from common import *
+
+host = socket.gethostname()
+
+parser = optparse.OptionParser(usage="usage: %prog [options]",
+ description="machine reservation agent")
+parser.add_option("-b", "--broker", default="localhost",
+ help="connect to specified BROKER (default %default)")
+parser.add_option("-d", "--database",
+ help="database file for persistent machine status")
+parser.add_option("-a", "--address", default="reservations",
+ help="address for reservation requests")
+parser.add_option("-i", "--identity", default=host,
+ help="resource id (default %default)")
+parser.add_option("-v", dest="verbose", action="store_true",
+ help="enable verbose logging")
+
+opts, args = parser.parse_args()
+
+if opts.verbose:
+ enable("qpid", DEBUG)
+else:
+ enable("qpid", WARN)
+
+conn = Connection.establish(opts.broker, reconnect=True, reconnect_interval=1)
+
+
+class Agent(Dispatcher):
+
+ def __init__(self, identity):
+ self.identity = identity
+ self.status = FREE
+ self.owner = None
+
+ def running(self):
+ return True
+
+ def get_status(self):
+ msg = Message(properties = {"type": "status"},
+ content = {"identity": self.identity,
+ "status": self.status,
+ "owner": self.owner})
+ return msg
+
+ def do_discover(self, msg):
+ r = self.get_status()
+ return [(msg.reply_to, r)]
+
+ def do_reserve(self, msg):
+ if self.status == FREE:
+ self.owner = msg.content["owner"]
+ self.status = BUSY
+ return self.do_discover(msg)
+
+ def do_release(self, msg):
+ if self.owner == msg.content["owner"]:
+ self.status = FREE
+ self.owner = None
+ return self.do_discover(msg)
+
+ def ignored(self, msg):
+ patterns = msg.properties.get("identity")
+ type = msg.properties.get("type")
+ if patterns and match(self.identity, patterns):
+ return type == "status"
+ else:
+ return True
+
+try:
+ ssn = conn.session()
+ rcv = ssn.receiver(opts.address)
+ rcv.capacity = 10
+ snd = ssn.sender(opts.address)
+ agent = Agent(opts.identity)
+ snd.send(agent.get_status())
+ agent.run(ssn)
+except KeyboardInterrupt:
+ pass
+finally:
+ conn.close()
diff --git a/qpid/python/examples/reservations/reserve b/qpid/python/examples/reservations/reserve
new file mode 100755
index 0000000000..68e7fee912
--- /dev/null
+++ b/qpid/python/examples/reservations/reserve
@@ -0,0 +1,197 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import optparse, os, sys, time
+from uuid import uuid4
+from qpid.messaging import *
+from qpid.log import enable, DEBUG, WARN
+from common import *
+
+parser = optparse.OptionParser(usage="usage: %prog [options] PATTERN ...",
+ description="reserve a machine")
+parser.add_option("-b", "--broker", default="localhost",
+ help="connect to specified BROKER (default %default)")
+parser.add_option("-a", "--address", default="reservations",
+ help="address for reservation requests")
+parser.add_option("-r", "--release", action="store_true",
+ help="release any machines matching the pattern")
+parser.add_option("-s", "--status", action="store_true",
+ help="list machine status")
+parser.add_option("-d", "--discover", action="store_true",
+ help="use discovery instead of inventory")
+parser.add_option("-o", "--owner", default=os.environ["USER"],
+ help="the holder of the reservation")
+parser.add_option("-n", "--number", type=int, default=1,
+ help="the number of machines to reserve")
+parser.add_option("-t", "--timeout", type=float, default=10,
+ help="timeout in seconds to wait for resources")
+parser.add_option("-v", dest="verbose", action="store_true",
+ help="enable verbose logging")
+
+opts, args = parser.parse_args()
+
+if opts.verbose:
+ enable("qpid", DEBUG)
+else:
+ enable("qpid", WARN)
+
+if args:
+ patterns = args
+else:
+ patterns = ["*"]
+
+conn = Connection.establish(opts.broker)
+
+if opts.release:
+ request_type = "release"
+ candidate_status = BUSY
+ candidate_owner = opts.owner
+else:
+ request_type = "reserve"
+ candidate_status = FREE
+ candidate_owner = None
+
+class Requester(Dispatcher):
+
+ def __init__(self):
+ self.agents = {}
+ self.requests = set()
+ self.outstanding = set()
+
+ def agent_status(self, id):
+ status, owner = self.agents[id]
+ if owner:
+ return "%s %s(%s)" % (id, status, owner)
+ else:
+ return "%s %s" % (id, status)
+
+ def correlation(self, cid):
+ self.requests.add(cid)
+ self.outstanding.add(cid)
+
+ def ignored(self, msg):
+ return msg.properties.get("type") not in ("status", "empty") or \
+ msg.correlation_id not in self.requests
+
+ def do_status(self, msg):
+ id, status, owner = get_status(msg)
+ self.agents[id] = (status, owner)
+
+ if opts.status:
+ print self.agent_status(id)
+
+ def do_empty(self, msg):
+ print "no matching resources"
+
+ def candidates(self, candidate_status, candidate_owner):
+ for id, (status, owner) in self.agents.items():
+ if status == candidate_status and owner == candidate_owner:
+ yield id
+
+ def dispatch(self, msg):
+ result = Dispatcher.dispatch(self, msg)
+ count = msg.properties.get("count")
+ sequence = msg.properties.get("sequence")
+ if count and sequence == count:
+ self.outstanding.discard(msg.correlation_id)
+ return result
+
+try:
+ ssn = conn.session()
+ rcv = ssn.receiver(opts.address, capacity=10)
+ snd = ssn.sender(opts.address)
+
+ correlation_id = str(uuid4())
+
+ if opts.discover:
+ properties = {"type": "discover", "identity": patterns}
+ content = None
+ else:
+ properties = {"type": "query"}
+ content = {"identity": patterns}
+
+ snd.send(Message(reply_to = opts.address,
+ correlation_id = correlation_id,
+ properties = properties,
+ content = content))
+
+ req = Requester()
+ req.correlation(correlation_id)
+
+ start = time.time()
+ ellapsed = 0
+ requested = set()
+ discovering = opts.discover
+
+ while ellapsed <= opts.timeout and (discovering or req.outstanding):
+ try:
+ msg = rcv.fetch(opts.timeout - ellapsed)
+ ssn.acknowledge(msg)
+ except Empty:
+ continue
+ finally:
+ ellapsed = time.time() - start
+
+ req.dispatch(msg)
+ if not opts.status:
+ if len(requested) < opts.number:
+ for cid in req.candidates(candidate_status, candidate_owner):
+ if cid in requested: continue
+ req_msg = Message(reply_to = opts.address,
+ correlation_id = str(uuid4()),
+ properties = {"type": request_type,
+ "identity": [cid]},
+ content = {"owner": opts.owner})
+ if not requested:
+ print "requesting %s:" % request_type,
+ print cid,
+ sys.stdout.flush()
+ req.correlation(req_msg.correlation_id)
+ snd.send(req_msg)
+ requested.add(cid)
+ else:
+ discovering = False
+
+ if requested:
+ print
+ owners = {}
+ for id in requested:
+ st, ow = req.agents[id]
+ if not owners.has_key(ow):
+ owners[ow] = []
+ owners[ow].append(id)
+ keys = list(owners.keys())
+ keys.sort()
+ for k in keys:
+ owners[k].sort()
+ v = ", ".join(owners[k])
+ if k is None:
+ print "free: %s" % v
+ else:
+ print "owner %s: %s" % (k, v)
+ elif req.agents and not opts.status:
+ print "no available resources"
+
+ if req.outstanding:
+ print "request timed out"
+except KeyboardInterrupt:
+ pass
+finally:
+ conn.close()
diff --git a/qpid/python/mllib/__init__.py b/qpid/python/mllib/__init__.py
new file mode 100644
index 0000000000..af192df1d1
--- /dev/null
+++ b/qpid/python/mllib/__init__.py
@@ -0,0 +1,86 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+This module provides document parsing and transformation utilities for
+both SGML and XML.
+"""
+
+import os, dom, transforms, parsers, sys
+import xml.sax, types
+from xml.sax.handler import ErrorHandler
+from xml.sax.xmlreader import InputSource
+from cStringIO import StringIO
+
+def transform(node, *args):
+ result = node
+ for t in args:
+ if isinstance(t, types.ClassType):
+ t = t()
+ result = result.dispatch(t)
+ return result
+
+def sgml_parse(source):
+ if isinstance(source, basestring):
+ source = StringIO(source)
+ fname = "<string>"
+ elif hasattr(source, "name"):
+ fname = source.name
+ p = parsers.SGMLParser()
+ num = 1
+ for line in source:
+ p.feed(line)
+ p.parser.line(fname, num, None)
+ num += 1
+ p.close()
+ return p.parser.tree
+
+class Resolver:
+
+ def __init__(self, path):
+ self.path = path
+
+ def resolveEntity(self, publicId, systemId):
+ for p in self.path:
+ fname = os.path.join(p, systemId)
+ if os.path.exists(fname):
+ source = InputSource(systemId)
+ source.setByteStream(open(fname))
+ return source
+ return InputSource(systemId)
+
+def xml_parse(filename, path=()):
+ if sys.version_info[0:2] == (2,3):
+ # XXX: this is for older versions of python
+ from urllib import pathname2url
+ source = "file:%s" % pathname2url( os.path.abspath( filename ) )
+ else:
+ source = filename
+ h = parsers.XMLParser()
+ p = xml.sax.make_parser()
+ p.setContentHandler(h)
+ p.setErrorHandler(ErrorHandler())
+ p.setEntityResolver(Resolver(path))
+ p.parse(source)
+ return h.parser.tree
+
+def sexp(node):
+ s = transforms.Sexp()
+ node.dispatch(s)
+ return s.out
diff --git a/qpid/python/mllib/dom.py b/qpid/python/mllib/dom.py
new file mode 100644
index 0000000000..486f7082e1
--- /dev/null
+++ b/qpid/python/mllib/dom.py
@@ -0,0 +1,310 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+Simple DOM for both SGML and XML documents.
+"""
+
+from __future__ import division
+from __future__ import generators
+from __future__ import nested_scopes
+
+import transforms
+
+class Container:
+
+ def __init__(self):
+ self.children = []
+
+ def add(self, child):
+ child.parent = self
+ self.children.append(child)
+
+ def extend(self, children):
+ for child in children:
+ child.parent = self
+ self.children.append(child)
+
+class Component:
+
+ def __init__(self):
+ self.parent = None
+
+ def index(self):
+ if self.parent:
+ return self.parent.children.index(self)
+ else:
+ return 0
+
+ def _line(self, file, line, column):
+ self.file = file
+ self.line = line
+ self.column = column
+
+class DispatchError(Exception):
+
+ def __init__(self, scope, f):
+ msg = "no such attribtue"
+
+class Dispatcher:
+
+ def is_type(self, type):
+ cls = self
+ while cls != None:
+ if cls.type == type:
+ return True
+ cls = cls.base
+ return False
+
+ def dispatch(self, f, attrs = ""):
+ cls = self
+ while cls != None:
+ if hasattr(f, cls.type):
+ return getattr(f, cls.type)(self)
+ else:
+ cls = cls.base
+
+ cls = self
+ while cls != None:
+ if attrs:
+ sep = ", "
+ if cls.base == None:
+ sep += "or "
+ else:
+ sep = ""
+ attrs += "%s'%s'" % (sep, cls.type)
+ cls = cls.base
+
+ raise AttributeError("'%s' object has no attribute %s" %
+ (f.__class__.__name__, attrs))
+
+class Node(Container, Component, Dispatcher):
+
+ type = "node"
+ base = None
+
+ def __init__(self):
+ Container.__init__(self)
+ Component.__init__(self)
+ self.query = Query([self])
+
+ def __getitem__(self, name):
+ for nd in self.query[name]:
+ return nd
+
+ def text(self):
+ return self.dispatch(transforms.Text())
+
+ def tag(self, name, *attrs, **kwargs):
+ t = Tag(name, *attrs, **kwargs)
+ self.add(t)
+ return t
+
+ def data(self, s):
+ d = Data(s)
+ self.add(d)
+ return d
+
+ def entity(self, s):
+ e = Entity(s)
+ self.add(e)
+ return e
+
+class Tree(Node):
+
+ type = "tree"
+ base = Node
+
+class Tag(Node):
+
+ type = "tag"
+ base = Node
+
+ def __init__(self, _name, *attrs, **kwargs):
+ Node.__init__(self)
+ self.name = _name
+ self.attrs = list(attrs)
+ self.attrs.extend(kwargs.items())
+ self.singleton = False
+
+ def get_attr(self, name):
+ for k, v in self.attrs:
+ if name == k:
+ return v
+
+ def _idx(self, attr):
+ idx = 0
+ for k, v in self.attrs:
+ if k == attr:
+ return idx
+ idx += 1
+ return None
+
+ def set_attr(self, name, value):
+ idx = self._idx(name)
+ if idx is None:
+ self.attrs.append((name, value))
+ else:
+ self.attrs[idx] = (name, value)
+
+ def dispatch(self, f):
+ try:
+ attr = "do_" + self.name
+ method = getattr(f, attr)
+ except AttributeError:
+ return Dispatcher.dispatch(self, f, "'%s'" % attr)
+ return method(self)
+
+class Leaf(Component, Dispatcher):
+
+ type = "leaf"
+ base = None
+
+ def __init__(self, data):
+ assert isinstance(data, basestring)
+ self.data = data
+
+class Data(Leaf):
+ type = "data"
+ base = Leaf
+
+class Entity(Leaf):
+ type = "entity"
+ base = Leaf
+
+class Character(Leaf):
+ type = "character"
+ base = Leaf
+
+class Comment(Leaf):
+ type = "comment"
+ base = Leaf
+
+###################
+## Query Classes ##
+###########################################################################
+
+class Adder:
+
+ def __add__(self, other):
+ return Sum(self, other)
+
+class Sum(Adder):
+
+ def __init__(self, left, right):
+ self.left = left
+ self.right = right
+
+ def __iter__(self):
+ for x in self.left:
+ yield x
+ for x in self.right:
+ yield x
+
+class View(Adder):
+
+ def __init__(self, source):
+ self.source = source
+
+class Filter(View):
+
+ def __init__(self, predicate, source):
+ View.__init__(self, source)
+ self.predicate = predicate
+
+ def __iter__(self):
+ for nd in self.source:
+ if self.predicate(nd): yield nd
+
+class Flatten(View):
+
+ def __iter__(self):
+ sources = [iter(self.source)]
+ while sources:
+ try:
+ nd = sources[-1].next()
+ if isinstance(nd, Tree):
+ sources.append(iter(nd.children))
+ else:
+ yield nd
+ except StopIteration:
+ sources.pop()
+
+class Children(View):
+
+ def __iter__(self):
+ for nd in self.source:
+ for child in nd.children:
+ yield child
+
+class Attributes(View):
+
+ def __iter__(self):
+ for nd in self.source:
+ for a in nd.attrs:
+ yield a
+
+class Values(View):
+
+ def __iter__(self):
+ for name, value in self.source:
+ yield value
+
+def flatten_path(path):
+ if isinstance(path, basestring):
+ for part in path.split("/"):
+ yield part
+ elif callable(path):
+ yield path
+ else:
+ for p in path:
+ for fp in flatten_path(p):
+ yield fp
+
+class Query(View):
+
+ def __iter__(self):
+ for nd in self.source:
+ yield nd
+
+ def __getitem__(self, path):
+ query = self.source
+ for p in flatten_path(path):
+ if callable(p):
+ select = Query
+ pred = p
+ source = query
+ elif isinstance(p, basestring):
+ if p[0] == "@":
+ select = Values
+ pred = lambda x, n=p[1:]: x[0] == n
+ source = Attributes(query)
+ elif p[0] == "#":
+ select = Query
+ pred = lambda x, t=p[1:]: x.is_type(t)
+ source = Children(query)
+ else:
+ select = Query
+ pred = lambda x, n=p: isinstance(x, Tag) and x.name == n
+ source = Flatten(Children(query))
+ else:
+ raise ValueError(p)
+ query = select(Filter(pred, source))
+
+ return query
diff --git a/qpid/python/mllib/parsers.py b/qpid/python/mllib/parsers.py
new file mode 100644
index 0000000000..3e7cc10dc2
--- /dev/null
+++ b/qpid/python/mllib/parsers.py
@@ -0,0 +1,139 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+Parsers for SGML and XML to dom.
+"""
+
+import sgmllib, xml.sax.handler
+from dom import *
+
+class Parser:
+
+ def __init__(self):
+ self.tree = Tree()
+ self.node = self.tree
+ self.nodes = []
+
+ def line(self, id, lineno, colno):
+ while self.nodes:
+ n = self.nodes.pop()
+ n._line(id, lineno, colno)
+
+ def add(self, node):
+ self.node.add(node)
+ self.nodes.append(node)
+
+ def start(self, name, attrs):
+ tag = Tag(name, *attrs)
+ self.add(tag)
+ self.node = tag
+
+ def end(self, name):
+ self.balance(name)
+ self.node = self.node.parent
+
+ def data(self, data):
+ children = self.node.children
+ if children and isinstance(children[-1], Data):
+ children[-1].data += data
+ else:
+ self.add(Data(data))
+
+ def comment(self, comment):
+ self.add(Comment(comment))
+
+ def entity(self, ref):
+ self.add(Entity(ref))
+
+ def character(self, ref):
+ self.add(Character(ref))
+
+ def balance(self, name = None):
+ while self.node != self.tree and name != self.node.name:
+ self.node.parent.extend(self.node.children)
+ del self.node.children[:]
+ self.node.singleton = True
+ self.node = self.node.parent
+
+
+class SGMLParser(sgmllib.SGMLParser):
+
+ def __init__(self, entitydefs = None):
+ sgmllib.SGMLParser.__init__(self)
+ if entitydefs == None:
+ self.entitydefs = {}
+ else:
+ self.entitydefs = entitydefs
+ self.parser = Parser()
+
+ def unknown_starttag(self, name, attrs):
+ self.parser.start(name, attrs)
+
+ def handle_data(self, data):
+ self.parser.data(data)
+
+ def handle_comment(self, comment):
+ self.parser.comment(comment)
+
+ def unknown_entityref(self, ref):
+ self.parser.entity(ref)
+
+ def unknown_charref(self, ref):
+ self.parser.character(ref)
+
+ def unknown_endtag(self, name):
+ self.parser.end(name)
+
+ def close(self):
+ sgmllib.SGMLParser.close(self)
+ self.parser.balance()
+ assert self.parser.node == self.parser.tree
+
+class XMLParser(xml.sax.handler.ContentHandler):
+
+ def __init__(self):
+ self.parser = Parser()
+ self.locator = None
+
+ def line(self):
+ if self.locator != None:
+ self.parser.line(self.locator.getSystemId(),
+ self.locator.getLineNumber(),
+ self.locator.getColumnNumber())
+
+ def setDocumentLocator(self, locator):
+ self.locator = locator
+
+ def startElement(self, name, attrs):
+ self.parser.start(name, attrs.items())
+ self.line()
+
+ def endElement(self, name):
+ self.parser.end(name)
+ self.line()
+
+ def characters(self, content):
+ self.parser.data(content)
+ self.line()
+
+ def skippedEntity(self, name):
+ self.parser.entity(name)
+ self.line()
+
diff --git a/qpid/python/mllib/transforms.py b/qpid/python/mllib/transforms.py
new file mode 100644
index 0000000000..69d99125e3
--- /dev/null
+++ b/qpid/python/mllib/transforms.py
@@ -0,0 +1,164 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+Useful transforms for dom objects.
+"""
+
+import dom
+from cStringIO import StringIO
+
+class Visitor:
+
+ def descend(self, node):
+ for child in node.children:
+ child.dispatch(self)
+
+ def node(self, node):
+ self.descend(node)
+
+ def leaf(self, leaf):
+ pass
+
+class Identity:
+
+ def descend(self, node):
+ result = []
+ for child in node.children:
+ result.append(child.dispatch(self))
+ return result
+
+ def default(self, tag):
+ result = dom.Tag(tag.name, *tag.attrs)
+ result.extend(self.descend(tag))
+ return result
+
+ def tree(self, tree):
+ result = dom.Tree()
+ result.extend(self.descend(tree))
+ return result
+
+ def tag(self, tag):
+ return self.default(tag)
+
+ def leaf(self, leaf):
+ return leaf.__class__(leaf.data)
+
+class Sexp(Identity):
+
+ def __init__(self):
+ self.stack = []
+ self.level = 0
+ self.out = ""
+
+ def open(self, s):
+ self.out += "(%s" % s
+ self.level += len(s) + 1
+ self.stack.append(s)
+
+ def line(self, s = ""):
+ self.out = self.out.rstrip()
+ self.out += "\n" + " "*self.level + s
+
+ def close(self):
+ s = self.stack.pop()
+ self.level -= len(s) + 1
+ self.out = self.out.rstrip()
+ self.out += ")"
+
+ def tree(self, tree):
+ self.open("+ ")
+ for child in tree.children:
+ self.line(); child.dispatch(self)
+ self.close()
+
+ def tag(self, tag):
+ self.open("Node(%s) " % tag.name)
+ for child in tag.children:
+ self.line(); child.dispatch(self)
+ self.close()
+
+ def leaf(self, leaf):
+ self.line("%s(%s)" % (leaf.__class__.__name__, leaf.data))
+
+class Output:
+
+ def descend(self, node):
+ out = StringIO()
+ for child in node.children:
+ out.write(child.dispatch(self))
+ return out.getvalue()
+
+ def default(self, tag):
+ out = StringIO()
+ out.write("<%s" % tag.name)
+ for k, v in tag.attrs:
+ out.write(' %s="%s"' % (k, v))
+ out.write(">")
+ out.write(self.descend(tag))
+ if not tag.singleton:
+ out.write("</%s>" % tag.name)
+ return out.getvalue()
+
+ def tree(self, tree):
+ return self.descend(tree)
+
+ def tag(self, tag):
+ return self.default(tag)
+
+ def data(self, leaf):
+ return leaf.data
+
+ def entity(self, leaf):
+ return "&%s;" % leaf.data
+
+ def character(self, leaf):
+ raise Exception("TODO")
+
+ def comment(self, leaf):
+ return "<!-- %s -->" % leaf.data
+
+class Empty(Output):
+
+ def tag(self, tag):
+ return self.descend(tag)
+
+ def data(self, leaf):
+ return ""
+
+ def entity(self, leaf):
+ return ""
+
+ def character(self, leaf):
+ return ""
+
+ def comment(self, leaf):
+ return ""
+
+class Text(Empty):
+
+ def data(self, leaf):
+ return leaf.data
+
+ def entity(self, leaf):
+ return "&%s;" % leaf.data
+
+ def character(self, leaf):
+ # XXX: is this right?
+ return "&#%s;" % leaf.data
diff --git a/qpid/python/qpid-python-test b/qpid/python/qpid-python-test
new file mode 100755
index 0000000000..dfe6a6fc7a
--- /dev/null
+++ b/qpid/python/qpid-python-test
@@ -0,0 +1,639 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+# TODO: summarize, test harness preconditions (e.g. broker is alive)
+
+import logging, optparse, os, struct, sys, time, traceback, types
+from fnmatch import fnmatchcase as match
+from getopt import GetoptError
+from logging import getLogger, StreamHandler, Formatter, Filter, \
+ WARN, DEBUG, ERROR
+from qpid.harness import Skipped
+from qpid.util import URL
+
+levels = {
+ "DEBUG": DEBUG,
+ "WARN": WARN,
+ "ERROR": ERROR
+ }
+
+sorted_levels = [(v, k) for k, v in levels.items()]
+sorted_levels.sort()
+sorted_levels = [v for k, v in sorted_levels]
+
+parser = optparse.OptionParser(usage="usage: %prog [options] PATTERN ...",
+ description="Run tests matching the specified PATTERNs.")
+parser.add_option("-l", "--list", action="store_true", default=False,
+ help="list tests instead of executing them")
+parser.add_option("-b", "--broker", default="localhost",
+ help="run tests against BROKER (default %default)")
+parser.add_option("-f", "--log-file", metavar="FILE", help="log output to FILE")
+parser.add_option("-v", "--log-level", metavar="LEVEL", default="WARN",
+ help="only display log messages of LEVEL or higher severity: "
+ "%s (default %%default)" % ", ".join(sorted_levels))
+parser.add_option("-c", "--log-category", metavar="CATEGORY", action="append",
+ dest="log_categories", default=[],
+ help="log only categories matching CATEGORY pattern")
+parser.add_option("-m", "--module", action="append", default=[],
+ dest="modules", help="add module to test search path")
+parser.add_option("-i", "--ignore", action="append", default=[],
+ help="ignore tests matching IGNORE pattern")
+parser.add_option("-I", "--ignore-file", metavar="IFILE", action="append",
+ default=[],
+ help="ignore tests matching patterns in IFILE")
+parser.add_option("-H", "--halt-on-error", action="store_true", default=False,
+ dest="hoe", help="halt if an error is encountered")
+parser.add_option("-t", "--time", action="store_true", default=False,
+ help="report timing information on test run")
+parser.add_option("-D", "--define", metavar="DEFINE", dest="defines",
+ action="append", default=[], help="define test parameters")
+parser.add_option("-x", "--xml", metavar="XML", dest="xml",
+ help="write test results in Junit style xml suitable for use by CI tools etc")
+
+class Config:
+
+ def __init__(self):
+ self.broker = URL("localhost")
+ self.defines = {}
+ self.log_file = None
+ self.log_level = WARN
+ self.log_categories = []
+
+opts, args = parser.parse_args()
+
+includes = []
+excludes = ["*__*__"]
+config = Config()
+list_only = opts.list
+config.broker = URL(opts.broker)
+for d in opts.defines:
+ try:
+ idx = d.index("=")
+ name = d[:idx]
+ value = d[idx+1:]
+ config.defines[name] = value
+ except ValueError:
+ config.defines[d] = None
+config.log_file = opts.log_file
+config.log_level = levels[opts.log_level.upper()]
+config.log_categories = opts.log_categories
+excludes.extend([v.strip() for v in opts.ignore])
+for v in opts.ignore_file:
+ f = open(v)
+ for line in f:
+ line = line.strip()
+ if line.startswith("#"):
+ continue
+ excludes.append(line)
+ f.close()
+
+for a in args:
+ includes.append(a.strip())
+
+if not includes:
+ if opts.modules:
+ includes.append("*")
+ else:
+ includes.extend(["qpid.tests.*"])
+
+def is_ignored(path):
+ for p in excludes:
+ if match(path, p):
+ return True
+ return False
+
+def is_included(path):
+ if is_ignored(path):
+ return False
+ for p in includes:
+ if match(path, p):
+ return True
+ return False
+
+def is_smart():
+ return sys.stdout.isatty() and os.environ.get("TERM", "dumb") != "dumb"
+
+try:
+ import fcntl, termios
+
+ def width():
+ if is_smart():
+ s = struct.pack("HHHH", 0, 0, 0, 0)
+ fd_stdout = sys.stdout.fileno()
+ x = fcntl.ioctl(fd_stdout, termios.TIOCGWINSZ, s)
+ rows, cols, xpx, ypx = struct.unpack("HHHH", x)
+ return cols
+ else:
+ try:
+ return int(os.environ.get("COLUMNS", "80"))
+ except ValueError:
+ return 80
+
+ WIDTH = width()
+
+ def resize(sig, frm):
+ global WIDTH
+ WIDTH = width()
+
+ import signal
+ signal.signal(signal.SIGWINCH, resize)
+
+except ImportError:
+ WIDTH = 80
+
+def vt100_attrs(*attrs):
+ return "\x1B[%sm" % ";".join(map(str, attrs))
+
+vt100_reset = vt100_attrs(0)
+
+KEYWORDS = {"pass": (32,),
+ "skip": (33,),
+ "fail": (31,),
+ "start": (34,),
+ "total": (34,),
+ "ignored": (33,),
+ "selected": (34,),
+ "elapsed": (34,),
+ "average": (34,)}
+
+COLORIZE = is_smart()
+
+def colorize_word(word, text=None):
+ if text is None:
+ text = word
+ return colorize(text, *KEYWORDS.get(word, ()))
+
+def colorize(text, *attrs):
+ if attrs and COLORIZE:
+ return "%s%s%s" % (vt100_attrs(*attrs), text, vt100_reset)
+ else:
+ return text
+
+def indent(text):
+ lines = text.split("\n")
+ return " %s" % "\n ".join(lines)
+
+# Write a 'minimal' Junit xml style report file suitable for use by CI tools such as Jenkins.
+class JunitXmlStyleReporter:
+
+ def __init__(self, file):
+ self.f = open(file, "w");
+
+ def begin(self):
+ self.f.write('<?xml version="1.0" encoding="UTF-8" ?>\n')
+ self.f.write('<testsuite>\n')
+
+ def report(self, name, result):
+ parts = name.split(".")
+ method = parts[-1]
+ module = '.'.join(parts[0:-1])
+ self.f.write('<testcase classname="%s" name="%s" time="%f">\n' % (module, method, result.time))
+ if result.failed:
+ self.f.write('<failure>\n')
+ self.f.write('<![CDATA[\n')
+ self.f.write(result.exceptions)
+ self.f.write(']]>\n')
+ self.f.write('</failure>\n')
+ self.f.write('</testcase>\n')
+
+ def end(self):
+ self.f.write('</testsuite>\n')
+ self.f.close()
+
+class Interceptor:
+
+ def __init__(self):
+ self.newline = False
+ self.indent = False
+ self.passthrough = True
+ self.dirty = False
+ self.last = None
+
+ def begin(self):
+ self.newline = True
+ self.indent = True
+ self.passthrough = False
+ self.dirty = False
+ self.last = None
+
+ def reset(self):
+ self.newline = False
+ self.indent = False
+ self.passthrough = True
+
+class StreamWrapper:
+
+ def __init__(self, interceptor, stream, prefix=" "):
+ self.interceptor = interceptor
+ self.stream = stream
+ self.prefix = prefix
+
+ def fileno(self):
+ return self.stream.fileno()
+
+ def isatty(self):
+ return self.stream.isatty()
+
+ def write(self, s):
+ if self.interceptor.passthrough:
+ self.stream.write(s)
+ return
+
+ if s:
+ self.interceptor.dirty = True
+
+ if self.interceptor.newline:
+ self.interceptor.newline = False
+ self.stream.write(" %s\n" % colorize_word("start"))
+ self.interceptor.indent = True
+ if self.interceptor.indent:
+ self.stream.write(self.prefix)
+ if s.endswith("\n"):
+ s = s.replace("\n", "\n%s" % self.prefix)[:-2]
+ self.interceptor.indent = True
+ else:
+ s = s.replace("\n", "\n%s" % self.prefix)
+ self.interceptor.indent = False
+ self.stream.write(s)
+
+ if s:
+ self.interceptor.last = s[-1]
+
+ def flush(self):
+ self.stream.flush()
+
+interceptor = Interceptor()
+
+out_wrp = StreamWrapper(interceptor, sys.stdout)
+err_wrp = StreamWrapper(interceptor, sys.stderr)
+
+out = sys.stdout
+err = sys.stderr
+sys.stdout = out_wrp
+sys.stderr = err_wrp
+
+class PatternFilter(Filter):
+
+ def __init__(self, *patterns):
+ Filter.__init__(self, patterns)
+ self.patterns = patterns
+
+ def filter(self, record):
+ if not self.patterns:
+ return True
+ for p in self.patterns:
+ if match(record.name, p):
+ return True
+ return False
+
+root = getLogger()
+handler = StreamHandler(sys.stdout)
+filter = PatternFilter(*config.log_categories)
+handler.addFilter(filter)
+handler.setFormatter(Formatter("%(asctime)s %(levelname)s %(message)s"))
+root.addHandler(handler)
+root.setLevel(WARN)
+
+log = getLogger("qpid.test")
+
+PASS = "pass"
+SKIP = "skip"
+FAIL = "fail"
+
+class Runner:
+
+ def __init__(self):
+ self.exceptions = []
+ self.skip = False
+
+ def passed(self):
+ return not self.exceptions
+
+ def skipped(self):
+ return self.skip
+
+ def failed(self):
+ return self.exceptions and not self.skip
+
+ def halt(self):
+ return self.exceptions or self.skip
+
+ def run(self, name, phase):
+ try:
+ phase()
+ except KeyboardInterrupt:
+ raise
+ except:
+ exi = sys.exc_info()
+ if issubclass(exi[0], Skipped):
+ self.skip = True
+ self.exceptions.append((name, exi))
+
+ def status(self):
+ if self.passed():
+ return PASS
+ elif self.skipped():
+ return SKIP
+ elif self.failed():
+ return FAIL
+ else:
+ return None
+
+ def get_formatted_exceptions(self):
+ for name, info in self.exceptions:
+ if issubclass(info[0], Skipped):
+ output = indent("".join(traceback.format_exception_only(*info[:2]))).rstrip()
+ else:
+ output = "Error during %s:" % name
+ output += indent("".join(traceback.format_exception(*info))).rstrip()
+ return output
+
+ST_WIDTH = 8
+
+def run_test(name, test, config):
+ patterns = filter.patterns
+ level = root.level
+ filter.patterns = config.log_categories
+ root.setLevel(config.log_level)
+
+ parts = name.split(".")
+ line = None
+ output = ""
+ for part in parts:
+ if line:
+ if len(line) + len(part) >= (WIDTH - ST_WIDTH - 1):
+ output += "%s. \\\n" % line
+ line = " %s" % part
+ else:
+ line = "%s.%s" % (line, part)
+ else:
+ line = part
+
+ if line:
+ output += "%s %s" % (line, (((WIDTH - ST_WIDTH) - len(line))*"."))
+ sys.stdout.write(output)
+ sys.stdout.flush()
+ interceptor.begin()
+ start = time.time()
+ try:
+ runner = test()
+ finally:
+ interceptor.reset()
+ end = time.time()
+ if interceptor.dirty:
+ if interceptor.last != "\n":
+ sys.stdout.write("\n")
+ sys.stdout.write(output)
+ print " %s" % colorize_word(runner.status())
+ if runner.failed() or runner.skipped():
+ print runner.get_formatted_exceptions()
+ root.setLevel(level)
+ filter.patterns = patterns
+ return TestResult(end - start, runner.passed(), runner.skipped(), runner.failed(), runner.get_formatted_exceptions())
+
+class TestResult:
+
+ def __init__(self, time, passed, skipped, failed, exceptions):
+ self.time = time
+ self.passed = passed
+ self.skipped = skipped
+ self.failed = failed
+ self.exceptions = exceptions
+
+class FunctionTest:
+
+ def __init__(self, test):
+ self.test = test
+
+ def name(self):
+ return "%s.%s" % (self.test.__module__, self.test.__name__)
+
+ def run(self):
+ return run_test(self.name(), self._run, config)
+
+ def _run(self):
+ runner = Runner()
+ runner.run("test", lambda: self.test(config))
+ return runner
+
+ def __repr__(self):
+ return "FunctionTest(%r)" % self.test
+
+class MethodTest:
+
+ def __init__(self, cls, method):
+ self.cls = cls
+ self.method = method
+
+ def name(self):
+ return "%s.%s.%s" % (self.cls.__module__, self.cls.__name__, self.method)
+
+ def run(self):
+ return run_test(self.name(), self._run, config)
+
+ def _run(self):
+ runner = Runner()
+ inst = self.cls(self.method)
+ test = getattr(inst, self.method)
+
+ if hasattr(inst, "configure"):
+ runner.run("configure", lambda: inst.configure(config))
+ if runner.halt(): return runner
+ if hasattr(inst, "setUp"):
+ runner.run("setup", inst.setUp)
+ if runner.halt(): return runner
+ elif hasattr(inst, "setup"):
+ runner.run("setup", inst.setup)
+ if runner.halt(): return runner
+
+ runner.run("test", test)
+
+ if hasattr(inst, "tearDown"):
+ runner.run("teardown", inst.tearDown)
+ elif hasattr(inst, "teardown"):
+ runner.run("teardown", inst.teardown)
+
+ return runner
+
+ def __repr__(self):
+ return "MethodTest(%r, %r)" % (self.cls, self.method)
+
+class PatternMatcher:
+
+ def __init__(self, *patterns):
+ self.patterns = patterns
+
+ def matches(self, name):
+ for p in self.patterns:
+ if match(name, p):
+ return True
+ return False
+
+class FunctionScanner(PatternMatcher):
+
+ def inspect(self, obj):
+ return type(obj) == types.FunctionType and self.matches(name)
+
+ def descend(self, func):
+ # the None is required for older versions of python
+ return; yield None
+
+ def extract(self, func):
+ yield FunctionTest(func)
+
+class ClassScanner(PatternMatcher):
+
+ def inspect(self, obj):
+ return type(obj) in (types.ClassType, types.TypeType) and self.matches(obj.__name__)
+
+ def descend(self, cls):
+ # the None is required for older versions of python
+ return; yield None
+
+ def extract(self, cls):
+ names = dir(cls)
+ names.sort()
+ for name in names:
+ obj = getattr(cls, name)
+ t = type(obj)
+ if t == types.MethodType and name.startswith("test"):
+ yield MethodTest(cls, name)
+
+class ModuleScanner:
+
+ def inspect(self, obj):
+ return type(obj) == types.ModuleType
+
+ def descend(self, obj):
+ names = dir(obj)
+ names.sort()
+ for name in names:
+ yield getattr(obj, name)
+
+ def extract(self, obj):
+ # the None is required for older versions of python
+ return; yield None
+
+class Harness:
+
+ def __init__(self):
+ self.scanners = [
+ ModuleScanner(),
+ ClassScanner("*Test", "*Tests", "*TestCase"),
+ FunctionScanner("test_*")
+ ]
+ self.tests = []
+ self.scanned = []
+
+ def scan(self, *roots):
+ objects = list(roots)
+
+ while objects:
+ obj = objects.pop(0)
+ for s in self.scanners:
+ if s.inspect(obj):
+ self.tests.extend(s.extract(obj))
+ for child in s.descend(obj):
+ if not (child in self.scanned or child in objects):
+ objects.append(child)
+ self.scanned.append(obj)
+
+modules = opts.modules
+if not modules:
+ modules.extend(["qpid.tests"])
+h = Harness()
+for name in modules:
+ m = __import__(name, None, None, ["dummy"])
+ h.scan(m)
+
+filtered = [t for t in h.tests if is_included(t.name())]
+ignored = [t for t in h.tests if is_ignored(t.name())]
+total = len(filtered) + len(ignored)
+
+if opts.xml and not list_only:
+ xmlr = JunitXmlStyleReporter(opts.xml);
+ xmlr.begin();
+else:
+ xmlr = None
+
+passed = 0
+failed = 0
+skipped = 0
+start = time.time()
+for t in filtered:
+ if list_only:
+ print t.name()
+ else:
+ st = t.run()
+ if xmlr:
+ xmlr.report(t.name(), st)
+ if st.passed:
+ passed += 1
+ elif st.skipped:
+ skipped += 1
+ elif st.failed:
+ failed += 1
+ if opts.hoe:
+ break
+end = time.time()
+
+run = passed + failed
+
+if not list_only:
+ if passed:
+ _pass = "pass"
+ else:
+ _pass = "fail"
+ if failed:
+ outcome = "fail"
+ else:
+ outcome = "pass"
+ if ignored:
+ ign = "ignored"
+ else:
+ ign = "pass"
+ if skipped:
+ skip = "skip"
+ else:
+ skip = "pass"
+ print colorize("Totals:", 1),
+ totals = [colorize_word("total", "%s tests" % total),
+ colorize_word(_pass, "%s passed" % passed),
+ colorize_word(skip, "%s skipped" % skipped),
+ colorize_word(ign, "%s ignored" % len(ignored)),
+ colorize_word(outcome, "%s failed" % failed)]
+ print ", ".join(totals),
+ if opts.hoe and failed > 0:
+ print " -- (halted after %s)" % run
+ else:
+ print
+ if opts.time and run > 0:
+ print colorize("Timing:", 1),
+ timing = [colorize_word("elapsed", "%.2fs elapsed" % (end - start)),
+ colorize_word("average", "%.2fs average" % ((end - start)/run))]
+ print ", ".join(timing)
+
+if xmlr:
+ xmlr.end()
+
+if failed:
+ sys.exit(1)
+else:
+ sys.exit(0)
diff --git a/qpid/python/qpid-python-test-ant.xml b/qpid/python/qpid-python-test-ant.xml
new file mode 100644
index 0000000000..f70e8923ed
--- /dev/null
+++ b/qpid/python/qpid-python-test-ant.xml
@@ -0,0 +1,192 @@
+<!--
+ -
+ - Licensed to the Apache Software Foundation (ASF) under one
+ - or more contributor license agreements. See the NOTICE file
+ - distributed with this work for additional information
+ - regarding copyright ownership. The ASF licenses this file
+ - to you under the Apache License, Version 2.0 (the
+ - "License"); you may not use this file except in compliance
+ - with the License. You may obtain a copy of the License at
+ -
+ - http://www.apache.org/licenses/LICENSE-2.0
+ -
+ - Unless required by applicable law or agreed to in writing,
+ - software distributed under the License is distributed on an
+ - "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ - KIND, either express or implied. See the License for the
+ - specific language governing permissions and limitations
+ - under the License.
+ -
+ -->
+
+<project name="qpid-python-test-ant" default="test" >
+
+ <!-- Ant wrapper around qpid-python-test. Starts Qpid broker; runs
+ qpid-python-test, and formats the test output. -->
+
+ <!-- Directories etc -->
+ <property name="python.dir" value="${basedir}"/>
+ <property name="qpid.root.dir" value="${basedir}/.."/>
+ <property name="java.dir" value="${basedir}/../java"/>
+ <property name="cpp.dir" value="${basedir}/../cpp"/>
+ <property name="build.dir" value="${python.dir}/build"/>
+ <property name="test.results.dir" value="${build.dir}/results"/>
+ <property name="test.work.dir" value="${build.dir}/work"/>
+
+ <!-- Qpid Broker Executable/Url/Port -->
+ <property name="qpid.port" value="15672"/>
+ <property name="qpid.python.broker.url" value="amqp://guest/guest@localhost:${qpid.port}"/>
+ <property name="qpid.executable" value="${java.dir}/build/bin/qpid-server"/>
+ <property name="qpid.executable.args" value="-p ${qpid.port}"/>
+
+ <!-- Additional modules to be added to command. Property must include -M -->
+ <property name="python.test.modules" value=""/>
+ <!-- Ignore file. Property must include -I -->
+ <property name="python.test.ignore" value=""/>
+
+ <!-- Time to wait for socket to be bound -->
+ <property name="ensurefree.maxwait" value="1000"/>
+ <property name="start.maxwait" value="20000"/>
+ <property name="stop.maxwait" value="10000"/>
+ <property name="socket.checkevery" value="1000"/>
+
+ <!-- Success message -->
+ <property name="passed.message" value=" 0 failed"/>
+
+
+ <target name="test" depends="clean, init, ensure-port-free, start-broker, run-tests, stop-broker, kill-broker, report"/>
+
+ <target name="init">
+ <mkdir dir="${test.results.dir}"/>
+ <mkdir dir="${test.work.dir}"/>
+ </target>
+
+ <target name="clean">
+ <delete dir="${test.results.dir}"/>
+ <delete dir="${test.work.dir}"/>
+ </target>
+
+ <target name="ensure-port-free" depends="init" unless="skip.ensure-port-free">
+ <await-port-free port="${qpid.port}" maxwait="${ensurefree.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="ensurefree.timeout"/>
+ <fail message="Broker port ${qpid.port} is not free" if="ensurefree.timeout"/>
+ </target>
+
+ <target name="start-broker" depends="init">
+ <echo>Starting Qpid with ${qpid.executable} ${qpid.executable.args}</echo>
+ <exec executable="${qpid.executable}" spawn="true">
+ <env key="QPID_WORK" value="${test.work.dir}"/>
+ <arg line="${qpid.executable.args}"/>
+ </exec>
+
+ <await-port-bound port="${qpid.port}" maxwait="${start.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="start.timeout"/>
+ <antcall target="wait-for-broker-ready"/>
+ </target>
+
+ <target name="wait-for-broker-ready" if="java.broker">
+ <await-broker-log path="${test.work.dir}/log/qpid.log" entry="BRK-1004" maxwait="${start.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="start.timeout"/>
+ </target>
+
+ <target name="stop-broker" depends="init">
+ <get-pid port="${qpid.port}" targetProperty="pid" resultproperty="stopresultproperty"/>
+ <echo>Stopping Qpid with pid '${pid}'</echo>
+ <kill-pid pid="${pid}" signo="-15"/>
+
+ <await-port-free port="${qpid.port}" maxwait="${stop.maxwait}" checkevery="${socket.checkevery}" timeoutproperty="stop.timeout"/>
+ </target>
+
+ <target name="kill-broker" depends="init" if="stop.timeout">
+ <get-pid port="${qpid.port}" targetProperty="pid" resultproperty="killresultproperty"/>
+ <echo>Killing Qpid with pid '${pid}'</echo>
+ <kill-pid pid="${pid}" signo="-9"/>
+ </target>
+
+ <target name="run-tests" depends="init" unless="start.timeout">
+ <echo>Running test-suite</echo>
+ <exec executable="${python.dir}/qpid-python-test" output="${test.results.dir}/results.out" error="${test.results.dir}/results.err">
+ <env key="PYTHONPATH" value="${qpid.root.dir}/tests/src/py:${qpid.root.dir}/extras/qmf/src/py:${qpid.root.dir}/tools/src/py"/>
+ <arg line="-b ${qpid.python.broker.url} -x ${test.results.dir}/TEST-python.xml ${python.test.modules} ${python.test.ignore}"/>
+ </exec>
+
+ <condition property="tests.passed">
+ <isfileselected file="${test.results.dir}/results.out">
+ <contains text="${passed.message}"/>
+ </isfileselected>
+ </condition>
+ </target>
+
+ <target name="report" depends="init" unless="tests.passed">
+ <fail message="Test(s) failed" unless="tests.passed"/>
+ <echo message="Test(s) passed" if="tests.passed"/>
+ </target>
+
+ <macrodef name="get-pid">
+ <attribute name="targetProperty"/>
+ <attribute name="port"/>
+ <attribute name="resultproperty"/>
+ <sequential>
+ <exec executable="lsof" outputproperty="@{targetProperty}" resultproperty="@{resultproperty}">
+ <arg value="-t"/> <!-- Terse output -->
+ <arg value="-i"/> <arg value=":@{port}"/>
+ </exec>
+ <fail message="lsof failed to determine the pid using port @{port}, exit status ${@{resultproperty}}">
+ <condition>
+ <not>
+ <equals arg1="${@{resultproperty}}" arg2="0"/>
+ </not>
+ </condition>
+ </fail>
+ </sequential>
+ </macrodef>
+
+ <macrodef name="kill-pid">
+ <attribute name="pid"/>
+ <attribute name="signo"/>
+ <sequential>
+ <exec executable="kill">
+ <arg value="@{signo}"/>
+ <arg value="@{pid}"/>
+ </exec>
+ </sequential>
+ </macrodef>
+
+ <macrodef name="await-port-free">
+ <attribute name="maxwait"/>
+ <attribute name="checkevery"/>
+ <attribute name="timeoutproperty"/>
+ <attribute name="port"/>
+ <sequential>
+ <waitfor maxwait="@{maxwait}" maxwaitunit="millisecond" checkevery="@{checkevery}" checkeveryunit="millisecond" timeoutproperty="@{timeoutproperty}">
+ <not>
+ <socket server="localhost" port="@{port}"/>
+ </not>
+ </waitfor>
+ </sequential>
+ </macrodef>
+
+ <macrodef name="await-port-bound">
+ <attribute name="maxwait"/>
+ <attribute name="checkevery"/>
+ <attribute name="timeoutproperty"/>
+ <attribute name="port"/>
+ <sequential>
+ <waitfor maxwait="@{maxwait}" maxwaitunit="millisecond" checkevery="@{checkevery}" checkeveryunit="millisecond" timeoutproperty="@{timeoutproperty}">
+ <socket server="localhost" port="@{port}"/>
+ </waitfor>
+ </sequential>
+ </macrodef>
+
+ <macrodef name="await-broker-log">
+ <attribute name="maxwait"/>
+ <attribute name="checkevery"/>
+ <attribute name="timeoutproperty"/>
+ <attribute name="entry"/>
+ <attribute name="path"/>
+ <sequential>
+ <echo message="Waiting for entry '@{entry}' in '@{path}' "/>
+ <waitfor maxwait="@{maxwait}" maxwaitunit="millisecond" checkevery="@{checkevery}" checkeveryunit="millisecond" timeoutproperty="@{timeoutproperty}">
+ <resourcecontains resource="@{path}" substring="@{entry}"/>
+ </waitfor>
+ <echo message="Timeout @{timeoutproperty}"/>
+ </sequential>
+ </macrodef>
+</project>
diff --git a/qpid/python/qpid/__init__.py b/qpid/python/qpid/__init__.py
new file mode 100644
index 0000000000..780cab46a0
--- /dev/null
+++ b/qpid/python/qpid/__init__.py
@@ -0,0 +1,84 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import connection
+
+class Struct:
+
+ def __init__(self, type, *args, **kwargs):
+ self.__dict__["type"] = type
+ self.__dict__["_values"] = {}
+
+ if len(args) > len(self.type.fields):
+ raise TypeError("too many args")
+
+ for a, f in zip(args, self.type.fields):
+ self.set(f.name, a)
+
+ for k, a in kwargs.items():
+ self.set(k, a)
+
+ def _check(self, attr):
+ field = self.type.fields.byname.get(attr)
+ if field == None:
+ raise AttributeError(attr)
+ return field
+
+ def exists(self, attr):
+ return self.type.fields.byname.has_key(attr)
+
+ def has(self, attr):
+ self._check(attr)
+ return self._values.has_key(attr)
+
+ def set(self, attr, value):
+ self._check(attr)
+ self._values[attr] = value
+
+ def get(self, attr):
+ field = self._check(attr)
+ return self._values.get(attr, field.default())
+
+ def clear(self, attr):
+ self._check(attr)
+ del self._values[attr]
+
+ def __setattr__(self, attr, value):
+ self.set(attr, value)
+
+ def __getattr__(self, attr):
+ return self.get(attr)
+
+ def __delattr__(self, attr):
+ self.clear(attr)
+
+ def __setitem__(self, attr, value):
+ self.set(attr, value)
+
+ def __getitem__(self, attr):
+ return self.get(attr)
+
+ def __delitem__(self, attr):
+ self.clear(attr)
+
+ def __str__(self):
+ return "%s %s" % (self.type, self._values)
+
+ def __repr__(self):
+ return str(self)
diff --git a/qpid/python/qpid/client.py b/qpid/python/qpid/client.py
new file mode 100644
index 0000000000..5fedaa2cb1
--- /dev/null
+++ b/qpid/python/qpid/client.py
@@ -0,0 +1,277 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+An AMQP client implementation that uses a custom delegate for
+interacting with the server.
+"""
+
+import os, threading
+from peer import Peer, Channel, Closed
+from delegate import Delegate
+from util import get_client_properties_with_defaults
+from connection08 import Connection, Frame, connect
+from spec08 import load
+from queue import Queue
+from reference import ReferenceId, References
+from saslmech.finder import get_sasl_mechanism
+from saslmech.sasl import SaslException
+
+
+class Client:
+
+ def __init__(self, host, port, spec = None, vhost = None):
+ self.host = host
+ self.port = port
+ if spec:
+ self.spec = spec
+ else:
+ from specs_config import amqp_spec_0_9
+ self.spec = load(amqp_spec_0_9)
+ self.structs = StructFactory(self.spec)
+ self.sessions = {}
+
+ self.mechanism = None
+ self.response = None
+ self.locale = None
+ self.sasl = None
+
+ self.vhost = vhost
+ if self.vhost == None:
+ self.vhost = "/"
+
+ self.queues = {}
+ self.lock = threading.Lock()
+
+ self.closed = False
+ self.reason = None
+ self.started = threading.Event()
+ self.peer = None
+
+ def wait(self):
+ self.started.wait()
+ if self.closed:
+ raise Closed(self.reason)
+
+ def queue(self, key):
+ self.lock.acquire()
+ try:
+ try:
+ q = self.queues[key]
+ except KeyError:
+ q = Queue(0)
+ self.queues[key] = q
+ finally:
+ self.lock.release()
+ return q
+
+ def start(self, response=None, mechanism=None, locale="en_US", tune_params=None,
+ username=None, password=None,
+ client_properties=None, connection_options=None, sasl_options = None,
+ channel_options=None):
+ self.mechanism = mechanism
+ self.response = response
+ self.username = username
+ self.password = password
+ self.locale = locale
+ self.tune_params = tune_params
+ self.client_properties=get_client_properties_with_defaults(provided_client_properties=client_properties, version_property_key="version")
+ self.sasl_options = sasl_options
+ self.socket = connect(self.host, self.port, connection_options)
+ self.conn = Connection(self.socket, self.spec)
+ self.peer = Peer(self.conn, ClientDelegate(self), Session, channel_options)
+
+ self.conn.init()
+ self.peer.start()
+ self.wait()
+ self.channel(0).connection_open(self.vhost)
+
+ def channel(self, id):
+ self.lock.acquire()
+ try:
+ ssn = self.peer.channel(id)
+ ssn.client = self
+ self.sessions[id] = ssn
+ finally:
+ self.lock.release()
+ return ssn
+
+ def session(self):
+ self.lock.acquire()
+ try:
+ id = None
+ for i in xrange(1, 64*1024):
+ if not self.sessions.has_key(i):
+ id = i
+ break
+ finally:
+ self.lock.release()
+ if id == None:
+ raise RuntimeError("out of channels")
+ else:
+ return self.channel(id)
+
+ def close(self):
+ if self.peer:
+ try:
+ if not self.closed:
+ channel = self.channel(0);
+ if channel and not channel._closed:
+ try:
+ channel.connection_close(reply_code=200)
+ except:
+ pass
+ self.closed = True
+ finally:
+ self.peer.stop()
+
+class ClientDelegate(Delegate):
+
+ def __init__(self, client):
+ Delegate.__init__(self)
+ self.client = client
+
+ def connection_start(self, ch, msg):
+
+ if self.client.mechanism is None:
+ if self.client.response is not None:
+ # Supports users passing the response argument alon
+ self.client.mechanism = "AMQPLAIN"
+ else:
+ supportedMechs = msg.frame.args[3].split()
+
+ self.client.sasl = get_sasl_mechanism(supportedMechs, self.client.username, self.client.password, sasl_options=self.client.sasl_options)
+
+ if self.client.sasl == None:
+ raise SaslException("sasl negotiation failed: no mechanism agreed. Server supports: %s " % supportedMechs)
+
+ self.client.mechanism = self.client.sasl.mechanismName()
+
+ if self.client.response is None:
+ self.client.response = self.client.sasl.initialResponse()
+
+ msg.start_ok(mechanism=self.client.mechanism,
+ response=self.client.response or "",
+ locale=self.client.locale,
+ client_properties=self.client.client_properties)
+
+ def connection_secure(self, ch, msg):
+ msg.secure_ok(response=self.client.sasl.response(msg.challenge))
+
+ def connection_tune(self, ch, msg):
+ if self.client.tune_params:
+ #todo: just override the params, i.e. don't require them
+ # all to be included in tune_params
+ msg.tune_ok(**self.client.tune_params)
+ else:
+ msg.tune_ok(*msg.frame.args)
+ self.client.started.set()
+
+ def message_transfer(self, ch, msg):
+ self.client.queue(msg.destination).put(msg)
+
+ def message_open(self, ch, msg):
+ ch.references.open(msg.reference)
+
+ def message_close(self, ch, msg):
+ ch.references.close(msg.reference)
+
+ def message_append(self, ch, msg):
+ ch.references.get(msg.reference).append(msg.bytes)
+
+ def message_acquired(self, ch, msg):
+ ch.control_queue.put(msg)
+
+ def basic_deliver(self, ch, msg):
+ self.client.queue(msg.consumer_tag).put(msg)
+
+ def channel_pong(self, ch, msg):
+ msg.ok()
+
+ def channel_close(self, ch, msg):
+ ch.closed(msg)
+
+ def channel_flow(self, ch, msg):
+ # On resuming we don't want to send a message before flow-ok has been sent.
+ # Therefore, we send flow-ok before we set the flow_control flag.
+ if msg.active:
+ msg.flow_ok()
+ ch.set_flow_control(not msg.active)
+ # On suspending we don't want to send a message after flow-ok has been sent.
+ # Therefore, we send flow-ok after we set the flow_control flag.
+ if not msg.active:
+ msg.flow_ok()
+
+ def session_ack(self, ch, msg):
+ pass
+
+ def session_closed(self, ch, msg):
+ ch.closed(msg)
+
+ def connection_close(self, ch, msg):
+ self.client.peer.closed(msg)
+
+ def execution_complete(self, ch, msg):
+ ch.completion.complete(msg.cumulative_execution_mark)
+
+ def execution_result(self, ch, msg):
+ future = ch.futures[msg.command_id]
+ future.put_response(ch, msg.data)
+
+ def closed(self, reason):
+ self.client.closed = True
+ self.client.reason = reason
+ self.client.started.set()
+
+class StructFactory:
+
+ def __init__(self, spec):
+ self.spec = spec
+ self.factories = {}
+
+ def __getattr__(self, name):
+ if self.factories.has_key(name):
+ return self.factories[name]
+ elif self.spec.domains.byname.has_key(name):
+ f = lambda *args, **kwargs: self.struct(name, *args, **kwargs)
+ self.factories[name] = f
+ return f
+ else:
+ raise AttributeError(name)
+
+ def struct(self, name, *args, **kwargs):
+ return self.spec.struct(name, *args, **kwargs)
+
+class Session(Channel):
+
+ def __init__(self, *args):
+ Channel.__init__(self, *args)
+ self.references = References()
+ self.client = None
+
+ def open(self):
+ self.session_open()
+
+ def close(self):
+ self.session_close()
+ self.client.lock.acquire()
+ try:
+ del self.client.sessions[self.id]
+ finally:
+ self.client.lock.release()
diff --git a/qpid/python/qpid/codec.py b/qpid/python/qpid/codec.py
new file mode 100644
index 0000000000..a4c542415c
--- /dev/null
+++ b/qpid/python/qpid/codec.py
@@ -0,0 +1,701 @@
+#!/usr/bin/env python
+
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+Utility code to translate between python objects and AMQP encoded data
+fields.
+
+The unit test for this module is located in tests/codec.py
+"""
+
+import re, qpid, spec08, os
+from cStringIO import StringIO
+from struct import *
+from reference import ReferenceId
+from logging import getLogger
+
+log = getLogger("qpid.codec")
+
+class EOF(Exception):
+ pass
+
+# This code appears to be dead
+TYPE_ALIASES = {
+ "long_string": "longstr",
+ "unsigned_int": "long"
+ }
+
+class Codec:
+
+ """
+ class that handles encoding/decoding of AMQP primitives
+ """
+
+ def __init__(self, stream, spec):
+ """
+ initializing the stream/fields used
+ """
+ self.stream = stream
+ self.spec = spec
+ self.nwrote = 0
+ self.nread = 0
+ self.incoming_bits = []
+ self.outgoing_bits = []
+
+ # Before 0-91, the AMQP's set of types did not include the boolean type. However,
+ # the 0-8 and 0-9 Java client uses this type so we encode/decode it too. However, this
+ # can be turned off by setting the followng environment value.
+ if "QPID_CODEC_DISABLE_0_91_BOOLEAN" in os.environ:
+ self.understand_boolean = False
+ else:
+ self.understand_boolean = True
+
+ log.debug("AMQP 0-91 boolean supported : %r", self.understand_boolean)
+
+ self.types = {}
+ self.codes = {}
+ self.integertypes = [int, long]
+ self.encodings = {
+ float: "double", # python uses 64bit floats, send them as doubles
+ basestring: "longstr",
+ None.__class__:"void",
+ list: "sequence",
+ tuple: "sequence",
+ dict: "table"
+ }
+
+ if self.understand_boolean:
+ self.encodings[bool] = "boolean"
+
+ for constant in self.spec.constants:
+ # This code appears to be dead
+ if constant.klass == "field-table-type":
+ type = constant.name.replace("field_table_", "")
+ self.typecode(constant.id, TYPE_ALIASES.get(type, type))
+
+ if not self.types:
+ # long-string 'S'
+ self.typecode(ord('S'), "longstr")
+ # void 'V'
+ self.typecode(ord('V'), "void")
+ # long-int 'I' (32bit signed)
+ self.typecode(ord('I'), "signed_int")
+ # long-long-int 'l' (64bit signed)
+ # This is a long standing pre-0-91-spec type used by the Java
+ # client, 0-9-1 says it should be unsigned or use 'L')
+ self.typecode(ord('l'), "signed_long")
+ # double 'd'
+ self.typecode(ord('d'), "double")
+ # float 'f'
+ self.typecode(ord('f'), "float")
+
+ if self.understand_boolean:
+ self.typecode(ord('t'), "boolean")
+
+ ## The following are supported for decoding only ##
+
+ # short-short-uint 'b' (8bit signed)
+ self.types[ord('b')] = "signed_octet"
+ # short-int 's' (16bit signed)
+ # This is a long standing pre-0-91-spec type code used by the Java
+ # client to send shorts, it should really be a short-string, or for 0-9-1 use 'U'
+ self.types[ord('s')] = "signed_short"
+
+ def typecode(self, code, type):
+ self.types[code] = type
+ self.codes[type] = code
+
+ def resolve(self, klass, value):
+ if(klass in self.integertypes):
+ if (value >= -2147483648 and value <= 2147483647):
+ return "signed_int"
+ elif (value >= -9223372036854775808 and value <= 9223372036854775807):
+ return "signed_long"
+ else:
+ raise ValueError('Integer value is outwith the supported 64bit signed range')
+ if self.encodings.has_key(klass):
+ return self.encodings[klass]
+ for base in klass.__bases__:
+ result = self.resolve(base, value)
+ if result != None:
+ return result
+
+ def read(self, n):
+ """
+ reads in 'n' bytes from the stream. Can raise EOF exception
+ """
+ self.clearbits()
+ data = self.stream.read(n)
+ if n > 0 and len(data) == 0:
+ raise EOF()
+ self.nread += len(data)
+ return data
+
+ def write(self, s):
+ """
+ writes data 's' to the stream
+ """
+ self.flushbits()
+ self.stream.write(s)
+ self.nwrote += len(s)
+
+ def flush(self):
+ """
+ flushes the bits and data present in the stream
+ """
+ self.flushbits()
+ self.stream.flush()
+
+ def flushbits(self):
+ """
+ flushes the bits(compressed into octets) onto the stream
+ """
+ if len(self.outgoing_bits) > 0:
+ bytes = []
+ index = 0
+ for b in self.outgoing_bits:
+ if index == 0: bytes.append(0)
+ if b: bytes[-1] |= 1 << index
+ index = (index + 1) % 8
+ del self.outgoing_bits[:]
+ for byte in bytes:
+ self.encode_octet(byte)
+
+ def clearbits(self):
+ if self.incoming_bits:
+ self.incoming_bits = []
+
+ def pack(self, fmt, *args):
+ """
+ packs the data 'args' as per the format 'fmt' and writes it to the stream
+ """
+ self.write(pack(fmt, *args))
+
+ def unpack(self, fmt):
+ """
+ reads data from the stream and unpacks it as per the format 'fmt'
+ """
+ size = calcsize(fmt)
+ data = self.read(size)
+ values = unpack(fmt, data)
+ if len(values) == 1:
+ return values[0]
+ else:
+ return values
+
+ def encode(self, type, value):
+ """
+ calls the appropriate encode function e.g. encode_octet, encode_short etc.
+ """
+ if isinstance(type, spec08.Struct):
+ self.encode_struct(type, value)
+ else:
+ getattr(self, "encode_" + type)(value)
+
+ def decode(self, type):
+ """
+ calls the appropriate decode function e.g. decode_octet, decode_short etc.
+ """
+ if isinstance(type, spec08.Struct):
+ return self.decode_struct(type)
+ else:
+ log.debug("Decoding using method: decode_" + type)
+ return getattr(self, "decode_" + type)()
+
+ def encode_bit(self, o):
+ """
+ encodes a bit
+ """
+ if o:
+ self.outgoing_bits.append(True)
+ else:
+ self.outgoing_bits.append(False)
+
+ def decode_bit(self):
+ """
+ decodes a bit
+ """
+ if len(self.incoming_bits) == 0:
+ bits = self.decode_octet()
+ for i in range(8):
+ self.incoming_bits.append(bits >> i & 1 != 0)
+ return self.incoming_bits.pop(0)
+
+ def encode_octet(self, o):
+ """
+ encodes an UNSIGNED octet (8 bits) data 'o' in network byte order
+ """
+
+ # octet's valid range is [0,255]
+ if (o < 0 or o > 255):
+ raise ValueError('Valid range of octet is [0,255]')
+
+ self.pack("!B", int(o))
+
+ def decode_octet(self):
+ """
+ decodes an UNSIGNED octet (8 bits) encoded in network byte order
+ """
+ return self.unpack("!B")
+
+ def decode_signed_octet(self):
+ """
+ decodes a signed octet (8 bits) encoded in network byte order
+ """
+ return self.unpack("!b")
+
+ def encode_short(self, o):
+ """
+ encodes an UNSIGNED short (16 bits) data 'o' in network byte order
+ AMQP 0-9-1 type: short-uint
+ """
+
+ # short int's valid range is [0,65535]
+ if (o < 0 or o > 65535):
+ raise ValueError('Valid range of short int is [0,65535]: %s' % o)
+
+ self.pack("!H", int(o))
+
+ def decode_short(self):
+ """
+ decodes an UNSIGNED short (16 bits) in network byte order
+ AMQP 0-9-1 type: short-uint
+ """
+ return self.unpack("!H")
+
+ def decode_signed_short(self):
+ """
+ decodes a signed short (16 bits) in network byte order
+ AMQP 0-9-1 type: short-int
+ """
+ return self.unpack("!h")
+
+ def encode_long(self, o):
+ """
+ encodes an UNSIGNED long (32 bits) data 'o' in network byte order
+ AMQP 0-9-1 type: long-uint
+ """
+
+ # we need to check both bounds because on 64 bit platforms
+ # struct.pack won't raise an error if o is too large
+ if (o < 0 or o > 4294967295):
+ raise ValueError('Valid range of long int is [0,4294967295]')
+
+ self.pack("!L", int(o))
+
+ def decode_long(self):
+ """
+ decodes an UNSIGNED long (32 bits) in network byte order
+ AMQP 0-9-1 type: long-uint
+ """
+ return self.unpack("!L")
+
+ def encode_signed_long(self, o):
+ """
+ encodes a signed long (64 bits) in network byte order
+ AMQP 0-9-1 type: long-long-int
+ """
+ self.pack("!q", o)
+
+ def decode_signed_long(self):
+ """
+ decodes a signed long (64 bits) in network byte order
+ AMQP 0-9-1 type: long-long-int
+ """
+ return self.unpack("!q")
+
+ def encode_signed_int(self, o):
+ """
+ encodes a signed int (32 bits) in network byte order
+ AMQP 0-9-1 type: long-int
+ """
+ self.pack("!l", o)
+
+ def decode_signed_int(self):
+ """
+ decodes a signed int (32 bits) in network byte order
+ AMQP 0-9-1 type: long-int
+ """
+ return self.unpack("!l")
+
+ def encode_longlong(self, o):
+ """
+ encodes an UNSIGNED long long (64 bits) data 'o' in network byte order
+ AMQP 0-9-1 type: long-long-uint
+ """
+ self.pack("!Q", o)
+
+ def decode_longlong(self):
+ """
+ decodes an UNSIGNED long long (64 bits) in network byte order
+ AMQP 0-9-1 type: long-long-uint
+ """
+ return self.unpack("!Q")
+
+ def encode_float(self, o):
+ self.pack("!f", o)
+
+ def decode_float(self):
+ return self.unpack("!f")
+
+ def encode_double(self, o):
+ self.pack("!d", o)
+
+ def decode_double(self):
+ return self.unpack("!d")
+
+ def encode_bin128(self, b):
+ for idx in range (0,16):
+ self.pack("!B", ord (b[idx]))
+
+ def decode_bin128(self):
+ result = ""
+ for idx in range (0,16):
+ result = result + chr (self.unpack("!B"))
+ return result
+
+ def encode_raw(self, len, b):
+ for idx in range (0,len):
+ self.pack("!B", b[idx])
+
+ def decode_raw(self, len):
+ result = ""
+ for idx in range (0,len):
+ result = result + chr (self.unpack("!B"))
+ return result
+
+ def enc_str(self, fmt, s):
+ """
+ encodes a string 's' in network byte order as per format 'fmt'
+ """
+ size = len(s)
+ self.pack(fmt, size)
+ self.write(s)
+
+ def dec_str(self, fmt):
+ """
+ decodes a string in network byte order as per format 'fmt'
+ """
+ size = self.unpack(fmt)
+ return self.read(size)
+
+ def encode_shortstr(self, s):
+ """
+ encodes a short string 's' in network byte order
+ """
+
+ # short strings are limited to 255 octets
+ if len(s) > 255:
+ raise ValueError('Short strings are limited to 255 octets')
+
+ self.enc_str("!B", s)
+
+ def decode_shortstr(self):
+ """
+ decodes a short string in network byte order
+ """
+ return self.dec_str("!B")
+
+ def encode_longstr(self, s):
+ """
+ encodes a long string 's' in network byte order
+ """
+ if isinstance(s, dict):
+ self.encode_table(s)
+ else:
+ self.enc_str("!L", s)
+
+ def decode_longstr(self):
+ """
+ decodes a long string 's' in network byte order
+ """
+ return self.dec_str("!L")
+
+ def encode_table(self, tbl):
+ """
+ encodes a table data structure in network byte order
+ """
+ enc = StringIO()
+ codec = Codec(enc, self.spec)
+ if tbl:
+ for key, value in tbl.items():
+ if self.spec.major == 8 and self.spec.minor == 0 and len(key) > 128:
+ raise ValueError("field table key too long: '%s'" % key)
+ type = self.resolve(value.__class__, value)
+ if type == None:
+ raise ValueError("no encoding for: " + str(value.__class__))
+ codec.encode_shortstr(key)
+ codec.encode_octet(self.codes[type])
+ codec.encode(type, value)
+ s = enc.getvalue()
+ self.encode_long(len(s))
+ self.write(s)
+
+ def decode_table(self):
+ """
+ decodes a table data structure in network byte order
+ """
+ size = self.decode_long()
+ start = self.nread
+ result = {}
+ while self.nread - start < size:
+ key = self.decode_shortstr()
+ log.debug("Field table entry key: %r", key)
+ code = self.decode_octet()
+ log.debug("Field table entry type code: %r", code)
+ if self.types.has_key(code):
+ value = self.decode(self.types[code])
+ else:
+ w = width(code)
+ if fixed(code):
+ value = self.read(w)
+ else:
+ value = self.read(self.dec_num(w))
+ result[key] = value
+ log.debug("Field table entry value: %r", value)
+ return result
+
+ def encode_timestamp(self, t):
+ """
+ encodes a timestamp data structure in network byte order
+ """
+ self.encode_longlong(t)
+
+ def decode_timestamp(self):
+ """
+ decodes a timestamp data structure in network byte order
+ """
+ return self.decode_longlong()
+
+ def encode_content(self, s):
+ """
+ encodes a content data structure in network byte order
+
+ content can be passed as a string in which case it is assumed to
+ be inline data, or as an instance of ReferenceId indicating it is
+ a reference id
+ """
+ if isinstance(s, ReferenceId):
+ self.encode_octet(1)
+ self.encode_longstr(s.id)
+ else:
+ self.encode_octet(0)
+ self.encode_longstr(s)
+
+ def decode_content(self):
+ """
+ decodes a content data structure in network byte order
+
+ return a string for inline data and a ReferenceId instance for
+ references
+ """
+ type = self.decode_octet()
+ if type == 0:
+ return self.decode_longstr()
+ else:
+ return ReferenceId(self.decode_longstr())
+
+ # new domains for 0-10:
+
+ def encode_rfc1982_long(self, s):
+ self.encode_long(s)
+
+ def decode_rfc1982_long(self):
+ return self.decode_long()
+
+ def encode_rfc1982_long_set(self, s):
+ self.encode_short(len(s) * 4)
+ for i in s:
+ self.encode_long(i)
+
+ def decode_rfc1982_long_set(self):
+ count = self.decode_short() / 4
+ set = []
+ for i in range(0, count):
+ set.append(self.decode_long())
+ return set;
+
+ def encode_uuid(self, s):
+ self.pack("16s", s)
+
+ def decode_uuid(self):
+ return self.unpack("16s")
+
+ def encode_void(self,o):
+ #NO-OP, value is implicit in the type.
+ return
+
+ def decode_void(self):
+ return None
+
+ def enc_num(self, width, n):
+ if width == 1:
+ self.encode_octet(n)
+ elif width == 2:
+ self.encode_short(n)
+ elif width == 3:
+ self.encode_long(n)
+ else:
+ raise ValueError("invalid width: %s" % width)
+
+ def dec_num(self, width):
+ if width == 1:
+ return self.decode_octet()
+ elif width == 2:
+ return self.decode_short()
+ elif width == 4:
+ return self.decode_long()
+ else:
+ raise ValueError("invalid width: %s" % width)
+
+ def encode_struct(self, type, s):
+ if type.size:
+ enc = StringIO()
+ codec = Codec(enc, self.spec)
+ codec.encode_struct_body(type, s)
+ codec.flush()
+ body = enc.getvalue()
+ self.enc_num(type.size, len(body))
+ self.write(body)
+ else:
+ self.encode_struct_body(type, s)
+
+ def decode_struct(self, type):
+ if type.size:
+ size = self.dec_num(type.size)
+ if size == 0:
+ return None
+ return self.decode_struct_body(type)
+
+ def encode_struct_body(self, type, s):
+ reserved = 8*type.pack - len(type.fields)
+ assert reserved >= 0
+
+ for f in type.fields:
+ if s == None:
+ self.encode_bit(False)
+ elif f.type == "bit":
+ self.encode_bit(s.get(f.name))
+ else:
+ self.encode_bit(s.has(f.name))
+
+ for i in range(reserved):
+ self.encode_bit(False)
+
+ for f in type.fields:
+ if f.type != "bit" and s != None and s.has(f.name):
+ self.encode(f.type, s.get(f.name))
+
+ self.flush()
+
+ def decode_struct_body(self, type):
+ reserved = 8*type.pack - len(type.fields)
+ assert reserved >= 0
+
+ s = qpid.Struct(type)
+
+ for f in type.fields:
+ if f.type == "bit":
+ s.set(f.name, self.decode_bit())
+ elif self.decode_bit():
+ s.set(f.name, None)
+
+ for i in range(reserved):
+ if self.decode_bit():
+ raise ValueError("expecting reserved flag")
+
+ for f in type.fields:
+ if f.type != "bit" and s.has(f.name):
+ s.set(f.name, self.decode(f.type))
+
+ self.clearbits()
+
+ return s
+
+ def encode_long_struct(self, s):
+ enc = StringIO()
+ codec = Codec(enc, self.spec)
+ type = s.type
+ codec.encode_short(type.type)
+ codec.encode_struct_body(type, s)
+ self.encode_longstr(enc.getvalue())
+
+ def decode_long_struct(self):
+ codec = Codec(StringIO(self.decode_longstr()), self.spec)
+ type = self.spec.structs[codec.decode_short()]
+ return codec.decode_struct_body(type)
+
+ def decode_array(self):
+ size = self.decode_long()
+ code = self.decode_octet()
+ count = self.decode_long()
+ result = []
+ for i in range(0, count):
+ if self.types.has_key(code):
+ value = self.decode(self.types[code])
+ else:
+ w = width(code)
+ if fixed(code):
+ value = self.read(w)
+ else:
+ value = self.read(self.dec_num(w))
+ result.append(value)
+ return result
+
+ def encode_boolean(self, s):
+ if (s):
+ self.pack("!c", "\x01")
+ else:
+ self.pack("!c", "\x00")
+
+ def decode_boolean(self):
+ b = self.unpack("!c")
+ if b == "\x00":
+ return False
+ else:
+ # AMQP spec says anything else is True
+ return True
+
+
+
+def fixed(code):
+ return (code >> 6) != 2
+
+def width(code):
+ # decimal
+ if code >= 192:
+ decsel = (code >> 4) & 3
+ if decsel == 0:
+ return 5
+ elif decsel == 1:
+ return 9
+ elif decsel == 3:
+ return 0
+ else:
+ raise ValueError(code)
+ # variable width
+ elif code < 192 and code >= 128:
+ lenlen = (code >> 4) & 3
+ if lenlen == 3: raise ValueError(code)
+ return 2 ** lenlen
+ # fixed width
+ else:
+ return (code >> 4) & 7
diff --git a/qpid/python/qpid/codec010.py b/qpid/python/qpid/codec010.py
new file mode 100644
index 0000000000..f4dc60fcc4
--- /dev/null
+++ b/qpid/python/qpid/codec010.py
@@ -0,0 +1,404 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import datetime, string
+from packer import Packer
+from datatypes import serial, timestamp, RangedSet, Struct, UUID
+from ops import Compound, PRIMITIVE, COMPOUND
+
+class CodecException(Exception): pass
+
+def direct(t):
+ return lambda x: t
+
+def map_str(s):
+ for c in s:
+ if ord(c) >= 0x80:
+ return "vbin16"
+ return "str16"
+
+class Codec(Packer):
+
+ ENCODINGS = {
+ bool: direct("boolean"),
+ unicode: direct("str16"),
+ str: map_str,
+ buffer: direct("vbin32"),
+ int: direct("int64"),
+ long: direct("int64"),
+ float: direct("double"),
+ None.__class__: direct("void"),
+ list: direct("list"),
+ tuple: direct("list"),
+ dict: direct("map"),
+ timestamp: direct("datetime"),
+ datetime.datetime: direct("datetime"),
+ UUID: direct("uuid"),
+ Compound: direct("struct32")
+ }
+
+ def encoding(self, obj):
+ enc = self._encoding(obj.__class__, obj)
+ if enc is None:
+ raise CodecException("no encoding for %r" % obj)
+ return PRIMITIVE[enc]
+
+ def _encoding(self, klass, obj):
+ if self.ENCODINGS.has_key(klass):
+ return self.ENCODINGS[klass](obj)
+ for base in klass.__bases__:
+ result = self._encoding(base, obj)
+ if result != None:
+ return result
+
+ def read_primitive(self, type):
+ return getattr(self, "read_%s" % type.NAME)()
+ def write_primitive(self, type, v):
+ getattr(self, "write_%s" % type.NAME)(v)
+
+ def read_void(self):
+ return None
+ def write_void(self, v):
+ assert v == None
+
+ def read_bit(self):
+ return True
+ def write_bit(self, b):
+ if not b: raise ValueError(b)
+
+ def read_uint8(self):
+ return self.unpack("!B")
+ def write_uint8(self, n):
+ if n < 0 or n > 255:
+ raise CodecException("Cannot encode %d as uint8" % n)
+ return self.pack("!B", n)
+
+ def read_int8(self):
+ return self.unpack("!b")
+ def write_int8(self, n):
+ if n < -128 or n > 127:
+ raise CodecException("Cannot encode %d as int8" % n)
+ self.pack("!b", n)
+
+ def read_char(self):
+ return self.unpack("!c")
+ def write_char(self, c):
+ self.pack("!c", c)
+
+ def read_boolean(self):
+ return self.read_uint8() != 0
+ def write_boolean(self, b):
+ if b: n = 1
+ else: n = 0
+ self.write_uint8(n)
+
+
+ def read_uint16(self):
+ return self.unpack("!H")
+ def write_uint16(self, n):
+ if n < 0 or n > 65535:
+ raise CodecException("Cannot encode %d as uint16" % n)
+ self.pack("!H", n)
+
+ def read_int16(self):
+ return self.unpack("!h")
+ def write_int16(self, n):
+ if n < -32768 or n > 32767:
+ raise CodecException("Cannot encode %d as int16" % n)
+ self.pack("!h", n)
+
+
+ def read_uint32(self):
+ return self.unpack("!L")
+ def write_uint32(self, n):
+ if n < 0 or n > 4294967295:
+ raise CodecException("Cannot encode %d as uint32" % n)
+ self.pack("!L", n)
+
+ def read_int32(self):
+ return self.unpack("!l")
+ def write_int32(self, n):
+ if n < -2147483648 or n > 2147483647:
+ raise CodecException("Cannot encode %d as int32" % n)
+ self.pack("!l", n)
+
+ def read_float(self):
+ return self.unpack("!f")
+ def write_float(self, f):
+ self.pack("!f", f)
+
+ def read_sequence_no(self):
+ return serial(self.read_uint32())
+ def write_sequence_no(self, n):
+ self.write_uint32(n.value)
+
+
+ def read_uint64(self):
+ return self.unpack("!Q")
+ def write_uint64(self, n):
+ self.pack("!Q", n)
+
+ def read_int64(self):
+ return self.unpack("!q")
+ def write_int64(self, n):
+ self.pack("!q", n)
+
+ def read_datetime(self):
+ return timestamp(self.read_uint64())
+ def write_datetime(self, t):
+ if isinstance(t, datetime.datetime):
+ t = timestamp(t)
+ self.write_uint64(t)
+
+ def read_double(self):
+ return self.unpack("!d")
+ def write_double(self, d):
+ self.pack("!d", d)
+
+ def read_vbin8(self):
+ return self.read(self.read_uint8())
+ def write_vbin8(self, b):
+ if isinstance(b, buffer):
+ b = str(b)
+ self.write_uint8(len(b))
+ self.write(b)
+
+ def read_str8(self):
+ return self.read_vbin8().decode("utf8")
+ def write_str8(self, s):
+ self.write_vbin8(s.encode("utf8"))
+
+ def read_str16(self):
+ return self.read_vbin16().decode("utf8")
+ def write_str16(self, s):
+ self.write_vbin16(s.encode("utf8"))
+
+ def read_str16_latin(self):
+ return self.read_vbin16().decode("iso-8859-15")
+ def write_str16_latin(self, s):
+ self.write_vbin16(s.encode("iso-8859-15"))
+
+
+ def read_vbin16(self):
+ return self.read(self.read_uint16())
+ def write_vbin16(self, b):
+ if isinstance(b, buffer):
+ b = str(b)
+ self.write_uint16(len(b))
+ self.write(b)
+
+ def read_sequence_set(self):
+ result = RangedSet()
+ size = self.read_uint16()
+ nranges = size/8
+ while nranges > 0:
+ lower = self.read_sequence_no()
+ upper = self.read_sequence_no()
+ result.add(lower, upper)
+ nranges -= 1
+ return result
+ def write_sequence_set(self, ss):
+ size = 8*len(ss.ranges)
+ self.write_uint16(size)
+ for range in ss.ranges:
+ self.write_sequence_no(range.lower)
+ self.write_sequence_no(range.upper)
+
+ def read_vbin32(self):
+ return self.read(self.read_uint32())
+ def write_vbin32(self, b):
+ if isinstance(b, buffer):
+ b = str(b)
+ # Allow unicode values in connection 'response' field
+ if isinstance(b, unicode):
+ b = b.encode('utf8')
+ self.write_uint32(len(b))
+ self.write(b)
+
+ def read_map(self):
+ sc = StringCodec(self.read_vbin32())
+ if not sc.encoded:
+ return None
+ count = sc.read_uint32()
+ result = {}
+ while sc.encoded:
+ k = sc.read_str8()
+ code = sc.read_uint8()
+ type = PRIMITIVE[code]
+ v = sc.read_primitive(type)
+ result[k] = v
+ return result
+
+ def _write_map_elem(self, k, v):
+ type = self.encoding(v)
+ sc = StringCodec()
+ sc.write_str8(k)
+ sc.write_uint8(type.CODE)
+ sc.write_primitive(type, v)
+ return sc.encoded
+
+ def write_map(self, m):
+ sc = StringCodec()
+ if m is not None:
+ sc.write_uint32(len(m))
+ sc.write(string.joinfields(map(self._write_map_elem, m.keys(), m.values()), ""))
+ self.write_vbin32(sc.encoded)
+
+ def read_array(self):
+ sc = StringCodec(self.read_vbin32())
+ if not sc.encoded:
+ return None
+ type = PRIMITIVE[sc.read_uint8()]
+ count = sc.read_uint32()
+ result = []
+ while count > 0:
+ result.append(sc.read_primitive(type))
+ count -= 1
+ return result
+ def write_array(self, a):
+ sc = StringCodec()
+ if a is not None:
+ if len(a) > 0:
+ type = self.encoding(a[0])
+ else:
+ type = self.encoding(None)
+ sc.write_uint8(type.CODE)
+ sc.write_uint32(len(a))
+ for o in a:
+ sc.write_primitive(type, o)
+ self.write_vbin32(sc.encoded)
+
+ def read_list(self):
+ sc = StringCodec(self.read_vbin32())
+ if not sc.encoded:
+ return None
+ count = sc.read_uint32()
+ result = []
+ while count > 0:
+ type = PRIMITIVE[sc.read_uint8()]
+ result.append(sc.read_primitive(type))
+ count -= 1
+ return result
+ def write_list(self, l):
+ sc = StringCodec()
+ if l is not None:
+ sc.write_uint32(len(l))
+ for o in l:
+ type = self.encoding(o)
+ sc.write_uint8(type.CODE)
+ sc.write_primitive(type, o)
+ self.write_vbin32(sc.encoded)
+
+ def read_struct32(self):
+ size = self.read_uint32()
+ code = self.read_uint16()
+ cls = COMPOUND[code]
+ op = cls()
+ self.read_fields(op)
+ return op
+ def write_struct32(self, value):
+ self.write_compound(value)
+
+ def read_compound(self, cls):
+ size = self.read_size(cls.SIZE)
+ if cls.CODE is not None:
+ code = self.read_uint16()
+ assert code == cls.CODE
+ op = cls()
+ self.read_fields(op)
+ return op
+ def write_compound(self, op):
+ sc = StringCodec()
+ if op.CODE is not None:
+ sc.write_uint16(op.CODE)
+ sc.write_fields(op)
+ self.write_size(op.SIZE, len(sc.encoded))
+ self.write(sc.encoded)
+
+ def read_fields(self, op):
+ flags = 0
+ for i in range(op.PACK):
+ flags |= (self.read_uint8() << 8*i)
+
+ for i in range(len(op.FIELDS)):
+ f = op.FIELDS[i]
+ if flags & (0x1 << i):
+ if COMPOUND.has_key(f.type):
+ value = self.read_compound(COMPOUND[f.type])
+ else:
+ value = getattr(self, "read_%s" % f.type)()
+ setattr(op, f.name, value)
+ def write_fields(self, op):
+ flags = 0
+ for i in range(len(op.FIELDS)):
+ f = op.FIELDS[i]
+ value = getattr(op, f.name)
+ if f.type == "bit":
+ present = value
+ else:
+ present = value != None
+ if present:
+ flags |= (0x1 << i)
+ for i in range(op.PACK):
+ self.write_uint8((flags >> 8*i) & 0xFF)
+ for i in range(len(op.FIELDS)):
+ f = op.FIELDS[i]
+ if flags & (0x1 << i):
+ if COMPOUND.has_key(f.type):
+ enc = self.write_compound
+ else:
+ enc = getattr(self, "write_%s" % f.type)
+ value = getattr(op, f.name)
+ enc(value)
+
+ def read_size(self, width):
+ if width > 0:
+ attr = "read_uint%d" % (width*8)
+ return getattr(self, attr)()
+ def write_size(self, width, n):
+ if width > 0:
+ attr = "write_uint%d" % (width*8)
+ getattr(self, attr)(n)
+
+ def read_uuid(self):
+ return UUID(bytes=self.unpack("16s"))
+ def write_uuid(self, s):
+ if isinstance(s, UUID):
+ s = s.bytes
+ self.pack("16s", s)
+
+ def read_bin128(self):
+ return self.unpack("16s")
+ def write_bin128(self, b):
+ self.pack("16s", b)
+
+
+
+class StringCodec(Codec):
+
+ def __init__(self, encoded = ""):
+ self.encoded = encoded
+
+ def read(self, n):
+ result = self.encoded[:n]
+ self.encoded = self.encoded[n:]
+ return result
+
+ def write(self, s):
+ self.encoded += s
diff --git a/qpid/python/qpid/compat.py b/qpid/python/qpid/compat.py
new file mode 100644
index 0000000000..12966c2383
--- /dev/null
+++ b/qpid/python/qpid/compat.py
@@ -0,0 +1,221 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import sys
+import errno
+import time
+from logging import getLogger
+log = getLogger("qpid.messaging")
+
+try:
+ set = set
+except NameError:
+ from sets import Set as set
+
+try:
+ from socket import SHUT_RDWR
+except ImportError:
+ SHUT_RDWR = 2
+
+try:
+ from traceback import format_exc
+except ImportError:
+ import traceback
+ def format_exc():
+ return "".join(traceback.format_exception(*sys.exc_info()))
+
+# QPID-5588: prefer poll() to select(), as it allows file descriptors with
+# values > FD_SETSIZE
+import select as _select_mod
+try:
+ # QPID-5790: unless eventlet/greenthreads have monkey-patched the select
+ # module, as to date poll() is not properly supported by eventlet
+ import eventlet
+ _is_patched = eventlet.patcher.is_monkey_patched("select")
+except ImportError:
+ _is_patched = False
+
+if hasattr(_select_mod, "poll") and not _is_patched:
+ from select import error as SelectError
+ def select(rlist, wlist, xlist, timeout=None):
+ fd_count = 0
+ rset = set(rlist)
+ wset = set(wlist)
+ xset = set(xlist)
+ if timeout:
+ # select expects seconds, poll milliseconds
+ timeout = float(timeout) * 1000
+ poller = _select_mod.poll()
+
+ rwset = rset.intersection(wset)
+ for rw in rwset:
+ poller.register(rw, (_select_mod.POLLIN | _select_mod.POLLOUT))
+ fd_count += 1
+ for ro in rset.difference(rwset):
+ poller.register(ro, _select_mod.POLLIN)
+ fd_count += 1
+ for wo in wset.difference(rwset):
+ poller.register(wo, _select_mod.POLLOUT)
+ fd_count += 1
+ for x in xset:
+ poller.register(x, _select_mod.POLLPRI)
+ fd_count += 1
+
+ # select returns the objects passed in, but poll gives us back only the
+ # integer fds. Maintain a map to get back:
+ fd_map = {}
+ for o in rset | wset | xset:
+ if hasattr(o, "fileno"):
+ fd_map[o.fileno()] = o
+
+ log.debug("poll(%d fds, timeout=%s)", fd_count, timeout)
+ active = poller.poll(timeout)
+ log.debug("poll() returned %s fds", len(active))
+
+ rfds = []
+ wfds = []
+ xfds = []
+ # set the error conditions so we do a read(), which will report the error
+ rflags = (_select_mod.POLLIN | _select_mod.POLLERR | _select_mod.POLLHUP)
+ for fds, flags in active:
+ if fds in fd_map:
+ fds = fd_map[fds]
+ if (flags & rflags):
+ rfds.append(fds)
+ if (flags & _select_mod.POLLOUT):
+ wfds.append(fds)
+ if (flags & _select_mod.POLLPRI):
+ xfds.append(fds)
+ return (rfds, wfds, xfds)
+else:
+ if tuple(sys.version_info[0:2]) < (2, 4):
+ from select import select as old_select
+ def select(rlist, wlist, xlist, timeout=None):
+ return old_select(list(rlist), list(wlist), list(xlist), timeout)
+ else:
+ from select import select
+ from select import error as SelectError
+
+class BaseWaiter:
+
+ def wakeup(self):
+ self._do_write()
+
+ def wait(self, timeout=None):
+ start = time.time()
+ if timeout is not None:
+ ready = False
+ while timeout > 0:
+ try:
+ ready, _, _ = select([self], [], [], timeout)
+ break
+ except SelectError, e:
+ if e[0] == errno.EINTR:
+ elapsed = time.time() - start
+ timeout = timeout - elapsed
+ else:
+ raise e
+ else:
+ ready = True
+
+ if ready:
+ self._do_read()
+ return True
+ else:
+ return False
+
+ def reading(self):
+ return True
+
+ def readable(self):
+ self._do_read()
+
+if sys.platform in ('win32', 'cygwin'):
+ import socket
+
+ class SockWaiter(BaseWaiter):
+
+ def __init__(self, read_sock, write_sock):
+ self.read_sock = read_sock
+ self.write_sock = write_sock
+
+ def _do_write(self):
+ self.write_sock.send("\0")
+
+ def _do_read(self):
+ self.read_sock.recv(65536)
+
+ def fileno(self):
+ return self.read_sock.fileno()
+
+ def close(self):
+ if self.write_sock is not None:
+ self.write_sock.close()
+ self.write_sock = None
+ self.read_sock.close()
+ self.read_sock = None
+
+ def __del__(self):
+ self.close()
+
+ def __repr__(self):
+ return "SockWaiter(%r, %r)" % (self.read_sock, self.write_sock)
+
+ def selectable_waiter():
+ listener = socket.socket()
+ listener.bind(('', 0))
+ listener.listen(1)
+ _, port = listener.getsockname()
+ write_sock = socket.socket()
+ write_sock.connect(("127.0.0.1", port))
+ read_sock, _ = listener.accept()
+ listener.close()
+ return SockWaiter(read_sock, write_sock)
+else:
+ import os
+
+ class PipeWaiter(BaseWaiter):
+
+ def __init__(self):
+ self.read_fd, self.write_fd = os.pipe()
+
+ def _do_write(self):
+ os.write(self.write_fd, "\0")
+
+ def _do_read(self):
+ os.read(self.read_fd, 65536)
+
+ def fileno(self):
+ return self.read_fd
+
+ def close(self):
+ if self.write_fd is not None:
+ os.close(self.write_fd)
+ self.write_fd = None
+ os.close(self.read_fd)
+ self.read_fd = None
+
+ def __del__(self):
+ self.close()
+
+ def __repr__(self):
+ return "PipeWaiter(%r, %r)" % (self.read_fd, self.write_fd)
+
+ def selectable_waiter():
+ return PipeWaiter()
diff --git a/qpid/python/qpid/concurrency.py b/qpid/python/qpid/concurrency.py
new file mode 100644
index 0000000000..eefe0d445f
--- /dev/null
+++ b/qpid/python/qpid/concurrency.py
@@ -0,0 +1,106 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import compat, inspect, time
+
+def synchronized(meth):
+ args, vargs, kwargs, defs = inspect.getargspec(meth)
+ scope = {}
+ scope["meth"] = meth
+ exec """
+def %s%s:
+ %s
+ %s._lock.acquire()
+ try:
+ return meth%s
+ finally:
+ %s._lock.release()
+""" % (meth.__name__, inspect.formatargspec(args, vargs, kwargs, defs),
+ repr(inspect.getdoc(meth)), args[0],
+ inspect.formatargspec(args, vargs, kwargs, defs,
+ formatvalue=lambda x: ""),
+ args[0]) in scope
+ return scope[meth.__name__]
+
+class Waiter(object):
+
+ def __init__(self, condition):
+ self.condition = condition
+
+ def wait(self, predicate, timeout=None):
+ passed = 0
+ start = time.time()
+ while not predicate():
+ if timeout is None:
+ # XXX: this timed wait thing is not necessary for the fast
+ # condition from this module, only for the condition impl from
+ # the threading module
+
+ # using the timed wait prevents keyboard interrupts from being
+ # blocked while waiting
+ self.condition.wait(3)
+ elif passed < timeout:
+ self.condition.wait(timeout - passed)
+ else:
+ return bool(predicate())
+ passed = time.time() - start
+ return True
+
+ def notify(self):
+ self.condition.notify()
+
+ def notifyAll(self):
+ self.condition.notifyAll()
+
+class Condition:
+
+ def __init__(self, lock):
+ self.lock = lock
+ self.waiters = []
+ self.waiting = []
+
+ def notify(self):
+ assert self.lock._is_owned()
+ if self.waiting:
+ self.waiting[0].wakeup()
+
+ def notifyAll(self):
+ assert self.lock._is_owned()
+ for w in self.waiting:
+ w.wakeup()
+
+ def wait(self, timeout=None):
+ assert self.lock._is_owned()
+ if not self.waiters:
+ self.waiters.append(compat.selectable_waiter())
+ sw = self.waiters.pop(0)
+ self.waiting.append(sw)
+ try:
+ st = self.lock._release_save()
+ sw.wait(timeout)
+ finally:
+ self.lock._acquire_restore(st)
+ self.waiting.remove(sw)
+ self.waiters.append(sw)
+
+ def gc(self):
+ assert self.lock._is_owned()
+ while self.waiters:
+ sw = self.waiters.pop(0)
+ sw.close()
diff --git a/qpid/python/qpid/connection.py b/qpid/python/qpid/connection.py
new file mode 100644
index 0000000000..2453f38c34
--- /dev/null
+++ b/qpid/python/qpid/connection.py
@@ -0,0 +1,250 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import datatypes, session
+from threading import Thread, Condition, RLock
+from util import wait, notify
+from codec010 import StringCodec
+from framing import *
+from session import Session
+from generator import control_invoker
+from exceptions import *
+from logging import getLogger
+import delegates, socket
+import sys
+
+class ChannelBusy(Exception): pass
+
+class ChannelsBusy(Exception): pass
+
+class SessionBusy(Exception): pass
+
+class ConnectionFailed(Exception): pass
+
+def client(*args, **kwargs):
+ return delegates.Client(*args, **kwargs)
+
+def server(*args, **kwargs):
+ return delegates.Server(*args, **kwargs)
+
+from framer import Framer
+
+class Connection(Framer):
+
+ def __init__(self, sock, delegate=client, **args):
+ Framer.__init__(self, sock)
+ self.lock = RLock()
+ self.attached = {}
+ self.sessions = {}
+
+ self.condition = Condition()
+ # XXX: we should combine this into a single comprehensive state
+ # model (whatever that means)
+ self.opened = False
+ self.failed = False
+ self.closed = False
+ self.close_code = (None, "connection aborted")
+
+ self.thread = Thread(target=self.run)
+ self.thread.setDaemon(True)
+
+ self.channel_max = 65535
+ self.user_id = None
+
+ self.op_enc = OpEncoder()
+ self.seg_enc = SegmentEncoder()
+ self.frame_enc = FrameEncoder()
+
+ self.delegate = delegate(self, **args)
+
+ def attach(self, name, ch, delegate, force=False):
+ self.lock.acquire()
+ try:
+ ssn = self.attached.get(ch.id)
+ if ssn is not None:
+ if ssn.name != name:
+ raise ChannelBusy(ch, ssn)
+ else:
+ ssn = self.sessions.get(name)
+ if ssn is None:
+ ssn = Session(name, delegate=delegate)
+ self.sessions[name] = ssn
+ elif ssn.channel is not None:
+ if force:
+ del self.attached[ssn.channel.id]
+ ssn.channel = None
+ else:
+ raise SessionBusy(ssn)
+ self.attached[ch.id] = ssn
+ ssn.channel = ch
+ ch.session = ssn
+ return ssn
+ finally:
+ self.lock.release()
+
+ def detach(self, name, ch):
+ self.lock.acquire()
+ try:
+ self.attached.pop(ch.id, None)
+ ssn = self.sessions.pop(name, None)
+ if ssn is not None:
+ ssn.channel = None
+ ssn.closed()
+ return ssn
+ finally:
+ self.lock.release()
+
+ def __channel(self):
+ for i in xrange(1, self.channel_max):
+ if not self.attached.has_key(i):
+ return i
+ else:
+ raise ChannelsBusy()
+
+ def session(self, name, timeout=None, delegate=session.client):
+ self.lock.acquire()
+ try:
+ ch = Channel(self, self.__channel())
+ ssn = self.attach(name, ch, delegate)
+ ssn.channel.session_attach(name)
+ if wait(ssn.condition, lambda: ssn.channel is not None, timeout):
+ return ssn
+ else:
+ self.detach(name, ch)
+ raise Timeout()
+ finally:
+ self.lock.release()
+
+ def detach_all(self):
+ self.lock.acquire()
+ self.failed = True
+ try:
+ for ssn in self.attached.values():
+ if self.close_code[0] != 200:
+ ssn.exceptions.append(self.close_code)
+ self.detach(ssn.name, ssn.channel)
+ finally:
+ self.lock.release()
+
+ def start(self, timeout=None):
+ self.delegate.start()
+ self.thread.start()
+ if not wait(self.condition, lambda: self.opened or self.failed, timeout):
+ self.thread.join()
+ raise Timeout()
+ if self.failed:
+ self.thread.join()
+ raise ConnectionFailed(*self.close_code)
+
+ def run(self):
+ frame_dec = FrameDecoder()
+ seg_dec = SegmentDecoder()
+ op_dec = OpDecoder()
+
+ while not self.closed:
+ try:
+ data = self.sock.recv(64*1024)
+ if not data:
+ self.detach_all()
+ break
+ # If we have a security layer and it sends us no decoded data,
+ # that's OK as long as its return code is happy.
