summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorKenneth Reitz <me@kennethreitz.com>2011-03-23 01:59:19 -0400
committerKenneth Reitz <me@kennethreitz.com>2011-03-23 01:59:19 -0400
commitb113f49ce6aa4dec565b5c0ee30074a9ecdaf3f4 (patch)
treefdea5cad26524d5c59ef54c41499fdcba64a40d3
parent1429b9f8c4324df31a52342e52c55d9794fe02dc (diff)
downloadtablib-b113f49ce6aa4dec565b5c0ee30074a9ecdaf3f4.tar.gz
python3 AND python2 packages.
-rw-r--r--tablib/packages/markup.py44
-rw-r--r--tablib/packages/markup3.py484
-rw-r--r--tablib/packages/xlwt/BIFFRecords.py4787
-rw-r--r--tablib/packages/xlwt/Bitmap.py520
-rw-r--r--tablib/packages/xlwt/Cell.py476
-rw-r--r--tablib/packages/xlwt/Column.py68
-rw-r--r--tablib/packages/xlwt/CompoundDoc.py1032
-rw-r--r--tablib/packages/xlwt/ExcelFormula.py84
-rw-r--r--tablib/packages/xlwt/ExcelFormulaLexer.py254
-rw-r--r--tablib/packages/xlwt/ExcelFormulaParser.py1336
-rw-r--r--tablib/packages/xlwt/ExcelMagic.py1721
-rw-r--r--tablib/packages/xlwt/Formatting.py522
-rw-r--r--tablib/packages/xlwt/Row.py506
-rw-r--r--tablib/packages/xlwt/Style.py1185
-rw-r--r--tablib/packages/xlwt/UnicodeUtils.py162
-rw-r--r--tablib/packages/xlwt/Utils.py392
-rw-r--r--tablib/packages/xlwt/Workbook.py1271
-rw-r--r--tablib/packages/xlwt/Worksheet.py2593
-rw-r--r--tablib/packages/xlwt/__init__.py25
-rw-r--r--tablib/packages/xlwt/antlr.py5743
-rw-r--r--tablib/packages/xlwt/doc/xlwt.html199
-rw-r--r--tablib/packages/xlwt/examples/big-16Mb.py35
-rw-r--r--tablib/packages/xlwt/examples/big-35Mb.py34
-rw-r--r--tablib/packages/xlwt/examples/blanks.py36
-rw-r--r--tablib/packages/xlwt/examples/col_width.py19
-rw-r--r--tablib/packages/xlwt/examples/country.py10
-rw-r--r--tablib/packages/xlwt/examples/dates.py37
-rw-r--r--tablib/packages/xlwt/examples/format.py38
-rw-r--r--tablib/packages/xlwt/examples/formula_names.py34
-rw-r--r--tablib/packages/xlwt/examples/formulas.py47
-rw-r--r--tablib/packages/xlwt/examples/hyperlinks.py28
-rw-r--r--tablib/packages/xlwt/examples/image.py12
-rw-r--r--tablib/packages/xlwt/examples/merged.py39
-rw-r--r--tablib/packages/xlwt/examples/merged0.py30
-rw-r--r--tablib/packages/xlwt/examples/merged1.py102
-rw-r--r--tablib/packages/xlwt/examples/mini.py9
-rw-r--r--tablib/packages/xlwt/examples/num_formats.py60
-rw-r--r--tablib/packages/xlwt/examples/numbers.py25
-rw-r--r--tablib/packages/xlwt/examples/outline.py113
-rw-r--r--tablib/packages/xlwt/examples/panes.py58
-rw-r--r--tablib/packages/xlwt/examples/parse-fmla.py12
-rw-r--r--tablib/packages/xlwt/examples/protection.py122
-rw-r--r--tablib/packages/xlwt/examples/python.bmpbin0 -> 37446 bytes
-rw-r--r--tablib/packages/xlwt/examples/row_styles.py17
-rw-r--r--tablib/packages/xlwt/examples/row_styles_empty.py18
-rw-r--r--tablib/packages/xlwt/examples/simple.py24
-rw-r--r--tablib/packages/xlwt/examples/sst.py52
-rw-r--r--tablib/packages/xlwt/examples/unicode0.py12
-rw-r--r--tablib/packages/xlwt/examples/unicode1.py28
-rw-r--r--tablib/packages/xlwt/examples/unicode2.py19
-rw-r--r--tablib/packages/xlwt/examples/wsprops.py155
-rw-r--r--tablib/packages/xlwt/examples/xlwt_easyxf_simple_demo.py46
-rw-r--r--tablib/packages/xlwt/excel-formula.g374
-rw-r--r--tablib/packages/yaml/__init__.py16
-rw-r--r--tablib/packages/yaml/composer.py18
-rw-r--r--tablib/packages/yaml/constructor.py198
-rw-r--r--tablib/packages/yaml/cyaml.py8
-rw-r--r--tablib/packages/yaml/dumper.py8
-rw-r--r--tablib/packages/yaml/emitter.py313
-rw-r--r--tablib/packages/yaml/error.py8
-rw-r--r--tablib/packages/yaml/loader.py12
-rw-r--r--tablib/packages/yaml/parser.py32
-rw-r--r--tablib/packages/yaml/reader.py89
-rw-r--r--tablib/packages/yaml/representer.py227
-rw-r--r--tablib/packages/yaml/resolver.py76
-rw-r--r--tablib/packages/yaml/scanner.py399
-rw-r--r--tablib/packages/yaml/serializer.py10
-rw-r--r--tablib/packages/yaml3/__init__.py288
-rw-r--r--tablib/packages/yaml3/composer.py139
-rw-r--r--tablib/packages/yaml3/constructor.py686
-rw-r--r--tablib/packages/yaml3/cyaml.py85
-rw-r--r--tablib/packages/yaml3/dumper.py62
-rw-r--r--tablib/packages/yaml3/emitter.py1132
-rw-r--r--tablib/packages/yaml3/error.py75
-rw-r--r--tablib/packages/yaml3/events.py86
-rw-r--r--tablib/packages/yaml3/loader.py40
-rw-r--r--tablib/packages/yaml3/nodes.py49
-rw-r--r--tablib/packages/yaml3/parser.py584
-rw-r--r--tablib/packages/yaml3/reader.py192
-rw-r--r--tablib/packages/yaml3/representer.py374
-rw-r--r--tablib/packages/yaml3/resolver.py224
-rw-r--r--tablib/packages/yaml3/scanner.py1448
-rw-r--r--tablib/packages/yaml3/serializer.py111
-rw-r--r--tablib/packages/yaml3/tokens.py104
84 files changed, 20179 insertions, 11963 deletions
diff --git a/tablib/packages/markup.py b/tablib/packages/markup.py
index 1973c00..234f116 100644
--- a/tablib/packages/markup.py
+++ b/tablib/packages/markup.py
@@ -68,7 +68,7 @@ class element:
"""Append the actual tags to content."""
out = "<%s" % tag
- for key, value in kwargs.items( ):
+ for key, value in kwargs.iteritems( ):
if value is not None: # when value is None that means stuff like <... checked>
key = key.strip('_') # strip this so class_ will mean class, etc.
if key == 'http_equiv': # special cases, maybe change _ to - overall?
@@ -156,17 +156,17 @@ class page:
if mode == 'strict_html' or mode == 'html':
self.onetags = valid_onetags
- self.onetags += list(map( str.lower, self.onetags ))
+ self.onetags += map( string.lower, self.onetags )
self.twotags = valid_twotags
- self.twotags += list(map( str.lower, self.twotags ))
+ self.twotags += map( string.lower, self.twotags )
self.deptags = deprecated_onetags + deprecated_twotags
- self.deptags += list(map( str.lower, self.deptags ))
+ self.deptags += map( string.lower, self.deptags )
self.mode = 'strict_html'
elif mode == 'loose_html':
self.onetags = valid_onetags + deprecated_onetags
- self.onetags += list(map( str.lower, self.onetags ))
+ self.onetags += map( string.lower, self.onetags )
self.twotags = valid_twotags + deprecated_twotags
- self.twotags += list(map( str.lower, self.twotags ))
+ self.twotags += map( string.lower, self.twotags )
self.mode = mode
elif mode == 'xml':
if onetags and twotags:
@@ -183,7 +183,7 @@ class page:
def __getattr__( self, attr ):
if attr.startswith("__") and attr.endswith("__"):
- raise AttributeError(attr)
+ raise AttributeError, attr
return element( attr, case=self.case, parent=self )
def __str__( self ):
@@ -307,7 +307,7 @@ class page:
"""This convenience function is only useful for html.
It adds css stylesheet(s) to the document via the <link> element."""
- if isinstance( filelist, str ):
+ if isinstance( filelist, basestring ):
self.link( href=filelist, rel='stylesheet', type='text/css', media='all' )
else:
for file in filelist:
@@ -319,20 +319,20 @@ class page:
a dictionary of the form { 'name':'content' }."""
if isinstance( mydict, dict ):
- for name, content in mydict.items( ):
+ for name, content in mydict.iteritems( ):
self.meta( name=name, content=content )
else:
- raise TypeError("Metainfo should be called with a dictionary argument of name:content pairs.")
+ raise TypeError, "Metainfo should be called with a dictionary argument of name:content pairs."
def scripts( self, mydict ):
"""Only useful in html, mydict is dictionary of src:type pairs will
be rendered as <script type='text/type' src=src></script>"""
if isinstance( mydict, dict ):
- for src, type in mydict.items( ):
+ for src, type in mydict.iteritems( ):
self.script( '', src=src, type='text/%s' % type )
else:
- raise TypeError("Script should be given a dictionary of src:type pairs.")
+ raise TypeError, "Script should be given a dictionary of src:type pairs."
class _oneliner:
@@ -345,7 +345,7 @@ class _oneliner:
def __getattr__( self, attr ):
if attr.startswith("__") and attr.endswith("__"):
- raise AttributeError(attr)
+ raise AttributeError, attr
return element( attr, case=self.case, parent=None )
oneliner = _oneliner( case='lower' )
@@ -359,14 +359,14 @@ def _argsdicts( args, mydict ):
elif len( args ) == 1:
args = _totuple( args[0] )
else:
- raise Exception("We should have never gotten here.")
+ raise Exception, "We should have never gotten here."
- mykeys = list(mydict.keys( ))
- myvalues = list(map( _totuple, list(mydict.values( )) ))
+ mykeys = mydict.keys( )
+ myvalues = map( _totuple, mydict.values( ) )
- maxlength = max( list(map( len, [ args ] + myvalues )) )
+ maxlength = max( map( len, [ args ] + myvalues ) )
- for i in range( maxlength ):
+ for i in xrange( maxlength ):
thisdict = { }
for key, value in zip( mykeys, myvalues ):
try:
@@ -383,7 +383,7 @@ def _argsdicts( args, mydict ):
def _totuple( x ):
"""Utility stuff to convert string, int, float, None or anything to a usable tuple."""
- if isinstance( x, str ):
+ if isinstance( x, basestring ):
out = x,
elif isinstance( x, ( int, float ) ):
out = str( x ),
@@ -397,7 +397,7 @@ def _totuple( x ):
def escape( text, newline=False ):
"""Escape special html characters."""
- if isinstance( text, str ):
+ if isinstance( text, basestring ):
if '&' in text:
text = text.replace( '&', '&amp;' )
if '>' in text:
@@ -419,7 +419,7 @@ _escape = escape
def unescape( text ):
"""Inverse of escape."""
- if isinstance( text, str ):
+ if isinstance( text, basestring ):
if '&amp;' in text:
text = text.replace( '&amp;', '&' )
if '&gt;' in text:
@@ -481,4 +481,4 @@ class CustomizationError( MarkupError ):
self.message = "If you customize the allowed elements, you must define both types 'onetags' and 'twotags'."
if __name__ == '__main__':
- print(__doc__)
+ print __doc__
diff --git a/tablib/packages/markup3.py b/tablib/packages/markup3.py
new file mode 100644
index 0000000..1973c00
--- /dev/null
+++ b/tablib/packages/markup3.py
@@ -0,0 +1,484 @@
+# This code is in the public domain, it comes
+# with absolutely no warranty and you can do
+# absolutely whatever you want with it.
+
+__date__ = '17 May 2007'
+__version__ = '1.7'
+__doc__= """
+This is markup.py - a Python module that attempts to
+make it easier to generate HTML/XML from a Python program
+in an intuitive, lightweight, customizable and pythonic way.
+
+The code is in the public domain.
+
+Version: %s as of %s.
+
+Documentation and further info is at http://markup.sourceforge.net/
+
+Please send bug reports, feature requests, enhancement
+ideas or questions to nogradi at gmail dot com.
+
+Installation: drop markup.py somewhere into your Python path.
+""" % ( __version__, __date__ )
+
+import string
+
+class element:
+ """This class handles the addition of a new element."""
+
+ def __init__( self, tag, case='lower', parent=None ):
+ self.parent = parent
+
+ if case == 'lower':
+ self.tag = tag.lower( )
+ else:
+ self.tag = tag.upper( )
+
+ def __call__( self, *args, **kwargs ):
+ if len( args ) > 1:
+ raise ArgumentError( self.tag )
+
+ # if class_ was defined in parent it should be added to every element
+ if self.parent is not None and self.parent.class_ is not None:
+ if 'class_' not in kwargs:
+ kwargs['class_'] = self.parent.class_
+
+ if self.parent is None and len( args ) == 1:
+ x = [ self.render( self.tag, False, myarg, mydict ) for myarg, mydict in _argsdicts( args, kwargs ) ]
+ return '\n'.join( x )
+ elif self.parent is None and len( args ) == 0:
+ x = [ self.render( self.tag, True, myarg, mydict ) for myarg, mydict in _argsdicts( args, kwargs ) ]
+ return '\n'.join( x )
+
+ if self.tag in self.parent.twotags:
+ for myarg, mydict in _argsdicts( args, kwargs ):
+ self.render( self.tag, False, myarg, mydict )
+ elif self.tag in self.parent.onetags:
+ if len( args ) == 0:
+ for myarg, mydict in _argsdicts( args, kwargs ):
+ self.render( self.tag, True, myarg, mydict ) # here myarg is always None, because len( args ) = 0
+ else:
+ raise ClosingError( self.tag )
+ elif self.parent.mode == 'strict_html' and self.tag in self.parent.deptags:
+ raise DeprecationError( self.tag )
+ else:
+ raise InvalidElementError( self.tag, self.parent.mode )
+
+ def render( self, tag, single, between, kwargs ):
+ """Append the actual tags to content."""
+
+ out = "<%s" % tag
+ for key, value in kwargs.items( ):
+ if value is not None: # when value is None that means stuff like <... checked>
+ key = key.strip('_') # strip this so class_ will mean class, etc.
+ if key == 'http_equiv': # special cases, maybe change _ to - overall?
+ key = 'http-equiv'
+ elif key == 'accept_charset':
+ key = 'accept-charset'
+ out = "%s %s=\"%s\"" % ( out, key, escape( value ) )
+ else:
+ out = "%s %s" % ( out, key )
+ if between is not None:
+ out = "%s>%s</%s>" % ( out, between, tag )
+ else:
+ if single:
+ out = "%s />" % out
+ else:
+ out = "%s>" % out
+ if self.parent is not None:
+ self.parent.content.append( out )
+ else:
+ return out
+
+ def close( self ):
+ """Append a closing tag unless element has only opening tag."""
+
+ if self.tag in self.parent.twotags:
+ self.parent.content.append( "</%s>" % self.tag )
+ elif self.tag in self.parent.onetags:
+ raise ClosingError( self.tag )
+ elif self.parent.mode == 'strict_html' and self.tag in self.parent.deptags:
+ raise DeprecationError( self.tag )
+
+ def open( self, **kwargs ):
+ """Append an opening tag."""
+
+ if self.tag in self.parent.twotags or self.tag in self.parent.onetags:
+ self.render( self.tag, False, None, kwargs )
+ elif self.mode == 'strict_html' and self.tag in self.parent.deptags:
+ raise DeprecationError( self.tag )
+
+class page:
+ """This is our main class representing a document. Elements are added
+ as attributes of an instance of this class."""
+
+ def __init__( self, mode='strict_html', case='lower', onetags=None, twotags=None, separator='\n', class_=None ):
+ """Stuff that effects the whole document.
+
+ mode -- 'strict_html' for HTML 4.01 (default)
+ 'html' alias for 'strict_html'
+ 'loose_html' to allow some deprecated elements
+ 'xml' to allow arbitrary elements
+
+ case -- 'lower' element names will be printed in lower case (default)
+ 'upper' they will be printed in upper case
+
+ onetags -- list or tuple of valid elements with opening tags only
+ twotags -- list or tuple of valid elements with both opening and closing tags
+ these two keyword arguments may be used to select
+ the set of valid elements in 'xml' mode
+ invalid elements will raise appropriate exceptions
+
+ separator -- string to place between added elements, defaults to newline
+
+ class_ -- a class that will be added to every element if defined"""
+
+ valid_onetags = [ "AREA", "BASE", "BR", "COL", "FRAME", "HR", "IMG", "INPUT", "LINK", "META", "PARAM" ]
+ valid_twotags = [ "A", "ABBR", "ACRONYM", "ADDRESS", "B", "BDO", "BIG", "BLOCKQUOTE", "BODY", "BUTTON",
+ "CAPTION", "CITE", "CODE", "COLGROUP", "DD", "DEL", "DFN", "DIV", "DL", "DT", "EM", "FIELDSET",
+ "FORM", "FRAMESET", "H1", "H2", "H3", "H4", "H5", "H6", "HEAD", "HTML", "I", "IFRAME", "INS",
+ "KBD", "LABEL", "LEGEND", "LI", "MAP", "NOFRAMES", "NOSCRIPT", "OBJECT", "OL", "OPTGROUP",
+ "OPTION", "P", "PRE", "Q", "SAMP", "SCRIPT", "SELECT", "SMALL", "SPAN", "STRONG", "STYLE",
+ "SUB", "SUP", "TABLE", "TBODY", "TD", "TEXTAREA", "TFOOT", "TH", "THEAD", "TITLE", "TR",
+ "TT", "UL", "VAR" ]
+ deprecated_onetags = [ "BASEFONT", "ISINDEX" ]
+ deprecated_twotags = [ "APPLET", "CENTER", "DIR", "FONT", "MENU", "S", "STRIKE", "U" ]
+
+ self.header = [ ]
+ self.content = [ ]
+ self.footer = [ ]
+ self.case = case
+ self.separator = separator
+
+ # init( ) sets it to True so we know that </body></html> has to be printed at the end
+ self._full = False
+ self.class_= class_
+
+ if mode == 'strict_html' or mode == 'html':
+ self.onetags = valid_onetags
+ self.onetags += list(map( str.lower, self.onetags ))
+ self.twotags = valid_twotags
+ self.twotags += list(map( str.lower, self.twotags ))
+ self.deptags = deprecated_onetags + deprecated_twotags
+ self.deptags += list(map( str.lower, self.deptags ))
+ self.mode = 'strict_html'
+ elif mode == 'loose_html':
+ self.onetags = valid_onetags + deprecated_onetags
+ self.onetags += list(map( str.lower, self.onetags ))
+ self.twotags = valid_twotags + deprecated_twotags
+ self.twotags += list(map( str.lower, self.twotags ))
+ self.mode = mode
+ elif mode == 'xml':
+ if onetags and twotags:
+ self.onetags = onetags
+ self.twotags = twotags
+ elif ( onetags and not twotags ) or ( twotags and not onetags ):
+ raise CustomizationError( )
+ else:
+ self.onetags = russell( )
+ self.twotags = russell( )
+ self.mode = mode
+ else:
+ raise ModeError( mode )
+
+ def __getattr__( self, attr ):
+ if attr.startswith("__") and attr.endswith("__"):
+ raise AttributeError(attr)
+ return element( attr, case=self.case, parent=self )
+
+ def __str__( self ):
+
+ if self._full and ( self.mode == 'strict_html' or self.mode == 'loose_html' ):
+ end = [ '</body>', '</html>' ]
+ else:
+ end = [ ]
+
+ return self.separator.join( self.header + self.content + self.footer + end )
+
+ def __call__( self, escape=False ):
+ """Return the document as a string.
+
+ escape -- False print normally
+ True replace < and > by &lt; and &gt;
+ the default escape sequences in most browsers"""
+
+ if escape:
+ return _escape( self.__str__( ) )
+ else:
+ return self.__str__( )
+
+ def add( self, text ):
+ """This is an alias to addcontent."""
+ self.addcontent( text )
+
+ def addfooter( self, text ):
+ """Add some text to the bottom of the document"""
+ self.footer.append( text )
+
+ def addheader( self, text ):
+ """Add some text to the top of the document"""
+ self.header.append( text )
+
+ def addcontent( self, text ):
+ """Add some text to the main part of the document"""
+ self.content.append( text )
+
+
+ def init( self, lang='en', css=None, metainfo=None, title=None, header=None,
+ footer=None, charset=None, encoding=None, doctype=None, bodyattrs=None, script=None ):
+ """This method is used for complete documents with appropriate
+ doctype, encoding, title, etc information. For an HTML/XML snippet
+ omit this method.
+
+ lang -- language, usually a two character string, will appear
+ as <html lang='en'> in html mode (ignored in xml mode)
+
+ css -- Cascading Style Sheet filename as a string or a list of
+ strings for multiple css files (ignored in xml mode)
+
+ metainfo -- a dictionary in the form { 'name':'content' } to be inserted
+ into meta element(s) as <meta name='name' content='content'>
+ (ignored in xml mode)
+
+ bodyattrs --a dictionary in the form { 'key':'value', ... } which will be added
+ as attributes of the <body> element as <body key='value' ... >
+ (ignored in xml mode)
+
+ script -- dictionary containing src:type pairs, <script type='text/type' src=src></script>
+
+ title -- the title of the document as a string to be inserted into
+ a title element as <title>my title</title> (ignored in xml mode)
+
+ header -- some text to be inserted right after the <body> element
+ (ignored in xml mode)
+
+ footer -- some text to be inserted right before the </body> element
+ (ignored in xml mode)
+
+ charset -- a string defining the character set, will be inserted into a
+ <meta http-equiv='Content-Type' content='text/html; charset=myset'>
+ element (ignored in xml mode)
+
+ encoding -- a string defining the encoding, will be put into to first line of
+ the document as <?xml version='1.0' encoding='myencoding' ?> in
+ xml mode (ignored in html mode)
+
+ doctype -- the document type string, defaults to
+ <!DOCTYPE HTML PUBLIC '-//W3C//DTD HTML 4.01 Transitional//EN'>
+ in html mode (ignored in xml mode)"""
+
+ self._full = True
+
+ if self.mode == 'strict_html' or self.mode == 'loose_html':
+ if doctype is None:
+ doctype = "<!DOCTYPE HTML PUBLIC '-//W3C//DTD HTML 4.01 Transitional//EN'>"
+ self.header.append( doctype )
+ self.html( lang=lang )
+ self.head( )
+ if charset is not None:
+ self.meta( http_equiv='Content-Type', content="text/html; charset=%s" % charset )
+ if metainfo is not None:
+ self.metainfo( metainfo )
+ if css is not None:
+ self.css( css )
+ if title is not None:
+ self.title( title )
+ if script is not None:
+ self.scripts( script )
+ self.head.close()
+ if bodyattrs is not None:
+ self.body( **bodyattrs )
+ else:
+ self.body( )
+ if header is not None:
+ self.content.append( header )
+ if footer is not None:
+ self.footer.append( footer )
+
+ elif self.mode == 'xml':
+ if doctype is None:
+ if encoding is not None:
+ doctype = "<?xml version='1.0' encoding='%s' ?>" % encoding
+ else:
+ doctype = "<?xml version='1.0' ?>"
+ self.header.append( doctype )
+
+ def css( self, filelist ):
+ """This convenience function is only useful for html.
+ It adds css stylesheet(s) to the document via the <link> element."""
+
+ if isinstance( filelist, str ):
+ self.link( href=filelist, rel='stylesheet', type='text/css', media='all' )
+ else:
+ for file in filelist:
+ self.link( href=file, rel='stylesheet', type='text/css', media='all' )
+
+ def metainfo( self, mydict ):
+ """This convenience function is only useful for html.
+ It adds meta information via the <meta> element, the argument is
+ a dictionary of the form { 'name':'content' }."""
+
+ if isinstance( mydict, dict ):
+ for name, content in mydict.items( ):
+ self.meta( name=name, content=content )
+ else:
+ raise TypeError("Metainfo should be called with a dictionary argument of name:content pairs.")
+
+ def scripts( self, mydict ):
+ """Only useful in html, mydict is dictionary of src:type pairs will
+ be rendered as <script type='text/type' src=src></script>"""
+
+ if isinstance( mydict, dict ):
+ for src, type in mydict.items( ):
+ self.script( '', src=src, type='text/%s' % type )
+ else:
+ raise TypeError("Script should be given a dictionary of src:type pairs.")
+
+
+class _oneliner:
+ """An instance of oneliner returns a string corresponding to one element.
+ This class can be used to write 'oneliners' that return a string
+ immediately so there is no need to instantiate the page class."""
+
+ def __init__( self, case='lower' ):
+ self.case = case
+
+ def __getattr__( self, attr ):
+ if attr.startswith("__") and attr.endswith("__"):
+ raise AttributeError(attr)
+ return element( attr, case=self.case, parent=None )
+
+oneliner = _oneliner( case='lower' )
+upper_oneliner = _oneliner( case='upper' )
+
+def _argsdicts( args, mydict ):
+ """A utility generator that pads argument list and dictionary values, will only be called with len( args ) = 0, 1."""
+
+ if len( args ) == 0:
+ args = None,
+ elif len( args ) == 1:
+ args = _totuple( args[0] )
+ else:
+ raise Exception("We should have never gotten here.")
+
+ mykeys = list(mydict.keys( ))
+ myvalues = list(map( _totuple, list(mydict.values( )) ))
+
+ maxlength = max( list(map( len, [ args ] + myvalues )) )
+
+ for i in range( maxlength ):
+ thisdict = { }
+ for key, value in zip( mykeys, myvalues ):
+ try:
+ thisdict[ key ] = value[i]
+ except IndexError:
+ thisdict[ key ] = value[-1]
+ try:
+ thisarg = args[i]
+ except IndexError:
+ thisarg = args[-1]
+
+ yield thisarg, thisdict
+
+def _totuple( x ):
+ """Utility stuff to convert string, int, float, None or anything to a usable tuple."""
+
+ if isinstance( x, str ):
+ out = x,
+ elif isinstance( x, ( int, float ) ):
+ out = str( x ),
+ elif x is None:
+ out = None,
+ else:
+ out = tuple( x )
+
+ return out
+
+def escape( text, newline=False ):
+ """Escape special html characters."""
+
+ if isinstance( text, str ):
+ if '&' in text:
+ text = text.replace( '&', '&amp;' )
+ if '>' in text:
+ text = text.replace( '>', '&gt;' )
+ if '<' in text:
+ text = text.replace( '<', '&lt;' )
+ if '\"' in text:
+ text = text.replace( '\"', '&quot;' )
+ if '\'' in text:
+ text = text.replace( '\'', '&quot;' )
+ if newline:
+ if '\n' in text:
+ text = text.replace( '\n', '<br>' )
+
+ return text
+
+_escape = escape
+
+def unescape( text ):
+ """Inverse of escape."""
+
+ if isinstance( text, str ):
+ if '&amp;' in text:
+ text = text.replace( '&amp;', '&' )
+ if '&gt;' in text:
+ text = text.replace( '&gt;', '>' )
+ if '&lt;' in text:
+ text = text.replace( '&lt;', '<' )
+ if '&quot;' in text:
+ text = text.replace( '&quot;', '\"' )
+
+ return text
+
+class dummy:
+ """A dummy class for attaching attributes."""
+ pass
+
+doctype = dummy( )
+doctype.frameset = "<!DOCTYPE HTML PUBLIC '-//W3C//DTD HTML 4.01 Frameset//EN' 'http://www.w3.org/TR/html4/frameset.dtd'>"
+doctype.strict = "<!DOCTYPE HTML PUBLIC '-//W3C//DTD HTML 4.01//EN' 'http://www.w3.org/TR/html4/strict.dtd'>"
+doctype.loose = "<!DOCTYPE HTML PUBLIC '-//W3C//DTD HTML 4.01 Transitional//EN' 'http://www.w3.org/TR/html4/loose.dtd'>"
+
+class russell:
+ """A dummy class that contains anything."""
+
+ def __contains__( self, item ):
+ return True
+
+
+class MarkupError( Exception ):
+ """All our exceptions subclass this."""
+ def __str__( self ):
+ return self.message
+
+class ClosingError( MarkupError ):
+ def __init__( self, tag ):
+ self.message = "The element '%s' does not accept non-keyword arguments (has no closing tag)." % tag
+
+class OpeningError( MarkupError ):
+ def __init__( self, tag ):
+ self.message = "The element '%s' can not be opened." % tag
+
+class ArgumentError( MarkupError ):
+ def __init__( self, tag ):
+ self.message = "The element '%s' was called with more than one non-keyword argument." % tag
+
+class InvalidElementError( MarkupError ):
+ def __init__( self, tag, mode ):
+ self.message = "The element '%s' is not valid for your mode '%s'." % ( tag, mode )
+
+class DeprecationError( MarkupError ):
+ def __init__( self, tag ):
+ self.message = "The element '%s' is deprecated, instantiate markup.page with mode='loose_html' to allow it." % tag
+
+class ModeError( MarkupError ):
+ def __init__( self, mode ):
+ self.message = "Mode '%s' is invalid, possible values: strict_html, loose_html, xml." % mode
+
+class CustomizationError( MarkupError ):
+ def __init__( self ):
+ self.message = "If you customize the allowed elements, you must define both types 'onetags' and 'twotags'."
+
+if __name__ == '__main__':
+ print(__doc__)
diff --git a/tablib/packages/xlwt/BIFFRecords.py b/tablib/packages/xlwt/BIFFRecords.py
index e2120fd..4660c03 100644
--- a/tablib/packages/xlwt/BIFFRecords.py
+++ b/tablib/packages/xlwt/BIFFRecords.py
@@ -1,2394 +1,2393 @@
-# -*- coding: utf-8 -*-
-
-from struct import pack
-from .UnicodeUtils import upack1, upack2
-import sys
-
-class SharedStringTable(object):
- _SST_ID = 0x00FC
- _CONTINUE_ID = 0x003C
-
- def __init__(self, encoding):
- self.encoding = encoding
- self._str_indexes = {}
- self._tally = []
- self._add_calls = 0
- # Following 3 attrs are used for temporary storage in the
- # get_biff_record() method and methods called by it. The pseudo-
- # initialisation here is for documentation purposes only.
- self._sst_record = None
- self._continues = None
- self._current_piece = None
-
- def add_str(self, s):
- if self.encoding != 'ascii' and not isinstance(s, str):
- s = str(s, self.encoding)
- self._add_calls += 1
- if s not in self._str_indexes:
- idx = len(self._str_indexes)
- self._str_indexes[s] = idx
- self._tally.append(1)
- else:
- idx = self._str_indexes[s]
- self._tally[idx] += 1
- return idx
-
- def del_str(self, idx):
- # This is called when we are replacing the contents of a string cell.
- assert self._tally[idx] > 0
- self._tally[idx] -= 1
- self._add_calls -= 1
-
- def str_index(self, s):
- return self._str_indexes[s]
-
- def get_biff_record(self):
- self._sst_record = b''
- self._continues = [None, None]
- self._current_piece = pack('<II', 0, 0)
- data = [(idx, s) for s, idx in self._str_indexes.items()]
- data.sort() # in index order
- for idx, s in data:
- if self._tally[idx] == 0:
- s = b''
- self._add_to_sst(s)
- del data
- self._new_piece()
- self._continues[0] = pack('<2HII', self._SST_ID, len(self._sst_record), self._add_calls, len(self._str_indexes))
- self._continues[1] = self._sst_record[8:]
- self._sst_record = None
- self._current_piece = None
- result = b''.join(self._continues)
- self._continues = None
- return result
-
-
- def _add_to_sst(self, s):
- u_str = upack2(s, self.encoding)
- # (to_py3): added b'...'
- is_unicode_str = u_str[2] == b'\x01'
- if is_unicode_str:
- atom_len = 5 # 2 byte -- len,
- # 1 byte -- options,
- # 2 byte -- 1st sym
- else:
- atom_len = 4 # 2 byte -- len,
- # 1 byte -- options,
- # 1 byte -- 1st sym
-
- self._save_atom(u_str[0:atom_len])
- self._save_splitted(u_str[atom_len:], is_unicode_str)
-
- def _new_piece(self):
- if self._sst_record == b'':
- self._sst_record = self._current_piece
- else:
- curr_piece_len = len(self._current_piece)
- self._continues.append(pack('<2H%ds'%curr_piece_len, self._CONTINUE_ID, curr_piece_len, self._current_piece))
- self._current_piece = b''
-
- def _save_atom(self, s):
- atom_len = len(s)
- free_space = 0x2020 - len(self._current_piece)
- if free_space < atom_len:
- self._new_piece()
- self._current_piece += s
-
- def _save_splitted(self, s, is_unicode_str):
- i = 0
- str_len = len(s)
- while i < str_len:
- piece_len = len(self._current_piece)
- free_space = 0x2020 - piece_len
- tail_len = str_len - i
- need_more_space = free_space < tail_len
-
- if not need_more_space:
- atom_len = tail_len
- else:
- if is_unicode_str:
- atom_len = free_space & 0xFFFE
- else:
- atom_len = free_space
-
- self._current_piece += s[i:i+atom_len]
-
- if need_more_space:
- self._new_piece()
- if is_unicode_str:
- self._current_piece += b'\x01' # (to_py3): added b'...'