+ if self.security_layer_rx:
+ try:
+ data = self.security_layer_rx.decode(data)
+ except:
+ self.detach_all()
+ break
+ # When we do not use SSL transport, we get periodic
+ # spurious timeout events on the socket. When using SSL,
+ # these events show up as timeout *errors*. Both should be
+ # ignored unless we have aborted.
+ except socket.timeout:
+ if self.aborted():
+ self.close_code = (None, "connection timed out")
+ self.detach_all()
+ break
+ else:
+ continue
+ except socket.error, e:
+ if self.aborted() or str(e) != "The read operation timed out":
+ self.close_code = (None, str(e))
+ self.detach_all()
+ break
+ else:
+ continue
+ frame_dec.write(data)
+ seg_dec.write(*frame_dec.read())
+ op_dec.write(*seg_dec.read())
+ for op in op_dec.read():
+ try:
+ self.delegate.received(op)
+ except Closed, e:
+ self.close_code = (None, str(e))
+ if not self.opened:
+ self.failed = True
+ self.closed = True
+ notify(self.condition)
+ self.sock.close()
+
+ def write_op(self, op):
+ self.sock_lock.acquire()
+ try:
+ self.op_enc.write(op)
+ self.seg_enc.write(*self.op_enc.read())
+ self.frame_enc.write(*self.seg_enc.read())
+ bytes = self.frame_enc.read()
+ self.write(bytes)
+ self.flush()
+ finally:
+ self.sock_lock.release()
+
+ def close(self, timeout=None):
+ if not self.opened: return
+ Channel(self, 0).connection_close(200)
+ if not wait(self.condition, lambda: not self.opened, timeout):
+ raise Timeout()
+ self.thread.join(timeout=timeout)
+
+ def __str__(self):
+ return "%s:%s" % self.sock.getsockname()
+
+ def __repr__(self):
+ return str(self)
+
+log = getLogger("qpid.io.ctl")
+
+class Channel(control_invoker()):
+
+ def __init__(self, connection, id):
+ self.connection = connection
+ self.id = id
+ self.session = None
+
+ def invoke(self, op, args, kwargs):
+ ctl = op(*args, **kwargs)
+ ctl.channel = self.id
+ self.connection.write_op(ctl)
+ log.debug("SENT %s", ctl)
+
+ def __str__(self):
+ return "%s[%s]" % (self.connection, self.id)
+
+ def __repr__(self):
+ return str(self)
diff --git a/qpid/python/qpid/connection08.py b/qpid/python/qpid/connection08.py
new file mode 100644
index 0000000000..9565937a6e
--- /dev/null
+++ b/qpid/python/qpid/connection08.py
@@ -0,0 +1,555 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+A Connection class containing socket code that uses the spec metadata
+to read and write Frame objects. This could be used by a client,
+server, or even a proxy implementation.
+"""
+
+import socket, codec, errno, qpid
+from cStringIO import StringIO
+from codec import EOF
+from compat import SHUT_RDWR
+from exceptions import VersionError
+from logging import getLogger, DEBUG
+
+log = getLogger("qpid.connection08")
+
+class SockIO:
+
+ def __init__(self, sock):
+ self.sock = sock
+
+ def write(self, buf):
+ if log.isEnabledFor(DEBUG):
+ log.debug("OUT: %r", buf)
+ self.sock.sendall(buf)
+
+ def read(self, n):
+ data = ""
+ while len(data) < n:
+ try:
+ s = self.sock.recv(n - len(data))
+ except socket.error:
+ break
+ if len(s) == 0:
+ break
+ data += s
+ if log.isEnabledFor(DEBUG):
+ log.debug("IN: %r", data)
+ return data
+
+ def flush(self):
+ pass
+
+ def close(self):
+ try:
+ try:
+ self.sock.shutdown(SHUT_RDWR)
+ except socket.error, e:
+ if (e.errno == errno.ENOTCONN):
+ pass
+ else:
+ raise
+ finally:
+ self.sock.close()
+
+def connect(host, port, options = None):
+ sock = socket.socket()
+
+ if options and options.get("ssl", False):
+ log.debug("Wrapping socket for SSL")
+ from ssl import wrap_socket, CERT_REQUIRED, CERT_NONE
+
+ ssl_certfile = options.get("ssl_certfile", None)
+ ssl_keyfile = options.get("ssl_keyfile", ssl_certfile)
+ ssl_trustfile = options.get("ssl_trustfile", None)
+ ssl_require_trust = options.get("ssl_require_trust", True)
+
+ if ssl_require_trust:
+ validate = CERT_REQUIRED
+ else:
+ validate = CERT_NONE
+
+ sock = wrap_socket(sock,
+ keyfile = ssl_keyfile,
+ certfile = ssl_certfile,
+ ca_certs = ssl_trustfile,
+ cert_reqs = validate)
+
+ sock.connect((host, port))
+ sock.setblocking(1)
+ return SockIO(sock)
+
+def listen(host, port, predicate = lambda: True):
+ sock = socket.socket()
+ sock.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1)
+ sock.bind((host, port))
+ sock.listen(5)
+ while predicate():
+ s, a = sock.accept()
+ yield SockIO(s)
+
+class FramingError(Exception):
+ pass
+
+class Connection:
+
+ def __init__(self, io, spec):
+ self.codec = codec.Codec(io, spec)
+ self.spec = spec
+ self.FRAME_END = self.spec.constants.byname["frame_end"].id
+ self.write = getattr(self, "write_%s_%s" % (self.spec.major, self.spec.minor))
+ self.read = getattr(self, "read_%s_%s" % (self.spec.major, self.spec.minor))
+ self.io = io
+
+ def flush(self):
+ self.codec.flush()
+
+ INIT="!4s4B"
+
+ def init(self):
+ self.codec.pack(Connection.INIT, "AMQP", 1, 1, self.spec.major,
+ self.spec.minor)
+
+ def tini(self):
+ self.codec.unpack(Connection.INIT)
+
+ def write_8_0(self, frame):
+ c = self.codec
+ c.encode_octet(self.spec.constants.byname[frame.type].id)
+ c.encode_short(frame.channel)
+ body = StringIO()
+ enc = codec.Codec(body, self.spec)
+ frame.encode(enc)
+ enc.flush()
+ c.encode_longstr(body.getvalue())
+ c.encode_octet(self.FRAME_END)
+
+ def read_8_0(self):
+ c = self.codec
+ tid = c.decode_octet()
+ try:
+ type = self.spec.constants.byid[tid].name
+ except KeyError:
+ if tid == ord('A') and c.unpack("!3s") == "MQP":
+ _, _, major, minor = c.unpack("4B")
+ raise VersionError("client: %s-%s, server: %s-%s" %
+ (self.spec.major, self.spec.minor, major, minor))
+ else:
+ raise FramingError("unknown frame type: %s" % tid)
+ try:
+ channel = c.decode_short()
+ body = c.decode_longstr()
+ dec = codec.Codec(StringIO(body), self.spec)
+ frame = Frame.DECODERS[type].decode(self.spec, dec, len(body))
+ frame.channel = channel
+ end = c.decode_octet()
+ if end != self.FRAME_END:
+ garbage = ""
+ while end != self.FRAME_END:
+ garbage += chr(end)
+ end = c.decode_octet()
+ raise FramingError("frame error: expected %r, got %r" % (self.FRAME_END, garbage))
+ return frame
+ except EOF:
+ # An EOF caught here can indicate an error decoding the frame,
+ # rather than that a disconnection occurred,so it's worth logging it.
+ log.exception("Error occurred when reading frame with tid %s" % tid)
+ raise
+
+ def write_0_9(self, frame):
+ self.write_8_0(frame)
+
+ def read_0_9(self):
+ return self.read_8_0()
+
+ def write_0_91(self, frame):
+ self.write_8_0(frame)
+
+ def read_0_91(self):
+ return self.read_8_0()
+
+ def write_0_10(self, frame):
+ c = self.codec
+ flags = 0
+ if frame.bof: flags |= 0x08
+ if frame.eof: flags |= 0x04
+ if frame.bos: flags |= 0x02
+ if frame.eos: flags |= 0x01
+
+ c.encode_octet(flags) # TODO: currently fixed at ver=0, B=E=b=e=1
+ c.encode_octet(self.spec.constants.byname[frame.type].id)
+ body = StringIO()
+ enc = codec.Codec(body, self.spec)
+ frame.encode(enc)
+ enc.flush()
+ frame_size = len(body.getvalue()) + 12 # TODO: Magic number (frame header size)
+ c.encode_short(frame_size)
+ c.encode_octet(0) # Reserved
+ c.encode_octet(frame.subchannel & 0x0f)
+ c.encode_short(frame.channel)
+ c.encode_long(0) # Reserved
+ c.write(body.getvalue())
+ c.encode_octet(self.FRAME_END)
+
+ def read_0_10(self):
+ c = self.codec
+ flags = c.decode_octet() # TODO: currently ignoring flags
+ framing_version = (flags & 0xc0) >> 6
+ if framing_version != 0:
+ raise FramingError("frame error: unknown framing version")
+ type = self.spec.constants.byid[c.decode_octet()].name
+ frame_size = c.decode_short()
+ if frame_size < 12: # TODO: Magic number (frame header size)
+ raise FramingError("frame error: frame size too small")
+ reserved1 = c.decode_octet()
+ field = c.decode_octet()
+ subchannel = field & 0x0f
+ channel = c.decode_short()
+ reserved2 = c.decode_long() # TODO: reserved maybe need to ensure 0
+ if (flags & 0x30) != 0 or reserved1 != 0 or (field & 0xf0) != 0:
+ raise FramingError("frame error: reserved bits not all zero")
+ body_size = frame_size - 12 # TODO: Magic number (frame header size)
+ body = c.read(body_size)
+ dec = codec.Codec(StringIO(body), self.spec)
+ try:
+ frame = Frame.DECODERS[type].decode(self.spec, dec, len(body))
+ except EOF:
+ raise FramingError("truncated frame body: %r" % body)
+ frame.channel = channel
+ frame.subchannel = subchannel
+ end = c.decode_octet()
+ if end != self.FRAME_END:
+ garbage = ""
+ while end != self.FRAME_END:
+ garbage += chr(end)
+ end = c.decode_octet()
+ raise FramingError("frame error: expected %r, got %r" % (self.FRAME_END, garbage))
+ return frame
+
+ def write_99_0(self, frame):
+ self.write_0_10(frame)
+
+ def read_99_0(self):
+ return self.read_0_10()
+
+ def close(self):
+ self.io.close();
+
+class Frame:
+
+ DECODERS = {}
+
+ class __metaclass__(type):
+
+ def __new__(cls, name, bases, dict):
+ for attr in ("encode", "decode", "type"):
+ if not dict.has_key(attr):
+ raise TypeError("%s must define %s" % (name, attr))
+ dict["decode"] = staticmethod(dict["decode"])
+ if dict.has_key("__init__"):
+ __init__ = dict["__init__"]
+ def init(self, *args, **kwargs):
+ args = list(args)
+ self.init(args, kwargs)
+ __init__(self, *args, **kwargs)
+ dict["__init__"] = init
+ t = type.__new__(cls, name, bases, dict)
+ if t.type != None:
+ Frame.DECODERS[t.type] = t
+ return t
+
+ type = None
+
+ def init(self, args, kwargs):
+ self.channel = kwargs.pop("channel", 0)
+ self.subchannel = kwargs.pop("subchannel", 0)
+ self.bos = True
+ self.eos = True
+ self.bof = True
+ self.eof = True
+
+ def encode(self, enc): abstract
+
+ def decode(spec, dec, size): abstract
+
+class Method(Frame):
+
+ type = "frame_method"
+
+ def __init__(self, method, args):
+ if len(args) != len(method.fields):
+ argspec = ["%s: %s" % (f.name, f.type)
+ for f in method.fields]
+ raise TypeError("%s.%s expecting (%s), got %s" %
+ (method.klass.name, method.name, ", ".join(argspec),
+ args))
+ self.method = method
+ self.method_type = method
+ self.args = args
+ self.eof = not method.content
+
+ def encode(self, c):
+ version = (c.spec.major, c.spec.minor)
+ if version == (0, 10) or version == (99, 0):
+ c.encode_octet(self.method.klass.id)
+ c.encode_octet(self.method.id)
+ else:
+ c.encode_short(self.method.klass.id)
+ c.encode_short(self.method.id)
+ for field, arg in zip(self.method.fields, self.args):
+ c.encode(field.type, arg)
+
+ def decode(spec, c, size):
+ version = (c.spec.major, c.spec.minor)
+ if version == (0, 10) or version == (99, 0):
+ klass = spec.classes.byid[c.decode_octet()]
+ meth = klass.methods.byid[c.decode_octet()]
+ else:
+ klass = spec.classes.byid[c.decode_short()]
+ meth = klass.methods.byid[c.decode_short()]
+ args = tuple([c.decode(f.type) for f in meth.fields])
+ return Method(meth, args)
+
+ def __str__(self):
+ return "[%s] %s %s" % (self.channel, self.method,
+ ", ".join([str(a) for a in self.args]))
+
+class Request(Frame):
+
+ type = "frame_request"
+
+ def __init__(self, id, response_mark, method):
+ self.id = id
+ self.response_mark = response_mark
+ self.method = method
+ self.method_type = method.method_type
+ self.args = method.args
+
+ def encode(self, enc):
+ enc.encode_longlong(self.id)
+ enc.encode_longlong(self.response_mark)
+ # reserved
+ enc.encode_long(0)
+ self.method.encode(enc)
+
+ def decode(spec, dec, size):
+ id = dec.decode_longlong()
+ mark = dec.decode_longlong()
+ # reserved
+ dec.decode_long()
+ method = Method.decode(spec, dec, size - 20)
+ return Request(id, mark, method)
+
+ def __str__(self):
+ return "[%s] Request(%s) %s" % (self.channel, self.id, self.method)
+
+class Response(Frame):
+
+ type = "frame_response"
+
+ def __init__(self, id, request_id, batch_offset, method):
+ self.id = id
+ self.request_id = request_id
+ self.batch_offset = batch_offset
+ self.method = method
+ self.method_type = method.method_type
+ self.args = method.args
+
+ def encode(self, enc):
+ enc.encode_longlong(self.id)
+ enc.encode_longlong(self.request_id)
+ enc.encode_long(self.batch_offset)
+ self.method.encode(enc)
+
+ def decode(spec, dec, size):
+ id = dec.decode_longlong()
+ request_id = dec.decode_longlong()
+ batch_offset = dec.decode_long()
+ method = Method.decode(spec, dec, size - 20)
+ return Response(id, request_id, batch_offset, method)
+
+ def __str__(self):
+ return "[%s] Response(%s,%s,%s) %s" % (self.channel, self.id, self.request_id, self.batch_offset, self.method)
+
+def uses_struct_encoding(spec):
+ return (spec.major == 0 and spec.minor == 10) or (spec.major == 99 and spec.minor == 0)
+
+class Header(Frame):
+
+ type = "frame_header"
+
+ def __init__(self, klass, weight, size, properties):
+ self.klass = klass
+ self.weight = weight
+ self.size = size
+ self.properties = properties
+ self.eof = size == 0
+ self.bof = False
+
+ def __getitem__(self, name):
+ return self.properties[name]
+
+ def __setitem__(self, name, value):
+ self.properties[name] = value
+
+ def __delitem__(self, name):
+ del self.properties[name]
+
+ def encode(self, c):
+ if uses_struct_encoding(c.spec):
+ self.encode_structs(c)
+ else:
+ self.encode_legacy(c)
+
+ def encode_structs(self, c):
+ # XXX
+ structs = [qpid.Struct(c.spec.domains.byname["delivery_properties"].type),
+ qpid.Struct(c.spec.domains.byname["message_properties"].type)]
+
+ # XXX
+ props = self.properties.copy()
+ for k in self.properties:
+ for s in structs:
+ if s.exists(k):
+ s.set(k, props.pop(k))
+ if props:
+ raise TypeError("no such property: %s" % (", ".join(props)))
+
+ # message properties store the content-length now, and weight is
+ # deprecated
+ if self.size != None:
+ structs[1].content_length = self.size
+
+ for s in structs:
+ c.encode_long_struct(s)
+
+ def encode_legacy(self, c):
+ c.encode_short(self.klass.id)
+ c.encode_short(self.weight)
+ c.encode_longlong(self.size)
+
+ # property flags
+ nprops = len(self.klass.fields)
+ flags = 0
+ for i in range(nprops):
+ f = self.klass.fields.items[i]
+ flags <<= 1
+ if self.properties.get(f.name) != None:
+ flags |= 1
+ # the last bit indicates more flags
+ if i > 0 and (i % 15) == 0:
+ flags <<= 1
+ if nprops > (i + 1):
+ flags |= 1
+ c.encode_short(flags)
+ flags = 0
+ flags <<= ((16 - (nprops % 15)) % 16)
+ c.encode_short(flags)
+
+ # properties
+ for f in self.klass.fields:
+ v = self.properties.get(f.name)
+ if v != None:
+ c.encode(f.type, v)
+
+ def decode(spec, c, size):
+ if uses_struct_encoding(spec):
+ return Header.decode_structs(spec, c, size)
+ else:
+ return Header.decode_legacy(spec, c, size)
+
+ def decode_structs(spec, c, size):
+ structs = []
+ start = c.nread
+ while c.nread - start < size:
+ structs.append(c.decode_long_struct())
+
+ # XXX
+ props = {}
+ length = None
+ for s in structs:
+ for f in s.type.fields:
+ if s.has(f.name):
+ props[f.name] = s.get(f.name)
+ if f.name == "content_length":
+ length = s.get(f.name)
+ return Header(None, 0, length, props)
+
+ decode_structs = staticmethod(decode_structs)
+
+ def decode_legacy(spec, c, size):
+ klass = spec.classes.byid[c.decode_short()]
+ weight = c.decode_short()
+ size = c.decode_longlong()
+
+ # property flags
+ bits = []
+ while True:
+ flags = c.decode_short()
+ for i in range(15, 0, -1):
+ if flags >> i & 0x1 != 0:
+ bits.append(True)
+ else:
+ bits.append(False)
+ if flags & 0x1 == 0:
+ break
+
+ # properties
+ properties = {}
+ for b, f in zip(bits, klass.fields):
+ if b:
+ # Note: decode returns a unicode u'' string but only
+ # plain '' strings can be used as keywords so we need to
+ # stringify the names.
+ properties[str(f.name)] = c.decode(f.type)
+ return Header(klass, weight, size, properties)
+
+ decode_legacy = staticmethod(decode_legacy)
+
+ def __str__(self):
+ return "%s %s %s %s" % (self.klass, self.weight, self.size,
+ self.properties)
+
+class Body(Frame):
+
+ type = "frame_body"
+
+ def __init__(self, content):
+ self.content = content
+ self.eof = True
+ self.bof = False
+
+ def encode(self, enc):
+ enc.write(self.content)
+
+ def decode(spec, dec, size):
+ return Body(dec.read(size))
+
+ def __str__(self):
+ return "Body(%r)" % self.content
+
+# TODO:
+# OOB_METHOD = "frame_oob_method"
+# OOB_HEADER = "frame_oob_header"
+# OOB_BODY = "frame_oob_body"
+# TRACE = "frame_trace"
+# HEARTBEAT = "frame_heartbeat"
diff --git a/qpid/python/qpid/content.py b/qpid/python/qpid/content.py
new file mode 100644
index 0000000000..9391f4f1a8
--- /dev/null
+++ b/qpid/python/qpid/content.py
@@ -0,0 +1,58 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+A simple python representation for AMQP content.
+"""
+
+def default(val, defval):
+ if val == None:
+ return defval
+ else:
+ return val
+
+class Content:
+
+ def __init__(self, body = "", children = None, properties = None):
+ self.body = body
+ self.children = default(children, [])
+ self.properties = default(properties, {})
+
+ def size(self):
+ return len(self.body)
+
+ def weight(self):
+ return len(self.children)
+
+ def __getitem__(self, name):
+ return self.properties[name]
+
+ def __setitem__(self, name, value):
+ self.properties[name] = value
+
+ def __delitem__(self, name):
+ del self.properties[name]
+
+ def __str__(self):
+ if self.children:
+ return "%s [%s] %s" % (self.properties,
+ ", ".join(map(str, self.children)),
+ self.body)
+ else:
+ return "%s %s" % (self.properties, self.body)
diff --git a/qpid/python/qpid/datatypes.py b/qpid/python/qpid/datatypes.py
new file mode 100644
index 0000000000..ca1466c261
--- /dev/null
+++ b/qpid/python/qpid/datatypes.py
@@ -0,0 +1,385 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import threading, struct, datetime, time
+from exceptions import Timeout
+
+class Struct:
+
+ def __init__(self, _type, *args, **kwargs):
+ if len(args) > len(_type.fields):
+ raise TypeError("%s() takes at most %s arguments (%s given)" %
+ (_type.name, len(_type.fields), len(args)))
+
+ self._type = _type
+
+ idx = 0
+ for field in _type.fields:
+ if idx < len(args):
+ arg = args[idx]
+ if kwargs.has_key(field.name):
+ raise TypeError("%s() got multiple values for keyword argument '%s'" %
+ (_type.name, field.name))
+ elif kwargs.has_key(field.name):
+ arg = kwargs.pop(field.name)
+ else:
+ arg = field.default()
+ setattr(self, field.name, arg)
+ idx += 1
+
+ if kwargs:
+ unexpected = kwargs.keys()[0]
+ raise TypeError("%s() got an unexpected keyword argument '%s'" %
+ (_type.name, unexpected))
+
+ def __getitem__(self, name):
+ return getattr(self, name)
+
+ def __setitem__(self, name, value):
+ if not hasattr(self, name):
+ raise AttributeError("'%s' object has no attribute '%s'" %
+ (self._type.name, name))
+ setattr(self, name, value)
+
+ def __repr__(self):
+ fields = []
+ for f in self._type.fields:
+ v = self[f.name]
+ if f.type.is_present(v):
+ fields.append("%s=%r" % (f.name, v))
+ return "%s(%s)" % (self._type.name, ", ".join(fields))
+
+class Message:
+
+ def __init__(self, *args):
+ if args:
+ self.body = args[-1]
+ else:
+ self.body = None
+ if len(args) > 1:
+ self.headers = list(args[:-1])
+ else:
+ self.headers = None
+ self.id = None
+
+ def has(self, name):
+ return self.get(name) != None
+
+ def get(self, name):
+ if self.headers:
+ for h in self.headers:
+ if h.NAME == name:
+ return h
+ return None
+
+ def set(self, header):
+ if self.headers is None:
+ self.headers = []
+ idx = 0
+ while idx < len(self.headers):
+ if self.headers[idx].NAME == header.NAME:
+ self.headers[idx] = header
+ return
+ idx += 1
+ self.headers.append(header)
+
+ def clear(self, name):
+ idx = 0
+ while idx < len(self.headers):
+ if self.headers[idx].NAME == name:
+ del self.headers[idx]
+ return
+ idx += 1
+
+ def __repr__(self):
+ args = []
+ if self.headers:
+ args.extend(map(repr, self.headers))
+ if self.body:
+ args.append(repr(self.body))
+ if self.id is not None:
+ args.append("id=%s" % self.id)
+ return "Message(%s)" % ", ".join(args)
+
+def serial(o):
+ if isinstance(o, Serial):
+ return o
+ else:
+ return Serial(o)
+
+class Serial:
+
+ def __init__(self, value):
+ self.value = value & 0xFFFFFFFFL
+
+ def __hash__(self):
+ return hash(self.value)
+
+ def __cmp__(self, other):
+ if other.__class__ not in (int, long, Serial):
+ return 1
+
+ other = serial(other)
+
+ delta = (self.value - other.value) & 0xFFFFFFFFL
+ neg = delta & 0x80000000L
+ mag = delta & 0x7FFFFFFF
+
+ if neg:
+ return -mag
+ else:
+ return mag
+
+ def __add__(self, other):
+ return Serial(self.value + other)
+
+ def __sub__(self, other):
+ if isinstance(other, Serial):
+ return self.value - other.value
+ else:
+ return Serial(self.value - other)
+
+ def __repr__(self):
+ return "serial(%s)" % self.value
+
+ def __str__(self):
+ return str(self.value)
+
+class Range:
+
+ def __init__(self, lower, upper = None):
+ self.lower = serial(lower)
+ if upper is None:
+ self.upper = self.lower
+ else:
+ self.upper = serial(upper)
+
+ def __contains__(self, n):
+ return self.lower <= n and n <= self.upper
+
+ def __iter__(self):
+ i = self.lower
+ while i <= self.upper:
+ yield i
+ i += 1
+
+ def touches(self, r):
+ # XXX: are we doing more checks than we need?
+ return (self.lower - 1 in r or
+ self.upper + 1 in r or
+ r.lower - 1 in self or
+ r.upper + 1 in self or
+ self.lower in r or
+ self.upper in r or
+ r.lower in self or
+ r.upper in self)
+
+ def span(self, r):
+ return Range(min(self.lower, r.lower), max(self.upper, r.upper))
+
+ def intersect(self, r):
+ lower = max(self.lower, r.lower)
+ upper = min(self.upper, r.upper)
+ if lower > upper:
+ return None
+ else:
+ return Range(lower, upper)
+
+ def __repr__(self):
+ return "%s-%s" % (self.lower, self.upper)
+
+class RangedSet:
+
+ def __init__(self, *args):
+ self.ranges = []
+ for n in args:
+ self.add(n)
+
+ def __contains__(self, n):
+ for r in self.ranges:
+ if n in r:
+ return True
+ return False
+
+ def add_range(self, range):
+ idx = 0
+ while idx < len(self.ranges):
+ r = self.ranges[idx]
+ if range.touches(r):
+ del self.ranges[idx]
+ range = range.span(r)
+ elif range.upper < r.lower:
+ self.ranges.insert(idx, range)
+ return
+ else:
+ idx += 1
+ self.ranges.append(range)
+
+ def add(self, lower, upper = None):
+ self.add_range(Range(lower, upper))
+
+ def empty(self):
+ for r in self.ranges:
+ if r.lower <= r.upper:
+ return False
+ return True
+
+ def max(self):
+ if self.ranges:
+ return self.ranges[-1].upper
+ else:
+ return None
+
+ def min(self):
+ if self.ranges:
+ return self.ranges[0].lower
+ else:
+ return None
+
+ def __iter__(self):
+ return iter(self.ranges)
+
+ def __repr__(self):
+ return str(self.ranges)
+
+class Future:
+ def __init__(self, initial=None, exception=Exception):
+ self.value = initial
+ self._error = None
+ self._set = threading.Event()
+ self.exception = exception
+
+ def error(self, error):
+ self._error = error
+ self._set.set()
+
+ def set(self, value):
+ self.value = value
+ self._set.set()
+
+ def get(self, timeout=None):
+ self._set.wait(timeout)
+ if self._set.isSet():
+ if self._error != None:
+ raise self.exception(self._error)
+ return self.value
+ else:
+ raise Timeout()
+
+ def is_set(self):
+ return self._set.isSet()
+
+try:
+ from uuid import uuid4
+ from uuid import UUID
+except ImportError:
+ class UUID:
+ def __init__(self, hex=None, bytes=None):
+ if [hex, bytes].count(None) != 1:
+ raise TypeErrror("need one of hex or bytes")
+ if bytes is not None:
+ self.bytes = bytes
+ elif hex is not None:
+ fields=hex.split("-")
+ fields[4:5] = [fields[4][:4], fields[4][4:]]
+ self.bytes = struct.pack("!LHHHHL", *[int(x,16) for x in fields])
+
+ def __cmp__(self, other):
+ if isinstance(other, UUID):
+ return cmp(self.bytes, other.bytes)
+ else:
+ return -1
+
+ def __str__(self):
+ return "%08x-%04x-%04x-%04x-%04x%08x" % struct.unpack("!LHHHHL", self.bytes)
+
+ def __repr__(self):
+ return "UUID(%r)" % str(self)
+
+ def __hash__(self):
+ return self.bytes.__hash__()
+
+ import os, random, socket, time
+ rand = random.Random()
+ rand.seed((os.getpid(), time.time(), socket.gethostname()))
+ def random_uuid():
+ bytes = [rand.randint(0, 255) for i in xrange(16)]
+
+ # From RFC4122, the version bits are set to 0100
+ bytes[7] &= 0x0F
+ bytes[7] |= 0x40
+
+ # From RFC4122, the top two bits of byte 8 get set to 01
+ bytes[8] &= 0x3F
+ bytes[8] |= 0x80
+ return "".join(map(chr, bytes))
+
+ def uuid4():
+ return UUID(bytes=random_uuid())
+
+def parseUUID(str):
+ return UUID(hex=str)
+
+class timestamp(float):
+
+ def __new__(cls, obj=None):
+ if obj is None:
+ obj = time.time()
+ elif isinstance(obj, datetime.datetime):
+ obj = time.mktime(obj.timetuple()) + 1e-6 * obj.microsecond
+ return super(timestamp, cls).__new__(cls, obj)
+
+ def datetime(self):
+ return datetime.datetime.fromtimestamp(self)
+
+ def __add__(self, other):
+ if isinstance(other, datetime.timedelta):
+ return timestamp(self.datetime() + other)
+ else:
+ return timestamp(float(self) + other)
+
+ def __sub__(self, other):
+ if isinstance(other, datetime.timedelta):
+ return timestamp(self.datetime() - other)
+ else:
+ return timestamp(float(self) - other)
+
+ def __radd__(self, other):
+ if isinstance(other, datetime.timedelta):
+ return timestamp(self.datetime() + other)
+ else:
+ return timestamp(other + float(self))
+
+ def __rsub__(self, other):
+ if isinstance(other, datetime.timedelta):
+ return timestamp(self.datetime() - other)
+ else:
+ return timestamp(other - float(self))
+
+ def __neg__(self):
+ return timestamp(-float(self))
+
+ def __pos__(self):
+ return self
+
+ def __abs__(self):
+ return timestamp(abs(float(self)))
+
+ def __repr__(self):
+ return "timestamp(%r)" % float(self)
diff --git a/qpid/python/qpid/debug.py b/qpid/python/qpid/debug.py
new file mode 100644
index 0000000000..b5dbd4d9d9
--- /dev/null
+++ b/qpid/python/qpid/debug.py
@@ -0,0 +1,55 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import threading, traceback, signal, sys, time
+
+def stackdump(sig, frm):
+ code = []
+ for threadId, stack in sys._current_frames().items():
+ code.append("\n# ThreadID: %s" % threadId)
+ for filename, lineno, name, line in traceback.extract_stack(stack):
+ code.append('File: "%s", line %d, in %s' % (filename, lineno, name))
+ if line:
+ code.append(" %s" % (line.strip()))
+ print "\n".join(code)
+
+signal.signal(signal.SIGQUIT, stackdump)
+
+class LoudLock:
+
+ def __init__(self):
+ self.lock = threading.RLock()
+
+ def acquire(self, blocking=1):
+ while not self.lock.acquire(blocking=0):
+ time.sleep(1)
+ print >> sys.out, "TRYING"
+ traceback.print_stack(None, None, out)
+ print >> sys.out, "TRYING"
+ print >> sys.out, "ACQUIRED"
+ traceback.print_stack(None, None, out)
+ print >> sys.out, "ACQUIRED"
+ return True
+
+ def _is_owned(self):
+ return self.lock._is_owned()
+
+ def release(self):
+ self.lock.release()
+
diff --git a/qpid/python/qpid/delegate.py b/qpid/python/qpid/delegate.py
new file mode 100644
index 0000000000..b447c4aa29
--- /dev/null
+++ b/qpid/python/qpid/delegate.py
@@ -0,0 +1,53 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+Delegate implementation intended for use with the peer module.
+"""
+
+import threading, inspect, traceback, sys
+from connection08 import Method, Request, Response
+
+def _handler_name(method):
+ return "%s_%s" % (method.klass.name, method.name)
+
+class Delegate:
+
+ def __init__(self):
+ self.handlers = {}
+ self.invokers = {}
+
+ def __call__(self, channel, frame):
+ method = frame.method
+
+ try:
+ handler = self.handlers[method]
+ except KeyError:
+ name = _handler_name(method)
+ handler = getattr(self, name)
+ self.handlers[method] = handler
+
+ try:
+ return handler(channel, frame)
+ except:
+ print >> sys.stderr, "Error in handler: %s\n\n%s" % \
+ (_handler_name(method), traceback.format_exc())
+
+ def closed(self, reason):
+ print "Connection closed: %s" % reason
diff --git a/qpid/python/qpid/delegates.py b/qpid/python/qpid/delegates.py
new file mode 100644
index 0000000000..ae7ed7f988
--- /dev/null
+++ b/qpid/python/qpid/delegates.py
@@ -0,0 +1,215 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import os, connection, session
+from util import notify, get_client_properties_with_defaults
+from datatypes import RangedSet
+from exceptions import VersionError, Closed
+from logging import getLogger
+from ops import Control
+import sys
+from qpid import sasl
+
+log = getLogger("qpid.io.ctl")
+
+class Delegate:
+
+ def __init__(self, connection, delegate=session.client):
+ self.connection = connection
+ self.delegate = delegate
+
+ def received(self, op):
+ ssn = self.connection.attached.get(op.channel)
+ if ssn is None:
+ ch = connection.Channel(self.connection, op.channel)
+ else:
+ ch = ssn.channel
+
+ if isinstance(op, Control):
+ log.debug("RECV %s", op)
+ getattr(self, op.NAME)(ch, op)
+ elif ssn is None:
+ ch.session_detached()
+ else:
+ ssn.received(op)
+
+ def connection_close(self, ch, close):
+ self.connection.close_code = (close.reply_code, close.reply_text)
+ ch.connection_close_ok()
+ raise Closed(close.reply_text)
+
+ def connection_close_ok(self, ch, close_ok):
+ self.connection.opened = False
+ self.connection.closed = True
+ notify(self.connection.condition)
+
+ def connection_heartbeat(self, ch, hrt):
+ pass
+
+ def session_attach(self, ch, a):
+ try:
+ self.connection.attach(a.name, ch, self.delegate, a.force)
+ ch.session_attached(a.name)
+ except connection.ChannelBusy:
+ ch.session_detached(a.name)
+ except connection.SessionBusy:
+ ch.session_detached(a.name)
+
+ def session_attached(self, ch, a):
+ notify(ch.session.condition)
+
+ def session_detach(self, ch, d):
+ #send back the confirmation of detachment before removing the
+ #channel from the attached set; this avoids needing to hold the
+ #connection lock during the sending of this control and ensures
+ #that if the channel is immediately reused for a new session the
+ #attach request will follow the detached notification.
+ ch.session_detached(d.name)
+ ssn = self.connection.detach(d.name, ch)
+
+ def session_detached(self, ch, d):
+ self.connection.detach(d.name, ch)
+
+ def session_request_timeout(self, ch, rt):
+ ch.session_timeout(rt.timeout);
+
+ def session_command_point(self, ch, cp):
+ ssn = ch.session
+ ssn.receiver.next_id = cp.command_id
+ ssn.receiver.next_offset = cp.command_offset
+
+ def session_completed(self, ch, cmp):
+ ch.session.sender.completed(cmp.commands)
+ if cmp.timely_reply:
+ ch.session_known_completed(cmp.commands)
+ notify(ch.session.condition)
+
+ def session_known_completed(self, ch, kn_cmp):
+ ch.session.receiver.known_completed(kn_cmp.commands)
+
+ def session_flush(self, ch, f):
+ rcv = ch.session.receiver
+ if f.expected:
+ if rcv.next_id == None:
+ exp = None
+ else:
+ exp = RangedSet(rcv.next_id)
+ ch.session_expected(exp)
+ if f.confirmed:
+ ch.session_confirmed(rcv._completed)
+ if f.completed:
+ ch.session_completed(rcv._completed)
+
+class Server(Delegate):
+
+ def start(self):
+ self.connection.read_header()
+ # XXX
+ self.connection.write_header(0, 10)
+ connection.Channel(self.connection, 0).connection_start(mechanisms=["ANONYMOUS"])
+
+ def connection_start_ok(self, ch, start_ok):
+ ch.connection_tune(channel_max=65535)
+
+ def connection_tune_ok(self, ch, tune_ok):
+ pass
+
+ def connection_open(self, ch, open):
+ self.connection.opened = True
+ ch.connection_open_ok()
+ notify(self.connection.condition)
+
+class Client(Delegate):
+
+ def __init__(self, connection, username=None, password=None,
+ mechanism=None, heartbeat=None, **kwargs):
+ Delegate.__init__(self, connection)
+ provided_client_properties = kwargs.get("client_properties")
+ self.client_properties=get_client_properties_with_defaults(provided_client_properties)
+
+ ##
+ ## self.acceptableMechanisms is the list of SASL mechanisms that the client is willing to
+ ## use. If it's None, then any mechanism is acceptable.
+ ##
+ self.acceptableMechanisms = None
+ if mechanism:
+ self.acceptableMechanisms = mechanism.split(" ")
+ self.heartbeat = heartbeat
+ self.username = username
+ self.password = password
+
+ self.sasl = sasl.Client()
+ if username and len(username) > 0:
+ self.sasl.setAttr("username", str(username))
+ if password and len(password) > 0:
+ self.sasl.setAttr("password", str(password))
+ self.sasl.setAttr("service", str(kwargs.get("service", "qpidd")))
+ if "host" in kwargs:
+ self.sasl.setAttr("host", str(kwargs["host"]))
+ if "min_ssf" in kwargs:
+ self.sasl.setAttr("minssf", kwargs["min_ssf"])
+ if "max_ssf" in kwargs:
+ self.sasl.setAttr("maxssf", kwargs["max_ssf"])
+ self.sasl.init()
+
+ def start(self):
+ # XXX
+ cli_major = 0
+ cli_minor = 10
+ self.connection.write_header(cli_major, cli_minor)
+ magic, _, _, major, minor = self.connection.read_header()
+ if not (magic == "AMQP" and major == cli_major and minor == cli_minor):
+ raise VersionError("client: %s-%s, server: %s-%s" %
+ (cli_major, cli_minor, major, minor))
+
+ def connection_start(self, ch, start):
+ mech_list = ""
+ for mech in start.mechanisms:
+ if (not self.acceptableMechanisms) or mech in self.acceptableMechanisms:
+ mech_list += str(mech) + " "
+ mech = None
+ initial = None
+ try:
+ mech, initial = self.sasl.start(mech_list)
+ except Exception, e:
+ raise Closed(str(e))
+ ch.connection_start_ok(client_properties=self.client_properties,
+ mechanism=mech, response=initial)
+
+ def connection_secure(self, ch, secure):
+ resp = None
+ try:
+ resp = self.sasl.step(secure.challenge)
+ except Exception, e:
+ raise Closed(str(e))
+ ch.connection_secure_ok(response=resp)
+
+ def connection_tune(self, ch, tune):
+ ch.connection_tune_ok(heartbeat=self.heartbeat)
+ ch.connection_open()
+ self.connection.user_id = self.sasl.auth_username()
+ self.connection.security_layer_tx = self.sasl
+
+ def connection_open_ok(self, ch, open_ok):
+ self.connection.security_layer_rx = self.sasl
+ self.connection.opened = True
+ notify(self.connection.condition)
+
+ def connection_heartbeat(self, ch, hrt):
+ ch.connection_heartbeat()
diff --git a/qpid/python/qpid/disp.py b/qpid/python/qpid/disp.py
new file mode 100644
index 0000000000..d1340b8a05
--- /dev/null
+++ b/qpid/python/qpid/disp.py
@@ -0,0 +1,236 @@
+#!/usr/bin/env python
+
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from time import strftime, gmtime
+
+class Header:
+ """ """
+ NONE = 1
+ KMG = 2
+ YN = 3
+ Y = 4
+ TIME_LONG = 5
+ TIME_SHORT = 6
+ DURATION = 7
+
+ def __init__(self, text, format=NONE):
+ self.text = text
+ self.format = format
+
+ def __repr__(self):
+ return self.text
+
+ def __str__(self):
+ return self.text
+
+ def formatted(self, value):
+ try:
+ if value == None:
+ return ''
+ if self.format == Header.NONE:
+ return value
+ if self.format == Header.KMG:
+ return self.num(value)
+ if self.format == Header.YN:
+ if value:
+ return 'Y'
+ return 'N'
+ if self.format == Header.Y:
+ if value:
+ return 'Y'
+ return ''
+ if self.format == Header.TIME_LONG:
+ return strftime("%c", gmtime(value / 1000000000))
+ if self.format == Header.TIME_SHORT:
+ return strftime("%X", gmtime(value / 1000000000))
+ if self.format == Header.DURATION:
+ if value < 0: value = 0
+ sec = value / 1000000000
+ min = sec / 60
+ hour = min / 60
+ day = hour / 24
+ result = ""
+ if day > 0:
+ result = "%dd " % day
+ if hour > 0 or result != "":
+ result += "%dh " % (hour % 24)
+ if min > 0 or result != "":
+ result += "%dm " % (min % 60)
+ result += "%ds" % (sec % 60)
+ return result
+ except:
+ return "?"
+
+ def numCell(self, value, tag):
+ fp = float(value) / 1000.
+ if fp < 10.0:
+ return "%1.2f%c" % (fp, tag)
+ if fp < 100.0:
+ return "%2.1f%c" % (fp, tag)
+ return "%4d%c" % (value / 1000, tag)
+
+ def num(self, value):
+ if value < 1000:
+ return "%4d" % value
+ if value < 1000000:
+ return self.numCell(value, 'k')
+ value /= 1000
+ if value < 1000000:
+ return self.numCell(value, 'm')
+ value /= 1000
+ return self.numCell(value, 'g')
+
+
+class Display:
+ """ Display formatting for QPID Management CLI """
+
+ def __init__(self, spacing=2, prefix=" "):
+ self.tableSpacing = spacing
+ self.tablePrefix = prefix
+ self.timestampFormat = "%X"
+
+ def formattedTable(self, title, heads, rows):
+ fRows = []
+ for row in rows:
+ fRow = []
+ col = 0
+ for cell in row:
+ fRow.append(heads[col].formatted(cell))
+ col += 1
+ fRows.append(fRow)
+ headtext = []
+ for head in heads:
+ headtext.append(head.text)
+ self.table(title, headtext, fRows)
+
+ def table(self, title, heads, rows):
+ """ Print a table with autosized columns """
+
+ # Pad the rows to the number of heads
+ for row in rows:
+ diff = len(heads) - len(row)
+ for idx in range(diff):
+ row.append("")
+
+ print title
+ if len (rows) == 0:
+ return
+ colWidth = []
+ col = 0
+ line = self.tablePrefix
+ for head in heads:
+ width = len (head)
+ for row in rows:
+ cellWidth = len (unicode (row[col]))
+ if cellWidth > width:
+ width = cellWidth
+ colWidth.append (width + self.tableSpacing)
+ line = line + head
+ if col < len (heads) - 1:
+ for i in range (colWidth[col] - len (head)):
+ line = line + " "
+ col = col + 1
+ print line
+ line = self.tablePrefix
+ for width in colWidth:
+ line = line + "=" * width
+ line = line[:255]
+ print line
+
+ for row in rows:
+ line = self.tablePrefix
+ col = 0
+ for width in colWidth:
+ line = line + unicode (row[col])
+ if col < len (heads) - 1:
+ for i in range (width - len (unicode (row[col]))):
+ line = line + " "
+ col = col + 1
+ print line
+
+ def do_setTimeFormat (self, fmt):
+ """ Select timestamp format """
+ if fmt == "long":
+ self.timestampFormat = "%c"
+ elif fmt == "short":
+ self.timestampFormat = "%X"
+
+ def timestamp (self, nsec):
+ """ Format a nanosecond-since-the-epoch timestamp for printing """
+ return strftime (self.timestampFormat, gmtime (nsec / 1000000000))
+
+ def duration(self, nsec):
+ if nsec < 0: nsec = 0
+ sec = nsec / 1000000000
+ min = sec / 60
+ hour = min / 60
+ day = hour / 24
+ result = ""
+ if day > 0:
+ result = "%dd " % day
+ if hour > 0 or result != "":
+ result += "%dh " % (hour % 24)
+ if min > 0 or result != "":
+ result += "%dm " % (min % 60)
+ result += "%ds" % (sec % 60)
+ return result
+
+class Sortable:
+ """ """
+ def __init__(self, row, sortIndex):
+ self.row = row
+ self.sortIndex = sortIndex
+ if sortIndex >= len(row):
+ raise Exception("sort index exceeds row boundary")
+
+ def __cmp__(self, other):
+ return cmp(self.row[self.sortIndex], other.row[self.sortIndex])
+
+ def getRow(self):
+ return self.row
+
+class Sorter:
+ """ """
+ def __init__(self, heads, rows, sortCol, limit=0, inc=True):
+ col = 0
+ for head in heads:
+ if head.text == sortCol:
+ break
+ col += 1
+ if col == len(heads):
+ raise Exception("sortCol '%s', not found in headers" % sortCol)
+
+ list = []
+ for row in rows:
+ list.append(Sortable(row, col))
+ list.sort()
+ if not inc:
+ list.reverse()
+ count = 0
+ self.sorted = []
+ for row in list:
+ self.sorted.append(row.getRow())
+ count += 1
+ if count == limit:
+ break
+
+ def getSorted(self):
+ return self.sorted
diff --git a/qpid/python/qpid/exceptions.py b/qpid/python/qpid/exceptions.py
new file mode 100644
index 0000000000..2bd80b7ffe
--- /dev/null
+++ b/qpid/python/qpid/exceptions.py
@@ -0,0 +1,22 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+class Closed(Exception): pass
+class Timeout(Exception): pass
+class VersionError(Exception): pass
diff --git a/qpid/python/qpid/framer.py b/qpid/python/qpid/framer.py
new file mode 100644
index 0000000000..08e172287f
--- /dev/null
+++ b/qpid/python/qpid/framer.py
@@ -0,0 +1,128 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import struct, socket
+from exceptions import Closed
+from packer import Packer
+from threading import RLock
+from logging import getLogger
+
+raw = getLogger("qpid.io.raw")
+frm = getLogger("qpid.io.frm")
+
+class FramingError(Exception): pass
+
+class Framer(Packer):
+
+ HEADER="!4s4B"
+
+ def __init__(self, sock):
+ self.sock = sock
+ self.sock_lock = RLock()
+ self.tx_buf = ""
+ self.rx_buf = ""
+ self.security_layer_tx = None
+ self.security_layer_rx = None
+ self.maxbufsize = 65535
+
+ def aborted(self):
+ return False
+
+ def write(self, buf):
+ self.tx_buf += buf
+
+ def flush(self):
+ self.sock_lock.acquire()
+ try:
+ if self.security_layer_tx:
+ try:
+ cipher_buf = self.security_layer_tx.encode(self.tx_buf)
+ except SASLError, e:
+ raise Closed(str(e))
+ self._write(cipher_buf)
+ else:
+ self._write(self.tx_buf)
+ self.tx_buf = ""
+ frm.debug("FLUSHED")
+ finally:
+ self.sock_lock.release()
+
+ def _write(self, buf):
+ while buf:
+ try:
+ n = self.sock.send(buf)
+ except socket.timeout:
+ if self.aborted():
+ raise Closed()
+ else:
+ continue
+ raw.debug("SENT %r", buf[:n])
+ buf = buf[n:]
+
+ ##
+ ## Implementation Note:
+ ##
+ ## This function was modified to use the SASL security layer for content
+ ## decryption. As such, the socket read should read in "self.maxbufsize"
+ ## instead of "n" (the requested number of octets). However, since this
+ ## is one of two places in the code where the socket is read, the read
+ ## size had to be left at "n". This is because this function is
+ ## apparently only used to read the first 8 octets from a TCP socket. If
+ ## we read beyond "n" octets, the remaing octets won't be processed and
+ ## the connection handshake will fail.
+ ##
+ def read(self, n):
+ while len(self.rx_buf) < n:
+ try:
+ # QPID-5808: never consume more than n bytes from the socket,
+ # otherwise the extra bytes are discarded.
+ s = self.sock.recv(n - len(self.rx_buf))
+ if self.security_layer_rx:
+ try:
+ s = self.security_layer_rx.decode(s)
+ except SASLError, e:
+ raise Closed(str(e))
+ except socket.timeout:
+ if self.aborted():
+ raise Closed()
+ else:
+ continue
+ except socket.error, e:
+ if self.rx_buf != "":
+ raise e
+ else:
+ raise Closed()
+ if len(s) == 0:
+ raise Closed()
+ self.rx_buf += s
+ raw.debug("RECV %r", s)
+ data = self.rx_buf[0:n]
+ self.rx_buf = self.rx_buf[n:]
+ return data
+
+ def read_header(self):
+ return self.unpack(Framer.HEADER)
+
+ def write_header(self, major, minor):
+ self.sock_lock.acquire()
+ try:
+ self.pack(Framer.HEADER, "AMQP", 1, 1, major, minor)
+ self.flush()
+ finally:
+ self.sock_lock.release()
diff --git a/qpid/python/qpid/framing.py b/qpid/python/qpid/framing.py
new file mode 100644
index 0000000000..389b607853
--- /dev/null
+++ b/qpid/python/qpid/framing.py
@@ -0,0 +1,313 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import struct
+
+FIRST_SEG = 0x08
+LAST_SEG = 0x04
+FIRST_FRM = 0x02
+LAST_FRM = 0x01
+
+class Frame:
+
+ HEADER = "!2BHxBH4x"
+ HEADER_SIZE = struct.calcsize(HEADER)
+ MAX_PAYLOAD = 65535 - struct.calcsize(HEADER)
+
+ def __init__(self, flags, type, track, channel, payload):
+ if len(payload) > Frame.MAX_PAYLOAD:
+ raise ValueError("max payload size exceeded: %s" % len(payload))
+ self.flags = flags
+ self.type = type
+ self.track = track
+ self.channel = channel
+ self.payload = payload
+
+ def isFirstSegment(self):
+ return bool(FIRST_SEG & self.flags)
+
+ def isLastSegment(self):
+ return bool(LAST_SEG & self.flags)
+
+ def isFirstFrame(self):
+ return bool(FIRST_FRM & self.flags)
+
+ def isLastFrame(self):
+ return bool(LAST_FRM & self.flags)
+
+ def __repr__(self):
+ return "%s%s%s%s %s %s %s %r" % (int(self.isFirstSegment()),
+ int(self.isLastSegment()),
+ int(self.isFirstFrame()),
+ int(self.isLastFrame()),
+ self.type,
+ self.track,
+ self.channel,
+ self.payload)
+
+class Segment:
+
+ def __init__(self, first, last, type, track, channel, payload):
+ self.id = None
+ self.offset = None
+ self.first = first
+ self.last = last
+ self.type = type
+ self.track = track
+ self.channel = channel
+ self.payload = payload
+
+ def __repr__(self):
+ return "%s%s %s %s %s %r" % (int(self.first), int(self.last), self.type,
+ self.track, self.channel, self.payload)
+
+class FrameDecoder:
+
+ def __init__(self):
+ self.input = ""
+ self.output = []
+ self.parse = self.__frame_header
+
+ def write(self, bytes):
+ self.input += bytes
+ while True:
+ next = self.parse()
+ if next is None:
+ break
+ else:
+ self.parse = next
+
+ def __consume(self, n):
+ result = self.input[:n]
+ self.input = self.input[n:]
+ return result
+
+ def __frame_header(self):
+ if len(self.input) >= Frame.HEADER_SIZE:
+ st = self.__consume(Frame.HEADER_SIZE)
+ self.flags, self.type, self.size, self.track, self.channel = \
+ struct.unpack(Frame.HEADER, st)
+ return self.__frame_body
+
+ def __frame_body(self):
+ size = self.size - Frame.HEADER_SIZE
+ if len(self.input) >= size:
+ payload = self.__consume(size)
+ frame = Frame(self.flags, self.type, self.track, self.channel, payload)
+ self.output.append(frame)
+ return self.__frame_header
+
+ def read(self):
+ result = self.output
+ self.output = []
+ return result
+
+class FrameEncoder:
+
+ def __init__(self):
+ self.output = ""
+
+ def write(self, *frames):
+ for frame in frames:
+ size = len(frame.payload) + Frame.HEADER_SIZE
+ track = frame.track & 0x0F
+ self.output += struct.pack(Frame.HEADER, frame.flags, frame.type, size,
+ track, frame.channel)
+ self.output += frame.payload
+
+ def read(self):
+ result = self.output
+ self.output = ""
+ return result
+
+class SegmentDecoder:
+
+ def __init__(self):
+ self.fragments = {}
+ self.segments = []
+
+ def write(self, *frames):
+ for frm in frames:
+ key = (frm.channel, frm.track)
+ seg = self.fragments.get(key)
+
+ if seg == None:
+ seg = Segment(frm.isFirstSegment(), frm.isLastSegment(),
+ frm.type, frm.track, frm.channel, "")
+ self.fragments[key] = seg
+
+ seg.payload += frm.payload
+
+ if frm.isLastFrame():
+ self.fragments.pop(key)
+ self.segments.append(seg)
+
+ def read(self):
+ result = self.segments
+ self.segments = []
+ return result
+
+class SegmentEncoder:
+
+ def __init__(self, max_payload=Frame.MAX_PAYLOAD):
+ self.max_payload = max_payload
+ self.frames = []
+
+ def write(self, *segments):
+ for seg in segments:
+ remaining = seg.payload
+
+ first = True
+ while first or remaining:
+ payload = remaining[:self.max_payload]
+ remaining = remaining[self.max_payload:]
+
+ flags = 0
+ if first:
+ flags |= FIRST_FRM
+ first = False
+ if not remaining:
+ flags |= LAST_FRM
+ if seg.first:
+ flags |= FIRST_SEG
+ if seg.last:
+ flags |= LAST_SEG
+
+ frm = Frame(flags, seg.type, seg.track, seg.channel, payload)
+ self.frames.append(frm)
+
+ def read(self):
+ result = self.frames
+ self.frames = []
+ return result
+
+from ops import COMMANDS, CONTROLS, COMPOUND, Header, segment_type, track
+
+from codec010 import StringCodec
+
+class OpEncoder:
+
+ def __init__(self):
+ self.segments = []
+
+ def write(self, *ops):
+ for op in ops:
+ if COMMANDS.has_key(op.NAME):
+ seg_type = segment_type.command
+ seg_track = track.command
+ enc = self.encode_command(op)
+ elif CONTROLS.has_key(op.NAME):
+ seg_type = segment_type.control
+ seg_track = track.control
+ enc = self.encode_compound(op)
+ else:
+ raise ValueError(op)
+ seg = Segment(True, False, seg_type, seg_track, op.channel, enc)
+ self.segments.append(seg)
+ if hasattr(op, "headers") and op.headers is not None:
+ hdrs = ""
+ for h in op.headers:
+ hdrs += self.encode_compound(h)
+ seg = Segment(False, False, segment_type.header, seg_track, op.channel,
+ hdrs)
+ self.segments.append(seg)
+ if hasattr(op, "payload") and op.payload is not None:
+ self.segments.append(Segment(False, False, segment_type.body, seg_track,
+ op.channel, op.payload))
+ self.segments[-1].last = True
+
+ def encode_command(self, cmd):
+ sc = StringCodec()
+ sc.write_uint16(cmd.CODE)
+ sc.write_compound(Header(sync=cmd.sync))
+ sc.write_fields(cmd)
+ return sc.encoded
+
+ def encode_compound(self, op):
+ sc = StringCodec()
+ sc.write_compound(op)
+ return sc.encoded
+
+ def read(self):
+ result = self.segments
+ self.segments = []
+ return result
+
+class OpDecoder:
+
+ def __init__(self):
+ self.current_op = {}
+ self.ops = []
+
+ def write(self, *segments):
+ for seg in segments:
+ op = self.current_op.get(seg.track)
+ if seg.first:
+ if seg.type == segment_type.command:
+ op = self.decode_command(seg.payload)
+ elif seg.type == segment_type.control:
+ op = self.decode_control(seg.payload)
+ else:
+ raise ValueError(seg)
+ op.channel = seg.channel
+ elif seg.type == segment_type.header:
+ if op.headers is None:
+ op.headers = []
+ op.headers.extend(self.decode_headers(seg.payload))
+ elif seg.type == segment_type.body:
+ if op.payload is None:
+ op.payload = seg.payload
+ else:
+ op.payload += seg.payload
+ if seg.last:
+ self.ops.append(op)
+ if seg.track in self.current_op:
+ del self.current_op[seg.track]
+ else:
+ self.current_op[seg.track] = op
+
+ def decode_command(self, encoded):
+ sc = StringCodec(encoded)
+ code = sc.read_uint16()
+ cls = COMMANDS[code]
+ hdr = sc.read_compound(Header)
+ cmd = cls()
+ sc.read_fields(cmd)
+ cmd.sync = hdr.sync
+ return cmd
+
+ def decode_control(self, encoded):
+ sc = StringCodec(encoded)
+ code = sc.read_uint16()
+ cls = CONTROLS[code]
+ ctl = cls()
+ sc.read_fields(ctl)
+ return ctl
+
+ def decode_headers(self, encoded):
+ sc = StringCodec(encoded)
+ result = []
+ while sc.encoded:
+ result.append(sc.read_struct32())
+ return result
+
+ def read(self):
+ result = self.ops
+ self.ops = []
+ return result
diff --git a/qpid/python/qpid/generator.py b/qpid/python/qpid/generator.py
new file mode 100644
index 0000000000..02d11e5005
--- /dev/null
+++ b/qpid/python/qpid/generator.py
@@ -0,0 +1,56 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import sys
+
+from ops import *
+
+def METHOD(module, op):
+ method = lambda self, *args, **kwargs: self.invoke(op, args, kwargs)
+ if sys.version_info[:2] > (2, 3):
+ method.__name__ = op.__name__
+ method.__doc__ = op.__doc__
+ method.__module__ = module
+ return method
+
+def generate(module, operations):
+ dict = {}
+
+ for name, enum in ENUMS.items():
+ if isinstance(name, basestring):
+ dict[name] = enum
+
+ for name, op in COMPOUND.items():
+ if isinstance(name, basestring):
+ dict[name] = METHOD(module, op)
+
+ for name, op in operations.items():
+ if isinstance(name, basestring):
+ dict[name] = METHOD(module, op)
+
+ return dict
+
+def invoker(name, operations):
+ return type(name, (), generate(invoker.__module__, operations))
+
+def command_invoker():
+ return invoker("CommandInvoker", COMMANDS)
+
+def control_invoker():
+ return invoker("ControlInvoker", CONTROLS)
diff --git a/qpid/python/qpid/harness.py b/qpid/python/qpid/harness.py
new file mode 100644
index 0000000000..ce48481612
--- /dev/null
+++ b/qpid/python/qpid/harness.py
@@ -0,0 +1,20 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+class Skipped(Exception): pass
diff --git a/qpid/python/qpid/lexer.py b/qpid/python/qpid/lexer.py
new file mode 100644
index 0000000000..ec28bbb91a
--- /dev/null
+++ b/qpid/python/qpid/lexer.py
@@ -0,0 +1,118 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import re
+
+class Type:
+
+ def __init__(self, name, pattern=None):
+ self.name = name
+ self.pattern = pattern
+
+ def __repr__(self):
+ return self.name
+
+class Lexicon:
+
+ def __init__(self):
+ self.types = []
+ self._eof = None
+
+ def define(self, name, pattern):
+ t = Type(name, pattern)
+ self.types.append(t)
+ return t
+
+ def eof(self, name):
+ t = Type(name)
+ self._eof = t
+ return t
+
+ def compile(self):
+ types = self.types[:]
+ joined = "|".join(["(%s)" % t.pattern for t in types])
+ rexp = re.compile(joined)
+ return Lexer(types, self._eof, rexp)
+
+class Token:
+
+ def __init__(self, type, value, input, position):
+ self.type = type
+ self.value = value
+ self.input = input
+ self.position = position
+
+ def line_info(self):
+ return line_info(self.input, self.position)
+
+ def __repr__(self):
+ if self.value is None:
+ return repr(self.type)
+ else:
+ return "%s(%s)" % (self.type, self.value)
+
+
+class LexError(Exception):
+ pass
+
+def line_info(st, pos):
+ idx = 0
+ lineno = 1
+ column = 0
+ line_pos = 0
+ while idx < pos:
+ if st[idx] == "\n":
+ lineno += 1
+ column = 0
+ line_pos = idx
+ column += 1
+ idx += 1
+
+ end = st.find("\n", line_pos)
+ if end < 0:
+ end = len(st)
+ line = st[line_pos:end]
+
+ return line, lineno, column
+
+class Lexer:
+
+ def __init__(self, types, eof, rexp):
+ self.types = types
+ self.eof = eof
+ self.rexp = rexp
+ self.byname = {}
+ for t in self.types + [eof]:
+ self.byname[t.name] = t
+
+ def type(self, name):
+ return self.byname[name]
+
+ def lex(self, st):
+ pos = 0
+ while pos < len(st):
+ m = self.rexp.match(st, pos)
+ if m is None:
+ line, ln, col = line_info(st, pos)
+ raise LexError("unrecognized characters line:%s,%s: %s" % (ln, col, line))
+ else:
+ idx = m.lastindex
+ t = Token(self.types[idx - 1], m.group(idx), st, pos)
+ yield t
+ pos = m.end()
+ yield Token(self.eof, None, st, pos)
diff --git a/qpid/python/qpid/log.py b/qpid/python/qpid/log.py
new file mode 100644
index 0000000000..1fd7d74136
--- /dev/null
+++ b/qpid/python/qpid/log.py
@@ -0,0 +1,28 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from logging import getLogger, StreamHandler, Formatter
+from logging import DEBUG, INFO, WARN, ERROR, CRITICAL
+
+def enable(name=None, level=WARN, file=None):
+ log = getLogger(name)
+ handler = StreamHandler(file)
+ handler.setFormatter(Formatter("%(asctime)s %(levelname)s %(message)s"))
+ log.addHandler(handler)
+ log.setLevel(level)
diff --git a/qpid/python/qpid/management.py b/qpid/python/qpid/management.py
new file mode 100644
index 0000000000..3de8da9d49
--- /dev/null
+++ b/qpid/python/qpid/management.py
@@ -0,0 +1,922 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+###############################################################################
+## This file is being obsoleted by qmf/console.py
+###############################################################################
+
+"""
+Management API for Qpid
+"""
+
+import qpid
+import struct
+import socket
+from threading import Thread
+from datatypes import Message, RangedSet
+from time import time
+from cStringIO import StringIO
+from codec010 import StringCodec as Codec
+from threading import Lock, Condition
+
+
+class SequenceManager:
+ """ Manage sequence numbers for asynchronous method calls """
+ def __init__ (self):
+ self.lock = Lock ()
+ self.sequence = 0
+ self.pending = {}
+
+ def reserve (self, data):
+ """ Reserve a unique sequence number """
+ self.lock.acquire ()
+ result = self.sequence
+ self.sequence = self.sequence + 1
+ self.pending[result] = data
+ self.lock.release ()
+ return result
+
+ def release (self, seq):
+ """ Release a reserved sequence number """
+ data = None
+ self.lock.acquire ()
+ if seq in self.pending:
+ data = self.pending[seq]
+ del self.pending[seq]
+ self.lock.release ()
+ return data
+
+
+class mgmtObject (object):
+ """ Generic object that holds the contents of a management object with its
+ attributes set as object attributes. """
+
+ def __init__ (self, classKey, timestamps, row):
+ self.classKey = classKey
+ self.timestamps = timestamps
+ for cell in row:
+ setattr (self, cell[0], cell[1])
+
+class objectId(object):
+ """ Object that represents QMF object identifiers """
+
+ def __init__(self, codec, first=0, second=0):
+ if codec:
+ self.first = codec.read_uint64()
+ self.second = codec.read_uint64()
+ else:
+ self.first = first
+ self.second = second
+
+ def __cmp__(self, other):
+ if other == None:
+ return 1
+ if self.first < other.first:
+ return -1
+ if self.first > other.first:
+ return 1
+ if self.second < other.second:
+ return -1
+ if self.second > other.second:
+ return 1
+ return 0
+
+
+ def index(self):
+ return (self.first, self.second)
+
+ def getFlags(self):
+ return (self.first & 0xF000000000000000) >> 60
+
+ def getSequence(self):
+ return (self.first & 0x0FFF000000000000) >> 48
+
+ def getBroker(self):
+ return (self.first & 0x0000FFFFF0000000) >> 28
+
+ def getBank(self):
+ return self.first & 0x000000000FFFFFFF
+
+ def getObject(self):
+ return self.second
+
+ def isDurable(self):
+ return self.getSequence() == 0
+
+ def encode(self, codec):
+ codec.write_uint64(self.first)
+ codec.write_uint64(self.second)
+
+
+class methodResult:
+ """ Object that contains the result of a method call """
+
+ def __init__ (self, status, sText, args):
+ self.status = status
+ self.statusText = sText
+ for arg in args:
+ setattr (self, arg, args[arg])
+
+class brokerInfo:
+ """ Object that contains information about a broker and the session to it """
+
+ def __init__ (self, brokerId, sessionId):
+ self.brokerId = brokerId
+ self.sessionId = sessionId
+
+class managementChannel:
+ """ This class represents a connection to an AMQP broker. """
+
+ def __init__ (self, ssn, topicCb, replyCb, exceptionCb, cbContext, _detlife=0):
+ """ Given a channel on an established AMQP broker connection, this method
+ opens a session and performs all of the declarations and bindings needed
+ to participate in the management protocol. """
+ self.enabled = True
+ self.ssn = ssn
+ self.sessionId = ssn.name
+ self.topicName = "mgmt-%s" % self.sessionId
+ self.replyName = "repl-%s" % self.sessionId
+ self.qpidChannel = ssn
+ self.tcb = topicCb
+ self.rcb = replyCb
+ self.ecb = exceptionCb
+ self.context = cbContext
+ self.reqsOutstanding = 0
+ self.brokerInfo = None
+
+ ssn.auto_sync = False
+ ssn.queue_declare (queue=self.topicName, exclusive=True, auto_delete=True)
+ ssn.queue_declare (queue=self.replyName, exclusive=True, auto_delete=True)
+
+ ssn.exchange_bind (exchange="amq.direct",
+ queue=self.replyName, binding_key=self.replyName)
+ ssn.message_subscribe (queue=self.topicName, destination="tdest",
+ accept_mode=ssn.accept_mode.none,
+ acquire_mode=ssn.acquire_mode.pre_acquired)
+ ssn.message_subscribe (queue=self.replyName, destination="rdest",
+ accept_mode=ssn.accept_mode.none,
+ acquire_mode=ssn.acquire_mode.pre_acquired)
+
+ ssn.incoming ("tdest").listen (self.topicCb, self.exceptionCb)
+ ssn.incoming ("rdest").listen (self.replyCb)
+
+ ssn.message_set_flow_mode (destination="tdest", flow_mode=1)
+ ssn.message_flow (destination="tdest", unit=0, value=0xFFFFFFFFL)
+ ssn.message_flow (destination="tdest", unit=1, value=0xFFFFFFFFL)
+
+ ssn.message_set_flow_mode (destination="rdest", flow_mode=1)
+ ssn.message_flow (destination="rdest", unit=0, value=0xFFFFFFFFL)
+ ssn.message_flow (destination="rdest", unit=1, value=0xFFFFFFFFL)
+
+ def setBrokerInfo (self, data):
+ self.brokerInfo = data
+
+ def shutdown (self):
+ self.enabled = False
+ self.ssn.incoming("tdest").stop()
+ self.ssn.incoming("rdest").stop()
+
+ def topicCb (self, msg):
+ """ Receive messages via the topic queue on this channel. """
+ if self.enabled:
+ self.tcb (self, msg)
+ self.ssn.receiver._completed.add(msg.id)
+ self.ssn.channel.session_completed(self.ssn.receiver._completed)
+
+ def replyCb (self, msg):
+ """ Receive messages via the reply queue on this channel. """
+ if self.enabled:
+ self.rcb (self, msg)
+ self.ssn.receiver._completed.add(msg.id)
+ self.ssn.channel.session_completed(self.ssn.receiver._completed)
+
+ def exceptionCb (self, data):
+ if self.ecb != None:
+ self.ecb (self, data)
+
+ def send (self, exchange, msg):
+ if self.enabled:
+ self.qpidChannel.message_transfer (destination=exchange, message=msg)
+
+ def message (self, body, routing_key="broker"):
+ dp = self.qpidChannel.delivery_properties()
+ dp.routing_key = routing_key
+ mp = self.qpidChannel.message_properties()
+ mp.content_type = "application/octet-stream"
+ mp.reply_to = self.qpidChannel.reply_to("amq.direct", self.replyName)
+ return Message(dp, mp, body)
+
+
+class managementClient:
+ """ This class provides an API for access to management data on the AMQP
+ network. It implements the management protocol and manages the management
+ schemas as advertised by the various management agents in the network. """
+
+ CTRL_BROKER_INFO = 1
+ CTRL_SCHEMA_LOADED = 2
+ CTRL_USER = 3
+ CTRL_HEARTBEAT = 4
+
+ SYNC_TIME = 10.0
+
+ #========================================================
+ # User API - interacts with the class's user
+ #========================================================
+ def __init__ (self, unused=None, ctrlCb=None, configCb=None, instCb=None, methodCb=None, closeCb=None):
+ self.ctrlCb = ctrlCb
+ self.configCb = configCb
+ self.instCb = instCb
+ self.methodCb = methodCb
+ self.closeCb = closeCb
+ self.schemaCb = None
+ self.eventCb = None
+ self.channels = []
+ self.seqMgr = SequenceManager ()
+ self.schema = {}
+ self.packages = {}
+ self.cv = Condition ()
+ self.syncInFlight = False
+ self.syncSequence = 0
+ self.syncResult = None
+
+ def schemaListener (self, schemaCb):
+ """ Optionally register a callback to receive details of the schema of
+ managed objects in the network. """
+ self.schemaCb = schemaCb
+
+ def eventListener (self, eventCb):
+ """ Optionally register a callback to receive events from managed objects
+ in the network. """
+ self.eventCb = eventCb
+
+ def addChannel (self, channel, cbContext=None):
+ """ Register a new channel. """
+ mch = managementChannel (channel, self.topicCb, self.replyCb, self.exceptCb, cbContext)
+
+ self.channels.append (mch)
+ self.incOutstanding (mch)
+ codec = Codec ()
+ self.setHeader (codec, ord ('B'))
+ msg = mch.message(codec.encoded)
+ mch.send ("qpid.management", msg)
+ return mch
+
+ def removeChannel (self, mch):
+ """ Remove a previously added channel from management. """
+ mch.shutdown ()
+ self.channels.remove (mch)
+
+ def callMethod (self, channel, userSequence, objId, className, methodName, args=None):
+ """ Invoke a method on a managed object. """
+ self.method (channel, userSequence, objId, className, methodName, args)
+
+ def getObjects (self, channel, userSequence, className, bank=0):
+ """ Request immediate content from broker """
+ codec = Codec ()
+ self.setHeader (codec, ord ('G'), userSequence)
+ ft = {}
+ ft["_class"] = className
+ codec.write_map (ft)
+ msg = channel.message(codec.encoded, routing_key="agent.1.%d" % bank)
+ channel.send ("qpid.management", msg)
+
+ def syncWaitForStable (self, channel):
+ """ Synchronous (blocking) call to wait for schema stability on a channel """
+ self.cv.acquire ()
+ if channel.reqsOutstanding == 0:
+ self.cv.release ()
+ return channel.brokerInfo
+
+ self.syncInFlight = True
+ starttime = time ()
+ while channel.reqsOutstanding != 0:
+ self.cv.wait (self.SYNC_TIME)
+ if time () - starttime > self.SYNC_TIME:
+ self.cv.release ()
+ raise RuntimeError ("Timed out waiting for response on channel")
+ self.cv.release ()
+ return channel.brokerInfo
+
+ def syncCallMethod (self, channel, objId, className, methodName, args=None):
+ """ Synchronous (blocking) method call """
+ self.cv.acquire ()
+ self.syncInFlight = True
+ self.syncResult = None
+ self.syncSequence = self.seqMgr.reserve ("sync")
+ self.cv.release ()
+ self.callMethod (channel, self.syncSequence, objId, className, methodName, args)
+ self.cv.acquire ()
+ starttime = time ()
+ while self.syncInFlight:
+ self.cv.wait (self.SYNC_TIME)
+ if time () - starttime > self.SYNC_TIME:
+ self.cv.release ()
+ raise RuntimeError ("Timed out waiting for response on channel")
+ result = self.syncResult
+ self.cv.release ()
+ return result
+
+ def syncGetObjects (self, channel, className, bank=0):
+ """ Synchronous (blocking) get call """
+ self.cv.acquire ()
+ self.syncInFlight = True
+ self.syncResult = []
+ self.syncSequence = self.seqMgr.reserve ("sync")
+ self.cv.release ()
+ self.getObjects (channel, self.syncSequence, className, bank)
+ self.cv.acquire ()
+ starttime = time ()
+ while self.syncInFlight:
+ self.cv.wait (self.SYNC_TIME)
+ if time () - starttime > self.SYNC_TIME:
+ self.cv.release ()
+ raise RuntimeError ("Timed out waiting for response on channel")
+ result = self.syncResult
+ self.cv.release ()
+ return result
+
+ #========================================================
+ # Channel API - interacts with registered channel objects
+ #========================================================
+ def topicCb (self, ch, msg):
+ """ Receive messages via the topic queue of a particular channel. """
+ codec = Codec (msg.body)
+ while True:
+ hdr = self.checkHeader (codec)
+ if hdr == None:
+ return
+
+ if hdr[0] == 'p':
+ self.handlePackageInd (ch, codec)
+ elif hdr[0] == 'q':
+ self.handleClassInd (ch, codec)
+ elif hdr[0] == 'h':
+ self.handleHeartbeat (ch, codec)
+ elif hdr[0] == 'e':
+ self.handleEvent (ch, codec)
+ else:
+ self.parse (ch, codec, hdr[0], hdr[1])
+
+ def replyCb (self, ch, msg):
+ """ Receive messages via the reply queue of a particular channel. """
+ codec = Codec (msg.body)
+ while True:
+ hdr = self.checkHeader (codec)
+ if hdr == None:
+ return
+
+ if hdr[0] == 'm':
+ self.handleMethodReply (ch, codec, hdr[1])
+ elif hdr[0] == 'z':
+ self.handleCommandComplete (ch, codec, hdr[1])
+ elif hdr[0] == 'b':
+ self.handleBrokerResponse (ch, codec)
+ elif hdr[0] == 'p':
+ self.handlePackageInd (ch, codec)
+ elif hdr[0] == 'q':
+ self.handleClassInd (ch, codec)
+ else:
+ self.parse (ch, codec, hdr[0], hdr[1])
+
+ def exceptCb (self, ch, data):
+ if self.closeCb != None:
+ self.closeCb (ch.context, data)
+
+ #========================================================
+ # Internal Functions
+ #========================================================
+ def setHeader (self, codec, opcode, seq = 0):
+ """ Compose the header of a management message. """
+ codec.write_uint8 (ord ('A'))
+ codec.write_uint8 (ord ('M'))
+ codec.write_uint8 (ord ('2'))
+ codec.write_uint8 (opcode)
+ codec.write_uint32 (seq)
+
+ def checkHeader (self, codec):
+ """ Check the header of a management message and extract the opcode and class. """
+ try:
+ octet = chr (codec.read_uint8 ())
+ if octet != 'A':
+ return None
+ octet = chr (codec.read_uint8 ())
+ if octet != 'M':
+ return None
+ octet = chr (codec.read_uint8 ())
+ if octet != '2':
+ return None
+ opcode = chr (codec.read_uint8 ())
+ seq = codec.read_uint32 ()
+ return (opcode, seq)
+ except:
+ return None
+
+ def encodeValue (self, codec, value, typecode):
+ """ Encode, into the codec, a value based on its typecode. """
+ if typecode == 1:
+ codec.write_uint8 (int (value))
+ elif typecode == 2:
+ codec.write_uint16 (int (value))
+ elif typecode == 3:
+ codec.write_uint32 (long (value))
+ elif typecode == 4:
+ codec.write_uint64 (long (value))
+ elif typecode == 5:
+ codec.write_uint8 (int (value))
+ elif typecode == 6:
+ codec.write_str8 (value)
+ elif typecode == 7:
+ codec.write_str16 (value)
+ elif typecode == 8: # ABSTIME
+ codec.write_uint64 (long (value))
+ elif typecode == 9: # DELTATIME
+ codec.write_uint64 (long (value))
+ elif typecode == 10: # REF
+ value.encode(codec)
+ elif typecode == 11: # BOOL
+ codec.write_uint8 (int (value))
+ elif typecode == 12: # FLOAT
+ codec.write_float (float (value))
+ elif typecode == 13: # DOUBLE
+ codec.write_double (float (value))
+ elif typecode == 14: # UUID
+ codec.write_uuid (value)
+ elif typecode == 15: # FTABLE
+ codec.write_map (value)
+ elif typecode == 16:
+ codec.write_int8 (int(value))
+ elif typecode == 17:
+ codec.write_int16 (int(value))
+ elif typecode == 18:
+ codec.write_int32 (int(value))
+ elif typecode == 19:
+ codec.write_int64 (int(value))
+ else:
+ raise ValueError ("Invalid type code: %d" % typecode)
+
+ def decodeValue (self, codec, typecode):
+ """ Decode, from the codec, a value based on its typecode. """
+ if typecode == 1:
+ data = codec.read_uint8 ()
+ elif typecode == 2:
+ data = codec.read_uint16 ()
+ elif typecode == 3:
+ data = codec.read_uint32 ()
+ elif typecode == 4:
+ data = codec.read_uint64 ()
+ elif typecode == 5:
+ data = codec.read_uint8 ()
+ elif typecode == 6:
+ data = codec.read_str8 ()
+ elif typecode == 7:
+ data = codec.read_str16 ()
+ elif typecode == 8: # ABSTIME
+ data = codec.read_uint64 ()
+ elif typecode == 9: # DELTATIME
+ data = codec.read_uint64 ()
+ elif typecode == 10: # REF
+ data = objectId(codec)
+ elif typecode == 11: # BOOL
+ data = codec.read_uint8 ()
+ elif typecode == 12: # FLOAT
+ data = codec.read_float ()
+ elif typecode == 13: # DOUBLE
+ data = codec.read_double ()
+ elif typecode == 14: # UUID
+ data = codec.read_uuid ()
+ elif typecode == 15: # FTABLE
+ data = codec.read_map ()
+ elif typecode == 16:
+ data = codec.read_int8 ()
+ elif typecode == 17:
+ data = codec.read_int16 ()
+ elif typecode == 18:
+ data = codec.read_int32 ()
+ elif typecode == 19:
+ data = codec.read_int64 ()
+ else:
+ raise ValueError ("Invalid type code: %d" % typecode)
+ return data
+
+ def incOutstanding (self, ch):
+ self.cv.acquire ()
+ ch.reqsOutstanding = ch.reqsOutstanding + 1
+ self.cv.release ()
+
+ def decOutstanding (self, ch):
+ self.cv.acquire ()
+ ch.reqsOutstanding = ch.reqsOutstanding - 1
+ if ch.reqsOutstanding == 0 and self.syncInFlight:
+ self.syncInFlight = False
+ self.cv.notify ()
+ self.cv.release ()
+
+ if ch.reqsOutstanding == 0:
+ if self.ctrlCb != None:
+ self.ctrlCb (ch.context, self.CTRL_SCHEMA_LOADED, None)
+ ch.ssn.exchange_bind (exchange="qpid.management",
+ queue=ch.topicName, binding_key="console.#")
+ ch.ssn.exchange_bind (exchange="qpid.management",
+ queue=ch.topicName, binding_key="schema.#")
+
+
+ def handleMethodReply (self, ch, codec, sequence):
+ status = codec.read_uint32 ()
+ sText = codec.read_str16 ()
+
+ data = self.seqMgr.release (sequence)
+ if data == None:
+ return
+
+ (userSequence, classId, methodName) = data
+ args = {}
+ context = self.seqMgr.release (userSequence)
+
+ if status == 0:
+ schemaClass = self.schema[classId]
+ ms = schemaClass['M']
+ arglist = None
+ for mname in ms:
+ (mdesc, margs) = ms[mname]
+ if mname == methodName:
+ arglist = margs
+ if arglist == None:
+ return
+
+ for arg in arglist:
+ if arg[2].find("O") != -1:
+ args[arg[0]] = self.decodeValue (codec, arg[1])
+
+ if context == "sync" and userSequence == self.syncSequence:
+ self.cv.acquire ()
+ self.syncInFlight = False
+ self.syncResult = methodResult (status, sText, args)
+ self.cv.notify ()
+ self.cv.release ()
+ elif self.methodCb != None:
+ self.methodCb (ch.context, userSequence, status, sText, args)
+
+ def handleCommandComplete (self, ch, codec, seq):
+ code = codec.read_uint32 ()
+ text = codec.read_str8 ()
+ data = (seq, code, text)
+ context = self.seqMgr.release (seq)
+ if context == "outstanding":
+ self.decOutstanding (ch)
+ elif context == "sync" and seq == self.syncSequence:
+ self.cv.acquire ()
+ self.syncInFlight = False
+ self.cv.notify ()
+ self.cv.release ()
+ elif self.ctrlCb != None:
+ self.ctrlCb (ch.context, self.CTRL_USER, data)
+
+ def handleBrokerResponse (self, ch, codec):
+ uuid = codec.read_uuid ()
+ ch.brokerInfo = brokerInfo (uuid, ch.sessionId)
+ if self.ctrlCb != None:
+ self.ctrlCb (ch.context, self.CTRL_BROKER_INFO, ch.brokerInfo)
+
+ # Send a package request
+ sendCodec = Codec ()
+ seq = self.seqMgr.reserve ("outstanding")
+ self.setHeader (sendCodec, ord ('P'), seq)
+ smsg = ch.message(sendCodec.encoded)
+ ch.send ("qpid.management", smsg)
+
+ def handlePackageInd (self, ch, codec):
+ pname = codec.read_str8 ()
+ if pname not in self.packages:
+ self.packages[pname] = {}
+
+ # Send a class request
+ sendCodec = Codec ()
+ seq = self.seqMgr.reserve ("outstanding")
+ self.setHeader (sendCodec, ord ('Q'), seq)
+ self.incOutstanding (ch)
+ sendCodec.write_str8 (pname)
+ smsg = ch.message(sendCodec.encoded)
+ ch.send ("qpid.management", smsg)
+
+ def handleClassInd (self, ch, codec):
+ kind = codec.read_uint8()
+ if kind != 1: # This API doesn't handle new-style events
+ return
+ pname = codec.read_str8()
+ cname = codec.read_str8()
+ hash = codec.read_bin128()
+ if pname not in self.packages:
+ return
+
+ if (cname, hash) not in self.packages[pname]:
+ # Send a schema request
+ sendCodec = Codec ()
+ seq = self.seqMgr.reserve ("outstanding")
+ self.setHeader (sendCodec, ord ('S'), seq)
+ self.incOutstanding (ch)
+ sendCodec.write_str8 (pname)
+ sendCodec.write_str8 (cname)
+ sendCodec.write_bin128 (hash)
+ smsg = ch.message(sendCodec.encoded)
+ ch.send ("qpid.management", smsg)
+
+ def handleHeartbeat (self, ch, codec):
+ timestamp = codec.read_uint64()
+ if self.ctrlCb != None:
+ self.ctrlCb (ch.context, self.CTRL_HEARTBEAT, timestamp)
+
+ def handleEvent (self, ch, codec):
+ if self.eventCb == None:
+ return
+ timestamp = codec.read_uint64()
+ objId = objectId(codec)
+ packageName = codec.read_str8()
+ className = codec.read_str8()
+ hash = codec.read_bin128()
+ name = codec.read_str8()
+ classKey = (packageName, className, hash)
+ if classKey not in self.schema:
+ return;
+ schemaClass = self.schema[classKey]
+ row = []
+ es = schemaClass['E']
+ arglist = None
+ for ename in es:
+ (edesc, eargs) = es[ename]
+ if ename == name:
+ arglist = eargs
+ if arglist == None:
+ return
+ for arg in arglist:
+ row.append((arg[0], self.decodeValue(codec, arg[1])))
+ self.eventCb(ch.context, classKey, objId, name, row)
+
+ def parseSchema (self, ch, codec):
+ """ Parse a received schema-description message. """
+ self.decOutstanding (ch)
+ kind = codec.read_uint8()
+ if kind != 1: # This API doesn't handle new-style events
+ return
+ packageName = codec.read_str8 ()
+ className = codec.read_str8 ()
+ hash = codec.read_bin128 ()
+ hasSupertype = 0 #codec.read_uint8()
+ configCount = codec.read_uint16 ()
+ instCount = codec.read_uint16 ()
+ methodCount = codec.read_uint16 ()
+ if hasSupertype != 0:
+ supertypePackage = codec.read_str8()
+ supertypeClass = codec.read_str8()
+ supertypeHash = codec.read_bin128()
+
+ if packageName not in self.packages:
+ return
+ if (className, hash) in self.packages[packageName]:
+ return
+
+ classKey = (packageName, className, hash)
+ if classKey in self.schema:
+ return
+
+ configs = []
+ insts = []
+ methods = {}
+
+ configs.append (("id", 4, "", "", 1, 1, None, None, None, None, None))
+ insts.append (("id", 4, None, None))
+
+ for idx in range (configCount):
+ ft = codec.read_map ()
+ name = str (ft["name"])
+ type = ft["type"]
+ access = ft["access"]
+ index = ft["index"]
+ optional = ft["optional"]
+ unit = None
+ min = None
+ max = None
+ maxlen = None
+ desc = None
+
+ for key, value in ft.items ():
+ if key == "unit":
+ unit = str (value)
+ elif key == "min":
+ min = value
+ elif key == "max":
+ max = value
+ elif key == "maxlen":
+ maxlen = value
+ elif key == "desc":
+ desc = str (value)
+
+ config = (name, type, unit, desc, access, index, min, max, maxlen, optional)
+ configs.append (config)
+
+ for idx in range (instCount):
+ ft = codec.read_map ()
+ name = str (ft["name"])
+ type = ft["type"]
+ unit = None
+ desc = None
+
+ for key, value in ft.items ():
+ if key == "unit":
+ unit = str (value)
+ elif key == "desc":
+ desc = str (value)
+
+ inst = (name, type, unit, desc)
+ insts.append (inst)
+
+ for idx in range (methodCount):
+ ft = codec.read_map ()
+ mname = str (ft["name"])
+ argCount = ft["argCount"]
+ if "desc" in ft:
+ mdesc = str (ft["desc"])
+ else:
+ mdesc = None
+
+ args = []
+ for aidx in range (argCount):
+ ft = codec.read_map ()
+ name = str (ft["name"])
+ type = ft["type"]
+ dir = str (ft["dir"].upper ())
+ unit = None
+ min = None
+ max = None
+ maxlen = None
+ desc = None
+ default = None
+
+ for key, value in ft.items ():
+ if key == "unit":
+ unit = str (value)
+ elif key == "min":
+ min = value
+ elif key == "max":
+ max = value
+ elif key == "maxlen":
+ maxlen = value
+ elif key == "desc":
+ desc = str (value)
+ elif key == "default":
+ default = str (value)
+
+ arg = (name, type, dir, unit, desc, min, max, maxlen, default)
+ args.append (arg)
+ methods[mname] = (mdesc, args)
+
+ schemaClass = {}
+ schemaClass['C'] = configs
+ schemaClass['I'] = insts
+ schemaClass['M'] = methods
+ self.schema[classKey] = schemaClass
+
+ if self.schemaCb != None:
+ self.schemaCb (ch.context, classKey, configs, insts, methods, {})
+
+ def parsePresenceMasks(self, codec, schemaClass):
+ """ Generate a list of not-present properties """
+ excludeList = []
+ bit = 0
+ for element in schemaClass['C'][1:]:
+ if element[9] == 1:
+ if bit == 0:
+ mask = codec.read_uint8()
+ bit = 1
+ if (mask & bit) == 0:
+ excludeList.append(element[0])
+ bit = bit * 2
+ if bit == 256:
+ bit = 0
+ return excludeList
+
+ def parseContent (self, ch, cls, codec, seq=0):
+ """ Parse a received content message. """
+ if (cls == 'C' or (cls == 'B' and seq == 0)) and self.configCb == None:
+ return
+ if cls == 'I' and self.instCb == None:
+ return
+
+ packageName = codec.read_str8 ()
+ className = codec.read_str8 ()
+ hash = codec.read_bin128 ()
+ classKey = (packageName, className, hash)
+
+ if classKey not in self.schema:
+ return
+
+ row = []
+ timestamps = []
+
+ timestamps.append (codec.read_uint64 ()) # Current Time
+ timestamps.append (codec.read_uint64 ()) # Create Time
+ timestamps.append (codec.read_uint64 ()) # Delete Time
+ objId = objectId(codec)
+ schemaClass = self.schema[classKey]
+ if cls == 'C' or cls == 'B':
+ notPresent = self.parsePresenceMasks(codec, schemaClass)
+
+ if cls == 'C' or cls == 'B':
+ row.append(("id", objId))
+ for element in schemaClass['C'][1:]:
+ tc = element[1]
+ name = element[0]
+ if name in notPresent:
+ row.append((name, None))
+ else:
+ data = self.decodeValue(codec, tc)
+ row.append((name, data))
+
+ if cls == 'I' or cls == 'B':
+ if cls == 'I':
+ row.append(("id", objId))
+ for element in schemaClass['I'][1:]:
+ tc = element[1]
+ name = element[0]
+ data = self.decodeValue (codec, tc)
+ row.append ((name, data))
+
+ if cls == 'C' or (cls == 'B' and seq != self.syncSequence):
+ self.configCb (ch.context, classKey, row, timestamps)
+ elif cls == 'B' and seq == self.syncSequence:
+ if timestamps[2] == 0:
+ obj = mgmtObject (classKey, timestamps, row)
+ self.syncResult.append (obj)
+ elif cls == 'I':
+ self.instCb (ch.context, classKey, row, timestamps)
+
+ def parse (self, ch, codec, opcode, seq):
+ """ Parse a message received from the topic queue. """
+ if opcode == 's':
+ self.parseSchema (ch, codec)
+ elif opcode == 'c':
+ self.parseContent (ch, 'C', codec)
+ elif opcode == 'i':
+ self.parseContent (ch, 'I', codec)
+ elif opcode == 'g':
+ self.parseContent (ch, 'B', codec, seq)
+ else:
+ raise ValueError ("Unknown opcode: %c" % opcode);
+
+ def method (self, channel, userSequence, objId, classId, methodName, args):
+ """ Invoke a method on an object """
+ codec = Codec ()
+ sequence = self.seqMgr.reserve ((userSequence, classId, methodName))
+ self.setHeader (codec, ord ('M'), sequence)
+ objId.encode(codec)
+ codec.write_str8 (classId[0])
+ codec.write_str8 (classId[1])
+ codec.write_bin128 (classId[2])
+ codec.write_str8 (methodName)
+ bank = "%d.%d" % (objId.getBroker(), objId.getBank())
+
+ # Encode args according to schema
+ if classId not in self.schema:
+ self.seqMgr.release (sequence)
+ raise ValueError ("Unknown class name: %s" % classId)
+
+ schemaClass = self.schema[classId]
+ ms = schemaClass['M']
+ arglist = None
+ for mname in ms:
+ (mdesc, margs) = ms[mname]
+ if mname == methodName:
+ arglist = margs
+ if arglist == None:
+ self.seqMgr.release (sequence)
+ raise ValueError ("Unknown method name: %s" % methodName)
+
+ for arg in arglist:
+ if arg[2].find("I") != -1:
+ value = arg[8] # default
+ if arg[0] in args:
+ value = args[arg[0]]
+ if value == None:
+ self.seqMgr.release (sequence)
+ raise ValueError ("Missing non-defaulted argument: %s" % arg[0])
+ self.encodeValue (codec, value, arg[1])
+
+ packageName = classId[0]
+ className = classId[1]
+ msg = channel.message(codec.encoded, "agent." + bank)
+ channel.send ("qpid.management", msg)
diff --git a/qpid/python/qpid/managementdata.py b/qpid/python/qpid/managementdata.py
new file mode 100644
index 0000000000..61cb10c134
--- /dev/null
+++ b/qpid/python/qpid/managementdata.py
@@ -0,0 +1,773 @@
+#!/usr/bin/env python
+
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+
+###############################################################################
+## This file is being obsoleted by qmf/console.py
+###############################################################################
+
+import qpid
+import re
+import socket
+import struct
+import os
+import platform
+import locale
+from qpid.connection import Timeout
+from qpid.management import managementChannel, managementClient
+from threading import Lock
+from disp import Display
+from shlex import split
+from qpid.connection import Connection
+from qpid.util import connect
+
+class Broker:
+ def __init__ (self, text):
+ rex = re.compile(r"""
+ # [ <user> [ / <password> ] @] <host> [ :<port> ]
+ ^ (?: ([^/]*) (?: / ([^@]*) )? @)? ([^:]+) (?: :([0-9]+))?$""", re.X)
+ match = rex.match(text)
+ if not match: raise ValueError("'%s' is not a valid broker url" % (text))
+ user, password, host, port = match.groups()
+
+ if port: self.port = int(port)
+ else: self.port = 5672
+ for addr in socket.getaddrinfo(host, self.port):
+ if addr[1] == socket.AF_INET:
+ self.host = addr[4][0]
+ self.username = user or "guest"
+ self.password = password or "guest"
+
+ def name (self):
+ return self.host + ":" + str (self.port)
+
+class ManagementData:
+
+ #
+ # Data Structure:
+ #
+ # Please note that this data structure holds only the most recent
+ # configuration and instrumentation data for each object. It does
+ # not hold the detailed historical data that is sent from the broker.