- else:
- self._current_piece += b'\x00' # (to_py3): added b'...'
-
- i += atom_len
-
-
-class BiffRecord(object):
-
- _rec_data = b'' # class attribute; child classes need to set this.
-
- # Sheer waste.
- # def __init__(self):
- # self._rec_data = ''
-
- def get_rec_id(self):
- return _REC_ID
-
- def get_rec_header(self):
- return pack('<2H', self._REC_ID, len(self._rec_data))
-
- # Not over-ridden by any child classes, never called (except by "get"; see below).
- # def get_rec_data(self):
- # return self._rec_data
-
- def get(self):
- # data = self.get_rec_data()
- data = self._rec_data
-
- if len(data) > 0x2020: # limit for BIFF7/8
- chunks = []
- pos = 0
- while pos < len(data):
- chunk_pos = pos + 0x2020
- chunk = data[pos:chunk_pos]
- chunks.append(chunk)
- pos = chunk_pos
- continues = pack('<2H', self._REC_ID, len(chunks[0])) + chunks[0]
- for chunk in chunks[1:]:
- continues += pack('<2H%ds'%len(chunk), 0x003C, len(chunk), chunk)
- # 0x003C -- CONTINUE record id
- return continues
- else:
- return self.get_rec_header() + data
-
-
-class Biff8BOFRecord(BiffRecord):
- """
- Offset Size Contents
- 0 2 Version, contains 0600H for BIFF8 and BIFF8X
- 2 2 Type of the following data:
- 0005H = Workbook globals
- 0006H = Visual Basic module
- 0010H = Worksheet
- 0020H = Chart
- 0040H = Macro sheet
- 0100H = Workspace file
- 4 2 Build identifier
- 6 2 Build year
- 8 4 File history flags
- 12 4 Lowest Excel version that can read all records in this file
- """
- _REC_ID = 0x0809
- # stream types
- BOOK_GLOBAL = 0x0005
- VB_MODULE = 0x0006
- WORKSHEET = 0x0010
- CHART = 0x0020
- MACROSHEET = 0x0040
- WORKSPACE = 0x0100
-
- def __init__(self, rec_type):
- version = 0x0600
- build = 0x0DBB
- year = 0x07CC
- file_hist_flags = 0x00
- ver_can_read = 0x06
-
- self._rec_data = pack('<4H2I', version, rec_type, build, year, file_hist_flags, ver_can_read)
-
-
-class InteraceHdrRecord(BiffRecord):
- _REC_ID = 0x00E1
-
- def __init__(self):
- self._rec_data = pack('BB', 0xB0, 0x04)
-
-
-class InteraceEndRecord(BiffRecord):
- _REC_ID = 0x00E2
-
- def __init__(self):
- self._rec_data = b''
-
-
-class MMSRecord(BiffRecord):
- _REC_ID = 0x00C1
-
- def __init__(self):
- self._rec_data = pack('<H', 0x00)
-
-
-class WriteAccessRecord(BiffRecord):
- """
- This record is part of the file protection. It contains the name of the
- user that has saved the file. The user name is always stored as an
- equal-sized string. All unused characters after the name are filled
- with space characters. It is not required to write the mentioned string
- length. Every other length will be accepted too.
- """
- _REC_ID = 0x005C
-
- def __init__(self, owner):
- uowner = owner[0:0x30]
- uowner_len = len(uowner)
- self._rec_data = pack('%ds%ds' % (uowner_len, 0x70 - uowner_len),
- uowner, b' '*(0x70 - uowner_len)) # (to_py3): added b'...'
-
-
-class DSFRecord(BiffRecord):
- """
- This record specifies if the file contains an additional BIFF5/BIFF7
- workbook stream.
- Record DSF, BIFF8:
- Offset Size Contents
- 0 2 0 = Only the BIFF8 Workbook stream is present
- 1 = Additional BIFF5/BIFF7 Book stream is in the file
- A double stream file can be read by Excel 5.0 and Excel 95, and still
- contains all new features added to BIFF8 (which are left out in the
- BIFF5/BIFF7 Book stream).
- """
- _REC_ID = 0x0161
-
- def __init__(self):
- self._rec_data = pack('<H', 0x00)
-
-
-class TabIDRecord(BiffRecord):
- _REC_ID = 0x013D
-
- def __init__(self, sheetcount):
- for i in range(sheetcount):
- self._rec_data += pack('<H', i+1)
-
-
-class FnGroupCountRecord(BiffRecord):
- _REC_ID = 0x009C
-
- def __init__(self):
- self._rec_data = pack('BB', 0x0E, 0x00)
-
-
-class WindowProtectRecord(BiffRecord):
- """
- This record is part of the worksheet/workbook protection. It determines
- whether the window configuration of this document is protected. Window
- protection is not active, if this record is omitted.
- """
- _REC_ID = 0x0019
-
- def __init__(self, wndprotect):
- self._rec_data = pack('<H', wndprotect)
-
-
-class ObjectProtectRecord(BiffRecord):
- """
- This record is part of the worksheet/workbook protection.
- It determines whether the objects of the current sheet are protected.
- Object protection is not active, if this record is omitted.
- """
- _REC_ID = 0x0063
-
-
- def __init__(self, objprotect):
- self._rec_data = pack('<H', objprotect)
-
-
-class ScenProtectRecord(BiffRecord):
- """
- This record is part of the worksheet/workbook protection. It
- determines whether the scenarios of the current sheet are protected.
- Scenario protection is not active, if this record is omitted.
- """
- _REC_ID = 0x00DD
-
-
- def __init__(self, scenprotect):
- self._rec_data = pack('<H', scenprotect)
-
-
-class ProtectRecord(BiffRecord):
- """
- This record is part of the worksheet/workbook protection. It specifies
- whether a worksheet or a workbook is protected against modification.
- Protection is not active, if this record is omitted.
- """
-
- _REC_ID = 0x0012
-
- def __init__(self, protect):
- self._rec_data = pack('<H', protect)
-
-
-class PasswordRecord(BiffRecord):
- """
- This record is part of the worksheet/workbook protection. It
- stores a 16-bit hash value, calculated from the worksheet or workbook
- protection password.
- """
- _REC_ID = 0x0013
- def passwd_hash(self, plaintext):
- """
- Based on the algorithm provided by Daniel Rentz of OpenOffice.
- """
- if plaintext == b"":
- return 0
-
- passwd_hash = 0x0000
- for i, char in enumerate(plaintext):
- c = ord(char) << (i + 1)
- low_15 = c & 0x7fff
- high_15 = c & 0x7fff << 15
- high_15 = high_15 >> 15
- c = low_15 | high_15
- passwd_hash ^= c
- passwd_hash ^= len(plaintext)
- passwd_hash ^= 0xCE4B
- return passwd_hash
-
- def __init__(self, passwd = b""):
- self._rec_data = pack('<H', self.passwd_hash(passwd))
-
-
-class Prot4RevRecord(BiffRecord):
- _REC_ID = 0x01AF
-
- def __init__(self):
- self._rec_data = pack('<H', 0x00)
-
-
-class Prot4RevPassRecord(BiffRecord):
- _REC_ID = 0x01BC
-
- def __init__(self):
- self._rec_data = pack('<H', 0x00)
-
-
-class BackupRecord(BiffRecord):
- """
- This record contains a Boolean value determining whether Excel makes
- a backup of the file while saving.
- """
- _REC_ID = 0x0040
-
- def __init__(self, backup):
- self._rec_data = pack('<H', backup)
-
-class HideObjRecord(BiffRecord):
- """
- This record specifies whether and how to show objects in the workbook.
-
- Record HIDEOBJ, BIFF3-BIFF8:
- Offset Size Contents
- 0 2 Viewing mode for objects:
- 0 = Show all objects
- 1 = Show placeholders
- 2 = Do not show objects
- """
- _REC_ID = 0x008D
-
- def __init__(self):
- self._rec_data = pack('<H', 0x00)
-
-
-
-class RefreshAllRecord(BiffRecord):
- """
- """
-
- _REC_ID = 0x01B7
-
- def __init__(self):
- self._rec_data = pack('<H', 0x00)
-
-
-class BookBoolRecord(BiffRecord):
- """
- This record contains a Boolean value determining whether to save values
- linked from external workbooks (CRN records and XCT records). In BIFF3
- and BIFF4 this option is stored in the WSBOOL record.
-
- Record BOOKBOOL, BIFF5-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Save external linked values;
- 1 = Do not save external linked values
- """
-
- _REC_ID = 0x00DA
-
- def __init__(self):
- self._rec_data = pack('<H', 0x00)
-
-
-class CountryRecord(BiffRecord):
- """
- This record stores two Windows country identifiers. The first
- represents the user interface language of the Excel version that has
- saved the file, and the second represents the system regional settings
- at the time the file was saved.
-
- Record COUNTRY, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 Windows country identifier of the user interface language of Excel
- 2 2 Windows country identifier of the system regional settings
-
- The following table shows most of the used country identifiers. Most
- of these identifiers are equal to the international country calling
- codes.
-
- 1 USA
- 2 Canada
- 7 Russia
- """
-
- _REC_ID = 0x008C
-
- def __init__(self, ui_id, sys_settings_id):
- self._rec_data = pack('<2H', ui_id, sys_settings_id)
-
-
-class UseSelfsRecord(BiffRecord):
- """
- This record specifies if the formulas in the workbook can use natural
- language formulas. This type of formula can refer to cells by its
- content or the content of the column or row header cell.
-
- Record USESELFS, BIFF8:
-
- Offset Size Contents
- 0 2 0 = Do not use natural language formulas
- 1 = Use natural language formulas
-
- """
-
- _REC_ID = 0x0160
-
- def __init__(self):
- self._rec_data = pack('<H', 0x01)
-
-
-class EOFRecord(BiffRecord):
- _REC_ID = 0x000A
-
- def __init__(self):
- self._rec_data = b''
-
-
-class DateModeRecord(BiffRecord):
- """
- This record specifies the base date for displaying date values. All
- dates are stored as count of days past this base date. In BIFF2-BIFF4
- this record is part of the Calculation Settings Block.
- In BIFF5-BIFF8 it is stored in the Workbook Globals Substream.
-
- Record DATEMODE, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Base is 1899-Dec-31 (the cell = 1 represents 1900-Jan-01)
- 1 = Base is 1904-Jan-01 (the cell = 1 represents 1904-Jan-02)
- """
- _REC_ID = 0x0022
-
- def __init__(self, from1904):
- if from1904:
- self._rec_data = pack('<H', 1)
- else:
- self._rec_data = pack('<H', 0)
-
-
-class PrecisionRecord(BiffRecord):
- """
- This record stores if formulas use the real cell values for calculation
- or the values displayed on the screen. In BIFF2- BIFF4 this record
- is part of the Calculation Settings Block. In BIFF5-BIFF8 it is stored
- in the Workbook Globals Substream.
-
- Record PRECISION, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Use displayed values;
- 1 = Use real cell values
- """
- _REC_ID = 0x000E
-
- def __init__(self, use_real_values):
- if use_real_values:
- self._rec_data = pack('<H', 1)
- else:
- self._rec_data = pack('<H', 0)
-
-
-class CodepageBiff8Record(BiffRecord):
- """
- This record stores the text encoding used to write byte strings, stored
- as MS Windows code page identifier. The CODEPAGE record in BIFF8 always
- contains the code page 1200 (UTF-16). Therefore it is not
- possible to obtain the encoding used for a protection password (it is
- not UTF-16).
-
- Record CODEPAGE, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 Code page identifier used for byte string text encoding:
- 016FH = 367 = ASCII
- 01B5H = 437 = IBM PC CP-437 (US)
- 02D0H = 720 = IBM PC CP-720 (OEM Arabic)
- 02E1H = 737 = IBM PC CP-737 (Greek)
- 0307H = 775 = IBM PC CP-775 (Baltic)
- 0352H = 850 = IBM PC CP-850 (Latin I)
- 0354H = 852 = IBM PC CP-852 (Latin II (Central European))
- 0357H = 855 = IBM PC CP-855 (Cyrillic)
- 0359H = 857 = IBM PC CP-857 (Turkish)
- 035AH = 858 = IBM PC CP-858 (Multilingual Latin I with Euro)
- 035CH = 860 = IBM PC CP-860 (Portuguese)
- 035DH = 861 = IBM PC CP-861 (Icelandic)
- 035EH = 862 = IBM PC CP-862 (Hebrew)
- 035FH = 863 = IBM PC CP-863 (Canadian (French))
- 0360H = 864 = IBM PC CP-864 (Arabic)
- 0361H = 865 = IBM PC CP-865 (Nordic)
- 0362H = 866 = IBM PC CP-866 (Cyrillic (Russian))
- 0365H = 869 = IBM PC CP-869 (Greek (Modern))
- 036AH = 874 = Windows CP-874 (Thai)
- 03A4H = 932 = Windows CP-932 (Japanese Shift-JIS)
- 03A8H = 936 = Windows CP-936 (Chinese Simplified GBK)
- 03B5H = 949 = Windows CP-949 (Korean (Wansung))
- 03B6H = 950 = Windows CP-950 (Chinese Traditional BIG5)
- 04B0H = 1200 = UTF-16 (BIFF8)
- 04E2H = 1250 = Windows CP-1250 (Latin II) (Central European)
- 04E3H = 1251 = Windows CP-1251 (Cyrillic)
- 04E4H = 1252 = Windows CP-1252 (Latin I) (BIFF4-BIFF7)
- 04E5H = 1253 = Windows CP-1253 (Greek)
- 04E6H = 1254 = Windows CP-1254 (Turkish)
- 04E7H = 1255 = Windows CP-1255 (Hebrew)
- 04E8H = 1256 = Windows CP-1256 (Arabic)
- 04E9H = 1257 = Windows CP-1257 (Baltic)
- 04EAH = 1258 = Windows CP-1258 (Vietnamese)
- 0551H = 1361 = Windows CP-1361 (Korean (Johab))
- 2710H = 10000 = Apple Roman
- 8000H = 32768 = Apple Roman
- 8001H = 32769 = Windows CP-1252 (Latin I) (BIFF2-BIFF3)
- """
- _REC_ID = 0x0042
- UTF_16 = 0x04B0
-
- def __init__(self):
- self._rec_data = pack('<H', self.UTF_16)
-
-class Window1Record(BiffRecord):
- """
- Offset Size Contents
- 0 2 Horizontal position of the document window (in twips = 1/20 of a point)
- 2 2 Vertical position of the document window (in twips = 1/20 of a point)
- 4 2 Width of the document window (in twips = 1/20 of a point)
- 6 2 Height of the document window (in twips = 1/20 of a point)
- 8 2 Option flags:
- Bits Mask Contents
- 0 0001H 0 = Window is visible 1 = Window is hidden
- 1 0002H 0 = Window is open 1 = Window is minimised
- 3 0008H 0 = Horizontal scroll bar hidden 1 = Horizontal scroll bar visible
- 4 0010H 0 = Vertical scroll bar hidden 1 = Vertical scroll bar visible
- 5 0020H 0 = Worksheet tab bar hidden 1 = Worksheet tab bar visible
- 10 2 Index to active (displayed) worksheet
- 12 2 Index of first visible tab in the worksheet tab bar
- 14 2 Number of selected worksheets (highlighted in the worksheet tab bar)
- 16 2 Width of worksheet tab bar (in 1/1000 of window width). The remaining space is used by the
- horizontal scrollbar.
- """
- _REC_ID = 0x003D
- # flags
-
- def __init__(self,
- hpos_twips, vpos_twips,
- width_twips, height_twips,
- flags,
- active_sheet,
- first_tab_index, selected_tabs, tab_width):
- self._rec_data = pack('<9H', hpos_twips, vpos_twips,
- width_twips, height_twips,
- flags,
- active_sheet,
- first_tab_index, selected_tabs, tab_width)
-
-class FontRecord(BiffRecord):
- """
- WARNING
- The font with index 4 is omitted in all BIFF versions.
- This means the first four fonts have zero-based indexes, and
- the fifth font and all following fonts are referenced with one-based
- indexes.
-
- Offset Size Contents
- 0 2 Height of the font (in twips = 1/20 of a point)
- 2 2 Option flags:
- Bit Mask Contents
- 0 0001H 1 = Characters are bold (redundant, see below)
- 1 0002H 1 = Characters are italic
- 2 0004H 1 = Characters are underlined (redundant, see below)
- 3 0008H 1 = Characters are struck out
- 0010H 1 = Outline
- 0020H 1 = Shadow
- 4 2 Colour index
- 6 2 Font weight (100-1000).
- Standard values are 0190H (400) for normal text and 02BCH
- (700) for bold text.
- 8 2 Escapement type:
- 0000H = None
- 0001H = Superscript
- 0002H = Subscript
- 10 1 Underline type:
- 00H = None
- 01H = Single
- 21H = Single accounting
- 02H = Double
- 22H = Double accounting
- 11 1 Font family:
- 00H = None (unknown or don't care)
- 01H = Roman (variable width, serifed)
- 02H = Swiss (variable width, sans-serifed)
- 03H = Modern (fixed width, serifed or sans-serifed)
- 04H = Script (cursive)
- 05H = Decorative (specialised, i.e. Old English, Fraktur)
- 12 1 Character set:
- 00H = 0 = ANSI Latin
- 01H = 1 = System default
- 02H = 2 = Symbol
- 4DH = 77 = Apple Roman
- 80H = 128 = ANSI Japanese Shift-JIS
- 81H = 129 = ANSI Korean (Hangul)
- 82H = 130 = ANSI Korean (Johab)
- 86H = 134 = ANSI Chinese Simplified GBK
- 88H = 136 = ANSI Chinese Traditional BIG5
- A1H = 161 = ANSI Greek
- A2H = 162 = ANSI Turkish
- A3H = 163 = ANSI Vietnamese
- B1H = 177 = ANSI Hebrew
- B2H = 178 = ANSI Arabic
- BAH = 186 = ANSI Baltic
- CCH = 204 = ANSI Cyrillic
- DEH = 222 = ANSI Thai
- EEH = 238 = ANSI Latin II (Central European)
- FFH = 255 = OEM Latin I
- 13 1 Not used
- 14 var. Font name:
- BIFF5/BIFF7: Byte string, 8-bit string length
- BIFF8: Unicode string, 8-bit string length
- The boldness and underline flags are still set in the options field,
- but not used on reading the font. Font weight and underline type
- are specified in separate fields instead.
- """
- _REC_ID = 0x0031
-
- def __init__(self,
- height, options, colour_index, weight, escapement,
- underline, family, charset,
- name):
- uname = upack1(name)
- uname_len = len(uname)
-
- self._rec_data = pack('<5H4B%ds' % uname_len, height, options, colour_index, weight, escapement,
- underline, family, charset, 0x00,
- uname)
-
-class NumberFormatRecord(BiffRecord):
- """
- Record FORMAT, BIFF8:
- Offset Size Contents
- 0 2 Format index used in other records
- 2 var. Number format string (Unicode string, 16-bit string length)
-
- From BIFF5 on, the built-in number formats will be omitted. The built-in
- formats are dependent on the current regional settings of the operating
- system. The following table shows which number formats are used by default
- in a US-English environment. All indexes from 0 to 163 are reserved for
- built-in formats. The first user-defined format starts at 164.
-
- The built-in number formats, BIFF5-BIFF8
-
- Index Type Format string
- 0 General General
- 1 Decimal 0
- 2 Decimal 0.00
- 3 Decimal #,##0
- 4 Decimal #,##0.00
- 5 Currency "$"#,##0_);("$"#,##
- 6 Currency "$"#,##0_);[Red]("$"#,##
- 7 Currency "$"#,##0.00_);("$"#,##
- 8 Currency "$"#,##0.00_);[Red]("$"#,##
- 9 Percent 0%
- 10 Percent 0.00%
- 11 Scientific 0.00E+00
- 12 Fraction # ?/?
- 13 Fraction # ??/??
- 14 Date M/D/YY
- 15 Date D-MMM-YY
- 16 Date D-MMM
- 17 Date MMM-YY
- 18 Time h:mm AM/PM
- 19 Time h:mm:ss AM/PM
- 20 Time h:mm
- 21 Time h:mm:ss
- 22 Date/Time M/D/YY h:mm
- 37 Account _(#,##0_);(#,##0)
- 38 Account _(#,##0_);[Red](#,##0)
- 39 Account _(#,##0.00_);(#,##0.00)
- 40 Account _(#,##0.00_);[Red](#,##0.00)
- 41 Currency _("$"* #,##0_);_("$"* (#,##0);_("$"* "-"_);_(@_)
- 42 Currency _(* #,##0_);_(* (#,##0);_(* "-"_);_(@_)
- 43 Currency _("$"* #,##0.00_);_("$"* (#,##0.00);_("$"* "-"??_);_(@_)
- 44 Currency _(* #,##0.00_);_(* (#,##0.00);_(* "-"??_);_(@_)
- 45 Time mm:ss
- 46 Time [h]:mm:ss
- 47 Time mm:ss.0
- 48 Scientific ##0.0E+0
- 49 Text @
- """
- _REC_ID = 0x041E
-
- def __init__(self, idx, fmtstr):
- ufmtstr = upack2(fmtstr)
- ufmtstr_len = len(ufmtstr)
-
- self._rec_data = pack('<H%ds' % ufmtstr_len, idx, ufmtstr)
-
-
-class XFRecord(BiffRecord):
- """
- XF Substructures
- -------------------------------------------------------------------------
- XF_TYPE_PROT XF Type and Cell Protection (3 Bits), BIFF3-BIFF8
- These 3 bits are part of a specific data byte.
- Bit Mask Contents
- 0 01H 1 = Cell is locked
- 1 02H 1 = Formula is hidden
- 2 04H 0 = Cell XF; 1 = Style XF
-
- XF_USED_ATTRIB Attributes Used from Parent Style XF (6 Bits),
- BIFF3-BIFF8 Each bit describes the validity of a specific group
- of attributes. In cell XFs a cleared bit means the attributes of the
- parent style XF are used (but only if the attributes are valid there),
- a set bit means the attributes of this XF are used. In style XFs
- a cleared bit means the attribute setting is valid, a set bit means the
- attribute should be ignored.
- Bit Mask Contents
- 0 01H Flag for number format
- 1 02H Flag for font
- 2 04H Flag for horizontal and vertical alignment, text wrap, indentation, orientation, rotation, and
- text direction
- 3 08H Flag for border lines
- 4 10H Flag for background area style
- 5 20H Flag for cell protection (cell locked and formula hidden)
-
- XF_HOR_ALIGN Horizontal Alignment (3 Bits), BIFF2-BIFF8 The horizontal
- alignment consists of 3 bits and is part of a specific data byte.
- Value Horizontal alignment
- 00H General
- 01H Left
- 02H Centred
- 03H Right
- 04H Filled
- 05H Justified (BIFF4-BIFF8X)
- 06H Centred across selection (BIFF4-BIFF8X)
- 07H Distributed (BIFF8X)
-
- XF_VERT_ALIGN Vertical Alignment (2 or 3 Bits), BIFF4-BIFF8
- The vertical alignment consists of 2 bits (BIFF4) or 3 bits (BIFF5-BIFF8)
- and is part of a specific data byte. Vertical alignment is not available
- in BIFF2 and BIFF3.
- Value Vertical alignment
- 00H Top
- 01H Centred
- 02H Bottom
- 03H Justified (BIFF5-BIFF8X)
- 04H Distributed (BIFF8X)
-
- XF_ORIENTATION Text Orientation (2 Bits), BIFF4-BIFF7 In the BIFF
- versions BIFF4-BIFF7, text can be rotated in steps of 90 degrees
- or stacked. The orientation mode consists of 2 bits and is part of
- a specific data byte. In BIFF8 a rotation angle occurs instead of these
- flags.
- Value Text orientation
- 00H Not rotated
- 01H Letters are stacked top-to-bottom, but not rotated
- 02H Text is rotated 90 degrees counterclockwise
- 03H Text is rotated 90 degrees clockwise
-
- XF_ROTATION Text Rotation Angle (1 Byte), BIFF8
- Value Text rotation
- 0 Not rotated
- 1-90 1 to 90 degrees counterclockwise
- 91-180 1 to 90 degrees clockwise
- 255 Letters are stacked top-to-bottom, but not rotated
-
- XF_BORDER_34 Cell Border Style (4 Bytes), BIFF3-BIFF4 Cell borders
- contain a line style and a line colour for each line of the border.
- Bit Mask Contents
- 2-0 00000007H Top line style
- 7-3 000000F8H Colour index for top line colour
- 10-8 00000700H Left line style
- 15-11 0000F800H Colour index for left line colour
- 18-16 00070000H Bottom line style
- 23-19 00F80000H Colour index for bottom line colour
- 26-24 07000000H Right line style
- 31-27 F8000000H Colour index for right line colour
-
- XF_AREA_34 Cell Background Area Style (2 Bytes), BIFF3-BIFF4 A cell
- background area style contains an area pattern and a foreground and
- background colour.
- Bit Mask Contents
- 5-0 003FH Fill pattern
- 10-6 07C0H Colour index for pattern colour
- 15-11 F800H Colour index for pattern background
- ---------------------------------------------------------------------------------------------
- Record XF, BIFF8:
- Offset Size Contents
- 0 2 Index to FONT record
- 2 2 Index to FORMAT record
- 4 2 Bit Mask Contents
- 2-0 0007H XF_TYPE_PROT . XF type, cell protection (see above)
- 15-4 FFF0H Index to parent style XF (always FFFH in style XFs)
- 6 1 Bit Mask Contents
- 2-0 07H XF_HOR_ALIGN . Horizontal alignment (see above)
- 3 08H 1 = Text is wrapped at right border
- 6-4 70H XF_VERT_ALIGN . Vertical alignment (see above)
- 7 1 XF_ROTATION: Text rotation angle (see above)
- 8 1 Bit Mask Contents
- 3-0 0FH Indent level
- 4 10H 1 = Shrink content to fit into cell
- 5 merge
- 7-6 C0H Text direction (BIFF8X only)
- 00b = According to context
- 01b = Left-to-right
- 10b = Right-to-left
- 9 1 Bit Mask Contents
- 7-2 FCH XF_USED_ATTRIB . Used attributes (see above)
- 10 4 Cell border lines and background area:
- Bit Mask Contents
- 3-0 0000000FH Left line style
- 7-4 000000F0H Right line style
- 11-8 00000F00H Top line style
- 15-12 0000F000H Bottom line style
- 22-16 007F0000H Colour index for left line colour
- 29-23 3F800000H Colour index for right line colour
- 30 40000000H 1 = Diagonal line from top left to right bottom
- 31 80000000H 1 = Diagonal line from bottom left to right top
- 14 4 Bit Mask Contents
- 6-0 0000007FH Colour index for top line colour
- 13-7 00003F80H Colour index for bottom line colour
- 20-14 001FC000H Colour index for diagonal line colour
- 24-21 01E00000H Diagonal line style
- 31-26 FC000000H Fill pattern
- 18 2 Bit Mask Contents
- 6-0 007FH Colour index for pattern colour
- 13-7 3F80H Colour index for pattern background
-
- """
- _REC_ID = 0x00E0
-
- def __init__(self, xf, xftype='cell'):
- font_xf_idx, fmt_str_xf_idx, alignment, borders, pattern, protection = xf
- fnt = pack('<H', font_xf_idx)
- fmt = pack('<H', fmt_str_xf_idx)
- if xftype == 'cell':
- prt = pack('<H',
- ((protection.cell_locked & 0x01) << 0) |
- ((protection.formula_hidden & 0x01) << 1)
- )
- else:
- prt = pack('<H', 0xFFF5)
- aln = pack('B',
- ((alignment.horz & 0x07) << 0) |
- ((alignment.wrap & 0x01) << 3) |
- ((alignment.vert & 0x07) << 4)
- )
- rot = pack('B', alignment.rota)
- txt = pack('B',
- ((alignment.inde & 0x0F) << 0) |
- ((alignment.shri & 0x01) << 4) |
- ((alignment.merg & 0x01) << 5) |
- ((alignment.dire & 0x03) << 6)
- )
- if xftype == 'cell':
- used_attr = pack('B', 0xF8)
- else:
- used_attr = pack('B', 0xF4)
-
- if borders.left == borders.NO_LINE:
- borders.left_colour = 0x00
- if borders.right == borders.NO_LINE:
- borders.right_colour = 0x00
- if borders.top == borders.NO_LINE:
- borders.top_colour = 0x00
- if borders.bottom == borders.NO_LINE:
- borders.bottom_colour = 0x00
- if borders.diag == borders.NO_LINE:
- borders.diag_colour = 0x00
- brd1 = pack('<L',
- ((borders.left & 0x0F) << 0 ) |
- ((borders.right & 0x0F) << 4 ) |
- ((borders.top & 0x0F) << 8 ) |
- ((borders.bottom & 0x0F) << 12) |
- ((borders.left_colour & 0x7F) << 16) |
- ((borders.right_colour & 0x7F) << 23) |
- ((borders.need_diag1 & 0x01) << 30) |
- ((borders.need_diag2 & 0x01) << 31)
- )
- brd2 = pack('<L',
- ((borders.top_colour & 0x7F) << 0 ) |
- ((borders.bottom_colour & 0x7F) << 7 ) |
- ((borders.diag_colour & 0x7F) << 14) |
- ((borders.diag & 0x0F) << 21) |
- ((pattern.pattern & 0x3F) << 26)
- )
- pat = pack('<H',
- ((pattern.pattern_fore_colour & 0x7F) << 0 ) |
- ((pattern.pattern_back_colour & 0x7F) << 7 )
- )
- self._rec_data = fnt + fmt + prt + \
- aln + rot + txt + used_attr + \
- brd1 + brd2 + \
- pat
-
-class StyleRecord(BiffRecord):
- """
- STYLE record for user-defined cell styles, BIFF3-BIFF8:
- Offset Size Contents
- 0 2 Bit Mask Contents
- 11-0 0FFFH Index to style XF record
- 15 8000H Always 0 for user-defined styles
- 2 var. BIFF2-BIFF7: Non-empty byte string, 8-bit string length
- BIFF8: Non-empty Unicode string, 16-bit string length
- STYLE record for built-in cell styles, BIFF3-BIFF8:
- Offset Size Contents
- 0 2 Bit Mask Contents
- 11-0 0FFFH Index to style XF record
- 15 8000H Always 1 for built-in styles
- 2 1 Identifier of the built-in cell style:
- 00H = Normal
- 01H = RowLevel_lv (see next field)
- 02H = ColLevel_lv (see next field)
- 03H = Comma
- 04H = Currency
- 05H = Percent
- 06H = Comma [0] (BIFF4-BIFF8)
- 07H = Currency [0] (BIFF4-BIFF8)
- 08H = Hyperlink (BIFF8)
- 09H = Followed Hyperlink (BIFF8)
- 3 1 Level for RowLevel or ColLevel style
- (zero-based, lv), FFH otherwise
- The RowLevel and ColLevel styles specify the formatting of subtotal
- cells in a specific outline level. The level is specified by the last
- field in the STYLE record. Valid values are 0-6 for the outline levels
- 1-7.
- """
- _REC_ID = 0x0293
-
- def __init__(self):
- self._rec_data = pack('<HBB', 0x8000, 0x00, 0xFF)
- # TODO: implement user-defined styles???
-
-
-class PaletteRecord(BiffRecord):
- """
- This record contains the definition of all user-defined colours
- available for cell and object formatting.
-
- Record PALETTE, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 Number of following colours (nm). Contains 16 in BIFF3-BIFF4 and 56 in BIFF5-BIFF8.
- 2 4*nm List of nm RGB colours
-
- The following table shows how colour indexes are used in other records:
-
- Colour index Resulting colour or internal list index
- 00H Built-in Black (R = 00H, G = 00H, B = 00H)
- 01H Built-in White (R = FFH, G = FFH, B = FFH)
- 02H Built-in Red (R = FFH, G = 00H, B = 00H)
- 03H Built-in Green (R = 00H, G = FFH, B = 00H)
- 04H Built-in Blue (R = 00H, G = 00H, B = FFH)
- 05H Built-in Yellow (R = FFH, G = FFH, B = 00H)
- 06H Built-in Magenta (R = FFH, G = 00H, B = FFH)
- 07H Built-in Cyan (R = 00H, G = FFH, B = FFH)
- 08H First user-defined colour from the PALETTE record (entry 0 from record colour list)
- .........................