+ # The only historical data it keeps are the high and low watermarks
+ # for hi-lo statistics.
+ #
+ # tables :== {class-key}
+ # {<obj-id>}
+ # (timestamp, config-record, inst-record)
+ # class-key :== (<package-name>, <class-name>, <class-hash>)
+ # timestamp :== (<last-interval-time>, <create-time>, <delete-time>)
+ # config-record :== [element]
+ # inst-record :== [element]
+ # element :== (<element-name>, <element-value>)
+ #
+
+ def registerObjId (self, objId):
+ if not objId.index() in self.idBackMap:
+ self.idBackMap[objId.index()] = self.nextId
+ self.idMap[self.nextId] = objId
+ self.nextId += 1
+
+ def displayObjId (self, objIdIndex):
+ if objIdIndex in self.idBackMap:
+ return self.idBackMap[objIdIndex]
+ else:
+ return 0
+
+ def rawObjId (self, displayId):
+ if displayId in self.idMap:
+ return self.idMap[displayId]
+ else:
+ return None
+
+ def displayClassName (self, cls):
+ (packageName, className, hash) = cls
+ rev = self.schema[cls][4]
+ if rev == 0:
+ suffix = ""
+ else:
+ suffix = ".%d" % rev
+ return packageName + ":" + className + suffix
+
+ def dataHandler (self, context, className, list, timestamps):
+ """ Callback for configuration and instrumentation data updates """
+ self.lock.acquire ()
+ try:
+ # If this class has not been seen before, create an empty dictionary to
+ # hold objects of this class
+ if className not in self.tables:
+ self.tables[className] = {}
+
+ # Register the ID so a more friendly presentation can be displayed
+ objId = list[0][1]
+ oidx = objId.index()
+ self.registerObjId (objId)
+
+ # If this object hasn't been seen before, create a new object record with
+ # the timestamps and empty lists for configuration and instrumentation data.
+ if oidx not in self.tables[className]:
+ self.tables[className][oidx] = (timestamps, [], [])
+
+ (unused, oldConf, oldInst) = self.tables[className][oidx]
+
+ # For config updates, simply replace old config list with the new one.
+ if context == 0: #config
+ self.tables[className][oidx] = (timestamps, list, oldInst)
+
+ # For instrumentation updates, carry the minimum and maximum values for
+ # "hi-lo" stats forward.
+ elif context == 1: #inst
+ if len (oldInst) == 0:
+ newInst = list
+ else:
+ newInst = []
+ for idx in range (len (list)):
+ (key, value) = list[idx]
+ if key.find ("High") == len (key) - 4:
+ if oldInst[idx][1] > value:
+ value = oldInst[idx][1]
+ if key.find ("Low") == len (key) - 3:
+ if oldInst[idx][1] < value:
+ value = oldInst[idx][1]
+ newInst.append ((key, value))
+ self.tables[className][oidx] = (timestamps, oldConf, newInst)
+
+ finally:
+ self.lock.release ()
+
+ def ctrlHandler (self, context, op, data):
+ if op == self.mclient.CTRL_BROKER_INFO:
+ pass
+ elif op == self.mclient.CTRL_HEARTBEAT:
+ pass
+
+ def configHandler (self, context, className, list, timestamps):
+ self.dataHandler (0, className, list, timestamps);
+
+ def instHandler (self, context, className, list, timestamps):
+ self.dataHandler (1, className, list, timestamps);
+
+ def methodReply (self, broker, sequence, status, sText, args):
+ """ Callback for method-reply messages """
+ self.lock.acquire ()
+ try:
+ line = "Call Result: " + self.methodsPending[sequence] + \
+ " " + str (status) + " (" + sText + ")"
+ print line, args
+ del self.methodsPending[sequence]
+ finally:
+ self.lock.release ()
+
+ def closeHandler (self, context, reason):
+ if self.operational:
+ print "Connection to broker lost:", reason
+ self.operational = False
+ if self.cli != None:
+ self.cli.setPromptMessage ("Broker Disconnected")
+
+ def schemaHandler (self, context, classKey, configs, insts, methods, events):
+ """ Callback for schema updates """
+ if classKey not in self.schema:
+ schemaRev = 0
+ for key in self.schema:
+ if classKey[0] == key[0] and classKey[1] == key[1]:
+ schemaRev += 1
+ self.schema[classKey] = (configs, insts, methods, events, schemaRev)
+
+ def setCli (self, cliobj):
+ self.cli = cliobj
+
+ def __init__ (self, disp, host, username="guest", password="guest"):
+ self.lock = Lock ()
+ self.tables = {}
+ self.schema = {}
+ self.bootSequence = 0
+ self.operational = False
+ self.disp = disp
+ self.cli = None
+ self.lastUnit = None
+ self.methodSeq = 1
+ self.methodsPending = {}
+ self.sessionId = "%s.%d" % (platform.uname()[1], os.getpid())
+
+ self.broker = Broker (host)
+ sock = connect (self.broker.host, self.broker.port)
+ oldTimeout = sock.gettimeout()
+ sock.settimeout(10)
+ self.conn = Connection (sock,
+ username=self.broker.username, password=self.broker.password)
+ def aborted():
+ raise Timeout("Waiting for connection to be established with broker")
+ oldAborted = self.conn.aborted
+ self.conn.aborted = aborted
+
+ self.conn.start ()
+
+ sock.settimeout(oldTimeout)
+ self.conn.aborted = oldAborted
+
+ self.mclient = managementClient ("unused", self.ctrlHandler, self.configHandler,
+ self.instHandler, self.methodReply, self.closeHandler)
+ self.mclient.schemaListener (self.schemaHandler)
+ self.mch = self.mclient.addChannel (self.conn.session(self.sessionId))
+ self.operational = True
+ self.idMap = {}
+ self.idBackMap = {}
+ self.nextId = 101
+
+ def close (self):
+ pass
+
+ def refName (self, oid):
+ if oid == None:
+ return "NULL"
+ return str (self.displayObjId (oid.index()))
+
+ def valueDisplay (self, classKey, key, value):
+ if value == None:
+ return "<NULL>"
+ for kind in range (2):
+ schema = self.schema[classKey][kind]
+ for item in schema:
+ if item[0] == key:
+ typecode = item[1]
+ unit = item[2]
+ if (typecode >= 1 and typecode <= 5) or typecode == 12 or typecode == 13 or \
+ (typecode >= 16 and typecode <= 19):
+ if unit == None or unit == self.lastUnit:
+ return str (value)
+ else:
+ self.lastUnit = unit
+ suffix = ""
+ if value != 1:
+ suffix = "s"
+ return str (value) + " " + unit + suffix
+ elif typecode == 6 or typecode == 7: # strings
+ return value
+ elif typecode == 8:
+ if value == 0:
+ return "--"
+ return self.disp.timestamp (value)
+ elif typecode == 9:
+ return str (value)
+ elif typecode == 10:
+ return self.refName (value)
+ elif typecode == 11:
+ if value == 0:
+ return "False"
+ else:
+ return "True"
+ elif typecode == 14:
+ return str (value)
+ elif typecode == 15:
+ return str (value)
+ return "*type-error*"
+
+ def getObjIndex (self, classKey, config):
+ """ Concatenate the values from index columns to form a unique object name """
+ result = ""
+ schemaConfig = self.schema[classKey][0]
+ for item in schemaConfig:
+ if item[5] == 1 and item[0] != "id":
+ if result != "":
+ result = result + "."
+ for key,val in config:
+ if key == item[0]:
+ result = result + self.valueDisplay (classKey, key, val)
+ return result
+
+ def getClassKey (self, className):
+ delimPos = className.find(":")
+ if delimPos == -1:
+ schemaRev = 0
+ delim = className.find(".")
+ if delim != -1:
+ schemaRev = int(className[delim + 1:])
+ name = className[0:delim]
+ else:
+ name = className
+ for key in self.schema:
+ if key[1] == name and self.schema[key][4] == schemaRev:
+ return key
+ else:
+ package = className[0:delimPos]
+ name = className[delimPos + 1:]
+ schemaRev = 0
+ delim = name.find(".")
+ if delim != -1:
+ schemaRev = int(name[delim + 1:])
+ name = name[0:delim]
+ for key in self.schema:
+ if key[0] == package and key[1] == name:
+ if self.schema[key][4] == schemaRev:
+ return key
+ return None
+
+ def classCompletions (self, prefix):
+ """ Provide a list of candidate class names for command completion """
+ self.lock.acquire ()
+ complist = []
+ try:
+ for name in self.tables:
+ if name.find (prefix) == 0:
+ complist.append (name)
+ finally:
+ self.lock.release ()
+ return complist
+
+ def typeName (self, typecode):
+ """ Convert type-codes to printable strings """
+ if typecode == 1:
+ return "uint8"
+ elif typecode == 2:
+ return "uint16"
+ elif typecode == 3:
+ return "uint32"
+ elif typecode == 4:
+ return "uint64"
+ elif typecode == 5:
+ return "bool"
+ elif typecode == 6:
+ return "short-string"
+ elif typecode == 7:
+ return "long-string"
+ elif typecode == 8:
+ return "abs-time"
+ elif typecode == 9:
+ return "delta-time"
+ elif typecode == 10:
+ return "reference"
+ elif typecode == 11:
+ return "boolean"
+ elif typecode == 12:
+ return "float"
+ elif typecode == 13:
+ return "double"
+ elif typecode == 14:
+ return "uuid"
+ elif typecode == 15:
+ return "field-table"
+ elif typecode == 16:
+ return "int8"
+ elif typecode == 17:
+ return "int16"
+ elif typecode == 18:
+ return "int32"
+ elif typecode == 19:
+ return "int64"
+ elif typecode == 20:
+ return "object"
+ elif typecode == 21:
+ return "list"
+ elif typecode == 22:
+ return "array"
+ else:
+ raise ValueError ("Invalid type code: %d" % typecode)
+
+ def accessName (self, code):
+ """ Convert element access codes to printable strings """
+ if code == 1:
+ return "ReadCreate"
+ elif code == 2:
+ return "ReadWrite"
+ elif code == 3:
+ return "ReadOnly"
+ else:
+ raise ValueError ("Invalid access code: %d" %code)
+
+ def notNone (self, text):
+ if text == None:
+ return ""
+ else:
+ return text
+
+ def isOid (self, id):
+ for char in str (id):
+ if not char.isdigit () and not char == '-':
+ return False
+ return True
+
+ def listOfIds (self, classKey, tokens):
+ """ Generate a tuple of object ids for a classname based on command tokens. """
+ list = []
+ if len(tokens) == 0 or tokens[0] == "all":
+ for id in self.tables[classKey]:
+ list.append (self.displayObjId (id))
+
+ elif tokens[0] == "active":
+ for id in self.tables[classKey]:
+ if self.tables[classKey][id][0][2] == 0:
+ list.append (self.displayObjId (id))
+
+ else:
+ for token in tokens:
+ if self.isOid (token):
+ if token.find ("-") != -1:
+ ids = token.split("-", 2)
+ for id in range (int (ids[0]), int (ids[1]) + 1):
+ if self.getClassForId (self.rawObjId (long (id))) == classKey:
+ list.append (id)
+ else:
+ list.append (int(token))
+
+ list.sort ()
+ result = ()
+ for item in list:
+ result = result + (item,)
+ return result
+
+ def listClasses (self):
+ """ Generate a display of the list of classes """
+ self.lock.acquire ()
+ try:
+ rows = []
+ sorted = self.tables.keys ()
+ sorted.sort ()
+ for name in sorted:
+ active = 0
+ deleted = 0
+ for record in self.tables[name]:
+ isdel = False
+ ts = self.tables[name][record][0]
+ if ts[2] > 0:
+ isdel = True
+ if isdel:
+ deleted = deleted + 1
+ else:
+ active = active + 1
+ rows.append ((self.displayClassName (name), active, deleted))
+ if len (rows) != 0:
+ self.disp.table ("Management Object Types:",
+ ("ObjectType", "Active", "Deleted"), rows)
+ else:
+ print "Waiting for next periodic update"
+ finally:
+ self.lock.release ()
+
+ def listObjects (self, tokens):
+ """ Generate a display of a list of objects in a class """
+ if len(tokens) == 0:
+ print "Error - No class name provided"
+ return
+
+ self.lock.acquire ()
+ try:
+ classKey = self.getClassKey (tokens[0])
+ if classKey == None:
+ print ("Object type %s not known" % tokens[0])
+ else:
+ rows = []
+ if classKey in self.tables:
+ ids = self.listOfIds(classKey, tokens[1:])
+ for objId in ids:
+ (ts, config, inst) = self.tables[classKey][self.rawObjId(objId).index()]
+ createTime = self.disp.timestamp (ts[1])
+ destroyTime = "-"
+ if ts[2] > 0:
+ destroyTime = self.disp.timestamp (ts[2])
+ objIndex = self.getObjIndex (classKey, config)
+ row = (objId, createTime, destroyTime, objIndex)
+ rows.append (row)
+ self.disp.table ("Objects of type %s" % self.displayClassName(classKey),
+ ("ID", "Created", "Destroyed", "Index"),
+ rows)
+ finally:
+ self.lock.release ()
+
+ def showObjects (self, tokens):
+ """ Generate a display of object data for a particular class """
+ self.lock.acquire ()
+ try:
+ self.lastUnit = None
+ if self.isOid (tokens[0]):
+ if tokens[0].find ("-") != -1:
+ rootId = int (tokens[0][0:tokens[0].find ("-")])
+ else:
+ rootId = int (tokens[0])
+
+ classKey = self.getClassForId (self.rawObjId (rootId))
+ remaining = tokens
+ if classKey == None:
+ print "Id not known: %d" % int (tokens[0])
+ raise ValueError ()
+ else:
+ classKey = self.getClassKey (tokens[0])
+ remaining = tokens[1:]
+ if classKey not in self.tables:
+ print "Class not known: %s" % tokens[0]
+ raise ValueError ()
+
+ userIds = self.listOfIds (classKey, remaining)
+ if len (userIds) == 0:
+ print "No object IDs supplied"
+ raise ValueError ()
+
+ ids = []
+ for id in userIds:
+ if self.getClassForId (self.rawObjId (long (id))) == classKey:
+ ids.append (self.rawObjId (long (id)))
+
+ rows = []
+ timestamp = None
+ config = self.tables[classKey][ids[0].index()][1]
+ for eIdx in range (len (config)):
+ key = config[eIdx][0]
+ if key != "id":
+ row = ("property", key)
+ for id in ids:
+ if timestamp == None or \
+ timestamp < self.tables[classKey][id.index()][0][0]:
+ timestamp = self.tables[classKey][id.index()][0][0]
+ (key, value) = self.tables[classKey][id.index()][1][eIdx]
+ row = row + (self.valueDisplay (classKey, key, value),)
+ rows.append (row)
+
+ inst = self.tables[classKey][ids[0].index()][2]
+ for eIdx in range (len (inst)):
+ key = inst[eIdx][0]
+ if key != "id":
+ row = ("statistic", key)
+ for id in ids:
+ (key, value) = self.tables[classKey][id.index()][2][eIdx]
+ row = row + (self.valueDisplay (classKey, key, value),)
+ rows.append (row)
+
+ titleRow = ("Type", "Element")
+ for id in ids:
+ titleRow = titleRow + (self.refName(id),)
+ caption = "Object of type %s:" % self.displayClassName(classKey)
+ if timestamp != None:
+ caption = caption + " (last sample time: " + self.disp.timestamp (timestamp) + ")"
+ self.disp.table (caption, titleRow, rows)
+
+ except:
+ pass
+ self.lock.release ()
+
+ def schemaSummary (self):
+ """ Generate a display of the list of classes in the schema """
+ self.lock.acquire ()
+ try:
+ rows = []
+ sorted = self.schema.keys ()
+ sorted.sort ()
+ for classKey in sorted:
+ tuple = self.schema[classKey]
+ row = (self.displayClassName(classKey), len (tuple[0]), len (tuple[1]),
+ len (tuple[2]))
+ rows.append (row)
+ self.disp.table ("Classes in Schema:",
+ ("Class", "Properties", "Statistics", "Methods"),
+ rows)
+ finally:
+ self.lock.release ()
+
+ def schemaTable (self, className):
+ """ Generate a display of details of the schema of a particular class """
+ self.lock.acquire ()
+ try:
+ classKey = self.getClassKey (className)
+ if classKey == None:
+ print ("Class name %s not known" % className)
+ raise ValueError ()
+
+ rows = []
+ schemaRev = self.schema[classKey][4]
+ for config in self.schema[classKey][0]:
+ name = config[0]
+ if name != "id":
+ typename = self.typeName(config[1])
+ unit = self.notNone (config[2])
+ desc = self.notNone (config[3])
+ access = self.accessName (config[4])
+ extra = ""
+ if config[5] == 1:
+ extra += "index "
+ if config[6] != None:
+ extra += "Min: " + str(config[6]) + " "
+ if config[7] != None:
+ extra += "Max: " + str(config[7]) + " "
+ if config[8] != None:
+ extra += "MaxLen: " + str(config[8]) + " "
+ if config[9] == 1:
+ extra += "optional "
+ rows.append ((name, typename, unit, access, extra, desc))
+
+ for config in self.schema[classKey][1]:
+ name = config[0]
+ if name != "id":
+ typename = self.typeName(config[1])
+ unit = self.notNone (config[2])
+ desc = self.notNone (config[3])
+ rows.append ((name, typename, unit, "", "", desc))
+
+ titles = ("Element", "Type", "Unit", "Access", "Notes", "Description")
+ self.disp.table ("Schema for class '%s':" % self.displayClassName(classKey), titles, rows)
+
+ for mname in self.schema[classKey][2]:
+ (mdesc, args) = self.schema[classKey][2][mname]
+ caption = "\nMethod '%s' %s" % (mname, self.notNone (mdesc))
+ rows = []
+ for arg in args:
+ name = arg[0]
+ typename = self.typeName (arg[1])
+ dir = arg[2]
+ unit = self.notNone (arg[3])
+ desc = self.notNone (arg[4])
+ extra = ""
+ if arg[5] != None:
+ extra = extra + "Min: " + str (arg[5])
+ if arg[6] != None:
+ extra = extra + "Max: " + str (arg[6])
+ if arg[7] != None:
+ extra = extra + "MaxLen: " + str (arg[7])
+ if arg[8] != None:
+ extra = extra + "Default: " + str (arg[8])
+ rows.append ((name, typename, dir, unit, extra, desc))
+ titles = ("Argument", "Type", "Direction", "Unit", "Notes", "Description")
+ self.disp.table (caption, titles, rows)
+
+ except Exception,e:
+ pass
+ self.lock.release ()
+
+ def getClassForId (self, objId):
+ """ Given an object ID, return the class key for the referenced object """
+ for classKey in self.tables:
+ if objId.index() in self.tables[classKey]:
+ return classKey
+ return None
+
+ def callMethod (self, userOid, methodName, args):
+ self.lock.acquire ()
+ methodOk = True
+ try:
+ classKey = self.getClassForId (self.rawObjId (userOid))
+ if classKey == None:
+ raise ValueError ()
+
+ if methodName not in self.schema[classKey][2]:
+ print "Method '%s' not valid for class '%s'" % (methodName, self.displayClassName(classKey))
+ raise ValueError ()
+
+ schemaMethod = self.schema[classKey][2][methodName]
+ count = 0
+ for arg in range(len(schemaMethod[1])):
+ if schemaMethod[1][arg][2].find("I") != -1:
+ count += 1
+ if len (args) != count:
+ print "Wrong number of method args: Need %d, Got %d" % (count, len (args))
+ raise ValueError ()
+
+ namedArgs = {}
+ idx = 0
+ for arg in range(len(schemaMethod[1])):
+ if schemaMethod[1][arg][2].find("I") != -1:
+ namedArgs[schemaMethod[1][arg][0]] = args[idx]
+ idx += 1
+
+ self.methodSeq = self.methodSeq + 1
+ self.methodsPending[self.methodSeq] = methodName
+ except Exception, e:
+ methodOk = False
+ self.lock.release ()
+ if methodOk:
+# try:
+ self.mclient.callMethod (self.mch, self.methodSeq, self.rawObjId (userOid), classKey,
+ methodName, namedArgs)
+# except ValueError, e:
+# print "Error invoking method:", e
+
+ def makeIdRow (self, displayId):
+ if displayId in self.idMap:
+ objId = self.idMap[displayId]
+ else:
+ return None
+ if objId.getFlags() == 0:
+ flags = ""
+ else:
+ flags = str(objId.getFlags())
+ seq = objId.getSequence()
+ if seq == 0:
+ seqText = "<durable>"
+ else:
+ seqText = str(seq)
+ return (displayId, flags, seqText, objId.getBroker(), objId.getBank(), hex(objId.getObject()))
+
+ def listIds (self, select):
+ rows = []
+ if select == 0:
+ sorted = self.idMap.keys()
+ sorted.sort()
+ for displayId in sorted:
+ row = self.makeIdRow (displayId)
+ rows.append(row)
+ else:
+ row = self.makeIdRow (select)
+ if row == None:
+ print "Display Id %d not known" % select
+ return
+ rows.append(row)
+ self.disp.table("Translation of Display IDs:",
+ ("DisplayID", "Flags", "BootSequence", "Broker", "Bank", "Object"),
+ rows)
+
+ def do_list (self, data):
+ tokens = data.split ()
+ if len (tokens) == 0:
+ self.listClasses ()
+ else:
+ self.listObjects (tokens)
+
+ def do_show (self, data):
+ tokens = data.split ()
+ self.showObjects (tokens)
+
+ def do_schema (self, data):
+ if data == "":
+ self.schemaSummary ()
+ else:
+ self.schemaTable (data)
+
+ def do_call (self, data):
+ encTokens = data.split ()
+ try:
+ tokens = [a.decode(locale.getpreferredencoding()) for a in encArgs]
+ except:
+ tokens = encTokens
+ if len (tokens) < 2:
+ print "Not enough arguments supplied"
+ return
+
+ displayId = long (tokens[0])
+ methodName = tokens[1]
+ args = tokens[2:]
+ self.callMethod (displayId, methodName, args)
+
+ def do_id (self, data):
+ if data == "":
+ select = 0
+ else:
+ select = int(data)
+ self.listIds(select)
+
+ def do_exit (self):
+ self.mclient.removeChannel (self.mch)
diff --git a/qpid/python/qpid/message.py b/qpid/python/qpid/message.py
new file mode 100644
index 0000000000..4d31da2846
--- /dev/null
+++ b/qpid/python/qpid/message.py
@@ -0,0 +1,73 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+from connection08 import Method, Request
+
+class Message:
+
+ def __init__(self, channel, frame, content = None):
+ self.channel = channel
+ self.frame = frame
+ self.method = frame.method_type
+ self.content = content
+ if self.method.is_l4_command():
+ self.command_id = self.channel.incoming_completion.sequence.next()
+ #print "allocated: ", self.command_id, "to ", self.method.klass.name, "_", self.method.name
+
+ def __len__(self):
+ return len(self.frame.args)
+
+ def _idx(self, idx):
+ if idx < 0: idx += len(self)
+ if idx < 0 or idx > len(self):
+ raise IndexError(idx)
+ return idx
+
+ def __getitem__(self, idx):
+ return self.frame.args[idx]
+
+ def __getattr__(self, attr):
+ fields = self.method.fields.byname
+ if fields.has_key(attr):
+ f = fields[attr]
+ result = self[self.method.fields.index(f)]
+ else:
+ for r in self.method.responses:
+ if attr == r.name:
+ def respond(*args, **kwargs):
+ batch=0
+ if kwargs.has_key("batchoffset"):
+ batch=kwargs.pop("batchoffset")
+ self.channel.respond(Method(r, r.arguments(*args, **kwargs)), batch, self.frame)
+ result = respond
+ break
+ else:
+ raise AttributeError(attr)
+ return result
+
+ STR = "%s %s content = %s"
+ REPR = STR.replace("%s", "%r")
+
+ def __str__(self):
+ return Message.STR % (self.method, self.frame.args, self.content)
+
+ def __repr__(self):
+ return Message.REPR % (self.method, self.frame.args, self.content)
+
+ def complete(self, cumulative=True):
+ self.channel.incoming_completion.complete(mark=self.command_id, cumulative=cumulative)
diff --git a/qpid/python/qpid/messaging/__init__.py b/qpid/python/qpid/messaging/__init__.py
new file mode 100644
index 0000000000..f9ddda2e80
--- /dev/null
+++ b/qpid/python/qpid/messaging/__init__.py
@@ -0,0 +1,35 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+A candidate high level messaging API for python.
+
+Areas that still need work:
+
+ - definition of the arguments for L{Session.sender} and L{Session.receiver}
+ - standard L{Message} properties
+ - L{Message} content encoding
+ - protocol negotiation/multiprotocol impl
+"""
+
+from qpid.datatypes import timestamp, uuid4, Serial
+from qpid.messaging.constants import *
+from qpid.messaging.endpoints import *
+from qpid.messaging.exceptions import *
+from qpid.messaging.message import *
diff --git a/qpid/python/qpid/messaging/address.py b/qpid/python/qpid/messaging/address.py
new file mode 100644
index 0000000000..e423f09193
--- /dev/null
+++ b/qpid/python/qpid/messaging/address.py
@@ -0,0 +1,172 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import re
+from qpid.lexer import Lexicon, LexError
+from qpid.parser import Parser, ParseError
+
+l = Lexicon()
+
+LBRACE = l.define("LBRACE", r"\{")
+RBRACE = l.define("RBRACE", r"\}")
+LBRACK = l.define("LBRACK", r"\[")
+RBRACK = l.define("RBRACK", r"\]")
+COLON = l.define("COLON", r":")
+SEMI = l.define("SEMI", r";")
+SLASH = l.define("SLASH", r"/")
+COMMA = l.define("COMMA", r",")
+NUMBER = l.define("NUMBER", r'[+-]?[0-9]*\.?[0-9]+')
+ID = l.define("ID", r'[a-zA-Z_](?:[a-zA-Z0-9_-]*[a-zA-Z0-9_])?')
+STRING = l.define("STRING", r""""(?:[^\\"]|\\.)*"|'(?:[^\\']|\\.)*'""")
+ESC = l.define("ESC", r"\\[^ux]|\\x[0-9a-fA-F][0-9a-fA-F]|\\u[0-9a-fA-F][0-9a-fA-F][0-9a-fA-F][0-9a-fA-F]")
+SYM = l.define("SYM", r"[.#*%@$^!+-]")
+WSPACE = l.define("WSPACE", r"[ \n\r\t]+")
+EOF = l.eof("EOF")
+
+LEXER = l.compile()
+
+def lex(st):
+ return LEXER.lex(st)
+
+def tok2str(tok):
+ if tok.type is STRING:
+ return eval(tok.value)
+ elif tok.type is ESC:
+ if tok.value[1] == "x":
+ return eval('"%s"' % tok.value)
+ elif tok.value[1] == "u":
+ return eval('u"%s"' % tok.value)
+ else:
+ return tok.value[1]
+ else:
+ return tok.value
+
+CONSTANTS = {
+ "True": True,
+ "true": True,
+ "False": False,
+ "false": False,
+ "None": None
+ }
+
+def tok2obj(tok):
+ if tok.type == ID:
+ return CONSTANTS.get(tok.value, tok.value)
+ elif tok.type in (STRING, NUMBER):
+ return eval(tok.value)
+ else:
+ return tok.value
+
+def toks2str(toks):
+ if toks:
+ return "".join(map(tok2str, toks))
+ else:
+ return None
+
+class AddressParser(Parser):
+
+ def __init__(self, tokens):
+ Parser.__init__(self, [t for t in tokens if t.type is not WSPACE])
+
+ def parse(self):
+ result = self.address()
+ self.eat(EOF)
+ return result
+
+ def address(self):
+ name = toks2str(self.eat_until(SLASH, SEMI, EOF))
+
+ if name is None:
+ raise ParseError(self.next())
+
+ if self.matches(SLASH):
+ self.eat(SLASH)
+ subject = toks2str(self.eat_until(SEMI, EOF))
+ else:
+ subject = None
+
+ if self.matches(SEMI):
+ self.eat(SEMI)
+ options = self.map()
+ else:
+ options = None
+ return name, subject, options
+
+ def map(self):
+ self.eat(LBRACE)
+
+ result = {}
+ while True:
+ if self.matches(NUMBER, STRING, ID, LBRACE, LBRACK):
+ n, v = self.keyval()
+ result[n] = v
+ if self.matches(COMMA):
+ self.eat(COMMA)
+ elif self.matches(RBRACE):
+ break
+ else:
+ raise ParseError(self.next(), COMMA, RBRACE)
+ elif self.matches(RBRACE):
+ break
+ else:
+ raise ParseError(self.next(), NUMBER, STRING, ID, LBRACE, LBRACK,
+ RBRACE)
+
+ self.eat(RBRACE)
+ return result
+
+ def keyval(self):
+ key = self.value()
+ self.eat(COLON)
+ val = self.value()
+ return (key, val)
+
+ def value(self):
+ if self.matches(NUMBER, STRING, ID):
+ return tok2obj(self.eat())
+ elif self.matches(LBRACE):
+ return self.map()
+ elif self.matches(LBRACK):
+ return self.list()
+ else:
+ raise ParseError(self.next(), NUMBER, STRING, ID, LBRACE, LBRACK)
+
+ def list(self):
+ self.eat(LBRACK)
+
+ result = []
+
+ while True:
+ if self.matches(RBRACK):
+ break
+ else:
+ result.append(self.value())
+ if self.matches(COMMA):
+ self.eat(COMMA)
+ elif self.matches(RBRACK):
+ break
+ else:
+ raise ParseError(self.next(), COMMA, RBRACK)
+
+ self.eat(RBRACK)
+ return result
+
+def parse(addr):
+ return AddressParser(lex(addr)).parse()
+
+__all__ = ["parse", "ParseError"]
diff --git a/qpid/python/qpid/messaging/constants.py b/qpid/python/qpid/messaging/constants.py
new file mode 100644
index 0000000000..f230c4def8
--- /dev/null
+++ b/qpid/python/qpid/messaging/constants.py
@@ -0,0 +1,40 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+__SELF__ = object()
+
+class Constant:
+
+ def __init__(self, name, value=__SELF__):
+ self.name = name
+ if value is __SELF__:
+ self.value = self
+ else:
+ self.value = value
+
+ def __repr__(self):
+ return self.name
+
+AMQP_PORT = 5672
+AMQPS_PORT = 5671
+
+UNLIMITED = Constant("UNLIMITED", 0xFFFFFFFFL)
+
+REJECTED = Constant("REJECTED")
+RELEASED = Constant("RELEASED")
diff --git a/qpid/python/qpid/messaging/driver.py b/qpid/python/qpid/messaging/driver.py
new file mode 100644
index 0000000000..74ed038b0e
--- /dev/null
+++ b/qpid/python/qpid/messaging/driver.py
@@ -0,0 +1,1432 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import socket, struct, sys, time
+from logging import getLogger, DEBUG
+from qpid import compat
+from qpid import sasl
+from qpid.concurrency import synchronized
+from qpid.datatypes import RangedSet, Serial
+from qpid.framing import OpEncoder, SegmentEncoder, FrameEncoder, \
+ FrameDecoder, SegmentDecoder, OpDecoder
+from qpid.messaging import address, transports
+from qpid.messaging.constants import UNLIMITED, REJECTED, RELEASED
+from qpid.messaging.exceptions import *
+from qpid.messaging.message import get_codec, Disposition, Message
+from qpid.messaging.endpoints import MangledString
+from qpid.ops import *
+from qpid.selector import Selector
+from qpid.util import URL, default,get_client_properties_with_defaults
+from qpid.validator import And, Context, List, Map, Types, Values
+from threading import Condition, Thread
+
+log = getLogger("qpid.messaging")
+rawlog = getLogger("qpid.messaging.io.raw")
+opslog = getLogger("qpid.messaging.io.ops")
+
+def addr2reply_to(addr):
+ name, subject, options = address.parse(addr)
+ if options:
+ type = options.get("node", {}).get("type")
+ else:
+ type = None
+
+ if type == "topic":
+ return ReplyTo(name, subject)
+ else:
+ return ReplyTo(None, name)
+
+def reply_to2addr(reply_to):
+ if reply_to.exchange in (None, ""):
+ return reply_to.routing_key
+ elif reply_to.routing_key is None:
+ return "%s; {node: {type: topic}}" % reply_to.exchange
+ else:
+ return "%s/%s; {node: {type: topic}}" % (reply_to.exchange, reply_to.routing_key)
+
+class Attachment:
+
+ def __init__(self, target):
+ self.target = target
+
+# XXX
+
+DURABLE_DEFAULT=False
+
+# XXX
+
+class Pattern:
+ """
+ The pattern filter matches the supplied wildcard pattern against a
+ message subject.
+ """
+
+ def __init__(self, value):
+ self.value = value
+
+ # XXX: this should become part of the driver
+ def _bind(self, sst, exchange, queue):
+ from qpid.ops import ExchangeBind
+
+ sst.write_cmd(ExchangeBind(exchange=exchange, queue=queue,
+ binding_key=self.value.replace("*", "#")))
+
+SUBJECT_DEFAULTS = {
+ "topic": "#"
+ }
+
+def noop(): pass
+def sync_noop(): pass
+
+class SessionState:
+
+ def __init__(self, driver, session, name, channel):
+ self.driver = driver
+ self.session = session
+ self.name = name
+ self.channel = channel
+ self.detached = False
+ self.committing = False
+ self.aborting = False
+
+ # sender state
+ self.sent = Serial(0)
+ self.acknowledged = RangedSet()
+ self.actions = {}
+ self.min_completion = self.sent
+ self.max_completion = self.sent
+ self.results = {}
+ self.need_sync = False
+
+ # receiver state
+ self.received = None
+ self.executed = RangedSet()
+
+ # XXX: need to periodically exchange completion/known_completion
+
+ self.destinations = {}
+
+ def write_query(self, query, handler, obj):
+ id = self.sent
+ self.write_cmd(query, lambda: handler(self.results.pop(id), obj))
+
+ def apply_overrides(self, cmd, overrides):
+ for k, v in overrides.items():
+ cmd[k.replace('-', '_')] = v
+
+ def write_cmd(self, cmd, action=noop, overrides=None, sync=True):
+ if overrides:
+ self.apply_overrides(cmd, overrides)
+
+ if action != noop:
+ cmd.sync = sync
+ if self.detached:
+ raise Exception("detached")
+ cmd.id = self.sent
+ self.sent += 1
+ self.actions[cmd.id] = action
+ self.max_completion = cmd.id
+ self.write_op(cmd)
+ self.need_sync = not cmd.sync
+
+ def write_cmds(self, cmds, action=noop):
+ if cmds:
+ for cmd in cmds[:-1]:
+ self.write_cmd(cmd)
+ self.write_cmd(cmds[-1], action)
+ else:
+ action()
+
+ def write_op(self, op):
+ op.channel = self.channel
+ self.driver.write_op(op)
+
+POLICIES = Values("always", "sender", "receiver", "never")
+RELIABILITY = Values("unreliable", "at-most-once", "at-least-once",
+ "exactly-once")
+
+DECLARE = Map({}, restricted=False)
+BINDINGS = List(Map({
+ "exchange": Types(basestring),
+ "queue": Types(basestring),
+ "key": Types(basestring),
+ "arguments": Map({}, restricted=False)
+ }))
+
+COMMON_OPTS = {
+ "create": POLICIES,
+ "delete": POLICIES,
+ "assert": POLICIES,
+ "node": Map({
+ "type": Values("queue", "topic"),
+ "durable": Types(bool),
+ "x-declare": DECLARE,
+ "x-bindings": BINDINGS
+ }),
+ "link": Map({
+ "name": Types(basestring),
+ "durable": Types(bool),
+ "reliability": RELIABILITY,
+ "x-declare": DECLARE,
+ "x-bindings": BINDINGS,
+ "x-subscribe": Map({}, restricted=False)
+ })
+ }
+
+RECEIVE_MODES = Values("browse", "consume")
+
+SOURCE_OPTS = COMMON_OPTS.copy()
+SOURCE_OPTS.update({
+ "mode": RECEIVE_MODES
+ })
+
+TARGET_OPTS = COMMON_OPTS.copy()
+
+class LinkIn:
+
+ ADDR_NAME = "source"
+ DIR_NAME = "receiver"
+ VALIDATOR = Map(SOURCE_OPTS)
+
+ def init_link(self, sst, rcv, _rcv):
+ _rcv.destination = str(rcv.id)
+ sst.destinations[_rcv.destination] = _rcv
+ _rcv.draining = False
+ _rcv.bytes_open = False
+ _rcv.on_unlink = []
+
+ def do_link(self, sst, rcv, _rcv, type, subtype, action):
+ link_opts = _rcv.options.get("link", {})
+ if type == "topic":
+ default_reliability = "unreliable"
+ else:
+ default_reliability = "at-least-once"
+ reliability = link_opts.get("reliability", default_reliability)
+ declare = link_opts.get("x-declare", {})
+ subscribe = link_opts.get("x-subscribe", {})
+ acq_mode = acquire_mode.pre_acquired
+ if reliability in ("unreliable", "at-most-once"):
+ rcv._accept_mode = accept_mode.none
+ else:
+ rcv._accept_mode = accept_mode.explicit
+
+ if type == "topic":
+ default_name = "%s.%s" % (rcv.session.name, _rcv.destination)
+ _rcv._queue = link_opts.get("name", default_name)
+ sst.write_cmd(QueueDeclare(queue=_rcv._queue,
+ durable=link_opts.get("durable", False),
+ exclusive=True,
+ auto_delete=(reliability == "unreliable")),
+ overrides=declare)
+ if declare.get("exclusive", True): _rcv.on_unlink = [QueueDelete(_rcv._queue)]
+ subject = _rcv.subject or SUBJECT_DEFAULTS.get(subtype)
+ bindings = get_bindings(link_opts, _rcv._queue, _rcv.name, subject)
+ if not bindings:
+ sst.write_cmd(ExchangeBind(_rcv._queue, _rcv.name, subject))
+
+ elif type == "queue":
+ _rcv._queue = _rcv.name
+ if _rcv.options.get("mode", "consume") == "browse":
+ acq_mode = acquire_mode.not_acquired
+ bindings = get_bindings(link_opts, queue=_rcv._queue)
+
+
+ sst.write_cmds(bindings)
+ sst.write_cmd(MessageSubscribe(queue=_rcv._queue,
+ destination=_rcv.destination,
+ acquire_mode = acq_mode,
+ accept_mode = rcv._accept_mode),
+ overrides=subscribe)
+ sst.write_cmd(MessageSetFlowMode(_rcv.destination, flow_mode.credit), action)
+
+ def do_unlink(self, sst, rcv, _rcv, action=noop):
+ link_opts = _rcv.options.get("link", {})
+ reliability = link_opts.get("reliability")
+ cmds = [MessageCancel(_rcv.destination)]
+ cmds.extend(_rcv.on_unlink)
+ msgs = [] #release back messages for the closing receiver
+ msg = rcv.session._pop(rcv)
+ while msg is not None:
+ msgs.append(msg)
+ msg = rcv.session._pop(rcv)
+ if len(msgs) > 0:
+ ids = RangedSet(*[m._transfer_id for m in msgs])
+ log.debug("releasing back messages: %s, as receiver is closing", ids)
+ cmds.append(MessageRelease(ids, True))
+ sst.write_cmds(cmds, action)
+
+ def del_link(self, sst, rcv, _rcv):
+ del sst.destinations[_rcv.destination]
+
+class LinkOut:
+
+ ADDR_NAME = "target"
+ DIR_NAME = "sender"
+ VALIDATOR = Map(TARGET_OPTS)
+
+ def init_link(self, sst, snd, _snd):
+ _snd.closing = False
+ _snd.pre_ack = False
+
+ def do_link(self, sst, snd, _snd, type, subtype, action):
+ link_opts = _snd.options.get("link", {})
+ reliability = link_opts.get("reliability", "at-least-once")
+ _snd.pre_ack = reliability in ("unreliable", "at-most-once")
+ if type == "topic":
+ _snd._exchange = _snd.name
+ _snd._routing_key = _snd.subject
+ bindings = get_bindings(link_opts, exchange=_snd.name, key=_snd.subject)
+ elif type == "queue":
+ _snd._exchange = ""
+ _snd._routing_key = _snd.name
+ bindings = get_bindings(link_opts, queue=_snd.name)
+ sst.write_cmds(bindings, action)
+
+ def do_unlink(self, sst, snd, _snd, action=noop):
+ action()
+
+ def del_link(self, sst, snd, _snd):
+ pass
+
+class Cache:
+
+ def __init__(self, ttl):
+ self.ttl = ttl
+ self.entries = {}
+
+ def __setitem__(self, key, value):
+ self.entries[key] = time.time(), value
+
+ def __getitem__(self, key):
+ tstamp, value = self.entries[key]
+ if time.time() - tstamp >= self.ttl:
+ del self.entries[key]
+ raise KeyError(key)
+ else:
+ return value
+
+ def __delitem__(self, key):
+ del self.entries[key]
+
+# XXX
+HEADER="!4s4B"
+
+EMPTY_DP = DeliveryProperties()
+EMPTY_MP = MessageProperties()
+
+SUBJECT = "qpid.subject"
+
+CLOSED = "CLOSED"
+READ_ONLY = "READ_ONLY"
+WRITE_ONLY = "WRITE_ONLY"
+OPEN = "OPEN"
+
+class Driver:
+
+ def __init__(self, connection):
+ self.connection = connection
+ self.log_id = "%x" % id(self.connection)
+ self._lock = self.connection._lock
+
+ self._selector = Selector.default()
+ self._attempts = 0
+ self._delay = self.connection.reconnect_interval_min
+ self._reconnect_log = self.connection.reconnect_log
+ self._host = 0
+ self._retrying = False
+ self._next_retry = None
+ self._transport = None
+
+ self._timeout = None
+
+ self.engine = None
+
+ def _next_host(self):
+ urls = [URL(u) for u in self.connection.reconnect_urls]
+ hosts = [(self.connection.host, default(self.connection.port, 5672))] + \
+ [(u.host, default(u.port, 5672)) for u in urls]
+ if self._host >= len(hosts):
+ self._host = 0
+ self._last_host = hosts[self._host]
+ if self._host == 0:
+ self._attempts += 1
+ self._host = self._host + 1
+ return self._last_host
+
+ def _num_hosts(self):
+ return len(self.connection.reconnect_urls) + 1
+
+ @synchronized
+ def wakeup(self):
+ self.dispatch()
+ self._selector.wakeup()
+
+ def start(self):
+ self._selector.register(self)
+
+ def stop(self):
+ self._selector.unregister(self)
+ if self._transport:
+ self.st_closed()
+
+ def fileno(self):
+ return self._transport.fileno()
+
+ @synchronized
+ def reading(self):
+ return self._transport is not None and \
+ self._transport.reading(True)
+
+ @synchronized
+ def writing(self):
+ return self._transport is not None and \
+ self._transport.writing(self.engine.pending())
+
+ @synchronized
+ def timing(self):
+ return self._timeout
+
+ def _check_retry_ok(self):
+ """We consider a reconnect to have suceeded only when we have received
+ open-ok from the peer.
+
+ If we declared success as soon as the transport connected, then we could get
+ into an infinite heartbeat loop if the remote process is hung and never
+ sends us any data. We would fail the connection after 2 missed heartbeats,
+ reconnect the transport, declare the reconnect ok, then fail again after 2
+ missed heartbeats and so on.
+ """
+ if self._retrying and self.engine._connected: # Means we have received open-ok.
+ if self._reconnect_log:
+ log.warn("reconnect succeeded: %s:%s", *self._last_host)
+ self._next_retry = None
+ self._attempts = 0
+ self._delay = self.connection.reconnect_interval_min
+ self._retrying = False
+
+ @synchronized
+ def readable(self):
+ try:
+ data = self._transport.recv(64*1024)
+ if data is None:
+ return
+ elif data:
+ rawlog.debug("READ[%s]: %r", self.log_id, data)
+ self.engine.write(data)
+ self._check_retry_ok()
+ else:
+ self.close_engine()
+ except socket.error, e:
+ self.close_engine(ConnectionError(text=str(e)))
+
+ self.update_status()
+
+ self._notify()
+
+ def _notify(self):
+ if self.connection.error:
+ self.connection._condition.gc()
+ self.connection._waiter.notifyAll()
+
+ def close_engine(self, e=None):
+ if e is None:
+ e = ConnectionError(text="connection aborted")
+
+ if (self.connection.reconnect and
+ (self.connection.reconnect_limit is None or
+ self.connection.reconnect_limit <= 0 or
+ self._attempts <= self.connection.reconnect_limit)):
+ if self._host < self._num_hosts():
+ delay = 0
+ else:
+ delay = self._delay
+ self._delay = min(2*self._delay,
+ self.connection.reconnect_interval_max)
+ self._next_retry = time.time() + delay
+ if self._reconnect_log:
+ log.warn("recoverable error[attempt %s]: %s" % (self._attempts, e))
+ if delay > 0:
+ log.warn("sleeping %s seconds" % delay)
+ self._retrying = True
+ self.engine.close()
+ else:
+ self.engine.close(e)
+
+ self.schedule()
+
+ def update_status(self):
+ if not self.engine: return False
+ status = self.engine.status()
+ return getattr(self, "st_%s" % status.lower())()
+
+ def st_closed(self):
+ # XXX: this log statement seems to sometimes hit when the socket is not connected
+ # XXX: rawlog.debug("CLOSE[%s]: %s", self.log_id, self._socket.getpeername())
+ if self._transport: self._transport.close()
+ self._transport = None
+ self.engine = None
+ return True
+
+ def st_open(self):
+ return False
+
+ @synchronized
+ def writeable(self):
+ notify = False
+ try:
+ n = self._transport.send(self.engine.peek())
+ if n == 0: return
+ sent = self.engine.read(n)
+ rawlog.debug("SENT[%s]: %r", self.log_id, sent)
+ except socket.error, e:
+ self.close_engine(e)
+ notify = True
+
+ if self.update_status() or notify:
+ self._notify()
+
+ @synchronized
+ def timeout(self):
+ self.dispatch()
+ self.update_status()
+ self._notify()
+ self.schedule()
+
+ def schedule(self):
+ times = []
+ if self.connection.heartbeat:
+ times.append(time.time() + self.connection.heartbeat)
+ if self._next_retry:
+ times.append(self._next_retry)
+ if times:
+ self._timeout = min(times)
+ else:
+ self._timeout = None
+
+ def dispatch(self):
+ try:
+ if self._transport is None:
+ if self.connection._connected and not self.connection.error:
+ self.connect()
+ else:
+ self.engine.dispatch()
+ except HeartbeatTimeout, e:
+ self.close_engine(e)
+ except ContentError, e:
+ msg = compat.format_exc()
+ self.connection.error = ContentError(text=msg)
+ except:
+ # XXX: Does socket get leaked if this occurs?
+ msg = compat.format_exc()
+ self.connection.error = InternalError(text=msg)
+
+ def connect(self):
+ if self._retrying and time.time() < self._next_retry:
+ return
+
+ try:
+ # XXX: should make this non blocking
+ host, port = self._next_host()
+ if self._retrying and self._reconnect_log:
+ log.warn("trying: %s:%s", host, port)
+ self.engine = Engine(self.connection)
+ self.engine.open()
+ rawlog.debug("OPEN[%s]: %s:%s", self.log_id, host, port)
+ trans = transports.TRANSPORTS.get(self.connection.transport)
+ if trans:
+ self._transport = trans(self.connection, host, port)
+ else:
+ raise ConnectError("no such transport: %s" % self.connection.transport)
+ self.schedule()
+ except socket.error, e:
+ self.close_engine(ConnectError(text=str(e)))
+
+DEFAULT_DISPOSITION = Disposition(None)
+
+def get_bindings(opts, queue=None, exchange=None, key=None):
+ bindings = opts.get("x-bindings", [])
+ cmds = []
+ for b in bindings:
+ exchange = b.get("exchange", exchange)
+ queue = b.get("queue", queue)
+ key = b.get("key", key)
+ args = b.get("arguments", {})
+ cmds.append(ExchangeBind(queue, exchange, key, args))
+ return cmds
+
+CONNECTION_ERRS = {
+ # anythong not here (i.e. everything right now) will default to
+ # connection error
+ }
+
+SESSION_ERRS = {
+ # anything not here will default to session error
+ error_code.unauthorized_access: UnauthorizedAccess,
+ error_code.not_found: NotFound,
+ error_code.resource_locked: ReceiverError,
+ error_code.resource_limit_exceeded: TargetCapacityExceeded,
+ error_code.internal_error: ServerError
+ }
+
+class Engine:
+
+ def __init__(self, connection):
+ self.connection = connection
+ self.log_id = "%x" % id(self.connection)
+ self._closing = False
+ self._connected = False
+ self._reconnecting = bool(connection.sessions)
+ self._attachments = {}
+
+ self._in = LinkIn()
+ self._out = LinkOut()
+
+ self._channel_max = 65536
+ self._channels = 0
+ self._sessions = {}
+
+ self.address_cache = Cache(self.connection.address_ttl)
+
+ self._status = CLOSED
+ self._buf = ""
+ self._hdr = ""
+ # Set _last_in and _last_out here so heartbeats will be timed from the
+ # beginning of connection if no data is sent/received.
+ self._last_in = time.time()
+ self._last_out = time.time()
+ self._op_enc = OpEncoder()
+ self._seg_enc = SegmentEncoder()
+ self._frame_enc = FrameEncoder()
+ self._frame_dec = FrameDecoder()
+ self._seg_dec = SegmentDecoder()
+ self._op_dec = OpDecoder()
+
+ self._sasl = sasl.Client()
+ if self.connection.username:
+ self._sasl.setAttr("username", self.connection.username)
+ if self.connection.password:
+ self._sasl.setAttr("password", self.connection.password)
+ if self.connection.host:
+ self._sasl.setAttr("host", self.connection.host)
+ self._sasl.setAttr("service", self.connection.sasl_service)
+ if self.connection.sasl_min_ssf is not None:
+ self._sasl.setAttr("minssf", self.connection.sasl_min_ssf)
+ if self.connection.sasl_max_ssf is not None:
+ self._sasl.setAttr("maxssf", self.connection.sasl_max_ssf)
+ self._sasl.init()
+ self._sasl_encode = False
+ self._sasl_decode = False
+
+ def _reset(self):
+ self.connection._transport_connected = False
+
+ for ssn in self.connection.sessions.values():
+ for m in ssn.acked + ssn.unacked + ssn.incoming:
+ m._transfer_id = None
+ for snd in ssn.senders:
+ snd.linked = False
+ for rcv in ssn.receivers:
+ rcv.impending = rcv.received
+ rcv.linked = False
+
+ def status(self):
+ return self._status
+
+ def write(self, data):
+ self._last_in = time.time()
+ try:
+ if self._sasl_decode:
+ data = self._sasl.decode(data)
+
+ if len(self._hdr) < 8:
+ r = 8 - len(self._hdr)
+ self._hdr += data[:r]
+ data = data[r:]
+
+ if len(self._hdr) == 8:
+ self.do_header(self._hdr)
+
+ self._frame_dec.write(data)
+ self._seg_dec.write(*self._frame_dec.read())
+ self._op_dec.write(*self._seg_dec.read())
+ for op in self._op_dec.read():
+ self.assign_id(op)
+ opslog.debug("RCVD[%s]: %r", self.log_id, op)
+ op.dispatch(self)
+ self.dispatch()
+ except MessagingError, e:
+ self.close(e)
+ except:
+ self.close(InternalError(text=compat.format_exc()))
+
+ def close(self, e=None):
+ self._reset()
+ # We cannot re-establish transactional sessions, they must be aborted.
+ # We could re-do transactional enqueues, but not dequeues.
+ for ssn in self.connection.sessions.values():
+ if ssn.transactional:
+ if ssn.committing:
+ ssn.error = TransactionUnknown(text="Transaction outcome unknown due to transport failure")
+ else:
+ ssn.error = TransactionAborted(text="Transaction aborted due to transport failure")
+ ssn.closed = True
+ if e:
+ self.connection.error = e
+ self._status = CLOSED
+
+ def assign_id(self, op):
+ if isinstance(op, Command):
+ sst = self.get_sst(op)
+ op.id = sst.received
+ sst.received += 1
+
+ def pending(self):
+ return len(self._buf)
+
+ def read(self, n):
+ result = self._buf[:n]
+ self._buf = self._buf[n:]
+ return result
+
+ def peek(self):
+ return self._buf
+
+ def write_op(self, op):
+ opslog.debug("SENT[%s]: %r", self.log_id, op)
+ self._op_enc.write(op)
+ self._seg_enc.write(*self._op_enc.read())
+ self._frame_enc.write(*self._seg_enc.read())
+ bytes = self._frame_enc.read()
+ if self._sasl_encode:
+ bytes = self._sasl.encode(bytes)
+ self._buf += bytes
+ self._last_out = time.time()
+
+ def do_header(self, hdr):
+ cli_major = 0; cli_minor = 10
+ magic, _, _, major, minor = struct.unpack(HEADER, hdr)
+ if major != cli_major or minor != cli_minor:
+ raise VersionError(text="client: %s-%s, server: %s-%s" %
+ (cli_major, cli_minor, major, minor))
+
+ def do_connection_start(self, start):
+ if self.connection.sasl_mechanisms:
+ permitted = self.connection.sasl_mechanisms.split()
+ mechs = [m for m in start.mechanisms if m in permitted]
+ else:
+ mechs = start.mechanisms
+ try:
+ mech, initial = self._sasl.start(" ".join(mechs))
+ except sasl.SASLError, e:
+ if "ANONYMOUS" not in mechs and self.connection.username is None:
+ _text="Anonymous connections disabled, missing credentials"
+ else:
+ _text=str(e)
+ raise AuthenticationFailure(text=_text)
+
+ client_properties = get_client_properties_with_defaults(provided_client_properties=self.connection.client_properties);
+ self.write_op(ConnectionStartOk(client_properties=client_properties,
+ mechanism=mech, response=initial))
+
+ def do_connection_secure(self, secure):
+ resp = self._sasl.step(secure.challenge)
+ self.write_op(ConnectionSecureOk(response=resp))
+
+ def do_connection_tune(self, tune):
+ # XXX: is heartbeat protocol specific?
+ if tune.channel_max is not None:
+ self.channel_max = tune.channel_max
+ self.write_op(ConnectionTuneOk(heartbeat=self.connection.heartbeat,
+ channel_max=self.channel_max))
+ self.write_op(ConnectionOpen())
+ self._sasl_encode = True
+
+ def do_connection_open_ok(self, open_ok):
+ self.connection.auth_username = self._sasl.auth_username()
+ self._connected = True
+ self._sasl_decode = True
+ self.connection._transport_connected = True
+
+ def do_connection_heartbeat(self, hrt):
+ pass
+
+ def do_connection_close(self, close):
+ self.write_op(ConnectionCloseOk())
+ if close.reply_code != close_code.normal:
+ exc = CONNECTION_ERRS.get(close.reply_code, ConnectionError)
+ self.connection.error = exc(close.reply_code, close.reply_text)
+ # XXX: should we do a half shutdown on the socket here?
+ # XXX: we really need to test this, we may end up reporting a
+ # connection abort after this, if we were to do a shutdown on read
+ # and stop reading, then we wouldn't report the abort, that's
+ # probably the right thing to do
+
+ def do_connection_close_ok(self, close_ok):
+ self.close()
+
+ def do_session_attached(self, atc):
+ pass
+
+ def do_session_command_point(self, cp):
+ sst = self.get_sst(cp)
+ sst.received = cp.command_id
+
+ def do_session_completed(self, sc):
+ sst = self.get_sst(sc)
+ for r in sc.commands:
+ sst.acknowledged.add(r.lower, r.upper)
+
+ if not sc.commands.empty():
+ while sst.min_completion in sc.commands:
+ if sst.actions.has_key(sst.min_completion):
+ sst.actions.pop(sst.min_completion)()
+ sst.min_completion += 1
+
+ def session_known_completed(self, kcmp):
+ sst = self.get_sst(kcmp)
+ executed = RangedSet()
+ for e in sst.executed.ranges:
+ for ke in kcmp.ranges:
+ if e.lower in ke and e.upper in ke:
+ break
+ else:
+ executed.add_range(e)
+ sst.executed = completed
+
+ def do_session_flush(self, sf):
+ sst = self.get_sst(sf)
+ if sf.expected:
+ if sst.received is None:
+ exp = None
+ else:
+ exp = RangedSet(sst.received)
+ sst.write_op(SessionExpected(exp))
+ if sf.confirmed:
+ sst.write_op(SessionConfirmed(sst.executed))
+ if sf.completed:
+ sst.write_op(SessionCompleted(sst.executed))
+
+ def do_session_request_timeout(self, rt):
+ sst = self.get_sst(rt)
+ sst.write_op(SessionTimeout(timeout=0))
+
+ def do_execution_result(self, er):
+ sst = self.get_sst(er)
+ sst.results[er.command_id] = er.value
+ sst.executed.add(er.id)
+
+ def do_execution_exception(self, ex):
+ sst = self.get_sst(ex)
+ exc = SESSION_ERRS.get(ex.error_code, SessionError)
+ sst.session.error = exc(ex.error_code, ex.description)
+
+ def dispatch(self):
+ if not self.connection._connected and not self._closing and self._status != CLOSED:
+ self.disconnect()
+
+ if self._connected and not self._closing:
+ for ssn in self.connection.sessions.values():
+ self.attach(ssn)
+ self.process(ssn)
+
+ # We need to check heartbeat even if not self._connected since we may have
+ # heartbeat timeout before receiving an open-ok
+ if self.connection.heartbeat and self._status != CLOSED and not self._closing:
+ now = time.time()
+ if now - self._last_in > 2*self.connection.heartbeat:
+ raise HeartbeatTimeout(text="heartbeat timeout")
+ # Only send heartbeats if we are connected.
+ if self._connected and now - self._last_out >= self.connection.heartbeat/2.0:
+ self.write_op(ConnectionHeartbeat())
+
+ def open(self):
+ self._reset()
+ self._status = OPEN
+ self._buf += struct.pack(HEADER, "AMQP", 1, 1, 0, 10)
+
+ def disconnect(self):
+ self.write_op(ConnectionClose(close_code.normal))
+ self._closing = True
+
+ def attach(self, ssn):
+ if ssn.closed: return
+ sst = self._attachments.get(ssn)
+ if sst is None:
+ for i in xrange(0, self.channel_max):
+ if not self._sessions.has_key(i):
+ ch = i
+ break
+ else:
+ raise RuntimeError("all channels used")
+ sst = SessionState(self, ssn, ssn.name, ch)
+ sst.write_op(SessionAttach(name=ssn.name, force=self._reconnecting))
+ sst.write_op(SessionCommandPoint(sst.sent, 0))
+ self._reconnecting = False
+ sst.outgoing_idx = 0
+ sst.acked = []
+ sst.acked_idx = 0
+ if ssn.transactional:
+ sst.write_cmd(TxSelect())
+ self._attachments[ssn] = sst
+ self._sessions[sst.channel] = sst
+
+ for snd in ssn.senders:
+ self.link(snd, self._out, snd.target)
+ for rcv in ssn.receivers:
+ self.link(rcv, self._in, rcv.source)
+
+ if sst is not None and ssn.closing and not sst.detached:
+ sst.detached = True
+ sst.write_op(SessionDetach(name=ssn.name))
+
+ def get_sst(self, op):
+ return self._sessions[op.channel]
+
+ def do_session_detached(self, dtc):
+ sst = self._sessions.pop(dtc.channel)
+ ssn = sst.session
+ del self._attachments[ssn]
+ ssn.closed = True
+
+ def do_session_detach(self, dtc):
+ sst = self.get_sst(dtc)
+ sst.write_op(SessionDetached(name=dtc.name))
+ self.do_session_detached(dtc)
+
+ def link(self, lnk, dir, addr):
+ sst = self._attachments.get(lnk.session)
+ _lnk = self._attachments.get(lnk)
+
+ if _lnk is None and not lnk.closed:
+ _lnk = Attachment(lnk)
+ _lnk.closing = False
+ dir.init_link(sst, lnk, _lnk)
+
+ err = self.parse_address(_lnk, dir, addr) or self.validate_options(_lnk, dir)
+ if err:
+ lnk.error = err
+ lnk.closed = True
+ return
+
+ def linked():
+ lnk.linked = True
+
+ def resolved(type, subtype):
+ dir.do_link(sst, lnk, _lnk, type, subtype, linked)
+
+ self.resolve_declare(sst, _lnk, dir.DIR_NAME, resolved)
+ self._attachments[lnk] = _lnk
+
+ if lnk.linked and lnk.closing and not lnk.closed:
+ if not _lnk.closing:
+ def unlinked():
+ dir.del_link(sst, lnk, _lnk)
+ del self._attachments[lnk]
+ lnk.closed = True
+ if _lnk.options.get("delete") in ("always", dir.DIR_NAME):
+ dir.do_unlink(sst, lnk, _lnk)
+ requested_type = _lnk.options.get("node", {}).get("type")
+ self.delete(sst, _lnk.name, unlinked, node_type=requested_type)
+ else:
+ dir.do_unlink(sst, lnk, _lnk, unlinked)
+ _lnk.closing = True
+ elif not lnk.linked and lnk.closing and not lnk.closed:
+ if lnk.error: lnk.closed = True
+
+ def parse_address(self, lnk, dir, addr):
+ if addr is None:
+ return MalformedAddress(text="%s is None" % dir.ADDR_NAME)
+ else:
+ try:
+ lnk.name, lnk.subject, lnk.options = address.parse(addr)
+ # XXX: subject
+ if lnk.options is None:
+ lnk.options = {}
+ if isinstance(addr, MangledString):
+ lnk.options['create'] = "always"
+ if 'node' not in lnk.options:
+ lnk.options['node'] = {}
+ if 'x-declare' not in lnk.options['node']:
+ lnk.options['node']['x-declare'] = {}
+ xdeclare = lnk.options['node']['x-declare']
+ if 'auto-delete' not in xdeclare:
+ xdeclare['auto-delete'] = "True"
+ if 'exclusive' not in xdeclare:
+ xdeclare['exclusive'] = "True"
+ except address.LexError, e:
+ return MalformedAddress(text=str(e))
+ except address.ParseError, e:
+ return MalformedAddress(text=str(e))
+
+ def validate_options(self, lnk, dir):
+ ctx = Context()
+ err = dir.VALIDATOR.validate(lnk.options, ctx)
+ if err: return InvalidOption(text="error in options: %s" % err)
+
+ def resolve_declare(self, sst, lnk, dir, action):
+ declare = lnk.options.get("create") in ("always", dir)
+ assrt = lnk.options.get("assert") in ("always", dir)
+ requested_type = lnk.options.get("node", {}).get("type")
+ def do_resolved(type, subtype):
+ err = None
+ if type is None:
+ if declare:
+ err = self.declare(sst, lnk, action, True)
+ else:
+ err = NotFound(text="no such %s: %s" % (requested_type or "queue", lnk.name))
+ else:
+ if assrt:
+ expected = lnk.options.get("node", {}).get("type")
+ if expected and type != expected:
+ if declare:
+ err = self.declare(sst, lnk, action, True)
+ else:
+ err = AssertionFailed(text="expected %s, got %s" % (expected, type))
+ if "node" in lnk.options and "x-bindings" in lnk.options["node"]:
+ err = self.declare(sst, lnk, action, False)
+ if err is None:
+ action(type, subtype)
+
+ if err:
+ tgt = lnk.target
+ tgt.error = err
+ del self._attachments[tgt]
+ tgt.closed = True
+ return
+ self.resolve(sst, lnk.name, do_resolved, node_type=requested_type, force=declare)
+
+ def resolve(self, sst, name, action, force=False, node_type=None, delete=False):
+ if not force and not node_type:
+ try:
+ type, subtype = self.address_cache[name]
+ action(type, subtype)
+ return
+ except KeyError:
+ pass
+
+ args = { "topic":None, "queue":None }
+ def do_result(r, obj):
+ args[obj] = r
+ def do_action():
+ er = args["topic"]
+ qr = args["queue"]
+ if node_type == "topic" and er and not er.not_found:
+ type, subtype = "topic", er.type
+ elif node_type == "queue" and qr and qr.queue:
+ type, subtype = "queue", None
+ elif (er and er.not_found) and qr and not qr.queue:
+ type, subtype = None, None
+ elif (qr and qr.queue):
+ if node_type == "topic" and force:
+ type, subtype = None, None
+ else:
+ type, subtype = "queue", None
+ elif (er and not er.not_found):
+ if node_type == "queue" and force:
+ type, subtype = None, None
+ else:
+ type, subtype = "topic", er.type
+ elif er:
+ if er.not_found:
+ type, subtype = None, None
+ else:
+ type, subtype = "topic", er.type
+ else:
+ type, subtype = None, None
+ if type is not None:
+ self.address_cache[name] = (type, subtype)
+ action(type, subtype)
+ def do_result_and_action(r, obj):
+ do_result(r, obj)
+ do_action()
+ if (node_type is None): # we don't know the type, let check broker
+ sst.write_query(ExchangeQuery(name), do_result, "topic")
+ sst.write_query(QueueQuery(name), do_result_and_action, "queue")
+ elif force and not delete: # we forcefully declare known type, dont ask broker
+ do_action()
+ elif node_type == "topic":
+ sst.write_query(ExchangeQuery(name), do_result_and_action, "topic")
+ else:
+ sst.write_query(QueueQuery(name), do_result_and_action, "queue")
+
+ def declare(self, sst, lnk, action, create_node):
+ name = lnk.name
+ props = lnk.options.get("node", {})
+ durable = props.get("durable", DURABLE_DEFAULT)
+ type = props.get("type", "queue")
+ declare = props.get("x-declare", {})
+
+ cmd = None
+ if type == "topic":
+ if create_node: cmd = ExchangeDeclare(exchange=name, durable=durable)
+ bindings = get_bindings(props, exchange=name)
+ elif type == "queue":
+ if create_node: cmd = QueueDeclare(queue=name, durable=durable)
+ bindings = get_bindings(props, queue=name)
+ else:
+ raise ValueError(type)
+
+ if cmd is not None:
+ sst.apply_overrides(cmd, declare)
+ if type == "topic":
+ if cmd.type is None:
+ cmd.type = "topic"
+ subtype = cmd.type
+ else:
+ subtype = None
+ cmds = [cmd]
+ else:
+ cmds = []
+
+ cmds.extend(bindings)
+
+ def declared():
+ if create_node:
+ self.address_cache[name] = (type, subtype)
+ action(type, subtype)
+
+ sst.write_cmds(cmds, declared)
+
+ def delete(self, sst, name, action, node_type=None):
+ def deleted():
+ del self.address_cache[name]
+ action()
+
+ def do_delete(type, subtype):
+ if type == "topic":
+ sst.write_cmd(ExchangeDelete(name), deleted)
+ elif type == "queue":
+ sst.write_cmd(QueueDelete(name), deleted)
+ elif type is None:
+ action()
+ else:
+ raise ValueError(type)
+ self.resolve(sst, name, do_delete, force=True, node_type=node_type, delete=True)
+
+ def process(self, ssn):
+ if ssn.closed or ssn.closing: return
+
+ sst = self._attachments[ssn]
+
+ while sst.outgoing_idx < len(ssn.outgoing):
+ msg = ssn.outgoing[sst.outgoing_idx]
+ snd = msg._sender
+ # XXX: should check for sender error here
+ _snd = self._attachments.get(snd)
+ if _snd and snd.linked:
+ self.send(snd, msg)
+ sst.outgoing_idx += 1
+ else:
+ break
+
+ for snd in ssn.senders:
+ # XXX: should included snd.acked in this
+ if snd.synced >= snd.queued and sst.need_sync:
+ sst.write_cmd(ExecutionSync(), sync_noop)
+
+ for rcv in ssn.receivers:
+ self.process_receiver(rcv)
+
+ if ssn.acked:
+ messages = ssn.acked[sst.acked_idx:]
+ if messages:
+ ids = RangedSet()
+
+ disposed = [(DEFAULT_DISPOSITION, [])]
+ acked = []
+ for m in messages:
+ # XXX: we're ignoring acks that get lost when disconnected,
+ # could we deal this via some message-id based purge?