-
- 17H (BIFF3-BIFF4) Last user-defined colour from the PALETTE record (entry 15 or 55 from record colour list)
- 3FH (BIFF5-BIFF8)
-
- 18H (BIFF3-BIFF4) System window text colour for border lines (used in records XF, CF, and
- 40H (BIFF5-BIFF8) WINDOW2 (BIFF8 only))
-
- 19H (BIFF3-BIFF4) System window background colour for pattern background (used in records XF, and CF)
- 41H (BIFF5-BIFF8)
-
- 43H System face colour (dialogue background colour)
- 4DH System window text colour for chart border lines
- 4EH System window background colour for chart areas
- 4FH Automatic colour for chart border lines (seems to be always Black)
- 50H System ToolTip background colour (used in note objects)
- 51H System ToolTip text colour (used in note objects)
- 7FFFH System window text colour for fonts (used in records FONT, EFONT, and CF)
-
- """
- _REC_ID = 0x0092
-
-
-class BoundSheetRecord(BiffRecord):
- """
- This record is located in the workbook globals area and represents
- a sheet inside of the workbook. For each sheet a BOUNDSHEET record
- is written. It stores the sheet name and a stream offset to the BOF
- record within the workbook stream. The record is also known
- as BUNDLESHEET.
-
- Record BOUNDSHEET, BIFF5-BIFF8:
- Offset Size Contents
- 0 4 Absolute stream position of the BOF record of the sheet represented by this record. This
- field is never encrypted in protected files.
- 4 1 Visibility:
- 00H = Visible
- 01H = Hidden
- 02H = Strong hidden
- 5 1 Sheet type:
- 00H = Worksheet
- 02H = Chart
- 06H = Visual Basic module
- 6 var. Sheet name:
- BIFF5/BIFF7: Byte string, 8-bit string length
- BIFF8: Unicode string, 8-bit string length
- """
- _REC_ID = 0x0085
-
- def __init__(self, stream_pos, visibility, sheetname, encoding='ascii'):
- usheetname = upack1(sheetname, encoding)
- uusheetname_len = len(usheetname)
-
- self._rec_data = pack('<LBB%ds' % uusheetname_len, stream_pos, visibility, 0x00, usheetname)
-
-
-class ContinueRecord(BiffRecord):
- """
- Whenever the content of a record exceeds the given limits (see table),
- the record must be split. Several CONTINUE records containing the
- additional data are added after the parent record.
-
- BIFF version Maximum data size of a record
- BIFF2-BIFF7 2080 bytes (2084 bytes including record header)
- BIFF8 8224 bytes (8228 bytes including record header) (0x2020)
-
- Record CONTINUE, BIFF2-BIFF8:
- Offset Size Contents
- 0 var. Data continuation of the previous record
-
- Unicode strings are split in a special way. At the beginning of each
- CONTINUE record the option flags byte is repeated. Only the character
- size flag will be set in this flags byte, the Rich-Text flag and the
- Far-East flag are set to zero. In each CONTINUE record it is possible
- that the character size changes from 8-bit characters to 16-bit
- characters and vice versa.
-
- Never a Unicode string is split until and including the first
- character. That means, all header fields (string length, option flags,
- optional Rich-Text size, and optional Far-East data size) and the first
- character of the string have to occur together in the leading record,
- or have to be moved completely into the CONTINUE record. Formatting
- runs cannot be split between their components (character index and FONT
- record index). If a string is split between two formatting runs, the
- option flags field will not be repeated in the CONTINUE record.
- """
- _REC_ID = 0x003C
-
-
-class SSTRecord(BiffRecord):
- """
- This record contains a list of all strings used anywhere in the
- workbook. Each string occurs only once. The workbook uses indexes into
- the list to reference the strings.
-
- Record SST, BIFF8:
- Offset Size Contents
- 0 4 Total number of strings in the workbook (see below)
- 4 4 Number of following strings (nm)
- 8 var. List of nm Unicode strings, 16-bit string length
-
- The first field of the SST record counts the total occurrence
- of strings in the workbook. For instance, the string AAA is used
- 3 times and the string BBB is used 2 times. The first field contains
- 5 and the second field contains 2, followed by the two strings.
- """
- _REC_ID = 0x00FC
-
-
-class ExtSSTRecord(BiffRecord):
- """
- This record occurs in conjunction with the SST record. It is used
- by Excel to create a hash table with stream offsets to the SST record
- to optimise string search operations. Excel may not shorten this record
- if strings are deleted from the shared string table, so the last part
- might contain invalid data. The stream indexes in this record divide
- the SST into portions containing a constant number of strings.
-
- Record EXTSST, BIFF8:
-
- Offset Size Contents
- 0 2 Number of strings in a portion, this number is >=8
- 2 var. List of OFFSET structures for all portions. Each OFFSET contains the following data:
- Offset Size Contents
- 0 4 Absolute stream position of first string of the portion
- 4 2 Position of first string of the portion inside of current record,
- including record header. This counter restarts at zero, if the SST
- record is continued with a CONTINUE record.
- 6 2 Not used
- """
- _REC_ID = 0x00FF
-
- def __init__(self, sst_stream_pos, str_placement, portions_len):
- extsst = {}
- abs_stream_pos = sst_stream_pos
- str_counter = 0
- portion_counter = 0
- while str_counter < len(str_placement):
- str_chunk_num, pos_in_chunk = str_placement[str_counter]
- if str_chunk_num != portion_counter:
- portion_counter = str_chunk_num
- abs_stream_pos += portions_len[portion_counter-1]
- #print hex(abs_stream_pos)
- str_stream_pos = abs_stream_pos + pos_in_chunk + 4 # header
- extsst[str_counter] = (pos_in_chunk, str_stream_pos)
- str_counter += 1
-
- exsst_str_count_delta = max(8, len(str_placement)*8/0x2000) # maybe smth else?
- self._rec_data = pack('<H', exsst_str_count_delta)
- str_counter = 0
- while str_counter < len(str_placement):
- self._rec_data += pack('<IHH', extsst[str_counter][1], extsst[str_counter][0], 0)
- str_counter += exsst_str_count_delta
-
-class DimensionsRecord(BiffRecord):
- """
- Record DIMENSIONS, BIFF8:
-
- Offset Size Contents
- 0 4 Index to first used row
- 4 4 Index to last used row, increased by 1
- 8 2 Index to first used column
- 10 2 Index to last used column, increased by 1
- 12 2 Not used
- """
- _REC_ID = 0x0200
- def __init__(self, first_used_row, last_used_row, first_used_col, last_used_col):
- if first_used_row > last_used_row or first_used_col > last_used_col:
- # Special case: empty worksheet
- first_used_row = first_used_col = 0
- last_used_row = last_used_col = -1
- self._rec_data = pack('<2L3H',
- first_used_row, last_used_row + 1,
- first_used_col, last_used_col + 1,
- 0x00)
-
-
-class Window2Record(BiffRecord):
- """
- Record WINDOW2, BIFF8:
-
- Offset Size Contents
- 0 2 Option flags (see below)
- 2 2 Index to first visible row
- 4 2 Index to first visible column
- 6 2 Colour index of grid line colour. Note that in BIFF2-BIFF7 an RGB colour is
- written instead.
- 8 2 Not used
- 10 2 Cached magnification factor in page break preview (in percent); 0 = Default (60%)
- 12 2 Cached magnification factor in normal view (in percent); 0 = Default (100%)
- 14 4 Not used
-
- In BIFF8 this record stores used magnification factors for page break
- preview and normal view. These values are used to restore the
- magnification, when the view is changed. The real magnification of the
- currently active view is stored in the SCL record. The type of the
- active view is stored in the option flags field (see below).
-
- 0 0001H 0 = Show formula results 1 = Show formulas
- 1 0002H 0 = Do not show grid lines 1 = Show grid lines
- 2 0004H 0 = Do not show sheet headers 1 = Show sheet headers
- 3 0008H 0 = Panes are not frozen 1 = Panes are frozen (freeze)
- 4 0010H 0 = Show zero values as empty cells 1 = Show zero values
- 5 0020H 0 = Manual grid line colour 1 = Automatic grid line colour
- 6 0040H 0 = Columns from left to right 1 = Columns from right to left
- 7 0080H 0 = Do not show outline symbols 1 = Show outline symbols
- 8 0100H 0 = Keep splits if pane freeze is removed 1 = Remove splits if pane freeze is removed
- 9 0200H 0 = Sheet not selected 1 = Sheet selected (BIFF5-BIFF8)
- 10 0400H 0 = Sheet not visible 1 = Sheet visible (BIFF5-BIFF8)
- 11 0800H 0 = Show in normal view 1 = Show in page break preview (BIFF8)
-
- The freeze flag specifies, if a following PANE record describes unfrozen or frozen panes.
-
- *** This class appends the optional SCL record ***
-
- Record SCL, BIFF4-BIFF8:
-
- This record stores the magnification of the active view of the current worksheet.
- In BIFF8 this can be either the normal view or the page break preview.
- This is determined in the WINDOW2 record. The SCL record is part of the
- Sheet View Settings Block.
-
- Offset Size Contents
- 0 2 Numerator of the view magnification fraction (num)
- 2 2 Denumerator [denominator] of the view magnification fraction (den)
- The magnification is stored as reduced fraction. The magnification results from num/den.
-
- SJM note: Excel expresses (e.g.) 25% in reduced form i.e. 1/4. Reason unknown. This code
- writes 25/100, and Excel is happy with that.
-
- """
- _REC_ID = 0x023E
-
- def __init__(self, options, first_visible_row, first_visible_col,
- grid_colour, preview_magn, normal_magn, scl_magn):
- self._rec_data = pack('<7HL', options,
- first_visible_row, first_visible_col,
- grid_colour,
- 0x00,
- preview_magn, normal_magn,
- 0x00)
- if scl_magn:
- self._scl_rec = pack('<4H', 0x00A0, 4, scl_magn, 100)
- else:
- self._scl_rec = b''
-
- def get(self):
- return self.get_rec_header() + self._rec_data + self._scl_rec
-
-
-class PanesRecord(BiffRecord):
- """
- This record stores the position of window panes. It is part of the Sheet
- View Settings Block. If the sheet does not contain any splits, this
- record will not occur.
- A sheet can be split in two different ways, with unfrozen panes or with
- frozen panes. A flag in the WINDOW2 record specifies, if the panes are
- frozen, which affects the contents of this record.
-
- Record PANE, BIFF2-BIFF8:
- Offset Size Contents
- 0 2 Position of the vertical split
- (px, 0 = No vertical split):
- Unfrozen pane: Width of the left pane(s)
- (in twips = 1/20 of a point)
- Frozen pane: Number of visible
- columns in left pane(s)
- 2 2 Position of the horizontal split
- (py, 0 = No horizontal split):
- Unfrozen pane: Height of the top pane(s)
- (in twips = 1/20 of a point)
- Frozen pane: Number of visible
- rows in top pane(s)
- 4 2 Index to first visible row
- in bottom pane(s)
- 6 2 Index to first visible column
- in right pane(s)
- 8 1 Identifier of pane with active
- cell cursor
- [9] 1 Not used (BIFF5-BIFF8 only, not written
- in BIFF2-BIFF4)
-
- If the panes are frozen, pane 0 is always active, regardless
- of the cursor position. The correct identifiers for all possible
- combinations of visible panes are shown in the following pictures.
-
- px = 0, py = 0 px = 0, py > 0
- -------------------------- ------------|-------------
- | | | |
- | | | 3 |
- | | | |
- - 3 - --------------------------
- | | | |
- | | | 2 |
- | | | |
- -------------------------- ------------|-------------
-
- px > 0, py = 0 px > 0, py > 0
- ------------|------------- ------------|-------------
- | | | | | |
- | | | | 3 | 2 |
- | | | | | |
- - 3 | 1 - --------------------------
- | | | | | |
- | | | | 1 | 0 |
- | | | | | |
- ------------|------------- ------------|-------------
- """
- _REC_ID = 0x0041
- def __init__(self, px, py, first_row_bottom, first_col_right, active_pane):
- self._rec_data = pack('<5H', int(px), int(py), int(first_row_bottom),
- int(first_col_right), int(active_pane))
-
-
-class RowRecord(BiffRecord):
- """
- This record contains the properties of a single row in a sheet. Rows
- and cells in a sheet are divided into blocks of 32 rows.
-
- Record ROW, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 Index of this row
- 2 2 Index to column of the first cell which is described by a cell record
- 4 2 Index to column of the last cell which is described by a cell record,
- increased by 1
- 6 2 Bit Mask Contents
- 14-0 7FFFH Height of the row, in twips = 1/20 of a point
- 15 8000H 0 = Row has custom height; 1 = Row has default height
- 8 2 Not used
- 10 2 In BIFF3-BIFF4 this field contains a relative offset
- to calculate stream position of the first cell record
- for this row. In BIFF5-BIFF8 this field is not used
- anymore, but the DBCELL record instead.
- 12 4 Option flags and default row formatting:
- Bit Mask Contents
- 2-0 00000007H Outline level of the row
- 4 00000010H 1 = Outline group starts or ends here (depending
- on where the outline buttons are located,
- see WSBOOL record), and is collapsed
- 5 00000020H 1 = Row is hidden (manually, or by a filter or outline group)
- 6 00000040H 1 = Row height and default font height do not match
- 7 00000080H 1 = Row has explicit default format (fl)
- 8 00000100H Always 1
- 27-16 0FFF0000H If fl=1: Index to default XF record
- 28 10000000H 1 = Additional space above the row. This flag is set,
- if the upper border of at least one cell in this row
- or if the lower border of at least one cell in the row
- above is formatted with a thick line style.
- Thin and medium line styles are not taken into account.
- 29 20000000H 1 = Additional space below the row. This flag is set,
- if the lower border of at least one cell in this row
- or if the upper border of at least one cell in the row
- below is formatted with a medium or thick line style.
- Thin line styles are not taken into account.
- """
-
- _REC_ID = 0x0208
-
- def __init__(self, index, first_col, last_col, height_options, options):
- self._rec_data = pack('<6HL', index, first_col, last_col + 1,
- height_options,
- 0x00, 0x00,
- options)
-
-class LabelSSTRecord(BiffRecord):
- """
- This record represents a cell that contains a string. It replaces the
- LABEL record and RSTRING record used in BIFF2-BIFF7.
- """
- _REC_ID = 0x00FD
-
- def __init__(self, row, col, xf_idx, sst_idx):
- self._rec_data = pack('<3HL', row, col, xf_idx, sst_idx)
-
-
-class MergedCellsRecord(BiffRecord):
- """
- This record contains all merged cell ranges of the current sheet.
-
- Record MERGEDCELLS, BIFF8:
-
- Offset Size Contents
- 0 var. Cell range address list with all merged ranges
-
- ------------------------------------------------------------------
-
- A cell range address list consists of a field with the number of ranges
- and the list of the range addresses.
-
- Cell range address list, BIFF8:
-
- Offset Size Contents
- 0 2 Number of following cell range addresses (nm)
- 2 8*nm List of nm cell range addresses
-
- ---------------------------------------------------------------------
- Cell range address, BIFF8:
-
- Offset Size Contents
- 0 2 Index to first row
- 2 2 Index to last row
- 4 2 Index to first column
- 6 2 Index to last column
-
- """
- _REC_ID = 0x00E5
-
- def __init__(self, merged_list):
- i = len(merged_list) - 1
- while i >= 0:
- j = 0
- merged = b''
- while (i >= 0) and (j < 0x403):
- r1, r2, c1, c2 = merged_list[i]
- merged += pack('<4H', r1, r2, c1, c2)
- i -= 1
- j += 1
- self._rec_data += pack('<3H', self._REC_ID, len(merged) + 2, j) + \
- merged
-
- # for some reason Excel doesn't use CONTINUE
- def get(self):
- return self._rec_data
-
-class MulBlankRecord(BiffRecord):
- """
- This record represents a cell range of empty cells. All cells are
- located in the same row.
-
- Record MULBLANK, BIFF5-BIFF8:
-
- Offset Size Contents
- 0 2 Index to row
- 2 2 Index to first column (fc)
- 4 2*nc List of nc=lc-fc+1 16-bit indexes to XF records
- 4+2*nc 2 Index to last column (lc)
- """
- _REC_ID = 0x00BE
-
- def __init__(self, row, first_col, last_col, xf_index):
- blanks_count = last_col-first_col+1
- self._rec_data = pack('%dH' % blanks_count, *([xf_index]*blanks_count))
- self._rec_data = pack('<2H', row, first_col) + self._rec_data + pack('<H', last_col)
-
-
-class BlankRecord(BiffRecord):
- """
- This record represents an empty cell.
-
- Record BLANK, BIFF5-BIFF8:
-
- Offset Size Contents
- 0 2 Index to row
- 2 2 Index to first column (fc)
- 4 2 indexes to XF record
- """
- _REC_ID = 0x0201
-
- def __init__(self, row, col, xf_index):
- self._rec_data = pack('<3H', row, col, xf_index)
-
-
-class RKRecord(BiffRecord):
- """
- This record represents a cell that contains an RK value (encoded integer or
- floating-point value). If a floating-point value cannot be encoded to an RK value,
- a NUMBER record will be written.
- """
- _REC_ID = 0x027E
-
- def __init__(self, row, col, xf_index, rk_encoded):
- self._rec_data = pack('<3Hi', row, col, xf_index, rk_encoded)
-
-
-class NumberRecord(BiffRecord):
- """
- This record represents a cell that contains an IEEE-754 floating-point value.