+ if m._transfer_id is None:
+ acked.append(m)
+ continue
+ ids.add(m._transfer_id)
+ if m._receiver._accept_mode is accept_mode.explicit:
+ disp = m._disposition or DEFAULT_DISPOSITION
+ last, msgs = disposed[-1]
+ if disp.type is last.type and disp.options == last.options:
+ msgs.append(m)
+ else:
+ disposed.append((disp, [m]))
+ else:
+ acked.append(m)
+
+ for range in ids:
+ sst.executed.add_range(range)
+ sst.write_op(SessionCompleted(sst.executed))
+
+ def ack_acker(msgs):
+ def ack_ack():
+ for m in msgs:
+ ssn.acked.remove(m)
+ sst.acked_idx -= 1
+ # XXX: should this check accept_mode too?
+ if not ssn.transactional:
+ sst.acked.remove(m)
+ return ack_ack
+
+ for disp, msgs in disposed:
+ if not msgs: continue
+ if disp.type is None:
+ op = MessageAccept
+ elif disp.type is RELEASED:
+ op = MessageRelease
+ elif disp.type is REJECTED:
+ op = MessageReject
+ sst.write_cmd(op(RangedSet(*[m._transfer_id for m in msgs]),
+ **disp.options),
+ ack_acker(msgs))
+ if log.isEnabledFor(DEBUG):
+ for m in msgs:
+ log.debug("SACK[%s]: %s, %s", ssn.log_id, m, m._disposition)
+
+ sst.acked.extend(messages)
+ sst.acked_idx += len(messages)
+ ack_acker(acked)()
+
+ if ssn.committing and not sst.committing:
+ def commit_ok():
+ del sst.acked[:]
+ ssn.committing = False
+ ssn.committed = True
+ ssn.aborting = False
+ ssn.aborted = False
+ sst.committing = False
+ sst.write_cmd(TxCommit(), commit_ok)
+ sst.committing = True
+
+ if ssn.aborting and not sst.aborting:
+ sst.aborting = True
+ def do_rb():
+ messages = sst.acked + ssn.unacked + ssn.incoming
+ ids = RangedSet(*[m._transfer_id for m in messages])
+ for range in ids:
+ sst.executed.add_range(range)
+ sst.write_op(SessionCompleted(sst.executed))
+ sst.write_cmd(MessageRelease(ids, True))
+ sst.write_cmd(TxRollback(), do_rb_ok)
+
+ def do_rb_ok():
+ del ssn.incoming[:]
+ del ssn.unacked[:]
+ del sst.acked[:]
+
+ for rcv in ssn.receivers:
+ rcv.impending = rcv.received
+ rcv.returned = rcv.received
+ # XXX: do we need to update granted here as well?
+
+ for rcv in ssn.receivers:
+ self.process_receiver(rcv)
+
+ ssn.aborting = False
+ ssn.aborted = True
+ ssn.committing = False
+ ssn.committed = False
+ sst.aborting = False
+
+ for rcv in ssn.receivers:
+ _rcv = self._attachments[rcv]
+ sst.write_cmd(MessageStop(_rcv.destination))
+ sst.write_cmd(ExecutionSync(), do_rb)
+
+ def grant(self, rcv):
+ sst = self._attachments[rcv.session]
+ _rcv = self._attachments.get(rcv)
+ if _rcv is None or not rcv.linked or _rcv.closing or _rcv.draining:
+ return
+
+ if rcv.granted is UNLIMITED:
+ if rcv.impending is UNLIMITED:
+ delta = 0
+ else:
+ delta = UNLIMITED
+ elif rcv.impending is UNLIMITED:
+ delta = -1
+ else:
+ delta = max(rcv.granted, rcv.received) - rcv.impending
+
+ if delta is UNLIMITED:
+ if not _rcv.bytes_open:
+ sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.byte, UNLIMITED.value))
+ _rcv.bytes_open = True
+ sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.message, UNLIMITED.value))
+ rcv.impending = UNLIMITED
+ elif delta > 0:
+ if not _rcv.bytes_open:
+ sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.byte, UNLIMITED.value))
+ _rcv.bytes_open = True
+ sst.write_cmd(MessageFlow(_rcv.destination, credit_unit.message, delta))
+ rcv.impending += delta
+ elif delta < 0 and not rcv.draining:
+ _rcv.draining = True
+ def do_stop():
+ rcv.impending = rcv.received
+ _rcv.draining = False
+ _rcv.bytes_open = False
+ self.grant(rcv)
+ sst.write_cmd(MessageStop(_rcv.destination), do_stop)
+
+ if rcv.draining:
+ _rcv.draining = True
+ def do_flush():
+ rcv.impending = rcv.received
+ rcv.granted = rcv.impending
+ _rcv.draining = False
+ _rcv.bytes_open = False
+ rcv.draining = False
+ sst.write_cmd(MessageFlush(_rcv.destination), do_flush)
+
+
+ def process_receiver(self, rcv):
+ if rcv.closed: return
+ self.grant(rcv)
+
+ def send(self, snd, msg):
+ sst = self._attachments[snd.session]
+ _snd = self._attachments[snd]
+
+ if msg.subject is None or _snd._exchange == "":
+ rk = _snd._routing_key
+ else:
+ rk = msg.subject
+
+ if msg.subject is None:
+ subject = _snd.subject
+ else:
+ subject = msg.subject
+
+ # XXX: do we need to query to figure out how to create the reply-to interoperably?
+ if msg.reply_to:
+ rt = addr2reply_to(msg.reply_to)
+ else:
+ rt = None
+ content_encoding = msg.properties.get("x-amqp-0-10.content-encoding")
+ dp = DeliveryProperties(routing_key=rk)
+ mp = MessageProperties(message_id=msg.id,
+ user_id=msg.user_id,
+ reply_to=rt,
+ correlation_id=msg.correlation_id,
+ app_id = msg.properties.get("x-amqp-0-10.app-id"),
+ content_type=msg.content_type,
+ content_encoding=content_encoding,
+ application_headers=msg.properties)
+ if subject is not None:
+ if mp.application_headers is None:
+ mp.application_headers = {}
+ mp.application_headers[SUBJECT] = subject
+ if msg.durable is not None:
+ if msg.durable:
+ dp.delivery_mode = delivery_mode.persistent
+ else:
+ dp.delivery_mode = delivery_mode.non_persistent
+ if msg.priority is not None:
+ dp.priority = msg.priority
+ if msg.ttl is not None:
+ dp.ttl = long(msg.ttl*1000)
+ enc, dec = get_codec(msg.content_type)
+ try:
+ body = enc(msg.content)
+ except AttributeError, e:
+ # convert to non-blocking EncodeError
+ raise EncodeError(e)
+
+ # XXX: this is not safe for out of order, can this be triggered by pre_ack?
+ def msg_acked():
+ # XXX: should we log the ack somehow too?
+ snd.acked += 1
+ m = snd.session.outgoing.pop(0)
+ sst.outgoing_idx -= 1
+ log.debug("RACK[%s]: %s", sst.session.log_id, msg)
+ assert msg == m
+
+ xfr = MessageTransfer(destination=_snd._exchange, headers=(dp, mp),
+ payload=body)
+
+ if _snd.pre_ack:
+ sst.write_cmd(xfr)
+ else:
+ sst.write_cmd(xfr, msg_acked, sync=msg._sync)
+
+ log.debug("SENT[%s]: %s", sst.session.log_id, msg)
+
+ if _snd.pre_ack:
+ msg_acked()
+
+ def do_message_transfer(self, xfr):
+ sst = self.get_sst(xfr)
+ ssn = sst.session
+
+ msg = self._decode(xfr)
+ rcv = sst.destinations[xfr.destination].target
+ msg._receiver = rcv
+ if rcv.closing or rcv.closed: # release message to a closing receiver
+ ids = RangedSet(*[msg._transfer_id])
+ log.debug("releasing back %s message: %s, as receiver is closing", ids, msg)
+ sst.write_cmd(MessageRelease(ids, True))
+ return
+ if rcv.impending is not UNLIMITED:
+ assert rcv.received < rcv.impending, "%s, %s" % (rcv.received, rcv.impending)
+ rcv.received += 1
+ log.debug("RCVD[%s]: %s", ssn.log_id, msg)
+ ssn.message_received(msg)
+
+
+ def _decode(self, xfr):
+ dp = EMPTY_DP
+ mp = EMPTY_MP
+
+ for h in xfr.headers:
+ if isinstance(h, DeliveryProperties):
+ dp = h
+ elif isinstance(h, MessageProperties):
+ mp = h
+
+ ap = mp.application_headers
+ enc, dec = get_codec(mp.content_type)
+ try:
+ content = dec(xfr.payload)
+ except Exception, e:
+ raise DecodeError(e)
+ msg = Message(content)
+ msg.id = mp.message_id
+ if ap is not None:
+ msg.subject = ap.get(SUBJECT)
+ msg.user_id = mp.user_id
+ if mp.reply_to is not None:
+ msg.reply_to = reply_to2addr(mp.reply_to)
+ msg.correlation_id = mp.correlation_id
+ if dp.delivery_mode is not None:
+ msg.durable = dp.delivery_mode == delivery_mode.persistent
+ msg.priority = dp.priority
+ if dp.ttl is not None:
+ msg.ttl = dp.ttl/1000.0
+ msg.redelivered = dp.redelivered
+ msg.properties = mp.application_headers or {}
+ if mp.app_id is not None:
+ msg.properties["x-amqp-0-10.app-id"] = mp.app_id
+ if mp.content_encoding is not None:
+ msg.properties["x-amqp-0-10.content-encoding"] = mp.content_encoding
+ if dp.routing_key is not None:
+ msg.properties["x-amqp-0-10.routing-key"] = dp.routing_key
+ if dp.timestamp is not None:
+ msg.properties["x-amqp-0-10.timestamp"] = dp.timestamp
+ msg.content_type = mp.content_type
+ msg._transfer_id = xfr.id
+ return msg
diff --git a/qpid/python/qpid/messaging/endpoints.py b/qpid/python/qpid/messaging/endpoints.py
new file mode 100644
index 0000000000..2797677b1d
--- /dev/null
+++ b/qpid/python/qpid/messaging/endpoints.py
@@ -0,0 +1,1118 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+A candidate high level messaging API for python.
+
+Areas that still need work:
+
+ - definition of the arguments for L{Session.sender} and L{Session.receiver}
+ - standard L{Message} properties
+ - L{Message} content encoding
+ - protocol negotiation/multiprotocol impl
+"""
+
+from logging import getLogger
+from math import ceil
+from qpid.codec010 import StringCodec
+from qpid.concurrency import synchronized, Waiter, Condition
+from qpid.datatypes import Serial, uuid4
+from qpid.messaging.constants import *
+from qpid.messaging.exceptions import *
+from qpid.messaging.message import *
+from qpid.ops import PRIMITIVE
+from qpid.util import default, URL
+from threading import Thread, RLock
+
+log = getLogger("qpid.messaging")
+
+static = staticmethod
+
+class Endpoint:
+
+ def _ecwait(self, predicate, timeout=None):
+ result = self._ewait(lambda: self.closed or predicate(), timeout)
+ self.check_closed()
+ return result
+
+class Connection(Endpoint):
+
+ """
+ A Connection manages a group of L{Sessions<Session>} and connects
+ them with a remote endpoint.
+ """
+
+ @static
+ def establish(url=None, timeout=None, **options):
+ """
+ Constructs a L{Connection} with the supplied parameters and opens
+ it.
+ """
+ conn = Connection(url, **options)
+ conn.open(timeout=timeout)
+ return conn
+
+ def __init__(self, url=None, **options):
+ """
+ Creates a connection. A newly created connection must be opened
+ with the Connection.open() method before it can be used.
+
+ @type url: str
+ @param url: [ <username> [ / <password> ] @ ] <host> [ : <port> ]
+ @type host: str
+ @param host: the name or ip address of the remote host (overriden by url)
+ @type port: int
+ @param port: the port number of the remote host (overriden by url)
+ @type transport: str
+ @param transport: one of tcp, tcp+tls, or ssl (alias for tcp+tls)
+ @type heartbeat: int
+ @param heartbeat: heartbeat interval in seconds
+
+ @type username: str
+ @param username: the username for authentication (overriden by url)
+ @type password: str
+ @param password: the password for authentication (overriden by url)
+ @type sasl_mechanisms: str
+ @param sasl_mechanisms: space separated list of permitted sasl mechanisms
+ @type sasl_service: str
+ @param sasl_service: the service name if needed by the SASL mechanism in use
+ @type sasl_min_ssf: int
+ @param sasl_min_ssf: the minimum acceptable security strength factor
+ @type sasl_max_ssf: int
+ @param sasl_max_ssf: the maximum acceptable security strength factor
+
+ @type reconnect: bool
+ @param reconnect: enable/disable automatic reconnect
+ @type reconnect_timeout: float
+ @param reconnect_timeout: total time to attempt reconnect
+ @type reconnect_interval_min: float
+ @param reconnect_interval_min: minimum interval between reconnect attempts
+ @type reconnect_interval_max: float
+ @param reconnect_interval_max: maximum interval between reconnect attempts
+ @type reconnect_interval: float
+ @param reconnect_interval: set both min and max reconnect intervals
+ @type reconnect_limit: int
+ @param reconnect_limit: limit the total number of reconnect attempts
+ @type reconnect_urls: list[str]
+ @param reconnect_urls: list of backup hosts specified as urls
+
+ @type address_ttl: float
+ @param address_ttl: time until cached address resolution expires
+
+ @type ssl_keyfile: str
+ @param ssl_keyfile: file with client's private key (PEM format)
+ @type ssl_certfile: str
+ @param ssl_certfile: file with client's public (eventually priv+pub) key (PEM format)
+ @type ssl_trustfile: str
+ @param ssl_trustfile: file trusted certificates to validate the server
+ @type ssl_skip_hostname_check: bool
+ @param ssl_skip_hostname_check: disable verification of hostname in
+ certificate. Use with caution - disabling hostname checking leaves you
+ vulnerable to Man-in-the-Middle attacks.
+
+ @rtype: Connection
+ @return: a disconnected Connection
+ """
+ # List of all attributes
+ opt_keys = ['host', 'transport', 'port', 'heartbeat', 'username', 'password', 'sasl_mechanisms', 'sasl_service', 'sasl_min_ssf', 'sasl_max_ssf', 'reconnect', 'reconnect_timeout', 'reconnect_interval', 'reconnect_interval_min', 'reconnect_interval_max', 'reconnect_limit', 'reconnect_urls', 'reconnect_log', 'address_ttl', 'tcp_nodelay', 'ssl_keyfile', 'ssl_certfile', 'ssl_trustfile', 'ssl_skip_hostname_check', 'client_properties', 'protocol' ]
+ # Create all attributes on self and set to None.
+ for key in opt_keys:
+ setattr(self, key, None)
+ # Get values from options, check for invalid options
+ for (key, value) in options.iteritems():
+ if key in opt_keys:
+ setattr(self, key, value)
+ else:
+ raise ConnectionError("Unknown connection option %s with value %s" %(key, value))
+
+ # Now handle items that need special treatment or have speical defaults:
+ if self.host:
+ url = default(url, self.host)
+ if isinstance(url, basestring):
+ url = URL(url)
+ self.host = url.host
+
+ if self.transport is None:
+ if url.scheme == url.AMQP:
+ self.transport = "tcp"
+ elif url.scheme == url.AMQPS:
+ self.transport = "ssl"
+ else:
+ self.transport = "tcp"
+ if self.transport in ("ssl", "tcp+tls"):
+ self.port = default(url.port, default(self.port, AMQPS_PORT))
+ else:
+ self.port = default(url.port, default(self.port, AMQP_PORT))
+
+ if self.protocol and self.protocol != "amqp0-10":
+ raise ConnectionError("Connection option 'protocol' value '" + value + "' unsupported (must be amqp0-10)")
+
+ self.username = default(url.user, self.username)
+ self.password = default(url.password, self.password)
+ self.auth_username = None
+ self.sasl_service = default(self.sasl_service, "qpidd")
+
+ self.reconnect = default(self.reconnect, False)
+ self.reconnect_interval_min = default(self.reconnect_interval_min,
+ default(self.reconnect_interval, 1))
+ self.reconnect_interval_max = default(self.reconnect_interval_max,
+ default(self.reconnect_interval, 2*60))
+ self.reconnect_urls = default(self.reconnect_urls, [])
+ self.reconnect_log = default(self.reconnect_log, True)
+
+ self.address_ttl = default(self.address_ttl, 60)
+ self.tcp_nodelay = default(self.tcp_nodelay, False)
+
+ self.ssl_keyfile = default(self.ssl_keyfile, None)
+ self.ssl_certfile = default(self.ssl_certfile, None)
+ self.ssl_trustfile = default(self.ssl_trustfile, None)
+ # if ssl_skip_hostname_check was not explicitly set, this will be None
+ self._ssl_skip_hostname_check_actual = options.get("ssl_skip_hostname_check")
+ self.ssl_skip_hostname_check = default(self.ssl_skip_hostname_check, False)
+ self.client_properties = default(self.client_properties, {})
+
+ self.options = options
+
+
+ self.id = str(uuid4())
+ self.session_counter = 0
+ self.sessions = {}
+ self._open = False
+ self._connected = False
+ self._transport_connected = False
+ self._lock = RLock()
+ self._condition = Condition(self._lock)
+ self._waiter = Waiter(self._condition)
+ self._modcount = Serial(0)
+ self.error = None
+ from driver import Driver
+ self._driver = Driver(self)
+
+ def _wait(self, predicate, timeout=None):
+ return self._waiter.wait(predicate, timeout=timeout)
+
+ def _wakeup(self):
+ self._modcount += 1
+ self._driver.wakeup()
+
+ def check_error(self):
+ if self.error:
+ self._condition.gc()
+ e = self.error
+ if isinstance(e, ContentError):
+ """ forget the content error. It will be
+ raised this time but won't block future calls
+ """
+ self.error = None
+ raise e
+
+ def get_error(self):
+ return self.error
+
+ def _ewait(self, predicate, timeout=None):
+ result = self._wait(lambda: self.error or predicate(), timeout)
+ self.check_error()
+ return result
+
+ def check_closed(self):
+ if not self._connected:
+ self._condition.gc()
+ raise ConnectionClosed()
+
+ @synchronized
+ def session(self, name=None, transactional=False):
+ """
+ Creates or retrieves the named session. If the name is omitted or
+ None, then a unique name is chosen based on a randomly generated
+ uuid.
+
+ @type name: str
+ @param name: the session name
+ @rtype: Session
+ @return: the named Session
+ """
+
+ if name is None:
+ name = "%s:%s" % (self.id, self.session_counter)
+ self.session_counter += 1
+ else:
+ name = "%s:%s" % (self.id, name)
+
+ if self.sessions.has_key(name):
+ return self.sessions[name]
+ else:
+ ssn = Session(self, name, transactional)
+ self.sessions[name] = ssn
+ self._wakeup()
+ return ssn
+
+ @synchronized
+ def _remove_session(self, ssn):
+ self.sessions.pop(ssn.name, 0)
+
+ @synchronized
+ def open(self, timeout=None):
+ """
+ Opens a connection.
+ """
+ if self._open:
+ raise ConnectionError("already open")
+ self._open = True
+ if self.reconnect and self.reconnect_timeout > 0:
+ timeout = self.reconnect_timeout
+ self.attach(timeout=timeout)
+
+ @synchronized
+ def opened(self):
+ """
+ Return true if the connection is open, false otherwise.
+ """
+ return self._open
+
+ @synchronized
+ def attach(self, timeout=None):
+ """
+ Attach to the remote endpoint.
+ """
+ if not self._connected:
+ self._connected = True
+ self._driver.start()
+ self._wakeup()
+ if not self._ewait(lambda: self._transport_connected and not self._unlinked(), timeout=timeout):
+ self.reconnect = False
+ raise Timeout("Connection attach timed out")
+
+ def _unlinked(self):
+ return [l
+ for ssn in self.sessions.values()
+ if not (ssn.error or ssn.closed)
+ for l in ssn.senders + ssn.receivers
+ if not (l.linked or l.error or l.closed)]
+
+ @synchronized
+ def detach(self, timeout=None):
+ """
+ Detach from the remote endpoint.
+ """
+ if self._connected:
+ self._connected = False
+ self._wakeup()
+ cleanup = True
+ else:
+ cleanup = False
+ try:
+ if not self._wait(lambda: not self._transport_connected, timeout=timeout):
+ raise Timeout("detach timed out")
+ finally:
+ if cleanup:
+ self._driver.stop()
+ self._condition.gc()
+
+ @synchronized
+ def attached(self):
+ """
+ Return true if the connection is attached, false otherwise.
+ """
+ return self._connected
+
+ @synchronized
+ def close(self, timeout=None):
+ """
+ Close the connection and all sessions.
+ """
+ try:
+ for ssn in self.sessions.values():
+ ssn.close(timeout=timeout)
+ finally:
+ self.detach(timeout=timeout)
+ self._open = False
+
+class Session(Endpoint):
+
+ """
+ Sessions provide a linear context for sending and receiving
+ L{Messages<Message>}. L{Messages<Message>} are sent and received
+ using the L{Sender.send} and L{Receiver.fetch} methods of the
+ L{Sender} and L{Receiver} objects associated with a Session.
+
+ Each L{Sender} and L{Receiver} is created by supplying either a
+ target or source address to the L{sender} and L{receiver} methods of
+ the Session. The address is supplied via a string syntax documented
+ below.
+
+ Addresses
+ =========
+
+ An address identifies a source or target for messages. In its
+ simplest form this is just a name. In general a target address may
+ also be used as a source address, however not all source addresses
+ may be used as a target, e.g. a source might additionally have some
+ filtering criteria that would not be present in a target.
+
+ A subject may optionally be specified along with the name. When an
+ address is used as a target, any subject specified in the address is
+ used as the default subject of outgoing messages for that target.
+ When an address is used as a source, any subject specified in the
+ address is pattern matched against the subject of available messages
+ as a filter for incoming messages from that source.
+
+ The options map contains additional information about the address
+ including:
+
+ - policies for automatically creating, and deleting the node to
+ which an address refers
+
+ - policies for asserting facts about the node to which an address
+ refers
+
+ - extension points that can be used for sender/receiver
+ configuration
+
+ Mapping to AMQP 0-10
+ --------------------
+ The name is resolved to either an exchange or a queue by querying
+ the broker.
+
+ The subject is set as a property on the message. Additionally, if
+ the name refers to an exchange, the routing key is set to the
+ subject.
+
+ Syntax
+ ------
+ The following regular expressions define the tokens used to parse
+ addresses::
+ LBRACE: \\{
+ RBRACE: \\}
+ LBRACK: \\[
+ RBRACK: \\]
+ COLON: :
+ SEMI: ;
+ SLASH: /
+ COMMA: ,
+ NUMBER: [+-]?[0-9]*\\.?[0-9]+
+ ID: [a-zA-Z_](?:[a-zA-Z0-9_-]*[a-zA-Z0-9_])?
+ STRING: "(?:[^\\\\"]|\\\\.)*"|\'(?:[^\\\\\']|\\\\.)*\'
+ ESC: \\\\[^ux]|\\\\x[0-9a-fA-F][0-9a-fA-F]|\\\\u[0-9a-fA-F][0-9a-fA-F][0-9a-fA-F][0-9a-fA-F]
+ SYM: [.#*%@$^!+-]
+ WSPACE: [ \\n\\r\\t]+
+
+ The formal grammar for addresses is given below::
+ address = name [ "/" subject ] [ ";" options ]
+ name = ( part | quoted )+
+ subject = ( part | quoted | "/" )*
+ quoted = STRING / ESC
+ part = LBRACE / RBRACE / COLON / COMMA / NUMBER / ID / SYM
+ options = map
+ map = "{" ( keyval ( "," keyval )* )? "}"
+ keyval = ID ":" value
+ value = NUMBER / STRING / ID / map / list
+ list = "[" ( value ( "," value )* )? "]"
+
+ This grammar resuls in the following informal syntax::
+
+ <name> [ / <subject> ] [ ; <options> ]
+
+ Where options is::
+
+ { <key> : <value>, ... }
+
+ And values may be:
+ - numbers
+ - single, double, or non quoted strings
+ - maps (dictionaries)
+ - lists
+
+ Options
+ -------
+ The options map permits the following parameters::
+
+ <name> [ / <subject> ] ; {
+ create: always | sender | receiver | never,
+ delete: always | sender | receiver | never,
+ assert: always | sender | receiver | never,
+ mode: browse | consume,
+ node: {
+ type: queue | topic,
+ durable: True | False,
+ x-declare: { ... <declare-overrides> ... },
+ x-bindings: [<binding_1>, ... <binding_n>]
+ },
+ link: {
+ name: <link-name>,
+ durable: True | False,
+ reliability: unreliable | at-most-once | at-least-once | exactly-once,
+ x-declare: { ... <declare-overrides> ... },
+ x-bindings: [<binding_1>, ... <binding_n>],
+ x-subscribe: { ... <subscribe-overrides> ... }
+ }
+ }
+
+ Bindings are specified as a map with the following options::
+
+ {
+ exchange: <exchange>,
+ queue: <queue>,
+ key: <key>,
+ arguments: <arguments>
+ }
+
+ The create, delete, and assert policies specify who should perfom
+ the associated action:
+
+ - I{always}: the action will always be performed
+ - I{sender}: the action will only be performed by the sender
+ - I{receiver}: the action will only be performed by the receiver
+ - I{never}: the action will never be performed (this is the default)
+
+ The node-type is one of:
+
+ - I{topic}: a topic node will default to the topic exchange,
+ x-declare may be used to specify other exchange types
+ - I{queue}: this is the default node-type
+
+ The x-declare map permits protocol specific keys and values to be
+ specified when exchanges or queues are declared. These keys and
+ values are passed through when creating a node or asserting facts
+ about an existing node.
+
+ Examples
+ --------
+ A simple name resolves to any named node, usually a queue or a
+ topic::
+
+ my-queue-or-topic
+
+ A simple name with a subject will also resolve to a node, but the
+ presence of the subject will cause a sender using this address to
+ set the subject on outgoing messages, and receivers to filter based
+ on the subject::
+
+ my-queue-or-topic/my-subject
+
+ A subject pattern can be used and will cause filtering if used by
+ the receiver. If used for a sender, the literal value gets set as
+ the subject::
+
+ my-queue-or-topic/my-*
+
+ In all the above cases, the address is resolved to an existing node.
+ If you want the node to be auto-created, then you can do the
+ following. By default nonexistent nodes are assumed to be queues::
+
+ my-queue; {create: always}
+
+ You can customize the properties of the queue::
+
+ my-queue; {create: always, node: {durable: True}}
+
+ You can create a topic instead if you want::
+
+ my-queue; {create: always, node: {type: topic}}
+
+ You can assert that the address resolves to a node with particular
+ properties::
+
+ my-transient-topic; {
+ assert: always,
+ node: {
+ type: topic,
+ durable: False
+ }
+ }
+ """
+
+ def __init__(self, connection, name, transactional):
+ self.connection = connection
+ self.name = name
+ self.log_id = "%x" % id(self)
+
+ self.transactional = transactional
+
+ self.committing = False
+ self.committed = True
+ self.aborting = False
+ self.aborted = False
+
+ self.next_sender_id = 0
+ self.senders = []
+ self.next_receiver_id = 0
+ self.receivers = []
+ self.outgoing = []
+ self.incoming = []
+ self.unacked = []
+ self.acked = []
+ # XXX: I hate this name.
+ self.ack_capacity = UNLIMITED
+
+ self.error = None
+ self.closing = False
+ self.closed = False
+
+ self._lock = connection._lock
+ self._msg_received = None
+
+ def __repr__(self):
+ return "<Session %s>" % self.name
+
+ def _wait(self, predicate, timeout=None):
+ return self.connection._wait(predicate, timeout=timeout)
+
+ def _wakeup(self):
+ self.connection._wakeup()
+
+ def check_error(self):
+ self.connection.check_error()
+ if self.error:
+ raise self.error
+
+ def get_error(self):
+ err = self.connection.get_error()
+ if err:
+ return err
+ else:
+ return self.error
+
+ def _ewait(self, predicate, timeout=None):
+ result = self.connection._ewait(lambda: self.error or predicate(), timeout)
+ self.check_error()
+ return result
+
+ def check_closed(self):
+ if self.closed:
+ raise SessionClosed()
+
+ def message_received(self, msg):
+ self.incoming.append(msg)
+ if self._msg_received:
+ self._msg_received()
+
+ @synchronized
+ def sender(self, target, **options):
+ """
+ Creates a L{Sender} that may be used to send L{Messages<Message>}
+ to the specified target.
+
+ @type target: str
+ @param target: the target to which messages will be sent
+ @rtype: Sender
+ @return: a new Sender for the specified target
+ """
+ target = _mangle(target)
+ sender = Sender(self, self.next_sender_id, target, options)
+ self.next_sender_id += 1
+ self.senders.append(sender)
+ if not self.closed and self.connection._connected:
+ self._wakeup()
+ try:
+ sender._ewait(lambda: sender.linked)
+ except LinkError, e:
+ sender.close()
+ raise e
+ return sender
+
+ @synchronized
+ def receiver(self, source, **options):
+ """
+ Creates a receiver that may be used to fetch L{Messages<Message>}
+ from the specified source.
+
+ @type source: str
+ @param source: the source of L{Messages<Message>}
+ @rtype: Receiver
+ @return: a new Receiver for the specified source
+ """
+ source = _mangle(source)
+ receiver = Receiver(self, self.next_receiver_id, source, options)
+ self.next_receiver_id += 1
+ self.receivers.append(receiver)
+ if not self.closed and self.connection._connected:
+ self._wakeup()
+ try:
+ receiver._ewait(lambda: receiver.linked)
+ except LinkError, e:
+ receiver.close()
+ raise e
+ return receiver
+
+ @synchronized
+ def _count(self, predicate):
+ result = 0
+ for msg in self.incoming:
+ if predicate(msg):
+ result += 1
+ return result
+
+ def _peek(self, receiver):
+ for msg in self.incoming:
+ if msg._receiver == receiver:
+ return msg
+
+ def _pop(self, receiver):
+ i = 0
+ while i < len(self.incoming):
+ msg = self.incoming[i]
+ if msg._receiver == receiver:
+ del self.incoming[i]
+ return msg
+ else:
+ i += 1
+
+ @synchronized
+ def _get(self, receiver, timeout=None):
+ if self._ewait(lambda: ((self._peek(receiver) is not None) or
+ self.closing or receiver.closed),
+ timeout):
+ msg = self._pop(receiver)
+ if msg is not None:
+ msg._receiver.returned += 1
+ self.unacked.append(msg)
+ log.debug("RETR[%s]: %s", self.log_id, msg)
+ return msg
+ return None
+
+ @synchronized
+ def set_message_received_handler(self, handler):
+ """Register a callback that will be invoked when a message arrives on the
+ session. Use with caution: since this callback is invoked in the context
+ of the driver thread, it is not safe to call any of the public messaging
+ APIs from within this callback. The intent of the handler is to provide
+ an efficient way to notify the application that a message has arrived.
+ This can be useful for those applications that need to schedule a task
+ to poll for received messages without blocking in the messaging API.
+ """
+ self._msg_received = handler
+
+ @synchronized
+ def next_receiver(self, timeout=None):
+ if self._ecwait(lambda: self.incoming, timeout):
+ return self.incoming[0]._receiver
+ else:
+ raise Empty
+
+ @synchronized
+ def acknowledge(self, message=None, disposition=None, sync=True):
+ """
+ Acknowledge the given L{Message}. If message is None, then all
+ unacknowledged messages on the session are acknowledged.
+
+ @type message: Message
+ @param message: the message to acknowledge or None
+ @type sync: boolean
+ @param sync: if true then block until the message(s) are acknowledged
+ """
+ if message is None:
+ messages = self.unacked[:]
+ else:
+ messages = [message]
+
+ for m in messages:
+ if self.ack_capacity is not UNLIMITED:
+ if self.ack_capacity <= 0:
+ # XXX: this is currently a SendError, maybe it should be a SessionError?
+ raise InsufficientCapacity("ack_capacity = %s" % self.ack_capacity)
+ self._wakeup()
+ self._ecwait(lambda: len(self.acked) < self.ack_capacity)
+ m._disposition = disposition
+ self.unacked.remove(m)
+ self.acked.append(m)
+
+ self._wakeup()
+ if sync:
+ self._ecwait(lambda: not [m for m in messages if m in self.acked])
+
+ @synchronized
+ def commit(self, timeout=None):
+ """
+ Commit outstanding transactional work. This consists of all
+ message sends and receives since the prior commit or rollback.
+ """
+ if not self.transactional:
+ raise NontransactionalSession()
+ self.committing = True
+ self._wakeup()
+ try:
+ if not self._ecwait(lambda: not self.committing, timeout=timeout):
+ raise Timeout("commit timed out")
+ except TransactionError:
+ raise
+ except Exception, e:
+ self.error = TransactionAborted(text="Transaction aborted: %s"%e)
+ raise self.error
+ if self.aborted:
+ raise TransactionAborted()
+ assert self.committed
+
+ @synchronized
+ def rollback(self, timeout=None):
+ """
+ Rollback outstanding transactional work. This consists of all
+ message sends and receives since the prior commit or rollback.
+ """
+ if not self.transactional:
+ raise NontransactionalSession()
+ self.aborting = True
+ self._wakeup()
+ if not self._ecwait(lambda: not self.aborting, timeout=timeout):
+ raise Timeout("rollback timed out")
+ assert self.aborted
+
+ @synchronized
+ def sync(self, timeout=None):
+ """
+ Sync the session.
+ """
+ for snd in self.senders:
+ snd.sync(timeout=timeout)
+ if not self._ewait(lambda: not self.outgoing and not self.acked, timeout=timeout):
+ raise Timeout("session sync timed out")
+
+ @synchronized
+ def close(self, timeout=None):
+ """
+ Close the session.
+ """
+ if self.error: return
+ self.sync(timeout=timeout)
+
+ for link in self.receivers + self.senders:
+ link.close(timeout=timeout)
+
+ if not self.closing:
+ self.closing = True
+ self._wakeup()
+
+ try:
+ if not self._ewait(lambda: self.closed, timeout=timeout):
+ raise Timeout("session close timed out")
+ finally:
+ self.connection._remove_session(self)
+
+class MangledString(str): pass
+
+def _mangle(addr):
+ if addr and addr.startswith("#"):
+ return MangledString(str(uuid4()) + addr)
+ else:
+ return addr
+
+class Sender(Endpoint):
+
+ """
+ Sends outgoing messages.
+ """
+
+ def __init__(self, session, id, target, options):
+ self.session = session
+ self.id = id
+ self.target = target
+ self.options = options
+ self.capacity = options.get("capacity", UNLIMITED)
+ self.threshold = 0.5
+ self.durable = options.get("durable")
+ self.queued = Serial(0)
+ self.synced = Serial(0)
+ self.acked = Serial(0)
+ self.error = None
+ self.linked = False
+ self.closing = False
+ self.closed = False
+ self._lock = self.session._lock
+
+ def _wakeup(self):
+ self.session._wakeup()
+
+ def check_error(self):
+ self.session.check_error()
+ if self.error:
+ raise self.error
+
+ def get_error(self):
+ err = self.session.get_error()
+ if err:
+ return err
+ else:
+ return self.error
+
+ def _ewait(self, predicate, timeout=None):
+ result = self.session._ewait(lambda: self.error or predicate(), timeout)
+ self.check_error()
+ return result
+
+ def check_closed(self):
+ if self.closed:
+ raise LinkClosed()
+
+ @synchronized
+ def unsettled(self):
+ """
+ Returns the number of messages awaiting acknowledgment.
+ @rtype: int
+ @return: the number of unacknowledged messages
+ """
+ return self.queued - self.acked
+
+ @synchronized
+ def available(self):
+ if self.capacity is UNLIMITED:
+ return UNLIMITED
+ else:
+ return self.capacity - self.unsettled()
+
+ @synchronized
+ def send(self, object, sync=True, timeout=None):
+ """
+ Send a message. If the object passed in is of type L{unicode},
+ L{str}, L{list}, or L{dict}, it will automatically be wrapped in a
+ L{Message} and sent. If it is of type L{Message}, it will be sent
+ directly. If the sender capacity is not L{UNLIMITED} then send
+ will block until there is available capacity to send the message.
+ If the timeout parameter is specified, then send will throw an
+ L{InsufficientCapacity} exception if capacity does not become
+ available within the specified time.
+
+ @type object: unicode, str, list, dict, Message
+ @param object: the message or content to send
+
+ @type sync: boolean
+ @param sync: if true then block until the message is sent
+
+ @type timeout: float
+ @param timeout: the time to wait for available capacity
+ """
+
+ if not self.session.connection._connected or self.session.closing:
+ raise Detached()
+
+ self._ecwait(lambda: self.linked, timeout=timeout)
+
+ if isinstance(object, Message):
+ message = object
+ else:
+ message = Message(object)
+
+ if message.durable is None:
+ message.durable = self.durable
+
+ if self.capacity is not UNLIMITED:
+ if self.capacity <= 0:
+ raise InsufficientCapacity("capacity = %s" % self.capacity)
+ if not self._ecwait(self.available, timeout=timeout):
+ raise InsufficientCapacity("capacity = %s" % self.capacity)
+
+ # XXX: what if we send the same message to multiple senders?
+ message._sender = self
+ if self.capacity is not UNLIMITED:
+ message._sync = sync or self.available() <= int(ceil(self.threshold*self.capacity))
+ else:
+ message._sync = sync
+ self.session.outgoing.append(message)
+ self.queued += 1
+
+ if sync:
+ self.sync(timeout=timeout)
+ assert message not in self.session.outgoing
+ else:
+ self._wakeup()
+
+ @synchronized
+ def sync(self, timeout=None):
+ mno = self.queued
+ if self.synced < mno:
+ self.synced = mno
+ self._wakeup()
+ try:
+ if not self._ewait(lambda: self.acked >= mno, timeout=timeout):
+ raise Timeout("sender sync timed out")
+ except ContentError:
+ # clean bad message so we can continue
+ self.acked = mno
+ self.session.outgoing.pop(0)
+ raise
+
+ @synchronized
+ def close(self, timeout=None):
+ """
+ Close the Sender.
+ """
+ # avoid erroring out when closing a sender that was never
+ # established
+ if self.acked < self.queued:
+ self.sync(timeout=timeout)
+
+ if not self.closing:
+ self.closing = True
+ self._wakeup()
+
+ try:
+ if not self.session._ewait(lambda: self.closed, timeout=timeout):
+ raise Timeout("sender close timed out")
+ finally:
+ try:
+ self.session.senders.remove(self)
+ except ValueError:
+ pass
+
+class Receiver(Endpoint, object):
+
+ """
+ Receives incoming messages from a remote source. Messages may be
+ fetched with L{fetch}.
+ """
+
+ def __init__(self, session, id, source, options):
+ self.session = session
+ self.id = id
+ self.source = source
+ self.options = options
+
+ self.granted = Serial(0)
+ self.draining = False
+ self.impending = Serial(0)
+ self.received = Serial(0)
+ self.returned = Serial(0)
+
+ self.error = None
+ self.linked = False
+ self.closing = False
+ self.closed = False
+ self._lock = self.session._lock
+ self._capacity = 0
+ self._set_capacity(options.get("capacity", 0), False)
+ self.threshold = 0.5
+
+ @synchronized
+ def _set_capacity(self, c, wakeup=True):
+ if c is UNLIMITED:
+ self._capacity = c.value
+ else:
+ self._capacity = c
+ self._grant()
+ if wakeup:
+ self._wakeup()
+
+ def _get_capacity(self):
+ if self._capacity == UNLIMITED.value:
+ return UNLIMITED
+ else:
+ return self._capacity
+
+ capacity = property(_get_capacity, _set_capacity)
+
+ def _wakeup(self):
+ self.session._wakeup()
+
+ def check_error(self):
+ self.session.check_error()
+ if self.error:
+ raise self.error
+
+ def get_error(self):
+ err = self.session.get_error()
+ if err:
+ return err
+ else:
+ return self.error
+
+ def _ewait(self, predicate, timeout=None):
+ result = self.session._ewait(lambda: self.error or predicate(), timeout)
+ self.check_error()
+ return result
+
+ def check_closed(self):
+ if self.closed:
+ raise LinkClosed()
+
+ @synchronized
+ def unsettled(self):
+ """
+ Returns the number of acknowledged messages awaiting confirmation.
+ """
+ return len([m for m in self.session.acked if m._receiver is self])
+
+ @synchronized
+ def available(self):
+ """
+ Returns the number of messages available to be fetched by the
+ application.
+
+ @rtype: int
+ @return: the number of available messages
+ """
+ return self.received - self.returned
+
+ @synchronized
+ def fetch(self, timeout=None):
+ """
+ Fetch and return a single message. A timeout of None will block
+ forever waiting for a message to arrive, a timeout of zero will
+ return immediately if no messages are available.
+
+ @type timeout: float
+ @param timeout: the time to wait for a message to be available
+ """
+
+ self._ecwait(lambda: self.linked)
+
+ if self._capacity == 0:
+ self.granted = self.returned + 1
+ self._wakeup()
+ self._ecwait(lambda: self.impending >= self.granted)
+ msg = self.session._get(self, timeout=timeout)
+ if msg is None:
+ self.check_closed()
+ self.draining = True
+ self._wakeup()
+ self._ecwait(lambda: not self.draining)
+ msg = self.session._get(self, timeout=0)
+ self._grant()
+ self._wakeup()
+ if msg is None:
+ raise Empty()
+ elif self._capacity not in (0, UNLIMITED.value):
+ t = int(ceil(self.threshold * self._capacity))
+ if self.received - self.returned <= t:
+ self.granted = self.returned + self._capacity
+ self._wakeup()
+ return msg
+
+ def _grant(self):
+ if self._capacity == UNLIMITED.value:
+ self.granted = UNLIMITED
+ else:
+ self.granted = self.returned + self._capacity
+
+ @synchronized
+ def close(self, timeout=None):
+ """
+ Close the receiver.
+ """
+ if not self.closing:
+ self.closing = True
+ self._wakeup()
+
+ try:
+ if not self.session._ewait(lambda: self.closed, timeout=timeout):
+ raise Timeout("receiver close timed out")
+ finally:
+ try:
+ self.session.receivers.remove(self)
+ except ValueError:
+ pass
+
+__all__ = ["Connection", "Session", "Sender", "Receiver"]
diff --git a/qpid/python/qpid/messaging/exceptions.py b/qpid/python/qpid/messaging/exceptions.py
new file mode 100644
index 0000000000..2284d7cde9
--- /dev/null
+++ b/qpid/python/qpid/messaging/exceptions.py
@@ -0,0 +1,179 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+class Timeout(Exception):
+ pass
+
+## Messaging Errors
+
+class MessagingError(Exception):
+
+ def __init__(self, code=None, text=None, **info):
+ self.code = code
+ self.text = text
+ self.info = info
+ if self.code is None:
+ msg = self.text
+ else:
+ msg = "%s(%s)" % (self.text, self.code)
+ if info:
+ msg += " " + ", ".join(["%s=%r" % (k, v) for k, v in self.info.items()])
+ Exception.__init__(self, msg)
+class InternalError(MessagingError):
+ pass
+
+## Connection Errors
+
+class ConnectionError(MessagingError):
+ """
+ The base class for all connection related exceptions.
+ """
+ pass
+
+class ConnectError(ConnectionError):
+ """
+ Exception raised when there is an error connecting to the remote
+ peer.
+ """
+ pass
+
+class VersionError(ConnectError):
+ pass
+
+class AuthenticationFailure(ConnectError):
+ pass
+
+class ConnectionClosed(ConnectionError):
+ pass
+
+class HeartbeatTimeout(ConnectionError):
+ pass
+
+## Session Errors
+
+class SessionError(MessagingError):
+ pass
+
+class Detached(SessionError):
+ """
+ Exception raised when an operation is attempted that is illegal when
+ detached.
+ """
+ pass
+
+class NontransactionalSession(SessionError):
+ """
+ Exception raised when commit or rollback is attempted on a non
+ transactional session.
+ """
+ pass
+
+class TransactionError(SessionError):
+ """Base class for transactional errors"""
+ pass
+
+class TransactionAborted(TransactionError):
+ """The transaction was automatically rolled back. This could be due to an error
+ on the broker, such as a store failure, or a connection failure during the
+ transaction"""
+ pass
+
+class TransactionUnknown(TransactionError):
+ """ The outcome of the transaction on the broker (commit or roll-back) is not
+ known. This occurs when the connection fails after we sent the commit but
+ before we received a response."""
+ pass
+
+class UnauthorizedAccess(SessionError):
+ pass
+
+class ServerError(SessionError):
+ pass
+
+class SessionClosed(SessionError):
+ pass
+
+## Link Errors
+
+class LinkError(MessagingError):
+ pass
+
+class InsufficientCapacity(LinkError):
+ pass
+
+class AddressError(LinkError):
+ pass
+
+class MalformedAddress(AddressError):
+ pass
+
+class InvalidOption(AddressError):
+ pass
+
+class ResolutionError(AddressError):
+ pass
+
+class AssertionFailed(ResolutionError):
+ pass
+
+class NotFound(ResolutionError):
+ pass
+
+class LinkClosed(LinkError):
+ pass
+
+## Sender Errors
+
+class SenderError(LinkError):
+ pass
+
+class SendError(SenderError):
+ pass
+
+class TargetCapacityExceeded(SendError):
+ pass
+
+## Receiver Errors
+
+class ReceiverError(LinkError):
+ pass
+
+class FetchError(ReceiverError):
+ pass
+
+class Empty(FetchError):
+ """
+ Exception raised by L{Receiver.fetch} when there is no message
+ available within the alloted time.
+ """
+ pass
+
+## Message Content errors
+class ContentError(MessagingError):
+ """
+ This type of exception will be returned to the application
+ once, and will not block further requests
+ """
+ pass
+
+class EncodeError(ContentError):
+ pass
+
+class DecodeError(ContentError):
+ pass
diff --git a/qpid/python/qpid/messaging/message.py b/qpid/python/qpid/messaging/message.py
new file mode 100644
index 0000000000..b70b365c16
--- /dev/null
+++ b/qpid/python/qpid/messaging/message.py
@@ -0,0 +1,173 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from qpid.codec010 import StringCodec
+from qpid.ops import PRIMITIVE
+
+def codec(name):
+ type = PRIMITIVE[name]
+
+ def encode(x):
+ sc = StringCodec()
+ sc.write_primitive(type, x)
+ return sc.encoded
+
+ def decode(x):
+ sc = StringCodec(x)
+ return sc.read_primitive(type)
+
+ return encode, decode
+
+# XXX: need to correctly parse the mime type and deal with
+# content-encoding header
+
+TYPE_MAPPINGS={
+ dict: "amqp/map",
+ list: "amqp/list",
+ unicode: "text/plain; charset=utf8",
+ unicode: "text/plain",
+ buffer: None,
+ str: None,
+ None.__class__: None
+ }
+
+DEFAULT_CODEC = (lambda x: x, lambda x: x)
+
+def encode_text_plain(x):
+ if x is None:
+ return None
+ else:
+ return x.encode("utf8")
+
+def decode_text_plain(x):
+ if x is None:
+ return None
+ else:
+ return x.decode("utf8")
+
+TYPE_CODEC={
+ "amqp/map": codec("map"),
+ "amqp/list": codec("list"),
+ "text/plain; charset=utf8": (encode_text_plain, decode_text_plain),
+ "text/plain": (encode_text_plain, decode_text_plain),
+ "": DEFAULT_CODEC,
+ None: DEFAULT_CODEC
+ }
+
+def get_type(content):
+ return TYPE_MAPPINGS[content.__class__]
+
+def get_codec(content_type):
+ return TYPE_CODEC.get(content_type, DEFAULT_CODEC)
+
+UNSPECIFIED = object()
+
+class Message:
+
+ """
+ A message consists of a standard set of fields, an application
+ defined set of properties, and some content.
+
+ @type id: str
+ @ivar id: the message id
+ @type subject: str
+ @ivar subject: message subject
+ @type user_id: str
+ @ivar user_id: the user-id of the message producer
+ @type reply_to: str
+ @ivar reply_to: the address to send replies
+ @type correlation_id: str
+ @ivar correlation_id: a correlation-id for the message
+ @type durable: bool
+ @ivar durable: message durability
+ @type priority: int
+ @ivar priority: message priority
+ @type ttl: float
+ @ivar ttl: time-to-live measured in seconds
+ @type properties: dict
+ @ivar properties: application specific message properties
+ @type content_type: str
+ @ivar content_type: the content-type of the message
+ @type content: str, unicode, buffer, dict, list
+ @ivar content: the message content
+ """
+
+ def __init__(self, content=None, content_type=UNSPECIFIED, id=None,
+ subject=None, user_id=None, reply_to=None, correlation_id=None,
+ durable=None, priority=None, ttl=None, properties=None):
+ """
+ Construct a new message with the supplied content. The
+ content-type of the message will be automatically inferred from
+ type of the content parameter.
+
+ @type content: str, unicode, buffer, dict, list
+ @param content: the message content
+
+ @type content_type: str
+ @param content_type: the content-type of the message
+ """
+ self.id = id
+ self.subject = subject
+ self.user_id = user_id
+ self.reply_to = reply_to
+ self.correlation_id = correlation_id
+ self.durable = durable
+ self.priority = priority
+ self.ttl = ttl
+ self.redelivered = False
+ if properties is None:
+ self.properties = {}
+ else:
+ self.properties = properties
+ if content_type is UNSPECIFIED:
+ self.content_type = get_type(content)
+ else:
+ self.content_type = content_type
+ self.content = content
+
+ def __repr__(self):
+ args = []
+ for name in ["id", "subject", "user_id", "reply_to", "correlation_id",
+ "priority", "ttl"]:
+ value = self.__dict__[name]
+ if value is not None: args.append("%s=%r" % (name, value))
+ for name in ["durable", "redelivered", "properties"]:
+ value = self.__dict__[name]
+ if value: args.append("%s=%r" % (name, value))
+ if self.content_type != get_type(self.content):
+ args.append("content_type=%r" % self.content_type)
+ if self.content is not None:
+ if args:
+ args.append("content=%r" % self.content)
+ else:
+ args.append(repr(self.content))
+ return "Message(%s)" % ", ".join(args)
+
+class Disposition:
+
+ def __init__(self, type, **options):
+ self.type = type
+ self.options = options
+
+ def __repr__(self):
+ args = [str(self.type)] + \
+ ["%s=%r" % (k, v) for k, v in self.options.items()]
+ return "Disposition(%s)" % ", ".join(args)
+
+__all__ = ["Message", "Disposition"]
diff --git a/qpid/python/qpid/messaging/transports.py b/qpid/python/qpid/messaging/transports.py
new file mode 100644
index 0000000000..f39c256d02
--- /dev/null
+++ b/qpid/python/qpid/messaging/transports.py
@@ -0,0 +1,235 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import socket
+from qpid.util import connect
+
+TRANSPORTS = {}
+
+class SocketTransport:
+
+ def __init__(self, conn, host, port):
+ self.socket = connect(host, port)
+ if conn.tcp_nodelay:
+ self.socket.setsockopt(socket.IPPROTO_TCP, socket.TCP_NODELAY, 1)
+
+ def fileno(self):
+ return self.socket.fileno()
+
+class tcp(SocketTransport):
+
+ def reading(self, reading):
+ return reading
+
+ def writing(self, writing):
+ return writing
+
+ def send(self, bytes):
+ return self.socket.send(bytes)
+
+ def recv(self, n):
+ return self.socket.recv(n)
+
+ def close(self):
+ self.socket.close()
+
+TRANSPORTS["tcp"] = tcp
+
+try:
+ from ssl import wrap_socket, SSLError, SSL_ERROR_WANT_READ, \
+ SSL_ERROR_WANT_WRITE, CERT_REQUIRED, CERT_NONE
+except ImportError:
+
+ ## try the older python SSL api:
+ from socket import ssl
+
+ class old_ssl(SocketTransport):
+ def __init__(self, conn, host, port):
+ SocketTransport.__init__(self, conn, host, port)
+ # Bug (QPID-4337): this is the "old" version of python SSL.
+ # The private key is required. If a certificate is given, but no
+ # keyfile, assume the key is contained in the certificate
+ ssl_keyfile = conn.ssl_keyfile
+ ssl_certfile = conn.ssl_certfile
+ if ssl_certfile and not ssl_keyfile:
+ ssl_keyfile = ssl_certfile
+
+ # this version of SSL does NOT perform certificate validation. If the
+ # connection has been configured with CA certs (via ssl_trustfile), then
+ # the application expects the certificate to be validated against the
+ # supplied CA certs. Since this version cannot validate, the peer cannot
+ # be trusted.
+ if conn.ssl_trustfile:
+ raise socket.error("This version of Python does not support verification of the peer's certificate.")
+
+ self.ssl = ssl(self.socket, keyfile=ssl_keyfile, certfile=ssl_certfile)
+ self.socket.setblocking(1)
+
+ def reading(self, reading):
+ return reading
+
+ def writing(self, writing):
+ return writing
+
+ def recv(self, n):
+ return self.ssl.read(n)
+
+ def send(self, s):
+ return self.ssl.write(s)
+
+ def close(self):
+ self.socket.close()
+
+ TRANSPORTS["ssl"] = old_ssl
+ TRANSPORTS["tcp+tls"] = old_ssl
+
+else:
+ class tls(SocketTransport):
+
+ def __init__(self, conn, host, port):
+ SocketTransport.__init__(self, conn, host, port)
+ if conn.ssl_trustfile:
+ validate = CERT_REQUIRED
+ else:
+ validate = CERT_NONE
+
+ # if user manually set flag to false then require cert
+ actual = getattr(conn, "_ssl_skip_hostname_check_actual", None)
+ if actual is not None and conn.ssl_skip_hostname_check is False:
+ validate = CERT_REQUIRED
+
+ self.tls = wrap_socket(self.socket, keyfile=conn.ssl_keyfile,
+ certfile=conn.ssl_certfile,
+ ca_certs=conn.ssl_trustfile,
+ cert_reqs=validate)
+
+ if validate == CERT_REQUIRED and not conn.ssl_skip_hostname_check:
+ match_found = False
+ peer_cert = self.tls.getpeercert()
+ if peer_cert:
+ peer_names = []
+ if 'subjectAltName' in peer_cert:
+ for san in peer_cert['subjectAltName']:
+ if san[0] == 'DNS':
+ peer_names.append(san[1].lower())
+ if 'subject' in peer_cert:
+ for sub in peer_cert['subject']:
+ while isinstance(sub, tuple) and isinstance(sub[0],tuple):
+ sub = sub[0] # why the extra level of indirection???
+ if sub[0] == 'commonName':
+ peer_names.append(sub[1].lower())
+ for pattern in peer_names:
+ if _match_dns_pattern( host.lower(), pattern ):
+ #print "Match found %s" % pattern
+ match_found = True
+ break
+ if not match_found:
+ raise SSLError("Connection hostname '%s' does not match names from peer certificate: %s" % (host, peer_names))
+
+ self.socket.setblocking(0)
+ self.state = None
+ # See qpid-4872: need to store the parameters last passed to tls.write()
+ # in case the calls fail with an SSL_ERROR_WANT_* error and we have to
+ # retry the call with the same parameters.
+ self.write_retry = None # buffer passed to last call of tls.write()
+
+ def reading(self, reading):
+ if self.state is None:
+ return reading
+ else:
+ return self.state == SSL_ERROR_WANT_READ
+
+ def writing(self, writing):
+ if self.state is None:
+ return writing
+ else:
+ return self.state == SSL_ERROR_WANT_WRITE
+
+ def send(self, bytes):
+ if self.write_retry is None:
+ self.write_retry = bytes
+ self._clear_state()
+ try:
+ n = self.tls.write( self.write_retry )
+ self.write_retry = None
+ return n
+ except SSLError, e:
+ if self._update_state(e.args[0]):
+ # will retry on next invokation
+ return 0
+ self.write_retry = None
+ raise
+ except:
+ self.write_retry = None
+ raise
+
+ def recv(self, n):
+ self._clear_state()
+ try:
+ return self.tls.read(n)
+ except SSLError, e:
+ if self._update_state(e.args[0]):
+ # will retry later:
+ return None
+ else:
+ raise
+
+ def _clear_state(self):
+ self.state = None
+
+ def _update_state(self, code):
+ if code in (SSL_ERROR_WANT_READ, SSL_ERROR_WANT_WRITE):
+ self.state = code
+ return True
+ else:
+ return False
+
+ def close(self):
+ self.socket.setblocking(1)
+ # this closes the underlying socket
+ self.tls.close()
+
+ def _match_dns_pattern( hostname, pattern ):
+ """ For checking the hostnames provided by the peer's certificate
+ """
+ if pattern.find("*") == -1:
+ return hostname == pattern
+
+ # DNS wildcarded pattern - see RFC2818
+ h_labels = hostname.split(".")
+ p_labels = pattern.split(".")
+
+ while h_labels and p_labels:
+ if p_labels[0].find("*") == -1:
+ if p_labels[0] != h_labels[0]:
+ return False
+ else:
+ p = p_labels[0].split("*")
+ if not h_labels[0].startswith(p[0]):
+ return False
+ if not h_labels[0].endswith(p[1]):
+ return False
+ h_labels.pop(0)
+ p_labels.pop(0)
+
+ return not h_labels and not p_labels
+
+
+ TRANSPORTS["ssl"] = tls
+ TRANSPORTS["tcp+tls"] = tls
diff --git a/qpid/python/qpid/messaging/util.py b/qpid/python/qpid/messaging/util.py
new file mode 100644
index 0000000000..726cfd5172
--- /dev/null
+++ b/qpid/python/qpid/messaging/util.py
@@ -0,0 +1,64 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+Add-on utilities for the L{qpid.messaging} API.
+"""
+
+from qpid.messaging import *
+from logging import getLogger
+from threading import Thread
+
+log = getLogger("qpid.messaging.util")
+
+def auto_fetch_reconnect_urls(conn):
+ ssn = conn.session("auto-fetch-reconnect-urls")
+ rcv = ssn.receiver("amq.failover")
+ rcv.capacity = 10
+
+ def main():
+ while True:
+ try:
+ msg = rcv.fetch()
+ except LinkClosed:
+ return
+ set_reconnect_urls(conn, msg)
+ ssn.acknowledge(msg, sync=False)
+
+ thread = Thread(name="auto-fetch-reconnect-urls", target=main)
+ thread.setDaemon(True)
+ thread.start()
+
+
+def set_reconnect_urls(conn, msg):
+ reconnect_urls = []
+ urls = msg.properties["amq.failover"]
+ for u in urls:
+ # FIXME aconway 2012-06-12: Nasty hack parsing of the C++ broker's URL format.
+ if u.startswith("amqp:"):
+ for a in u[5:].split(","):
+ parts = a.split(":")
+ # Handle IPv6 addresses which have : in the host part.
+ port = parts[-1] # Last : separated field is port
+ host = ":".join(parts[1:-1]) # First : separated field is protocol, host is the rest.
+ reconnect_urls.append("%s:%s" % (host, port))
+ conn.reconnect_urls = reconnect_urls
+ log.warn("set reconnect_urls for conn %s: %s", conn, reconnect_urls)
+
+__all__ = ["auto_fetch_reconnect_urls", "set_reconnect_urls"]
diff --git a/qpid/python/qpid/mimetype.py b/qpid/python/qpid/mimetype.py
new file mode 100644
index 0000000000..f512996b9f
--- /dev/null
+++ b/qpid/python/qpid/mimetype.py
@@ -0,0 +1,106 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import re, rfc822
+from lexer import Lexicon, LexError
+from parser import Parser, ParseError
+
+l = Lexicon()
+
+LPAREN = l.define("LPAREN", r"\(")
+RPAREN = l.define("LPAREN", r"\)")
+SLASH = l.define("SLASH", r"/")
+SEMI = l.define("SEMI", r";")
+EQUAL = l.define("EQUAL", r"=")
+TOKEN = l.define("TOKEN", r'[^()<>@,;:\\"/\[\]?= ]+')
+STRING = l.define("STRING", r'"(?:[^\\"]|\\.)*"')
+WSPACE = l.define("WSPACE", r"[ \n\r\t]+")
+EOF = l.eof("EOF")
+
+LEXER = l.compile()
+
+def lex(st):
+ return LEXER.lex(st)
+
+class MimeTypeParser(Parser):
+
+ def __init__(self, tokens):
+ Parser.__init__(self, [t for t in tokens if t.type is not WSPACE])
+
+ def parse(self):
+ result = self.mimetype()
+ self.eat(EOF)
+ return result
+
+ def mimetype(self):
+ self.remove_comments()
+ self.reset()
+
+ type = self.eat(TOKEN).value.lower()
+ self.eat(SLASH)
+ subtype = self.eat(TOKEN).value.lower()
+
+ params = []
+ while True:
+ if self.matches(SEMI):
+ params.append(self.parameter())
+ else:
+ break
+
+ return type, subtype, params
+
+ def remove_comments(self):
+ while True:
+ self.eat_until(LPAREN, EOF)
+ if self.matches(LPAREN):
+ self.remove(*self.comment())
+ else:
+ break
+
+ def comment(self):
+ start = self.eat(LPAREN)
+
+ while True:
+ self.eat_until(LPAREN, RPAREN)
+ if self.matches(LPAREN):
+ self.comment()
+ else:
+ break
+
+ end = self.eat(RPAREN)
+ return start, end
+
+ def parameter(self):
+ self.eat(SEMI)
+ name = self.eat(TOKEN).value
+ self.eat(EQUAL)
+ value = self.value()
+ return name, value
+
+ def value(self):
+ if self.matches(TOKEN):
+ return self.eat().value
+ elif self.matches(STRING):
+ return rfc822.unquote(self.eat().value)
+ else:
+ raise ParseError(self.next(), TOKEN, STRING)
+
+def parse(addr):
+ return MimeTypeParser(lex(addr)).parse()
+
+__all__ = ["parse", "ParseError"]
diff --git a/qpid/python/qpid/ops.py b/qpid/python/qpid/ops.py
new file mode 100644
index 0000000000..390552be6d
--- /dev/null
+++ b/qpid/python/qpid/ops.py
@@ -0,0 +1,294 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import os, mllib, cPickle as pickle, sys
+from util import fill
+
+class Primitive(object):
+ pass
+
+class Enum(object):
+
+ # XXX: for backwards compatibility
+ def values(cls):
+ print >> sys.stderr, "warning, please use .VALUES instead of .values()"
+ return cls.VALUES
+ # we can't use the backport preprocessor here because this code gets
+ # called by setup.py
+ values = classmethod(values)
+
+class Field:
+
+ def __init__(self, name, type, default=None):
+ self.name = name
+ self.type = type
+ self.default = default
+
+ def __repr__(self):
+ return "%s: %s" % (self.name, self.type)
+
+class Compound(object):
+
+ UNENCODED=[]
+
+ def __init__(self, *args, **kwargs):
+ args = list(args)
+ for f in self.ARGS:
+ if args:
+ a = args.pop(0)
+ else:
+ a = kwargs.pop(f.name, f.default)
+ setattr(self, f.name, a)
+ if args:
+ raise TypeError("%s takes at most %s arguments (%s given))" %
+ (self.__class__.__name__, len(self.ARGS),
+ len(self.ARGS) + len(args)))
+ if kwargs:
+ raise TypeError("got unexpected keyword argument '%s'" % kwargs.keys()[0])
+
+ def fields(self):
+ result = {}
+ for f in self.FIELDS:
+ result[f.name] = getattr(self, f.name)
+ return result
+
+ def args(self):
+ result = {}
+ for f in self.ARGS:
+ result[f.name] = getattr(self, f.name)
+ return result
+
+ def __getitem__(self, attr):
+ return getattr(self, attr)
+
+ def __setitem__(self, attr, value):
+ setattr(self, attr, value)
+
+ def dispatch(self, target, *args):
+ handler = "do_%s" % self.NAME
+ getattr(target, handler)(self, *args)
+
+ def __repr__(self, extras=()):
+ return "%s(%s)" % (self.__class__.__name__,
+ ", ".join(["%s=%r" % (f.name, getattr(self, f.name))
+ for f in self.ARGS
+ if getattr(self, f.name) != f.default]))
+
+class Command(Compound):
+ UNENCODED=[Field("channel", "uint16", 0),
+ Field("id", "sequence-no", None),
+ Field("sync", "bit", False),
+ Field("headers", None, None),
+ Field("payload", None, None)]
+
+class Control(Compound):
+ UNENCODED=[Field("channel", "uint16", 0)]
+
+def pythonize(st):
+ if st is None:
+ return None
+ else:
+ return str(st.replace("-", "_"))
+
+def pydoc(op, children=()):
+ doc = "\n\n".join([fill(p.text(), 0) for p in op.query["doc"]])
+ for ch in children:
+ doc += "\n\n " + pythonize(ch["@name"]) + " -- " + str(ch["@label"])
+ ch_descs ="\n\n".join([fill(p.text(), 4) for p in ch.query["doc"]])
+ if ch_descs:
+ doc += "\n\n" + ch_descs
+ return doc
+
+def studly(st):
+ return "".join([p.capitalize() for p in st.split("-")])
+
+def klass(nd):
+ while nd.parent is not None:
+ if hasattr(nd.parent, "name") and nd.parent.name == "class":
+ return nd.parent
+ else:
+ nd = nd.parent
+
+def included(nd):
+ cls = klass(nd)
+ if cls is None:
+ return True
+ else:
+ return cls["@name"] not in ("file", "stream")
+
+def num(s):
+ if s: return int(s, 0)
+
+def code(nd):
+ c = num(nd["@code"])
+ if c is None:
+ return None
+ else:
+ cls = klass(nd)
+ if cls is None:
+ return c
+ else:
+ return c | (num(cls["@code"]) << 8)
+
+def default(f):
+ if f["@type"] == "bit":
+ return False
+ else:
+ return None
+
+def make_compound(decl, base, domains):
+ dict = {}
+ fields = decl.query["field"]
+ dict["__doc__"] = pydoc(decl, fields)
+ dict["NAME"] = pythonize(decl["@name"])
+ dict["SIZE"] = num(decl["@size"])
+ dict["CODE"] = code(decl)
+ dict["PACK"] = num(decl["@pack"])
+ dict["FIELDS"] = [Field(pythonize(f["@name"]), resolve(f, domains),
+ default(f))
+ for f in fields]
+ dict["ARGS"] = dict["FIELDS"] + base.UNENCODED
+ return str(studly(decl["@name"])), (base,), dict
+
+def make_restricted(decl, domains):
+ name = pythonize(decl["@name"])
+ dict = {}
+ choices = decl.query["choice"]
+ dict["__doc__"] = pydoc(decl, choices)
+ dict["NAME"] = name
+ dict["TYPE"] = str(decl.parent["@type"])
+ values = []
+ for ch in choices:
+ val = int(ch["@value"], 0)
+ dict[pythonize(ch["@name"])] = val
+ values.append(val)
+ dict["VALUES"] = values
+ return name, (Enum,), dict
+
+def make_type(decl, domains):
+ name = pythonize(decl["@name"])
+ dict = {}
+ dict["__doc__"] = pydoc(decl)
+ dict["NAME"] = name
+ dict["CODE"] = code(decl)
+ return str(studly(decl["@name"])), (Primitive,), dict
+
+def make_command(decl, domains):
+ decl.set_attr("name", "%s-%s" % (decl.parent["@name"], decl["@name"]))
+ decl.set_attr("size", "0")
+ decl.set_attr("pack", "2")
+ name, bases, dict = make_compound(decl, Command, domains)
+ dict["RESULT"] = pythonize(decl["result/@type"]) or pythonize(decl["result/struct/@name"])
+ return name, bases, dict
+
+def make_control(decl, domains):
+ decl.set_attr("name", "%s-%s" % (decl.parent["@name"], decl["@name"]))
+ decl.set_attr("size", "0")
+ decl.set_attr("pack", "2")
+ return make_compound(decl, Control, domains)
+
+def make_struct(decl, domains):
+ return make_compound(decl, Compound, domains)
+
+def make_enum(decl, domains):
+ decl.set_attr("name", decl.parent["@name"])
+ return make_restricted(decl, domains)
+
+
+vars = globals()
+
+def make(nd, domains):
+ return vars["make_%s" % nd.name](nd, domains)
+
+def qualify(nd, field="@name"):
+ cls = klass(nd)
+ if cls is None:
+ return pythonize(nd[field])
+ else:
+ return pythonize("%s.%s" % (cls["@name"], nd[field]))
+
+def resolve(nd, domains):
+ candidates = qualify(nd, "@type"), pythonize(nd["@type"])
+ for c in candidates:
+ if domains.has_key(c):
+ while domains.has_key(c):
+ c = domains[c]
+ return c
+ else:
+ return c
+
+def load_types_from_xml(file):
+ spec = mllib.xml_parse(file)
+ domains = dict([(qualify(d), pythonize(d["@type"]))
+ for d in spec.query["amqp/domain", included] + \
+ spec.query["amqp/class/domain", included]])
+ type_decls = \
+ spec.query["amqp/class/command", included] + \
+ spec.query["amqp/class/control", included] + \
+ spec.query["amqp/class/command/result/struct", included] + \
+ spec.query["amqp/class/struct", included] + \
+ spec.query["amqp/class/domain/enum", included] + \
+ spec.query["amqp/domain/enum", included] + \
+ spec.query["amqp/type"]
+ types = [make(nd, domains) for nd in type_decls]
+ return types
+
+def load_types(file):
+ base, ext = os.path.splitext(file)
+ pclfile = "%s.pcl" % base
+ if os.path.exists(pclfile) and \
+ os.path.getmtime(pclfile) > os.path.getmtime(file):
+ f = open(pclfile, "rb")
+ types = pickle.load(f)
+ f.close()
+ else:
+ types = load_types_from_xml(file)
+ if os.access(os.path.dirname(os.path.abspath(pclfile)), os.W_OK):
+ f = open(pclfile, "wb")
+ pickle.dump(types, f)
+ f.close()
+ return types
+
+from specs_config import amqp_spec as file
+types = load_types(file)
+
+ENUMS = {}
+PRIMITIVE = {}
+COMPOUND = {}
+COMMANDS = {}
+CONTROLS = {}
+
+for name, bases, _dict in types:
+ t = type(name, bases, _dict)
+ vars[name] = t
+
+ if issubclass(t, Command):
+ COMMANDS[t.NAME] = t
+ COMMANDS[t.CODE] = t
+ elif issubclass(t, Control):
+ CONTROLS[t.NAME] = t
+ CONTROLS[t.CODE] = t
+ elif issubclass(t, Compound):
+ COMPOUND[t.NAME] = t
+ if t.CODE is not None:
+ COMPOUND[t.CODE] = t
+ elif issubclass(t, Primitive):
+ PRIMITIVE[t.NAME] = t
+ PRIMITIVE[t.CODE] = t
+ elif issubclass(t, Enum):
+ ENUMS[t.NAME] = t
diff --git a/qpid/python/qpid/packer.py b/qpid/python/qpid/packer.py
new file mode 100644
index 0000000000..22c16918dc
--- /dev/null
+++ b/qpid/python/qpid/packer.py
@@ -0,0 +1,36 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import struct
+
+class Packer:
+
+ def read(self, n): abstract
+
+ def write(self, s): abstract
+
+ def unpack(self, fmt):
+ values = struct.unpack(fmt, self.read(struct.calcsize(fmt)))
+ if len(values) == 1:
+ return values[0]
+ else:
+ return values
+
+ def pack(self, fmt, *args):
+ self.write(struct.pack(fmt, *args))
diff --git a/qpid/python/qpid/parser.py b/qpid/python/qpid/parser.py
new file mode 100644
index 0000000000..233f0a8469
--- /dev/null
+++ b/qpid/python/qpid/parser.py
@@ -0,0 +1,68 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+class ParseError(Exception):
+
+ def __init__(self, token, *expected):
+ line, ln, col = token.line_info()
+ exp = ", ".join(map(str, expected))
+ if len(expected) > 1:
+ exp = "(%s)" % exp
+ if expected:
+ msg = "expecting %s, got %s line:%s,%s:%s" % (exp, token, ln, col, line)
+ else:
+ msg = "unexpected token %s line:%s,%s:%s" % (token, ln, col, line)
+ Exception.__init__(self, msg)
+ self.token = token
+ self.expected = expected
+
+class Parser:
+
+ def __init__(self, tokens):
+ self.tokens = tokens
+ self.idx = 0
+
+ def next(self):
+ return self.tokens[self.idx]
+
+ def matches(self, *types):
+ return self.next().type in types
+
+ def eat(self, *types):
+ if types and not self.matches(*types):
+ raise ParseError(self.next(), *types)
+ else:
+ t = self.next()
+ self.idx += 1
+ return t
+
+ def eat_until(self, *types):
+ result = []
+ while not self.matches(*types):
+ result.append(self.eat())
+ return result
+
+ def remove(self, start, end):
+ start_idx = self.tokens.index(start)
+ end_idx = self.tokens.index(end) + 1
+ del self.tokens[start_idx:end_idx]
+ self.idx -= end_idx - start_idx
+
+ def reset(self):
+ self.idx = 0
diff --git a/qpid/python/qpid/peer.py b/qpid/python/qpid/peer.py
new file mode 100644
index 0000000000..fcad0f3ae6
--- /dev/null
+++ b/qpid/python/qpid/peer.py
@@ -0,0 +1,533 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+This module contains a skeletal peer implementation useful for
+implementing an AMQP server, client, or proxy. The peer implementation
+sorts incoming frames to their intended channels, and dispatches
+incoming method frames to a delegate.
+"""
+
+import threading, traceback, socket, sys
+from connection08 import EOF, Method, Header, Body, Request, Response, VersionError
+from message import Message
+from queue import Queue, Closed as QueueClosed
+from content import Content
+from cStringIO import StringIO
+from time import time
+from exceptions import Closed, Timeout
+from logging import getLogger
+
+log = getLogger("qpid.peer")
+
+class Sequence:
+
+ def __init__(self, start, step = 1):
+ # we should keep start for wrap around
+ self._next = start
+ self.step = step
+ self.lock = threading.Lock()
+
+ def next(self):
+ self.lock.acquire()
+ try:
+ result = self._next
+ self._next += self.step
+ return result
+ finally:
+ self.lock.release()
+
+class Peer:
+
+ def __init__(self, conn, delegate, channel_factory=None, channel_options=None):
+ self.conn = conn
+ self.delegate = delegate
+ self.outgoing = Queue(0)
+ self.work = Queue(0)
+ self.channels = {}
+ self.lock = threading.Lock()
+ if channel_factory:
+ self.channel_factory = channel_factory
+ else:
+ self.channel_factory = Channel
+ if channel_options is None:
+ channel_options = {}
+ self.channel_options = channel_options
+
+ def channel(self, id):
+ self.lock.acquire()
+ try:
+ try:
+ ch = self.channels[id]
+ except KeyError:
+ ch = self.channel_factory(id, self.outgoing, self.conn.spec, self.channel_options)
+ self.channels[id] = ch
+ finally:
+ self.lock.release()
+ return ch
+
+ def start(self):
+ self.writer_thread = threading.Thread(target=self.writer)
+ self.writer_thread.daemon = True
+ self.writer_thread.start()
+
+ self.reader_thread = threading.Thread(target=self.reader)
+ self.reader_thread.daemon = True
+ self.reader_thread.start()
+
+ self.worker_thread = threading.Thread(target=self.worker)
+ self.worker_thread.daemon = True
+ self.worker_thread.start()
+
+ def fatal(self, message=None):
+ """Call when an unexpected exception occurs that will kill a thread."""
+ self.closed("Fatal error: %s\n%s" % (message or "", traceback.format_exc()))
+
+ def reader(self):
+ try:
+ while True:
+ try:
+ frame = self.conn.read()
+ except EOF, e:
+ self.work.close()
+ break
+ ch = self.channel(frame.channel)
+ ch.receive(frame, self.work)
+ except VersionError, e:
+ self.closed(e)
+ except:
+ self.fatal()
+
+ def closed(self, reason):
+ # We must close the delegate first because closing channels
+ # may wake up waiting threads and we don't want them to see
+ # the delegate as open.
+ self.delegate.closed(reason)
+ for ch in self.channels.values():
+ ch.closed(reason)
+
+ def writer(self):
+ try:
+ while True:
+ try:
+ message = self.outgoing.get()
+ self.conn.write(message)
+ except socket.error, e:
+ self.closed(e)
+ break
+ self.conn.flush()
+ except QueueClosed:
+ pass
+ except:
+ self.fatal()
+
+ def worker(self):
+ try:
+ while True:
+ queue = self.work.get()
+ frame = queue.get()
+ channel = self.channel(frame.channel)
+ if frame.method_type.content:
+ content = read_content(queue)
+ else:
+ content = None
+
+ self.delegate(channel, Message(channel, frame, content))
+ except QueueClosed:
+ self.closed("worker closed")
+ except:
+ self.fatal()
+
+ def stop(self):
+ try:
+ self.work.close();
+ self.outgoing.close();
+ self.conn.close();
+ finally:
+ timeout = 1;
+ self.worker_thread.join(timeout);
+ if self.worker_thread.isAlive():
+ log.warn("Worker thread failed to shutdown within timeout")
+ self.reader_thread.join(timeout);
+ if self.reader_thread.isAlive():
+ log.warn("Reader thread failed to shutdown within timeout")
+ self.writer_thread.join(timeout);
+ if self.writer_thread.isAlive():
+ log.warn("Writer thread failed to shutdown within timeout")
+
+class Requester:
+
+ def __init__(self, writer):
+ self.write = writer
+ self.sequence = Sequence(1)
+ self.mark = 0
+ # request_id -> listener
+ self.outstanding = {}
+
+ def request(self, method, listener, content = None):
+ frame = Request(self.sequence.next(), self.mark, method)
+ self.outstanding[frame.id] = listener
+ self.write(frame, content)
+
+ def receive(self, channel, frame):
+ listener = self.outstanding.pop(frame.request_id)
+ listener(channel, frame)
+
+class Responder:
+
+ def __init__(self, writer):
+ self.write = writer
+ self.sequence = Sequence(1)
+
+ def respond(self, method, batch, request):
+ if isinstance(request, Method):
+ self.write(method)
+ else:
+ # allow batching from frame at either end
+ if batch<0:
+ frame = Response(self.sequence.next(), request.id+batch, -batch, method)
+ else:
+ frame = Response(self.sequence.next(), request.id, batch, method)
+ self.write(frame)
+
+class Channel:
+
+ def __init__(self, id, outgoing, spec, options):
+ self.id = id
+ self.outgoing = outgoing
+ self.spec = spec
+ self.incoming = Queue(0)
+ self.responses = Queue(0)
+ self.queue = None
+ self.content_queue = None
+ self._closed = False
+ self.reason = None
+
+ self.requester = Requester(self.write)
+ self.responder = Responder(self.write)
+
+ self.completion = OutgoingCompletion()
+ self.incoming_completion = IncomingCompletion(self)
+ self.futures = {}
+ self.control_queue = Queue(0)#used for incoming methods that appas may want to handle themselves
+
+ self.invoker = self.invoke_method
+ self.use_execution_layer = (spec.major == 0 and spec.minor == 10) or (spec.major == 99 and spec.minor == 0)
+ self.synchronous = True
+
+ self._flow_control_wait_failure = options.get("qpid.flow_control_wait_failure", 60)
+ self._flow_control_wait_condition = threading.Condition()
+ self._flow_control = False
+
+ def closed(self, reason):
+ if self._closed:
+ return
+ self._closed = True
+ self.reason = reason
+ self.incoming.close()
+ self.responses.close()
+ self.completion.close()
+ self.incoming_completion.reset()
+ for f in self.futures.values():
+ f.put_response(self, reason)
+
+ def write(self, frame, content = None):
+ if self._closed:
+ raise Closed(self.reason)
+ frame.channel = self.id
+ self.outgoing.put(frame)
+ if (isinstance(frame, (Method, Request))
+ and content == None
+ and frame.method_type.content):
+ content = Content()
+ if content != None:
+ self.write_content(frame.method_type.klass, content)
+
+ def write_content(self, klass, content):
+ header = Header(klass, content.weight(), content.size(), content.properties)
+ self.write(header)
+ for child in content.children:
+ self.write_content(klass, child)
+ # should split up if content.body exceeds max frame size
+ if content.body:
+ self.write(Body(content.body))
+
+ def receive(self, frame, work):
+ if isinstance(frame, Method):
+ if frame.method_type.content:
+ if frame.method.response:
+ self.content_queue = self.responses
+ else:
+ self.content_queue = self.incoming
+ if frame.method.response:
+ self.queue = self.responses
+ else:
+ self.queue = self.incoming
+ work.put(self.incoming)
+ elif isinstance(frame, Request):
+ self.queue = self.incoming
+ work.put(self.incoming)
+ elif isinstance(frame, Response):
+ self.requester.receive(self, frame)
+ if frame.method_type.content:
+ self.queue = self.responses
+ return
+ elif isinstance(frame, Body) or isinstance(frame, Header):
+ self.queue = self.content_queue
+ self.queue.put(frame)
+
+ def queue_response(self, channel, frame):
+ channel.responses.put(frame.method)
+
+ def request(self, method, listener, content = None):
+ self.requester.request(method, listener, content)
+
+ def respond(self, method, batch, request):
+ self.responder.respond(method, batch, request)
+
+ def invoke(self, type, args, kwargs):
+ if (type.klass.name in ["channel", "session"]) and (type.name in ["close", "open", "closed"]):
+ self.completion.reset()
+ self.incoming_completion.reset()
+ self.completion.next_command(type)
+
+ content = kwargs.pop("content", None)
+ frame = Method(type, type.arguments(*args, **kwargs))
+ return self.invoker(frame, content)
+
+ # used for 0-9
+ def invoke_reliable(self, frame, content = None):
+ if not self.synchronous:
+ future = Future()
+ self.request(frame, future.put_response, content)
+ if not frame.method.responses: return None
+ else: return future
+
+ self.request(frame, self.queue_response, content)
+ if not frame.method.responses:
+ if self.use_execution_layer and frame.method_type.is_l4_command():
+ self.execution_sync()
+ self.completion.wait()
+ if self._closed:
+ raise Closed(self.reason)
+ return None
+ try:
+ resp = self.responses.get()
+ if resp.method_type.content:
+ return Message(self, resp, read_content(self.responses))
+ else:
+ return Message(self, resp)
+ except QueueClosed, e:
+ if self._closed:
+ raise Closed(self.reason)
+ else:
+ raise e
+
+ # used for 0-8 and 0-10
+ def invoke_method(self, frame, content = None):
+ if frame.method.result:
+ cmd_id = self.completion.command_id
+ future = Future()
+ self.futures[cmd_id] = future
+
+ if frame.method.klass.name == "basic" and frame.method.name == "publish":
+ self._flow_control_wait_condition.acquire()
+ try:
+ self.check_flow_control()
+ self.write(frame, content)
+ finally:
+ self._flow_control_wait_condition.release()
+ else:
+ self.write(frame, content)
+
+ try:
+ # here we depend on all nowait fields being named nowait
+ f = frame.method.fields.byname["nowait"]
+ nowait = frame.args[frame.method.fields.index(f)]
+ except KeyError:
+ nowait = False
+
+ try:
+ if not nowait and frame.method.responses:
+ resp = self.responses.get()
+ if resp.method.content:
+ content = read_content(self.responses)
+ else:
+ content = None
+ if resp.method in frame.method.responses:
+ return Message(self, resp, content)
+ else:
+ raise ValueError(resp)
+ elif frame.method.result:
+ if self.synchronous:
+ fr = future.get_response(timeout=10)
+ if self._closed:
+ raise Closed(self.reason)
+ return fr
+ else:
+ return future
+ elif self.synchronous and not frame.method.response \
+ and self.use_execution_layer and frame.method.is_l4_command():
+ self.execution_sync()
+ completed = self.completion.wait(timeout=10)
+ if self._closed:
+ raise Closed(self.reason)
+ if not completed:
+ self.closed("Timed-out waiting for completion of %s" % frame)
+ except QueueClosed, e:
+ if self._closed:
+ raise Closed(self.reason)
+ else:
+ raise e
+
+ # part of flow control for AMQP 0-8, 0-9, and 0-9-1
+ def set_flow_control(self, value):
+ self._flow_control_wait_condition.acquire()
+ self._flow_control = value
+ if value == False:
+ self._flow_control_wait_condition.notify()
+ self._flow_control_wait_condition.release()
+
+ # part of flow control for AMQP 0-8, 0-9, and 0-9-1
+ def check_flow_control(self):
+ if self._flow_control:
+ self._flow_control_wait_condition.wait(self._flow_control_wait_failure)
+ if self._flow_control:
+ raise Timeout("Unable to send message for " + str(self._flow_control_wait_failure) + " seconds due to broker enforced flow control")
+
+ def __getattr__(self, name):
+ type = self.spec.method(name)
+ if type == None: raise AttributeError(name)
+ method = lambda *args, **kwargs: self.invoke(type, args, kwargs)
+ self.__dict__[name] = method
+ return method
+
+def read_content(queue):
+ header = queue.get()
+ children = []
+ for i in range(header.weight):
+ children.append(read_content(queue))
+ buf = StringIO()
+ readbytes = 0
+ while readbytes < header.size:
+ body = queue.get()
+ content = body.content
+ buf.write(content)
+ readbytes += len(content)
+ return Content(buf.getvalue(), children, header.properties.copy())
+
+class Future:
+ def __init__(self):
+ self.completed = threading.Event()
+
+ def put_response(self, channel, response):
+ self.response = response
+ self.completed.set()
+
+ def get_response(self, timeout=None):
+ self.completed.wait(timeout)
+ if self.completed.isSet():
+ return self.response
+ else:
+ return None
+
+ def is_complete(self):
+ return self.completed.isSet()
+
+class OutgoingCompletion:
+ """
+ Manages completion of outgoing commands i.e. command sent by this peer
+ """
+
+ def __init__(self):
+ self.condition = threading.Condition()
+
+ #todo, implement proper wraparound
+ self.sequence = Sequence(0) #issues ids for outgoing commands
+ self.command_id = -1 #last issued id
+ self.mark = -1 #commands up to this mark are known to be complete
+ self._closed = False
+
+ def next_command(self, method):
+ #the following test is a hack until the track/sub-channel is available
+ if method.is_l4_command():
+ self.command_id = self.sequence.next()
+
+ def reset(self):
+ self.sequence = Sequence(0) #reset counter
+
+ def close(self):
+ self.reset()
+ self.condition.acquire()
+ try:
+ self._closed = True
+ self.condition.notifyAll()
+ finally:
+ self.condition.release()
+
+ def complete(self, mark):
+ self.condition.acquire()
+ try:
+ self.mark = mark
+ #print "set mark to %s [%s] " % (self.mark, self)
+ self.condition.notifyAll()
+ finally:
+ self.condition.release()
+
+ def wait(self, point_of_interest=-1, timeout=None):
+ if point_of_interest == -1: point_of_interest = self.command_id
+ start_time = time()
+ remaining = timeout
+ self.condition.acquire()
+ try:
+ while not self._closed and point_of_interest > self.mark:
+ #print "waiting for %s, mark = %s [%s]" % (point_of_interest, self.mark, self)
+ self.condition.wait(remaining)
+ if not self._closed and point_of_interest > self.mark and timeout:
+ if (start_time + timeout) < time(): break
+ else: remaining = timeout - (time() - start_time)
+ finally:
+ self.condition.release()
+ return point_of_interest <= self.mark
+
+class IncomingCompletion:
+ """
+ Manages completion of incoming commands i.e. command received by this peer
+ """
+
+ def __init__(self, channel):
+ self.sequence = Sequence(0) #issues ids for incoming commands
+ self.mark = -1 #id of last command of whose completion notification was sent to the other peer
+ self.channel = channel
+
+ def reset(self):
+ self.sequence = Sequence(0) #reset counter
+
+ def complete(self, mark, cumulative=True):
+ if cumulative:
+ if mark > self.mark:
+ self.mark = mark
+ self.channel.execution_complete(cumulative_execution_mark=self.mark)
+ else:
+ #TODO: record and manage the ranges properly
+ range = [mark, mark]
+ if (self.mark == -1):#hack until wraparound is implemented
+ self.channel.execution_complete(cumulative_execution_mark=0xFFFFFFFFL, ranged_execution_set=range)
+ else:
+ self.channel.execution_complete(cumulative_execution_mark=self.mark, ranged_execution_set=range)
diff --git a/qpid/python/qpid/queue.py b/qpid/python/qpid/queue.py
new file mode 100644
index 0000000000..63a7684843
--- /dev/null
+++ b/qpid/python/qpid/queue.py
@@ -0,0 +1,88 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+This module augments the standard python multithreaded Queue
+implementation to add a close() method so that threads blocking on the
+content of a queue can be notified if the queue is no longer in use.