- """
- _REC_ID = 0x0203
-
- def __init__(self, row, col, xf_index, number):
- self._rec_data = pack('<3Hd', row, col, xf_index, number)
-
-class BoolErrRecord(BiffRecord):
- """
- This record represents a cell that contains a boolean or error value.
- """
- _REC_ID = 0x0205
-
- def __init__(self, row, col, xf_index, number, is_error):
- self._rec_data = pack('<3HBB', row, col, xf_index, number, is_error)
-
-
-class FormulaRecord(BiffRecord):
- """
- Offset Size Contents
- 0 2 Index to row
- 2 2 Index to column
- 4 2 Index to XF record
- 6 8 Result of the formula
- 14 2 Option flags:
- Bit Mask Contents
- 0 0001H 1 = Recalculate always
- 1 0002H 1 = Calculate on open
- 3 0008H 1 = Part of a shared formula
- 16 4 Not used
- 20 var. Formula data (RPN token array)
-
- """
- _REC_ID = 0x0006
-
- def __init__(self, row, col, xf_index, rpn, calc_flags=0):
- self._rec_data = pack('<3HQHL', row, col, xf_index, 0xFFFF000000000003, calc_flags & 3, 0) + rpn
-
-
-class GutsRecord(BiffRecord):
- """
- This record contains information about the layout of outline symbols.
-
- Record GUTS, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 Width of the area to display row outlines (left of the sheet), in pixel
- 2 2 Height of the area to display column outlines (above the sheet), in pixel
- 4 2 Number of visible row outline levels (used row levels + 1; or 0, if not used)
- 6 2 Number of visible column outline levels (used column levels + 1; or 0, if not used)
-
- """
-
- _REC_ID = 0x0080
-
- def __init__(self, row_gut_width, col_gut_height, row_visible_levels, col_visible_levels):
- self._rec_data = pack('<4H', row_gut_width, col_gut_height, row_visible_levels, col_visible_levels)
-
-class WSBoolRecord(BiffRecord):
- """
- This record stores a 16 bit value with Boolean options for the current
- sheet. From BIFF5 on the "Save external linked values" option is moved
- to the record BOOKBOOL.
-
- Option flags of record WSBOOL, BIFF3-BIFF8:
-
- Bit Mask Contents
- 0 0001H 0 = Do not show automatic page breaks
- 1 = Show automatic page breaks
- 4 0010H 0 = Standard sheet
- 1 = Dialogue sheet (BIFF5-BIFF8)
- 5 0020H 0 = No automatic styles in outlines
- 1 = Apply automatic styles to outlines
- 6 0040H 0 = Outline buttons above outline group
- 1 = Outline buttons below outline group
- 7 0080H 0 = Outline buttons left of outline group
- 1 = Outline buttons right of outline group
- 8 0100H 0 = Scale printout in percent
- 1 = Fit printout to number of pages
- 9 0200H 0 = Save external linked values (BIFF3?BIFF4 only)
- 1 = Do not save external linked values (BIFF3?BIFF4 only)
- 10 0400H 0 = Do not show row outline symbols
- 1 = Show row outline symbols
- 11 0800H 0 = Do not show column outline symbols
- 1 = Show column outline symbols
- 13-12 3000H These flags specify the arrangement of windows.
- They are stored in BIFF4 only.
- 00 = Arrange windows tiled
- 01 = Arrange windows horizontal
- 10 = Arrange windows vertical112 = Arrange windows cascaded
- The following flags are valid for BIFF4-BIFF8 only:
- 14 4000H 0 = Standard expression evaluation
- 1 = Alternative expression evaluation
- 15 8000H 0 = Standard formula entries
- 1 = Alternative formula entries
-
- """
- _REC_ID = 0x0081
-
- def __init__(self, options):
- self._rec_data = pack('<H', options)
-
-class ColInfoRecord(BiffRecord):
- """
- This record specifies the width for a given range of columns.
- If a column does not have a corresponding COLINFO record,
- the width specified in the record STANDARDWIDTH is used. If
- this record is also not present, the contents of the record
- DEFCOLWIDTH is used instead.
- This record also specifies a default XF record to use for
- cells in the columns that are not described by any cell record
- (which contain the XF index for that cell). Additionally,
- the option flags field contains hidden, outline, and collapsed
- options applied at the columns.
-
- Record COLINFO, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 Index to first column in the range
- 2 2 Index to last column in the range
- 4 2 Width of the columns in 1/256 of the width of the zero character, using default font
- (first FONT record in the file)
- 6 2 Index to XF record for default column formatting
- 8 2 Option flags:
- Bits Mask Contents
- 0 0001H 1 = Columns are hidden
- 10-8 0700H Outline level of the columns (0 = no outline)
- 12 1000H 1 = Columns are collapsed
- 10 2 Not used
-
- """
- _REC_ID = 0x007D
-
- def __init__(self, first_col, last_col, width, xf_index, options):
- self._rec_data = pack('<6H', first_col, last_col, width, xf_index, options, 0)
-
-class CalcModeRecord(BiffRecord):
- """
- This record is part of the Calculation Settings Block.
- It specifies whether to calculate formulas manually,
- automatically or automatically except for multiple table operations.
-
- Record CALCMODE, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 FFFFH = automatic except for multiple table operations
- 0000H = manually
- 0001H = automatically (default)
- """
- _REC_ID = 0x000D
-
- def __init__(self, calc_mode):
- self._rec_data = pack('<h', calc_mode)
-
-
-class CalcCountRecord(BiffRecord):
- """
- This record is part of the Calculation Settings Block. It specifies the maximum
- number of times the formulas should be iteratively calculated. This is a fail-safe
- against mutually recursive formulas locking up a spreadsheet application.
-
- Record CALCCOUNT, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 Maximum number of iterations allowed in circular references
- """
-
- _REC_ID = 0x000C
-
- def __init__(self, calc_count):
- self._rec_data = pack('<H', calc_count)
-
-class RefModeRecord(BiffRecord):
- """
- This record is part of the Calculation Settings Block.
- It stores which method is used to show cell addresses in formulas.
- The “RC†mode uses numeric indexes for rows and columns,
- i.e. “R(1)C(-1)â€, or “R1C1:R2C2â€.
- The “A1†mode uses characters for columns and numbers for rows,
- i.e. “B1â€, or “$A$1:$B$2â€.
-
- Record REFMODE, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 0 = RC mode; 1 = A1 mode
-
- """
- _REC_ID = 0x00F
-
- def __init__(self, ref_mode):
- self._rec_data = pack('<H', ref_mode)
-
-class IterationRecord(BiffRecord):
- """
- This record is part of the Calculation Settings Block.
- It stores if iterations are allowed while calculating recursive formulas.
-
- Record ITERATION, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Iterations off; 1 = Iterations on
- """
- _REC_ID = 0x011
-
- def __init__(self, iterations_on):
- self._rec_data = pack('<H', iterations_on)
-
-class DeltaRecord(BiffRecord):
- """
- This record is part of the Calculation Settings Block.
- It stores the maximum change of the result to exit an iteration.
-
- Record DELTA, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 8 Maximum change in iteration
- (IEEE 754 floating-point value,
- 64bit double precision)
- """
- _REC_ID = 0x010
-
- def __init__(self, delta):
- self._rec_data = pack('<d', delta)
-
-class SaveRecalcRecord(BiffRecord):
- """
- This record is part of the Calculation Settings Block.
- It contains the “Recalculate before save†option in
- Excel's calculation settings dialogue.
-
- Record SAVERECALC, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Do not recalculate;
- 1 = Recalculate before saving the document
-
- """
- _REC_ID = 0x05F
-
- def __init__(self, recalc):
- self._rec_data = pack('<H', recalc)
-
-class PrintHeadersRecord(BiffRecord):
- """
- This record stores if the row and column headers
- (the areas with row numbers and column letters) will be printed.
-
- Record PRINTHEADERS, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Do not print row/column headers;
- 1 = Print row/column headers
- """
- _REC_ID = 0x02A
-
- def __init__(self, print_headers):
- self._rec_data = pack('<H', print_headers)
-
-
-class PrintGridLinesRecord(BiffRecord):
- """
- This record stores if sheet grid lines will be printed.
-
- Record PRINTGRIDLINES, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Do not print sheet grid lines;
- 1 = Print sheet grid lines
-
- """
- _REC_ID = 0x02B
-
- def __init__(self, print_grid):
- self._rec_data = pack('<H', print_grid)
-
-
-class GridSetRecord(BiffRecord):
- """
- This record specifies if the option to print sheet grid lines
- (record PRINTGRIDLINES) has ever been changed.
-
- Record GRIDSET, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Print grid lines option never changed
- 1 = Print grid lines option changed
- """
- _REC_ID = 0x082
-
- def __init__(self, print_grid_changed):
- self._rec_data = pack('<H', print_grid_changed)
-
-
-class DefaultRowHeightRecord(BiffRecord):
- """
- This record specifies the default height and default flags
- for rows that do not have a corresponding ROW record.
-
- Record DEFAULTROWHEIGHT, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 Option flags:
- Bit Mask Contents
- 0 0001H 1 = Row height and default font height do not match
- 1 0002H 1 = Row is hidden
- 2 0004H 1 = Additional space above the row
- 3 0008H 1 = Additional space below the row
- 2 2 Default height for unused rows, in twips = 1/20 of a point
-
- """
- _REC_ID = 0x0225
-
- def __init__(self, options, def_height):
- self._rec_data = pack('<2H', options, def_height)
-
-
-class DefColWidthRecord(BiffRecord):
- """
- This record specifies the default column width for columns that
- do not have a specific width set using the record COLINFO or COLWIDTH.
- This record has no effect, if a STANDARDWIDTH record is present in the file.
-
- Record DEFCOLWIDTH, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 2 Column width in characters, using the width of the zero
- character from default font (first FONT record in the file)
- """
- _REC_ID = 0x0055
-
- def __init__(self, def_width):
- self._rec_data = pack('<H', options, def_width)
-
-class HorizontalPageBreaksRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It contains all
- horizontal manual page breaks.
-
- Record HORIZONTALPAGEBREAKS, BIFF8:
- Offset Size Contents
- 0 2 Number of following row index structures (nm)
- 2 6nm List of nm row index structures. Each row index
- structure contains:
- Offset Size Contents
- 0 2 Index to first row below the page break
- 2 2 Index to first column of this page break
- 4 2 Index to last column of this page break
-
- The row indexes in the lists must be ordered ascending.
- If in BIFF8 a row contains several page breaks, they must be ordered
- ascending by start column index.
- """
- _REC_ID = 0x001B
-
- def __init__(self, breaks_list):
- self._rec_data = pack('<H', len(breaks_list))
- for r, c1, c2 in breaks_list:
- self._rec_data += pack('<3H', r, c1, c2)
-
-class VerticalPageBreaksRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It contains all
- vertical manual page breaks.
-
- Record VERTICALPAGEBREAKS, BIFF8:
- Offset Size Contents
- 0 2 Number of following column index structures (nm)
- 2 6nm List of nm column index structures. Each column index
- structure contains:
- Offset Size Contents
- 0 2 Index to first column following the page
- break
- 2 2 Index to first row of this page break
- 4 2 Index to last row of this page break
-
- The column indexes in the lists must be ordered ascending.
- If in BIFF8 a column contains several page breaks, they must be ordered
- ascending by start row index.
- """
- _REC_ID = 0x001A
-
- def __init__(self, breaks_list):
- self._rec_data = pack('<H', len(breaks_list))
- for r, c1, c2 in breaks_list:
- self._rec_data += pack('<3H', r, c1, c2)
-
-class HeaderRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It specifies the
- page header string for the current worksheet. If this record is not
- present or completely empty (record size is 0), the sheet does not
- contain a page header.
-
- Record HEADER for non-empty page header, BIFF2-BIFF8:
- Offset Size Contents
- 0 var. Page header string
- BIFF2-BIFF7: Non-empty byte string, 8bit string
- length
- BIFF8: Non-empty Unicode string, 16bit string length
- The header string may contain special commands, i.e. placeholders for
- the page number, current date, or text formatting attributes. These
- fields are represented by single letters (exception: font name and
- size, see below) with a leading ampersand ("&"). If the ampersand
- is part of the regular header text, it will be duplicated ("&&"). The
- page header is divided into 3 sections: the left, the centred, and the
- right section. Each section is introduced by a special command. All
- text and all commands following are part of the selected section. Each
- section starts with the text formatting specified in the default font
- (first FONT record in the file). Active formatting attributes from
- a previous section do not go into the next section.
-
- The following table shows all available commands:
-
- Command Contents
- && The "&" character itself
- &L Start of the left section
- &C Start of the centred section
- &R Start of the right section
- &P Current page number
- &N Page count
- &D Current date
- &T Current time
- &A Sheet name (BIFF5-BIFF8)
- &F File name without path
- &Z File path without file name (BIFF8X)
- &G Picture (BIFF8X)
- &B Bold on/off (BIFF2-BIFF4)
- &I Italic on/off (BIFF2-BIFF4)
- &U Underlining on/off
- &E Double underlining on/off (BIFF5-BIFF8)
- &S Strikeout on/off
- &X Superscript on/off (BIFF5-BIFF8)
- &Y Subscript on/off (BIFF5-BIFF8)
- &"<fontname>" Set new font <fontname>
- &"<fontname>,<fontstyle>"
- Set new font with specified style <fontstyle>.
- The style <fontstyle> is in most cases one of
- "Regular", "Bold", "Italic", or "Bold Italic".
- But this setting is dependent on the used font,
- it may differ (localised style names, or "Standard",
- "Oblique", ...). (BIFF5-BIFF8)
- &<fontheight> Set font height in points (<fontheight> is a decimal value).
- If this command is followed by a plain number to be printed
- in the header, it will be separated from the font height
- with a space character.
-
- """
- _REC_ID = 0x0014
-
- def __init__(self, header_str):
- self._rec_data = upack2(header_str)
-
-class FooterRecord(BiffRecord):
- """
- Semantic is equal to HEADER record
- """
- _REC_ID = 0x0015
-
- def __init__(self, footer_str):
- self._rec_data = upack2(footer_str)
-
-
-class HCenterRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It specifies if the
- sheet is centred horizontally when printed.
-
- Record HCENTER, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Print sheet left aligned
- 1 = Print sheet centred horizontally
-
- """
- _REC_ID = 0x0083
-
- def __init__(self, is_horz_center):
- self._rec_data = pack('<H', is_horz_center)
-
-
-class VCenterRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It specifies if the
- sheet is centred vertically when printed.
-
- Record VCENTER, BIFF3-BIFF8:
-
- Offset Size Contents
- 0 2 0 = Print sheet aligned at top page border
- 1 = Print sheet vertically centred
-
- """
- _REC_ID = 0x0084
-
- def __init__(self, is_vert_center):
- self._rec_data = pack('<H', is_vert_center)
-
-
-class LeftMarginRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It contains the left
- page margin of the current worksheet.
-
- Record LEFTMARGIN, BIFF2-BIFF8:
-
- Offset Size Contents
- 0 8 Left page margin in inches
- (IEEE 754 floating-point value, 64bit double precision)
-
- """
- _REC_ID = 0x0026
-
- def __init__(self, margin):
- self._rec_data = pack('<d', margin)
-
-
-class RightMarginRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It contains the right
- page margin of the current worksheet.
-
- Offset Size Contents
- 0 8 Right page margin in inches
- (IEEE 754 floating-point value, 64?bit double precision)
-
- """
- _REC_ID = 0x0027
-
- def __init__(self, margin):
- self._rec_data = pack('<d', margin)
-
-class TopMarginRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It contains the top
- page margin of the current worksheet.
-
- Offset Size Contents
- 0 8 Top page margin in inches
- (IEEE 754 floating-point value, 64?bit double precision)
-
- """
- _REC_ID = 0x0028
-
- def __init__(self, margin):
- self._rec_data = pack('<d', margin)
-
-
-class BottomMarginRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It contains the bottom
- page margin of the current worksheet.
-
- Offset Size Contents
- 0 8 Bottom page margin in inches
- (IEEE 754 floating-point value, 64?bit double precision)
-
- """
- _REC_ID = 0x0029
-
- def __init__(self, margin):
- self._rec_data = pack('<d', margin)
-
-class SetupPageRecord(BiffRecord):
- """
- This record is part of the Page Settings Block. It stores the page
- format settings of the current sheet. The pages may be scaled in
- percent or by using an absolute number of pages. This setting is
- located in the WSBOOL record. If pages are scaled in percent,
- the scaling factor in this record is used, otherwise the "Fit to
- pages" values. One of the "Fit to pages" values may be 0. In this case
- the sheet is scaled to fit only to the other value.
-
- Record SETUP, BIFF5-BIFF8:
-
- Offset Size Contents
- 0 2 Paper size (see below)
- 2 2 Scaling factor in percent
- 4 2 Start page number
- 6 2 Fit worksheet width to this number of pages
- (0 = use as many as needed)
- 8 2 Fit worksheet height to this number of pages
- (0 = use as many as needed)
- 10 2 Option flags:
- Bit Mask Contents
- 0 0001H 0 = Print pages in columns
- 1 = Print pages in rows
- 1 0002H 0 = Landscape
- 1 = Portrait
- 2 0004H 1 = Paper size, scaling factor,
- paper orientation (portrait/landscape),
- print resolution and number of copies
- are not initialised
- 3 0008H 0 = Print coloured
- 1 = Print black and white
- 4 0010H 0 = Default print quality
- 1 = Draft quality
- 5 0020H 0 = Do not print cell notes
- 1 = Print cell notes
- 6 0040H 0 = Paper orientation setting is valid
- 1 = Paper orientation setting not
- initialised
- 7 0080H 0 = Automatic page numbers
- 1 = Use start page number
- The following flags are valid for BIFF8 only:
- 9 0200H 0 = Print notes as displayed
- 1 = Print notes at end of sheet
- 11-10 0C00H 00 = Print errors as displayed
- 01 = Do not print errors
- 10 = Print errors as "--"
- 11 = Print errors as "#N/A!"
- 12 2 Print resolution in dpi
- 14 2 Vertical print resolution in dpi
- 16 8 Header margin (IEEE 754 floating-point value,
- 64bit double precision)
- 24 8 Footer margin (IEEE 754 floating-point value,
- 64bit double precision)
- 32 2 Number of copies to print
-
-
- PAPER TYPES:
-
- Index Paper type Paper size
- 0 Undefined
- 1 Letter 8 1/2" x 11"
- 2 Letter small 8 1/2" x 11"
- 3 Tabloid 11" x 17"
- 4 Ledger 17" x 11"
- 5 Legal 8 1/2" x 14"
- 6 Statement 5 1/2" x 8 1/2"
- 7 Executive 7 1/4" x 10 1/2"
- 8 A3 297mm x 420mm
- 9 A4 210mm x 297mm
- 10 A4 small 210mm x 297mm
- 11 A5 148mm x 210mm
- 12 B4 (JIS) 257mm x 364mm
- 13 B5 (JIS) 182mm x 257mm
- 14 Folio 8 1/2" x 13"
- 15 Quarto 215mm x 275mm
- 16 10x14 10" x 14"
- 17 11x17 11" x 17"
- 18 Note 8 1/2" x 11"
- 19 Envelope #9 3 7/8" x 8 7/8"
- 20 Envelope #10 4 1/8" x 9 1/2"
- 21 Envelope #11 4 1/2" x 10 3/8"
- 22 Envelope #12 4 3/4" x 11"
- 23 Envelope #14 5" x 11 1/2"
- 24 C 17" x 22"
- 25 D 22" x 34"
- 26 E 34" x 44"
- 27 Envelope DL 110mm x 220mm
- 28 Envelope C5 162mm x 229mm
- 29 Envelope C3 324mm x 458mm
- 30 Envelope C4 229mm x 324mm
- 31 Envelope C6 114mm x 162mm
- 32 Envelope C6/C5 114mm x 229mm
- 33 B4 (ISO) 250mm x 353mm
- 34 B5 (ISO) 176mm x 250mm
- 35 B6 (ISO) 125mm x 176mm
- 36 Envelope Italy 110mm x 230mm
- 37 Envelope Monarch 3 7/8" x 7 1/2"
- 38 63/4 Envelope 3 5/8" x 6 1/2"
- 39 US Standard Fanfold 14 7/8" x 11"
- 40 German Std. Fanfold 8 1/2" x 12"
- 41 German Legal Fanfold 8 1/2" x 13"
- 42 B4 (ISO) 250mm x 353mm
- 43 Japanese Postcard 100mm x 148mm
- 44 9x11 9" x 11"
- 45 10x11 10" x 11"
- 46 15x11 15" x 11"
- 47 Envelope Invite 220mm x 220mm
- 48 Undefined
- 49 Undefined
- 50 Letter Extra 9 1/2" x 12"
- 51 Legal Extra 9 1/2" x 15"
- 52 Tabloid Extra 11 11/16" x 18"
- 53 A4 Extra 235mm x 322mm
- 54 Letter Transverse 8 1/2" x 11"
- 55 A4 Transverse 210mm x 297mm
- 56 Letter Extra Transv. 9 1/2" x 12"
- 57 Super A/A4 227mm x 356mm
- 58 Super B/A3 305mm x 487mm
- 59 Letter Plus 8 1/2" x 12 11/16"
- 60 A4 Plus 210mm x 330mm
- 61 A5 Transverse 148mm x 210mm
- 62 B5 (JIS) Transverse 182mm x 257mm
- 63 A3 Extra 322mm x 445mm
- 64 A5 Extra 174mm x 235mm
- 65 B5 (ISO) Extra 201mm x 276mm
- 66 A2 420mm x 594mm
- 67 A3 Transverse 297mm x 420mm
- 68 A3 Extra Transverse 322mm x 445mm
- 69 Dbl. Japanese Postcard 200mm x 148mm
- 70 A6 105mm x 148mm
- 71
- 72
- 73
- 74
- 75 Letter Rotated 11" x 8 1/2"
- 76 A3 Rotated 420mm x 297mm
- 77 A4 Rotated 297mm x 210mm
- 78 A5 Rotated 210mm x 148mm
- 79 B4 (JIS) Rotated 364mm x 257mm
- 80 B5 (JIS) Rotated 257mm x 182mm
- 81 Japanese Postcard Rot. 148mm x 100mm
- 82 Dbl. Jap. Postcard Rot. 148mm x 200mm
- 83 A6 Rotated 148mm x 105mm
- 84
- 85
- 86
- 87
- 88 B6 (JIS) 128mm x 182mm
- 89 B6 (JIS) Rotated 182mm x 128mm
- 90 12x11 12" x 11"
-
- """
- _REC_ID = 0x00A1
- def __init__(self, paper, scaling, start_num, fit_width_to, fit_height_to,
- options,
- hres, vres,
- header_margin, footer_margin,
- num_copies):
- self._rec_data = pack('<8H2dH', paper, scaling, start_num,
- fit_width_to, fit_height_to, \
- options,
- hres, vres,
- header_margin, footer_margin,
- num_copies)
-
-class NameRecord(BiffRecord):
- """
- This record is part of a Link Table. It contains the name and the token
- array of an internal defined name. Token arrays of defined names
- contain tokens with aberrant token classes.
-
- Record NAME, BIFF5/BIFF7:
- Offset Size Contents
- 0 2 Option flags, see below
- 2 1 Keyboard shortcut (only for command macro names, see below)
- 3 1 Length of the name (character count, ln)
- 4 2 Size of the formula data (sz)
- 6 2 0 = Global name, otherwise index to EXTERNSHEET record (one-based)
- 8 2 0 = Global name, otherwise index to sheet (one-based)
- 10 1 Length of menu text (character count, lm)
- 11 1 Length of description text (character count, ld)
- 12 1 Length of help topic text (character count, lh)
- 13 1 Length of status bar text (character count, ls)
- 14 ln Character array of the name
- 14+ln sz Formula data (RPN token array without size field, 4)
- 14+ln+sz lm Character array of menu text
- var. ld Character array of description text
- var. lh Character array of help topic text
- var. ls Character array of status bar text
-
- Record NAME, BIFF8:
- Offset Size Contents
- 0 2 Option flags, see below
- 2 1 Keyboard shortcut (only for command macro names, see below)
- 3 1 Length of the name (character count, ln)
- 4 2 Size of the formula data (sz)
- 6 2 Not used
- 8 2 0 = Global name, otherwise index to sheet (one-based)
- 10 1 Length of menu text (character count, lm)
- 11 1 Length of description text (character count, ld)
- 12 1 Length of help topic text (character count, lh)
- 13 1 Length of status bar text (character count, ls)
- 14 var. Name (Unicode string without length field, 3.4)
- var. sz Formula data (RPN token array without size field, 4)
- [var.] var. (optional, only if lm > 0) Menu text (Unicode string without length field, 3.4)
- [var.] var. (optional, only if ld > 0) Description text (Unicode string without length field, 3.4)
- [var.] var. (optional, only if lh > 0) Help topic text (Unicode string without length field, 3.4)
- [var.] var. (optional, only if ls > 0) Status bar text (Unicode string without length field, 3.4)
- """
- _REC_ID = 0x0018
-
- def __init__(self, options, keyboard_shortcut, name, sheet_index, rpn,
- menu_text=b'', desc_text=b'', help_text=b'', status_text=b''):
- if type(name) == int:
- uname = chr(name)
- else:
- uname = upack1(name)[1:]
- uname_len = len(uname)
-
- #~ self._rec_data = pack('<HBBHHHBBBB%ds%ds' % (uname_len, len(rpn)), options, keyboard_shortcut, uname_len, len(rpn), 0x0000, sheet_index, len(menu_text), len(desc_text), len(help_text), len(status_text), uname, rpn) + menu_text + desc_text + help_text + status_text
- self._rec_data = pack('<HBBHHHBBBBB%ds%ds' % (uname_len, len(rpn)), options, keyboard_shortcut, uname_len, len(rpn), 0x0000, sheet_index, 0x00, len(menu_text), len(desc_text), len(help_text), len(status_text), uname, rpn) + menu_text + desc_text + help_text + status_text
-
-# Excel (both 2003 and 2007) don't like refs
-# split over a record boundary, which is what the
-# standard BiffRecord.get method does.
-
-# 8224 max data bytes in a BIFF record
-# 6 bytes per ref
-# 1370 = floor((8224 - 2) / 6.0) max refs in a record
-
-_maxRefPerRecord = 1370
-
-class ExternSheetRecord(BiffRecord):
- """
- In BIFF8 the record stores a list with indexes to SUPBOOK
- records (list of REF structures, 6.100). See 5.10.3 for
- details about external references in BIFF8.
-
- Record EXTERNSHEET, BIFF8:
- Offset Size Contents
- 0 2 Number of following REF structures (nm)
- 2 6nm List of nm REF structures. Each REF contains the following data:
- Offset Size Contents
- 0 2 Index to SUPBOOK record
- 2 2 Index to first SUPBOOK sheet
- 4 2 Index to last SUPBOOK sheet
- """
- _REC_ID = 0x0017
-
- def __init__(self, refs):
-
- # do we always need this ref? or only if there are no refs?
- # (I believe that if there are no refs then we should not generate the link table - Ruben)
- #refs.insert(0, (0,0,0))
-
- self.refs = refs
-
- def get(self):
- res = []
- nrefs = len(self.refs)
- for idx in range(0, nrefs, _maxRefPerRecord):
- chunk = self.refs[idx:idx+_maxRefPerRecord]
- krefs = len(chunk)
- if idx: # CONTINUE record
- header = pack("<HH", 0x003C, 6 * krefs)
- else: # ExternSheetRecord
- header = pack("<HHH", self._REC_ID, 6 * krefs + 2, nrefs)
- res.append(header)
- res.extend([pack("<HHH", *r) for r in chunk])
- return b''.join(res)
-
-class SupBookRecord(BiffRecord):
- """
- This record mainly stores the URL of an external document
- and a list of sheet names inside this document. Furthermore
- it is used to store DDE and OLE object links, or to indicate
- an internal 3D reference or an add-in function. See 5.10.3
- for details about external references in BIFF8.
-
- """
- _REC_ID = 0x01AE
-
-class InternalReferenceSupBookRecord(SupBookRecord):
- """
- In each file occurs a SUPBOOK that is used for internal 3D
- references. It stores the number of sheets of the own document.
-
- Record SUPBOOK for 3D references, BIFF8:
- Offset Size Contents
- 0 2 Number of sheets in this document
- 2 2 01H 04H (relict of BIFF5/BIFF7, the byte string "<04H>", see 3.9.1)
-
- """
-
- def __init__(self, num_sheets):
- self._rec_data = pack('<HBB', num_sheets, 0x01, 0x04)
-
-class XcallSupBookRecord(SupBookRecord):
- """
- Add-in function names are stored in EXTERNNAME records following this record.
-
- Offset Size Contents
- 0 2 0001H
- 2 2 01H 3AH (relict of BIFF5, the byte string ':', see EXTERNSHEET record, 5.41)
-
- """
-
- def __init__(self):
- self._rec_data = pack('<HBB', 1, 0x01, 0x3A)
-
-
-class ExternnameRecord(BiffRecord):
- """
- Record EXTERNNAME for external names and Analysis add-in functions, BIFF5-BIFF8:
- Offset Size Contents
- 0 2 Option flags (see below)
- 2 2 0 for global names, or:
- BIFF5: One-based index to EXTERNSHEET record containing the sheet name,
- BIFF8: One-based index to sheet list in preceding EXTERNALBOOK record.
- 4 2 Not used
- 6 var. BIFF5: Name (byte string, 8-bit string length, ?2.5.2).
- BIFF8: Name (Unicode string, 8-bit string length, ?2.5.3).
- See DEFINEDNAME record (?5.33) for a list of built-in names, if the built-in flag is set
- in the option flags above.
- var. var. Formula data (RPN token array, ?3)
-
- Option flags for external names (BIFF5-BIFF8)
- Bit Mask Contents
- 0 0001H 0 = Standard name; 1 = Built-in name
- 1 0002H 0 = Manual link; 1 = Automatic link (DDE links and OLE links only)
- 2 0004H 1 = Picture link (DDE links and OLE links only)
- 3 0008H 1 = This is the “StdDocumentName†identifier (DDE links only)
- 4 0010H 1 = OLE link
- 14-5 7FE0H Clipboard format of last successful update (DDE links and OLE links only)
- 15 8000H 1 = Iconified picture link (BIFF8 OLE links only)
- """
- _REC_ID = 0x0023
-
- def __init__(self, options=0, index=0, name=None, fmla=None):
- self._rec_data = pack('<HHH', options, index, 0) + upack1(name) + fmla.encode()
-
+# -*- coding: cp1252 -*-
+from struct import pack
+from UnicodeUtils import upack1, upack2
+import sys
+
+class SharedStringTable(object):
+ _SST_ID = 0x00FC
+ _CONTINUE_ID = 0x003C
+
+ def __init__(self, encoding):
+ self.encoding = encoding
+ self._str_indexes = {}
+ self._tally = []
+ self._add_calls = 0
+ # Following 3 attrs are used for temporary storage in the
+ # get_biff_record() method and methods called by it. The pseudo-
+ # initialisation here is for documentation purposes only.
+ self._sst_record = None
+ self._continues = None
+ self._current_piece = None
+
+ def add_str(self, s):
+ if self.encoding != 'ascii' and not isinstance(s, unicode):
+ s = unicode(s, self.encoding)
+ self._add_calls += 1
+ if s not in self._str_indexes:
+ idx = len(self._str_indexes)
+ self._str_indexes[s] = idx
+ self._tally.append(1)
+ else:
+ idx = self._str_indexes[s]
+ self._tally[idx] += 1
+ return idx
+
+ def del_str(self, idx):
+ # This is called when we are replacing the contents of a string cell.
+ assert self._tally[idx] > 0
+ self._tally[idx] -= 1
+ self._add_calls -= 1
+
+ def str_index(self, s):
+ return self._str_indexes[s]
+
+ def get_biff_record(self):
+ self._sst_record = ''
+ self._continues = [None, None]
+ self._current_piece = pack('<II', 0, 0)
+ data = [(idx, s) for s, idx in self._str_indexes.iteritems()]
+ data.sort() # in index order
+ for idx, s in data:
+ if self._tally[idx] == 0:
+ s = u''
+ self._add_to_sst(s)
+ del data
+ self._new_piece()
+ self._continues[0] = pack('<2HII', self._SST_ID, len(self._sst_record), self._add_calls, len(self._str_indexes))
+ self._continues[1] = self._sst_record[8:]
+ self._sst_record = None
+ self._current_piece = None
+ result = ''.join(self._continues)
+ self._continues = None
+ return result
+
+
+ def _add_to_sst(self, s):
+ u_str = upack2(s, self.encoding)
+
+ is_unicode_str = u_str[2] == '\x01'
+ if is_unicode_str:
+ atom_len = 5 # 2 byte -- len,
+ # 1 byte -- options,
+ # 2 byte -- 1st sym
+ else:
+ atom_len = 4 # 2 byte -- len,
+ # 1 byte -- options,
+ # 1 byte -- 1st sym
+
+ self._save_atom(u_str[0:atom_len])
+ self._save_splitted(u_str[atom_len:], is_unicode_str)
+
+ def _new_piece(self):
+ if self._sst_record == '':
+ self._sst_record = self._current_piece
+ else:
+ curr_piece_len = len(self._current_piece)
+ self._continues.append(pack('<2H%ds'%curr_piece_len, self._CONTINUE_ID, curr_piece_len, self._current_piece))
+ self._current_piece = ''
+
+ def _save_atom(self, s):
+ atom_len = len(s)
+ free_space = 0x2020 - len(self._current_piece)
+ if free_space < atom_len:
+ self._new_piece()
+ self._current_piece += s
+
+ def _save_splitted(self, s, is_unicode_str):
+ i = 0
+ str_len = len(s)
+ while i < str_len:
+ piece_len = len(self._current_piece)
+ free_space = 0x2020 - piece_len
+ tail_len = str_len - i
+ need_more_space = free_space < tail_len
+
+ if not need_more_space:
+ atom_len = tail_len
+ else:
+ if is_unicode_str:
+ atom_len = free_space & 0xFFFE
+ else:
+ atom_len = free_space
+
+ self._current_piece += s[i:i+atom_len]
+
+ if need_more_space:
+ self._new_piece()
+ if is_unicode_str:
+ self._current_piece += '\x01'
+ else:
+ self._current_piece += '\x00'
+
+ i += atom_len
+
+
+class BiffRecord(object):
+
+ _rec_data = '' # class attribute; child classes need to set this.