+"""
+
+from Queue import Queue as BaseQueue, Empty, Full
+from threading import Thread
+from exceptions import Closed
+
+class Queue(BaseQueue):
+
+ END = object()
+ STOP = object()
+
+ def __init__(self, *args, **kwargs):
+ BaseQueue.__init__(self, *args, **kwargs)
+ self.error = None
+ self.listener = None
+ self.exc_listener = None
+ self.thread = None
+
+ def close(self, error = None):
+ self.error = error
+ self.put(Queue.END)
+ if self.thread is not None:
+ self.thread.join()
+ self.thread = None
+
+ def get(self, block = True, timeout = None):
+ result = BaseQueue.get(self, block, timeout)
+ if result == Queue.END:
+ # this guarantees that any other waiting threads or any future
+ # calls to get will also result in a Closed exception
+ self.put(Queue.END)
+ raise Closed(self.error)
+ else:
+ return result
+
+ def listen(self, listener, exc_listener = None):
+ if listener is None and exc_listener is not None:
+ raise ValueError("cannot set exception listener without setting listener")
+
+ if listener is None:
+ if self.thread is not None:
+ self.put(Queue.STOP)
+ # loop and timed join permit keyboard interrupts to work
+ while self.thread.isAlive():
+ self.thread.join(3)
+ self.thread = None
+
+ self.listener = listener
+ self.exc_listener = exc_listener
+
+ if listener is not None and self.thread is None:
+ self.thread = Thread(target = self.run)
+ self.thread.setDaemon(True)
+ self.thread.start()
+
+ def run(self):
+ while True:
+ try:
+ o = self.get()
+ if o == Queue.STOP: break
+ self.listener(o)
+ except Closed, e:
+ if self.exc_listener is not None:
+ self.exc_listener(e)
+ break
diff --git a/qpid/python/qpid/reference.py b/qpid/python/qpid/reference.py
new file mode 100644
index 0000000000..48ecb67656
--- /dev/null
+++ b/qpid/python/qpid/reference.py
@@ -0,0 +1,117 @@
+#!/usr/bin/env python
+
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+Support for amqp 'reference' content (as opposed to inline content)
+"""
+
+import threading
+from queue import Queue, Closed
+
+class NotOpened(Exception): pass
+
+class AlreadyOpened(Exception): pass
+
+"""
+A representation of a reference id; can be passed wherever amqp
+content is required in place of inline data
+"""
+class ReferenceId:
+
+ def __init__(self, id):
+ self.id = id
+
+"""
+Holds content received through 'reference api'. Instances of this
+class will be placed in the consumers queue on receiving a transfer
+(assuming the reference has been opened). Data can be retrieved in
+chunks (as append calls are received) or in full (after reference has
+been closed signalling data s complete).
+"""
+
+class Reference:
+
+ def __init__(self, id):
+ self.id = id
+ self.chunks = Queue(0)
+
+ def close(self):
+ self.chunks.close()
+
+ def append(self, bytes):
+ self.chunks.put(bytes)
+
+ def get_chunk(self):
+ return self.chunks.get()
+
+ def get_complete(self):
+ data = ""
+ for chunk in self:
+ data += chunk
+ return data
+
+ def next(self):
+ try:
+ return self.get_chunk()
+ except Closed, e:
+ raise StopIteration
+
+ def __iter__(self):
+ return self
+
+"""
+Manages a set of opened references. New references can be opened and
+existing references can be retrieved or closed.
+"""
+class References:
+
+ def __init__(self):
+ self.map = {}
+ self.lock = threading.Lock()
+
+ def get(self, id):
+ self.lock.acquire()
+ try:
+ try:
+ ref = self.map[id]
+ except KeyError:
+ raise NotOpened()
+ finally:
+ self.lock.release()
+ return ref
+
+ def open(self, id):
+ self.lock.acquire()
+ try:
+ if id in self.map: raise AlreadyOpened()
+ self.map[id] = Reference(id)
+ finally:
+ self.lock.release()
+
+
+ def close(self, id):
+ self.get(id).close()
+ self.lock.acquire()
+ try:
+ self.map.pop(id)
+ finally:
+ self.lock.release()
+
diff --git a/qpid/python/qpid/sasl.py b/qpid/python/qpid/sasl.py
new file mode 100644
index 0000000000..a2147e3cc4
--- /dev/null
+++ b/qpid/python/qpid/sasl.py
@@ -0,0 +1,119 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import socket
+
+class SASLError(Exception):
+ pass
+
+class WrapperClient:
+
+ def __init__(self):
+ self._cli = _Client()
+
+ def setAttr(self, name, value):
+ # Allow unicode user names and passwords
+ if isinstance(value, unicode):
+ value = value.encode('utf8')
+ status = self._cli.setAttr(str(name), str(value))
+ if status and name == 'username':
+ status = self._cli.setAttr('externaluser', str(value))
+
+ if not status:
+ raise SASLError(self._cli.getError())
+
+ def init(self):
+ status = self._cli.init()
+ if not status:
+ raise SASLError(self._cli.getError())
+
+ def start(self, mechanisms):
+ status, mech, initial = self._cli.start(str(mechanisms))
+ if status:
+ return mech, initial
+ else:
+ raise SASLError(self._cli.getError())
+
+ def step(self, challenge):
+ status, response = self._cli.step(challenge)
+ if status:
+ return response
+ else:
+ raise SASLError(self._cli.getError())
+
+ def encode(self, bytes):
+ status, result = self._cli.encode(bytes)
+ if status:
+ return result
+ else:
+ raise SASLError(self._cli.getError())
+
+ def decode(self, bytes):
+ status, result = self._cli.decode(bytes)
+ if status:
+ return result
+ else:
+ raise SASLError(self._cli.getError())
+
+ def auth_username(self):
+ status, result = self._cli.getUserId()
+ if status:
+ return result
+ else:
+ raise SASLError(self._cli.getError())
+
+class PlainClient:
+
+ def __init__(self):
+ self.attrs = {}
+
+ def setAttr(self, name, value):
+ self.attrs[name] = value
+
+ def init(self):
+ pass
+
+ def start(self, mechanisms):
+ mechs = mechanisms.split()
+ if self.attrs.get("username") and "PLAIN" in mechs:
+ return "PLAIN", "\0%s\0%s" % (self.attrs.get("username"), self.attrs.get("password"))
+ elif "ANONYMOUS" in mechs:
+ return "ANONYMOUS", "%s@%s" % (self.attrs.get("username"), socket.gethostname())
+ elif "EXTERNAL" in mechs:
+ return "EXTERNAL", "%s" % (self.attrs.get("username"))
+ else:
+ raise SASLError("sasl negotiation failed: no mechanism agreed")
+
+ def step(self, challenge):
+ pass
+
+ def encode(self, bytes):
+ return bytes
+
+ def decode(self, bytes):
+ return bytes
+
+ def auth_username(self):
+ return self.attrs.get("username")
+
+try:
+ from saslwrapper import Client as _Client
+ Client = WrapperClient
+except ImportError:
+ Client = PlainClient
diff --git a/qpid/python/qpid/saslmech/__init__.py b/qpid/python/qpid/saslmech/__init__.py
new file mode 100644
index 0000000000..ebcab03ca2
--- /dev/null
+++ b/qpid/python/qpid/saslmech/__init__.py
@@ -0,0 +1,22 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""Pure python implementations of SASL mechanisms"""
+
+
diff --git a/qpid/python/qpid/saslmech/amqplain.py b/qpid/python/qpid/saslmech/amqplain.py
new file mode 100644
index 0000000000..731f6b6628
--- /dev/null
+++ b/qpid/python/qpid/saslmech/amqplain.py
@@ -0,0 +1,28 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from sasl import Sasl
+
+class AMQPLAIN(Sasl):
+
+ def initialResponse(self):
+ return {"LOGIN": self.user, "PASSWORD": self.password}
+
+ def priority(self):
+ return 0 \ No newline at end of file
diff --git a/qpid/python/qpid/saslmech/anonymous.py b/qpid/python/qpid/saslmech/anonymous.py
new file mode 100644
index 0000000000..1002a3aa0a
--- /dev/null
+++ b/qpid/python/qpid/saslmech/anonymous.py
@@ -0,0 +1,27 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from sasl import Sasl
+
+class ANONYMOUS(Sasl):
+
+ def prerequisitesOk(self):
+ return True
+
+
diff --git a/qpid/python/qpid/saslmech/cram_md5.py b/qpid/python/qpid/saslmech/cram_md5.py
new file mode 100644
index 0000000000..a351f43838
--- /dev/null
+++ b/qpid/python/qpid/saslmech/cram_md5.py
@@ -0,0 +1,27 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from sasl import Sasl
+from hmac import HMAC
+
+class CRAM_MD5(Sasl):
+
+ def response(self, challenge):
+ digest = HMAC( self.password, challenge).hexdigest()
+ return "%s %s" % (self.user, digest)
diff --git a/qpid/python/qpid/saslmech/cram_md5_hex.py b/qpid/python/qpid/saslmech/cram_md5_hex.py
new file mode 100644
index 0000000000..03463db083
--- /dev/null
+++ b/qpid/python/qpid/saslmech/cram_md5_hex.py
@@ -0,0 +1,30 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from sasl import Sasl
+from hmac import HMAC
+from hashlib import md5
+
+class CRAM_MD5_HEX(Sasl):
+
+ def response(self, challenge):
+ m = md5()
+ m.update(self.password)
+ digest = HMAC( m.hexdigest(), challenge).hexdigest()
+ return "%s %s" % (self.user, digest)
diff --git a/qpid/python/qpid/saslmech/external.py b/qpid/python/qpid/saslmech/external.py
new file mode 100644
index 0000000000..51c8d97530
--- /dev/null
+++ b/qpid/python/qpid/saslmech/external.py
@@ -0,0 +1,27 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from sasl import Sasl
+
+
+class EXTERNAL(Sasl):
+ """Sasl mechanism used when SSL with client-auth is in use"""
+
+ def prerequisitesOk(self):
+ return True
diff --git a/qpid/python/qpid/saslmech/finder.py b/qpid/python/qpid/saslmech/finder.py
new file mode 100644
index 0000000000..1dda9ec48f
--- /dev/null
+++ b/qpid/python/qpid/saslmech/finder.py
@@ -0,0 +1,66 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+
+from logging import getLogger
+
+log = getLogger("qpid.saslmech")
+
+def get_sasl_mechanism(mechanismNames, username, password, namespace="qpid.saslmech", sasl_options=None):
+ """Given a list of SASL mechanism names, dynamically loads a SASL implementation
+ from namespace qpid.sasl.mech respecting a mechanism priority"""
+
+ log.debug("Supported mechanism : %s", mechanismNames)
+
+ instances = []
+ for mechanismName in mechanismNames:
+ convertedName = mechanismName.replace("-","_")
+ canonicalName = "%s.%s.%s" % (namespace, convertedName.lower(), convertedName)
+ try:
+ log.debug("Checking for SASL implementation %s for mechanism %s", canonicalName, mechanismName)
+ clazz = _get_class(canonicalName)
+ log.debug("Found SASL implementation")
+ instance = clazz(username, password, mechanismName, sasl_options)
+ if (instance.prerequisitesOk()):
+ instances.append(instance)
+ else:
+ log.debug("SASL mechanism %s unavailable as the prerequistes for this mechanism have not been met", mechanismName)
+ except (ImportError, AttributeError), e:
+ # Unknown mechanism - this is normal if the server supports mechanism that the client does not
+ log.debug("Could not load implementation for %s", canonicalName)
+ pass
+
+ if instances:
+ instances.sort(key=lambda x : x.priority(), reverse=True)
+ sasl = instances[0]
+ log.debug("Selected SASL mechanism %s", sasl.mechanismName())
+ return sasl
+ else:
+ return None
+
+def _get_class( kls ):
+ parts = kls.split('.')
+ module = ".".join(parts[:-1])
+ m = __import__( module )
+ for comp in parts[1:]:
+ m = getattr(m, comp)
+ return m
+
+
+
diff --git a/qpid/python/qpid/saslmech/plain.py b/qpid/python/qpid/saslmech/plain.py
new file mode 100644
index 0000000000..8e6fb74f33
--- /dev/null
+++ b/qpid/python/qpid/saslmech/plain.py
@@ -0,0 +1,28 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from sasl import Sasl
+
+class PLAIN(Sasl):
+
+ def initialResponse(self):
+ return "\x00" + self.user + "\x00" + self.password
+
+ def priority(self):
+ return 0 \ No newline at end of file
diff --git a/qpid/python/qpid/saslmech/sasl.py b/qpid/python/qpid/saslmech/sasl.py
new file mode 100644
index 0000000000..7b1ae058db
--- /dev/null
+++ b/qpid/python/qpid/saslmech/sasl.py
@@ -0,0 +1,44 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+class SaslException(Exception): pass
+
+class Sasl:
+
+ def __init__(self, user, password, name, sasl_options = None):
+ self.user = user
+ self.password = password
+ self.name = name
+ self.sasl_options = sasl_options
+
+ def prerequisitesOk(self):
+ return self.user is not None and self.password is not None
+
+ def initialResponse(self):
+ return
+
+ def response(self, challenge):
+ return
+
+ def priority(self):
+ """Priority of the mechanism. Mechanism with a higher value will be chosen in preference to those with a lower priority"""
+ return 1
+
+ def mechanismName(self):
+ return self.name
diff --git a/qpid/python/qpid/saslmech/scram.py b/qpid/python/qpid/saslmech/scram.py
new file mode 100644
index 0000000000..11a2d2fbe4
--- /dev/null
+++ b/qpid/python/qpid/saslmech/scram.py
@@ -0,0 +1,91 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from hmac import HMAC
+from binascii import b2a_hex
+from sasl import Sasl
+import os
+import base64
+
+class SCRAM_base(Sasl):
+
+ def __init__(self, algorithm, user, password, name, sasl_options=None):
+ Sasl.__init__(self, user, password, name, sasl_options)
+ self.algorithm = algorithm
+ self.client_nonce = b2a_hex(os.urandom(16))
+ self.server_signature = None
+
+ def initialResponse(self):
+ name = self.user.replace("=","=3D").replace(",","=2C")
+ self.client_first_message = "n=" + name + ",r=" + self.client_nonce
+ return "n,," + self.client_first_message
+
+
+ def response(self, challenge):
+ if(self.server_signature):
+ self.evaluateOutcome(challenge)
+ return ""
+ else:
+ serverChallenge, salt, iterations = challenge.split(",")
+ self.server_nonce = serverChallenge[2:]
+ if self.server_nonce.find(self.client_nonce) != 0:
+ raise SaslException("Server nonce does not start with client nonce")
+ self.salt = base64.b64decode(salt[2:])
+
+ iterations = int(iterations[2:])
+
+ hmac = HMAC(key=self.password.replace("=","=3D").replace(",","=2C"),digestmod=self.algorithm)
+
+ hmac.update(self.salt)
+ hmac.update("\x00\x00\x00\x01")
+
+ saltedPassword = hmac.digest()
+ previous = saltedPassword
+
+ for i in range(1,iterations):
+ hmac = HMAC(key=self.password.replace("=","=3D").replace(",","=2C"),digestmod=self.algorithm)
+ hmac.update(previous)
+ previous = hmac.digest()
+ saltedPassword = ''.join(chr(ord(a) ^ ord(b)) for a,b in zip(saltedPassword,previous))
+
+ clientFinalMessageWithoutProof = "c=" + base64.b64encode("n,,") + ",r=" + self.server_nonce
+ authMessage = self.client_first_message + "," + challenge + "," + clientFinalMessageWithoutProof
+
+ clientKey = HMAC(key=saltedPassword,msg="Client Key",digestmod=self.algorithm).digest()
+ hashFunc = self.algorithm()
+ hashFunc.update(clientKey)
+ storedKey = hashFunc.digest()
+
+ clientSignature = HMAC(key=storedKey, msg=authMessage, digestmod=self.algorithm).digest()
+
+ clientProof = ''.join(chr(ord(a) ^ ord(b)) for a,b in zip(clientKey,clientSignature))
+
+ serverKey = HMAC(key=saltedPassword,msg="Server Key",digestmod=self.algorithm).digest()
+
+ self.server_signature = HMAC(key=serverKey,msg=authMessage,digestmod=self.algorithm).digest()
+ return clientFinalMessageWithoutProof + ",p=" + base64.b64encode(clientProof)
+
+
+ def evaluateOutcome(self, challenge):
+ serverVerification = challenge.split(",")[0]
+
+ serverSignature = base64.b64decode(serverVerification[2:])
+ if serverSignature != self.server_signature:
+ raise SaslException("Server verification failed")
+ return
diff --git a/qpid/python/qpid/saslmech/scram_sha_1.py b/qpid/python/qpid/saslmech/scram_sha_1.py
new file mode 100644
index 0000000000..83f58f8e76
--- /dev/null
+++ b/qpid/python/qpid/saslmech/scram_sha_1.py
@@ -0,0 +1,27 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from scram import SCRAM_base
+from hashlib import sha1
+
+class SCRAM_SHA_1(SCRAM_base):
+
+ def __init__(self, user, password, name, sasl_options=None):
+ SCRAM_base.__init__(self, sha1, user, password, name, sasl_options)
+
diff --git a/qpid/python/qpid/saslmech/scram_sha_256.py b/qpid/python/qpid/saslmech/scram_sha_256.py
new file mode 100644
index 0000000000..cc894895c0
--- /dev/null
+++ b/qpid/python/qpid/saslmech/scram_sha_256.py
@@ -0,0 +1,25 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from scram import SCRAM_base
+import hashlib
+
+class SCRAM_SHA_256(SCRAM_base):
+ def __init__(self, user, password, name, sasl_options=None):
+ SCRAM_base.__init__(self,hashlib.sha256,user,password, name, sasl_options) \ No newline at end of file
diff --git a/qpid/python/qpid/selector.py b/qpid/python/qpid/selector.py
new file mode 100644
index 0000000000..d2f4c1fc88
--- /dev/null
+++ b/qpid/python/qpid/selector.py
@@ -0,0 +1,153 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import atexit, time, errno, os
+from compat import select, set, selectable_waiter
+from threading import Thread, Lock
+
+class Acceptor:
+
+ def __init__(self, sock, handler):
+ self.sock = sock
+ self.handler = handler
+
+ def fileno(self):
+ return self.sock.fileno()
+
+ def reading(self):
+ return True
+
+ def writing(self):
+ return False
+
+ def readable(self):
+ sock, addr = self.sock.accept()
+ self.handler(sock)
+
+class Selector:
+
+ lock = Lock()
+ DEFAULT = None
+ _current_pid = None
+
+ @staticmethod
+ def default():
+ Selector.lock.acquire()
+ try:
+ if Selector.DEFAULT is None or Selector._current_pid != os.getpid():
+ sel = Selector()
+ atexit.register(sel.stop)
+ sel.start()
+ Selector.DEFAULT = sel
+ Selector._current_pid = os.getpid()
+ return Selector.DEFAULT
+ finally:
+ Selector.lock.release()
+
+ def __init__(self):
+ self.selectables = set()
+ self.reading = set()
+ self.writing = set()
+ self.waiter = selectable_waiter()
+ self.reading.add(self.waiter)
+ self.stopped = False
+ self.thread = None
+
+ def wakeup(self):
+ self.waiter.wakeup()
+
+ def register(self, selectable):
+ self.selectables.add(selectable)
+ self.modify(selectable)
+
+ def _update(self, selectable):
+ if selectable.reading():
+ self.reading.add(selectable)
+ else:
+ self.reading.discard(selectable)
+ if selectable.writing():
+ self.writing.add(selectable)
+ else:
+ self.writing.discard(selectable)
+ return selectable.timing()
+
+ def modify(self, selectable):
+ self._update(selectable)
+ self.wakeup()
+
+ def unregister(self, selectable):
+ self.reading.discard(selectable)
+ self.writing.discard(selectable)
+ self.selectables.discard(selectable)
+ self.wakeup()
+
+ def start(self):
+ self.stopped = False
+ self.thread = Thread(target=self.run)
+ self.thread.setDaemon(True)
+ self.thread.start();
+
+ def run(self):
+ while not self.stopped:
+ wakeup = None
+ for sel in self.selectables.copy():
+ t = self._update(sel)
+ if t is not None:
+ if wakeup is None:
+ wakeup = t
+ else:
+ wakeup = min(wakeup, t)
+
+ rd = []
+ wr = []
+ ex = []
+
+ while True:
+ try:
+ if wakeup is None:
+ timeout = None
+ else:
+ timeout = max(0, wakeup - time.time())
+ rd, wr, ex = select(self.reading, self.writing, (), timeout)
+ break
+ except Exception, (err, strerror):
+ # Repeat the select call if we were interrupted.
+ if err == errno.EINTR:
+ continue
+ else:
+ raise
+
+ for sel in wr:
+ if sel.writing():
+ sel.writeable()
+
+ for sel in rd:
+ if sel.reading():
+ sel.readable()
+
+ now = time.time()
+ for sel in self.selectables.copy():
+ w = sel.timing()
+ if w is not None and now > w:
+ sel.timeout()
+
+ def stop(self, timeout=None):
+ self.stopped = True
+ self.wakeup()
+ self.thread.join(timeout)
+ self.thread = None
diff --git a/qpid/python/qpid/session.py b/qpid/python/qpid/session.py
new file mode 100644
index 0000000000..95714a128a
--- /dev/null
+++ b/qpid/python/qpid/session.py
@@ -0,0 +1,308 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from threading import Condition, RLock, Lock, currentThread
+from generator import command_invoker
+from datatypes import RangedSet, Struct, Future
+from codec010 import StringCodec
+from queue import Queue
+from datatypes import Message, serial
+from ops import Command, MessageTransfer
+from util import wait, notify
+from exceptions import *
+from logging import getLogger
+
+log = getLogger("qpid.io.cmd")
+msg = getLogger("qpid.io.msg")
+
+class SessionException(Exception): pass
+class SessionClosed(SessionException): pass
+class SessionDetached(SessionException): pass
+
+def client(*args):
+ return Client(*args)
+
+def server(*args):
+ return Server(*args)
+
+INCOMPLETE = object()
+
+class Session(command_invoker()):
+
+ def __init__(self, name, auto_sync=True, timeout=10, delegate=client):
+ self.name = name
+ self.auto_sync = auto_sync
+ self.need_sync = True
+ self.timeout = timeout
+ self.channel = None
+ self.invoke_lock = Lock()
+ self._closing = False
+ self._closed = False
+
+ self.condition = Condition()
+
+ self.send_id = True
+ self.receiver = Receiver(self)
+ self.sender = Sender(self)
+
+ self.lock = RLock()
+ self._incoming = {}
+ self.results = {}
+ self.exceptions = []
+
+ self.delegate = delegate(self)
+
+ def incoming(self, destination):
+ self.lock.acquire()
+ try:
+ queue = self._incoming.get(destination)
+ if queue == None:
+ queue = Incoming(self, destination)
+ self._incoming[destination] = queue
+ return queue
+ finally:
+ self.lock.release()
+
+ def error(self):
+ exc = self.exceptions[:]
+ if len(exc) == 0:
+ return None
+ elif len(exc) == 1:
+ return exc[0]
+ else:
+ return tuple(exc)
+
+ def sync(self, timeout=None):
+ ch = self.channel
+ if ch is not None and currentThread() == ch.connection.thread:
+ raise SessionException("deadlock detected")
+ if self.need_sync:
+ self.execution_sync(sync=True)
+ last = self.sender.next_id - 1
+ if not wait(self.condition, lambda:
+ last in self.sender._completed or self.exceptions,
+ timeout):
+ raise Timeout()
+ if self.exceptions:
+ raise SessionException(self.error())
+
+ def close(self, timeout=None):
+ self.invoke_lock.acquire()
+ try:
+ self._closing = True
+ self.channel.session_detach(self.name)
+ finally:
+ self.invoke_lock.release()
+ if not wait(self.condition, lambda: self._closed, timeout):
+ raise Timeout()
+
+ def closed(self):
+ self.lock.acquire()
+ try:
+ if self._closed: return
+
+ error = self.error()
+ for id in self.results:
+ f = self.results[id]
+ f.error(error)
+ self.results.clear()
+
+ for q in self._incoming.values():
+ q.close(error)
+
+ self._closed = True
+ notify(self.condition)
+ finally:
+ self.lock.release()
+
+ def invoke(self, op, args, kwargs):
+ if issubclass(op, Command):
+ self.invoke_lock.acquire()
+ try:
+ return self.do_invoke(op, args, kwargs)
+ finally:
+ self.invoke_lock.release()
+ else:
+ return op(*args, **kwargs)
+
+ def do_invoke(self, op, args, kwargs):
+ if self._closing:
+ raise SessionClosed()
+
+ ch = self.channel
+ if ch == None:
+ raise SessionDetached()
+
+ if op == MessageTransfer:
+ if len(args) == len(op.FIELDS) + 1:
+ message = args[-1]
+ args = args[:-1]
+ else:
+ message = kwargs.pop("message", None)
+ if message is not None:
+ kwargs["headers"] = message.headers
+ kwargs["payload"] = message.body
+
+ cmd = op(*args, **kwargs)
+ cmd.sync = self.auto_sync or cmd.sync
+ self.need_sync = not cmd.sync
+ cmd.channel = ch.id
+
+ if op.RESULT:
+ result = Future(exception=SessionException)
+ self.results[self.sender.next_id] = result
+
+ self.send(cmd)
+
+ log.debug("SENT %s", cmd)
+ if op == MessageTransfer:
+ msg.debug("SENT %s", cmd)
+
+ if op.RESULT:
+ if self.auto_sync:
+ return result.get(self.timeout)
+ else:
+ return result
+ elif self.auto_sync:
+ self.sync(self.timeout)
+
+ def received(self, cmd):
+ self.receiver.received(cmd)
+ self.dispatch(cmd)
+
+ def dispatch(self, cmd):
+ log.debug("RECV %s", cmd)
+
+ result = getattr(self.delegate, cmd.NAME)(cmd)
+ if result is INCOMPLETE:
+ return
+ elif result is not None:
+ self.execution_result(cmd.id, result)
+
+ self.receiver.completed(cmd)
+ # XXX: don't forget to obey sync for manual completion as well
+ if cmd.sync:
+ self.channel.session_completed(self.receiver._completed)
+
+ def send(self, cmd):
+ self.sender.send(cmd)
+
+ def __repr__(self):
+ return '<Session: %s, %s>' % (self.name, self.channel)
+
+class Receiver:
+
+ def __init__(self, session):
+ self.session = session
+ self.next_id = None
+ self._completed = RangedSet()
+
+ def received(self, cmd):
+ if self.next_id == None:
+ raise Exception("todo")
+ cmd.id = self.next_id
+ self.next_id += 1
+
+ def completed(self, cmd):
+ if cmd.id == None:
+ raise ValueError("cannot complete unidentified command")
+ self._completed.add(cmd.id)
+
+ def known_completed(self, commands):
+ completed = RangedSet()
+ for c in self._completed.ranges:
+ for kc in commands.ranges:
+ if c.lower in kc and c.upper in kc:
+ break
+ else:
+ completed.add_range(c)
+ self._completed = completed
+
+class Sender:
+
+ def __init__(self, session):
+ self.session = session
+ self.next_id = serial(0)
+ self.commands = []
+ self._completed = RangedSet()
+
+ def send(self, cmd):
+ ch = self.session.channel
+ if ch is None:
+ raise SessionDetached()
+ cmd.id = self.next_id
+ self.next_id += 1
+ if self.session.send_id:
+ self.session.send_id = False
+ ch.session_command_point(cmd.id, 0)
+ self.commands.append(cmd)
+ ch.connection.write_op(cmd)
+
+ def completed(self, commands):
+ idx = 0
+ while idx < len(self.commands):
+ cmd = self.commands[idx]
+ if cmd.id in commands:
+ del self.commands[idx]
+ else:
+ idx += 1
+ for range in commands.ranges:
+ self._completed.add(range.lower, range.upper)
+
+class Incoming(Queue):
+
+ def __init__(self, session, destination):
+ Queue.__init__(self)
+ self.session = session
+ self.destination = destination
+
+ def start(self):
+ self.session.message_set_flow_mode(self.destination, self.session.flow_mode.credit)
+ for unit in self.session.credit_unit.VALUES:
+ self.session.message_flow(self.destination, unit, 0xFFFFFFFFL)
+
+ def stop(self):
+ self.session.message_cancel(self.destination)
+ self.listen(None)
+
+class Delegate:
+
+ def __init__(self, session):
+ self.session = session
+
+ #XXX: do something with incoming accepts
+ def message_accept(self, ma): None
+
+ def execution_result(self, er):
+ future = self.session.results.pop(er.command_id)
+ future.set(er.value)
+
+ def execution_exception(self, ex):
+ self.session.exceptions.append(ex)
+
+class Client(Delegate):
+
+ def message_transfer(self, cmd):
+ m = Message(cmd.payload)
+ m.headers = cmd.headers
+ m.id = cmd.id
+ messages = self.session.incoming(cmd.destination)
+ messages.put(m)
+ msg.debug("RECV %s", m)
+ return INCOMPLETE
diff --git a/qpid/python/qpid/spec08.py b/qpid/python/qpid/spec08.py
new file mode 100644
index 0000000000..a0047e7107
--- /dev/null
+++ b/qpid/python/qpid/spec08.py
@@ -0,0 +1,504 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+"""
+This module loads protocol metadata into python objects. It provides
+access to spec metadata via a python object model, and can also
+dynamically creating python methods, classes, and modules based on the
+spec metadata. All the generated methods have proper signatures and
+doc strings based on the spec metadata so the python help system can
+be used to browse the spec documentation. The generated methods all
+dispatch to the self.invoke(meth, args) callback of the containing
+class so that the generated code can be reused in a variety of
+situations.
+"""
+
+import re, new, mllib, qpid
+from util import fill
+
+class SpecContainer:
+
+ def __init__(self):
+ self.items = []
+ self.byname = {}
+ self.byid = {}
+ self.indexes = {}
+
+ def add(self, item):
+ if self.byname.has_key(item.name):
+ raise ValueError("duplicate name: %s" % item)
+ if item.id == None:
+ item.id = len(self)
+ elif self.byid.has_key(item.id):
+ raise ValueError("duplicate id: %s" % item)
+ self.indexes[item] = len(self.items)
+ self.items.append(item)
+ self.byname[item.name] = item
+ self.byid[item.id] = item
+
+ def index(self, item):
+ try:
+ return self.indexes[item]
+ except KeyError:
+ raise ValueError(item)
+
+ def __iter__(self):
+ return iter(self.items)
+
+ def __len__(self):
+ return len(self.items)
+
+class Metadata:
+
+ PRINT = []
+
+ def __init__(self):
+ pass
+
+ def __str__(self):
+ args = map(lambda f: "%s=%s" % (f, getattr(self, f)), self.PRINT)
+ return "%s(%s)" % (self.__class__.__name__, ", ".join(args))
+
+ def __repr__(self):
+ return str(self)
+
+class Spec(Metadata):
+
+ PRINT=["major", "minor", "file"]
+
+ def __init__(self, major, minor, file):
+ Metadata.__init__(self)
+ self.major = major
+ self.minor = minor
+ self.file = file
+ self.constants = SpecContainer()
+ self.domains = SpecContainer()
+ self.classes = SpecContainer()
+ # methods indexed by classname_methname
+ self.methods = {}
+ # structs by type code
+ self.structs = {}
+
+ def post_load(self):
+ self.module = self.define_module("amqp%s%s" % (self.major, self.minor))
+ self.klass = self.define_class("Amqp%s%s" % (self.major, self.minor))
+
+ def method(self, name):
+ if not self.methods.has_key(name):
+ for cls in self.classes:
+ clen = len(cls.name)
+ if name.startswith(cls.name) and name[clen] == "_":
+ end = name[clen + 1:]
+ if cls.methods.byname.has_key(end):
+ self.methods[name] = cls.methods.byname[end]
+ return self.methods.get(name)
+
+ def parse_method(self, name):
+ parts = re.split(r"\s*\.\s*", name)
+ if len(parts) != 2:
+ raise ValueError(name)
+ klass, meth = parts
+ return self.classes.byname[klass].methods.byname[meth]
+
+ def struct(self, name, *args, **kwargs):
+ type = self.domains.byname[name].type
+ return qpid.Struct(type, *args, **kwargs)
+
+ def define_module(self, name, doc = None):
+ module = new.module(name, doc)
+ module.__file__ = self.file
+ for c in self.classes:
+ cls = c.define_class(c.name)
+ cls.__module__ = module.__name__
+ setattr(module, c.name, cls)
+ return module
+
+ def define_class(self, name):
+ methods = {}
+ for c in self.classes:
+ for m in c.methods:
+ meth = m.klass.name + "_" + m.name
+ methods[meth] = m.define_method(meth)
+ return type(name, (), methods)
+
+class Constant(Metadata):
+
+ PRINT=["name", "id"]
+
+ def __init__(self, spec, name, id, klass, docs):
+ Metadata.__init__(self)
+ self.spec = spec
+ self.name = name
+ self.id = id
+ self.klass = klass
+ self.docs = docs
+
+class Domain(Metadata):
+
+ PRINT=["name", "type"]
+
+ def __init__(self, spec, name, type, description, docs):
+ Metadata.__init__(self)
+ self.spec = spec
+ self.id = None
+ self.name = name
+ self.type = type
+ self.description = description
+ self.docs = docs
+
+class Struct(Metadata):
+
+ PRINT=["size", "type", "pack"]
+
+ def __init__(self, size, type, pack):
+ Metadata.__init__(self)
+ self.size = size
+ self.type = type
+ self.pack = pack
+ self.fields = SpecContainer()
+
+class Class(Metadata):
+
+ PRINT=["name", "id"]
+
+ def __init__(self, spec, name, id, handler, docs):
+ Metadata.__init__(self)
+ self.spec = spec
+ self.name = name
+ self.id = id
+ self.handler = handler
+ self.fields = SpecContainer()
+ self.methods = SpecContainer()
+ self.docs = docs
+
+ def define_class(self, name):
+ methods = {}
+ for m in self.methods:
+ methods[m.name] = m.define_method(m.name)
+ return type(name, (), methods)
+
+class Method(Metadata):
+
+ PRINT=["name", "id"]
+
+ def __init__(self, klass, name, id, content, responses, result, synchronous,
+ description, docs):
+ Metadata.__init__(self)
+ self.klass = klass
+ self.name = name
+ self.id = id
+ self.content = content
+ self.responses = responses
+ self.result = result
+ self.synchronous = synchronous
+ self.fields = SpecContainer()
+ self.description = description
+ self.docs = docs
+ self.response = False
+
+ def is_l4_command(self):
+ return self.klass.name not in ["execution", "channel", "connection", "session"]
+
+ def arguments(self, *args, **kwargs):
+ nargs = len(args) + len(kwargs)
+ maxargs = len(self.fields)
+ if nargs > maxargs:
+ self._type_error("takes at most %s arguments (%s) given", maxargs, nargs)
+ result = []
+ for f in self.fields:
+ idx = self.fields.index(f)
+ if idx < len(args):
+ result.append(args[idx])
+ elif kwargs.has_key(f.name):
+ result.append(kwargs.pop(f.name))
+ else:
+ result.append(Method.DEFAULTS[f.type])
+ for key, value in kwargs.items():
+ if self.fields.byname.has_key(key):
+ self._type_error("got multiple values for keyword argument '%s'", key)
+ else:
+ self._type_error("got an unexpected keyword argument '%s'", key)
+ return tuple(result)
+
+ def _type_error(self, msg, *args):
+ raise TypeError("%s %s" % (self.name, msg % args))
+
+ def docstring(self):
+ s = "\n\n".join([fill(d, 2) for d in [self.description] + self.docs])
+ for f in self.fields:
+ if f.docs:
+ s += "\n\n" + "\n\n".join([fill(f.docs[0], 4, f.name)] +
+ [fill(d, 4) for d in f.docs[1:]])
+ if self.responses:
+ s += "\n\nValid responses: "
+ for r in self.responses:
+ s += r.name + " "
+ return s
+
+ METHOD = "__method__"
+ DEFAULTS = {"bit": False,
+ "shortstr": "",
+ "longstr": "",
+ "table": {},
+ "array": [],
+ "octet": 0,
+ "short": 0,
+ "long": 0,
+ "longlong": 0,
+ "timestamp": 0,
+ "content": None,
+ "uuid": "",
+ "rfc1982_long": 0,
+ "rfc1982_long_set": [],
+ "long_struct": None}
+
+ def define_method(self, name):
+ g = {Method.METHOD: self}
+ l = {}
+ args = [(f.name, Method.DEFAULTS[f.type]) for f in self.fields]
+ methargs = args[:]
+ if self.content:
+ args += [("content", None)]
+ code = "def %s(self, %s):\n" % \
+ (name, ", ".join(["%s = %r" % a for a in args]))
+ code += " %r\n" % self.docstring()
+ argnames = ", ".join([a[0] for a in methargs])
+ code += " return self.invoke(%s" % Method.METHOD
+ if argnames:
+ code += ", (%s,)" % argnames
+ else:
+ code += ", ()"
+ if self.content:
+ code += ", content"
+ code += ")"
+ exec code in g, l
+ return l[name]
+
+class Field(Metadata):
+
+ PRINT=["name", "id", "type"]
+
+ def __init__(self, name, id, type, domain, description, docs):
+ Metadata.__init__(self)
+ self.name = name
+ self.id = id
+ self.type = type
+ self.domain = domain
+ self.description = description
+ self.docs = docs
+
+ def default(self):
+ if isinstance(self.type, Struct):
+ return None
+ else:
+ return Method.DEFAULTS[self.type]
+
+WIDTHS = {
+ "octet": 1,
+ "short": 2,
+ "long": 4
+ }
+
+def width(st, default=None):
+ if st in (None, "none", ""):
+ return default
+ else:
+ return WIDTHS[st]
+
+def get_result(nd, spec):
+ result = nd["result"]
+ if not result: return None
+ name = result["@domain"]
+ if name != None: return spec.domains.byname[name]
+ st_nd = result["struct"]
+ st = Struct(width(st_nd["@size"]), int(result.parent.parent["@index"])*256 +
+ int(st_nd["@type"]), width(st_nd["@pack"], 2))
+ spec.structs[st.type] = st
+ load_fields(st_nd, st.fields, spec.domains.byname)
+ return st
+
+def get_desc(nd):
+ label = nd["@label"]
+ if not label:
+ label = nd.text()
+ if label:
+ label = label.strip()
+ return label
+
+def get_docs(nd):
+ return [n.text() for n in nd.query["doc"]]
+
+def load_fields(nd, l, domains):
+ for f_nd in nd.query["field"]:
+ type = f_nd["@domain"]
+ if type == None:
+ type = f_nd["@type"]
+ type = pythonize(type)
+ domain = None
+ while domains.has_key(type) and domains[type].type != type:
+ domain = domains[type]
+ type = domain.type
+ l.add(Field(pythonize(f_nd["@name"]), f_nd.index(), type, domain,
+ get_desc(f_nd), get_docs(f_nd)))
+
+def load(specfile, *errata):
+ doc = mllib.xml_parse(specfile)
+ spec_root = doc["amqp"]
+ spec = Spec(int(spec_root["@major"]), int(spec_root["@minor"]), specfile)
+
+ for root in [spec_root] + map(lambda x: mllib.xml_parse(x)["amqp"], errata):
+ # constants
+ for nd in root.query["constant"]:
+ val = nd["@value"]
+ if val.startswith("0x"): val = int(val, 16)
+ else: val = int(val)
+ const = Constant(spec, pythonize(nd["@name"]), val, nd["@class"],
+ get_docs(nd))
+ try:
+ spec.constants.add(const)
+ except ValueError, e:
+ pass
+ #print "Warning:", e
+
+ # domains are typedefs
+ structs = []
+ for nd in root.query["domain"]:
+ type = nd["@type"]
+ if type == None:
+ st_nd = nd["struct"]
+ code = st_nd["@type"]
+ if code not in (None, "", "none"):
+ code = int(code)
+ type = Struct(width(st_nd["@size"]), code, width(st_nd["@pack"], 2))
+ if type.type != None:
+ spec.structs[type.type] = type
+ structs.append((type, st_nd))
+ else:
+ type = pythonize(type)
+ domain = Domain(spec, pythonize(nd["@name"]), type, get_desc(nd),
+ get_docs(nd))
+ spec.domains.add(domain)
+
+ # structs
+ for st, st_nd in structs:
+ load_fields(st_nd, st.fields, spec.domains.byname)
+
+ # classes
+ for c_nd in root.query["class"]:
+ cname = pythonize(c_nd["@name"])
+ if spec.classes.byname.has_key(cname):
+ klass = spec.classes.byname[cname]
+ else:
+ klass = Class(spec, cname, int(c_nd["@index"]), c_nd["@handler"],
+ get_docs(c_nd))
+ spec.classes.add(klass)
+
+ added_methods = []
+ load_fields(c_nd, klass.fields, spec.domains.byname)
+ for m_nd in c_nd.query["method"]:
+ mname = pythonize(m_nd["@name"])
+ if klass.methods.byname.has_key(mname):
+ meth = klass.methods.byname[mname]
+ else:
+ meth = Method(klass, mname,
+ int(m_nd["@index"]),
+ m_nd["@content"] == "1",
+ [pythonize(nd["@name"]) for nd in m_nd.query["response"]],
+ get_result(m_nd, spec),
+ m_nd["@synchronous"] == "1",
+ get_desc(m_nd),
+ get_docs(m_nd))
+ klass.methods.add(meth)
+ added_methods.append(meth)
+ load_fields(m_nd, meth.fields, spec.domains.byname)
+ # resolve the responses
+ for m in added_methods:
+ m.responses = [klass.methods.byname[r] for r in m.responses]
+ for resp in m.responses:
+ resp.response = True
+
+ spec.post_load()
+ return spec
+
+REPLACE = {" ": "_", "-": "_"}
+KEYWORDS = {"global": "global_",
+ "return": "return_"}
+
+def pythonize(name):
+ name = str(name)
+ for key, val in REPLACE.items():
+ name = name.replace(key, val)
+ try:
+ name = KEYWORDS[name]
+ except KeyError:
+ pass
+ return name
+
+class Rule(Metadata):
+
+ PRINT = ["text", "implement", "tests"]
+
+ def __init__(self, text, implement, tests, path):
+ self.text = text
+ self.implement = implement
+ self.tests = tests
+ self.path = path
+
+def find_rules(node, rules):
+ if node.name == "rule":
+ rules.append(Rule(node.text, node.get("@implement"),
+ [ch.text for ch in node if ch.name == "test"],
+ node.path()))
+ if node.name == "doc" and node.get("@name") == "rule":
+ tests = []
+ if node.has("@test"):
+ tests.append(node["@test"])
+ rules.append(Rule(node.text, None, tests, node.path()))
+ for child in node:
+ find_rules(child, rules)
+
+def load_rules(specfile):
+ rules = []
+ find_rules(xmlutil.parse(specfile), rules)
+ return rules
+
+def test_summary():
+ template = """
+ <html><head><title>AMQP Tests</title></head>
+ <body>
+ <table width="80%%" align="center">
+ %s
+ </table>
+ </body>
+ </html>
+ """
+ rows = []
+ for rule in load_rules("amqp.org/specs/amqp7.xml"):
+ if rule.tests:
+ tests = ", ".join(rule.tests)
+ else:
+ tests = "&nbsp;"
+ rows.append('<tr bgcolor="#EEEEEE"><td><b>Path:</b> %s</td>'
+ '<td><b>Implement:</b> %s</td>'
+ '<td><b>Tests:</b> %s</td></tr>' %
+ (rule.path[len("/root/amqp"):], rule.implement, tests))
+ rows.append('<tr><td colspan="3">%s</td></tr>' % rule.text)
+ rows.append('<tr><td colspan="3">&nbsp;</td></tr>')
+
+ print template % "\n".join(rows)
diff --git a/qpid/python/qpid/specs/amqp-0-10-qpid-errata-stripped.xml b/qpid/python/qpid/specs/amqp-0-10-qpid-errata-stripped.xml
new file mode 100644
index 0000000000..83ddf709e9
--- /dev/null
+++ b/qpid/python/qpid/specs/amqp-0-10-qpid-errata-stripped.xml
@@ -0,0 +1,1203 @@
+<?xml version="1.0"?>
+
+<!--
+(c) Copyright Cisco Systems, Credit Suisse, Deutsche Borse Systems,
+Envoy Technologies, Inc., Goldman Sachs, IONA Technologies PLC, iMatix
+Corporation sprl.,JPMorgan Chase Bank Inc. N.A, Novell, Rabbit
+Technologies Ltd., Red Hat, Inc., TWIST Process Innovations ltd, and
+29West Inc. 2006, 2007.
+
+Copyright (c) 2009 AMQP Working Group.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+notice, this list of conditions and the following disclaimer in the
+documentation and/or other materials provided with the distribution.
+3. The name of the author may not be used to endorse or promote products
+derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+-->
+
+<amqp major="0" xmlns="http://www.amqp.org/schema/amqp.xsd" port="5672" minor="10">
+ <type name="bin8" code="0x00" fixed-width="1"/>
+ <type name="int8" code="0x01" fixed-width="1"/>
+ <type name="uint8" code="0x02" fixed-width="1"/>
+ <type name="char" code="0x04" fixed-width="1"/>
+ <type name="boolean" code="0x08" fixed-width="1"/>
+ <type name="bin16" code="0x10" fixed-width="2"/>
+ <type name="int16" code="0x11" fixed-width="2"/>
+ <type name="uint16" code="0x12" fixed-width="2"/>
+ <type name="bin32" code="0x20" fixed-width="4"/>
+ <type name="int32" code="0x21" fixed-width="4"/>
+ <type name="uint32" code="0x22" fixed-width="4"/>
+ <type name="float" code="0x23" fixed-width="4"/>
+ <type name="char-utf32" code="0x27" fixed-width="4"/>
+ <type name="sequence-no" fixed-width="4"/>
+ <type name="bin64" code="0x30" fixed-width="8"/>
+ <type name="int64" code="0x31" fixed-width="8"/>
+ <type name="uint64" code="0x32" fixed-width="8"/>
+ <type name="double" code="0x33" fixed-width="8"/>
+ <type name="datetime" code="0x38" fixed-width="8"/>
+ <type name="bin128" code="0x40" fixed-width="16"/>
+ <type name="uuid" code="0x48" fixed-width="16"/>
+ <type name="bin256" code="0x50" fixed-width="32"/>
+ <type name="bin512" code="0x60" fixed-width="64"/>
+ <type name="bin1024" code="0x70" fixed-width="128"/>
+ <type name="vbin8" code="0x80" variable-width="1"/>
+ <type name="str8-latin" code="0x84" variable-width="1"/>
+ <type name="str8" code="0x85" variable-width="1"/>
+ <type name="str8-utf16" code="0x86" variable-width="1"/>
+ <type name="vbin16" code="0x90" variable-width="2"/>
+ <type name="str16-latin" code="0x94" variable-width="2"/>
+ <type name="str16" code="0x95" variable-width="2"/>
+ <type name="str16-utf16" code="0x96" variable-width="2"/>
+ <type name="byte-ranges" variable-width="2"/>
+ <type name="sequence-set" variable-width="2"/>
+ <type name="vbin32" code="0xa0" variable-width="4"/>
+ <type name="map" code="0xa8" variable-width="4"/>
+ <type name="list" code="0xa9" variable-width="4"/>
+ <type name="array" code="0xaa" variable-width="4"/>
+ <type name="struct32" code="0xab" variable-width="4"/>
+ <type name="bin40" code="0xc0" fixed-width="5"/>
+ <type name="dec32" code="0xc8" fixed-width="5"/>
+ <type name="bin72" code="0xd0" fixed-width="9"/>
+ <type name="dec64" code="0xd8" fixed-width="9"/>
+ <type name="void" code="0xf0" fixed-width="0"/>
+ <type name="bit" code="0xf1" fixed-width="0"/>
+ <constant name="MIN-MAX-FRAME-SIZE" value="4096"/>
+ <domain name="segment-type" type="uint8">
+ <enum>
+ <choice name="control" value="0"/>
+ <choice name="command" value="1"/>
+ <choice name="header" value="2"/>
+ <choice name="body" value="3"/>
+ </enum>
+ </domain>
+ <domain name="track" type="uint8">
+ <enum>
+ <choice name="control" value="0"/>
+ <choice name="command" value="1"/>
+ </enum>
+ </domain>
+ <domain name="str16-array" type="array"/>
+ <class name="connection" code="0x1">
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="close-code" type="uint16">
+ <enum>
+ <choice name="normal" value="200"/>
+ <choice name="connection-forced" value="320"/>
+ <choice name="invalid-path" value="402"/>
+ <choice name="framing-error" value="501"/>
+ </enum>
+ </domain>
+ <domain name="amqp-host-url" type="str16"/>
+ <domain name="amqp-host-array" type="array"/>
+ <control name="start" code="0x1">
+ <rule name="protocol-name"/>
+ <rule name="client-support"/>
+ <implement role="client" handle="MUST"/>
+ <response name="start-ok"/>
+ <field name="server-properties" type="map">
+ <rule name="required-fields"/>
+ </field>
+ <field name="mechanisms" type="str16-array" required="true"/>
+ <field name="locales" type="str16-array" required="true">
+ <rule name="required-support"/>
+ </field>
+ </control>
+ <control name="start-ok" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <field name="client-properties" type="map">
+ <rule name="required-fields"/>
+ </field>
+ <field name="mechanism" type="str8" required="true">
+ <rule name="security"/>
+ <rule name="validity"/>
+ </field>
+ <field name="response" type="vbin32" required="true"/>
+ <field name="locale" type="str8" required="true"/>
+ </control>
+ <control name="secure" code="0x3">
+ <implement role="client" handle="MUST"/>
+ <response name="secure-ok"/>
+ <field name="challenge" type="vbin32" required="true"/>
+ </control>
+ <control name="secure-ok" code="0x4">
+ <implement role="server" handle="MUST"/>
+ <field name="response" type="vbin32" required="true"/>
+ </control>
+ <control name="tune" code="0x5">
+ <implement role="client" handle="MUST"/>
+ <response name="tune-ok"/>
+ <field name="channel-max" type="uint16"/>
+ <field name="max-frame-size" type="uint16">
+ <rule name="minimum"/>
+ </field>
+ <field name="heartbeat-min" type="uint16"/>
+ <field name="heartbeat-max" type="uint16">
+ <rule name="permitted-range"/>
+ <rule name="no-heartbeat-min"/>
+ </field>
+ </control>
+ <control name="tune-ok" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <field name="channel-max" type="uint16" required="true">
+ <rule name="upper-limit"/>
+ <rule name="available-channels"/>
+ </field>
+ <field name="max-frame-size" type="uint16">
+ <rule name="minimum"/>
+ <rule name="upper-limit"/>
+ <rule name="max-frame-size"/>
+ </field>
+ <field name="heartbeat" type="uint16">
+ <rule name="permitted-range"/>
+ <rule name="no-heartbeat-min"/>
+ </field>
+ </control>
+ <control name="open" code="0x7">
+ <implement role="server" handle="MUST"/>
+ <response name="open-ok"/>
+ <response name="redirect"/>
+ <field name="virtual-host" type="str8" required="true">
+ <rule name="separation"/>
+ <rule name="security"/>
+ </field>
+ <field name="capabilities" type="str16-array"/>
+ <field name="insist" type="bit">
+ <rule name="behavior"/>
+ </field>
+ </control>
+ <control name="open-ok" code="0x8">
+ <implement role="client" handle="MUST"/>
+ <field name="known-hosts" type="amqp-host-array"/>
+ </control>
+ <control name="redirect" code="0x9">
+ <rule name="usage"/>
+ <implement role="client" handle="MUST"/>
+ <field name="host" type="amqp-host-url" required="true"/>
+ <field name="known-hosts" type="amqp-host-array"/>
+ </control>
+ <control name="heartbeat" code="0xa">
+ <implement role="client" handle="MAY"/>
+ <implement role="server" handle="MAY"/>
+ </control>
+ <control name="close" code="0xb">
+ <implement role="client" handle="MUST"/>
+ <implement role="server" handle="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply-code" type="close-code" required="true"/>
+ <field name="reply-text" type="str8"/>
+ </control>
+ <control name="close-ok" code="0xc">
+ <rule name="reporting"/>
+ <implement role="client" handle="MUST"/>
+ <implement role="server" handle="MUST"/>
+ </control>
+ </class>
+ <class name="session" code="0x2">
+ <rule name="attachment"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <role name="sender" implement="MUST"/>
+ <role name="receiver" implement="MUST"/>
+ <domain name="name" type="vbin16"/>
+ <domain name="detach-code" type="uint8">
+ <enum>
+ <choice name="normal" value="0"/>
+ <choice name="session-busy" value="1"/>
+ <choice name="transport-busy" value="2"/>
+ <choice name="not-attached" value="3"/>
+ <choice name="unknown-ids" value="4"/>
+ </enum>
+ </domain>
+ <domain name="commands" type="sequence-set"/>
+ <struct name="header" size="1" pack="1">
+ <field name="sync" type="bit"/>
+ </struct>
+ <struct name="command-fragment" size="0" pack="0">
+ <field name="command-id" type="sequence-no" required="true"/>
+ <field name="byte-ranges" type="byte-ranges" required="true"/>
+ </struct>
+ <domain name="command-fragments" type="array"/>
+ <control name="attach" code="0x1">
+ <rule name="one-transport-per-session"/>
+ <rule name="one-session-per-transport"/>
+ <rule name="idempotence"/>
+ <rule name="scoping"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MAY"/>
+ <response name="attached"/>
+ <response name="detached"/>
+ <field name="name" type="name" required="true"/>
+ <field name="force" type="bit"/>
+ </control>
+ <control name="attached" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="name" type="name" required="true"/>
+ </control>
+ <control name="detach" code="0x3">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <response name="detached"/>
+ <field name="name" type="name" required="true"/>
+ </control>
+ <control name="detached" code="0x4">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="name" type="name" required="true"/>
+ <field name="code" type="detach-code" required="true"/>
+ </control>
+ <control name="request-timeout" code="0x5">
+ <rule name="maximum-granted-timeout"/>
+ <implement role="sender" handle="MUST"/>
+ <implement role="receiver" handle="MUST"/>
+ <response name="timeout"/>
+ <field name="timeout" type="uint32"/>
+ </control>
+ <control name="timeout" code="0x6">
+ <implement role="sender" handle="MUST"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="timeout" type="uint32"/>
+ </control>
+ <control name="command-point" code="0x7">
+ <rule name="newly-attached-transports"/>
+ <rule name="zero-offset"/>
+ <rule name="nonzero-offset"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="command-id" type="sequence-no" required="true"/>
+ <field name="command-offset" type="uint64" required="true"/>
+ </control>
+ <control name="expected" code="0x8">
+ <rule name="include-next-command"/>
+ <rule name="commands-empty-means-new-session"/>
+ <rule name="no-overlaps"/>
+ <rule name="minimal-fragments"/>
+ <implement role="sender" handle="MUST"/>
+ <field name="commands" type="commands" required="true"/>
+ <field name="fragments" type="command-fragments"/>
+ </control>
+ <control name="confirmed" code="0x9">
+ <rule name="durability"/>
+ <rule name="no-overlaps"/>
+ <rule name="minimal-fragments"/>
+ <implement role="sender" handle="MUST"/>
+ <field name="commands" type="commands">
+ <rule name="exclude-known-complete"/>
+ </field>
+ <field name="fragments" type="command-fragments"/>
+ </control>
+ <control name="completed" code="0xa">
+ <rule name="known-completed-reply"/>
+ <rule name="delayed-reply"/>
+ <rule name="merged-reply"/>
+ <implement role="sender" handle="MUST"/>
+ <field name="commands" type="commands">
+ <rule name="completed-implies-confirmed"/>
+ <rule name="exclude-known-complete"/>
+ </field>
+ <field name="timely-reply" type="bit"/>
+ </control>
+ <control name="known-completed" code="0xb">
+ <rule name="stateless"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="commands" type="commands">
+ <rule name="known-completed-implies-known-confirmed"/>
+ </field>
+ </control>
+ <control name="flush" code="0xc">
+ <implement role="receiver" handle="MUST"/>
+ <field name="expected" type="bit"/>
+ <field name="confirmed" type="bit"/>
+ <field name="completed" type="bit"/>
+ </control>
+ <control name="gap" code="0xd">
+ <rule name="gap-confirmation-and-completion"/>
+ <rule name="aborted-commands"/>
+ <rule name="completed-or-confirmed-commands"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="commands" type="commands"/>
+ </control>
+ </class>
+ <class name="execution" code="0x3">
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="error-code" type="uint16">
+ <enum>
+ <choice name="unauthorized-access" value="403"/>
+ <choice name="not-found" value="404"/>
+ <choice name="resource-locked" value="405"/>
+ <choice name="precondition-failed" value="406"/>
+ <choice name="resource-deleted" value="408"/>
+ <choice name="illegal-state" value="409"/>
+ <choice name="command-invalid" value="503"/>
+ <choice name="resource-limit-exceeded" value="506"/>
+ <choice name="not-allowed" value="530"/>
+ <choice name="illegal-argument" value="531"/>
+ <choice name="not-implemented" value="540"/>
+ <choice name="internal-error" value="541"/>
+ <choice name="invalid-argument" value="542"/>
+ </enum>
+ </domain>
+ <command name="sync" code="0x1">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ </command>
+ <command name="result" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="command-id" type="sequence-no" required="true"/>
+ <field name="value" type="struct32"/>
+ </command>
+ <command name="exception" code="0x3">
+ <implement role="client" handle="MUST"/>
+ <implement role="server" handle="MUST"/>
+ <field name="error-code" type="error-code" required="true"/>
+ <field name="command-id" type="sequence-no"/>
+ <field name="class-code" type="uint8"/>
+ <field name="command-code" type="uint8"/>
+ <field name="field-index" type="uint8"/>
+ <field name="description" type="str16"/>
+ <field name="error-info" type="map"/>
+ </command>
+ </class>
+ <class name="message" code="0x4">
+ <rule name="persistent-message"/>
+ <rule name="no-persistent-message-discard"/>
+ <rule name="throttling"/>
+ <rule name="non-persistent-message-overflow"/>
+ <rule name="non-persistent-message-discard"/>
+ <rule name="min-priority-levels"/>
+ <rule name="priority-level-implementation"/>
+ <rule name="priority-delivery"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="destination" type="str8"/>
+ <domain name="accept-mode" type="uint8">
+ <enum>
+ <choice name="explicit" value="0"/>
+ <choice name="none" value="1"/>
+ </enum>
+ </domain>
+ <domain name="acquire-mode" type="uint8">
+ <enum>
+ <choice name="pre-acquired" value="0"/>
+ <choice name="not-acquired" value="1"/>
+ </enum>
+ </domain>
+ <domain name="reject-code" type="uint16">
+ <enum>
+ <choice name="unspecified" value="0"/>
+ <choice name="unroutable" value="1"/>
+ <choice name="immediate" value="2"/>
+ </enum>
+ </domain>
+ <domain name="resume-id" type="str16"/>
+ <domain name="delivery-mode" type="uint8">
+ <enum>
+ <choice name="non-persistent" value="1"/>
+ <choice name="persistent" value="2"/>
+ </enum>
+ </domain>
+ <domain name="delivery-priority" type="uint8">
+ <enum>
+ <choice name="lowest" value="0"/>
+ <choice name="lower" value="1"/>
+ <choice name="low" value="2"/>
+ <choice name="below-average" value="3"/>
+ <choice name="medium" value="4"/>
+ <choice name="above-average" value="5"/>
+ <choice name="high" value="6"/>
+ <choice name="higher" value="7"/>
+ <choice name="very-high" value="8"/>
+ <choice name="highest" value="9"/>
+ </enum>
+ </domain>
+ <struct name="delivery-properties" code="0x1" size="4" pack="2">
+ <field name="discard-unroutable" type="bit"/>
+ <field name="immediate" type="bit"/>
+ <field name="redelivered" type="bit">
+ <rule name="implementation"/>
+ <rule name="hinting"/>
+ </field>
+ <field name="priority" type="delivery-priority" required="true"/>
+ <field name="delivery-mode" type="delivery-mode" required="true"/>
+ <field name="ttl" type="uint64">
+ <rule name="ttl-decrement"/>
+ </field>
+ <field name="timestamp" type="datetime"/>
+ <field name="expiration" type="datetime"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <field name="resume-id" type="resume-id"/>
+ <field name="resume-ttl" type="uint64"/>
+ </struct>
+ <struct name="fragment-properties" code="0x2" size="4" pack="2">
+ <field name="first" type="bit" default="1"/>
+ <field name="last" type="bit" default="1"/>
+ <field name="fragment-size" type="uint64"/>
+ </struct>
+ <struct name="reply-to" size="2" pack="2">
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ </struct>
+ <struct name="message-properties" code="0x3" size="4" pack="2">
+ <field name="content-length" type="uint64"/>
+ <field name="message-id" type="uuid">
+ <rule name="unique"/>
+ <rule name="immutable"/>
+ </field>
+ <field name="correlation-id" type="vbin16"/>
+ <field name="reply-to" type="reply-to"/>
+ <field name="content-type" type="str8"/>
+ <field name="content-encoding" type="str8"/>
+ <field name="user-id" type="vbin16">
+ <rule name="authentication"/>
+ </field>
+ <field name="app-id" type="vbin16"/>
+ <field name="application-headers" type="map"/>
+ </struct>
+ <domain name="flow-mode" type="uint8">
+ <enum>
+ <choice name="credit" value="0"/>
+ <choice name="window" value="1"/>
+ </enum>
+ </domain>
+ <domain name="credit-unit" type="uint8">
+ <enum>
+ <choice name="message" value="0"/>
+ <choice name="byte" value="1"/>
+ </enum>
+ </domain>
+ <command name="transfer" code="0x1">
+ <rule name="transactional-publish"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination">
+ <rule name="blank-destination"/>
+ <exception name="nonexistent-exchange" error-code="not-found"/>
+ </field>
+ <field name="accept-mode" type="accept-mode" required="true"/>
+ <field name="acquire-mode" type="acquire-mode" required="true"/>
+ <segments>
+ <header>
+ <entry type="delivery-properties"/>
+ <entry type="fragment-properties"/>
+ <entry type="message-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="accept" code="0x2">
+ <rule name="acquisition"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ </command>
+ <command name="reject" code="0x3">
+ <rule name="alternate-exchange"/>
+ <rule name="acquisition"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ <field name="code" type="reject-code" required="true"/>
+ <field name="text" type="str8"/>
+ </command>
+ <command name="release" code="0x4">
+ <rule name="ordering"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MAY"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ <field name="set-redelivered" type="bit"/>
+ </command>
+ <command name="acquire" code="0x5">
+ <rule name="one-to-one"/>
+ <implement role="server" handle="MUST"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ <result>
+ <struct name="acquired" code="0x4" size="4" pack="2">
+ <field name="transfers" type="session.commands" required="true"/>
+ </struct>
+ </result>
+ </command>
+ <command name="resume" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination">
+ <exception name="destination-not-found" error-code="not-found"/>
+ </field>
+ <field name="resume-id" type="resume-id" required="true">
+ <rule name="unknown-resume-id"/>
+ </field>
+ <result>
+ <struct name="message-resume-result" code="0x5" size="4" pack="2">
+ <field name="offset" type="uint64"/>
+ </struct>
+ </result>
+ </command>
+ <command name="subscribe" code="0x7">
+ <rule name="simultaneous-subscriptions"/>
+ <rule name="default-flow-mode"/>
+ <exception name="queue-deletion" error-code="resource-deleted"/>
+ <exception name="queue-not-found" error-code="not-found"/>
+ <rule name="initial-credit"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="queue.name" required="true"/>
+ <field name="destination" type="destination">
+ <exception name="unique-subscriber-destination" error-code="not-allowed"/>
+ </field>
+ <field name="accept-mode" type="accept-mode" required="true"/>
+ <field name="acquire-mode" type="acquire-mode" required="true"/>
+ <field name="exclusive" type="bit">
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="resume-id" type="resume-id"/>
+ <field name="resume-ttl" type="uint64"/>
+ <field name="arguments" type="map"/>
+ </command>
+ <command name="cancel" code="0x8">
+ <rule name="post-cancel-transfer-resolution"/>
+ <implement role="server" handle="MUST"/>
+ <field name="destination" type="destination" required="true">
+ <exception name="subscription-not-found" error-code="not-found"/>
+ </field>
+ </command>
+ <command name="set-flow-mode" code="0x9">
+ <rule name="byte-accounting"/>
+ <rule name="mode-switching"/>
+ <rule name="default-flow-mode"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ <field name="flow-mode" type="flow-mode" required="true"/>
+ </command>
+ <command name="flow" code="0xa">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ <field name="unit" type="credit-unit" required="true"/>
+ <field name="value" type="uint32"/>
+ </command>
+ <command name="flush" code="0xb">
+ <implement role="server" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ </command>
+ <command name="stop" code="0xc">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ </command>
+ </class>
+ <class name="tx" code="0x5">
+ <rule name="duplicate-tracking"/>
+ <role name="server" implement="SHOULD"/>
+ <command name="select" code="0x1">
+ <exception name="exactly-once" error-code="illegal-state"/>
+ <exception name="no-dtx" error-code="illegal-state"/>
+ <exception name="explicit-accepts" error-code="not-allowed"/>
+ <implement role="server" handle="MUST"/>
+ </command>
+ <command name="commit" code="0x2">
+ <exception name="select-required" error-code="illegal-state"/>
+ <implement role="server" handle="MUST"/>
+ </command>
+ <command name="rollback" code="0x3">
+ <exception name="select-required" error-code="illegal-state"/>
+ <implement role="server" handle="MUST"/>
+ </command>
+ </class>
+ <class name="dtx" code="0x6">
+ <rule name="transactionality"/>
+ <role name="server" implement="MAY"/>
+ <role name="client" implement="MAY"/>
+ <domain name="xa-status" type="uint16">
+ <enum>
+ <choice name="xa-ok" value="0"/>
+ <choice name="xa-rbrollback" value="1"/>
+ <choice name="xa-rbtimeout" value="2"/>
+ <choice name="xa-heurhaz" value="3"/>
+ <choice name="xa-heurcom" value="4"/>
+ <choice name="xa-heurrb" value="5"/>
+ <choice name="xa-heurmix" value="6"/>
+ <choice name="xa-rdonly" value="7"/>
+ </enum>
+ </domain>
+ <struct name="xa-result" code="0x1" size="4" pack="2">
+ <field name="status" type="xa-status" required="true"/>
+ </struct>
+ <struct name="xid" code="0x4" size="4" pack="2">
+ <field name="format" type="uint32" required="true"/>
+ <field name="global-id" type="vbin8" required="true"/>
+ <field name="branch-id" type="vbin8" required="true"/>
+ </struct>
+ <command name="select" code="0x1">
+ <implement role="server" handle="MAY"/>
+ </command>
+ <command name="start" code="0x2">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <exception name="already-known" error-code="not-allowed"/>
+ <exception name="join-and-resume" error-code="not-allowed"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-allowed"/>
+ </field>
+ <field name="join" type="bit">
+ <exception name="unsupported" error-code="not-implemented"/>
+ </field>
+ <field name="resume" type="bit"/>
+ <result type="xa-result"/>
+ </command>
+ <command name="end" code="0x3">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <exception name="suspend-and-fail" error-code="not-allowed"/>
+ <rule name="success"/>
+ <rule name="session-closed"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="not-associated" error-code="illegal-state"/>
+ </field>
+ <field name="fail" type="bit">
+ <rule name="failure"/>
+ </field>
+ <field name="suspend" type="bit">
+ <rule name="resume"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="commit" code="0x4">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ <field name="one-phase" type="bit">
+ <exception name="one-phase" error-code="illegal-state"/>
+ <exception name="two-phase" error-code="illegal-state"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="forget" code="0x5">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ </command>
+ <command name="get-timeout" code="0x6">
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ </field>
+ <result>
+ <struct name="get-timeout-result" code="0x2" size="4" pack="2">
+ <field name="timeout" type="uint32" required="true"/>
+ </struct>
+ </result>
+ </command>
+ <command name="prepare" code="0x7">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <rule name="obligation-1"/>
+ <rule name="obligation-2"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="recover" code="0x8">
+ <implement role="server" handle="MAY"/>
+ <result>
+ <struct name="recover-result" code="0x3" size="4" pack="2">
+ <field name="in-doubt" type="array" required="true"/>
+ </struct>
+ </result>
+ </command>
+ <command name="rollback" code="0x9">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="set-timeout" code="0xa">
+ <rule name="effective"/>
+ <rule name="reset"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ </field>
+ <field name="timeout" type="uint32" required="true"/>
+ </command>
+ </class>
+ <class name="exchange" code="0x7">
+ <rule name="required-types"/>
+ <rule name="recommended-types"/>
+ <rule name="required-instances"/>
+ <rule name="default-exchange"/>
+ <rule name="default-access"/>
+ <rule name="extensions"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="name" type="str8"/>
+ <command name="declare" code="0x1">
+ <rule name="minimum"/>
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="name" required="true">
+ <exception name="reserved-names" error-code="not-allowed"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ </field>
+ <field name="type" type="str8" required="true">
+ <exception name="typed" error-code="not-allowed"/>
+ <exception name="exchange-type-not-found" error-code="not-found"/>
+ </field>
+ <field name="alternate-exchange" type="name">
+ <rule name="empty-name"/>
+ <exception name="pre-existing-exchange" error-code="not-allowed"/>
+ <rule name="double-failure"/>
+ </field>
+ <field name="passive" type="bit">
+ <exception name="not-found" error-code="not-found"/>
+ </field>
+ <field name="durable" type="bit">
+ <rule name="support"/>
+ <rule name="sticky"/>
+ </field>
+ <field name="auto-delete" type="bit">
+ <rule name="sticky"/>
+ </field>
+ <field name="arguments" type="map">
+ <exception name="unknown-argument" error-code="not-implemented"/>
+ </field>
+ </command>
+ <command name="delete" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="name" required="true">
+ <exception name="exists" error-code="not-found"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ <exception name="used-as-alternate" error-code="not-allowed"/>
+ </field>
+ <field name="if-unused" type="bit">
+ <exception name="exchange-in-use" error-code="precondition-failed"/>
+ </field>
+ </command>
+ <command name="query" code="0x3">
+ <implement role="server" handle="MUST"/>
+ <field name="name" type="str8"/>
+ <result>
+ <struct name="exchange-query-result" code="0x1" size="4" pack="2">
+ <field name="type" type="str8"/>
+ <field name="durable" type="bit"/>
+ <field name="not-found" type="bit"/>
+ <field name="arguments" type="map"/>
+ </struct>
+ </result>
+ </command>
+ <command name="bind" code="0x4">
+ <rule name="duplicates"/>
+ <rule name="durable-exchange"/>
+ <rule name="binding-count"/>
+ <rule name="multiple-bindings"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="queue.name" required="true">
+ <exception name="empty-queue" error-code="invalid-argument"/>
+ <exception name="queue-existence" error-code="not-found"/>
+ </field>
+ <field name="exchange" type="name" required="true">
+ <exception name="exchange-existence" error-code="not-found"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ </field>
+ <field name="binding-key" type="str8" required="true"/>
+ <field name="arguments" type="map">
+ <exception name="unknown-argument" error-code="not-implemented"/>
+ </field>
+ </command>
+ <command name="unbind" code="0x5">
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="queue.name" required="true">
+ <exception name="non-existent-queue" error-code="not-found"/>
+ </field>
+ <field name="exchange" type="name" required="true">
+ <exception name="non-existent-exchange" error-code="not-found"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ </field>
+ <field name="binding-key" type="str8" required="true">
+ <exception name="non-existent-binding-key" error-code="not-found"/>
+ </field>
+ </command>
+ <command name="bound" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="str8"/>
+ <field name="queue" type="str8" required="true"/>
+ <field name="binding-key" type="str8"/>
+ <field name="arguments" type="map"/>
+ <result>
+ <struct name="exchange-bound-result" code="0x2" size="4" pack="2">
+ <field name="exchange-not-found" type="bit"/>
+ <field name="queue-not-found" type="bit"/>
+ <field name="queue-not-matched" type="bit"/>
+ <field name="key-not-matched" type="bit"/>
+ <field name="args-not-matched" type="bit"/>
+ </struct>
+ </result>
+ </command>
+ </class>
+ <class name="queue" code="0x8">
+ <rule name="any-content"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="name" type="str8"/>
+ <command name="declare" code="0x1">
+ <rule name="default-binding"/>
+ <rule name="minimum-queues"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true">
+ <exception name="reserved-prefix" error-code="not-allowed"/>
+ </field>
+ <field name="alternate-exchange" type="exchange.name">
+ <exception name="pre-existing-exchange" error-code="not-allowed"/>
+ <exception name="unknown-exchange" error-code="not-found"/>
+ </field>
+ <field name="passive" type="bit">
+ <exception name="passive" error-code="not-found"/>
+ </field>
+ <field name="durable" type="bit">
+ <rule name="persistence"/>
+ <rule name="types"/>
+ <rule name="pre-existence"/>
+ </field>
+ <field name="exclusive" type="bit">
+ <rule name="types"/>
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="auto-delete" type="bit">
+ <rule name="pre-existence"/>
+ </field>
+ <field name="arguments" type="map">
+ <exception name="unknown-argument" error-code="not-implemented"/>
+ </field>
+ </command>
+ <command name="delete" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true">
+ <exception name="empty-name" error-code="invalid-argument"/>
+ <exception name="queue-exists" error-code="not-found"/>
+ </field>
+ <field name="if-unused" type="bit">
+ <exception name="if-unused-flag" error-code="precondition-failed"/>
+ </field>
+ <field name="if-empty" type="bit">
+ <exception name="not-empty" error-code="precondition-failed"/>
+ </field>
+ </command>
+ <command name="purge" code="0x3">
+ <rule name="empty"/>
+ <rule name="pending-messages"/>
+ <rule name="purge-recovery"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true">
+ <exception name="empty-name" error-code="invalid-argument"/>
+ <exception name="queue-exists" error-code="not-found"/>
+ </field>
+ </command>
+ <command name="query" code="0x4">
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true"/>
+ <result>
+ <struct name="queue-query-result" code="0x1" size="4" pack="2">
+ <field name="queue" type="name" required="true"/>
+ <field name="alternate-exchange" type="exchange.name"/>
+ <field name="durable" type="bit"/>
+ <field name="exclusive" type="bit"/>
+ <field name="auto-delete" type="bit"/>
+ <field name="arguments" type="map"/>
+ <field name="message-count" type="uint32" required="true"/>
+ <field name="subscriber-count" type="uint32" required="true"/>
+ </struct>
+ </result>
+ </command>
+ </class>
+ <class name="file" code="0x9">
+ <rule name="reliable-storage"/>
+ <rule name="no-discard"/>
+ <rule name="priority-levels"/>
+ <rule name="acknowledgement-support"/>
+ <role name="server" implement="MAY"/>
+ <role name="client" implement="MAY"/>
+ <struct name="file-properties" code="0x1" size="4" pack="2">
+ <field name="content-type" type="str8"/>
+ <field name="content-encoding" type="str8"/>
+ <field name="headers" type="map"/>
+ <field name="priority" type="uint8"/>
+ <field name="reply-to" type="str8"/>
+ <field name="message-id" type="str8"/>
+ <field name="filename" type="str8"/>
+ <field name="timestamp" type="datetime"/>
+ <field name="cluster-id" type="str8"/>
+ </struct>
+ <domain name="return-code" type="uint16">
+ <enum>
+ <choice name="content-too-large" value="311"/>
+ <choice name="no-route" value="312"/>
+ <choice name="no-consumers" value="313"/>
+ </enum>
+ </domain>
+ <command name="qos" code="0x1">
+ <implement role="server" handle="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" type="uint32"/>
+ <field name="prefetch-count" type="uint16">
+ <rule name="prefetch-discretion"/>
+ </field>
+ <field name="global" type="bit"/>
+ </command>
+ <command name="qos-ok" code="0x2">
+ <implement role="client" handle="MUST"/>
+ </command>
+ <command name="consume" code="0x3">
+ <rule name="min-consumers"/>
+ <implement role="server" handle="MUST"/>
+ <response name="consume-ok"/>
+ <field name="queue" type="queue.name">
+ <exception name="queue-exists-if-empty" error-code="not-allowed"/>
+ </field>
+ <field name="consumer-tag" type="str8">
+ <exception name="not-existing-consumer" error-code="not-allowed"/>
+ <exception name="not-empty-consumer-tag" error-code="not-allowed"/>
+ </field>
+ <field name="no-local" type="bit"/>
+ <field name="no-ack" type="bit"/>
+ <field name="exclusive" type="bit">
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="nowait" type="bit"/>
+ <field name="arguments" type="map"/>
+ </command>
+ <command name="consume-ok" code="0x4">
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="cancel" code="0x5">
+ <implement role="server" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="open" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <response name="open-ok"/>
+ <field name="identifier" type="str8"/>
+ <field name="content-size" type="uint64">
+ <rule name="content-size"/>
+ </field>
+ </command>
+ <command name="open-ok" code="0x7">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <response name="stage"/>
+ <field name="staged-size" type="uint64">
+ <rule name="behavior"/>
+ <rule name="staging"/>
+ </field>
+ </command>
+ <command name="stage" code="0x8">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <segments>
+ <header required="true">
+ <entry type="file-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="publish" code="0x9">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="exchange.name">
+ <rule name="default"/>
+ <exception name="refusal" error-code="not-implemented"/>
+ </field>
+ <field name="routing-key" type="str8"/>
+ <field name="mandatory" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <field name="immediate" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <field name="identifier" type="str8"/>
+ </command>
+ <command name="return" code="0xa">
+ <implement role="client" handle="MUST"/>
+ <field name="reply-code" type="return-code"/>
+ <field name="reply-text" type="str8"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <segments>
+ <header required="true">
+ <entry type="file-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="deliver" code="0xb">
+ <rule name="redelivery-tracking"/>
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="non-zero"/>
+ </field>
+ <field name="redelivered" type="bit"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <field name="identifier" type="str8"/>
+ </command>
+ <command name="ack" code="0xc">
+ <implement role="server" handle="MUST"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="session-local"/>
+ </field>
+ <field name="multiple" type="bit">
+ <rule name="validation"/>
+ </field>
+ </command>
+ <command name="reject" code="0xd">
+ <rule name="server-interpretation"/>
+ <rule name="not-selection"/>
+ <implement role="server" handle="MUST"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="session-local"/>
+ </field>
+ <field name="requeue" type="bit">
+ <rule name="requeue-strategy"/>
+ </field>
+ </command>
+ </class>
+ <class name="stream" code="0xa">
+ <rule name="overflow-discard"/>
+ <rule name="priority-levels"/>
+ <rule name="acknowledgement-support"/>
+ <role name="server" implement="MAY"/>
+ <role name="client" implement="MAY"/>
+ <struct name="stream-properties" code="0x1" size="4" pack="2">
+ <field name="content-type" type="str8"/>
+ <field name="content-encoding" type="str8"/>
+ <field name="headers" type="map"/>
+ <field name="priority" type="uint8"/>
+ <field name="timestamp" type="datetime"/>
+ </struct>
+ <domain name="return-code" type="uint16">
+ <enum>
+ <choice name="content-too-large" value="311"/>
+ <choice name="no-route" value="312"/>
+ <choice name="no-consumers" value="313"/>
+ </enum>
+ </domain>
+ <command name="qos" code="0x1">
+ <implement role="server" handle="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" type="uint32"/>
+ <field name="prefetch-count" type="uint16"/>
+ <field name="consume-rate" type="uint32">
+ <rule name="ignore-prefetch"/>
+ <rule name="drop-by-priority"/>
+ </field>
+ <field name="global" type="bit"/>
+ </command>
+ <command name="qos-ok" code="0x2">
+ <implement role="client" handle="MUST"/>
+ </command>
+ <command name="consume" code="0x3">
+ <rule name="min-consumers"/>
+ <rule name="priority-based-delivery"/>
+ <implement role="server" handle="MUST"/>
+ <response name="consume-ok"/>
+ <field name="queue" type="queue.name">
+ <exception name="queue-exists-if-empty" error-code="not-allowed"/>
+ </field>
+ <field name="consumer-tag" type="str8">
+ <exception name="not-existing-consumer" error-code="not-allowed"/>
+ <exception name="not-empty-consumer-tag" error-code="not-allowed"/>
+ </field>
+ <field name="no-local" type="bit"/>
+ <field name="exclusive" type="bit">
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="nowait" type="bit"/>
+ <field name="arguments" type="map"/>
+ </command>
+ <command name="consume-ok" code="0x4">
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="cancel" code="0x5">
+ <implement role="server" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="publish" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="exchange.name">
+ <rule name="default"/>
+ <exception name="refusal" error-code="not-implemented"/>
+ </field>
+ <field name="routing-key" type="str8"/>
+ <field name="mandatory" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <field name="immediate" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <segments>
+ <header required="true">
+ <entry type="stream-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="return" code="0x7">
+ <implement role="client" handle="MUST"/>
+ <field name="reply-code" type="return-code"/>
+ <field name="reply-text" type="str8"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <segments>
+ <header required="true">
+ <entry type="stream-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="deliver" code="0x8">
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="session-local"/>
+ </field>
+ <field name="exchange" type="exchange.name"/>
+ <field name="queue" type="queue.name" required="true"/>
+ <segments>
+ <header required="true">
+ <entry type="stream-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ </class>
+</amqp>
diff --git a/qpid/python/qpid/specs/amqp-0-10-stripped.xml b/qpid/python/qpid/specs/amqp-0-10-stripped.xml
new file mode 100644
index 0000000000..1c53608138
--- /dev/null
+++ b/qpid/python/qpid/specs/amqp-0-10-stripped.xml
@@ -0,0 +1,1200 @@
+<?xml version="1.0"?>
+
+<!--
+(c) Copyright Cisco Systems, Credit Suisse, Deutsche Borse Systems,
+Envoy Technologies, Inc., Goldman Sachs, IONA Technologies PLC, iMatix
+Corporation sprl.,JPMorgan Chase Bank Inc. N.A, Novell, Rabbit
+Technologies Ltd., Red Hat, Inc., TWIST Process Innovations ltd, and
+29West Inc. 2006, 2007.
+
+Copyright (c) 2009 AMQP Working Group.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+notice, this list of conditions and the following disclaimer in the
+documentation and/or other materials provided with the distribution.
+3. The name of the author may not be used to endorse or promote products
+derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+-->
+
+<amqp major="0" xmlns="http://www.amqp.org/schema/amqp.xsd" port="5672" minor="10">
+ <type name="bin8" code="0x00" fixed-width="1"/>
+ <type name="int8" code="0x01" fixed-width="1"/>
+ <type name="uint8" code="0x02" fixed-width="1"/>
+ <type name="char" code="0x04" fixed-width="1"/>
+ <type name="boolean" code="0x08" fixed-width="1"/>
+ <type name="bin16" code="0x10" fixed-width="2"/>
+ <type name="int16" code="0x11" fixed-width="2"/>
+ <type name="uint16" code="0x12" fixed-width="2"/>
+ <type name="bin32" code="0x20" fixed-width="4"/>
+ <type name="int32" code="0x21" fixed-width="4"/>
+ <type name="uint32" code="0x22" fixed-width="4"/>
+ <type name="float" code="0x23" fixed-width="4"/>
+ <type name="char-utf32" code="0x27" fixed-width="4"/>
+ <type name="sequence-no" fixed-width="4"/>
+ <type name="bin64" code="0x30" fixed-width="8"/>
+ <type name="int64" code="0x31" fixed-width="8"/>
+ <type name="uint64" code="0x32" fixed-width="8"/>
+ <type name="double" code="0x33" fixed-width="8"/>
+ <type name="datetime" code="0x38" fixed-width="8"/>
+ <type name="bin128" code="0x40" fixed-width="16"/>
+ <type name="uuid" code="0x48" fixed-width="16"/>
+ <type name="bin256" code="0x50" fixed-width="32"/>
+ <type name="bin512" code="0x60" fixed-width="64"/>
+ <type name="bin1024" code="0x70" fixed-width="128"/>
+ <type name="vbin8" code="0x80" variable-width="1"/>
+ <type name="str8-latin" code="0x84" variable-width="1"/>
+ <type name="str8" code="0x85" variable-width="1"/>
+ <type name="str8-utf16" code="0x86" variable-width="1"/>
+ <type name="vbin16" code="0x90" variable-width="2"/>
+ <type name="str16-latin" code="0x94" variable-width="2"/>
+ <type name="str16" code="0x95" variable-width="2"/>
+ <type name="str16-utf16" code="0x96" variable-width="2"/>
+ <type name="byte-ranges" variable-width="2"/>
+ <type name="sequence-set" variable-width="2"/>
+ <type name="vbin32" code="0xa0" variable-width="4"/>
+ <type name="map" code="0xa8" variable-width="4"/>
+ <type name="list" code="0xa9" variable-width="4"/>
+ <type name="array" code="0xaa" variable-width="4"/>
+ <type name="struct32" code="0xab" variable-width="4"/>
+ <type name="bin40" code="0xc0" fixed-width="5"/>
+ <type name="dec32" code="0xc8" fixed-width="5"/>
+ <type name="bin72" code="0xd0" fixed-width="9"/>
+ <type name="dec64" code="0xd8" fixed-width="9"/>
+ <type name="void" code="0xf0" fixed-width="0"/>
+ <type name="bit" code="0xf1" fixed-width="0"/>
+ <constant name="MIN-MAX-FRAME-SIZE" value="4096"/>
+ <domain name="segment-type" type="uint8">
+ <enum>
+ <choice name="control" value="0"/>
+ <choice name="command" value="1"/>
+ <choice name="header" value="2"/>
+ <choice name="body" value="3"/>
+ </enum>
+ </domain>
+ <domain name="track" type="uint8">
+ <enum>
+ <choice name="control" value="0"/>
+ <choice name="command" value="1"/>
+ </enum>
+ </domain>
+ <domain name="str16-array" type="array"/>
+ <class name="connection" code="0x1">
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="close-code" type="uint16">
+ <enum>
+ <choice name="normal" value="200"/>
+ <choice name="connection-forced" value="320"/>
+ <choice name="invalid-path" value="402"/>
+ <choice name="framing-error" value="501"/>
+ </enum>
+ </domain>
+ <domain name="amqp-host-url" type="str16"/>
+ <domain name="amqp-host-array" type="array"/>
+ <control name="start" code="0x1">
+ <rule name="protocol-name"/>
+ <rule name="client-support"/>
+ <implement role="client" handle="MUST"/>
+ <response name="start-ok"/>
+ <field name="server-properties" type="map">
+ <rule name="required-fields"/>
+ </field>
+ <field name="mechanisms" type="str16-array" required="true"/>
+ <field name="locales" type="str16-array" required="true">
+ <rule name="required-support"/>
+ </field>
+ </control>
+ <control name="start-ok" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <field name="client-properties" type="map">
+ <rule name="required-fields"/>
+ </field>
+ <field name="mechanism" type="str8" required="true">
+ <rule name="security"/>
+ <rule name="validity"/>
+ </field>
+ <field name="response" type="vbin32" required="true"/>
+ <field name="locale" type="str8" required="true"/>
+ </control>
+ <control name="secure" code="0x3">
+ <implement role="client" handle="MUST"/>
+ <response name="secure-ok"/>
+ <field name="challenge" type="vbin32" required="true"/>
+ </control>
+ <control name="secure-ok" code="0x4">
+ <implement role="server" handle="MUST"/>
+ <field name="response" type="vbin32" required="true"/>
+ </control>
+ <control name="tune" code="0x5">
+ <implement role="client" handle="MUST"/>
+ <response name="tune-ok"/>
+ <field name="channel-max" type="uint16"/>
+ <field name="max-frame-size" type="uint16">
+ <rule name="minimum"/>
+ </field>
+ <field name="heartbeat-min" type="uint16"/>
+ <field name="heartbeat-max" type="uint16">
+ <rule name="permitted-range"/>
+ <rule name="no-heartbeat-min"/>
+ </field>
+ </control>
+ <control name="tune-ok" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <field name="channel-max" type="uint16" required="true">
+ <rule name="upper-limit"/>
+ <rule name="available-channels"/>
+ </field>
+ <field name="max-frame-size" type="uint16">
+ <rule name="minimum"/>
+ <rule name="upper-limit"/>
+ <rule name="max-frame-size"/>
+ </field>
+ <field name="heartbeat" type="uint16">
+ <rule name="permitted-range"/>
+ <rule name="no-heartbeat-min"/>
+ </field>
+ </control>
+ <control name="open" code="0x7">
+ <implement role="server" handle="MUST"/>
+ <response name="open-ok"/>
+ <response name="redirect"/>
+ <field name="virtual-host" type="str8" required="true">
+ <rule name="separation"/>
+ <rule name="security"/>
+ </field>
+ <field name="capabilities" type="str16-array"/>
+ <field name="insist" type="bit">
+ <rule name="behavior"/>
+ </field>
+ </control>
+ <control name="open-ok" code="0x8">
+ <implement role="client" handle="MUST"/>
+ <field name="known-hosts" type="amqp-host-array"/>
+ </control>
+ <control name="redirect" code="0x9">
+ <rule name="usage"/>
+ <implement role="client" handle="MUST"/>
+ <field name="host" type="amqp-host-url" required="true"/>
+ <field name="known-hosts" type="amqp-host-array"/>
+ </control>
+ <control name="heartbeat" code="0xa"/>
+ <control name="close" code="0xb">
+ <implement role="client" handle="MUST"/>
+ <implement role="server" handle="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply-code" type="close-code" required="true"/>
+ <field name="reply-text" type="str8"/>
+ </control>
+ <control name="close-ok" code="0xc">
+ <rule name="reporting"/>
+ <implement role="client" handle="MUST"/>
+ <implement role="server" handle="MUST"/>
+ </control>
+ </class>
+ <class name="session" code="0x2">
+ <rule name="attachment"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <role name="sender" implement="MUST"/>
+ <role name="receiver" implement="MUST"/>
+ <domain name="name" type="vbin16"/>
+ <domain name="detach-code" type="uint8">
+ <enum>
+ <choice name="normal" value="0"/>
+ <choice name="session-busy" value="1"/>
+ <choice name="transport-busy" value="2"/>
+ <choice name="not-attached" value="3"/>
+ <choice name="unknown-ids" value="4"/>
+ </enum>
+ </domain>
+ <domain name="commands" type="sequence-set"/>
+ <struct name="header" size="1" pack="1">
+ <field name="sync" type="bit"/>
+ </struct>
+ <struct name="command-fragment" size="0" pack="0">
+ <field name="command-id" type="sequence-no" required="true"/>
+ <field name="byte-ranges" type="byte-ranges" required="true"/>
+ </struct>
+ <domain name="command-fragments" type="array"/>
+ <control name="attach" code="0x1">
+ <rule name="one-transport-per-session"/>
+ <rule name="one-session-per-transport"/>
+ <rule name="idempotence"/>
+ <rule name="scoping"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MAY"/>
+ <response name="attached"/>
+ <response name="detached"/>
+ <field name="name" type="name" required="true"/>
+ <field name="force" type="bit"/>
+ </control>
+ <control name="attached" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="name" type="name" required="true"/>
+ </control>
+ <control name="detach" code="0x3">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <response name="detached"/>
+ <field name="name" type="name" required="true"/>
+ </control>
+ <control name="detached" code="0x4">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="name" type="name" required="true"/>
+ <field name="code" type="detach-code" required="true"/>
+ </control>
+ <control name="request-timeout" code="0x5">
+ <rule name="maximum-granted-timeout"/>
+ <implement role="sender" handle="MUST"/>
+ <implement role="receiver" handle="MUST"/>
+ <response name="timeout"/>
+ <field name="timeout" type="uint32"/>
+ </control>
+ <control name="timeout" code="0x6">
+ <implement role="sender" handle="MUST"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="timeout" type="uint32"/>
+ </control>
+ <control name="command-point" code="0x7">
+ <rule name="newly-attached-transports"/>
+ <rule name="zero-offset"/>
+ <rule name="nonzero-offset"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="command-id" type="sequence-no" required="true"/>
+ <field name="command-offset" type="uint64" required="true"/>
+ </control>
+ <control name="expected" code="0x8">
+ <rule name="include-next-command"/>
+ <rule name="commands-empty-means-new-session"/>
+ <rule name="no-overlaps"/>
+ <rule name="minimal-fragments"/>
+ <implement role="sender" handle="MUST"/>
+ <field name="commands" type="commands" required="true"/>
+ <field name="fragments" type="command-fragments"/>
+ </control>
+ <control name="confirmed" code="0x9">
+ <rule name="durability"/>
+ <rule name="no-overlaps"/>
+ <rule name="minimal-fragments"/>
+ <implement role="sender" handle="MUST"/>
+ <field name="commands" type="commands">
+ <rule name="exclude-known-complete"/>
+ </field>
+ <field name="fragments" type="command-fragments"/>
+ </control>
+ <control name="completed" code="0xa">
+ <rule name="known-completed-reply"/>
+ <rule name="delayed-reply"/>
+ <rule name="merged-reply"/>
+ <implement role="sender" handle="MUST"/>
+ <field name="commands" type="commands">
+ <rule name="completed-implies-confirmed"/>
+ <rule name="exclude-known-complete"/>
+ </field>
+ <field name="timely-reply" type="bit"/>
+ </control>
+ <control name="known-completed" code="0xb">
+ <rule name="stateless"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="commands" type="commands">
+ <rule name="known-completed-implies-known-confirmed"/>
+ </field>
+ </control>
+ <control name="flush" code="0xc">
+ <implement role="receiver" handle="MUST"/>
+ <field name="expected" type="bit"/>
+ <field name="confirmed" type="bit"/>
+ <field name="completed" type="bit"/>
+ </control>
+ <control name="gap" code="0xd">
+ <rule name="gap-confirmation-and-completion"/>
+ <rule name="aborted-commands"/>
+ <rule name="completed-or-confirmed-commands"/>
+ <implement role="receiver" handle="MUST"/>
+ <field name="commands" type="commands"/>
+ </control>
+ </class>
+ <class name="execution" code="0x3">
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="error-code" type="uint16">
+ <enum>
+ <choice name="unauthorized-access" value="403"/>
+ <choice name="not-found" value="404"/>
+ <choice name="resource-locked" value="405"/>
+ <choice name="precondition-failed" value="406"/>
+ <choice name="resource-deleted" value="408"/>
+ <choice name="illegal-state" value="409"/>
+ <choice name="command-invalid" value="503"/>
+ <choice name="resource-limit-exceeded" value="506"/>
+ <choice name="not-allowed" value="530"/>
+ <choice name="illegal-argument" value="531"/>
+ <choice name="not-implemented" value="540"/>
+ <choice name="internal-error" value="541"/>
+ <choice name="invalid-argument" value="542"/>
+ </enum>
+ </domain>
+ <command name="sync" code="0x1">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ </command>
+ <command name="result" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="command-id" type="sequence-no" required="true"/>
+ <field name="value" type="struct32"/>
+ </command>
+ <command name="exception" code="0x3">
+ <implement role="client" handle="MUST"/>
+ <implement role="server" handle="MUST"/>
+ <field name="error-code" type="error-code" required="true"/>
+ <field name="command-id" type="sequence-no"/>
+ <field name="class-code" type="uint8"/>
+ <field name="command-code" type="uint8"/>
+ <field name="field-index" type="uint8"/>
+ <field name="description" type="str16"/>
+ <field name="error-info" type="map"/>
+ </command>
+ </class>
+ <class name="message" code="0x4">
+ <rule name="persistent-message"/>
+ <rule name="no-persistent-message-discard"/>
+ <rule name="throttling"/>
+ <rule name="non-persistent-message-overflow"/>
+ <rule name="non-persistent-message-discard"/>
+ <rule name="min-priority-levels"/>
+ <rule name="priority-level-implementation"/>
+ <rule name="priority-delivery"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="destination" type="str8"/>
+ <domain name="accept-mode" type="uint8">
+ <enum>
+ <choice name="explicit" value="0"/>
+ <choice name="none" value="1"/>
+ </enum>
+ </domain>
+ <domain name="acquire-mode" type="uint8">
+ <enum>
+ <choice name="pre-acquired" value="0"/>
+ <choice name="not-acquired" value="1"/>
+ </enum>
+ </domain>
+ <domain name="reject-code" type="uint16">
+ <enum>
+ <choice name="unspecified" value="0"/>
+ <choice name="unroutable" value="1"/>
+ <choice name="immediate" value="2"/>
+ </enum>
+ </domain>
+ <domain name="resume-id" type="str16"/>
+ <domain name="delivery-mode" type="uint8">
+ <enum>
+ <choice name="non-persistent" value="1"/>
+ <choice name="persistent" value="2"/>
+ </enum>
+ </domain>
+ <domain name="delivery-priority" type="uint8">
+ <enum>
+ <choice name="lowest" value="0"/>
+ <choice name="lower" value="1"/>
+ <choice name="low" value="2"/>
+ <choice name="below-average" value="3"/>
+ <choice name="medium" value="4"/>
+ <choice name="above-average" value="5"/>
+ <choice name="high" value="6"/>
+ <choice name="higher" value="7"/>
+ <choice name="very-high" value="8"/>
+ <choice name="highest" value="9"/>
+ </enum>
+ </domain>
+ <struct name="delivery-properties" code="0x1" size="4" pack="2">
+ <field name="discard-unroutable" type="bit"/>
+ <field name="immediate" type="bit"/>
+ <field name="redelivered" type="bit">
+ <rule name="implementation"/>
+ <rule name="hinting"/>
+ </field>
+ <field name="priority" type="delivery-priority" required="true"/>
+ <field name="delivery-mode" type="delivery-mode" required="true"/>
+ <field name="ttl" type="uint64">
+ <rule name="ttl-decrement"/>
+ </field>
+ <field name="timestamp" type="datetime"/>
+ <field name="expiration" type="datetime"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <field name="resume-id" type="resume-id"/>
+ <field name="resume-ttl" type="uint64"/>
+ </struct>
+ <struct name="fragment-properties" code="0x2" size="4" pack="2">
+ <field name="first" type="bit" default="1"/>
+ <field name="last" type="bit" default="1"/>
+ <field name="fragment-size" type="uint64"/>
+ </struct>
+ <struct name="reply-to" size="2" pack="2">
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ </struct>
+ <struct name="message-properties" code="0x3" size="4" pack="2">
+ <field name="content-length" type="uint64"/>
+ <field name="message-id" type="uuid">
+ <rule name="unique"/>
+ <rule name="immutable"/>
+ </field>
+ <field name="correlation-id" type="vbin16"/>
+ <field name="reply-to" type="reply-to"/>
+ <field name="content-type" type="str8"/>
+ <field name="content-encoding" type="str8"/>
+ <field name="user-id" type="vbin16">
+ <rule name="authentication"/>
+ </field>
+ <field name="app-id" type="vbin16"/>
+ <field name="application-headers" type="map"/>
+ </struct>
+ <domain name="flow-mode" type="uint8">
+ <enum>
+ <choice name="credit" value="0"/>
+ <choice name="window" value="1"/>
+ </enum>
+ </domain>
+ <domain name="credit-unit" type="uint8">
+ <enum>
+ <choice name="message" value="0"/>
+ <choice name="byte" value="1"/>
+ </enum>
+ </domain>
+ <command name="transfer" code="0x1">
+ <rule name="transactional-publish"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination">
+ <rule name="blank-destination"/>
+ <exception name="nonexistent-exchange" error-code="not-found"/>
+ </field>
+ <field name="accept-mode" type="accept-mode" required="true"/>
+ <field name="acquire-mode" type="acquire-mode" required="true"/>
+ <segments>
+ <header>
+ <entry type="delivery-properties"/>
+ <entry type="fragment-properties"/>
+ <entry type="message-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="accept" code="0x2">
+ <rule name="acquisition"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ </command>
+ <command name="reject" code="0x3">
+ <rule name="alternate-exchange"/>
+ <rule name="acquisition"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ <field name="code" type="reject-code" required="true"/>
+ <field name="text" type="str8"/>
+ </command>
+ <command name="release" code="0x4">
+ <rule name="ordering"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MAY"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ <field name="set-redelivered" type="bit"/>
+ </command>
+ <command name="acquire" code="0x5">
+ <rule name="one-to-one"/>
+ <implement role="server" handle="MUST"/>
+ <field name="transfers" type="session.commands" required="true"/>
+ <result>
+ <struct name="acquired" code="0x4" size="4" pack="2">
+ <field name="transfers" type="session.commands" required="true"/>
+ </struct>
+ </result>
+ </command>
+ <command name="resume" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination">
+ <exception name="destination-not-found" error-code="not-found"/>
+ </field>
+ <field name="resume-id" type="resume-id" required="true">
+ <rule name="unknown-resume-id"/>
+ </field>
+ <result>
+ <struct name="message-resume-result" code="0x5" size="4" pack="2">
+ <field name="offset" type="uint64"/>
+ </struct>
+ </result>
+ </command>
+ <command name="subscribe" code="0x7">
+ <rule name="simultaneous-subscriptions"/>
+ <rule name="default-flow-mode"/>
+ <exception name="queue-deletion" error-code="resource-deleted"/>
+ <exception name="queue-not-found" error-code="not-found"/>
+ <rule name="initial-credit"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="queue.name" required="true"/>
+ <field name="destination" type="destination">
+ <exception name="unique-subscriber-destination" error-code="not-allowed"/>
+ </field>
+ <field name="accept-mode" type="accept-mode" required="true"/>
+ <field name="acquire-mode" type="acquire-mode" required="true"/>
+ <field name="exclusive" type="bit">
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="resume-id" type="resume-id"/>
+ <field name="resume-ttl" type="uint64"/>
+ <field name="arguments" type="map"/>
+ </command>
+ <command name="cancel" code="0x8">
+ <rule name="post-cancel-transfer-resolution"/>
+ <implement role="server" handle="MUST"/>
+ <field name="destination" type="destination" required="true">
+ <exception name="subscription-not-found" error-code="not-found"/>
+ </field>
+ </command>
+ <command name="set-flow-mode" code="0x9">
+ <rule name="byte-accounting"/>
+ <rule name="mode-switching"/>
+ <rule name="default-flow-mode"/>
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ <field name="flow-mode" type="flow-mode" required="true"/>
+ </command>
+ <command name="flow" code="0xa">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ <field name="unit" type="credit-unit" required="true"/>
+ <field name="value" type="uint32"/>
+ </command>
+ <command name="flush" code="0xb">
+ <implement role="server" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ </command>
+ <command name="stop" code="0xc">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <field name="destination" type="destination"/>
+ </command>
+ </class>
+ <class name="tx" code="0x5">
+ <rule name="duplicate-tracking"/>
+ <role name="server" implement="SHOULD"/>
+ <command name="select" code="0x1">
+ <exception name="exactly-once" error-code="illegal-state"/>
+ <exception name="no-dtx" error-code="illegal-state"/>
+ <exception name="explicit-accepts" error-code="not-allowed"/>
+ <implement role="server" handle="MUST"/>
+ </command>
+ <command name="commit" code="0x2">
+ <exception name="select-required" error-code="illegal-state"/>
+ <implement role="server" handle="MUST"/>
+ </command>
+ <command name="rollback" code="0x3">
+ <exception name="select-required" error-code="illegal-state"/>
+ <implement role="server" handle="MUST"/>
+ </command>
+ </class>
+ <class name="dtx" code="0x6">
+ <rule name="transactionality"/>
+ <role name="server" implement="MAY"/>
+ <role name="client" implement="MAY"/>
+ <domain name="xa-status" type="uint16">
+ <enum>
+ <choice name="xa-ok" value="0"/>
+ <choice name="xa-rbrollback" value="1"/>
+ <choice name="xa-rbtimeout" value="2"/>
+ <choice name="xa-heurhaz" value="3"/>
+ <choice name="xa-heurcom" value="4"/>
+ <choice name="xa-heurrb" value="5"/>
+ <choice name="xa-heurmix" value="6"/>
+ <choice name="xa-rdonly" value="7"/>
+ </enum>
+ </domain>
+ <struct name="xa-result" code="0x1" size="4" pack="2">
+ <field name="status" type="xa-status" required="true"/>
+ </struct>
+ <struct name="xid" size="2" pack="2">
+ <field name="format" type="uint32" required="true"/>
+ <field name="global-id" type="vbin8" required="true"/>
+ <field name="branch-id" type="vbin8" required="true"/>
+ </struct>
+ <command name="select" code="0x1">
+ <implement role="server" handle="MAY"/>
+ </command>
+ <command name="start" code="0x2">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <exception name="already-known" error-code="not-allowed"/>
+ <exception name="join-and-resume" error-code="not-allowed"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-allowed"/>
+ </field>
+ <field name="join" type="bit">
+ <exception name="unsupported" error-code="not-implemented"/>
+ </field>
+ <field name="resume" type="bit"/>
+ <result type="xa-result"/>
+ </command>
+ <command name="end" code="0x3">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <exception name="suspend-and-fail" error-code="not-allowed"/>
+ <rule name="success"/>
+ <rule name="session-closed"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="not-associated" error-code="illegal-state"/>
+ </field>
+ <field name="fail" type="bit">
+ <rule name="failure"/>
+ </field>
+ <field name="suspend" type="bit">
+ <rule name="resume"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="commit" code="0x4">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ <field name="one-phase" type="bit">
+ <exception name="one-phase" error-code="illegal-state"/>
+ <exception name="two-phase" error-code="illegal-state"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="forget" code="0x5">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ </command>
+ <command name="get-timeout" code="0x6">
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ </field>
+ <result>
+ <struct name="get-timeout-result" code="0x2" size="4" pack="2">
+ <field name="timeout" type="uint32" required="true"/>
+ </struct>
+ </result>
+ </command>
+ <command name="prepare" code="0x7">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <rule name="obligation-1"/>
+ <rule name="obligation-2"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="recover" code="0x8">
+ <implement role="server" handle="MAY"/>
+ <result>
+ <struct name="recover-result" code="0x3" size="4" pack="2">
+ <field name="in-doubt" type="array" required="true"/>
+ </struct>
+ </result>
+ </command>
+ <command name="rollback" code="0x9">
+ <exception name="illegal-state" error-code="illegal-state"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ <exception name="not-disassociated" error-code="illegal-state"/>
+ </field>
+ <result type="xa-result"/>
+ </command>
+ <command name="set-timeout" code="0xa">
+ <rule name="effective"/>
+ <rule name="reset"/>
+ <implement role="server" handle="MAY"/>
+ <field name="xid" type="xid" required="true">
+ <exception name="unknown-xid" error-code="not-found"/>
+ </field>
+ <field name="timeout" type="uint32" required="true"/>
+ </command>
+ </class>
+ <class name="exchange" code="0x7">
+ <rule name="required-types"/>
+ <rule name="recommended-types"/>
+ <rule name="required-instances"/>
+ <rule name="default-exchange"/>
+ <rule name="default-access"/>
+ <rule name="extensions"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="name" type="str8"/>
+ <command name="declare" code="0x1">
+ <rule name="minimum"/>
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="name" required="true">
+ <exception name="reserved-names" error-code="not-allowed"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ </field>
+ <field name="type" type="str8" required="true">
+ <exception name="typed" error-code="not-allowed"/>
+ <exception name="exchange-type-not-found" error-code="not-found"/>
+ </field>
+ <field name="alternate-exchange" type="name">
+ <rule name="empty-name"/>
+ <exception name="pre-existing-exchange" error-code="not-allowed"/>
+ <rule name="double-failure"/>
+ </field>
+ <field name="passive" type="bit">
+ <exception name="not-found" error-code="not-found"/>
+ </field>
+ <field name="durable" type="bit">
+ <rule name="support"/>
+ <rule name="sticky"/>
+ </field>
+ <field name="auto-delete" type="bit">
+ <rule name="sticky"/>
+ </field>
+ <field name="arguments" type="map">
+ <exception name="unknown-argument" error-code="not-implemented"/>
+ </field>
+ </command>
+ <command name="delete" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="name" required="true">
+ <exception name="exists" error-code="not-found"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ <exception name="used-as-alternate" error-code="not-allowed"/>
+ </field>
+ <field name="if-unused" type="bit">
+ <exception name="exchange-in-use" error-code="precondition-failed"/>
+ </field>
+ </command>
+ <command name="query" code="0x3">
+ <implement role="server" handle="MUST"/>
+ <field name="name" type="str8"/>
+ <result>
+ <struct name="exchange-query-result" code="0x1" size="4" pack="2">
+ <field name="type" type="str8"/>
+ <field name="durable" type="bit"/>
+ <field name="not-found" type="bit"/>
+ <field name="arguments" type="map"/>
+ </struct>
+ </result>
+ </command>
+ <command name="bind" code="0x4">
+ <rule name="duplicates"/>
+ <rule name="durable-exchange"/>
+ <rule name="binding-count"/>
+ <rule name="multiple-bindings"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="queue.name" required="true">
+ <exception name="empty-queue" error-code="invalid-argument"/>
+ <exception name="queue-existence" error-code="not-found"/>
+ </field>
+ <field name="exchange" type="name" required="true">
+ <exception name="exchange-existence" error-code="not-found"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ </field>
+ <field name="binding-key" type="str8" required="true"/>
+ <field name="arguments" type="map">
+ <exception name="unknown-argument" error-code="not-implemented"/>
+ </field>
+ </command>
+ <command name="unbind" code="0x5">
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="queue.name" required="true">
+ <exception name="non-existent-queue" error-code="not-found"/>
+ </field>
+ <field name="exchange" type="name" required="true">
+ <exception name="non-existent-exchange" error-code="not-found"/>
+ <exception name="exchange-name-required" error-code="invalid-argument"/>
+ </field>
+ <field name="binding-key" type="str8" required="true">
+ <exception name="non-existent-binding-key" error-code="not-found"/>
+ </field>
+ </command>
+ <command name="bound" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="str8"/>
+ <field name="queue" type="str8" required="true"/>
+ <field name="binding-key" type="str8"/>
+ <field name="arguments" type="map"/>
+ <result>
+ <struct name="exchange-bound-result" code="0x2" size="4" pack="2">
+ <field name="exchange-not-found" type="bit"/>
+ <field name="queue-not-found" type="bit"/>
+ <field name="queue-not-matched" type="bit"/>
+ <field name="key-not-matched" type="bit"/>
+ <field name="args-not-matched" type="bit"/>
+ </struct>
+ </result>
+ </command>
+ </class>
+ <class name="queue" code="0x8">
+ <rule name="any-content"/>
+ <role name="server" implement="MUST"/>
+ <role name="client" implement="MUST"/>
+ <domain name="name" type="str8"/>
+ <command name="declare" code="0x1">
+ <rule name="default-binding"/>
+ <rule name="minimum-queues"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true">
+ <exception name="reserved-prefix" error-code="not-allowed"/>
+ </field>
+ <field name="alternate-exchange" type="exchange.name">
+ <exception name="pre-existing-exchange" error-code="not-allowed"/>
+ <exception name="unknown-exchange" error-code="not-found"/>
+ </field>
+ <field name="passive" type="bit">
+ <exception name="passive" error-code="not-found"/>
+ </field>
+ <field name="durable" type="bit">
+ <rule name="persistence"/>
+ <rule name="types"/>
+ <rule name="pre-existence"/>
+ </field>
+ <field name="exclusive" type="bit">
+ <rule name="types"/>
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="auto-delete" type="bit">
+ <rule name="pre-existence"/>
+ </field>
+ <field name="arguments" type="map">
+ <exception name="unknown-argument" error-code="not-implemented"/>
+ </field>
+ </command>
+ <command name="delete" code="0x2">
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true">
+ <exception name="empty-name" error-code="invalid-argument"/>
+ <exception name="queue-exists" error-code="not-found"/>
+ </field>
+ <field name="if-unused" type="bit">
+ <exception name="if-unused-flag" error-code="precondition-failed"/>
+ </field>
+ <field name="if-empty" type="bit">
+ <exception name="not-empty" error-code="precondition-failed"/>
+ </field>
+ </command>
+ <command name="purge" code="0x3">
+ <rule name="empty"/>
+ <rule name="pending-messages"/>
+ <rule name="purge-recovery"/>
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true">
+ <exception name="empty-name" error-code="invalid-argument"/>
+ <exception name="queue-exists" error-code="not-found"/>
+ </field>
+ </command>
+ <command name="query" code="0x4">
+ <implement role="server" handle="MUST"/>
+ <field name="queue" type="name" required="true"/>
+ <result>
+ <struct name="queue-query-result" code="0x1" size="4" pack="2">
+ <field name="queue" type="name" required="true"/>
+ <field name="alternate-exchange" type="exchange.name"/>
+ <field name="durable" type="bit"/>
+ <field name="exclusive" type="bit"/>
+ <field name="auto-delete" type="bit"/>
+ <field name="arguments" type="map"/>
+ <field name="message-count" type="uint32" required="true"/>
+ <field name="subscriber-count" type="uint32" required="true"/>
+ </struct>
+ </result>
+ </command>
+ </class>
+ <class name="file" code="0x9">
+ <rule name="reliable-storage"/>
+ <rule name="no-discard"/>
+ <rule name="priority-levels"/>
+ <rule name="acknowledgement-support"/>
+ <role name="server" implement="MAY"/>
+ <role name="client" implement="MAY"/>
+ <struct name="file-properties" code="0x1" size="4" pack="2">
+ <field name="content-type" type="str8"/>
+ <field name="content-encoding" type="str8"/>
+ <field name="headers" type="map"/>
+ <field name="priority" type="uint8"/>
+ <field name="reply-to" type="str8"/>
+ <field name="message-id" type="str8"/>
+ <field name="filename" type="str8"/>
+ <field name="timestamp" type="datetime"/>
+ <field name="cluster-id" type="str8"/>
+ </struct>
+ <domain name="return-code" type="uint16">
+ <enum>
+ <choice name="content-too-large" value="311"/>
+ <choice name="no-route" value="312"/>
+ <choice name="no-consumers" value="313"/>
+ </enum>
+ </domain>
+ <command name="qos" code="0x1">
+ <implement role="server" handle="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" type="uint32"/>
+ <field name="prefetch-count" type="uint16">
+ <rule name="prefetch-discretion"/>
+ </field>
+ <field name="global" type="bit"/>
+ </command>
+ <command name="qos-ok" code="0x2">
+ <implement role="client" handle="MUST"/>
+ </command>
+ <command name="consume" code="0x3">
+ <rule name="min-consumers"/>
+ <implement role="server" handle="MUST"/>
+ <response name="consume-ok"/>
+ <field name="queue" type="queue.name">
+ <exception name="queue-exists-if-empty" error-code="not-allowed"/>
+ </field>
+ <field name="consumer-tag" type="str8">
+ <exception name="not-existing-consumer" error-code="not-allowed"/>
+ <exception name="not-empty-consumer-tag" error-code="not-allowed"/>
+ </field>
+ <field name="no-local" type="bit"/>
+ <field name="no-ack" type="bit"/>
+ <field name="exclusive" type="bit">
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="nowait" type="bit"/>
+ <field name="arguments" type="map"/>
+ </command>
+ <command name="consume-ok" code="0x4">
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="cancel" code="0x5">
+ <implement role="server" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="open" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <response name="open-ok"/>
+ <field name="identifier" type="str8"/>
+ <field name="content-size" type="uint64">
+ <rule name="content-size"/>
+ </field>
+ </command>
+ <command name="open-ok" code="0x7">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <response name="stage"/>
+ <field name="staged-size" type="uint64">
+ <rule name="behavior"/>
+ <rule name="staging"/>
+ </field>
+ </command>
+ <command name="stage" code="0x8">
+ <implement role="server" handle="MUST"/>
+ <implement role="client" handle="MUST"/>
+ <segments>
+ <header required="true">
+ <entry type="file-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="publish" code="0x9">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="exchange.name">
+ <rule name="default"/>
+ <exception name="refusal" error-code="not-implemented"/>
+ </field>
+ <field name="routing-key" type="str8"/>
+ <field name="mandatory" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <field name="immediate" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <field name="identifier" type="str8"/>
+ </command>
+ <command name="return" code="0xa">
+ <implement role="client" handle="MUST"/>
+ <field name="reply-code" type="return-code"/>
+ <field name="reply-text" type="str8"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <segments>
+ <header required="true">
+ <entry type="file-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="deliver" code="0xb">
+ <rule name="redelivery-tracking"/>
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="non-zero"/>
+ </field>
+ <field name="redelivered" type="bit"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <field name="identifier" type="str8"/>
+ </command>
+ <command name="ack" code="0xc">
+ <implement role="server" handle="MUST"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="session-local"/>
+ </field>
+ <field name="multiple" type="bit">
+ <rule name="validation"/>
+ </field>
+ </command>
+ <command name="reject" code="0xd">
+ <rule name="server-interpretation"/>
+ <rule name="not-selection"/>
+ <implement role="server" handle="MUST"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="session-local"/>
+ </field>
+ <field name="requeue" type="bit">
+ <rule name="requeue-strategy"/>
+ </field>
+ </command>
+ </class>
+ <class name="stream" code="0xa">
+ <rule name="overflow-discard"/>
+ <rule name="priority-levels"/>
+ <rule name="acknowledgement-support"/>
+ <role name="server" implement="MAY"/>
+ <role name="client" implement="MAY"/>
+ <struct name="stream-properties" code="0x1" size="4" pack="2">
+ <field name="content-type" type="str8"/>
+ <field name="content-encoding" type="str8"/>
+ <field name="headers" type="map"/>
+ <field name="priority" type="uint8"/>
+ <field name="timestamp" type="datetime"/>
+ </struct>
+ <domain name="return-code" type="uint16">
+ <enum>
+ <choice name="content-too-large" value="311"/>
+ <choice name="no-route" value="312"/>
+ <choice name="no-consumers" value="313"/>
+ </enum>
+ </domain>
+ <command name="qos" code="0x1">
+ <implement role="server" handle="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" type="uint32"/>
+ <field name="prefetch-count" type="uint16"/>
+ <field name="consume-rate" type="uint32">
+ <rule name="ignore-prefetch"/>
+ <rule name="drop-by-priority"/>
+ </field>
+ <field name="global" type="bit"/>
+ </command>
+ <command name="qos-ok" code="0x2">
+ <implement role="client" handle="MUST"/>
+ </command>
+ <command name="consume" code="0x3">
+ <rule name="min-consumers"/>
+ <rule name="priority-based-delivery"/>
+ <implement role="server" handle="MUST"/>
+ <response name="consume-ok"/>
+ <field name="queue" type="queue.name">
+ <exception name="queue-exists-if-empty" error-code="not-allowed"/>
+ </field>
+ <field name="consumer-tag" type="str8">
+ <exception name="not-existing-consumer" error-code="not-allowed"/>
+ <exception name="not-empty-consumer-tag" error-code="not-allowed"/>
+ </field>
+ <field name="no-local" type="bit"/>
+ <field name="exclusive" type="bit">
+ <exception name="in-use" error-code="resource-locked"/>
+ </field>
+ <field name="nowait" type="bit"/>
+ <field name="arguments" type="map"/>
+ </command>
+ <command name="consume-ok" code="0x4">
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="cancel" code="0x5">
+ <implement role="server" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ </command>
+ <command name="publish" code="0x6">
+ <implement role="server" handle="MUST"/>
+ <field name="exchange" type="exchange.name">
+ <rule name="default"/>
+ <exception name="refusal" error-code="not-implemented"/>
+ </field>
+ <field name="routing-key" type="str8"/>
+ <field name="mandatory" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <field name="immediate" type="bit">
+ <rule name="implementation"/>
+ </field>
+ <segments>
+ <header required="true">
+ <entry type="stream-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="return" code="0x7">
+ <implement role="client" handle="MUST"/>
+ <field name="reply-code" type="return-code"/>
+ <field name="reply-text" type="str8"/>
+ <field name="exchange" type="exchange.name"/>
+ <field name="routing-key" type="str8"/>
+ <segments>
+ <header required="true">
+ <entry type="stream-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ <command name="deliver" code="0x8">
+ <implement role="client" handle="MUST"/>
+ <field name="consumer-tag" type="str8"/>
+ <field name="delivery-tag" type="uint64">
+ <rule name="session-local"/>
+ </field>
+ <field name="exchange" type="exchange.name"/>
+ <field name="queue" type="queue.name" required="true"/>
+ <segments>
+ <header required="true">
+ <entry type="stream-properties"/>
+ </header>
+ <body/>
+ </segments>
+ </command>
+ </class>
+</amqp>
diff --git a/qpid/python/qpid/specs/amqp-0-10.dtd b/qpid/python/qpid/specs/amqp-0-10.dtd
new file mode 100644
index 0000000000..2be198525a
--- /dev/null
+++ b/qpid/python/qpid/specs/amqp-0-10.dtd
@@ -0,0 +1,246 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<!--
+ Copyright Notice
+ ================
+ (c) Copyright Cisco Systems, Credit Suisse, Deutsche Börse Systems, Envoy Technologies, Inc.,
+ Goldman Sachs, IONA Technologies PLC, iMatix Corporation sprl.,JPMorgan Chase Bank Inc. N.A,
+ Novell, Rabbit Technologies Ltd., Red Hat, Inc., TWIST Process Innovations ltd, and 29West Inc
+ 2006, 2007. All rights reserved.
+
+ License
+ =======
+ JPMorgan Chase Bank & Co., Cisco Systems, Inc., Envoy Technologies Inc., iMatix Corporation, IONA
+ Technologies, Red Hat, Inc., TWIST Process Innovations, and 29West Inc. (collectively, the
+ "Authors") each hereby grants to you a worldwide, perpetual, royalty-free, nontransferable,
+ nonexclusive license to (i) copy, display, distribute and implement the Advanced Messaging Queue
+ Protocol ("AMQP") Specification and (ii) the Licensed Claims that are held by the Authors, all for
+ the purpose of implementing the Advanced Messaging Queue Protocol Specification. Your license and
+ any rights under this Agreement will terminate immediately without notice from any Author if you
+ bring any claim, suit, demand, or action related to the Advanced Messaging Queue Protocol
+ Specification against any Author. Upon termination, you shall destroy all copies of the Advanced
+ Messaging Queue Protocol Specification in your possession or control.
+
+ As used hereunder, "Licensed Claims" means those claims of a patent or patent application,
+ throughout the world, excluding design patents and design registrations, owned or controlled, or
+ that can be sublicensed without fee and in compliance with the requirements of this Agreement, by
+ an Author or its affiliates now or at any future time and which would necessarily be infringed by
+ implementation of the Advanced Messaging Queue Protocol Specification. A claim is necessarily
+ infringed hereunder only when it is not possible to avoid infringing it because there is no
+ plausible non-infringing alternative for implementing the required portions of the Advanced
+ Messaging Queue Protocol Specification. Notwithstanding the foregoing, Licensed Claims shall not
+ include any claims other than as set forth above even if contained in the same patent as Licensed
+ Claims; or that read solely on any implementations of any portion of the Advanced Messaging Queue
+ Protocol Specification that are not required by the Advanced Messaging Queue Protocol
+ Specification, or that, if licensed, would require a payment of royalties by the licensor to
+ unaffiliated third parties. Moreover, Licensed Claims shall not include (i) any enabling
+ technologies that may be necessary to make or use any Licensed Product but are not themselves
+ expressly set forth in the Advanced Messaging Queue Protocol Specification (e.g., semiconductor
+ manufacturing technology, compiler technology, object oriented technology, networking technology,
+ operating system technology, and the like); or (ii) the implementation of other published
+ standards developed elsewhere and merely referred to in the body of the Advanced Messaging Queue
+ Protocol Specification, or (iii) any Licensed Product and any combinations thereof the purpose or
+ function of which is not required for compliance with the Advanced Messaging Queue Protocol
+ Specification. For purposes of this definition, the Advanced Messaging Queue Protocol
+ Specification shall be deemed to include both architectural and interconnection requirements
+ essential for interoperability and may also include supporting source code artifacts where such
+ architectural, interconnection requirements and source code artifacts are expressly identified as
+ being required or documentation to achieve compliance with the Advanced Messaging Queue Protocol
+ Specification.
+
+ As used hereunder, "Licensed Products" means only those specific portions of products (hardware,
+ software or combinations thereof) that implement and are compliant with all relevant portions of
+ the Advanced Messaging Queue Protocol Specification.
+
+ The following disclaimers, which you hereby also acknowledge as to any use you may make of the
+ Advanced Messaging Queue Protocol Specification:
+
+ THE ADVANCED MESSAGING QUEUE PROTOCOL SPECIFICATION IS PROVIDED "AS IS," AND THE AUTHORS MAKE NO
+ REPRESENTATIONS OR WARRANTIES, EXPRESS OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, WARRANTIES OF
+ MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE, NON-INFRINGEMENT, OR TITLE; THAT THE CONTENTS
+ OF THE ADVANCED MESSAGING QUEUE PROTOCOL SPECIFICATION ARE SUITABLE FOR ANY PURPOSE; NOR THAT THE
+ IMPLEMENTATION OF THE ADVANCED MESSAGING QUEUE PROTOCOL SPECIFICATION WILL NOT INFRINGE ANY THIRD
+ PARTY PATENTS, COPYRIGHTS, TRADEMARKS OR OTHER RIGHTS.
+
+ THE AUTHORS WILL NOT BE LIABLE FOR ANY DIRECT, INDIRECT, SPECIAL, INCIDENTAL OR CONSEQUENTIAL
+ DAMAGES ARISING OUT OF OR RELATING TO ANY USE, IMPLEMENTATION OR OF THE ADVANCED
+ MESSAGING QUEUE PROTOCOL SPECIFICATION.
+
+ The name and trademarks of the Authors may NOT be used in any manner, including advertising or
+ publicity pertaining to the Advanced Messaging Queue Protocol Specification or its contents
+ without specific, written prior permission. Title to copyright in the Advanced Messaging Queue
+ Protocol Specification will at all times remain with the Authors.
+
+ No other rights are granted by implication, estoppel or otherwise.
+
+ Upon termination of your license or rights under this Agreement, you shall destroy all copies of
+ the Advanced Messaging Queue Protocol Specification in your possession or control.
+
+ Trademarks
+ ==========
+ "JPMorgan", "JPMorgan Chase", "Chase", the JPMorgan Chase logo and the Octagon Symbol are
+ trademarks of JPMorgan Chase & Co.
+
+ IMATIX and the iMatix logo are trademarks of iMatix Corporation sprl.
+
+ IONA, IONA Technologies, and the IONA logos are trademarks of IONA Technologies PLC and/or its
+ subsidiaries.
+
+ LINUX is a trademark of Linus Torvalds. RED HAT and JBOSS are registered trademarks of Red Hat,
+ Inc. in the US and other countries.
+
+ Java, all Java-based trademarks and OpenOffice.org are trademarks of Sun Microsystems, Inc. in the
+ United States, other countries, or both.
+
+ Other company, product, or service names may be trademarks or service marks of others.
+
+ Links to full AMQP specification:
+ =================================
+ http://www.envoytech.org/spec/amq/
+ http://www.iona.com/opensource/amqp/
+ http://www.redhat.com/solutions/specifications/amqp/
+ http://www.twiststandards.org/tiki-index.php?page=AMQ
+ http://www.imatix.com/amqp
+-->
+
+<!ELEMENT amqp (doc|type|struct|domain|constant|class)*>
+<!ATTLIST amqp
+ xmlns CDATA #IMPLIED
+ major CDATA #REQUIRED
+ minor CDATA #REQUIRED
+ port CDATA #REQUIRED
+ comment CDATA #IMPLIED
+>
+
+<!ELEMENT constant (doc|rule)*>
+<!ATTLIST constant
+ name CDATA #REQUIRED
+ value CDATA #REQUIRED
+ label CDATA #IMPLIED
+>
+
+<!ELEMENT type (doc|rule)*>
+<!ATTLIST type
+ name CDATA #REQUIRED
+ label CDATA #IMPLIED
+ code CDATA #IMPLIED
+ fixed-width CDATA #IMPLIED
+ variable-width CDATA #IMPLIED
+>
+
+<!ELEMENT domain (doc|rule|enum)*>
+<!ATTLIST domain
+ name CDATA #REQUIRED
+ type CDATA #IMPLIED
+ label CDATA #IMPLIED
+>
+
+<!ELEMENT struct (field|doc|rule)*>
+<!ATTLIST struct
+ name CDATA #REQUIRED
+ label CDATA #IMPLIED
+ size (0|1|2|4) #IMPLIED
+ pack (0|1|2|4) #IMPLIED
+ code CDATA #IMPLIED>
+
+<!ELEMENT enum (choice)*>
+
+<!ELEMENT choice (doc|rule)*>
+<!ATTLIST choice
+ name CDATA #REQUIRED
+ value CDATA #REQUIRED
+>
+
+<!ELEMENT class (doc|role|rule|struct|domain|control|command)*>
+<!ATTLIST class
+ name CDATA #REQUIRED
+ code CDATA #REQUIRED
+ label CDATA #IMPLIED
+>
+
+<!ELEMENT role (doc|rule)*>
+<!ATTLIST role
+ name CDATA #REQUIRED
+ implement (MAY|SHOULD|MUST) #REQUIRED
+>
+
+<!ELEMENT control (doc|implement|rule|field|response)*>
+<!ATTLIST control
+ name CDATA #REQUIRED
+ code CDATA #REQUIRED
+ label CDATA #IMPLIED
+>
+
+<!ELEMENT command ((doc|implement|rule|exception|field|response)*, result?, segments?)>
+<!ATTLIST command
+ name CDATA #REQUIRED
+ code CDATA #REQUIRED
+ label CDATA #IMPLIED
+>
+
+<!ELEMENT implement (doc|rule)*>
+<!ATTLIST implement
+ role CDATA #REQUIRED
+ handle (MAY|SHOULD|MUST) #REQUIRED
+ send (MAY|SHOULD|MUST) #IMPLIED
+>
+
+<!ELEMENT field (doc|rule|exception)*>
+<!ATTLIST field
+ name CDATA #REQUIRED
+ type CDATA #IMPLIED
+ default CDATA #IMPLIED
+ code CDATA #IMPLIED
+ label CDATA #IMPLIED
+ required CDATA #IMPLIED
+>
+
+<!ELEMENT rule (doc*)>
+<!ATTLIST rule
+ name CDATA #REQUIRED
+ label CDATA #IMPLIED
+>
+
+<!ELEMENT exception (doc*)>
+<!ATTLIST exception
+ name CDATA #REQUIRED
+ error-code CDATA #IMPLIED
+ label CDATA #IMPLIED
+>
+
+<!ELEMENT response (doc|rule)*>
+<!ATTLIST response
+ name CDATA #IMPLIED
+>
+
+<!ELEMENT result (doc|rule|struct)*>
+<!ATTLIST result
+ type CDATA #IMPLIED
+>
+
+<!ELEMENT segments (doc|rule|header|body)*>
+
+<!ELEMENT header (doc|rule|entry)*>
+<!ATTLIST header
+ required (true|false) #IMPLIED
+>
+
+<!ELEMENT entry (doc|rule)*>
+<!ATTLIST entry
+ type CDATA #REQUIRED
+>
+
+<!ELEMENT body (doc|rule)*>
+<!ATTLIST body
+ required (true|false) #IMPLIED
+>
+
+<!ELEMENT doc (#PCDATA|xref)*>
+<!ATTLIST doc
+ type (grammar|scenario|picture|bnf|todo) #IMPLIED
+ title CDATA #IMPLIED
+>
+
+<!ELEMENT xref (#PCDATA)>
+<!ATTLIST xref
+ ref CDATA #REQUIRED>
diff --git a/qpid/python/qpid/specs/amqp-0-8-qpid-stripped.xml b/qpid/python/qpid/specs/amqp-0-8-qpid-stripped.xml
new file mode 100644
index 0000000000..6975e17aa6
--- /dev/null
+++ b/qpid/python/qpid/specs/amqp-0-8-qpid-stripped.xml
@@ -0,0 +1,784 @@
+<?xml version="1.0"?>
+
+<!--
+(c) Copyright JPMorgan Chase Bank & Co., Cisco Systems, Inc., Envoy
+Technologies Inc., iMatix Corporation, IONA\ufffd Technologies, Red
+Hat, Inc., TWIST Process Innovations, and 29West Inc. 2006.
+
+Copyright (c) 2009 AMQP Working Group.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+notice, this list of conditions and the following disclaimer in the
+documentation and/or other materials provided with the distribution.
+3. The name of the author may not be used to endorse or promote products
+derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+-->
+
+<amqp major="8" minor="0" port="5672">
+ <constant name="frame method" value="1"/>
+ <constant name="frame header" value="2"/>
+ <constant name="frame body" value="3"/>
+ <constant name="frame oob method" value="4"/>
+ <constant name="frame oob header" value="5"/>
+ <constant name="frame oob body" value="6"/>
+ <constant name="frame trace" value="7"/>
+ <constant name="frame heartbeat" value="8"/>
+ <constant name="frame min size" value="4096"/>
+ <constant name="frame end" value="206"/>
+ <constant name="reply success" value="200"/>
+ <constant name="not delivered" value="310" class="soft error"/>
+ <constant name="content too large" value="311" class="soft error"/>
+ <constant name="connection forced" value="320" class="hard error"/>
+ <constant name="invalid path" value="402" class="hard error"/>
+ <constant name="access refused" value="403" class="soft error"/>
+ <constant name="not found" value="404" class="soft error"/>
+ <constant name="resource locked" value="405" class="soft error"/>
+ <constant name="frame error" value="501" class="hard error"/>
+ <constant name="syntax error" value="502" class="hard error"/>
+ <constant name="command invalid" value="503" class="hard error"/>
+ <constant name="channel error" value="504" class="hard error"/>
+ <constant name="resource error" value="506" class="hard error"/>
+ <constant name="not allowed" value="530" class="hard error"/>
+ <constant name="not implemented" value="540" class="hard error"/>
+ <constant name="internal error" value="541" class="hard error"/>
+ <domain name="access ticket" type="short">
+ <assert check="ne" value="0"/>
+ </domain>
+ <domain name="class id" type="short"/>
+ <domain name="consumer tag" type="shortstr"/>
+ <domain name="delivery tag" type="longlong"/>
+ <domain name="exchange name" type="shortstr">
+ <assert check="length" value="127"/>
+ </domain>
+ <domain name="known hosts" type="shortstr"/>
+ <domain name="method id" type="short"/>
+ <domain name="no ack" type="bit"/>
+ <domain name="no local" type="bit"/>
+ <domain name="path" type="shortstr">
+ <assert check="notnull"/>
+ <assert check="syntax" rule="path"/>
+ <assert check="length" value="127"/>
+ </domain>
+ <domain name="peer properties" type="table"/>
+ <domain name="queue name" type="shortstr">
+ <assert check="length" value="127"/>
+ </domain>
+ <domain name="redelivered" type="bit"/>
+ <domain name="reply code" type="short">
+ <assert check="notnull"/>
+ </domain>
+ <domain name="reply text" type="shortstr">
+ <assert check="notnull"/>
+ </domain>
+ <class name="connection" handler="connection" index="10">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="start" synchronous="1" index="10">
+ <chassis name="client" implement="MUST"/>
+ <response name="start-ok"/>
+ <field name="version major" type="octet"/>
+ <field name="version minor" type="octet"/>
+ <field name="server properties" domain="peer properties"/>
+ <field name="mechanisms" type="longstr">
+ <see name="security mechanisms"/>
+ <assert check="notnull"/>
+ </field>
+ <field name="locales" type="longstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="start-ok" synchronous="1" index="11">
+ <chassis name="server" implement="MUST"/>
+ <field name="client properties" domain="peer properties"/>
+ <field name="mechanism" type="shortstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="response" type="longstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="locale" type="shortstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="secure" synchronous="1" index="20">
+ <chassis name="client" implement="MUST"/>
+ <response name="secure-ok"/>
+ <field name="challenge" type="longstr">
+ <see name="security mechanisms"/>
+ </field>
+ </method>
+ <method name="secure-ok" synchronous="1" index="21">
+ <chassis name="server" implement="MUST"/>
+ <field name="response" type="longstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="tune" synchronous="1" index="30">
+ <chassis name="client" implement="MUST"/>
+ <response name="tune-ok"/>
+ <field name="channel max" type="short"/>
+ <field name="frame max" type="long"/>
+ <field name="heartbeat" type="short"/>
+ </method>
+ <method name="tune-ok" synchronous="1" index="31">
+ <chassis name="server" implement="MUST"/>
+ <field name="channel max" type="short">
+ <assert check="notnull"/>
+ <assert check="le" method="tune" field="channel max"/>
+ </field>
+ <field name="frame max" type="long"/>
+ <field name="heartbeat" type="short"/>
+ </method>
+ <method name="open" synchronous="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <response name="open-ok"/>
+ <response name="redirect"/>
+ <field name="virtual host" domain="path">
+ <assert check="regexp" value="^[a-zA-Z0-9/-_]+$"/>
+ </field>
+ <field name="capabilities" type="shortstr"/>
+ <field name="insist" type="bit"/>
+ </method>
+ <method name="open-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <field name="known hosts" domain="known hosts"/>
+ </method>
+ <method name="redirect" synchronous="1" index="50">
+ <chassis name="client" implement="MAY"/>
+ <field name="host" type="shortstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="known hosts" domain="known hosts"/>
+ </method>
+ <method name="close" synchronous="1" index="60">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply code" domain="reply code"/>
+ <field name="reply text" domain="reply text"/>
+ <field name="class id" domain="class id"/>
+ <!-- Qpid difference : correct the domain -->
+ <field name="method id" domain="method id"/>
+ </method>
+ <method name="close-ok" synchronous="1" index="61">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ </method>
+ </class>
+ <class name="channel" handler="channel" index="20">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="open" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="open-ok"/>
+ <field name="out of band" type="shortstr">
+ <assert check="null"/>
+ </field>
+ </method>
+ <method name="open-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="flow" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="flow-ok"/>
+ <field name="active" type="bit"/>
+ </method>
+ <method name="flow-ok" index="21">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="active" type="bit"/>
+ </method>
+ <method name="alert" index="30">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply code" domain="reply code"/>
+ <field name="reply text" domain="reply text"/>
+ <field name="details" type="table"/>
+ </method>
+ <method name="close" synchronous="1" index="40">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply code" domain="reply code"/>
+ <field name="reply text" domain="reply text"/>
+ <field name="class id" domain="class id"/>
+ <field name="method id" domain="method id"/>
+ </method>
+ <method name="close-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ </method>
+ </class>
+ <class name="access" handler="connection" index="30">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="request" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="request-ok"/>
+ <field name="realm" domain="path"/>
+ <field name="exclusive" type="bit"/>
+ <field name="passive" type="bit"/>
+ <field name="active" type="bit"/>
+ <field name="write" type="bit"/>
+ <field name="read" type="bit"/>
+ </method>
+ <method name="request-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <field name="ticket" domain="access ticket"/>
+ </method>
+ </class>
+ <class name="exchange" handler="channel" index="40">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="declare" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="declare-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="exchange" domain="exchange name">
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/>
+ </field>
+ <field name="type" type="shortstr">
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/>
+ </field>
+ <field name="passive" type="bit"/>
+ <field name="durable" type="bit"/>
+ <field name="auto delete" type="bit"/>
+ <field name="internal" type="bit"/>
+ <field name="nowait" type="bit"/>
+ <field name="arguments" type="table"/>
+ </method>
+ <method name="declare-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="delete" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="delete-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="exchange" domain="exchange name">
+ <assert check="notnull"/>
+ </field>
+ <field name="if unused" type="bit"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="delete-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <!-- Qpid specific addition -->
+ <method name="bound" synchronous="1" index="22">
+ <chassis name="server" implement="SHOULD"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ <field name="queue" domain="queue name"/>
+ </method>
+ <method name="bound-ok" synchronous="1" index="23">
+ <field name="reply code" domain="reply code"/>
+ <field name="reply text" domain="reply text"/>
+ <chassis name="client" implement="SHOULD"/>
+ </method>
+ <!-- End Qpid specific addition -->
+ </class>
+ <class name="queue" handler="channel" index="50">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="declare" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="declare-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name">
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/>
+ </field>
+ <field name="passive" type="bit"/>
+ <field name="durable" type="bit"/>
+ <field name="exclusive" type="bit"/>
+ <field name="auto delete" type="bit"/>
+ <field name="nowait" type="bit"/>
+ <field name="arguments" type="table"/>
+ </method>
+ <method name="declare-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <field name="queue" domain="queue name">
+ <assert check="notnull"/>
+ </field>
+ <field name="message count" type="long"/>
+ <field name="consumer count" type="long"/>
+ </method>
+ <method name="bind" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="bind-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ <field name="nowait" type="bit"/>
+ <field name="arguments" type="table"/>
+ </method>
+ <method name="bind-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="purge" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="purge-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="purge-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="message count" type="long"/>
+ </method>
+ <method name="delete" synchronous="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <response name="delete-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name"/>
+ <field name="if unused" type="bit"/>
+ <field name="if empty" type="bit"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="delete-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <field name="message count" type="long"/>
+ </method>
+ </class>
+ <class name="basic" handler="channel" index="60">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="content type" type="shortstr"/>
+ <field name="content encoding" type="shortstr"/>
+ <field name="headers" type="table"/>
+ <field name="delivery mode" type="octet"/>
+ <field name="priority" type="octet"/>
+ <field name="correlation id" type="shortstr"/>
+ <field name="reply to" type="shortstr"/>
+ <field name="expiration" type="shortstr"/>
+ <field name="message id" type="shortstr"/>
+ <field name="timestamp" type="timestamp"/>
+ <field name="type" type="shortstr"/>
+ <field name="user id" type="shortstr"/>
+ <field name="app id" type="shortstr"/>
+ <field name="cluster id" type="shortstr"/>
+ <method name="qos" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch size" type="long"/>
+ <field name="prefetch count" type="short"/>
+ <field name="global" type="bit"/>
+ </method>
+ <method name="qos-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="consume" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="consume-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="no local" domain="no local"/>
+ <field name="no ack" domain="no ack"/>
+ <field name="exclusive" type="bit"/>
+ <field name="nowait" type="bit"/>
+ <!-- Qpid specific addition : interop issue extra field -->
+ <field name="arguments" type="table"/>
+ </method>
+ <method name="consume-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ </method>
+ <method name="cancel" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="cancel-ok"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="cancel-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ </method>
+ <method name="publish" content="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ <field name="mandatory" type="bit"/>
+ <field name="immediate" type="bit"/>
+ </method>
+ <method name="return" content="1" index="50">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply code" domain="reply code"/>
+ <field name="reply text" domain="reply text"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ </method>
+ <method name="deliver" content="1" index="60">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ </method>
+ <method name="get" synchronous="1" index="70">
+ <response name="get-ok"/>
+ <response name="get-empty"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name"/>
+ <field name="no ack" domain="no ack"/>
+ </method>
+ <method name="get-ok" synchronous="1" content="1" index="71">
+ <chassis name="client" implement="MAY"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ <field name="message count" type="long"/>
+ </method>
+ <method name="get-empty" synchronous="1" index="72">
+ <chassis name="client" implement="MAY"/>
+ <field name="cluster id" type="shortstr"/>
+ </method>
+ <method name="ack" index="80">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="multiple" type="bit"/>
+ </method>
+ <method name="reject" index="90">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="requeue" type="bit"/>
+ </method>
+ <!-- Qpid specific modification : interop issue, added synchronous reply -->
+ <method name="recover" index="100">
+ <chassis name="server" implement="MUST"/>
+ <field name="requeue" type="bit"/>
+ <response name="recover-ok"/>
+ </method>
+ <method name="recover-ok" synchronous="1" index="101">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <!-- End Qpid specific modification -->
+ </class>
+ <class name="file" handler="channel" index="70">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="content type" type="shortstr"/>
+ <field name="content encoding" type="shortstr"/>
+ <field name="headers" type="table"/>
+ <field name="priority" type="octet"/>
+ <field name="reply to" type="shortstr"/>
+ <field name="message id" type="shortstr"/>
+ <field name="filename" type="shortstr"/>
+ <field name="timestamp" type="timestamp"/>
+ <field name="cluster id" type="shortstr"/>
+ <method name="qos" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch size" type="long"/>
+ <field name="prefetch count" type="short"/>
+ <field name="global" type="bit"/>
+ </method>
+ <method name="qos-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="consume" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="consume-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="no local" domain="no local"/>
+ <field name="no ack" domain="no ack"/>
+ <field name="exclusive" type="bit"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="consume-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ </method>
+ <method name="cancel" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="cancel-ok"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="cancel-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ </method>
+ <method name="open" synchronous="1" index="40">
+ <response name="open-ok"/>
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="identifier" type="shortstr"/>
+ <field name="content size" type="longlong"/>
+ </method>
+ <method name="open-ok" synchronous="1" index="41">
+ <response name="stage"/>
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="staged size" type="longlong"/>
+ </method>
+ <method name="stage" content="1" index="50">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="publish" index="60">
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ <field name="mandatory" type="bit"/>
+ <field name="immediate" type="bit"/>
+ <field name="identifier" type="shortstr"/>
+ </method>
+ <method name="return" content="1" index="70">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply code" domain="reply code"/>
+ <field name="reply text" domain="reply text"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ </method>
+ <method name="deliver" index="80">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ <field name="identifier" type="shortstr"/>
+ </method>
+ <method name="ack" index="90">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="multiple" type="bit"/>
+ </method>
+ <method name="reject" index="100">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="requeue" type="bit"/>
+ </method>
+ </class>
+ <class name="stream" handler="channel" index="80">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="content type" type="shortstr"/>
+ <field name="content encoding" type="shortstr"/>
+ <field name="headers" type="table"/>
+ <field name="priority" type="octet"/>
+ <field name="timestamp" type="timestamp"/>
+ <method name="qos" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch size" type="long"/>
+ <field name="prefetch count" type="short"/>
+ <field name="consume rate" type="long"/>
+ <field name="global" type="bit"/>
+ </method>
+ <method name="qos-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="consume" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="consume-ok"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="queue" domain="queue name"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="no local" domain="no local"/>
+ <field name="exclusive" type="bit"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="consume-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ </method>
+ <method name="cancel" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="cancel-ok"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="nowait" type="bit"/>
+ </method>
+ <method name="cancel-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ </method>
+ <method name="publish" content="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access ticket"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ <field name="mandatory" type="bit"/>
+ <field name="immediate" type="bit"/>
+ </method>
+ <method name="return" content="1" index="50">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply code" domain="reply code"/>
+ <field name="reply text" domain="reply text"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="routing key" type="shortstr"/>
+ </method>
+ <method name="deliver" content="1" index="60">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer tag" domain="consumer tag"/>
+ <field name="delivery tag" domain="delivery tag"/>
+ <field name="exchange" domain="exchange name"/>
+ <field name="queue" domain="queue name">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ </class>
+ <class name="tx" handler="channel" index="90">
+ <chassis name="server" implement="SHOULD"/>
+ <chassis name="client" implement="MAY"/>
+ <method name="select" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="select-ok"/>
+ </method>
+ <method name="select-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="commit" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="commit-ok"/>
+ </method>
+ <method name="commit-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="rollback" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="rollback-ok"/>
+ </method>
+ <method name="rollback-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ </class>
+ <class name="dtx" handler="channel" index="100">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <method name="select" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="select-ok"/>
+ </method>
+ <method name="select-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="start" synchronous="1" index="20">
+ <chassis name="server" implement="MAY"/>
+ <response name="start-ok"/>
+ <field name="dtx identifier" type="shortstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="start-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ </class>
+ <class name="tunnel" handler="tunnel" index="110">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="headers" type="table"/>
+ <field name="proxy name" type="shortstr"/>
+ <field name="data name" type="shortstr"/>
+ <field name="durable" type="octet"/>
+ <field name="broadcast" type="octet"/>
+ <method name="request" content="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <field name="meta data" type="table"/>
+ </method>
+ </class>
+ <class name="test" handler="channel" index="120">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="SHOULD"/>
+ <method name="integer" synchronous="1" index="10">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="integer-ok"/>
+ <field name="integer 1" type="octet"/>
+ <field name="integer 2" type="short"/>
+ <field name="integer 3" type="long"/>
+ <field name="integer 4" type="longlong"/>
+ <field name="operation" type="octet">
+ <assert check="enum">
+ <value name="add"/>
+ <value name="min"/>
+ <value name="max"/>
+ </assert>
+ </field>
+ </method>
+ <method name="integer-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="result" type="longlong"/>
+ </method>
+ <method name="string" synchronous="1" index="20">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="string-ok"/>
+ <field name="string 1" type="shortstr"/>
+ <field name="string 2" type="longstr"/>
+ <field name="operation" type="octet">
+ <assert check="enum">
+ <value name="add"/>
+ <value name="min"/>
+ <value name="max"/>
+ </assert>
+ </field>
+ </method>
+ <method name="string-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="result" type="longstr"/>
+ </method>
+ <method name="table" synchronous="1" index="30">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="table-ok"/>
+ <field name="table" type="table"/>
+ <field name="integer op" type="octet">
+ <assert check="enum">
+ <value name="add"/>
+ <value name="min"/>
+ <value name="max"/>
+ </assert>
+ </field>
+ <field name="string op" type="octet">
+ <assert check="enum">
+ <value name="add"/>
+ <value name="min"/>
+ <value name="max"/>
+ </assert>
+ </field>
+ </method>
+ <method name="table-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="integer result" type="longlong"/>
+ <field name="string result" type="longstr"/>
+ </method>
+ <method name="content" synchronous="1" content="1" index="40">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="content-ok"/>
+ </method>
+ <method name="content-ok" synchronous="1" content="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="content checksum" type="long"/>
+ </method>
+ </class>
+</amqp>
diff --git a/qpid/python/qpid/specs/amqp-0-9-1-stripped.xml b/qpid/python/qpid/specs/amqp-0-9-1-stripped.xml
new file mode 100644
index 0000000000..ec55c8dd7a
--- /dev/null
+++ b/qpid/python/qpid/specs/amqp-0-9-1-stripped.xml
@@ -0,0 +1,477 @@
+<?xml version="1.0"?>
+<!--
+Copyright (c) 2009 AMQP Working Group.
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+notice, this list of conditions and the following disclaimer in the
+documentation and/or other materials provided with the distribution.
+3. The name of the author may not be used to endorse or promote products
+derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+-->
+<amqp major="0" minor="91" port="5672">
+ <constant name="frame-method" value="1"/>
+ <constant name="frame-header" value="2"/>
+ <constant name="frame-body" value="3"/>
+ <constant name="frame-heartbeat" value="8"/>
+ <constant name="frame-min-size" value="4096"/>
+ <constant name="frame-end" value="206"/>
+ <constant name="reply-success" value="200"/>
+ <constant name="content-too-large" value="311" class="soft-error"/>
+ <constant name="no-consumers" value="313" class="soft-error"/>
+ <constant name="connection-forced" value="320" class="hard-error"/>
+ <constant name="invalid-path" value="402" class="hard-error"/>
+ <constant name="access-refused" value="403" class="soft-error"/>
+ <constant name="not-found" value="404" class="soft-error"/>
+ <constant name="resource-locked" value="405" class="soft-error"/>
+ <constant name="precondition-failed" value="406" class="soft-error"/>
+ <constant name="frame-error" value="501" class="hard-error"/>
+ <constant name="syntax-error" value="502" class="hard-error"/>
+ <constant name="command-invalid" value="503" class="hard-error"/>
+ <constant name="channel-error" value="504" class="hard-error"/>
+ <constant name="unexpected-frame" value="505" class="hard-error"/>
+ <constant name="resource-error" value="506" class="hard-error"/>
+ <constant name="not-allowed" value="530" class="hard-error"/>
+ <constant name="not-implemented" value="540" class="hard-error"/>
+ <constant name="internal-error" value="541" class="hard-error"/>
+ <domain name="class-id" type="short"/>
+ <domain name="consumer-tag" type="shortstr"/>
+ <domain name="delivery-tag" type="longlong"/>
+ <domain name="exchange-name" type="shortstr">
+ <assert check="length" value="127"/>
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/>
+ </domain>
+ <domain name="method-id" type="short"/>
+ <domain name="no-ack" type="bit"/>
+ <domain name="no-local" type="bit"/>
+ <domain name="nowait" type="bit"/>
+ <!-- Qpid: restore these so that the generation sees the methods aas the same -->
+ <domain name="known-hosts" type="shortstr"/>
+ <domain name="access-ticket" type="short"/>
+ <!-- end Qpid specific -->
+ <domain name="path" type="shortstr">
+ <assert check="notnull"/>
+ <assert check="length" value="127"/>
+ </domain>
+ <domain name="peer-properties" type="table"/>
+ <domain name="queue-name" type="shortstr">
+ <assert check="length" value="127"/>
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/>
+ </domain>
+ <domain name="redelivered" type="bit"/>
+ <domain name="message-count" type="long"/>
+ <domain name="reply-code" type="short">
+ <assert check="notnull"/>
+ </domain>
+ <domain name="reply-text" type="shortstr">
+ <assert check="notnull"/>
+ </domain>
+ <domain name="bit" type="bit"/>
+ <domain name="octet" type="octet"/>
+ <domain name="short" type="short"/>
+ <domain name="long" type="long"/>
+ <domain name="longlong" type="longlong"/>
+ <domain name="shortstr" type="shortstr"/>
+ <domain name="longstr" type="longstr"/>
+ <domain name="timestamp" type="timestamp"/>
+ <domain name="table" type="table"/>
+ <class name="connection" handler="connection" index="10">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="start" synchronous="1" index="10">
+ <chassis name="client" implement="MUST"/>
+ <response name="start-ok"/>
+ <field name="version-major" domain="octet"/>
+ <field name="version-minor" domain="octet"/>
+ <field name="server-properties" domain="peer-properties"/>
+ <field name="mechanisms" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="locales" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="start-ok" synchronous="1" index="11">
+ <chassis name="server" implement="MUST"/>
+ <field name="client-properties" domain="peer-properties"/>
+ <field name="mechanism" domain="shortstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="response" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="locale" domain="shortstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="secure" synchronous="1" index="20">
+ <chassis name="client" implement="MUST"/>
+ <response name="secure-ok"/>
+ <field name="challenge" domain="longstr"/>
+ </method>
+ <method name="secure-ok" synchronous="1" index="21">
+ <chassis name="server" implement="MUST"/>
+ <field name="response" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="tune" synchronous="1" index="30">
+ <chassis name="client" implement="MUST"/>
+ <response name="tune-ok"/>
+ <field name="channel-max" domain="short"/>
+ <field name="frame-max" domain="long"/>
+ <field name="heartbeat" domain="short"/>
+ </method>
+ <method name="tune-ok" synchronous="1" index="31">
+ <chassis name="server" implement="MUST"/>
+ <field name="channel-max" domain="short">
+ <assert check="notnull"/>
+ <assert check="le" method="tune" field="channel-max"/>
+ </field>
+ <field name="frame-max" domain="long"/>
+ <field name="heartbeat" domain="short"/>
+ </method>
+ <method name="open" synchronous="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <response name="open-ok"/>
+ <field name="virtual-host" domain="path"/>
+ <field name="capabilities" type="shortstr" reserved="1"/>
+ <field name="insist" type="bit" reserved="1"/>
+ </method>
+ <method name="open-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <field name="known-hosts" domain="known-hosts" reserved="1"/>
+ </method>
+ <method name="close" synchronous="1" index="50">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="class-id" domain="class-id"/>
+ <field name="method-id" domain="method-id"/>
+ </method>
+ <method name="close-ok" synchronous="1" index="51">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ </method>
+ </class>
+ <class name="channel" handler="channel" index="20">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="open" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="open-ok"/>
+ <field name="out-of-band" type="shortstr" reserved="1"/>
+ </method>
+ <method name="open-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <field name="channel-id" type="longstr" reserved="1"/>
+ </method>
+ <method name="flow" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="flow-ok"/>
+ <field name="active" domain="bit"/>
+ </method>
+ <method name="flow-ok" index="21">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="active" domain="bit"/>
+ </method>
+ <method name="close" synchronous="1" index="40">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="class-id" domain="class-id"/>
+ <field name="method-id" domain="method-id"/>
+ </method>
+ <method name="close-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ </method>
+ </class>
+ <class name="exchange" handler="channel" index="40">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="declare" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="declare-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="exchange" domain="exchange-name">
+ <assert check="notnull"/>
+ </field>
+ <field name="type" domain="shortstr"/>
+ <field name="passive" domain="bit"/>
+ <field name="durable" domain="bit"/>
+ <field name="auto-delete" type="bit" reserved="1"/>
+ <field name="internal" type="bit" reserved="1"/>
+ <field name="nowait" domain="bit"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="declare-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="delete" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="delete-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="exchange" domain="exchange-name">
+ <assert check="notnull"/>
+ </field>
+ <field name="if-unused" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="delete-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <!-- Qpid : Added Exchange.bound and Exchange.bound-ok -->
+ <method name="bound" synchronous="1" index="22">
+ <chassis name="server" implement="SHOULD"/>
+ <response name="bound-ok"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name = "routing-key" type = "shortstr"/>
+ <field name = "queue" domain = "queue name"/>
+ </method>
+ <method name="bound-ok" synchronous="1" index="23">
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <chassis name="client" implement="SHOULD"/>
+ </method>
+ <!-- End Qpid addition -->
+ </class>
+ <class name="queue" handler="channel" index="50">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="declare" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="declare-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="passive" domain="bit"/>
+ <field name="durable" domain="bit"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="auto-delete" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="declare-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <field name="queue" domain="queue-name">
+ <assert check="notnull"/>
+ </field>
+ <field name="message-count" domain="long"/>
+ <field name="consumer-count" domain="long"/>
+ </method>
+ <method name="bind" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="bind-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="nowait" domain="bit"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="bind-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="unbind" synchronous="1" index="50">
+ <chassis name="server" implement="MUST"/>
+ <response name="unbind-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="unbind-ok" synchronous="1" index="51">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="purge" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="purge-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="purge-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="message-count" domain="long"/>
+ </method>
+ <method name="delete" synchronous="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <response name="delete-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="if-unused" domain="bit"/>
+ <field name="if-empty" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="delete-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <field name="message-count" domain="long"/>
+ </method>
+ </class>
+ <class name="basic" handler="channel" index="60">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="content-type" domain="shortstr"/>
+ <field name="content-encoding" domain="shortstr"/>
+ <field name="headers" domain="table"/>
+ <field name="delivery-mode" domain="octet"/>
+ <field name="priority" domain="octet"/>
+ <field name="correlation-id" domain="shortstr"/>
+ <field name="reply-to" domain="shortstr"/>
+ <field name="expiration" domain="shortstr"/>
+ <field name="message-id" domain="shortstr"/>
+ <field name="timestamp" domain="timestamp"/>
+ <field name="type" domain="shortstr"/>
+ <field name="user-id" domain="shortstr"/>
+ <field name="app-id" domain="shortstr"/>
+ <field name="reserved" domain="shortstr"/>
+ <method name="qos" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" domain="long"/>
+ <field name="prefetch-count" domain="short"/>
+ <field name="global" domain="bit"/>
+ </method>
+ <method name="qos-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="consume" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="consume-ok"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="no-local" domain="no-local"/>
+ <field name="no-ack" domain="no-ack"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="consume-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="cancel" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="cancel-ok"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="cancel-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="publish" content="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="mandatory" domain="bit"/>
+ <field name="immediate" domain="bit"/>
+ </method>
+ <method name="return" content="1" index="50">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ </method>
+ <method name="deliver" content="1" index="60">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ </method>
+ <method name="get" synchronous="1" index="70">
+ <response name="get-ok"/>
+ <response name="get-empty"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access-ticket" reserved="1"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="no-ack" domain="no-ack"/>
+ </method>
+ <method name="get-ok" synchronous="1" content="1" index="71">
+ <chassis name="client" implement="MAY"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="message-count" domain="long"/>
+ </method>
+ <method name="get-empty" synchronous="1" index="72">
+ <chassis name="client" implement="MAY"/>
+ <field name="cluster-id" type="shortstr" reserved="1"/>
+ </method>
+ <method name="ack" index="80">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="multiple" domain="bit"/>
+ </method>
+ <method name="reject" index="90">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="requeue" domain="bit"/>
+ </method>
+ <method name="recover" index="100" deprecated="1">
+ <chassis name="server" implement="MAY"/>
+ <field name="requeue" domain="bit"/>
+ </method>
+ <method name="recover-sync" index="110">
+ <chassis name="server" implement="MUST"/>
+ <field name="requeue" domain="bit"/>
+ </method>
+ <method name="recover-sync-ok" synchronous="1" index="111">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ </class>
+ <class name="tx" handler="channel" index="90">
+ <chassis name="server" implement="SHOULD"/>
+ <chassis name="client" implement="MAY"/>
+ <method name="select" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="select-ok"/>
+ </method>
+ <method name="select-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="commit" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="commit-ok"/>
+ </method>
+ <method name="commit-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="rollback" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="rollback-ok"/>
+ </method>
+ <method name="rollback-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ </class>
+</amqp>
diff --git a/qpid/python/qpid/specs/amqp-0-9-qpid-stripped.xml b/qpid/python/qpid/specs/amqp-0-9-qpid-stripped.xml
new file mode 100644
index 0000000000..e0075870de
--- /dev/null
+++ b/qpid/python/qpid/specs/amqp-0-9-qpid-stripped.xml
@@ -0,0 +1,876 @@
+<?xml version="1.0"?>
+
+<!--
+(c) Copyright JPMorgan Chase Bank & Co., Cisco Systems, Inc., Envoy
+Technologies Inc., iMatix Corporation, IONA\ufffd Technologies, Red
+Hat, Inc., TWIST Process Innovations, and 29West Inc. 2006.
+
+Copyright (c) 2009 AMQP Working Group.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+notice, this list of conditions and the following disclaimer in the
+documentation and/or other materials provided with the distribution.
+3. The name of the author may not be used to endorse or promote products
+derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+-->
+
+<amqp major="0" minor="9" port="5672">
+ <constant name="frame-method" value="1"/>
+ <constant name="frame-header" value="2"/>
+ <constant name="frame-body" value="3"/>
+ <constant name="frame-oob-method" value="4"/>
+ <constant name="frame-oob-header" value="5"/>
+ <constant name="frame-oob-body" value="6"/>
+ <constant name="frame-trace" value="7"/>
+ <constant name="frame-heartbeat" value="8"/>
+ <constant name="frame-min-size" value="4096"/>
+ <constant name="frame-end" value="206"/>
+ <constant name="reply-success" value="200"/>
+ <constant name="not-delivered" value="310" class="soft-error"/>
+ <constant name="content-too-large" value="311" class="soft-error"/>
+ <constant name="no-route" value="312" class="soft-error"/>
+ <constant name="no-consumers" value="313" class="soft-error"/>
+ <constant name="connection-forced" value="320" class="hard-error"/>
+ <constant name="invalid-path" value="402" class="hard-error"/>
+ <constant name="access-refused" value="403" class="soft-error"/>
+ <constant name="not-found" value="404" class="soft-error"/>
+ <constant name="resource-locked" value="405" class="soft-error"/>
+ <constant name="precondition-failed" value="406" class="soft-error"/>
+ <constant name="frame-error" value="501" class="hard-error"/>
+ <constant name="syntax-error" value="502" class="hard-error"/>
+ <constant name="command-invalid" value="503" class="hard-error"/>
+ <constant name="channel-error" value="504" class="hard-error"/>
+ <constant name="resource-error" value="506" class="hard-error"/>
+ <constant name="not-allowed" value="530" class="hard-error"/>
+ <constant name="not-implemented" value="540" class="hard-error"/>
+ <constant name="internal-error" value="541" class="hard-error"/>
+ <domain name="access-ticket" type="short">
+ <assert check="ne" value="0"/>
+ </domain>
+ <domain name="class-id" type="short"/>
+ <domain name="consumer-tag" type="shortstr"/>
+ <domain name="delivery-tag" type="longlong"/>
+ <domain name="exchange-name" type="shortstr">
+ <assert check="length" value="127"/>
+ </domain>
+ <domain name="known-hosts" type="shortstr"/>
+ <domain name="method-id" type="short"/>
+ <domain name="no-ack" type="bit"/>
+ <domain name="no-local" type="bit"/>
+ <domain name="path" type="shortstr">
+ <assert check="notnull"/>
+ <assert check="syntax" rule="path"/>
+ <assert check="length" value="127"/>
+ </domain>
+ <domain name="peer-properties" type="table"/>
+ <domain name="queue-name" type="shortstr">
+ <assert check="length" value="127"/>
+ </domain>
+ <domain name="redelivered" type="bit"/>
+ <domain name="reply-code" type="short">
+ <assert check="notnull"/>
+ </domain>
+ <domain name="reply-text" type="shortstr">
+ <assert check="notnull"/>
+ </domain>
+ <domain name="channel-id" type="longstr"/>
+ <domain name="duration" type="longlong"/>
+ <domain name="offset" type="longlong"/>
+ <domain name="reference" type="longstr"/>
+ <domain name="destination" type="shortstr"/>
+ <domain name="reject-code" type="short"/>
+ <domain name="reject-text" type="shortstr"/>
+ <domain name="security-token" type="longstr"/>
+ <domain name="bit" type="bit"/>
+ <domain name="octet" type="octet"/>
+ <domain name="short" type="short"/>
+ <domain name="long" type="long"/>
+ <domain name="longlong" type="longlong"/>
+ <domain name="shortstr" type="shortstr"/>
+ <domain name="longstr" type="longstr"/>
+ <domain name="timestamp" type="timestamp"/>
+ <domain name="table" type="table"/>
+ <class name="connection" handler="connection" index="10">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="start" synchronous="1" index="10">
+ <chassis name="client" implement="MUST"/>
+ <response name="start-ok"/>
+ <field name="version-major" domain="octet"/>
+ <field name="version-minor" domain="octet"/>
+ <field name="server-properties" domain="peer-properties"/>
+ <field name="mechanisms" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="locales" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="start-ok" synchronous="1" index="11">
+ <chassis name="server" implement="MUST"/>
+ <field name="client-properties" domain="peer-properties"/>
+ <field name="mechanism" domain="shortstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="response" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="locale" domain="shortstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="secure" synchronous="1" index="20">
+ <chassis name="client" implement="MUST"/>
+ <response name="secure-ok"/>
+ <field name="challenge" domain="longstr"/>
+ </method>
+ <method name="secure-ok" synchronous="1" index="21">
+ <chassis name="server" implement="MUST"/>
+ <field name="response" domain="longstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="tune" synchronous="1" index="30">
+ <chassis name="client" implement="MUST"/>
+ <response name="tune-ok"/>
+ <field name="channel-max" domain="short"/>
+ <field name="frame-max" domain="long"/>
+ <field name="heartbeat" domain="short"/>
+ </method>
+ <method name="tune-ok" synchronous="1" index="31">
+ <chassis name="server" implement="MUST"/>
+ <field name="channel-max" domain="short">
+ <assert check="notnull"/>
+ <assert check="le" method="tune" field="channel-max"/>
+ </field>
+ <field name="frame-max" domain="long"/>
+ <field name="heartbeat" domain="short"/>
+ </method>
+ <method name="open" synchronous="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <response name="open-ok"/>
+ <response name="redirect"/>
+ <field name="virtual-host" domain="path">
+ <assert check="regexp" value="^[a-zA-Z0-9/-_]+$"/>
+ </field>
+ <field name="capabilities" domain="shortstr"/>
+ <field name="insist" domain="bit"/>
+ </method>
+ <method name="open-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <field name="known-hosts" domain="known-hosts"/>
+ </method>
+ <method name="redirect" synchronous="1" index="42">
+ <chassis name="client" implement="MUST"/>
+ <field name="host" domain="shortstr">
+ <assert check="notnull"/>
+ </field>
+ <field name="known-hosts" domain="known-hosts"/>
+ </method>
+ <method name="close" synchronous="1" index="50">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="class-id" domain="class-id"/>
+ <field name="method-id" domain="method-id"/>
+ </method>
+ <method name="close-ok" synchronous="1" index="51">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ </method>
+ </class>
+ <class name="channel" handler="channel" index="20">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="open" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="open-ok"/>
+ <field name="out-of-band" domain="shortstr">
+ <assert check="null"/>
+ </field>
+ </method>
+ <method name="open-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <field name="channel-id" domain="channel-id"/>
+ </method>
+ <method name="flow" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="flow-ok"/>
+ <field name="active" domain="bit"/>
+ </method>
+ <method name="flow-ok" index="21">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="active" domain="bit"/>
+ </method>
+ <method name="close" synchronous="1" index="40">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ <response name="close-ok"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="class-id" domain="class-id"/>
+ <field name="method-id" domain="method-id"/>
+ </method>
+ <method name="close-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <chassis name="server" implement="MUST"/>
+ </method>
+ <method name="resume" index="50">
+ <response name="ok"/>
+ <chassis name="server" implement="MAY"/>
+ <field name="channel-id" domain="channel-id"/>
+ </method>
+ <method name="ping" index="60">
+ <response name="ok"/>
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="pong" index="70">
+ <response name="ok"/>
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="ok" index="80">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ </method>
+ </class>
+ <class name="access" handler="connection" index="30">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="request" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="request-ok"/>
+ <field name="realm" domain="shortstr"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="passive" domain="bit"/>
+ <field name="active" domain="bit"/>
+ <field name="write" domain="bit"/>
+ <field name="read" domain="bit"/>
+ </method>
+ <method name="request-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <field name="ticket" domain="access-ticket"/>
+ </method>
+ </class>
+ <class name="exchange" handler="channel" index="40">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="declare" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="declare-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="exchange" domain="exchange-name">
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/>
+ </field>
+ <field name="type" domain="shortstr">
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]+$"/>
+ </field>
+ <field name="passive" domain="bit"/>
+ <field name="durable" domain="bit"/>
+ <field name="auto-delete" domain="bit"/>
+ <field name="internal" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="declare-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="delete" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="delete-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="exchange" domain="exchange-name">
+ <assert check="notnull"/>
+ </field>
+ <field name="if-unused" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="delete-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <!-- Qpid specific addition -->
+ <method name="bound" synchronous="1" index="22">
+ <chassis name="server" implement="SHOULD"/>
+ <response name="bound-ok"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" type="shortstr"/>
+ <field name="queue" domain="queue name"/>
+ </method>
+ <method name="bound-ok" synchronous="1" index="23">
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <chassis name="client" implement="SHOULD"/>
+ </method>
+ <!-- End Qpid specific addition -->
+ </class>
+ <class name="queue" handler="channel" index="50">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="declare" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="declare-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name">
+ <assert check="regexp" value="^[a-zA-Z0-9-_.:]*$"/>
+ </field>
+ <field name="passive" domain="bit"/>
+ <field name="durable" domain="bit"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="auto-delete" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ <!-- Qpid diff - this field is known as filter in the original 0-9,
+ however since the name does not go on the wire, there is no
+ interop implication -->
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="declare-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ <field name="queue" domain="queue-name">
+ <assert check="notnull"/>
+ </field>
+ <field name="message-count" domain="long"/>
+ <field name="consumer-count" domain="long"/>
+ </method>
+ <method name="bind" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="bind-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="nowait" domain="bit"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="bind-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="unbind" synchronous="1" index="50">
+ <chassis name="server" implement="MUST"/>
+ <response name="unbind-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="unbind-ok" synchronous="1" index="51">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="purge" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="purge-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="purge-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="message-count" domain="long"/>
+ </method>
+ <method name="delete" synchronous="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <response name="delete-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="if-unused" domain="bit"/>
+ <field name="if-empty" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="delete-ok" synchronous="1" index="41">
+ <chassis name="client" implement="MUST"/>
+ <field name="message-count" domain="long"/>
+ </method>
+ </class>
+ <class name="basic" handler="channel" index="60">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="content-type" domain="shortstr"/>
+ <field name="content-encoding" domain="shortstr"/>
+ <field name="headers" domain="table"/>
+ <field name="delivery-mode" domain="octet"/>
+ <field name="priority" domain="octet"/>
+ <field name="correlation-id" domain="shortstr"/>
+ <field name="reply-to" domain="shortstr"/>
+ <field name="expiration" domain="shortstr"/>
+ <field name="message-id" domain="shortstr"/>
+ <field name="timestamp" domain="timestamp"/>
+ <field name="type" domain="shortstr"/>
+ <field name="user-id" domain="shortstr"/>
+ <field name="app-id" domain="shortstr"/>
+ <field name="cluster-id" domain="shortstr"/>
+ <method name="qos" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" domain="long"/>
+ <field name="prefetch-count" domain="short"/>
+ <field name="global" domain="bit"/>
+ </method>
+ <method name="qos-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="consume" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="consume-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="no-local" domain="no-local"/>
+ <field name="no-ack" domain="no-ack"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ <field name="arguments" domain="table"/>
+ </method>
+ <method name="consume-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="cancel" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="cancel-ok"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="cancel-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="publish" content="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="mandatory" domain="bit"/>
+ <field name="immediate" domain="bit"/>
+ </method>
+ <method name="return" content="1" index="50">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ </method>
+ <method name="deliver" content="1" index="60">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ </method>
+ <method name="get" synchronous="1" index="70">
+ <response name="get-ok"/>
+ <response name="get-empty"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="no-ack" domain="no-ack"/>
+ </method>
+ <method name="get-ok" synchronous="1" content="1" index="71">
+ <chassis name="client" implement="MAY"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="message-count" domain="long"/>
+ </method>
+ <method name="get-empty" synchronous="1" index="72">
+ <chassis name="client" implement="MAY"/>
+ <field name="cluster-id" domain="shortstr"/>
+ </method>
+ <method name="ack" index="80">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="multiple" domain="bit"/>
+ </method>
+ <method name="reject" index="90">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="requeue" domain="bit"/>
+ </method>
+ <method name="recover" index="100">
+ <chassis name="server" implement="MUST"/>
+ <field name="requeue" domain="bit"/>
+ </method>
+ <!-- Qpid specific addition -->
+ <method name="recover-sync" index="102">
+ <chassis name="server" implement="MUST"/>
+ <field name="requeue" type="bit"/>
+ <response name="recover-sync-ok"/>
+ </method>
+ <method name="recover-sync-ok" synchronous="1" index="101">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <!-- End Qpid specific addition -->
+ </class>
+ <class name="file" handler="channel" index="70">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="content-type" domain="shortstr"/>
+ <field name="content-encoding" domain="shortstr"/>
+ <field name="headers" domain="table"/>
+ <field name="priority" domain="octet"/>
+ <field name="reply-to" domain="shortstr"/>
+ <field name="message-id" domain="shortstr"/>
+ <field name="filename" domain="shortstr"/>
+ <field name="timestamp" domain="timestamp"/>
+ <field name="cluster-id" domain="shortstr"/>
+ <method name="qos" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" domain="long"/>
+ <field name="prefetch-count" domain="short"/>
+ <field name="global" domain="bit"/>
+ </method>
+ <method name="qos-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="consume" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="consume-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="no-local" domain="no-local"/>
+ <field name="no-ack" domain="no-ack"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ <field name="filter" domain="table"/>
+ </method>
+ <method name="consume-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="cancel" synchronous="1" index="30">
+ <response name="cancel-ok"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="cancel-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="open" synchronous="1" index="40">
+ <response name="open-ok"/>
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="identifier" domain="shortstr"/>
+ <field name="content-size" domain="longlong"/>
+ </method>
+ <method name="open-ok" synchronous="1" index="41">
+ <response name="stage"/>
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="staged-size" domain="longlong"/>
+ </method>
+ <method name="stage" content="1" index="50">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="publish" index="60">
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="mandatory" domain="bit"/>
+ <field name="immediate" domain="bit"/>
+ <field name="identifier" domain="shortstr"/>
+ </method>
+ <method name="return" content="1" index="70">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ </method>
+ <method name="deliver" index="80">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="identifier" domain="shortstr"/>
+ </method>
+ <method name="ack" index="90">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="multiple" domain="bit"/>
+ </method>
+ <method name="reject" index="100">
+ <chassis name="server" implement="MUST"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="requeue" domain="bit"/>
+ </method>
+ </class>
+ <class name="stream" handler="channel" index="80">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="content-type" domain="shortstr"/>
+ <field name="content-encoding" domain="shortstr"/>
+ <field name="headers" domain="table"/>
+ <field name="priority" domain="octet"/>
+ <field name="timestamp" domain="timestamp"/>
+ <method name="qos" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="qos-ok"/>
+ <field name="prefetch-size" domain="long"/>
+ <field name="prefetch-count" domain="short"/>
+ <field name="consume-rate" domain="long"/>
+ <field name="global" domain="bit"/>
+ </method>
+ <method name="qos-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="consume" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="consume-ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="no-local" domain="no-local"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="nowait" domain="bit"/>
+ <field name="filter" domain="table"/>
+ </method>
+ <method name="consume-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="cancel" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="cancel-ok"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="nowait" domain="bit"/>
+ </method>
+ <method name="cancel-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ </method>
+ <method name="publish" content="1" index="40">
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="mandatory" domain="bit"/>
+ <field name="immediate" domain="bit"/>
+ </method>
+ <method name="return" content="1" index="50">
+ <chassis name="client" implement="MUST"/>
+ <field name="reply-code" domain="reply-code"/>
+ <field name="reply-text" domain="reply-text"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ </method>
+ <method name="deliver" content="1" index="60">
+ <chassis name="client" implement="MUST"/>
+ <field name="consumer-tag" domain="consumer-tag"/>
+ <field name="delivery-tag" domain="delivery-tag"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="queue" domain="queue-name">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ </class>
+ <class name="tx" handler="channel" index="90">
+ <chassis name="server" implement="SHOULD"/>
+ <chassis name="client" implement="MAY"/>
+ <method name="select" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="select-ok"/>
+ </method>
+ <method name="select-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="commit" synchronous="1" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="commit-ok"/>
+ </method>
+ <method name="commit-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="rollback" synchronous="1" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="rollback-ok"/>
+ </method>
+ <method name="rollback-ok" synchronous="1" index="31">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ </class>
+ <class name="dtx" handler="channel" index="100">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <method name="select" synchronous="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <response name="select-ok"/>
+ </method>
+ <method name="select-ok" synchronous="1" index="11">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="start" synchronous="1" index="20">
+ <chassis name="server" implement="MAY"/>
+ <response name="start-ok"/>
+ <field name="dtx-identifier" domain="shortstr">
+ <assert check="notnull"/>
+ </field>
+ </method>
+ <method name="start-ok" synchronous="1" index="21">
+ <chassis name="client" implement="MUST"/>
+ </method>
+ </class>
+ <class name="tunnel" handler="tunnel" index="110">
+ <chassis name="server" implement="MAY"/>
+ <chassis name="client" implement="MAY"/>
+ <field name="headers" domain="table"/>
+ <field name="proxy-name" domain="shortstr"/>
+ <field name="data-name" domain="shortstr"/>
+ <field name="durable" domain="octet"/>
+ <field name="broadcast" domain="octet"/>
+ <method name="request" content="1" index="10">
+ <chassis name="server" implement="MUST"/>
+ <field name="meta-data" domain="table"/>
+ </method>
+ </class>
+ <class name="message" handler="channel" index="120">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <method name="transfer" index="10">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="ok"/>
+ <response name="reject"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="destination" domain="destination"/>
+ <field name="redelivered" domain="redelivered"/>
+ <field name="immediate" domain="bit"/>
+ <field name="ttl" domain="duration"/>
+ <field name="priority" domain="octet"/>
+ <field name="timestamp" domain="timestamp"/>
+ <field name="delivery-mode" domain="octet"/>
+ <field name="expiration" domain="timestamp"/>
+ <field name="exchange" domain="exchange-name"/>
+ <field name="routing-key" domain="shortstr"/>
+ <field name="message-id" domain="shortstr"/>
+ <field name="correlation-id" domain="shortstr"/>
+ <field name="reply-to" domain="shortstr"/>
+ <field name="content-type" domain="shortstr"/>
+ <field name="content-encoding" domain="shortstr"/>
+ <field name="user-id" domain="shortstr"/>
+ <field name="app-id" domain="shortstr"/>
+ <field name="transaction-id" domain="shortstr"/>
+ <field name="security-token" domain="security-token"/>
+ <field name="application-headers" domain="table"/>
+ <field name="body" domain="content"/>
+ </method>
+ <method name="consume" index="20">
+ <chassis name="server" implement="MUST"/>
+ <response name="ok"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="destination" domain="destination"/>
+ <field name="no-local" domain="no-local"/>
+ <field name="no-ack" domain="no-ack"/>
+ <field name="exclusive" domain="bit"/>
+ <field name="filter" domain="table"/>
+ </method>
+ <method name="cancel" index="30">
+ <chassis name="server" implement="MUST"/>
+ <response name="ok"/>
+ <field name="destination" domain="destination"/>
+ </method>
+ <method name="get" index="40">
+ <response name="ok"/>
+ <response name="empty"/>
+ <chassis name="server" implement="MUST"/>
+ <field name="ticket" domain="access-ticket"/>
+ <field name="queue" domain="queue-name"/>
+ <field name="destination" domain="destination"/>
+ <field name="no-ack" domain="no-ack"/>
+ </method>
+ <method name="recover" index="50">
+ <chassis name="server" implement="MUST"/>
+ <response name="ok"/>
+ <field name="requeue" domain="bit"/>
+ </method>
+ <method name="open" index="60">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="ok"/>
+ <field name="reference" domain="reference"/>
+ </method>
+ <method name="close" index="70">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="ok"/>
+ <field name="reference" domain="reference"/>
+ </method>
+ <method name="append" index="80">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="ok"/>
+ <field name="reference" domain="reference"/>
+ <field name="bytes" domain="longstr"/>
+ </method>
+ <method name="checkpoint" index="90">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="ok"/>
+ <field name="reference" domain="reference"/>
+ <field name="identifier" domain="shortstr"/>
+ </method>
+ <method name="resume" index="100">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <response name="offset"/>
+ <field name="reference" domain="reference"/>
+ <field name="identifier" domain="shortstr"/>
+ </method>
+ <method name="qos" index="110">
+ <chassis name="server" implement="MUST"/>
+ <response name="ok"/>
+ <field name="prefetch-size" domain="long"/>
+ <field name="prefetch-count" domain="short"/>
+ <field name="global" domain="bit"/>
+ </method>
+ <method name="ok" index="500">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="empty" index="510">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ </method>
+ <method name="reject" index="520">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="code" domain="reject-code"/>
+ <field name="text" domain="reject-text"/>
+ </method>
+ <method name="offset" index="530">
+ <chassis name="server" implement="MUST"/>
+ <chassis name="client" implement="MUST"/>
+ <field name="value" domain="offset"/>
+ </method>
+ </class>
+</amqp>
diff --git a/qpid/python/qpid/specs_config.py b/qpid/python/qpid/specs_config.py
new file mode 100644
index 0000000000..d991e8b084
--- /dev/null
+++ b/qpid/python/qpid/specs_config.py
@@ -0,0 +1,26 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import os
+
+AMQP_SPEC_DIR=os.path.join(os.path.dirname(os.path.abspath(__file__)), "specs")
+amqp_spec = os.path.join(AMQP_SPEC_DIR, "amqp-0-10-qpid-errata-stripped.xml")
+amqp_spec_0_8 = os.path.join(AMQP_SPEC_DIR, "amqp-0-8-qpid-stripped.xml")
+amqp_spec_0_9 = os.path.join(AMQP_SPEC_DIR, "amqp-0-9-qpid-stripped.xml")
+amqp_spec_0_9_1 = os.path.join(AMQP_SPEC_DIR, "amqp-0-9-1-stripped.xml")
diff --git a/qpid/python/qpid/testlib.py b/qpid/python/qpid/testlib.py
new file mode 100644
index 0000000000..256aa7b5e6
--- /dev/null
+++ b/qpid/python/qpid/testlib.py
@@ -0,0 +1,241 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+#
+# Support library for qpid python tests.
+#
+
+import string
+import random
+
+import unittest, traceback, socket
+import qpid.client, qmf.console
+import Queue
+from qpid.content import Content
+from qpid.message import Message
+from qpid.harness import Skipped
+from qpid.exceptions import VersionError
+
+import qpid.messaging
+from qpidtoollibs import BrokerAgent
+
+class TestBase(unittest.TestCase):
+ """Base class for Qpid test cases.
+
+ self.client is automatically connected with channel 1 open before
+ the test methods are run.
+
+ Deletes queues and exchanges after. Tests call
+ self.queue_declare(channel, ...) and self.exchange_declare(chanel,
+ ...) which are wrappers for the Channel functions that note
+ resources to clean up later.
+ """
+
+ def configure(self, config):
+ self.config = config
+
+ def setUp(self):
+ self.queues = []
+ self.exchanges = []
+ self.client = self.connect()
+ self.channel = self.client.channel(1)
+ self.version = (self.client.spec.major, self.client.spec.minor)
+ if self.version == (8, 0) or self.version == (0, 9):
+ self.channel.channel_open()
+ else:
+ self.channel.session_open()
+
+ def tearDown(self):
+ try:
+ for ch, q in self.queues:
+ ch.queue_delete(queue=q)
+ for ch, ex in self.exchanges:
+ ch.exchange_delete(exchange=ex)
+ except:
+ print "Error on tearDown:"
+ print traceback.print_exc()
+
+ self.client.close()
+
+ def connect(self, host=None, port=None, user=None, password=None, tune_params=None, client_properties=None, channel_options=None):
+ """Create a new connction, return the Client object"""
+ host = host or self.config.broker.host
+ port = port or self.config.broker.port or 5672
+ user = user or self.config.broker.user or "guest"
+ password = password or self.config.broker.password or "guest"
+ client = qpid.client.Client(host, port)
+ try:
+ client.start(username = user, password=password, tune_params=tune_params, client_properties=client_properties, channel_options=channel_options)
+ except qpid.client.Closed, e:
+ if isinstance(e.args[0], VersionError):
+ raise Skipped(e.args[0])
+ else:
+ raise e
+ except socket.error, e:
+ raise Skipped(e)
+ return client
+
+ def queue_declare(self, channel=None, *args, **keys):
+ channel = channel or self.channel
+ reply = channel.queue_declare(*args, **keys)
+ self.queues.append((channel, keys["queue"]))
+ return reply
+
+ def exchange_declare(self, channel=None, ticket=0, exchange='',
+ type='', passive=False, durable=False,
+ auto_delete=False,
+ arguments={}):
+ channel = channel or self.channel
+ reply = channel.exchange_declare(ticket=ticket, exchange=exchange, type=type, passive=passive,durable=durable, auto_delete=auto_delete, arguments=arguments)
+ self.exchanges.append((channel,exchange))
+ return reply
+
+ def uniqueString(self):
+ """Generate a unique string, unique for this TestBase instance"""
+ if not "uniqueCounter" in dir(self): self.uniqueCounter = 1;
+ return "Test Message " + str(self.uniqueCounter)
+
+ def randomLongString(self, length=65535):
+ body = ''.join(random.choice(string.ascii_uppercase) for _ in range(length))
+ return body
+
+ def consume(self, queueName, no_ack=True):
+ """Consume from named queue returns the Queue object."""
+
+ reply = self.channel.basic_consume(queue=queueName, no_ack=no_ack)
+ return self.client.queue(reply.consumer_tag)
+
+ def subscribe(self, channel=None, **keys):
+ channel = channel or self.channel
+ consumer_tag = keys["destination"]
+ channel.message_subscribe(**keys)
+ channel.message_flow(destination=consumer_tag, unit=0, value=0xFFFFFFFFL)
+ channel.message_flow(destination=consumer_tag, unit=1, value=0xFFFFFFFFL)
+
+ def assertEmpty(self, queue):
+ """Assert that the queue is empty"""
+ try:
+ queue.get(timeout=1)
+ self.fail("Queue is not empty.")
+ except Queue.Empty: None # Ignore
+
+ def assertPublishGet(self, queue, exchange="", routing_key="", properties=None):
+ """
+ Publish to exchange and assert queue.get() returns the same message.
+ """
+ body = self.uniqueString()
+ self.channel.basic_publish(
+ exchange=exchange,
+ content=Content(body, properties=properties),
+ routing_key=routing_key)
+ msg = queue.get(timeout=1)
+ self.assertEqual(body, msg.content.body)
+ if (properties):
+ self.assertEqual(properties, msg.content.properties)
+
+ def assertPublishConsume(self, queue="", exchange="", routing_key="", properties=None):
+ """
+ Publish a message and consume it, assert it comes back intact.
+ Return the Queue object used to consume.
+ """
+ self.assertPublishGet(self.consume(queue), exchange, routing_key, properties)
+
+ def assertChannelException(self, expectedCode, message):
+ if self.version == (8, 0) or self.version == (0, 9):
+ if not isinstance(message, Message): self.fail("expected channel_close method, got %s" % (message))
+ self.assertEqual("channel", message.method.klass.name)
+ self.assertEqual("close", message.method.name)
+ else:
+ if not isinstance(message, Message): self.fail("expected session_closed method, got %s" % (message))
+ self.assertEqual("session", message.method.klass.name)
+ self.assertEqual("closed", message.method.name)
+ self.assertEqual(expectedCode, message.reply_code)
+
+
+ def assertConnectionException(self, expectedCode, message):
+ if not isinstance(message, Message): self.fail("expected connection_close method, got %s" % (message))
+ self.assertEqual("connection", message.method.klass.name)
+ self.assertEqual("close", message.method.name)
+ self.assertEqual(expectedCode, message.reply_code)
+
+#0-10 support
+from qpid.connection import Connection
+from qpid.util import connect, ssl, URL
+
+class TestBase010(unittest.TestCase):
+ """
+ Base class for Qpid test cases. using the final 0-10 spec
+ """
+
+ def configure(self, config):
+ self.config = config
+ self.broker = config.broker
+ self.defines = self.config.defines
+
+ def setUp(self):
+ self.conn = self.connect()
+ self.session = self.conn.session("test-session", timeout=10)
+ self.qmf = None
+ self.test_queue_name = self.id()
+
+ def startQmf(self, handler=None):
+ self.qmf = qmf.console.Session(handler)
+ self.qmf_broker = self.qmf.addBroker(str(self.broker))
+
+ def startBrokerAccess(self):
+ """
+ New-style management access to the broker. Can be used in lieu of startQmf.
+ """
+ if 'broker_conn' not in self.__dict__:
+ self.broker_conn = qpid.messaging.Connection(str(self.broker))
+ self.broker_conn.open()
+ self.broker_access = BrokerAgent(self.broker_conn)
+
+ def connect(self, host=None, port=None):
+ url = self.broker
+ if url.scheme == URL.AMQPS:
+ default_port = 5671
+ else:
+ default_port = 5672
+ try:
+ sock = connect(host or url.host, port or url.port or default_port)
+ except socket.error, e:
+ raise Skipped(e)
+ if url.scheme == URL.AMQPS:
+ sock = ssl(sock)
+ conn = Connection(sock, username=url.user or "guest",
+ password=url.password or "guest")
+ try:
+ conn.start(timeout=10)
+ except VersionError, e:
+ raise Skipped(e)
+ return conn
+
+ def tearDown(self):
+ if not self.session.error(): self.session.close(timeout=10)
+ self.conn.close(timeout=10)
+ if self.qmf:
+ self.qmf.delBroker(self.qmf_broker)
+
+ def subscribe(self, session=None, **keys):
+ session = session or self.session
+ consumer_tag = keys["destination"]
+ session.message_subscribe(**keys)
+ session.message_flow(destination=consumer_tag, unit=0, value=0xFFFFFFFFL)
+ session.message_flow(destination=consumer_tag, unit=1, value=0xFFFFFFFFL)
diff --git a/qpid/python/qpid/tests/__init__.py b/qpid/python/qpid/tests/__init__.py
new file mode 100644
index 0000000000..85ab013b5a
--- /dev/null
+++ b/qpid/python/qpid/tests/__init__.py
@@ -0,0 +1,62 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+class Test:
+
+ def __init__(self, name):
+ self.name = name
+
+ def configure(self, config):
+ self.config = config
+
+# API Tests
+import qpid.tests.framing
+import qpid.tests.mimetype
+import qpid.tests.messaging
+
+# Legacy Tests
+import qpid.tests.codec
+import qpid.tests.queue
+import qpid.tests.datatypes
+import qpid.tests.connection
+import qpid.tests.spec010
+import qpid.tests.codec010
+import qpid.tests.util
+import qpid.tests.saslmech.finder
+
+class TestTestsXXX(Test):
+
+ def testFoo(self):
+ print "this test has output"
+
+ def testBar(self):
+ print "this test "*8
+ print "has"*10
+ print "a"*75
+ print "lot of"*10
+ print "output"*10
+
+ def testQux(self):
+ import sys
+ sys.stdout.write("this test has output with no newline")
+
+ def testQuxFail(self):
+ import sys
+ sys.stdout.write("this test has output with no newline")
+ fdsa
diff --git a/qpid/python/qpid/tests/codec.py b/qpid/python/qpid/tests/codec.py
new file mode 100644
index 0000000000..8017f794fe
--- /dev/null
+++ b/qpid/python/qpid/tests/codec.py
@@ -0,0 +1,729 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import unittest
+from qpid.codec import Codec
+from qpid.spec08 import load
+from cStringIO import StringIO
+from qpid.reference import ReferenceId
+
+__doc__ = """
+
+ This is a unit test script for qpid/codec.py
+
+ It can be run standalone or as part of the existing test framework.
+
+ To run standalone:
+ -------------------
+
+ Place in the qpid/python/tests/ directory and type...
+
+ python codec.py
+
+ A brief output will be printed on screen. The verbose output will be placed inn a file called
+ codec_unit_test_output.txt. [TODO: make this filename configurable]
+
+ To run as part of the existing test framework:
+ -----------------------------------------------
+
+ python run-tests tests.codec
+
+ Change History:
+ -----------------
+ Jimmy John 05/19/2007 Initial draft
+ Jimmy John 05/22/2007 Implemented comments by Rafael Schloming
+
+
+"""
+
+from qpid.specs_config import amqp_spec_0_8
+SPEC = load(amqp_spec_0_8)
+
+# --------------------------------------
+# --------------------------------------
+class BaseDataTypes(unittest.TestCase):
+
+
+ """
+ Base class containing common functions
+ """
+
+ # ---------------
+ def setUp(self):
+ """
+ standard setUp for unitetest (refer unittest documentation for details)
+ """
+ self.codec = Codec(StringIO(), SPEC)
+
+ # ------------------
+ def tearDown(self):
+ """
+ standard tearDown for unitetest (refer unittest documentation for details)
+ """
+ self.codec.stream.flush()
+ self.codec.stream.close()
+
+ # ----------------------------------------
+ def callFunc(self, functionName, *args):
+ """
+ helper function - given a function name and arguments, calls the function with the args and
+ returns the contents of the stream
+ """
+ getattr(self.codec, functionName)(args[0])
+ return self.codec.stream.getvalue()
+
+ # ----------------------------------------
+ def readFunc(self, functionName, *args):
+ """
+ helper function - creates a input stream and then calls the function with arguments as have been
+ supplied
+ """
+ self.codec.stream = StringIO(args[0])
+ return getattr(self.codec, functionName)()
+
+
+# ----------------------------------------
+# ----------------------------------------
+class IntegerTestCase(BaseDataTypes):
+
+ """
+ Handles octet, short, long, long long
+
+ """
+
+ # -------------------------
+ def __init__(self, *args):
+ """
+ sets constants for use in tests
+ """
+
+ BaseDataTypes.__init__(self, *args)
+ self.const_integer = 2
+ self.const_integer_octet_encoded = '\x02'
+ self.const_integer_short_encoded = '\x00\x02'
+ self.const_integer_long_encoded = '\x00\x00\x00\x02'
+ self.const_integer_long_long_encoded = '\x00\x00\x00\x00\x00\x00\x00\x02'
+
+ # -------------------------- #
+ # Unsigned Octect - 8 bits #
+ # -------------------------- #
+
+ # --------------------------
+ def test_unsigned_octet(self):
+ """
+ ubyte format requires 0<=number<=255
+ """
+ self.failUnlessEqual(self.callFunc('encode_octet', self.const_integer), self.const_integer_octet_encoded, 'octect encoding FAILED...')
+
+ # -------------------------------------------
+ def test_octet_out_of_upper_range(self):
+ """
+ testing for input above acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_octet, 256)
+
+ # -------------------------------------------
+ def test_uoctet_out_of_lower_range(self):
+ """
+ testing for input below acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_octet, -1)
+
+ # ---------------------------------
+ def test_uoctet_with_fraction(self):
+ """
+ the fractional part should be ignored...
+ """
+ self.failUnlessEqual(self.callFunc('encode_octet', 2.5), self.const_integer_octet_encoded, 'octect encoding FAILED with fractions...')
+
+ # ------------------------------------
+ def test_unsigned_octet_decode(self):
+ """
+ octet decoding
+ """
+ self.failUnlessEqual(self.readFunc('decode_octet', self.const_integer_octet_encoded), self.const_integer, 'octect decoding FAILED...')
+
+ # ----------------------------------- #
+ # Unsigned Short Integers - 16 bits #
+ # ----------------------------------- #
+
+ # -----------------------
+ def test_ushort_int(self):
+ """
+ testing unsigned short integer
+ """
+ self.failUnlessEqual(self.callFunc('encode_short', self.const_integer), self.const_integer_short_encoded, 'short encoding FAILED...')
+
+ # -------------------------------------------
+ def test_ushort_int_out_of_upper_range(self):
+ """
+ testing for input above acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_short, 65536)
+
+ # -------------------------------------------
+ def test_ushort_int_out_of_lower_range(self):
+ """
+ testing for input below acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_short, -1)
+
+ # ---------------------------------
+ def test_ushort_int_with_fraction(self):
+ """
+ the fractional part should be ignored...
+ """
+ self.failUnlessEqual(self.callFunc('encode_short', 2.5), self.const_integer_short_encoded, 'short encoding FAILED with fractions...')
+
+ # ------------------------------------
+ def test_ushort_int_decode(self):
+ """
+ unsigned short decoding
+ """
+ self.failUnlessEqual(self.readFunc('decode_short', self.const_integer_short_encoded), self.const_integer, 'unsigned short decoding FAILED...')
+
+
+ # ---------------------------------- #
+ # Unsigned Long Integers - 32 bits #
+ # ---------------------------------- #
+
+ # -----------------------
+ def test_ulong_int(self):
+ """
+ testing unsigned long iteger
+ """
+ self.failUnlessEqual(self.callFunc('encode_long', self.const_integer), self.const_integer_long_encoded, 'long encoding FAILED...')
+
+ # -------------------------------------------
+ def test_ulong_int_out_of_upper_range(self):
+ """
+ testing for input above acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_long, 4294967296)
+
+ # -------------------------------------------
+ def test_ulong_int_out_of_lower_range(self):
+ """
+ testing for input below acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_long, -1)
+
+ # ---------------------------------
+ def test_ulong_int_with_fraction(self):
+ """
+ the fractional part should be ignored...
+ """
+ self.failUnlessEqual(self.callFunc('encode_long', 2.5), self.const_integer_long_encoded, 'long encoding FAILED with fractions...')
+
+ # -------------------------------
+ def test_ulong_int_decode(self):
+ """
+ unsigned long decoding
+ """
+ self.failUnlessEqual(self.readFunc('decode_long', self.const_integer_long_encoded), self.const_integer, 'unsigned long decoding FAILED...')
+
+
+ # --------------------------------------- #
+ # Unsigned Long Long Integers - 64 bits #
+ # --------------------------------------- #
+
+ # -----------------------
+ def test_ulong_long_int(self):
+ """
+ testing unsinged long long integer
+ """
+ self.failUnlessEqual(self.callFunc('encode_longlong', self.const_integer), self.const_integer_long_long_encoded, 'long long encoding FAILED...')
+
+ # -------------------------------------------
+ def test_ulong_long_int_out_of_upper_range(self):
+ """
+ testing for input above acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_longlong, 18446744073709551616)
+
+ # -------------------------------------------
+ def test_ulong_long_int_out_of_lower_range(self):
+ """
+ testing for input below acceptable range
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_longlong, -1)
+
+ # ---------------------------------
+ def test_ulong_long_int_with_fraction(self):
+ """
+ the fractional part should be ignored...
+ """
+ self.failUnlessEqual(self.callFunc('encode_longlong', 2.5), self.const_integer_long_long_encoded, 'long long encoding FAILED with fractions...')
+
+ # ------------------------------------
+ def test_ulong_long_int_decode(self):
+ """
+ unsigned long long decoding
+ """
+ self.failUnlessEqual(self.readFunc('decode_longlong', self.const_integer_long_long_encoded), self.const_integer, 'unsigned long long decoding FAILED...')
+
+# -----------------------------------
+# -----------------------------------
+class BitTestCase(BaseDataTypes):
+
+ """
+ Handles bits
+ """
+
+ # ----------------------------------------------
+ def callFunc(self, functionName, *args):
+ """
+ helper function
+ """
+ for ele in args:
+ getattr(self.codec, functionName)(ele)
+
+ self.codec.flush()
+ return self.codec.stream.getvalue()
+
+ # -------------------
+ def test_bit1(self):
+ """
+ sends in 11
+ """
+ self.failUnlessEqual(self.callFunc('encode_bit', 1, 1), '\x03', '11 bit encoding FAILED...')
+
+ # -------------------
+ def test_bit2(self):
+ """
+ sends in 10011
+ """
+ self.failUnlessEqual(self.callFunc('encode_bit', 1, 1, 0, 0, 1), '\x13', '10011 bit encoding FAILED...')
+
+ # -------------------
+ def test_bit3(self):
+ """
+ sends in 1110100111 [10 bits(right to left), should be compressed into two octets]
+ """
+ self.failUnlessEqual(self.callFunc('encode_bit', 1,1,1,0,0,1,0,1,1,1), '\xa7\x03', '1110100111(right to left) bit encoding FAILED...')
+
+ # ------------------------------------
+ def test_bit_decode_1(self):
+ """
+ decode bit 1
+ """
+ self.failUnlessEqual(self.readFunc('decode_bit', '\x01'), 1, 'decode bit 1 FAILED...')
+
+ # ------------------------------------
+ def test_bit_decode_0(self):
+ """
+ decode bit 0
+ """
+ self.failUnlessEqual(self.readFunc('decode_bit', '\x00'), 0, 'decode bit 0 FAILED...')
+
+# -----------------------------------
+# -----------------------------------
+class StringTestCase(BaseDataTypes):
+
+ """
+ Handles short strings, long strings
+ """
+
+ # ------------------------------------------------------------- #
+ # Short Strings - 8 bit length followed by zero or more octets #
+ # ------------------------------------------------------------- #
+
+ # ---------------------------------------
+ def test_short_string_zero_length(self):
+ """
+ 0 length short string
+ """
+ self.failUnlessEqual(self.callFunc('encode_shortstr', ''), '\x00', '0 length short string encoding FAILED...')
+
+ # -------------------------------------------
+ def test_short_string_positive_length(self):
+ """
+ positive length short string
+ """
+ self.failUnlessEqual(self.callFunc('encode_shortstr', 'hello world'), '\x0bhello world', 'positive length short string encoding FAILED...')
+
+ # -------------------------------------------
+ def test_short_string_out_of_upper_range(self):
+ """
+ string length > 255
+ """
+ self.failUnlessRaises(Exception, self.codec.encode_shortstr, 'x'*256)
+
+ # ------------------------------------
+ def test_short_string_decode(self):
+ """
+ short string decode
+ """
+ self.failUnlessEqual(self.readFunc('decode_shortstr', '\x0bhello world'), 'hello world', 'short string decode FAILED...')
+
+
+ # ------------------------------------------------------------- #
+ # Long Strings - 32 bit length followed by zero or more octets #
+ # ------------------------------------------------------------- #
+
+ # ---------------------------------------
+ def test_long_string_zero_length(self):
+ """
+ 0 length long string
+ """
+ self.failUnlessEqual(self.callFunc('encode_longstr', ''), '\x00\x00\x00\x00', '0 length long string encoding FAILED...')
+
+ # -------------------------------------------
+ def test_long_string_positive_length(self):
+ """
+ positive length long string
+ """
+ self.failUnlessEqual(self.callFunc('encode_longstr', 'hello world'), '\x00\x00\x00\x0bhello world', 'positive length long string encoding FAILED...')
+
+ # ------------------------------------
+ def test_long_string_decode(self):
+ """
+ long string decode
+ """
+ self.failUnlessEqual(self.readFunc('decode_longstr', '\x00\x00\x00\x0bhello world'), 'hello world', 'long string decode FAILED...')
+
+
+# --------------------------------------
+# --------------------------------------
+class TimestampTestCase(BaseDataTypes):
+
+ """
+ No need of any test cases here as timestamps are implemented as long long which is tested above
+ """
+ pass
+
+# ---------------------------------------
+# ---------------------------------------
+class FieldTableTestCase(BaseDataTypes):
+
+ """
+ Handles Field Tables
+
+ Only S/I type messages seem to be implemented currently
+ """
+
+ # -------------------------
+ def __init__(self, *args):
+ """
+ sets constants for use in tests
+ """
+
+ BaseDataTypes.__init__(self, *args)
+ self.const_field_table_dummy_dict = {'$key1':'value1','$key2':'value2'}
+ self.const_field_table_dummy_dict_encoded = '\x00\x00\x00\x22\x05$key2S\x00\x00\x00\x06value2\x05$key1S\x00\x00\x00\x06value1'
+
+ # -------------------------------------------
+ def test_field_table_name_value_pair(self):
+ """
+ valid name value pair
+ """
+ self.failUnlessEqual(self.callFunc('encode_table', {'$key1':'value1'}), '\x00\x00\x00\x11\x05$key1S\x00\x00\x00\x06value1', 'valid name value pair encoding FAILED...')
+
+ # ---------------------------------------------------
+ def test_field_table_multiple_name_value_pair(self):
+ """
+ multiple name value pair
+ """
+ self.failUnlessEqual(self.callFunc('encode_table', self.const_field_table_dummy_dict), self.const_field_table_dummy_dict_encoded, 'multiple name value pair encoding FAILED...')
+
+ # ------------------------------------
+ def test_field_table_decode(self):
+ """
+ field table decode
+ """
+ self.failUnlessEqual(self.readFunc('decode_table', self.const_field_table_dummy_dict_encoded), self.const_field_table_dummy_dict, 'field table decode FAILED...')
+
+
+# ------------------------------------
+# ------------------------------------
+class ContentTestCase(BaseDataTypes):
+
+ """
+ Handles Content data types
+ """
+
+ # -----------------------------
+ def test_content_inline(self):
+ """
+ inline content
+ """
+ self.failUnlessEqual(self.callFunc('encode_content', 'hello inline message'), '\x00\x00\x00\x00\x14hello inline message', 'inline content encoding FAILED...')
+
+ # --------------------------------
+ def test_content_reference(self):
+ """
+ reference content
+ """
+ self.failUnlessEqual(self.callFunc('encode_content', ReferenceId('dummyId')), '\x01\x00\x00\x00\x07dummyId', 'reference content encoding FAILED...')
+
+ # ------------------------------------
+ def test_content_inline_decode(self):
+ """
+ inline content decode
+ """
+ self.failUnlessEqual(self.readFunc('decode_content', '\x00\x00\x00\x00\x14hello inline message'), 'hello inline message', 'inline content decode FAILED...')
+
+ # ------------------------------------
+ def test_content_reference_decode(self):
+ """
+ reference content decode
+ """
+ self.failUnlessEqual(self.readFunc('decode_content', '\x01\x00\x00\x00\x07dummyId').id, 'dummyId', 'reference content decode FAILED...')
+
+# -----------------------------------
+# -----------------------------------
+class BooleanTestCase(BaseDataTypes):
+
+ # -------------------
+ def test_true_encode(self):
+ self.failUnlessEqual(self.callFunc('encode_boolean', True), '\x01', 'True encoding FAILED...')
+
+ # -------------------
+ def test_true_decode(self):
+ self.failUnlessEqual(self.readFunc('decode_boolean', '\x01'), True, 'True decoding FAILED...')
+ self.failUnlessEqual(self.readFunc('decode_boolean', '\x02'), True, 'True decoding FAILED...')
+ self.failUnlessEqual(self.readFunc('decode_boolean', '\xFF'), True, 'True decoding FAILED...')
+
+ # -------------------
+ def test_false_encode(self):
+ self.failUnlessEqual(self.callFunc('encode_boolean', False), '\x00', 'False encoding FAILED...')
+
+ # -------------------
+ def test_false_decode(self):
+ self.failUnlessEqual(self.readFunc('decode_boolean', '\x00'), False, 'False decoding FAILED...')
+
+# -----------------------------------
+# -----------------------------------
+class ResolveTestCase(BaseDataTypes):
+
+ # -------------------
+ # Test resolving the value 1, which should implicitly be a python int
+ def test_resolve_int_1(self):
+ value = 1
+ expected = "signed_int"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving the value -1, which should implicitly be a python int
+ def test_resolve_int_negative_1(self):
+ value = -1
+ expected = "signed_int"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving the min signed 32bit integer value, -2^31
+ def test_resolve_int_min(self):
+ value = -2147483648 #-2^31
+ expected = "signed_int"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving the max signed 32bit integer value, 2^31 -1
+ def test_resolve_int_max(self):
+ value = 2147483647 #2^31 -1
+ expected = "signed_int"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving above the max signed 32bit integer value of 2^31 -1
+ # Should be a python long, but should be classed as a signed 64bit long on the wire either way
+ def test_resolve_int_above_signed_32bit_max(self):
+ value = 2147483648 #2^31, i.e 1 above the 32bit signed max
+ expected = "signed_long"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving above the max signed 32bit integer value of 2^31 -1
+ # As above except use an explicitly cast python long
+ def test_resolve_long_above_signed_32bit_max(self):
+ value = 2147483648L #2^31, i.e 1 above the 32bit signed max
+ expected = "signed_long"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving an explicitly cast python long of value 1, i.e less than the max signed 32bit integer value
+ # Should be encoded as a 32bit signed int on the wire
+ def test_resolve_long_1(self):
+ value = 1L
+ expected = "signed_int"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving the max signed 64bit integer value of 2^63 -1
+ # Should be a python long, but should be classed as a signed 64bit long on the wire either way
+ def test_resolve_64bit_signed_max(self):
+ value = 9223372036854775807 #2^63 -1
+ expected = "signed_long"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving the min signed 64bit integer value of -2^63
+ # Should be a python long, but should be classed as a signed 64bit long on the wire either way
+ def test_resolve_64bit_signed_min(self):
+ value = -9223372036854775808 # -2^63
+ expected = "signed_long"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving a value of 2^63, i.e more than the max a signed 64bit integer value can hold.
+ # Should throw an exception indicating the value can't be encoded.
+ def test_resolve_above_64bit_signed_max(self):
+ value = 9223372036854775808L #2^63
+ self.failUnlessRaises(Exception, self.codec.resolve, value.__class__, value)
+ # -------------------
+ # Test resolving a value of -2^63 -1, i.e less than the min a signed 64bit integer value can hold.
+ # Should throw an exception indicating the value can't be encoded.
+ def test_resolve_below_64bit_signed_min(self):
+ value = 9223372036854775808L # -2^63 -1
+ self.failUnlessRaises(Exception, self.codec.resolve, value.__class__, value)
+ # -------------------
+ # Test resolving a float. Should indicate use of double as python uses 64bit floats
+ def test_resolve_float(self):
+ value = 1.1
+ expected = "double"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving a string. Should indicate use of long string encoding
+ def test_resolve_string(self):
+ value = "myString"
+ expected = "longstr"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+ # -------------------
+ # Test resolving None. Should indicate use of a void encoding.
+ def test_resolve_None(self):
+ value = None
+ expected = "void"
+ resolved = self.codec.resolve(value.__class__, value)
+ self.failUnlessEqual(resolved, expected, "resolve FAILED...expected %s got %s" % (expected, resolved))
+
+# ------------------------ #
+# Pre - existing test code #
+# ------------------------ #
+
+# ---------------------
+def test(type, value):
+ """
+ old test function cut/copy/paste from qpid/codec.py
+ """
+ if isinstance(value, (list, tuple)):
+ values = value
+ else:
+ values = [value]
+ stream = StringIO()
+ codec = Codec(stream, SPEC)
+ for v in values:
+ codec.encode(type, v)
+ codec.flush()
+ enc = stream.getvalue()
+ stream.reset()
+ dup = []
+ for i in xrange(len(values)):
+ dup.append(codec.decode(type))
+ if values != dup:
+ raise AssertionError("%r --> %r --> %r" % (values, enc, dup))
+
+# -----------------------
+def dotest(type, value):
+ """
+ old test function cut/copy/paste from qpid/codec.py
+ """
+ args = (type, value)
+ test(*args)
+
+# -------------
+def oldtests():
+ """
+ old test function cut/copy/paste from qpid/codec.py
+ """
+ for value in ("1", "0", "110", "011", "11001", "10101", "10011"):
+ for i in range(10):
+ dotest("bit", map(lambda x: x == "1", value*i))
+
+ for value in ({}, {"asdf": "fdsa", "fdsa": 1, "three": 3}, {"one": 1}):
+ dotest("table", value)
+
+ for type in ("octet", "short", "long", "longlong"):
+ for value in range(0, 256):
+ dotest(type, value)
+
+ for type in ("shortstr", "longstr"):
+ for value in ("", "a", "asdf"):
+ dotest(type, value)
+
+# -----------------------------------------
+class oldTests(unittest.TestCase):
+
+ """
+ class to handle pre-existing test cases
+ """
+
+ # ---------------------------
+ def test_oldtestcases(self):
+ """
+ call the old tests
+ """
+ return oldtests()
+
+# ---------------------------
+# ---------------------------
+if __name__ == '__main__':
+
+ codec_test_suite = unittest.TestSuite()
+
+ #adding all the test suites...
+ codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(IntegerTestCase))
+ codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(BitTestCase))
+ codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(StringTestCase))
+ codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(TimestampTestCase))
+ codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(FieldTableTestCase))
+ codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(ContentTestCase))
+
+ #loading pre-existing test case from qpid/codec.py
+ codec_test_suite.addTest(unittest.defaultTestLoader.loadTestsFromTestCase(oldTests))
+
+ run_output_stream = StringIO()
+ test_runner = unittest.TextTestRunner(run_output_stream, '', '')
+ test_result = test_runner.run(codec_test_suite)
+
+ print '\n%d test run...' % (test_result.testsRun)
+
+ if test_result.wasSuccessful():
+ print '\nAll tests successful\n'
+
+ if test_result.failures:
+ print '\n----------'
+ print '%d FAILURES:' % (len(test_result.failures))
+ print '----------\n'
+ for failure in test_result.failures:
+ print str(failure[0]) + ' ... FAIL'
+
+ if test_result.errors:
+ print '\n---------'
+ print '%d ERRORS:' % (len(test_result.errors))
+ print '---------\n'
+
+ for error in test_result.errors:
+ print str(error[0]) + ' ... ERROR'
+
+ f = open('codec_unit_test_output.txt', 'w')
+ f.write(str(run_output_stream.getvalue()))
+ f.close()
diff --git a/qpid/python/qpid/tests/codec010.py b/qpid/python/qpid/tests/codec010.py
new file mode 100644
index 0000000000..787ebc146f
--- /dev/null
+++ b/qpid/python/qpid/tests/codec010.py
@@ -0,0 +1,133 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import time
+
+from unittest import TestCase
+from qpid.codec010 import StringCodec
+from qpid.datatypes import timestamp, uuid4
+from qpid.ops import PRIMITIVE
+
+class CodecTest(TestCase):
+
+ def check(self, type, value, compare=True):
+ t = PRIMITIVE[type]
+ sc = StringCodec()
+ sc.write_primitive(t, value)
+ decoded = sc.read_primitive(t)
+ if compare:
+ assert decoded == value, "%s, %s" % (decoded, value)
+ return decoded
+
+ def testMapString(self):
+ self.check("map", {"string": "this is a test"})
+
+ def testMapUnicode(self):
+ self.check("map", {"unicode": u"this is a unicode test"})
+
+ def testMapBinary(self):
+ self.check("map", {"binary": "\x7f\xb4R^\xe5\xf0:\x89\x96E1\xf6\xfe\xb9\x1b\xf5"})
+
+ def testMapBuffer(self):
+ s = "\x7f\xb4R^\xe5\xf0:\x89\x96E1\xf6\xfe\xb9\x1b\xf5"
+ dec = self.check("map", {"buffer": buffer(s)}, False)
+ assert dec["buffer"] == s
+
+ def testMapInt(self):
+ self.check("map", {"int": 3})
+
+ def testMapLong(self):
+ self.check("map", {"long": 2**32})
+ self.check("map", {"long": 1 << 34})
+ self.check("map", {"long": -(1 << 34)})
+
+ def testMapTimestamp(self):
+ decoded = self.check("map", {"timestamp": timestamp(0)})
+ assert isinstance(decoded["timestamp"], timestamp)
+
+ def testMapDatetime(self):
+ decoded = self.check("map", {"datetime": timestamp(0).datetime()}, compare=False)
+ assert isinstance(decoded["datetime"], timestamp)
+ assert decoded["datetime"] == 0.0
+
+ def testMapNone(self):
+ self.check("map", {"none": None})
+
+ def testMapNested(self):
+ self.check("map", {"map": {"string": "nested test"}})
+
+ def testMapList(self):
+ self.check("map", {"list": [1, "two", 3.0, -4]})
+
+ def testMapUUID(self):
+ self.check("map", {"uuid": uuid4()})
+
+ def testMapAll(self):
+ decoded = self.check("map", {"string": "this is a test",
+ "unicode": u"this is a unicode test",
+ "binary": "\x7f\xb4R^\xe5\xf0:\x89\x96E1\xf6\xfe\xb9\x1b\xf5",
+ "int": 3,
+ "long": 2**32,
+ "timestamp": timestamp(0),
+ "none": None,
+ "map": {"string": "nested map"},
+ "list": [1, "two", 3.0, -4],
+ "uuid": uuid4()})
+ assert isinstance(decoded["timestamp"], timestamp)
+
+ def testMapEmpty(self):
+ self.check("map", {})
+
+ def testMapNone(self):
+ self.check("map", None)
+
+ def testList(self):
+ self.check("list", [1, "two", 3.0, -4])
+
+ def testListEmpty(self):
+ self.check("list", [])
+
+ def testListNone(self):
+ self.check("list", None)
+
+ def testArrayInt(self):
+ self.check("array", [1, 2, 3, 4])
+
+ def testArrayString(self):
+ self.check("array", ["one", "two", "three", "four"])
+
+ def testArrayEmpty(self):
+ self.check("array", [])
+
+ def testArrayNone(self):
+ self.check("array", None)
+
+ def testInt16(self):
+ self.check("int16", 3)
+ self.check("int16", -3)
+
+ def testInt64(self):
+ self.check("int64", 3)
+ self.check("int64", -3)
+ self.check("int64", 1<<34)
+ self.check("int64", -(1<<34))
+
+ def testDatetime(self):
+ self.check("datetime", timestamp(0))
+ self.check("datetime", timestamp(long(time.time())))
diff --git a/qpid/python/qpid/tests/connection.py b/qpid/python/qpid/tests/connection.py
new file mode 100644
index 0000000000..6847285f69
--- /dev/null
+++ b/qpid/python/qpid/tests/connection.py
@@ -0,0 +1,227 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import time
+from threading import *
+from unittest import TestCase
+from qpid.util import connect, listen
+from qpid.connection import *
+from qpid.datatypes import Message
+from qpid.delegates import Server
+from qpid.queue import Queue
+from qpid.session import Delegate
+from qpid.ops import QueueQueryResult
+
+PORT = 1234
+
+class TestServer:
+
+ def __init__(self, queue):
+ self.queue = queue
+
+ def connection(self, connection):
+ return Server(connection, delegate=self.session)
+
+ def session(self, session):
+ session.auto_sync = False
+ return TestSession(session, self.queue)
+
+class TestSession(Delegate):
+
+ def __init__(self, session, queue):
+ self.session = session
+ self.queue = queue
+
+ def execution_sync(self, es):
+ pass
+
+ def queue_query(self, qq):
+ return QueueQueryResult(qq.queue)
+
+ def message_transfer(self, cmd):
+ if cmd.destination == "echo":
+ m = Message(cmd.payload)
+ m.headers = cmd.headers
+ self.session.message_transfer(cmd.destination, cmd.accept_mode,
+ cmd.acquire_mode, m)
+ elif cmd.destination == "abort":
+ self.session.channel.connection.sock.close()
+ elif cmd.destination == "heartbeat":
+ self.session.channel.connection_heartbeat()
+ else:
+ self.queue.put(cmd)
+
+class ConnectionTest(TestCase):
+
+ def setUp(self):
+ self.queue = Queue()
+ self.running = True
+ started = Event()
+
+ def run():
+ ts = TestServer(self.queue)
+ for s in listen("0.0.0.0", PORT, lambda: self.running, lambda: started.set()):
+ conn = Connection(s, delegate=ts.connection)
+ try:
+ conn.start(5)
+ except Closed:
+ pass
+
+ self.server = Thread(target=run)
+ self.server.setDaemon(True)
+ self.server.start()
+
+ started.wait(3)
+ assert started.isSet()
+
+ def tearDown(self):
+ self.running = False
+ connect("127.0.0.1", PORT).close()
+ self.server.join(3)
+
+ def connect(self, **kwargs):
+ return Connection(connect("127.0.0.1", PORT), **kwargs)
+
+ def test(self):
+ c = self.connect()
+ c.start(10)
+
+ ssn1 = c.session("test1", timeout=10)
+ ssn2 = c.session("test2", timeout=10)
+
+ assert ssn1 == c.sessions["test1"]
+ assert ssn2 == c.sessions["test2"]
+ assert ssn1.channel != None
+ assert ssn2.channel != None
+ assert ssn1 in c.attached.values()
+ assert ssn2 in c.attached.values()
+
+ ssn1.close(5)
+
+ assert ssn1.channel == None
+ assert ssn1 not in c.attached.values()
+ assert ssn2 in c.sessions.values()
+
+ ssn2.close(5)
+
+ assert ssn2.channel == None
+ assert ssn2 not in c.attached.values()
+ assert ssn2 not in c.sessions.values()
+
+ ssn = c.session("session", timeout=10)
+
+ assert ssn.channel != None
+ assert ssn in c.sessions.values()
+
+ destinations = ("one", "two", "three")
+
+ for d in destinations:
+ ssn.message_transfer(d)
+
+ for d in destinations:
+ cmd = self.queue.get(10)
+ assert cmd.destination == d
+ assert cmd.headers == None
+ assert cmd.payload == None
+
+ msg = Message("this is a test")
+ ssn.message_transfer("four", message=msg)
+ cmd = self.queue.get(10)
+ assert cmd.destination == "four"
+ assert cmd.headers == None
+ assert cmd.payload == msg.body
+
+ qq = ssn.queue_query("asdf")
+ assert qq.queue == "asdf"
+ c.close(5)
+
+ def testCloseGet(self):
+ c = self.connect()
+ c.start(10)
+ ssn = c.session("test", timeout=10)
+ echos = ssn.incoming("echo")
+
+ for i in range(10):
+ ssn.message_transfer("echo", message=Message("test%d" % i))
+
+ ssn.auto_sync=False
+ ssn.message_transfer("abort")
+
+ for i in range(10):
+ m = echos.get(timeout=10)
+ assert m.body == "test%d" % i
+
+ try:
+ m = echos.get(timeout=10)
+ assert False
+ except Closed, e:
+ pass
+
+ def testCloseListen(self):
+ c = self.connect()
+ c.start(10)
+ ssn = c.session("test", timeout=10)
+ echos = ssn.incoming("echo")
+
+ messages = []
+ exceptions = []
+ condition = Condition()
+ def listener(m): messages.append(m)
+ def exc_listener(e):
+ condition.acquire()
+ exceptions.append(e)
+ condition.notify()
+ condition.release()
+
+ echos.listen(listener, exc_listener)
+
+ for i in range(10):
+ ssn.message_transfer("echo", message=Message("test%d" % i))
+
+ ssn.auto_sync=False
+ ssn.message_transfer("abort")
+
+ condition.acquire()
+ start = time.time()
+ elapsed = 0
+ while not exceptions and elapsed < 10:
+ condition.wait(10 - elapsed)
+ elapsed = time.time() - start
+ condition.release()
+
+ for i in range(10):
+ m = messages.pop(0)
+ assert m.body == "test%d" % i
+
+ assert len(exceptions) == 1
+
+ def testSync(self):
+ c = self.connect()
+ c.start(10)
+ s = c.session("test")
+ s.auto_sync = False
+ s.message_transfer("echo", message=Message("test"))
+ s.sync(10)
+
+ def testHeartbeat(self):
+ c = self.connect(heartbeat=10)
+ c.start(10)
+ s = c.session("test")
+ s.channel.connection_heartbeat()
+ s.message_transfer("heartbeat")
diff --git a/qpid/python/qpid/tests/datatypes.py b/qpid/python/qpid/tests/datatypes.py
new file mode 100644
index 0000000000..00e649d6cf
--- /dev/null
+++ b/qpid/python/qpid/tests/datatypes.py
@@ -0,0 +1,296 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from unittest import TestCase
+from qpid.datatypes import *
+from qpid.ops import DeliveryProperties, FragmentProperties, MessageProperties
+
+class SerialTest(TestCase):
+
+ def test(self):
+ for s in (serial(0), serial(0x8FFFFFFFL), serial(0xFFFFFFFFL)):
+ assert s + 1 > s
+ assert s - 1 < s
+ assert s < s + 1
+ assert s > s - 1
+
+ assert serial(0xFFFFFFFFL) + 1 == serial(0)
+
+ assert min(serial(0xFFFFFFFFL), serial(0x0)) == serial(0xFFFFFFFFL)
+ assert max(serial(0xFFFFFFFFL), serial(0x0)) == serial(0x0)
+
+ def testIncr(self):
+ s = serial(0)
+ s += 1
+ assert s == serial(1)
+
+ def testIn(self):
+ l = [serial(1), serial(2), serial(3), serial(4)]
+ assert serial(1) in l
+ assert serial(0xFFFFFFFFL + 2) in l
+ assert 4 in l
+
+ def testNone(self):
+ assert serial(0) != None
+
+ def testHash(self):
+ d = {}
+ d[serial(0)] = "zero"
+ assert d[0] == "zero"
+
+ def testAdd(self):
+ assert serial(2) + 2 == serial(4)
+ assert serial(2) + 2 == 4
+
+ def testSub(self):
+ delta = serial(4) - serial(2)
+ assert isinstance(delta, int) or isinstance(delta, long)
+ assert delta == 2
+
+ delta = serial(4) - 2
+ assert isinstance(delta, Serial)
+ assert delta == serial(2)
+
+class RangedSetTest(TestCase):
+
+ def check(self, ranges):
+ posts = []
+ for range in ranges:
+ posts.append(range.lower)
+ posts.append(range.upper)
+
+ sorted = posts[:]
+ sorted.sort()
+
+ assert posts == sorted
+
+ idx = 1
+ while idx + 1 < len(posts):
+ assert posts[idx] + 1 != posts[idx+1]
+ idx += 2
+
+ def test(self):
+ rs = RangedSet()
+
+ self.check(rs.ranges)
+
+ rs.add(1)
+
+ assert 1 in rs
+ assert 2 not in rs
+ assert 0 not in rs
+ self.check(rs.ranges)
+
+ rs.add(2)
+
+ assert 0 not in rs
+ assert 1 in rs
+ assert 2 in rs
+ assert 3 not in rs
+ self.check(rs.ranges)
+
+ rs.add(0)
+
+ assert -1 not in rs
+ assert 0 in rs
+ assert 1 in rs
+ assert 2 in rs
+ assert 3 not in rs
+ self.check(rs.ranges)
+
+ rs.add(37)
+
+ assert -1 not in rs
+ assert 0 in rs
+ assert 1 in rs
+ assert 2 in rs
+ assert 3 not in rs
+ assert 36 not in rs
+ assert 37 in rs
+ assert 38 not in rs
+ self.check(rs.ranges)
+
+ rs.add(-1)
+ self.check(rs.ranges)
+
+ rs.add(-3)
+ self.check(rs.ranges)
+
+ rs.add(1, 20)
+ assert 21 not in rs
+ assert 20 in rs
+ self.check(rs.ranges)
+
+ def testAddSelf(self):
+ a = RangedSet()
+ a.add(0, 8)
+ self.check(a.ranges)
+ a.add(0, 8)
+ self.check(a.ranges)
+ assert len(a.ranges) == 1
+ range = a.ranges[0]
+ assert range.lower == 0
+ assert range.upper == 8
+
+ def testEmpty(self):
+ s = RangedSet()
+ assert s.empty()
+ s.add(0, -1)
+ assert s.empty()
+ s.add(0, 0)
+ assert not s.empty()
+
+ def testMinMax(self):
+ s = RangedSet()
+ assert s.max() is None
+ assert s.min() is None
+ s.add(0, 10)
+ assert s.max() == 10
+ assert s.min() == 0
+ s.add(0, 5)
+ assert s.max() == 10
+ assert s.min() == 0
+ s.add(0, 11)
+ assert s.max() == 11
+ assert s.min() == 0
+ s.add(15, 20)
+ assert s.max() == 20
+ assert s.min() == 0
+ s.add(-10, -5)
+ assert s.max() == 20
+ assert s.min() == -10
+
+class RangeTest(TestCase):
+
+ def testIntersect1(self):
+ a = Range(0, 10)
+ b = Range(9, 20)
+ i1 = a.intersect(b)
+ i2 = b.intersect(a)
+ assert i1.upper == 10
+ assert i2.upper == 10
+ assert i1.lower == 9
+ assert i2.lower == 9
+
+ def testIntersect2(self):
+ a = Range(0, 10)
+ b = Range(11, 20)
+ assert a.intersect(b) == None
+ assert b.intersect(a) == None
+
+ def testIntersect3(self):
+ a = Range(0, 10)
+ b = Range(3, 5)
+ i1 = a.intersect(b)
+ i2 = b.intersect(a)
+ assert i1.upper == 5
+ assert i2.upper == 5
+ assert i1.lower == 3
+ assert i2.lower == 3
+
+class UUIDTest(TestCase):
+
+ def test(self):
+ # this test is kind of lame, but it does excercise the basic
+ # functionality of the class
+ u = uuid4()
+ for i in xrange(1024):
+ assert u != uuid4()
+
+class MessageTest(TestCase):
+
+ def setUp(self):
+ self.mp = MessageProperties()
+ self.dp = DeliveryProperties()
+ self.fp = FragmentProperties()
+
+ def testHas(self):
+ m = Message(self.mp, self.dp, self.fp, "body")
+ assert m.has("message_properties")
+ assert m.has("delivery_properties")
+ assert m.has("fragment_properties")
+
+ def testGet(self):
+ m = Message(self.mp, self.dp, self.fp, "body")
+ assert m.get("message_properties") == self.mp
+ assert m.get("delivery_properties") == self.dp
+ assert m.get("fragment_properties") == self.fp
+
+ def testSet(self):
+ m = Message(self.mp, self.dp, "body")
+ assert m.get("fragment_properties") is None
+ m.set(self.fp)
+ assert m.get("fragment_properties") == self.fp
+
+ def testSetOnEmpty(self):
+ m = Message("body")
+ assert m.get("delivery_properties") is None
+ m.set(self.dp)
+ assert m.get("delivery_properties") == self.dp
+
+ def testSetReplace(self):
+ m = Message(self.mp, self.dp, self.fp, "body")
+ dp = DeliveryProperties()
+ assert m.get("delivery_properties") == self.dp
+ assert m.get("delivery_properties") != dp
+ m.set(dp)
+ assert m.get("delivery_properties") != self.dp
+ assert m.get("delivery_properties") == dp
+
+ def testClear(self):
+ m = Message(self.mp, self.dp, self.fp, "body")
+ assert m.get("message_properties") == self.mp
+ assert m.get("delivery_properties") == self.dp
+ assert m.get("fragment_properties") == self.fp
+ m.clear("fragment_properties")
+ assert m.get("fragment_properties") is None
+ assert m.get("message_properties") == self.mp
+ assert m.get("delivery_properties") == self.dp
+
+class TimestampTest(TestCase):
+
+ def check(self, expected, *values):
+ for v in values:
+ assert isinstance(v, timestamp)
+ assert v == expected
+ assert v == timestamp(expected)
+
+ def testAdd(self):
+ self.check(4.0,
+ timestamp(2.0) + 2.0,
+ 2.0 + timestamp(2.0))
+
+ def testSub(self):
+ self.check(2.0,
+ timestamp(4.0) - 2.0,
+ 4.0 - timestamp(2.0))
+
+ def testNeg(self):
+ self.check(-4.0, -timestamp(4.0))
+
+ def testPos(self):
+ self.check(+4.0, +timestamp(4.0))
+
+ def testAbs(self):
+ self.check(4.0, abs(timestamp(-4.0)))
+
+ def testConversion(self):
+ dt = timestamp(0).datetime()
+ t = timestamp(dt)
+ assert t == 0
diff --git a/qpid/python/qpid/tests/framing.py b/qpid/python/qpid/tests/framing.py
new file mode 100644
index 0000000000..0b33df8b9a
--- /dev/null
+++ b/qpid/python/qpid/tests/framing.py
@@ -0,0 +1,289 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+# setup, usage, teardown, errors(sync), errors(async), stress, soak,
+# boundary-conditions, config
+
+from qpid.tests import Test
+from qpid.framing import *
+
+class Base(Test):
+
+ def cmp_frames(self, frm1, frm2):
+ assert frm1.flags == frm2.flags, "expected: %r, got %r" % (frm1, frm2)
+ assert frm1.type == frm2.type, "expected: %r, got %r" % (frm1, frm2)
+ assert frm1.track == frm2.track, "expected: %r, got %r" % (frm1, frm2)
+ assert frm1.channel == frm2.channel, "expected: %r, got %r" % (frm1, frm2)
+ assert frm1.payload == frm2.payload, "expected: %r, got %r" % (frm1, frm2)
+
+ def cmp_segments(self, seg1, seg2):
+ assert seg1.first == seg2.first, "expected: %r, got %r" % (seg1, seg2)
+ assert seg1.last == seg2.last, "expected: %r, got %r" % (seg1, seg2)
+ assert seg1.type == seg2.type, "expected: %r, got %r" % (seg1, seg2)
+ assert seg1.track == seg2.track, "expected: %r, got %r" % (seg1, seg2)
+ assert seg1.channel == seg2.channel, "expected: %r, got %r" % (seg1, seg2)
+ assert seg1.payload == seg2.payload, "expected: %r, got %r" % (seg1, seg2)
+
+ def cmp_list(self, l1, l2):
+ if l1 is None:
+ assert l2 is None
+ return
+
+ assert len(l1) == len(l2)
+ for v1, v2 in zip(l1, l2):
+ if isinstance(v1, Compound):
+ self.cmp_ops(v1, v2)
+ else:
+ assert v1 == v2
+
+ def cmp_ops(self, op1, op2):
+ if op1 is None:
+ assert op2 is None
+ return
+
+ assert op1.__class__ == op2.__class__
+ cls = op1.__class__
+ assert op1.NAME == op2.NAME
+ assert op1.CODE == op2.CODE
+ assert op1.FIELDS == op2.FIELDS
+ for f in cls.FIELDS:
+ v1 = getattr(op1, f.name)
+ v2 = getattr(op2, f.name)
+ if COMPOUND.has_key(f.type) or f.type == "struct32":
+ self.cmp_ops(v1, v2)
+ elif f.type in ("list", "array"):
+ self.cmp_list(v1, v2)
+ else:
+ assert v1 == v2, "expected: %r, got %r" % (v1, v2)
+
+ if issubclass(cls, Command) or issubclass(cls, Control):
+ assert op1.channel == op2.channel
+
+ if issubclass(cls, Command):
+ assert op1.sync == op2.sync, "expected: %r, got %r" % (op1.sync, op2.sync)
+ assert (op1.headers is None and op2.headers is None) or \
+ (op1.headers is not None and op2.headers is not None)
+ if op1.headers is not None:
+ assert len(op1.headers) == len(op2.headers)
+ for h1, h2 in zip(op1.headers, op2.headers):
+ self.cmp_ops(h1, h2)
+
+class FrameTest(Base):
+
+ def enc_dec(self, frames, encoded=None):
+ enc = FrameEncoder()
+ dec = FrameDecoder()
+
+ enc.write(*frames)
+ bytes = enc.read()
+ if encoded is not None:
+ assert bytes == encoded, "expected %r, got %r" % (encoded, bytes)
+ dec.write(bytes)
+ dframes = dec.read()
+
+ assert len(frames) == len(dframes)
+ for f, df, in zip(frames, dframes):
+ self.cmp_frames(f, df)
+
+ def testEmpty(self):
+ self.enc_dec([Frame(0, 0, 0, 0, "")],
+ "\x00\x00\x00\x0c\x00\x00\x00\x00\x00\x00\x00\x00")
+
+ def testSingle(self):
+ self.enc_dec([Frame(0, 0, 0, 1, "payload")],
+ "\x00\x00\x00\x13\x00\x00\x00\x01\x00\x00\x00\x00payload")
+
+ def testMaxChannel(self):
+ self.enc_dec([Frame(0, 0, 0, 65535, "max-channel")],
+ "\x00\x00\x00\x17\x00\x00\xff\xff\x00\x00\x00\x00max-channel")
+
+ def testMaxType(self):
+ self.enc_dec([Frame(0, 255, 0, 0, "max-type")],
+ "\x00\xff\x00\x14\x00\x00\x00\x00\x00\x00\x00\x00max-type")
+
+ def testMaxTrack(self):
+ self.enc_dec([Frame(0, 0, 15, 0, "max-track")],
+ "\x00\x00\x00\x15\x00\x0f\x00\x00\x00\x00\x00\x00max-track")
+
+ def testSequence(self):
+ self.enc_dec([Frame(0, 0, 0, 0, "zero"),
+ Frame(0, 0, 0, 1, "one"),
+ Frame(0, 0, 1, 0, "two"),
+ Frame(0, 0, 1, 1, "three"),
+ Frame(0, 1, 0, 0, "four"),
+ Frame(0, 1, 0, 1, "five"),
+ Frame(0, 1, 1, 0, "six"),
+ Frame(0, 1, 1, 1, "seven"),
+ Frame(1, 0, 0, 0, "eight"),
+ Frame(1, 0, 0, 1, "nine"),
+ Frame(1, 0, 1, 0, "ten"),
+ Frame(1, 0, 1, 1, "eleven"),
+ Frame(1, 1, 0, 0, "twelve"),
+ Frame(1, 1, 0, 1, "thirteen"),
+ Frame(1, 1, 1, 0, "fourteen"),
+ Frame(1, 1, 1, 1, "fifteen")])
+
+class SegmentTest(Base):
+
+ def enc_dec(self, segments, frames=None, interleave=None, max_payload=Frame.MAX_PAYLOAD):
+ enc = SegmentEncoder(max_payload)
+ dec = SegmentDecoder()
+
+ enc.write(*segments)
+ frms = enc.read()
+ if frames is not None:
+ assert len(frames) == len(frms), "expected %s, got %s" % (frames, frms)
+ for f1, f2 in zip(frames, frms):
+ self.cmp_frames(f1, f2)
+ if interleave is not None:
+ ilvd = []
+ for f in frms:
+ ilvd.append(f)
+ if interleave:
+ ilvd.append(interleave.pop(0))
+ ilvd.extend(interleave)
+ dec.write(*ilvd)
+ else:
+ dec.write(*frms)
+ segs = dec.read()
+ assert len(segments) == len(segs)
+ for s1, s2 in zip(segments, segs):
+ self.cmp_segments(s1, s2)
+
+ def testEmpty(self):
+ self.enc_dec([Segment(True, True, 0, 0, 0, "")],
+ [Frame(FIRST_FRM | LAST_FRM | FIRST_SEG | LAST_SEG, 0, 0, 0,
+ "")])
+
+ def testSingle(self):
+ self.enc_dec([Segment(True, True, 0, 0, 0, "payload")],
+ [Frame(FIRST_FRM | LAST_FRM | FIRST_SEG | LAST_SEG, 0, 0, 0,
+ "payload")])
+
+ def testMaxChannel(self):
+ self.enc_dec([Segment(False, False, 0, 0, 65535, "max-channel")],
+ [Frame(FIRST_FRM | LAST_FRM, 0, 0, 65535, "max-channel")])
+
+ def testMaxType(self):
+ self.enc_dec([Segment(False, False, 255, 0, 0, "max-type")],
+ [Frame(FIRST_FRM | LAST_FRM, 255, 0, 0, "max-type")])
+
+ def testMaxTrack(self):
+ self.enc_dec([Segment(False, False, 0, 15, 0, "max-track")],
+ [Frame(FIRST_FRM | LAST_FRM, 0, 15, 0, "max-track")])
+
+ def testSequence(self):
+ self.enc_dec([Segment(True, False, 0, 0, 0, "one"),
+ Segment(False, False, 0, 0, 0, "two"),
+ Segment(False, True, 0, 0, 0, "three")],
+ [Frame(FIRST_FRM | LAST_FRM | FIRST_SEG, 0, 0, 0, "one"),
+ Frame(FIRST_FRM | LAST_FRM, 0, 0, 0, "two"),
+ Frame(FIRST_FRM | LAST_FRM | LAST_SEG, 0, 0, 0, "three")])
+
+ def testInterleaveChannel(self):
+ frames = [Frame(0, 0, 0, 0, chr(ord("a") + i)) for i in range(7)]
+ frames[0].flags |= FIRST_FRM
+ frames[-1].flags |= LAST_FRM
+
+ ilvd = [Frame(0, 0, 0, 1, chr(ord("a") + i)) for i in range(7)]
+
+ self.enc_dec([Segment(False, False, 0, 0, 0, "abcdefg")], frames, ilvd, max_payload=1)
+
+ def testInterleaveTrack(self):
+ frames = [Frame(0, 0, 0, 0, "%c%c" % (ord("a") + i, ord("a") + i + 1))
+ for i in range(0, 8, 2)]
+ frames[0].flags |= FIRST_FRM
+ frames[-1].flags |= LAST_FRM
+
+ ilvd = [Frame(0, 0, 1, 0, "%c%c" % (ord("a") + i, ord("a") + i + 1))
+ for i in range(0, 8, 2)]
+
+ self.enc_dec([Segment(False, False, 0, 0, 0, "abcdefgh")], frames, ilvd, max_payload=2)
+
+from qpid.ops import *
+
+class OpTest(Base):
+
+ def enc_dec(self, ops):
+ enc = OpEncoder()
+ dec = OpDecoder()
+ enc.write(*ops)
+ segs = enc.read()
+ dec.write(*segs)
+ dops = dec.read()
+ assert len(ops) == len(dops)
+ for op1, op2 in zip(ops, dops):
+ self.cmp_ops(op1, op2)
+
+ def testEmtpyMT(self):
+ self.enc_dec([MessageTransfer()])
+
+ def testEmptyMTSync(self):
+ self.enc_dec([MessageTransfer(sync=True)])
+
+ def testMT(self):
+ self.enc_dec([MessageTransfer(destination="asdf")])
+
+ def testSyncMT(self):
+ self.enc_dec([MessageTransfer(destination="asdf", sync=True)])
+
+ def testEmptyPayloadMT(self):
+ self.enc_dec([MessageTransfer(payload="")])
+
+ def testPayloadMT(self):
+ self.enc_dec([MessageTransfer(payload="test payload")])
+
+ def testHeadersEmptyPayloadMT(self):
+ self.enc_dec([MessageTransfer(headers=[DeliveryProperties()])])
+
+ def testHeadersPayloadMT(self):
+ self.enc_dec([MessageTransfer(headers=[DeliveryProperties()], payload="test payload")])
+
+ def testMultiHeadersEmptyPayloadMT(self):
+ self.enc_dec([MessageTransfer(headers=[DeliveryProperties(), MessageProperties()])])
+
+ def testMultiHeadersPayloadMT(self):
+ self.enc_dec([MessageTransfer(headers=[MessageProperties(), DeliveryProperties()], payload="test payload")])
+
+ def testContentTypeHeadersPayloadMT(self):
+ self.enc_dec([MessageTransfer(headers=[MessageProperties(content_type="text/plain")], payload="test payload")])
+
+ def testMulti(self):
+ self.enc_dec([MessageTransfer(),
+ MessageTransfer(sync=True),
+ MessageTransfer(destination="one"),
+ MessageTransfer(destination="two", sync=True),
+ MessageTransfer(destination="three", payload="test payload")])
+
+ def testControl(self):
+ self.enc_dec([SessionAttach(name="asdf")])
+
+ def testMixed(self):
+ self.enc_dec([SessionAttach(name="fdsa"), MessageTransfer(destination="test")])
+
+ def testChannel(self):
+ self.enc_dec([SessionAttach(name="asdf", channel=3), MessageTransfer(destination="test", channel=1)])
+
+ def testCompound(self):
+ self.enc_dec([MessageTransfer(headers=[MessageProperties(reply_to=ReplyTo(exchange="exch", routing_key="rk"))])])
+
+ def testListCompound(self):
+ self.enc_dec([ExecutionResult(value=RecoverResult(in_doubt=[Xid(global_id="one"),
+ Xid(global_id="two"),
+ Xid(global_id="three")]))])
diff --git a/qpid/python/qpid/tests/messaging/__init__.py b/qpid/python/qpid/tests/messaging/__init__.py
new file mode 100644
index 0000000000..38a5b066d6
--- /dev/null
+++ b/qpid/python/qpid/tests/messaging/__init__.py
@@ -0,0 +1,204 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import time
+from math import ceil
+from qpid.harness import Skipped
+from qpid.tests.messaging.implementation import *
+from qpid.tests import Test
+
+class Base(Test):
+
+ def setup_connection(self):
+ return None
+
+ def setup_session(self):
+ return None
+
+ def setup_sender(self):
+ return None
+
+ def setup_receiver(self):
+ return None
+
+ def setup(self):
+ self.test_id = uuid4()
+ self.broker = self.config.broker
+ try:
+ self.conn = self.setup_connection()
+ except ConnectError, e:
+ raise Skipped(e)
+ self.ssn = self.setup_session()
+ self.snd = self.setup_sender()
+ if self.snd is not None:
+ self.snd.durable = self.durable()
+ self.rcv = self.setup_receiver()
+
+ def teardown(self):
+ if self.conn is not None and self.conn.attached():
+ self.teardown_connection(self.conn)
+ self.conn = None
+
+ def teardown_connection(self, conn):
+ conn.close(timeout=self.timeout())
+
+ def content(self, base, count = None):
+ if count is None:
+ return "%s[%s]" % (base, self.test_id)
+ else:
+ return "%s[%s, %s]" % (base, count, self.test_id)
+
+ def message(self, base, count = None, **kwargs):
+ return Message(content=self.content(base, count), **kwargs)
+
+ def ping(self, ssn):
+ PING_Q = 'ping-queue; {create: always, delete: always}'
+ # send a message
+ sender = ssn.sender(PING_Q, durable=self.durable())
+ content = self.content("ping")
+ sender.send(content)
+ receiver = ssn.receiver(PING_Q)
+ msg = receiver.fetch(0)
+ ssn.acknowledge()
+ assert msg.content == content, "expected %r, got %r" % (content, msg.content)
+
+ def drain(self, rcv, limit=None, timeout=0, expected=None, redelivered=False):
+ messages = []
+ try:
+ while limit is None or len(messages) < limit:
+ messages.append(rcv.fetch(timeout=timeout))
+ except Empty:
+ pass
+ if expected is not None:
+ self.assertEchos(expected, messages, redelivered)
+ return messages
+
+ def diff(self, m1, m2, excluded_properties=()):
+ result = {}
+ for attr in ("id", "subject", "user_id", "reply_to",
+ "correlation_id", "durable", "priority", "ttl",
+ "redelivered", "content_type", "content"):
+ a1 = getattr(m1, attr)
+ a2 = getattr(m2, attr)
+ if a1 != a2:
+ result[attr] = (a1, a2)
+ p1 = dict(m1.properties)
+ p2 = dict(m2.properties)
+ for ep in excluded_properties:
+ p1.pop(ep, None)
+ p2.pop(ep, None)
+ if p1 != p2:
+ result["properties"] = (p1, p2)
+ return result
+
+ def assertEcho(self, msg, echo, redelivered=False):
+ if not isinstance(msg, Message) or not isinstance(echo, Message):
+ if isinstance(msg, Message):
+ msg = msg.content
+ if isinstance(echo, Message):
+ echo = echo.content
+ assert msg == echo, "expected %s, got %s" % (msg, echo)
+ else:
+ delta = self.diff(msg, echo, ("x-amqp-0-10.routing-key","qpid.subject"))
+ mttl, ettl = delta.pop("ttl", (0, 0))
+ if redelivered:
+ assert echo.redelivered, \
+ "expected %s to be redelivered: %s" % (msg, echo)
+ if delta.has_key("redelivered"):
+ del delta["redelivered"]
+ assert mttl is not None and ettl is not None, "%s, %s" % (mttl, ettl)
+ assert mttl >= ettl, "%s, %s" % (mttl, ettl)
+ assert not delta, "expected %s, got %s, delta %s" % (msg, echo, delta)
+
+ def assertEchos(self, msgs, echoes, redelivered=False):
+ assert len(msgs) == len(echoes), "%s, %s" % (msgs, echoes)
+ for m, e in zip(msgs, echoes):
+ self.assertEcho(m, e, redelivered)
+
+ def assertEmpty(self, rcv):
+ contents = self.drain(rcv)
+ assert len(contents) == 0, "%s is supposed to be empty: %s" % (rcv, contents)
+
+ def assertAvailable(self, rcv, expected=None, lower=None, upper=None):
+ if expected is not None:
+ if lower is not None or upper is not None:
+ raise ValueError("cannot specify lower or upper when specifying expected")
+ lower = expected
+ upper = expected
+ else:
+ if lower is None:
+ lower = int(ceil(rcv.threshold*rcv.capacity))
+ if upper is None:
+ upper = rcv.capacity
+
+ p = rcv.available()
+ if upper == lower:
+ assert p == lower, "expected %s, got %s" % (lower, p)
+ else:
+ assert lower <= p <= upper, "expected %s to be in range [%s, %s]" % (p, lower, upper)
+
+ def sleep(self):
+ time.sleep(self.delay())
+
+ def delay(self):
+ return float(self.config.defines.get("delay", "2"))
+
+ def timeout(self):
+ return float(self.config.defines.get("timeout", "60"))
+
+ def get_bool(self, name):
+ return self.config.defines.get(name, "false").lower() in ("true", "yes", "1")
+
+ def durable(self):
+ return self.get_bool("durable")
+
+ def reconnect(self):
+ return self.get_bool("reconnect")
+
+
+ def transport(self):
+ if self.broker.scheme == self.broker.AMQPS:
+ return "ssl"
+ else:
+ return "tcp"
+
+ def connection_options(self):
+ protocol_version = self.config.defines.get("protocol_version")
+ if protocol_version:
+ return {"reconnect": self.reconnect(),
+ "transport": self.transport(),
+ "protocol":protocol_version}
+ else:
+ return {"reconnect": self.reconnect(),
+ "transport": self.transport()}
+
+class VersionTest (Base):
+ def create_connection(self, version="amqp1.0", force=False):
+ opts = self.connection_options()
+ if force or not 'protocol' in opts:
+ opts['protocol'] = version;
+ return Connection.establish(self.broker, **opts)
+
+ def setup_connection(self):
+ return self.create_connection()
+
+ def setup_session(self):
+ return self.conn.session()
+
+import address, endpoints, message
diff --git a/qpid/python/qpid/tests/messaging/address.py b/qpid/python/qpid/tests/messaging/address.py
new file mode 100644
index 0000000000..aa9562a717
--- /dev/null
+++ b/qpid/python/qpid/tests/messaging/address.py
@@ -0,0 +1,321 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+
+from qpid.tests import Test
+from qpid.messaging.address import lex, parse, ParseError, EOF, ID, NUMBER, \
+ SYM, WSPACE, LEXER
+from qpid.lexer import Token
+from qpid.harness import Skipped
+from qpid.tests.parser import ParserBase
+
+def indent(st):
+ return " " + st.replace("\n", "\n ")
+
+def pprint_address(name, subject, options):
+ return "NAME: %s\nSUBJECT: %s\nOPTIONS: %s" % \
+ (pprint(name), pprint(subject), pprint(options))
+
+def pprint(o):
+ if isinstance(o, dict):
+ return pprint_map(o)
+ elif isinstance(o, list):
+ return pprint_list(o)
+ elif isinstance(o, basestring):
+ return pprint_string(o)
+ else:
+ return repr(o)
+
+def pprint_map(m):
+ items = ["%s: %s" % (pprint(k), pprint(v)) for k, v in m.items()]
+ items.sort()
+ return pprint_items("{", items, "}")
+
+def pprint_list(l):
+ return pprint_items("[", [pprint(x) for x in l], "]")
+
+def pprint_items(start, items, end):
+ if items:
+ return "%s\n%s\n%s" % (start, ",\n".join([indent(i) for i in items]), end)
+ else:
+ return "%s%s" % (start, end)
+
+def pprint_string(s):
+ result = "'"
+ for c in s:
+ if c == "'":
+ result += "\\'"
+ elif c == "\n":
+ result += "\\n"
+ elif ord(c) >= 0x80:
+ result += "\\u%04x" % ord(c)
+ else:
+ result += c
+ result += "'"
+ return result
+
+class AddressTests(ParserBase, Test):
+
+ EXCLUDE = (WSPACE, EOF)
+
+ def fields(self, line, n):
+ result = line.split(":", n - 1)
+ result.extend([None]*(n - len(result)))
+ return result
+
+ def call(self, parser, mode, input):
+ try:
+ from subprocess import Popen, PIPE, STDOUT
+ po = Popen([parser, mode], stdin=PIPE, stdout=PIPE, stderr=STDOUT)
+ except ImportError, e:
+ raise Skipped("%s" % e)
+ except OSError, e:
+ raise Skipped("%s: %s" % (e, parser))
+ out, _ = po.communicate(input=input)
+ return out
+
+ def parser(self):
+ return self.config.defines.get("address.parser")
+
+ def do_lex(self, st):
+ parser = self.parser()
+ if parser:
+ out = self.call(parser, "lex", st)
+ lines = out.split("\n")
+ toks = []
+ for line in lines:
+ if line.strip():
+ name, position, value = self.fields(line, 3)
+ toks.append(Token(LEXER.type(name), value, position, st))
+ return toks
+ else:
+ return lex(st)
+
+ def do_parse(self, st):
+ return parse(st)
+
+ def valid(self, addr, name=None, subject=None, options=None):
+ parser = self.parser()
+ if parser:
+ got = self.call(parser, "parse", addr)
+ expected = "%s\n" % pprint_address(name, subject, options)
+ assert expected == got, "expected\n<EXP>%s</EXP>\ngot\n<GOT>%s</GOT>" % (expected, got)
+ else:
+ ParserBase.valid(self, addr, (name, subject, options))
+
+ def invalid(self, addr, error=None):
+ parser = self.parser()
+ if parser:
+ got = self.call(parser, "parse", addr)
+ expected = "ERROR: %s\n" % error
+ assert expected == got, "expected %r, got %r" % (expected, got)
+ else:
+ ParserBase.invalid(self, addr, error)
+
+ def testDashInId1(self):
+ self.lex("foo-bar", ID)
+
+ def testDashInId2(self):
+ self.lex("foo-3", ID)
+
+ def testDashAlone1(self):
+ self.lex("foo - bar", ID, SYM, ID)
+
+ def testDashAlone2(self):
+ self.lex("foo - 3", ID, SYM, NUMBER)
+
+ def testLeadingDash(self):
+ self.lex("-foo", SYM, ID)
+
+ def testTrailingDash(self):
+ self.lex("foo-", ID, SYM)
+
+ def testNegativeNum(self):
+ self.lex("-3", NUMBER)
+
+ def testIdNum(self):
+ self.lex("id1", ID)
+
+ def testIdSpaceNum(self):
+ self.lex("id 1", ID, NUMBER)
+
+ def testHash(self):
+ self.valid("foo/bar.#", "foo", "bar.#")
+
+ def testStar(self):
+ self.valid("foo/bar.*", "foo", "bar.*")
+
+ def testColon(self):
+ self.valid("foo.bar/baz.qux:moo:arf", "foo.bar", "baz.qux:moo:arf")
+
+ def testOptions(self):
+ self.valid("foo.bar/baz.qux:moo:arf; {key: value}",
+ "foo.bar", "baz.qux:moo:arf", {"key": "value"})
+
+ def testOptionsTrailingComma(self):
+ self.valid("name/subject; {key: value,}", "name", "subject",
+ {"key": "value"})
+
+ def testOptionsNone(self):
+ self.valid("name/subject; {key: None}", "name", "subject",
+ {"key": None})
+
+ def testSemiSubject(self):
+ self.valid("foo.bar/'baz.qux;moo:arf'; {key: value}",
+ "foo.bar", "baz.qux;moo:arf", {"key": "value"})
+
+ def testCommaSubject(self):
+ self.valid("foo.bar/baz.qux.{moo,arf}", "foo.bar", "baz.qux.{moo,arf}")
+
+ def testCommaSubjectOptions(self):
+ self.valid("foo.bar/baz.qux.{moo,arf}; {key: value}", "foo.bar",
+ "baz.qux.{moo,arf}", {"key": "value"})
+
+ def testUnbalanced(self):
+ self.valid("foo.bar/baz.qux.{moo,arf; {key: value}", "foo.bar",
+ "baz.qux.{moo,arf", {"key": "value"})
+
+ def testSlashQuote(self):
+ self.valid("foo.bar\\/baz.qux.{moo,arf; {key: value}",
+ "foo.bar/baz.qux.{moo,arf",
+ None, {"key": "value"})
+
+ def testSlashHexEsc1(self):
+ self.valid("foo.bar\\x00baz.qux.{moo,arf; {key: value}",
+ "foo.bar\x00baz.qux.{moo,arf",
+ None, {"key": "value"})
+
+ def testSlashHexEsc2(self):
+ self.valid("foo.bar\\xffbaz.qux.{moo,arf; {key: value}",
+ "foo.bar\xffbaz.qux.{moo,arf",
+ None, {"key": "value"})
+
+ def testSlashHexEsc3(self):
+ self.valid("foo.bar\\xFFbaz.qux.{moo,arf; {key: value}",
+ "foo.bar\xFFbaz.qux.{moo,arf",
+ None, {"key": "value"})
+
+ def testSlashUnicode1(self):
+ self.valid("foo.bar\\u1234baz.qux.{moo,arf; {key: value}",
+ u"foo.bar\u1234baz.qux.{moo,arf", None, {"key": "value"})
+
+ def testSlashUnicode2(self):
+ self.valid("foo.bar\\u0000baz.qux.{moo,arf; {key: value}",
+ u"foo.bar\u0000baz.qux.{moo,arf", None, {"key": "value"})
+
+ def testSlashUnicode3(self):
+ self.valid("foo.bar\\uffffbaz.qux.{moo,arf; {key: value}",
+ u"foo.bar\uffffbaz.qux.{moo,arf", None, {"key": "value"})
+
+ def testSlashUnicode4(self):
+ self.valid("foo.bar\\uFFFFbaz.qux.{moo,arf; {key: value}",
+ u"foo.bar\uFFFFbaz.qux.{moo,arf", None, {"key": "value"})
+
+ def testNoName(self):
+ self.invalid("; {key: value}",
+ "unexpected token SEMI(;) line:1,0:; {key: value}")
+
+ def testEmpty(self):
+ self.invalid("", "unexpected token EOF line:1,0:")
+
+ def testNoNameSlash(self):
+ self.invalid("/asdf; {key: value}",
+ "unexpected token SLASH(/) line:1,0:/asdf; {key: value}")
+
+ def testBadOptions1(self):
+ self.invalid("name/subject; {",
+ "expecting (NUMBER, STRING, ID, LBRACE, LBRACK, RBRACE), "
+ "got EOF line:1,15:name/subject; {")
+
+ def testBadOptions2(self):
+ self.invalid("name/subject; { 3",
+ "expecting COLON, got EOF "
+ "line:1,17:name/subject; { 3")
+
+ def testBadOptions3(self):
+ self.invalid("name/subject; { key:",
+ "expecting (NUMBER, STRING, ID, LBRACE, LBRACK), got EOF "
+ "line:1,20:name/subject; { key:")
+
+ def testBadOptions4(self):
+ self.invalid("name/subject; { key: value",
+ "expecting (COMMA, RBRACE), got EOF "
+ "line:1,26:name/subject; { key: value")
+
+ def testBadOptions5(self):
+ self.invalid("name/subject; { key: value asdf",
+ "expecting (COMMA, RBRACE), got ID(asdf) "
+ "line:1,27:name/subject; { key: value asdf")
+
+ def testBadOptions6(self):
+ self.invalid("name/subject; { key: value,",
+ "expecting (NUMBER, STRING, ID, LBRACE, LBRACK, RBRACE), got EOF "
+ "line:1,27:name/subject; { key: value,")
+
+ def testBadOptions7(self):
+ self.invalid("name/subject; { key: value } asdf",
+ "expecting EOF, got ID(asdf) "
+ "line:1,29:name/subject; { key: value } asdf")
+
+ def testList1(self):
+ self.valid("name/subject; { key: [] }", "name", "subject", {"key": []})
+
+ def testList2(self):
+ self.valid("name/subject; { key: ['one'] }", "name", "subject", {"key": ['one']})
+
+ def testList3(self):
+ self.valid("name/subject; { key: [1, 2, 3] }", "name", "subject",
+ {"key": [1, 2, 3]})
+
+ def testList4(self):
+ self.valid("name/subject; { key: [1, [2, 3], 4] }", "name", "subject",
+ {"key": [1, [2, 3], 4]})
+
+ def testBadList1(self):
+ self.invalid("name/subject; { key: [ }", "expecting (NUMBER, STRING, ID, LBRACE, LBRACK), "
+ "got RBRACE(}) line:1,23:name/subject; { key: [ }")
+
+ def testBadList2(self):
+ self.invalid("name/subject; { key: [ 1 }", "expecting (COMMA, RBRACK), "
+ "got RBRACE(}) line:1,25:name/subject; { key: [ 1 }")
+
+ def testBadList3(self):
+ self.invalid("name/subject; { key: [ 1 2 }", "expecting (COMMA, RBRACK), "
+ "got NUMBER(2) line:1,25:name/subject; { key: [ 1 2 }")
+
+ def testBadList4(self):
+ self.invalid("name/subject; { key: [ 1 2 ] }", "expecting (COMMA, RBRACK), "
+ "got NUMBER(2) line:1,25:name/subject; { key: [ 1 2 ] }")
+
+ def testMap1(self):
+ self.valid("name/subject; { 'key': value }",
+ "name", "subject", {"key": "value"})
+
+ def testMap2(self):
+ self.valid("name/subject; { 1: value }", "name", "subject", {1: "value"})
+
+ def testMap3(self):
+ self.valid('name/subject; { "foo.bar": value }',
+ "name", "subject", {"foo.bar": "value"})
+
+ def testBoolean(self):
+ self.valid("name/subject; { true1: True, true2: true, "
+ "false1: False, false2: false }",
+ "name", "subject", {"true1": True, "true2": True,
+ "false1": False, "false2": False})
diff --git a/qpid/python/qpid/tests/messaging/endpoints.py b/qpid/python/qpid/tests/messaging/endpoints.py
new file mode 100644
index 0000000000..d0103ee32c
--- /dev/null
+++ b/qpid/python/qpid/tests/messaging/endpoints.py
@@ -0,0 +1,1387 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+# setup, usage, teardown, errors(sync), errors(async), stress, soak,
+# boundary-conditions, config
+
+import errno, os, socket, sys, time
+from qpid import compat
+from qpid.compat import set
+from qpid.messaging import *
+from qpid.messaging.transports import TRANSPORTS
+from qpid.tests.messaging import Base
+from threading import Thread
+
+class SetupTests(Base):
+
+ def testEstablish(self):
+ self.conn = Connection.establish(self.broker, **self.connection_options())
+ self.ping(self.conn.session())
+
+ def testOpen(self):
+ self.conn = Connection(self.broker, **self.connection_options())
+ self.conn.open()
+ self.ping(self.conn.session())
+
+ def testOpenReconnectURLs(self):
+ options = self.connection_options()
+ options["reconnect_urls"] = [self.broker, self.broker]
+ self.conn = Connection(self.broker, **options)
+ self.conn.open()
+ self.ping(self.conn.session())
+
+ def testTcpNodelay(self):
+ self.conn = Connection.establish(self.broker, tcp_nodelay=True)
+ assert self.conn._driver._transport.socket.getsockopt(socket.IPPROTO_TCP, socket.TCP_NODELAY)
+
+ def testConnectError(self):
+ try:
+ # Specifying port 0 yields a bad address on Windows; port 4 is unassigned
+ self.conn = Connection.establish("localhost:4")
+ assert False, "connect succeeded"
+ except ConnectError, e:
+ assert "refused" in str(e)
+
+ def testGetError(self):
+ self.conn = Connection("localhost:0")
+ try:
+ self.conn.open()
+ assert False, "connect succeeded"
+ except ConnectError, e:
+ assert self.conn.get_error() == e
+
+ def use_fds(self):
+ fds = []
+ try:
+ while True:
+ fds.append(os.open(getattr(os, "devnull", "/dev/null"), os.O_RDONLY))
+ except OSError, e:
+ if e.errno != errno.EMFILE:
+ raise e
+ else:
+ return fds
+
+ def testOpenCloseResourceLeaks(self):
+ fds = self.use_fds()
+ try:
+ for i in range(32):
+ if fds: os.close(fds.pop())
+ for i in xrange(64):
+ conn = Connection.establish(self.broker, **self.connection_options())
+ conn.close()
+ finally:
+ while fds:
+ os.close(fds.pop())
+
+ def testOpenFailResourceLeaks(self):
+ fds = self.use_fds()
+ try:
+ for i in range(32):
+ if fds: os.close(fds.pop())
+ for i in xrange(64):
+ conn = Connection("localhost:0", **self.connection_options())
+ # XXX: we need to force a waiter to be created for this test
+ # to work
+ conn._lock.acquire()
+ conn._wait(lambda: False, timeout=0.001)
+ conn._lock.release()
+ try:
+ conn.open()
+ except ConnectError, e:
+ pass
+ finally:
+ while fds:
+ os.close(fds.pop())
+
+ def testReconnect(self):
+ options = self.connection_options()
+ real = TRANSPORTS["tcp"]
+
+ class flaky:
+
+ def __init__(self, conn, host, port):
+ self.real = real(conn, host, port)
+ self.sent_count = 0
+ self.recv_count = 0
+
+ def fileno(self):
+ return self.real.fileno()
+
+ def reading(self, reading):
+ return self.real.reading(reading)
+
+ def writing(self, writing):
+ return self.real.writing(writing)
+
+ def send(self, bytes):
+ if self.sent_count > 2048:
+ raise socket.error("fake error")
+ n = self.real.send(bytes)
+ self.sent_count += n
+ return n
+
+ def recv(self, n):
+ if self.recv_count > 2048:
+ return ""
+ bytes = self.real.recv(n)
+ self.recv_count += len(bytes)
+ return bytes
+
+ def close(self):
+ self.real.close()
+
+ TRANSPORTS["flaky"] = flaky
+
+ options["reconnect"] = True
+ options["reconnect_interval"] = 0
+ options["reconnect_limit"] = 100
+ options["reconnect_log"] = False
+ options["transport"] = "flaky"
+
+ self.conn = Connection.establish(self.broker, **options)
+ ssn = self.conn.session()
+ snd = ssn.sender("test-reconnect-queue; {create: always, delete: always}")
+ rcv = ssn.receiver(snd.target)
+
+ msgs = [self.message("testReconnect", i) for i in range(20)]
+ for m in msgs:
+ snd.send(m)
+
+ content = set()
+ drained = []
+ duplicates = []
+ try:
+ while True:
+ m = rcv.fetch(timeout=0)
+ if m.content not in content:
+ content.add(m.content)
+ drained.append(m)
+ else:
+ duplicates.append(m)
+ ssn.acknowledge(m)
+ except Empty:
+ pass
+ # XXX: apparently we don't always get duplicates, should figure out why
+ #assert duplicates, "no duplicates"
+ assert len(drained) == len(msgs)
+ for m, d in zip(msgs, drained):
+ # XXX: we should figure out how to provide proper end to end
+ # redelivered
+ self.assertEcho(m, d, d.redelivered)
+
+class ConnectionTests(Base):
+
+ def setup_connection(self):
+ return Connection.establish(self.broker, **self.connection_options())
+
+ def testCheckClosed(self):
+ assert not self.conn.check_closed()
+
+ def testSessionAnon(self):
+ ssn1 = self.conn.session()
+ ssn2 = self.conn.session()
+ self.ping(ssn1)
+ self.ping(ssn2)
+ assert ssn1 is not ssn2
+
+ def testSessionNamed(self):
+ ssn1 = self.conn.session("one")
+ ssn2 = self.conn.session("two")
+ self.ping(ssn1)
+ self.ping(ssn2)
+ assert ssn1 is not ssn2
+ assert ssn1 is self.conn.session("one")
+ assert ssn2 is self.conn.session("two")
+
+ def testDetach(self):
+ ssn = self.conn.session()
+ self.ping(ssn)
+ self.conn.detach()
+ try:
+ self.ping(ssn)
+ assert False, "ping succeeded"
+ except Detached:
+ # this is the expected failure when pinging on a detached
+ # connection
+ pass
+ self.conn.attach()
+ self.ping(ssn)
+
+ def testClose(self):
+ self.conn.close()
+ assert not self.conn.attached()
+
+ def testSimultaneousClose(self):
+ ssns = [self.conn.session() for i in range(3)]
+ for s in ssns:
+ for i in range(3):
+ s.receiver("amq.topic")
+ s.sender("amq.topic")
+
+ def closer(errors):
+ try:
+ self.conn.close()
+ except:
+ _, e, _ = sys.exc_info()
+ errors.append(compat.format_exc(e))
+
+ t1_errors = []
+ t2_errors = []
+ t1 = Thread(target=lambda: closer(t1_errors))
+ t2 = Thread(target=lambda: closer(t2_errors))
+ t1.start()
+ t2.start()
+ t1.join(self.delay())
+ t2.join(self.delay())
+
+ assert not t1_errors, t1_errors[0]
+ assert not t2_errors, t2_errors[0]
+
+class hangable:
+
+ def __init__(self, conn, host, port):
+ self.tcp = TRANSPORTS["tcp"](conn, host, port)
+ self.hung = False
+
+ def hang(self):
+ self.hung = True
+
+ def fileno(self):
+ return self.tcp.fileno()
+
+ def reading(self, reading):
+ if self.hung:
+ return True
+ else:
+ return self.tcp.reading(reading)
+
+ def writing(self, writing):
+ if self.hung:
+ return False
+ else:
+ return self.tcp.writing(writing)
+
+ def send(self, bytes):
+ if self.hung:
+ return 0
+ else:
+ return self.tcp.send(bytes)
+
+ def recv(self, n):
+ if self.hung:
+ return ""
+ else:
+ return self.tcp.recv(n)
+
+ def close(self):
+ self.tcp.close()
+
+TRANSPORTS["hangable"] = hangable
+
+class TimeoutTests(Base):
+
+ def setup_connection(self):
+ options = self.connection_options()
+ options["transport"] = "hangable"
+ return Connection.establish(self.broker, **options)
+
+ def setup_session(self):
+ return self.conn.session()
+
+ def setup_sender(self):
+ return self.ssn.sender("amq.topic")
+
+ def setup_receiver(self):
+ return self.ssn.receiver("amq.topic; {link: {reliability: unreliable}}")
+
+ def teardown_connection(self, conn):
+ try:
+ conn.detach(timeout=0)
+ except Timeout:
+ pass
+
+ def hang(self):
+ self.conn._driver._transport.hang()
+
+ def timeoutTest(self, method):
+ self.hang()
+ try:
+ method(timeout=self.delay())
+ assert False, "did not time out"
+ except Timeout:
+ pass
+
+ def testSenderSync(self):
+ self.snd.send(self.content("testSenderSync"), sync=False)
+ self.timeoutTest(self.snd.sync)
+
+ def testSenderClose(self):
+ self.snd.send(self.content("testSenderClose"), sync=False)
+ self.timeoutTest(self.snd.close)
+
+ def testReceiverClose(self):
+ self.timeoutTest(self.rcv.close)
+
+ def testSessionSync(self):
+ self.snd.send(self.content("testSessionSync"), sync=False)
+ self.timeoutTest(self.ssn.sync)
+
+ def testSessionClose(self):
+ self.timeoutTest(self.ssn.close)
+
+ def testConnectionDetach(self):
+ self.timeoutTest(self.conn.detach)
+
+ def testConnectionClose(self):
+ self.timeoutTest(self.conn.close)
+
+ def testConnectionOpen(self):
+ options = self.connection_options()
+ options["reconnect"] = True
+ options["reconnect_timeout"] = self.delay()
+ try:
+ bad_conn = Connection.establish("badhostname", **options)
+ assert False, "did not time out"
+ except Timeout:
+ pass
+
+ACK_QC = 'test-ack-queue; {create: always}'
+ACK_QD = 'test-ack-queue; {delete: always}'
+
+class SessionTests(Base):
+
+ def setup_connection(self):
+ return Connection.establish(self.broker, **self.connection_options())
+
+ def setup_session(self):
+ return self.conn.session()
+
+ def testSender(self):
+ snd = self.ssn.sender('test-snd-queue; {create: sender, delete: receiver}',
+ durable=self.durable())
+ snd2 = self.ssn.sender(snd.target, durable=self.durable())
+ assert snd is not snd2
+ snd2.close()
+
+ content = self.content("testSender")
+ snd.send(content)
+ rcv = self.ssn.receiver(snd.target)
+ msg = rcv.fetch(0)
+ assert msg.content == content
+ self.ssn.acknowledge(msg)
+
+ def testReceiver(self):
+ rcv = self.ssn.receiver('test-rcv-queue; {create: always}')
+ rcv2 = self.ssn.receiver(rcv.source)
+ assert rcv is not rcv2
+ rcv2.close()
+
+ content = self.content("testReceiver")
+ snd = self.ssn.sender(rcv.source, durable=self.durable())
+ snd.send(content)
+ msg = rcv.fetch(0)
+ assert msg.content == content
+ self.ssn.acknowledge(msg)
+ snd2 = self.ssn.receiver('test-rcv-queue; {delete: always}')
+
+ def testDetachedReceiver(self):
+ self.conn.detach()
+ rcv = self.ssn.receiver("test-dis-rcv-queue; {create: always, delete: always}")
+ m = self.content("testDetachedReceiver")
+ self.conn.attach()
+ snd = self.ssn.sender("test-dis-rcv-queue")
+ snd.send(m)
+ self.drain(rcv, expected=[m])
+
+ def testNextReceiver(self):
+ ADDR = 'test-next-rcv-queue; {create: always, delete: always}'
+ rcv1 = self.ssn.receiver(ADDR, capacity=UNLIMITED)
+ rcv2 = self.ssn.receiver(ADDR, capacity=UNLIMITED)
+ rcv3 = self.ssn.receiver(ADDR, capacity=UNLIMITED)
+
+ snd = self.ssn.sender(ADDR)
+
+ msgs = []
+ for i in range(10):
+ content = self.content("testNextReceiver", i)
+ snd.send(content)
+ msgs.append(content)
+
+ fetched = []
+ try:
+ while True:
+ rcv = self.ssn.next_receiver(timeout=self.delay())
+ assert rcv in (rcv1, rcv2, rcv3)
+ assert rcv.available() > 0
+ fetched.append(rcv.fetch().content)
+ except Empty:
+ pass
+ assert msgs == fetched, "expecting %s, got %s" % (msgs, fetched)
+ self.ssn.acknowledge()
+ #we set the capacity to 0 to prevent the deletion of the queue -
+ #triggered the deletion policy when the first receiver is closed -
+ #resulting in session exceptions being issued for the remaining
+ #active subscriptions:
+ for r in [rcv1, rcv2, rcv3]:
+ r.capacity = 0
+
+ # XXX, we need a convenient way to assert that required queues are
+ # empty on setup, and possibly also to drain queues on teardown
+ def ackTest(self, acker, ack_capacity=None):
+ # send a bunch of messages
+ snd = self.ssn.sender(ACK_QC, durable=self.durable())
+ contents = [self.content("ackTest", i) for i in range(15)]
+ for c in contents:
+ snd.send(c)
+
+ # drain the queue, verify the messages are there and then close
+ # without acking
+ rcv = self.ssn.receiver(ACK_QC)
+ self.drain(rcv, expected=contents)
+ self.ssn.close()
+
+ # drain the queue again, verify that they are all the messages
+ # were requeued, and ack this time before closing
+ self.ssn = self.conn.session()
+ if ack_capacity is not None:
+ self.ssn.ack_capacity = ack_capacity
+ rcv = self.ssn.receiver(ACK_QC)
+ self.drain(rcv, expected=contents)
+ acker(self.ssn)
+ self.ssn.close()
+
+ # drain the queue a final time and verify that the messages were
+ # dequeued
+ self.ssn = self.conn.session()
+ rcv = self.ssn.receiver(ACK_QD)
+ self.assertEmpty(rcv)
+
+ def testAcknowledge(self):
+ self.ackTest(lambda ssn: ssn.acknowledge())
+
+ def testAcknowledgeAsync(self):
+ self.ackTest(lambda ssn: ssn.acknowledge(sync=False))
+
+ def testAcknowledgeAsyncAckCap0(self):
+ try:
+ try:
+ self.ackTest(lambda ssn: ssn.acknowledge(sync=False), 0)
+ assert False, "acknowledge shouldn't succeed with ack_capacity of zero"
+ except InsufficientCapacity:
+ pass
+ finally:
+ self.ssn.ack_capacity = UNLIMITED
+ self.drain(self.ssn.receiver(ACK_QD))
+ self.ssn.acknowledge()
+
+ def testAcknowledgeAsyncAckCap1(self):
+ self.ackTest(lambda ssn: ssn.acknowledge(sync=False), 1)
+
+ def testAcknowledgeAsyncAckCap5(self):
+ self.ackTest(lambda ssn: ssn.acknowledge(sync=False), 5)
+
+ def testAcknowledgeAsyncAckCapUNLIMITED(self):
+ self.ackTest(lambda ssn: ssn.acknowledge(sync=False), UNLIMITED)
+
+ def testRelease(self):
+ msgs = [self.message("testRelease", i) for i in range(3)]
+ snd = self.ssn.sender("test-release-queue; {create: always, delete: always}")
+ for m in msgs:
+ snd.send(m)
+ rcv = self.ssn.receiver(snd.target)
+ echos = self.drain(rcv, expected=msgs)
+ self.ssn.acknowledge(echos[0])
+ self.ssn.acknowledge(echos[1], Disposition(RELEASED, set_redelivered=True))
+ self.ssn.acknowledge(echos[2], Disposition(RELEASED))
+ self.drain(rcv, limit=1, expected=msgs[1:2], redelivered=True)
+ self.drain(rcv, expected=msgs[2:3])
+ self.ssn.acknowledge()
+
+ def testReject(self):
+ msgs = [self.message("testReject", i) for i in range(3)]
+ snd = self.ssn.sender("""
+ test-reject-queue; {
+ create: always,
+ delete: always,
+ node: {
+ x-declare: {
+ alternate-exchange: 'amq.topic'
+ }
+ }
+ }
+""")
+ for m in msgs:
+ snd.send(m)
+ rcv = self.ssn.receiver(snd.target)
+ rej = self.ssn.receiver("amq.topic")
+ echos = self.drain(rcv, expected=msgs)
+ self.ssn.acknowledge(echos[0])
+ self.ssn.acknowledge(echos[1], Disposition(REJECTED))
+ self.ssn.acknowledge(echos[2],
+ Disposition(REJECTED, code=0, text="test-reject"))
+ self.drain(rej, expected=msgs[1:])
+ self.ssn.acknowledge()
+
+ def send(self, ssn, target, base, count=1):
+ snd = ssn.sender(target, durable=self.durable())
+ messages = []
+ for i in range(count):
+ c = self.message(base, i)
+ snd.send(c)
+ messages.append(c)
+ snd.close()
+ return messages
+
+ def txTest(self, commit):
+ TX_Q = 'test-tx-queue; {create: sender, delete: receiver}'
+ TX_Q_COPY = 'test-tx-queue-copy; {create: always, delete: always}'
+ txssn = self.conn.session(transactional=True)
+ messages = self.send(self.ssn, TX_Q, "txTest", 3)
+ txrcv = txssn.receiver(TX_Q)
+ txsnd = txssn.sender(TX_Q_COPY, durable=self.durable())
+ rcv = self.ssn.receiver(txrcv.source)
+ copy_rcv = self.ssn.receiver(txsnd.target)
+ self.assertEmpty(copy_rcv)
+ for i in range(3):
+ m = txrcv.fetch(0)
+ txsnd.send(m)
+ self.assertEmpty(copy_rcv)
+ txssn.acknowledge()
+ if commit:
+ txssn.commit()
+ self.assertEmpty(rcv)
+ self.drain(copy_rcv, expected=messages)
+ else:
+ txssn.rollback()
+ self.drain(rcv, expected=messages, redelivered=True)
+ self.assertEmpty(copy_rcv)
+ self.ssn.acknowledge()
+
+ def testCommit(self):
+ self.txTest(True)
+
+ def testRollback(self):
+ self.txTest(False)
+
+ def txTestSend(self, commit):
+ TX_SEND_Q = 'test-tx-send-queue; {create: sender, delete: receiver}'
+ txssn = self.conn.session(transactional=True)
+ messages = self.send(txssn, TX_SEND_Q, "txTestSend", 3)
+ rcv = self.ssn.receiver(TX_SEND_Q)
+ self.assertEmpty(rcv)
+
+ if commit:
+ txssn.commit()
+ self.drain(rcv, expected=messages)
+ self.ssn.acknowledge()
+ else:
+ txssn.rollback()
+ self.assertEmpty(rcv)
+ txssn.commit()
+ self.assertEmpty(rcv)
+
+ def testCommitSend(self):
+ self.txTestSend(True)
+
+ def testRollbackSend(self):
+ self.txTestSend(False)
+
+ def txTestAck(self, commit):
+ TX_ACK_QC = 'test-tx-ack-queue; {create: always}'
+ TX_ACK_QD = 'test-tx-ack-queue; {delete: always}'
+ txssn = self.conn.session(transactional=True)
+ txrcv = txssn.receiver(TX_ACK_QC)
+ self.assertEmpty(txrcv)
+ messages = self.send(self.ssn, TX_ACK_QC, "txTestAck", 3)
+ self.drain(txrcv, expected=messages)
+
+ if commit:
+ txssn.acknowledge()
+ else:
+ txssn.rollback()
+ self.drain(txrcv, expected=messages, redelivered=True)
+ txssn.acknowledge()
+ txssn.rollback()
+ self.drain(txrcv, expected=messages, redelivered=True)
+ txssn.commit() # commit without ack
+ self.assertEmpty(txrcv)
+
+ txssn.close()
+
+ txssn = self.conn.session(transactional=True)
+ txrcv = txssn.receiver(TX_ACK_QC)
+ self.drain(txrcv, expected=messages, redelivered=True)
+ txssn.acknowledge()
+ txssn.commit()
+ rcv = self.ssn.receiver(TX_ACK_QD)
+ self.assertEmpty(rcv)
+ txssn.close()
+ self.assertEmpty(rcv)
+
+ def testCommitAck(self):
+ self.txTestAck(True)
+
+ def testRollbackAck(self):
+ self.txTestAck(False)
+
+ def testDoubleCommit(self):
+ ssn = self.conn.session(transactional=True)
+ snd = ssn.sender("amq.direct/doubleCommit")
+ rcv = ssn.receiver("amq.direct/doubleCommit")
+ msgs = [self.message("testDoubleCommit", i, subject="doubleCommit") for i in range(3)]
+ for m in msgs:
+ snd.send(m)
+ ssn.commit()
+ self.drain(rcv, expected=msgs)
+ ssn.acknowledge()
+ ssn.commit()
+
+ def testClose(self):
+ self.ssn.close()
+ try:
+ self.ping(self.ssn)
+ assert False, "ping succeeded"
+ except Detached:
+ pass
+
+ def testRxCallback(self):
+ """Verify that the callback is invoked when a message is received.
+ """
+ ADDR = 'test-rx_callback-queue; {create: always, delete: receiver}'
+ class CallbackHandler:
+ def __init__(self):
+ self.handler_called = False
+ def __call__(self):
+ self.handler_called = True
+ cb = CallbackHandler()
+ self.ssn.set_message_received_handler(cb)
+ rcv = self.ssn.receiver(ADDR)
+ rcv.capacity = UNLIMITED
+ snd = self.ssn.sender(ADDR)
+ assert not cb.handler_called
+ snd.send("Ping")
+ deadline = time.time() + self.timeout()
+ while time.time() < deadline:
+ if cb.handler_called:
+ break;
+ assert cb.handler_called
+ snd.close()
+ rcv.close()
+
+
+RECEIVER_Q = 'test-receiver-queue; {create: always, delete: always}'
+
+class ReceiverTests(Base):
+
+ def setup_connection(self):
+ return Connection.establish(self.broker, **self.connection_options())
+
+ def setup_session(self):
+ return self.conn.session()
+
+ def setup_sender(self):
+ return self.ssn.sender(RECEIVER_Q)
+
+ def setup_receiver(self):
+ return self.ssn.receiver(RECEIVER_Q)
+
+ def send(self, base, count = None, sync=True):
+ content = self.content(base, count)
+ self.snd.send(content, sync=sync)
+ return content
+
+ def testFetch(self):
+ try:
+ msg = self.rcv.fetch(0)
+ assert False, "unexpected message: %s" % msg
+ except Empty:
+ pass
+ try:
+ start = time.time()
+ msg = self.rcv.fetch(self.delay())
+ assert False, "unexpected message: %s" % msg
+ except Empty:
+ elapsed = time.time() - start
+ assert elapsed >= self.delay()
+
+ one = self.send("testFetch", 1)
+ two = self.send("testFetch", 2)
+ three = self.send("testFetch", 3)
+ msg = self.rcv.fetch(0)
+ assert msg.content == one
+ msg = self.rcv.fetch(self.delay())
+ assert msg.content == two
+ msg = self.rcv.fetch()
+ assert msg.content == three
+ self.ssn.acknowledge()
+
+ def fetchFromClosedTest(self, entry):
+ entry.close()
+ try:
+ msg = self.rcv.fetch(0)
+ assert False, "unexpected result: %s" % msg
+ except Empty, e:
+ assert False, "unexpected exception: %s" % e
+ except LinkClosed, e:
+ pass
+
+ def testFetchFromClosedReceiver(self):
+ self.fetchFromClosedTest(self.rcv)
+
+ def testFetchFromClosedSession(self):
+ self.fetchFromClosedTest(self.ssn)
+
+ def testFetchFromClosedConnection(self):
+ self.fetchFromClosedTest(self.conn)
+
+ def fetchFromConcurrentCloseTest(self, entry):
+ def closer():
+ self.sleep()
+ entry.close()
+ t = Thread(target=closer)
+ t.start()
+ try:
+ msg = self.rcv.fetch()
+ assert False, "unexpected result: %s" % msg
+ except Empty, e:
+ assert False, "unexpected exception: %s" % e
+ except LinkClosed, e:
+ pass
+ t.join()
+
+ def testFetchFromConcurrentCloseReceiver(self):
+ self.fetchFromConcurrentCloseTest(self.rcv)
+
+ def testFetchFromConcurrentCloseSession(self):
+ self.fetchFromConcurrentCloseTest(self.ssn)
+
+ def testFetchFromConcurrentCloseConnection(self):
+ self.fetchFromConcurrentCloseTest(self.conn)
+
+ def testCapacityIncrease(self):
+ content = self.send("testCapacityIncrease")
+ self.sleep()
+ assert self.rcv.available() == 0
+ self.rcv.capacity = UNLIMITED
+ self.sleep()
+ assert self.rcv.available() == 1
+ msg = self.rcv.fetch(0)
+ assert msg.content == content
+ assert self.rcv.available() == 0
+ self.ssn.acknowledge()
+
+ def testCapacityDecrease(self):
+ self.rcv.capacity = UNLIMITED
+ one = self.send("testCapacityDecrease", 1)
+ self.sleep()
+ assert self.rcv.available() == 1
+ msg = self.rcv.fetch(0)
+ assert msg.content == one
+
+ self.rcv.capacity = 0
+
+ two = self.send("testCapacityDecrease", 2)
+ self.sleep()
+ assert self.rcv.available() == 0
+ msg = self.rcv.fetch(0)
+ assert msg.content == two
+
+ self.ssn.acknowledge()
+
+ def capacityTest(self, capacity, threshold=None):
+ if threshold is not None:
+ self.rcv.threshold = threshold
+ self.rcv.capacity = capacity
+ self.assertAvailable(self.rcv, 0)
+
+ for i in range(2*capacity):
+ self.send("capacityTest(%s, %s)" % (capacity, threshold), i, sync=False)
+ self.snd.sync()
+ self.sleep()
+ self.assertAvailable(self.rcv)
+
+ first = capacity/2
+ second = capacity - first
+ self.drain(self.rcv, limit = first)
+ self.sleep()
+ self.assertAvailable(self.rcv)
+ self.drain(self.rcv, limit = second)
+ self.sleep()
+ self.assertAvailable(self.rcv)
+
+ drained = self.drain(self.rcv)
+ assert len(drained) == capacity, "%s, %s" % (len(drained), drained)
+ self.assertAvailable(self.rcv, 0)
+
+ self.ssn.acknowledge()
+
+ def testCapacity5(self):
+ self.capacityTest(5)
+
+ def testCapacity5Threshold1(self):
+ self.capacityTest(5, 1)
+
+ def testCapacity10(self):
+ self.capacityTest(10)
+
+ def testCapacity10Threshold1(self):
+ self.capacityTest(10, 1)
+
+ def testCapacity100(self):
+ self.capacityTest(100)
+
+ def testCapacity100Threshold1(self):
+ self.capacityTest(100, 1)
+
+ def testCapacityUNLIMITED(self):
+ self.rcv.capacity = UNLIMITED
+ self.assertAvailable(self.rcv, 0)
+
+ for i in range(10):
+ self.send("testCapacityUNLIMITED", i)
+ self.sleep()
+ self.assertAvailable(self.rcv, 10)
+
+ self.drain(self.rcv)
+ self.assertAvailable(self.rcv, 0)
+
+ self.ssn.acknowledge()
+
+ def testAvailable(self):
+ self.rcv.capacity = UNLIMITED
+ assert self.rcv.available() == 0
+
+ for i in range(3):
+ self.send("testAvailable", i)
+ self.sleep()
+ assert self.rcv.available() == 3
+
+ for i in range(3, 10):
+ self.send("testAvailable", i)
+ self.sleep()
+ assert self.rcv.available() == 10
+
+ self.drain(self.rcv, limit=3)
+ assert self.rcv.available() == 7
+
+ self.drain(self.rcv)
+ assert self.rcv.available() == 0
+
+ self.ssn.acknowledge()
+
+ def testDoubleClose(self):
+ m1 = self.content("testDoubleClose", 1)
+ m2 = self.content("testDoubleClose", 2)
+
+ snd = self.ssn.sender("""test-double-close; {
+ create: always,
+ delete: sender,
+ node: {
+ type: topic
+ }
+}
+""")
+ r1 = self.ssn.receiver(snd.target)
+ r2 = self.ssn.receiver(snd.target)
+ snd.send(m1)
+ self.drain(r1, expected=[m1])
+ self.drain(r2, expected=[m1])
+ r1.close()
+ snd.send(m2)
+ self.drain(r2, expected=[m2])
+ r2.close()
+
+ # XXX: need testClose
+
+ def testMode(self):
+ msgs = [self.content("testMode", 1),
+ self.content("testMode", 2),
+ self.content("testMode", 3)]
+
+ for m in msgs:
+ self.snd.send(m)
+
+ rb = self.ssn.receiver('test-receiver-queue; {mode: browse}')
+ rc = self.ssn.receiver('test-receiver-queue; {mode: consume}')
+ self.drain(rb, expected=msgs)
+ self.drain(rc, expected=msgs)
+ rb2 = self.ssn.receiver(rb.source)
+ self.assertEmpty(rb2)
+ self.drain(self.rcv, expected=[])
+
+ def testUnsettled(self):
+ # just tests the code path and not the value
+ rcv = self.ssn.receiver('test-receiver-unsettled-queue; {create: always, delete: always}')
+ rcv.unsettled()
+
+ def unreliabilityTest(self, mode="unreliable"):
+ msgs = [self.message("testUnreliable", i) for i in range(3)]
+ snd = self.ssn.sender("test-unreliability-queue; {create: sender, delete: receiver}")
+ rcv = self.ssn.receiver(snd.target)
+ for m in msgs:
+ snd.send(m)
+
+ # close without ack on reliable receiver, messages should be requeued
+ ssn = self.conn.session()
+ rrcv = ssn.receiver("test-unreliability-queue")
+ self.drain(rrcv, expected=msgs)
+ ssn.close()
+
+ # close without ack on unreliable receiver, messages should not be requeued
+ ssn = self.conn.session()
+ urcv = ssn.receiver("test-unreliability-queue; {link: {reliability: %s}}" % mode)
+ self.drain(urcv, expected=msgs, redelivered=True)
+ ssn.close()
+
+ self.assertEmpty(rcv)
+
+ def testUnreliable(self):
+ self.unreliabilityTest(mode="unreliable")
+
+ def testAtMostOnce(self):
+ self.unreliabilityTest(mode="at-most-once")
+
+class AddressTests(Base):
+
+ def setup_connection(self):
+ return Connection.establish(self.broker, **self.connection_options())
+
+ def setup_session(self):
+ return self.conn.session()
+
+ def badOption(self, options, error):
+ try:
+ self.ssn.sender("test-bad-options-snd; %s" % options)
+ assert False
+ except InvalidOption, e:
+ assert "error in options: %s" % error == str(e), e
+
+ try:
+ self.ssn.receiver("test-bad-options-rcv; %s" % options)
+ assert False
+ except InvalidOption, e:
+ assert "error in options: %s" % error == str(e), e
+
+ def testIllegalKey(self):
+ self.badOption("{create: always, node: "
+ "{this-property-does-not-exist: 3}}",
+ "node: this-property-does-not-exist: "
+ "illegal key")
+
+ def testWrongValue(self):
+ self.badOption("{create: asdf}", "create: asdf not in "
+ "('always', 'sender', 'receiver', 'never')")
+
+ def testWrongType1(self):
+ self.badOption("{node: asdf}",
+ "node: asdf is not a map")
+
+ def testWrongType2(self):
+ self.badOption("{node: {durable: []}}",
+ "node: durable: [] is not a bool")
+
+ def testCreateQueue(self):
+ snd = self.ssn.sender("test-create-queue; {create: always, delete: always, "
+ "node: {type: queue, durable: False, "
+ "x-declare: {auto_delete: true}}}")
+ content = self.content("testCreateQueue")
+ snd.send(content)
+ rcv = self.ssn.receiver("test-create-queue")
+ self.drain(rcv, expected=[content])
+
+ def createExchangeTest(self, props=""):
+ addr = """test-create-exchange; {
+ create: always,
+ delete: always,
+ node: {
+ type: topic,
+ durable: False,
+ x-declare: {auto_delete: true, %s}
+ }
+ }""" % props
+ snd = self.ssn.sender(addr)
+ snd.send("ping")
+ rcv1 = self.ssn.receiver("test-create-exchange/first")
+ rcv2 = self.ssn.receiver("test-create-exchange/first")
+ rcv3 = self.ssn.receiver("test-create-exchange/second")
+ for r in (rcv1, rcv2, rcv3):
+ try:
+ r.fetch(0)
+ assert False
+ except Empty:
+ pass
+ msg1 = Message(self.content("testCreateExchange", 1), subject="first")
+ msg2 = Message(self.content("testCreateExchange", 2), subject="second")
+ snd.send(msg1)
+ snd.send(msg2)
+ self.drain(rcv1, expected=[msg1.content])
+ self.drain(rcv2, expected=[msg1.content])
+ self.drain(rcv3, expected=[msg2.content])
+
+ def testCreateExchange(self):
+ self.createExchangeTest()
+
+ def testCreateExchangeDirect(self):
+ self.createExchangeTest("type: direct")
+
+ def testCreateExchangeTopic(self):
+ self.createExchangeTest("type: topic")
+
+ def testDeleteBySender(self):
+ snd = self.ssn.sender("test-delete; {create: always}")
+ snd.send("ping")
+ snd.close()
+ snd = self.ssn.sender("test-delete; {delete: always}")
+ snd.send("ping")
+ snd.close()
+ try:
+ self.ssn.sender("test-delete")
+ except NotFound, e:
+ assert "no such queue" in str(e)
+
+ def testDeleteByReceiver(self):
+ rcv = self.ssn.receiver("test-delete; {create: always, delete: always}")
+ try:
+ rcv.fetch(0)
+ except Empty:
+ pass
+ rcv.close()
+
+ try:
+ self.ssn.receiver("test-delete")
+ assert False
+ except NotFound, e:
+ assert "no such queue" in str(e)
+
+ def testDeleteSpecial(self):
+ snd = self.ssn.sender("amq.topic; {delete: always}")
+ snd.send("asdf")
+ try:
+ snd.close()
+ assert False, "successfully deleted amq.topic"
+ except SessionError, e:
+ assert e.code == 530
+ # XXX: need to figure out close after error
+ self.conn._remove_session(self.ssn)
+
+ def testNodeBindingsQueue(self):
+ snd = self.ssn.sender("""
+test-node-bindings-queue; {
+ create: always,
+ delete: always,
+ node: {
+ x-bindings: [{exchange: "amq.topic", key: "a.#"},
+ {exchange: "amq.direct", key: "b"},
+ {exchange: "amq.topic", key: "c.*"}]
+ }
+}
+""")
+ snd.send("one")
+ snd_a = self.ssn.sender("amq.topic/a.foo")
+ snd_b = self.ssn.sender("amq.direct/b")
+ snd_c = self.ssn.sender("amq.topic/c.bar")
+ snd_a.send("two")
+ snd_b.send("three")
+ snd_c.send("four")
+ rcv = self.ssn.receiver("test-node-bindings-queue")
+ self.drain(rcv, expected=["one", "two", "three", "four"])
+
+ def testNodeBindingsTopic(self):
+ rcv = self.ssn.receiver("test-node-bindings-topic-queue; {create: always, delete: always}")
+ rcv_a = self.ssn.receiver("test-node-bindings-topic-queue-a; {create: always, delete: always}")
+ rcv_b = self.ssn.receiver("test-node-bindings-topic-queue-b; {create: always, delete: always}")
+ rcv_c = self.ssn.receiver("test-node-bindings-topic-queue-c; {create: always, delete: always}")
+ snd = self.ssn.sender("""
+test-node-bindings-topic; {
+ create: always,
+ delete: always,
+ node: {
+ type: topic,
+ x-bindings: [{queue: test-node-bindings-topic-queue, key: "#"},
+ {queue: test-node-bindings-topic-queue-a, key: "a.#"},
+ {queue: test-node-bindings-topic-queue-b, key: "b"},
+ {queue: test-node-bindings-topic-queue-c, key: "c.*"}]
+ }
+}
+""")
+ m1 = Message("one")
+ m2 = Message(subject="a.foo", content="two")
+ m3 = Message(subject="b", content="three")
+ m4 = Message(subject="c.bar", content="four")
+ snd.send(m1)
+ snd.send(m2)
+ snd.send(m3)
+ snd.send(m4)
+ self.drain(rcv, expected=[m1, m2, m3, m4])
+ self.drain(rcv_a, expected=[m2])
+ self.drain(rcv_b, expected=[m3])
+ self.drain(rcv_c, expected=[m4])
+
+ def testLinkBindings(self):
+ m_a = self.message("testLinkBindings", 1, subject="a")
+ m_b = self.message("testLinkBindings", 2, subject="b")
+
+ self.ssn.sender("test-link-bindings-queue; {create: always, delete: always}")
+ snd = self.ssn.sender("amq.topic")
+
+ snd.send(m_a)
+ snd.send(m_b)
+ snd.close()
+
+ rcv = self.ssn.receiver("test-link-bindings-queue")
+ self.assertEmpty(rcv)
+
+ snd = self.ssn.sender("""
+amq.topic; {
+ link: {
+ x-bindings: [{queue: test-link-bindings-queue, key: a}]
+ }
+}
+""")
+
+ snd.send(m_a)
+ snd.send(m_b)
+
+ self.drain(rcv, expected=[m_a])
+ rcv.close()
+
+ rcv = self.ssn.receiver("""
+test-link-bindings-queue; {
+ link: {
+ x-bindings: [{exchange: "amq.topic", key: b}]
+ }
+}
+""")
+
+ snd.send(m_a)
+ snd.send(m_b)
+
+ self.drain(rcv, expected=[m_a, m_b])
+
+ def testSubjectOverride(self):
+ snd = self.ssn.sender("amq.topic/a")
+ rcv_a = self.ssn.receiver("amq.topic/a")
+ rcv_b = self.ssn.receiver("amq.topic/b")
+ m1 = self.content("testSubjectOverride", 1)
+ m2 = self.content("testSubjectOverride", 2)
+ snd.send(m1)
+ snd.send(Message(subject="b", content=m2))
+ self.drain(rcv_a, expected=[m1])
+ self.drain(rcv_b, expected=[m2])
+
+ def testSubjectDefault(self):
+ m1 = self.content("testSubjectDefault", 1)
+ m2 = self.content("testSubjectDefault", 2)
+ snd = self.ssn.sender("amq.topic/a")
+ rcv = self.ssn.receiver("amq.topic")
+ snd.send(m1)
+ snd.send(Message(subject="b", content=m2))
+ e1 = rcv.fetch(timeout=0)
+ e2 = rcv.fetch(timeout=0)
+ assert e1.subject == "a", "subject: %s" % e1.subject
+ assert e2.subject == "b", "subject: %s" % e2.subject
+ self.assertEmpty(rcv)
+
+ def doReliabilityTest(self, reliability, messages, expected):
+ snd = self.ssn.sender("amq.topic")
+ rcv = self.ssn.receiver("amq.topic; {link: {reliability: %s}}" % reliability)
+ for m in messages:
+ snd.send(m)
+ self.conn.detach()
+ self.conn.attach()
+ self.drain(rcv, expected=expected)
+
+ def testReliabilityUnreliable(self):
+ msgs = [self.message("testReliabilityUnreliable", i) for i in range(3)]
+ self.doReliabilityTest("unreliable", msgs, [])
+
+ def testReliabilityAtLeastOnce(self):
+ msgs = [self.message("testReliabilityAtLeastOnce", i) for i in range(3)]
+ self.doReliabilityTest("at-least-once", msgs, msgs)
+
+ def testLinkName(self):
+ msgs = [self.message("testLinkName", i) for i in range(3)]
+ snd = self.ssn.sender("amq.topic")
+ trcv = self.ssn.receiver("amq.topic; {link: {name: test-link-name}}")
+ qrcv = self.ssn.receiver("test-link-name")
+ for m in msgs:
+ snd.send(m)
+ self.drain(qrcv, expected=msgs)
+
+ def testAssert1(self):
+ try:
+ snd = self.ssn.sender("amq.topic; {assert: always, node: {type: queue}}")
+ assert 0, "assertion failed to trigger"
+ except AssertionFailed, e:
+ pass
+ except NotFound, e: # queue named amp.topic not found
+ pass
+
+ def testAssert2(self):
+ snd = self.ssn.sender("amq.topic; {assert: always}")
+
+NOSUCH_Q = "this-queue-should-not-exist"
+UNPARSEABLE_ADDR = "name/subject; {bad options"
+UNLEXABLE_ADDR = "\0x0\0x1\0x2\0x3"
+
+class AddressErrorTests(Base):
+
+ def setup_connection(self):
+ return Connection.establish(self.broker, **self.connection_options())
+
+ def setup_session(self):
+ return self.conn.session()
+
+ def senderErrorTest(self, addr, exc, check=lambda e: True):
+ try:
+ self.ssn.sender(addr, durable=self.durable())
+ assert False, "sender creation succeeded"
+ except exc, e:
+ assert check(e), "unexpected error: %s" % compat.format_exc(e)
+
+ def receiverErrorTest(self, addr, exc, check=lambda e: True):
+ try:
+ self.ssn.receiver(addr)
+ assert False, "receiver creation succeeded"
+ except exc, e:
+ assert check(e), "unexpected error: %s" % compat.format_exc(e)
+
+ def testNoneTarget(self):
+ self.senderErrorTest(None, MalformedAddress)
+
+ def testNoneSource(self):
+ self.receiverErrorTest(None, MalformedAddress)
+
+ def testNoTarget(self):
+ self.senderErrorTest(NOSUCH_Q, NotFound, lambda e: NOSUCH_Q in str(e))
+
+ def testNoSource(self):
+ self.receiverErrorTest(NOSUCH_Q, NotFound, lambda e: NOSUCH_Q in str(e))
+
+ def testUnparseableTarget(self):
+ self.senderErrorTest(UNPARSEABLE_ADDR, MalformedAddress,
+ lambda e: "expecting COLON" in str(e))
+
+ def testUnparseableSource(self):
+ self.receiverErrorTest(UNPARSEABLE_ADDR, MalformedAddress,
+ lambda e: "expecting COLON" in str(e))
+
+ def testUnlexableTarget(self):
+ self.senderErrorTest(UNLEXABLE_ADDR, MalformedAddress,
+ lambda e: "unrecognized characters" in str(e))
+
+ def testUnlexableSource(self):
+ self.receiverErrorTest(UNLEXABLE_ADDR, MalformedAddress,
+ lambda e: "unrecognized characters" in str(e))
+
+ def testInvalidMode(self):
+ self.receiverErrorTest('name; {mode: "this-is-a-bad-receiver-mode"}',
+ InvalidOption,
+ lambda e: "not in ('browse', 'consume')" in str(e))
+
+SENDER_Q = 'test-sender-q; {create: always, delete: always}'
+
+class SenderTests(Base):
+
+ def setup_connection(self):
+ return Connection.establish(self.broker, **self.connection_options())
+
+ def setup_session(self):
+ return self.conn.session()
+
+ def setup_sender(self):
+ return self.ssn.sender(SENDER_Q)
+
+ def setup_receiver(self):
+ return self.ssn.receiver(SENDER_Q)
+
+ def checkContent(self, content):
+ self.snd.send(content)
+ msg = self.rcv.fetch(0)
+ assert msg.content == content
+
+ out = Message(content)
+ self.snd.send(out)
+ echo = self.rcv.fetch(0)
+ assert out.content == echo.content
+ assert echo.content == msg.content
+ self.ssn.acknowledge()
+
+ def testSendString(self):
+ self.checkContent(self.content("testSendString"))
+
+ def testSendList(self):
+ self.checkContent(["testSendList", 1, 3.14, self.test_id])
+
+ def testSendMap(self):
+ self.checkContent({"testSendMap": self.test_id, "pie": "blueberry", "pi": 3.14})
+
+ def asyncTest(self, capacity):
+ self.snd.capacity = capacity
+ msgs = [self.content("asyncTest", i) for i in range(15)]
+ for m in msgs:
+ self.snd.send(m, sync=False)
+ self.drain(self.rcv, timeout=self.delay(), expected=msgs)
+ self.ssn.acknowledge()
+
+ def testSendAsyncCapacity0(self):
+ try:
+ self.asyncTest(0)
+ assert False, "send shouldn't succeed with zero capacity"
+ except InsufficientCapacity:
+ # this is expected
+ pass
+
+ def testSendAsyncCapacity1(self):
+ self.asyncTest(1)
+
+ def testSendAsyncCapacity5(self):
+ self.asyncTest(5)
+
+ def testSendAsyncCapacityUNLIMITED(self):
+ self.asyncTest(UNLIMITED)
+
+ def testCapacityTimeout(self):
+ self.snd.capacity = 1
+ msgs = []
+ caught = False
+ while len(msgs) < 100:
+ m = self.content("testCapacity", len(msgs))
+ try:
+ self.snd.send(m, sync=False, timeout=0)
+ msgs.append(m)
+ except InsufficientCapacity:
+ caught = True
+ break
+ self.snd.sync()
+ self.drain(self.rcv, expected=msgs)
+ self.ssn.acknowledge()
+ assert caught, "did not exceed capacity"
+
+ def testEINTR(self):
+ m1 = self.content("testEINTR", 0)
+ m2 = self.content("testEINTR", 1)
+
+ self.snd.send(m1, timeout=self.timeout())
+ try:
+ os.setuid(500)
+ assert False, "setuid should fail"
+ except:
+ pass
+ self.snd.send(m2, timeout=self.timeout())
diff --git a/qpid/python/qpid/tests/messaging/implementation.py b/qpid/python/qpid/tests/messaging/implementation.py
new file mode 100644
index 0000000000..fce60c6f38
--- /dev/null
+++ b/qpid/python/qpid/tests/messaging/implementation.py
@@ -0,0 +1,28 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import os
+if 'QPID_USE_SWIG_CLIENT' in os.environ and os.environ['QPID_USE_SWIG_CLIENT']:
+ try:
+ from qpid_messaging import *
+ from qpid.datatypes import uuid4
+ except ImportError, e:
+ print "Swigged client not found. Falling back to pure bindings, %s\n" % e
+ from qpid.messaging import *
+else:
+ from qpid.messaging import *
diff --git a/qpid/python/qpid/tests/messaging/message.py b/qpid/python/qpid/tests/messaging/message.py
new file mode 100644
index 0000000000..bfdd2c79e5
--- /dev/null
+++ b/qpid/python/qpid/tests/messaging/message.py
@@ -0,0 +1,187 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from qpid.tests.messaging.implementation import *
+from qpid.messaging.address import parse
+from qpid.tests.messaging import Base
+
+class MessageTests(Base):
+
+ def testCreateString(self):
+ m = Message("string")
+ assert m.content == "string"
+ assert m.content_type is None
+
+ def testCreateUnicode(self):
+ m = Message(u"unicode")
+ assert m.content == u"unicode"
+ assert m.content_type == "text/plain"
+
+ def testCreateMap(self):
+ m = Message({})
+ assert m.content == {}
+ assert m.content_type == "amqp/map"
+
+ def testCreateList(self):
+ m = Message([])
+ assert m.content == []
+ assert m.content_type == "amqp/list"
+
+ def testContentTypeOverride(self):
+ m = Message()
+ m.content_type = "text/html; charset=utf8"
+ m.content = u"<html/>"
+ assert m.content_type == "text/html; charset=utf8"
+
+ECHO_Q = 'test-message-echo-queue; {create: always, delete: always}'
+
+class MessageEchoTests(Base):
+
+ def setup_connection(self):
+ return Connection.establish(self.broker, **self.connection_options())
+
+ def setup_session(self):
+ return self.conn.session()
+
+ def setup_sender(self):
+ return self.ssn.sender(ECHO_Q)
+
+ def setup_receiver(self):
+ return self.ssn.receiver(ECHO_Q)
+
+ def check(self, msg):
+ self.snd.send(msg)
+ echo = self.rcv.fetch(0)
+ self.assertEcho(msg, echo)
+ self.ssn.acknowledge(echo)
+
+ def testStringContent(self):
+ self.check(Message("string"))
+
+ def testUnicodeContent(self):
+ self.check(Message(u"unicode"))
+
+
+ TEST_MAP = {"key1": "string",
+ "key2": u"unicode",
+ "key3": 3,
+ "key4": -3,
+ "key5": 3.14,
+ "key6": -3.14,
+ "key7": ["one", 2, 3.14],
+ "key8": [],
+ "key9": {"sub-key0": 3},
+ "key10": True,
+ "key11": False,
+ "x-amqp-0-10.app-id": "test-app-id",
+ "x-amqp-0-10.content-encoding": "test-content-encoding"}
+
+ def testMapContent(self):
+ self.check(Message(MessageEchoTests.TEST_MAP))
+
+ def testListContent(self):
+ self.check(Message([]))
+ self.check(Message([1, 2, 3]))
+ self.check(Message(["one", 2, 3.14, {"four": 4}]))
+
+ def testProperties(self):
+ msg = Message()
+ msg.subject = "subject"
+ msg.correlation_id = str(self.test_id)
+ msg.durable = True
+ msg.priority = 7
+ msg.ttl = 60
+ msg.properties = MessageEchoTests.TEST_MAP
+ msg.reply_to = "reply-address"
+ self.check(msg)
+
+ def testApplicationProperties(self):
+ msg = Message()
+ msg.properties["a"] = u"A"
+ msg.properties["b"] = 1
+ msg.properties["c"] = ["x", 2]
+ msg.properties["d"] = "D"
+ #make sure deleting works as expected
+ msg.properties["foo"] = "bar"
+ del msg.properties["foo"]
+ self.check(msg)
+
+ def testContentTypeUnknown(self):
+ msg = Message(content_type = "this-content-type-does-not-exist")
+ self.check(msg)
+
+ def testTextPlain(self):
+ self.check(Message(content_type="text/plain", content="asdf"))
+
+ def testTextPlainEmpty(self):
+ self.check(Message(content_type="text/plain"))
+
+ def check_rt(self, addr, expected=None):
+ if expected is None:
+ expected = addr
+ msg = Message(reply_to=addr)
+ self.snd.send(msg)
+ echo = self.rcv.fetch(0)
+ #reparse addresses and check individual parts as this avoids
+ #failing due to differenecs in whitespace when running over
+ #swigged client:
+ (actual_name, actual_subject, actual_options) = parse(echo.reply_to)
+ (expected_name, expected_subject, expected_options) = parse(expected)
+ assert actual_name == expected_name, (actual_name, expected_name)
+ assert actual_subject == expected_subject, (actual_subject, expected_subject)
+ assert actual_options == expected_options, (actual_options, expected_options)
+ self.ssn.acknowledge(echo)
+
+ def testReplyTo(self):
+ self.check_rt("name")
+
+ def testReplyToQueue(self):
+ self.check_rt("name; {node: {type: queue}}", "name")
+
+ def testReplyToQueueSubject(self):
+ self.check_rt("name/subject; {node: {type: queue}}", "name")
+
+ def testReplyToTopic(self):
+ self.check_rt("name; {node: {type: topic}}")
+
+ def testReplyToTopicSubject(self):
+ self.check_rt("name/subject; {node: {type: topic}}")
+
+ def testBooleanEncoding(self):
+ msg = Message({"true": True, "false": False})
+ self.snd.send(msg)
+ echo = self.rcv.fetch(0)
+ self.assertEcho(msg, echo)
+ t = echo.content["true"]
+ f = echo.content["false"]
+ assert isinstance(t, bool), t
+ assert isinstance(f, bool), f
+
+ def testExceptionRaisedMismatchedContentType(self):
+ msg = Message(content_type="amqp/map", content="asdf")
+ try:
+ self.snd.send(msg)
+ self.rcv.fetch(0)
+ assert False, "Exception not raised on mismatched content/content_type"
+ except Exception, e:
+ pass
+
+ def testRecoverAfterException(self):
+ self.testExceptionRaisedMismatchedContentType()
+ self.testTextPlain()
diff --git a/qpid/python/qpid/tests/mimetype.py b/qpid/python/qpid/tests/mimetype.py
new file mode 100644
index 0000000000..22760316f0
--- /dev/null
+++ b/qpid/python/qpid/tests/mimetype.py
@@ -0,0 +1,56 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from qpid.tests import Test
+from qpid.mimetype import lex, parse, ParseError, EOF, WSPACE
+from parser import ParserBase
+
+class MimeTypeTests(ParserBase, Test):
+
+ EXCLUDE = (WSPACE, EOF)
+
+ def do_lex(self, st):
+ return lex(st)
+
+ def do_parse(self, st):
+ return parse(st)
+
+ def valid(self, addr, type=None, subtype=None, parameters=None):
+ ParserBase.valid(self, addr, (type, subtype, parameters))
+
+ def testTypeOnly(self):
+ self.invalid("type", "expecting SLASH, got EOF line:1,4:type")
+
+ def testTypeSubtype(self):
+ self.valid("type/subtype", "type", "subtype", [])
+
+ def testTypeSubtypeParam(self):
+ self.valid("type/subtype ; name=value",
+ "type", "subtype", [("name", "value")])
+
+ def testTypeSubtypeParamComment(self):
+ self.valid("type/subtype ; name(This is a comment.)=value",
+ "type", "subtype", [("name", "value")])
+
+ def testMultipleParams(self):
+ self.valid("type/subtype ; name1=value1 ; name2=value2",
+ "type", "subtype", [("name1", "value1"), ("name2", "value2")])
+
+ def testCaseInsensitivity(self):
+ self.valid("Type/Subtype", "type", "subtype", [])
diff --git a/qpid/python/qpid/tests/parser.py b/qpid/python/qpid/tests/parser.py
new file mode 100644
index 0000000000..a4865cc9fe
--- /dev/null
+++ b/qpid/python/qpid/tests/parser.py
@@ -0,0 +1,37 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from qpid.parser import ParseError
+
+class ParserBase:
+
+ def lex(self, addr, *types):
+ toks = [t.type for t in self.do_lex(addr) if t.type not in self.EXCLUDE]
+ assert list(types) == toks, "expected %s, got %s" % (types, toks)
+
+ def valid(self, addr, expected):
+ got = self.do_parse(addr)
+ assert expected == got, "expected %s, got %s" % (expected, got)
+
+ def invalid(self, addr, error=None):
+ try:
+ p = self.do_parse(addr)
+ assert False, "invalid address parsed: %s" % p
+ except ParseError, e:
+ assert error == str(e), "expected %r, got %r" % (error, str(e))
diff --git a/qpid/python/qpid/tests/queue.py b/qpid/python/qpid/tests/queue.py
new file mode 100644
index 0000000000..e12354eb43
--- /dev/null
+++ b/qpid/python/qpid/tests/queue.py
@@ -0,0 +1,71 @@
+# Do not delete - marks this directory as a python package.
+
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import threading, time
+from unittest import TestCase
+from qpid.queue import Queue, Empty, Closed
+
+
+class QueueTest (TestCase):
+
+ # The qpid queue class just provides sime simple extensions to
+ # python's standard queue data structure, so we don't need to test
+ # all the queue functionality.
+
+ def test_listen(self):
+ values = []
+ heard = threading.Event()
+ def listener(x):
+ values.append(x)
+ heard.set()
+
+ q = Queue(0)
+ q.listen(listener)
+ heard.clear()
+ q.put(1)
+ heard.wait()
+ assert values[-1] == 1
+ heard.clear()
+ q.put(2)
+ heard.wait()
+ assert values[-1] == 2
+
+ q.listen(None)
+ q.put(3)
+ assert q.get(3) == 3
+ q.listen(listener)
+
+ heard.clear()
+ q.put(4)
+ heard.wait()
+ assert values[-1] == 4
+
+ def test_close(self):
+ q = Queue(0)
+ q.put(1); q.put(2); q.put(3); q.close()
+ assert q.get() == 1
+ assert q.get() == 2
+ assert q.get() == 3
+ for i in range(10):
+ try:
+ q.get()
+ raise AssertionError("expected Closed")
+ except Closed:
+ pass
diff --git a/qpid/python/qpid/tests/saslmech/__init__.py b/qpid/python/qpid/tests/saslmech/__init__.py
new file mode 100644
index 0000000000..d8a500d9d8
--- /dev/null
+++ b/qpid/python/qpid/tests/saslmech/__init__.py
@@ -0,0 +1,19 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
diff --git a/qpid/python/qpid/tests/saslmech/finder.py b/qpid/python/qpid/tests/saslmech/finder.py
new file mode 100644
index 0000000000..3ad5e727ba
--- /dev/null
+++ b/qpid/python/qpid/tests/saslmech/finder.py
@@ -0,0 +1,71 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from unittest import TestCase
+from qpid.saslmech.finder import get_sasl_mechanism
+from my_sasl import MY_SASL
+from my_sasl2 import MY_SASL2
+
+class SaslFinderTests (TestCase):
+ """Tests the ability to chose the a sasl mechanism from those available to be loaded"""
+
+ def test_known_mechansim(self):
+
+ supportedMechs = ["MY-SASL"]
+
+ mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech")
+
+ self.assertTrue(isinstance(mech, MY_SASL), "Mechanism %s is of unexpected type" % mech)
+ self.assertEquals("MY-SASL", mech.mechanismName())
+ self.assertTrue(mech.sasl_options is None)
+
+ def test_unknown_mechansim(self):
+
+ supportedMechs = ["not_a_mech"]
+
+ mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech")
+
+ self.assertTrue(mech == None, "Mechanism instance should be none")
+
+ def test_sasl_mechanism_with_higher_priority_prefered(self):
+
+ supportedMechs = ["MY-SASL", "MY-SASL2"]
+
+ mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech")
+
+ self.assertTrue(isinstance(mech, MY_SASL), "Mechanism %s is of unexpected type" % mech)
+
+ def test_sasl_mechanism_fallback_without_credentials(self):
+
+ # MY-SASL requires username/password, MY-SASL2 does not
+ supportedMechs = ["MY-SASL", "MY-SASL2"]
+
+ mech = get_sasl_mechanism(supportedMechs, None, None, namespace="qpid.tests.saslmech")
+
+ self.assertTrue(isinstance(mech, MY_SASL2), "Mechanism %s is of unexpected type" % mech)
+
+ def test_sasl_mechansim_options(self):
+
+ supportedMechs = ["MY-SASL"]
+
+ sasl_options = {'hello': 'world'}
+ mech = get_sasl_mechanism(supportedMechs, "myuser", "mypass", namespace="qpid.tests.saslmech", sasl_options=sasl_options)
+
+ self.assertTrue(isinstance(mech, MY_SASL), "Mechanism %s is of unexpected type" % mech)
+ self.assertEquals(sasl_options, mech.sasl_options)
diff --git a/qpid/python/qpid/tests/saslmech/my_sasl.py b/qpid/python/qpid/tests/saslmech/my_sasl.py
new file mode 100644
index 0000000000..c15fe4451c
--- /dev/null
+++ b/qpid/python/qpid/tests/saslmech/my_sasl.py
@@ -0,0 +1,22 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from qpid.saslmech.sasl import Sasl
+
+class MY_SASL(Sasl): pass
diff --git a/qpid/python/qpid/tests/saslmech/my_sasl2.py b/qpid/python/qpid/tests/saslmech/my_sasl2.py
new file mode 100644
index 0000000000..e0b3dfa56f
--- /dev/null
+++ b/qpid/python/qpid/tests/saslmech/my_sasl2.py
@@ -0,0 +1,28 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+from qpid.saslmech.sasl import Sasl
+
+class MY_SASL2(Sasl):
+
+ def priority(self):
+ return 0
+
+ def prerequisitesOk(self):
+ return True
diff --git a/qpid/python/qpid/tests/spec010.py b/qpid/python/qpid/tests/spec010.py
new file mode 100644
index 0000000000..ac04e1ee02
--- /dev/null
+++ b/qpid/python/qpid/tests/spec010.py
@@ -0,0 +1,74 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import os, tempfile, shutil, stat
+from unittest import TestCase
+from qpid.codec010 import Codec, StringCodec
+from qpid.ops import *
+
+class SpecTest(TestCase):
+
+ def testSessionHeader(self):
+ sc = StringCodec()
+ sc.write_compound(Header(sync=True))
+ assert sc.encoded == "\x01\x01"
+
+ sc = StringCodec()
+ sc.write_compound(Header(sync=False))
+ assert sc.encoded == "\x01\x00"
+
+ def encdec(self, value):
+ sc = StringCodec()
+ sc.write_compound(value)
+ decoded = sc.read_compound(value.__class__)
+ return decoded
+
+ def testMessageProperties(self):
+ props = MessageProperties(content_length=3735928559L,
+ reply_to=ReplyTo(exchange="the exchange name",
+ routing_key="the routing key"))
+ dec = self.encdec(props)
+ assert props.content_length == dec.content_length
+ assert props.reply_to.exchange == dec.reply_to.exchange
+ assert props.reply_to.routing_key == dec.reply_to.routing_key
+
+ def testMessageSubscribe(self):
+ cmd = MessageSubscribe(exclusive=True, destination="this is a test")
+ dec = self.encdec(cmd)
+ assert cmd.exclusive == dec.exclusive
+ assert cmd.destination == dec.destination
+
+ def testXid(self):
+ sc = StringCodec()
+ xid = Xid(format=0, global_id="gid", branch_id="bid")
+ sc.write_compound(xid)
+ assert sc.encoded == '\x00\x00\x00\x10\x06\x04\x07\x00\x00\x00\x00\x00\x03gid\x03bid'
+ dec = sc.read_compound(Xid)
+ assert xid.__dict__ == dec.__dict__
+
+# def testLoadReadOnly(self):
+# spec = "amqp.0-10-qpid-errata.xml"
+# f = testrunner.get_spec_file(spec)
+# dest = tempfile.mkdtemp()
+# shutil.copy(f, dest)
+# shutil.copy(os.path.join(os.path.dirname(f), "amqp.0-10.dtd"), dest)
+# os.chmod(dest, stat.S_IRUSR | stat.S_IXUSR)
+# fname = os.path.join(dest, spec)
+# load(fname)
+# assert not os.path.exists("%s.pcl" % fname)
diff --git a/qpid/python/qpid/tests/util.py b/qpid/python/qpid/tests/util.py
new file mode 100644
index 0000000000..4e901218c2
--- /dev/null
+++ b/qpid/python/qpid/tests/util.py
@@ -0,0 +1,52 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+from unittest import TestCase
+from qpid.util import get_client_properties_with_defaults
+
+class UtilTest (TestCase):
+
+ def test_default_client_properties_08091(self):
+ client_properties = get_client_properties_with_defaults(version_property_key="version")
+ self.assertTrue("product" in client_properties)
+ self.assertTrue("version" in client_properties)
+ self.assertTrue("platform" in client_properties)
+
+ def test_default_client_properties_010(self):
+ client_properties = get_client_properties_with_defaults(version_property_key="qpid.client_version")
+ self.assertTrue("product" in client_properties)
+ self.assertTrue("qpid.client_version" in client_properties)
+ self.assertTrue("platform" in client_properties)
+
+ def test_client_properties_with_provided_value(self):
+ client_properties = get_client_properties_with_defaults(provided_client_properties={"mykey":"myvalue"})
+ self.assertTrue("product" in client_properties)
+ self.assertTrue("mykey" in client_properties)
+ self.assertEqual("myvalue", client_properties["mykey"])
+
+ def test_client_properties_with_provided_value_that_overrides_default(self):
+ client_properties = get_client_properties_with_defaults(provided_client_properties={"product":"myproduct"})
+ self.assertEqual("myproduct", client_properties["product"])
+
+ def test_client_properties_with_no_provided_values(self):
+ client_properties = get_client_properties_with_defaults(provided_client_properties=None)
+ self.assertTrue("product" in client_properties)
+
+ client_properties = get_client_properties_with_defaults()
+ self.assertTrue("product" in client_properties)
+
diff --git a/qpid/python/qpid/util.py b/qpid/python/qpid/util.py
new file mode 100644
index 0000000000..b17f13e6e6
--- /dev/null
+++ b/qpid/python/qpid/util.py
@@ -0,0 +1,208 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+import os, socket, time, textwrap, re, sys
+
+try:
+ from ssl import wrap_socket as ssl
+except ImportError:
+ from socket import ssl as wrap_socket
+ class ssl:
+ def __init__(self, sock, keyfile=None, certfile=None, trustfile=None):
+ # Bug (QPID-4337): this is the "old" version of python SSL.
+ # The private key is required. If a certificate is given, but no
+ # keyfile, assume the key is contained in the certificate
+ if certfile and not keyfile:
+ keyfile = certfile
+ self.sock = sock
+ self.ssl = wrap_socket(sock, keyfile=keyfile, certfile=certfile)
+
+ def recv(self, n):
+ return self.ssl.read(n)
+
+ def send(self, s):
+ return self.ssl.write(s)
+
+ def close(self):
+ self.sock.close()
+
+def get_client_properties_with_defaults(provided_client_properties={}, version_property_key="qpid.client_version"):
+ ppid = 0
+ version = "unidentified"
+ try:
+ ppid = os.getppid()
+ except:
+ pass
+
+ try:
+ import pkg_resources
+ pkg = pkg_resources.require("qpid-python")
+ if pkg and pkg[0] and pkg[0].version:
+ version = pkg[0].version
+ except:
+ pass
+
+ client_properties = {"product": "qpid python client",
+ version_property_key : version,
+ "platform": os.name,
+ "qpid.client_process": os.path.basename(sys.argv and sys.argv[0] or ''),
+ "qpid.client_pid": os.getpid(),
+ "qpid.client_ppid": ppid}
+
+ if provided_client_properties:
+ client_properties.update(provided_client_properties)
+ return client_properties
+
+def connect(host, port):
+ for res in socket.getaddrinfo(host, port, 0, socket.SOCK_STREAM):
+ af, socktype, proto, canonname, sa = res
+ sock = socket.socket(af, socktype, proto)
+ try:
+ sock.connect(sa)
+ break
+ except socket.error, msg:
+ sock.close()
+ else:
+ # If we got here then we couldn't connect (yet)
+ raise
+ return sock
+
+def listen(host, port, predicate = lambda: True, bound = lambda: None):
+ sock = socket.socket()
+ sock.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1)
+ sock.bind((host, port))
+ sock.listen(5)
+ bound()
+ while predicate():
+ s, a = sock.accept()
+ yield s
+
+def mtime(filename):
+ return os.stat(filename).st_mtime
+
+def wait(condition, predicate, timeout=None):
+ condition.acquire()
+ try:
+ passed = 0
+ start = time.time()
+ while not predicate():
+ if timeout is None:
+ # using the timed wait prevents keyboard interrupts from being
+ # blocked while waiting
+ condition.wait(3)
+ elif passed < timeout:
+ condition.wait(timeout - passed)
+ else:
+ return False
+ passed = time.time() - start
+ return True
+ finally:
+ condition.release()
+
+def notify(condition, action=lambda: None):
+ condition.acquire()
+ try:
+ action()
+ condition.notifyAll()
+ finally:
+ condition.release()
+
+def fill(text, indent, heading = None):
+ sub = indent * " "
+ if heading:
+ if not text:
+ return (indent - 2) * " " + heading
+ init = (indent - 2) * " " + heading + " -- "
+ else:
+ init = sub
+ w = textwrap.TextWrapper(initial_indent = init, subsequent_indent = sub)
+ return w.fill(" ".join(text.split()))
+
+class URL:
+
+ RE = re.compile(r"""
+ # [ <scheme>:// ] [ <user> [ / <password> ] @] ( <host4> | \[ <host6> \] ) [ :<port> ]
+ ^ (?: ([^:/@]+)://)? (?: ([^:/@]+) (?: / ([^:/@]+) )? @)? (?: ([^@:/\[]+) | \[ ([a-f0-9:.]+) \] ) (?: :([0-9]+))?$
+""", re.X | re.I)
+
+ AMQPS = "amqps"
+ AMQP = "amqp"
+
+ def __init__(self, s=None, **kwargs):
+ if s is None:
+ self.scheme = kwargs.get('scheme', None)
+ self.user = kwargs.get('user', None)
+ self.password = kwargs.get('password', None)
+ self.host = kwargs.get('host', None)
+ self.port = kwargs.get('port', None)
+ if self.host is None:
+ raise ValueError('Host required for url')
+ elif isinstance(s, URL):
+ self.scheme = s.scheme
+ self.user = s.user
+ self.password = s.password
+ self.host = s.host
+ self.port = s.port
+ else:
+ match = URL.RE.match(s)
+ if match is None:
+ raise ValueError(s)
+ self.scheme, self.user, self.password, host4, host6, port = match.groups()
+ self.host = host4 or host6
+ if port is None:
+ self.port = None
+ else:
+ self.port = int(port)
+
+ def __repr__(self):
+ return "URL(%r)" % str(self)
+
+ def __str__(self):
+ s = ""
+ if self.scheme:
+ s += "%s://" % self.scheme
+ if self.user:
+ s += self.user
+ if self.password:
+ s += "/%s" % self.password
+ s += "@"
+ if ':' not in self.host:
+ s += self.host
+ else:
+ s += "[%s]" % self.host
+ if self.port:
+ s += ":%s" % self.port
+ return s
+
+ def __eq__(self, url):
+ if isinstance(url, basestring):
+ url = URL(url)
+ return \
+ self.scheme==url.scheme and \
+ self.user==url.user and self.password==url.password and \
+ self.host==url.host and self.port==url.port
+
+ def __ne__(self, url):
+ return not self.__eq__(url)
+
+def default(value, default):
+ if value is None:
+ return default
+ else:
+ return value
diff --git a/qpid/python/qpid/validator.py b/qpid/python/qpid/validator.py
new file mode 100644
index 0000000000..d234642b3e
--- /dev/null
+++ b/qpid/python/qpid/validator.py
@@ -0,0 +1,107 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+class Context:
+
+ def __init__(self):
+ self.containers = []
+
+ def push(self, o):
+ self.containers.append(o)
+
+ def pop(self):
+ return self.containers.pop()
+
+class Values:
+
+ def __init__(self, *values):
+ self.values = values
+
+ def validate(self, o, ctx):
+ if not o in self.values:
+ return "%s not in %s" % (o, self.values)
+
+ def __str__(self):
+ return self.value
+
+class Types:
+
+ def __init__(self, *types):
+ self.types = types
+
+ def validate(self, o, ctx):
+ for t in self.types:
+ if isinstance(o, t):
+ return
+ if len(self.types) == 1:
+ return "%s is not a %s" % (o, self.types[0].__name__)
+ else:
+ return "%s is not one of: %s" % (o, ", ".join([t.__name__ for t in self.types]))
+
+class List:
+
+ def __init__(self, condition):
+ self.condition = condition
+
+ def validate(self, o, ctx):
+ if not isinstance(o, list):
+ return "%s is not a list" % o
+
+ ctx.push(o)
+ for v in o:
+ err = self.condition.validate(v, ctx)
+ if err: return err
+
+class Map:
+
+ def __init__(self, map, restricted=True):
+ self.map = map
+ self.restricted = restricted
+
+ def validate(self, o, ctx):
+ errors = []
+
+ if not hasattr(o, "get"):
+ return "%s is not a map" % o
+
+ ctx.push(o)
+ for k, t in self.map.items():
+ v = o.get(k)
+ if v is not None:
+ err = t.validate(v, ctx)
+ if err: errors.append("%s: %s" % (k, err))
+ if self.restricted:
+ for k in o:
+ if not k in self.map:
+ errors.append("%s: illegal key" % k)
+ ctx.pop()
+
+ if errors:
+ return ", ".join(errors)
+
+class And:
+
+ def __init__(self, *conditions):
+ self.conditions = conditions
+
+ def validate(self, o, ctx):
+ for c in self.conditions:
+ err = c.validate(o, ctx)
+ if err:
+ return err
diff --git a/qpid/python/setup.py b/qpid/python/setup.py
new file mode 100755
index 0000000000..9b71a98536
--- /dev/null
+++ b/qpid/python/setup.py
@@ -0,0 +1,316 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements. See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership. The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License. You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied. See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+import os, re, sys, string
+from distutils.core import setup, Command
+from distutils.command.build import build as _build
+from distutils.command.build_py import build_py as _build_py
+from distutils.command.clean import clean as _clean
+from distutils.command.install_lib import install_lib as _install_lib
+from distutils.dep_util import newer
+from distutils.dir_util import remove_tree
+from distutils.dist import Distribution
+from distutils.errors import DistutilsFileError, DistutilsOptionError
+from distutils import log
+from stat import ST_ATIME, ST_MTIME, ST_MODE, S_IMODE
+
+MAJOR, MINOR = sys.version_info[0:2]
+
+class preprocessor:
+
+ def copy_file(self, src, dst, preserve_mode=1, preserve_times=1,
+ link=None, level=1):
+ name, actor = self.actor(src, dst)
+ if actor:
+ if not os.path.isfile(src):
+ raise DistutilsFileError, \
+ "can't copy '%s': doesn't exist or not a regular file" % src
+
+ if os.path.isdir(dst):
+ dir = dst
+ dst = os.path.join(dst, os.path.basename(src))
+ else:
+ dir = os.path.dirname(dst)
+
+ if not self.force and not newer(src, dst):
+ return dst, 0
+
+ if os.path.basename(dst) == os.path.basename(src):
+ log.info("%s %s -> %s", name, src, dir)
+ else:
+ log.info("%s %s -> %s", name, src, dst)
+
+ if self.dry_run:
+ return (dst, 1)
+ else:
+ try:
+ fsrc = open(src, 'rb')
+ except os.error, (errno, errstr):
+ raise DistutilsFileError, \
+ "could not open '%s': %s" % (src, errstr)
+
+ if os.path.exists(dst):
+ try:
+ os.unlink(dst)
+ except os.error, (errno, errstr):
+ raise DistutilsFileError, \
+ "could not delete '%s': %s" % (dst, errstr)
+
+ try:
+ fdst = open(dst, 'wb')
+ except os.error, (errno, errstr):
+ raise DistutilsFileError, \
+ "could not create '%s': %s" % (dst, errstr)
+
+ try:
+ fdst.write(actor(fsrc.read()))
+ finally:
+ fsrc.close()
+ fdst.close()
+
+ if preserve_mode or preserve_times:
+ st = os.stat(src)
+
+ if preserve_times:
+ os.utime(dst, (st[ST_ATIME], st[ST_MTIME]))
+ if preserve_mode:
+ os.chmod(dst, S_IMODE(st[ST_MODE]))
+
+ return (dst, 1)
+ else:
+ return Command.copy_file(self, src, dst, preserve_mode, preserve_times,
+ link, level)
+
+doc_option = [('build-doc', None, 'build directory for documentation')]
+
+class build(_build):
+
+ user_options = _build.user_options + doc_option
+
+ def initialize_options(self):
+ _build.initialize_options(self)
+ self.build_doc = None
+
+ def finalize_options(self):
+ _build.finalize_options(self)
+ if self.build_doc is None:
+ self.build_doc = "%s/doc" % self.build_base
+
+ def get_sub_commands(self):
+ return _build.get_sub_commands(self) + ["build_doc"]
+
+class build_doc(Command):
+
+ user_options = doc_option
+
+ def initialize_options(self):
+ self.build_doc = None
+
+ def finalize_options(self):
+ self.set_undefined_options('build', ('build_doc', 'build_doc'))
+
+ def run(self):
+ try:
+ from epydoc.docbuilder import build_doc_index
+ from epydoc.docwriter.html import HTMLWriter
+ except ImportError, e:
+ log.warn('%s -- skipping build_doc', e)
+ return
+
+ names = ["qpid.messaging"]
+ doc_index = build_doc_index(names, True, True)
+ html_writer = HTMLWriter(doc_index)
+ self.mkpath(self.build_doc)
+ log.info('epydoc %s to %s' % (", ".join(names), self.build_doc))
+ html_writer.write(self.build_doc)
+
+class clean(_clean):
+
+ user_options = _clean.user_options + doc_option
+
+ def initialize_options(self):
+ _clean.initialize_options(self)
+ self.build_doc = None
+
+ def finalize_options(self):
+ _clean.finalize_options(self)
+ self.set_undefined_options('build', ('build_doc', 'build_doc'))
+
+ def run(self):
+ if self.all:
+ if os.path.exists(self.build_doc):
+ remove_tree(self.build_doc, dry_run=self.dry_run)
+ else:
+ log.debug("%s doesn't exist -- can't clean it", self.build_doc)
+ _clean.run(self)
+
+if MAJOR <= 2 and MINOR <= 3:
+ from glob import glob
+ from distutils.util import convert_path
+ class distclass(Distribution):
+
+ def __init__(self, *args, **kwargs):
+ self.package_data = None
+ Distribution.__init__(self, *args, **kwargs)
+else:
+ distclass = Distribution
+
+ann = re.compile(r"([ \t]*)@([_a-zA-Z][_a-zA-Z0-9]*)([ \t\n\r]+def[ \t]+)([_a-zA-Z][_a-zA-Z0-9]*)")
+line = re.compile(r"\n([ \t]*)[^ \t\n#]+")
+
+class build_py(preprocessor, _build_py):
+
+ if MAJOR <= 2 and MINOR <= 3:
+ def initialize_options(self):
+ _build_py.initialize_options(self)
+ self.package_data = None
+
+ def finalize_options(self):
+ _build_py.finalize_options(self)
+ self.package_data = self.distribution.package_data
+ self.data_files = self.get_data_files()
+
+ def get_data_files (self):
+ data = []
+ if not self.packages:
+ return data
+ for package in self.packages:
+ # Locate package source directory
+ src_dir = self.get_package_dir(package)
+
+ # Compute package build directory
+ build_dir = os.path.join(*([self.build_lib] + package.split('.')))
+
+ # Length of path to strip from found files
+ plen = 0
+ if src_dir:
+ plen = len(src_dir)+1
+
+ # Strip directory from globbed filenames
+ filenames = [file[plen:]
+ for file in self.find_data_files(package, src_dir)]
+ data.append((package, src_dir, build_dir, filenames))
+ return data
+
+ def find_data_files (self, package, src_dir):
+ globs = (self.package_data.get('', [])
+ + self.package_data.get(package, []))
+ files = []
+ for pattern in globs:
+ # Each pattern has to be converted to a platform-specific path
+ filelist = glob(os.path.join(src_dir, convert_path(pattern)))
+ # Files that match more than one pattern are only added once
+ files.extend([fn for fn in filelist if fn not in files])
+ return files
+
+ def build_package_data (self):
+ lastdir = None
+ for package, src_dir, build_dir, filenames in self.data_files:
+ for filename in filenames:
+ target = os.path.join(build_dir, filename)
+ self.mkpath(os.path.dirname(target))
+ self.copy_file(os.path.join(src_dir, filename), target,
+ preserve_mode=False)
+
+ def build_packages(self):
+ _build_py.build_packages(self)
+ self.build_package_data()
+
+ # end if MAJOR <= 2 and MINOR <= 3
+
+ def backport(self, input):
+ output = ""
+ pos = 0
+ while True:
+ m = ann.search(input, pos)
+ if m:
+ indent, decorator, idef, function = m.groups()
+ output += input[pos:m.start()]
+ output += "%s#@%s%s%s" % (indent, decorator, idef, function)
+ pos = m.end()
+
+ subst = "\n%s%s = %s(%s)\n" % (indent, function, decorator, function)
+ npos = pos
+ while True:
+ n = line.search(input, npos)
+ if not n:
+ input += subst
+ break
+ if len(n.group(1)) <= len(indent):
+ idx = n.start()
+ input = input[:idx] + subst + input[idx:]
+ break
+ npos = n.end()
+ else:
+ break
+
+ output += input[pos:]
+ return output
+
+ def actor(self, src, dst):
+ base, ext = os.path.splitext(src)
+ if ext == ".py" and MAJOR <= 2 and MINOR <= 3:
+ return "backporting", self.backport
+ else:
+ return None, None
+
+def pclfile(xmlfile):
+ return "%s.pcl" % os.path.splitext(xmlfile)[0]
+
+class install_lib(_install_lib):
+
+ def get_outputs(self):
+ outputs = _install_lib.get_outputs(self)
+ extra = []
+ for of in outputs:
+ if os.path.basename(of) == "amqp-0-10-qpid-errata-stripped.xml":
+ extra.append(pclfile(of))
+ return outputs + extra
+
+ def install(self):
+ outfiles = _install_lib.install(self)
+ extra = []
+ for of in outfiles:
+ if os.path.basename(of) == "amqp-0-10-qpid-errata-stripped.xml":
+ tgt = pclfile(of)
+ if self.force or newer(of, tgt):
+ log.info("caching %s to %s" % (of, os.path.basename(tgt)))
+ if not self.dry_run:
+ from qpid.ops import load_types
+ load_types(of)
+ extra.append(tgt)
+ return outfiles + extra
+
+setup(name="qpid-python",
+ version="0.31",
+ author="Apache Qpid",
+ author_email="dev@qpid.apache.org",
+ packages=["mllib", "qpid", "qpid.messaging", "qpid.tests",
+ "qpid.tests.messaging", "qpid.saslmech", "qpid.tests.saslmech"],
+ package_data={"qpid": ["specs/*.dtd", "specs/*.xml"]},
+ scripts=["qpid-python-test"],
+ url="http://qpid.apache.org/",
+ license="Apache Software License",
+ description="Python client implementation for Apache Qpid",
+ cmdclass={"build": build,
+ "build_py": build_py,
+ "build_doc": build_doc,
+ "clean": clean,
+ "install_lib": install_lib},
+ distclass=distclass)
diff --git a/qpid/python/todo.txt b/qpid/python/todo.txt
new file mode 100644
index 0000000000..8dbe9c7cc4
--- /dev/null
+++ b/qpid/python/todo.txt
@@ -0,0 +1,197 @@
+Key:
+ F = Functional
+ PF = Partially Functional
+ NR = Needs Additional Review
+ ND = Needs Additional Design
+ NF = Not Functional
+
+Connection:
+
+ variables/configuration:
+
+ - reconnect: F, NR, ND
+ + reconnect functionality is done and the API semantics provided
+ are ready for review
+ + reconnect policies need to be finished, there is currently
+ only one hardcoded reconnect policy (retry every three
+ seconds), we need to define the pre-canned policies that we
+ want to support and a means to configure them, as well as a
+ very simple plugin/callback for defining ad-hoc policies
+ + need to feed failover exchange into the reconnect policy
+ + acks can be lost on reconnect
+ + handle reconnect during commit/rollback
+
+ - timeout: NF
+ + some sort of timeout threshold for killing the connection
+
+ methods:
+
+ - open/__init__: F, ND
+ + need to support kerberos
+ + need a better way of supplying various kinds of configuration:
+ - authentication info
+ - transport specific configuration options, e.g
+ - heartbeat
+ - socket options
+ - tcp-nodelay
+ - multiple brokers
+
+ - session: F, NR
+
+ - connect: F, NR
+
+ - disconnect: F, NR
+
+ - connected: F, NR
+
+ - close: F, NR, ND
+ + currently there is no distinction between a "close" that does
+ a complete handshake with the remote broker, and a "close"
+ that reclaims resources, this means that close can fail with
+ an exception, I don't like this as it is unclear to the user
+ if there is a responsibility to do further cleanup in this
+ case
+
+ errors:
+
+ - ConnectionError: F, NR
+ + ConnectError F, NR
+ + Disconnected F, NR
+
+ - notification of disconnect?
+
+Session:
+
+ methods:
+
+ - sender: F, NR, ND
+ + need to detail address options
+ + need to define subject pattern semantics
+ + consider providing convenience for sender/receiver caching
+ + need to provide sync option, possibly change default
+
+ - receiver: F, NR, ND
+ + need to detail address options
+ + need to define filter syntax/semantics
+ + consider providing convenience for sender/receiver caching
+ + need to provide sync option, possibly change default
+
+ - acknowledge: F, NR
+
+ - reject: NF
+
+ - release: NF
+
+ - commit: F, NR
+
+ - rollback: F, NR
+
+ - next_receiver: F, NR
+
+ - close: F, ND
+ + see comment on Connection.close
+
+ errors:
+
+ - SessionError: F, NR, ND
+ + SendError: F, NR, ND
+ + ReceiveError: F, NR, ND
+ + should there be fatal/non fatal variants?
+
+Sender:
+
+ methods:
+
+ - pending: F, NR
+
+ - send: F, NR
+
+ - sync: F, NR, ND
+ + currently this blocks until pending == 0, I'm thinking of
+ renaming this to wait and adding a slightly richer interface
+ that would let you wait for something like pending < n
+
+ - close: F, NR
+
+ errors:
+
+ - SendError
+ + InsufficientCapacity
+ + need specific subhierarchy for certain conditions, e.g. no such queue
+
+Receiver:
+
+ methods:
+
+ - pending: F, NR
+
+ - listen: F, ND
+ + see comment on Session.fetch
+
+ - fetch: F, NR, ND
+ + explicit grant for receiver
+ + changing capacity/prefetch to issue credit on ack rather than
+ fetch return
+
+ - sync/wait: NF
+
+ - close: F, NR
+
+ errors:
+
+ - ReceiveError
+ + Empty
+ + need specific subhierarchy for certain conditions, e.g. no such queue
+
+Message:
+
+ - standard message properties: F, NR, ND
+
+ - map messages: F, NR
+ + needs interop testing: NF
+ + needs java impl: NF
+
+ - list messages: F, NR, NI
+ + needs interop testing: NF
+ + needs java impl: NF
+
+ - boxed types: NF
+
+Address:
+
+ - syntax: F, NR
+ + need to consider whitespace in name/subject
+ + consider unquoted string concept
+ - subject related changes, e.g. allowing patterns on both ends: NF
+ - creating/deleting queues/exchanges F, NR
+ + need to handle cleanup of temp queues/topics: F, NR
+ + passthrough options for creating exchanges/queues: F, NR
+ - integration with java: NF
+ - queue browsing: F, NR
+ - temporary queues: NF
+ - xquery: NF
+
+Testing:
+ - stress/soak testing for async: NF
+ - stress/soak testing for reconnect: NF
+ - interop testing: NF
+ - multi session and multi connection client tests: NF
+
+Documentation:
+ - api level docs largely present but need updating and elaboration
+ - tutorial: NF
+
+Examples:
+ - drain: F, NR
+ - spout: F, NR
+ - server: F, NR
+ - client: NF
+ - reservations: F, NR
+ + code: F, NR
+ + doc: NF
+ - other examples, e.g. async?
+
+Miscellaneous:
+ - standard ping-like (drain/spout) utilities for all clients: NF
+ - caching of resolved addresses: F, NR
+ - consider using separate session for query/deletion/creation of addresses