+
+ # Sheer waste.
+ # def __init__(self):
+ # self._rec_data = ''
+
+ def get_rec_id(self):
+ return _REC_ID
+
+ def get_rec_header(self):
+ return pack('<2H', self._REC_ID, len(self._rec_data))
+
+ # Not over-ridden by any child classes, never called (except by "get"; see below).
+ # def get_rec_data(self):
+ # return self._rec_data
+
+ def get(self):
+ # data = self.get_rec_data()
+ data = self._rec_data
+
+ if len(data) > 0x2020: # limit for BIFF7/8
+ chunks = []
+ pos = 0
+ while pos < len(data):
+ chunk_pos = pos + 0x2020
+ chunk = data[pos:chunk_pos]
+ chunks.append(chunk)
+ pos = chunk_pos
+ continues = pack('<2H', self._REC_ID, len(chunks[0])) + chunks[0]
+ for chunk in chunks[1:]:
+ continues += pack('<2H%ds'%len(chunk), 0x003C, len(chunk), chunk)
+ # 0x003C -- CONTINUE record id
+ return continues
+ else:
+ return self.get_rec_header() + data
+
+
+class Biff8BOFRecord(BiffRecord):
+ """
+ Offset Size Contents
+ 0 2 Version, contains 0600H for BIFF8 and BIFF8X
+ 2 2 Type of the following data:
+ 0005H = Workbook globals
+ 0006H = Visual Basic module
+ 0010H = Worksheet
+ 0020H = Chart
+ 0040H = Macro sheet
+ 0100H = Workspace file
+ 4 2 Build identifier
+ 6 2 Build year
+ 8 4 File history flags
+ 12 4 Lowest Excel version that can read all records in this file
+ """
+ _REC_ID = 0x0809
+ # stream types
+ BOOK_GLOBAL = 0x0005
+ VB_MODULE = 0x0006
+ WORKSHEET = 0x0010
+ CHART = 0x0020
+ MACROSHEET = 0x0040
+ WORKSPACE = 0x0100
+
+ def __init__(self, rec_type):
+ version = 0x0600
+ build = 0x0DBB
+ year = 0x07CC
+ file_hist_flags = 0x00L
+ ver_can_read = 0x06L
+
+ self._rec_data = pack('<4H2I', version, rec_type, build, year, file_hist_flags, ver_can_read)
+
+
+class InteraceHdrRecord(BiffRecord):
+ _REC_ID = 0x00E1
+
+ def __init__(self):
+ self._rec_data = pack('BB', 0xB0, 0x04)
+
+
+class InteraceEndRecord(BiffRecord):
+ _REC_ID = 0x00E2
+
+ def __init__(self):
+ self._rec_data = ''
+
+
+class MMSRecord(BiffRecord):
+ _REC_ID = 0x00C1
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x00)
+
+
+class WriteAccessRecord(BiffRecord):
+ """
+ This record is part of the file protection. It contains the name of the
+ user that has saved the file. The user name is always stored as an
+ equal-sized string. All unused characters after the name are filled
+ with space characters. It is not required to write the mentioned string
+ length. Every other length will be accepted too.
+ """
+ _REC_ID = 0x005C
+
+ def __init__(self, owner):
+ uowner = owner[0:0x30]
+ uowner_len = len(uowner)
+ self._rec_data = pack('%ds%ds' % (uowner_len, 0x70 - uowner_len), uowner, ' '*(0x70 - uowner_len))
+
+
+class DSFRecord(BiffRecord):
+ """
+ This record specifies if the file contains an additional BIFF5/BIFF7
+ workbook stream.
+ Record DSF, BIFF8:
+ Offset Size Contents
+ 0 2 0 = Only the BIFF8 Workbook stream is present
+ 1 = Additional BIFF5/BIFF7 Book stream is in the file
+ A double stream file can be read by Excel 5.0 and Excel 95, and still
+ contains all new features added to BIFF8 (which are left out in the
+ BIFF5/BIFF7 Book stream).
+ """
+ _REC_ID = 0x0161
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x00)
+
+
+class TabIDRecord(BiffRecord):
+ _REC_ID = 0x013D
+
+ def __init__(self, sheetcount):
+ for i in range(sheetcount):
+ self._rec_data += pack('<H', i+1)
+
+
+class FnGroupCountRecord(BiffRecord):
+ _REC_ID = 0x009C
+
+ def __init__(self):
+ self._rec_data = pack('BB', 0x0E, 0x00)
+
+
+class WindowProtectRecord(BiffRecord):
+ """
+ This record is part of the worksheet/workbook protection. It determines
+ whether the window configuration of this document is protected. Window
+ protection is not active, if this record is omitted.
+ """
+ _REC_ID = 0x0019
+
+ def __init__(self, wndprotect):
+ self._rec_data = pack('<H', wndprotect)
+
+
+class ObjectProtectRecord(BiffRecord):
+ """
+ This record is part of the worksheet/workbook protection.
+ It determines whether the objects of the current sheet are protected.
+ Object protection is not active, if this record is omitted.
+ """
+ _REC_ID = 0x0063
+
+
+ def __init__(self, objprotect):
+ self._rec_data = pack('<H', objprotect)
+
+
+class ScenProtectRecord(BiffRecord):
+ """
+ This record is part of the worksheet/workbook protection. It
+ determines whether the scenarios of the current sheet are protected.
+ Scenario protection is not active, if this record is omitted.
+ """
+ _REC_ID = 0x00DD
+
+
+ def __init__(self, scenprotect):
+ self._rec_data = pack('<H', scenprotect)
+
+
+class ProtectRecord(BiffRecord):
+ """
+ This record is part of the worksheet/workbook protection. It specifies
+ whether a worksheet or a workbook is protected against modification.
+ Protection is not active, if this record is omitted.
+ """
+
+ _REC_ID = 0x0012
+
+ def __init__(self, protect):
+ self._rec_data = pack('<H', protect)
+
+
+class PasswordRecord(BiffRecord):
+ """
+ This record is part of the worksheet/workbook protection. It
+ stores a 16-bit hash value, calculated from the worksheet or workbook
+ protection password.
+ """
+ _REC_ID = 0x0013
+ def passwd_hash(self, plaintext):
+ """
+ Based on the algorithm provided by Daniel Rentz of OpenOffice.
+ """
+ if plaintext == "":
+ return 0
+
+ passwd_hash = 0x0000
+ for i, char in enumerate(plaintext):
+ c = ord(char) << (i + 1)
+ low_15 = c & 0x7fff
+ high_15 = c & 0x7fff << 15
+ high_15 = high_15 >> 15
+ c = low_15 | high_15
+ passwd_hash ^= c
+ passwd_hash ^= len(plaintext)
+ passwd_hash ^= 0xCE4B
+ return passwd_hash
+
+ def __init__(self, passwd = ""):
+ self._rec_data = pack('<H', self.passwd_hash(passwd))
+
+
+class Prot4RevRecord(BiffRecord):
+ _REC_ID = 0x01AF
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x00)
+
+
+class Prot4RevPassRecord(BiffRecord):
+ _REC_ID = 0x01BC
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x00)
+
+
+class BackupRecord(BiffRecord):
+ """
+ This record contains a Boolean value determining whether Excel makes
+ a backup of the file while saving.
+ """
+ _REC_ID = 0x0040
+
+ def __init__(self, backup):
+ self._rec_data = pack('<H', backup)
+
+class HideObjRecord(BiffRecord):
+ """
+ This record specifies whether and how to show objects in the workbook.
+
+ Record HIDEOBJ, BIFF3-BIFF8:
+ Offset Size Contents
+ 0 2 Viewing mode for objects:
+ 0 = Show all objects
+ 1 = Show placeholders
+ 2 = Do not show objects
+ """
+ _REC_ID = 0x008D
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x00)
+
+
+
+class RefreshAllRecord(BiffRecord):
+ """
+ """
+
+ _REC_ID = 0x01B7
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x00)
+
+
+class BookBoolRecord(BiffRecord):
+ """
+ This record contains a Boolean value determining whether to save values
+ linked from external workbooks (CRN records and XCT records). In BIFF3
+ and BIFF4 this option is stored in the WSBOOL record.
+
+ Record BOOKBOOL, BIFF5-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Save external linked values;
+ 1 = Do not save external linked values
+ """
+
+ _REC_ID = 0x00DA
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x00)
+
+
+class CountryRecord(BiffRecord):
+ """
+ This record stores two Windows country identifiers. The first
+ represents the user interface language of the Excel version that has
+ saved the file, and the second represents the system regional settings
+ at the time the file was saved.
+
+ Record COUNTRY, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 Windows country identifier of the user interface language of Excel
+ 2 2 Windows country identifier of the system regional settings
+
+ The following table shows most of the used country identifiers. Most
+ of these identifiers are equal to the international country calling
+ codes.
+
+ 1 USA
+ 2 Canada
+ 7 Russia
+ """
+
+ _REC_ID = 0x008C
+
+ def __init__(self, ui_id, sys_settings_id):
+ self._rec_data = pack('<2H', ui_id, sys_settings_id)
+
+
+class UseSelfsRecord(BiffRecord):
+ """
+ This record specifies if the formulas in the workbook can use natural
+ language formulas. This type of formula can refer to cells by its
+ content or the content of the column or row header cell.
+
+ Record USESELFS, BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Do not use natural language formulas
+ 1 = Use natural language formulas
+
+ """
+
+ _REC_ID = 0x0160
+
+ def __init__(self):
+ self._rec_data = pack('<H', 0x01)
+
+
+class EOFRecord(BiffRecord):
+ _REC_ID = 0x000A
+
+ def __init__(self):
+ self._rec_data = ''
+
+
+class DateModeRecord(BiffRecord):
+ """
+ This record specifies the base date for displaying date values. All
+ dates are stored as count of days past this base date. In BIFF2-BIFF4
+ this record is part of the Calculation Settings Block.
+ In BIFF5-BIFF8 it is stored in the Workbook Globals Substream.
+
+ Record DATEMODE, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Base is 1899-Dec-31 (the cell = 1 represents 1900-Jan-01)
+ 1 = Base is 1904-Jan-01 (the cell = 1 represents 1904-Jan-02)
+ """
+ _REC_ID = 0x0022
+
+ def __init__(self, from1904):
+ if from1904:
+ self._rec_data = pack('<H', 1)
+ else:
+ self._rec_data = pack('<H', 0)
+
+
+class PrecisionRecord(BiffRecord):
+ """
+ This record stores if formulas use the real cell values for calculation
+ or the values displayed on the screen. In BIFF2- BIFF4 this record
+ is part of the Calculation Settings Block. In BIFF5-BIFF8 it is stored
+ in the Workbook Globals Substream.
+
+ Record PRECISION, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Use displayed values;
+ 1 = Use real cell values
+ """
+ _REC_ID = 0x000E
+
+ def __init__(self, use_real_values):
+ if use_real_values:
+ self._rec_data = pack('<H', 1)
+ else:
+ self._rec_data = pack('<H', 0)
+
+
+class CodepageBiff8Record(BiffRecord):
+ """
+ This record stores the text encoding used to write byte strings, stored
+ as MS Windows code page identifier. The CODEPAGE record in BIFF8 always
+ contains the code page 1200 (UTF-16). Therefore it is not
+ possible to obtain the encoding used for a protection password (it is
+ not UTF-16).
+
+ Record CODEPAGE, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 Code page identifier used for byte string text encoding:
+ 016FH = 367 = ASCII
+ 01B5H = 437 = IBM PC CP-437 (US)
+ 02D0H = 720 = IBM PC CP-720 (OEM Arabic)
+ 02E1H = 737 = IBM PC CP-737 (Greek)
+ 0307H = 775 = IBM PC CP-775 (Baltic)
+ 0352H = 850 = IBM PC CP-850 (Latin I)
+ 0354H = 852 = IBM PC CP-852 (Latin II (Central European))
+ 0357H = 855 = IBM PC CP-855 (Cyrillic)
+ 0359H = 857 = IBM PC CP-857 (Turkish)
+ 035AH = 858 = IBM PC CP-858 (Multilingual Latin I with Euro)
+ 035CH = 860 = IBM PC CP-860 (Portuguese)
+ 035DH = 861 = IBM PC CP-861 (Icelandic)
+ 035EH = 862 = IBM PC CP-862 (Hebrew)
+ 035FH = 863 = IBM PC CP-863 (Canadian (French))
+ 0360H = 864 = IBM PC CP-864 (Arabic)
+ 0361H = 865 = IBM PC CP-865 (Nordic)
+ 0362H = 866 = IBM PC CP-866 (Cyrillic (Russian))
+ 0365H = 869 = IBM PC CP-869 (Greek (Modern))
+ 036AH = 874 = Windows CP-874 (Thai)
+ 03A4H = 932 = Windows CP-932 (Japanese Shift-JIS)
+ 03A8H = 936 = Windows CP-936 (Chinese Simplified GBK)
+ 03B5H = 949 = Windows CP-949 (Korean (Wansung))
+ 03B6H = 950 = Windows CP-950 (Chinese Traditional BIG5)
+ 04B0H = 1200 = UTF-16 (BIFF8)
+ 04E2H = 1250 = Windows CP-1250 (Latin II) (Central European)
+ 04E3H = 1251 = Windows CP-1251 (Cyrillic)
+ 04E4H = 1252 = Windows CP-1252 (Latin I) (BIFF4-BIFF7)
+ 04E5H = 1253 = Windows CP-1253 (Greek)
+ 04E6H = 1254 = Windows CP-1254 (Turkish)
+ 04E7H = 1255 = Windows CP-1255 (Hebrew)
+ 04E8H = 1256 = Windows CP-1256 (Arabic)
+ 04E9H = 1257 = Windows CP-1257 (Baltic)
+ 04EAH = 1258 = Windows CP-1258 (Vietnamese)
+ 0551H = 1361 = Windows CP-1361 (Korean (Johab))
+ 2710H = 10000 = Apple Roman
+ 8000H = 32768 = Apple Roman
+ 8001H = 32769 = Windows CP-1252 (Latin I) (BIFF2-BIFF3)
+ """
+ _REC_ID = 0x0042
+ UTF_16 = 0x04B0
+
+ def __init__(self):
+ self._rec_data = pack('<H', self.UTF_16)
+
+class Window1Record(BiffRecord):
+ """
+ Offset Size Contents
+ 0 2 Horizontal position of the document window (in twips = 1/20 of a point)
+ 2 2 Vertical position of the document window (in twips = 1/20 of a point)
+ 4 2 Width of the document window (in twips = 1/20 of a point)
+ 6 2 Height of the document window (in twips = 1/20 of a point)
+ 8 2 Option flags:
+ Bits Mask Contents
+ 0 0001H 0 = Window is visible 1 = Window is hidden
+ 1 0002H 0 = Window is open 1 = Window is minimised
+ 3 0008H 0 = Horizontal scroll bar hidden 1 = Horizontal scroll bar visible
+ 4 0010H 0 = Vertical scroll bar hidden 1 = Vertical scroll bar visible
+ 5 0020H 0 = Worksheet tab bar hidden 1 = Worksheet tab bar visible
+ 10 2 Index to active (displayed) worksheet
+ 12 2 Index of first visible tab in the worksheet tab bar
+ 14 2 Number of selected worksheets (highlighted in the worksheet tab bar)
+ 16 2 Width of worksheet tab bar (in 1/1000 of window width). The remaining space is used by the
+ horizontal scrollbar.
+ """
+ _REC_ID = 0x003D
+ # flags
+
+ def __init__(self,
+ hpos_twips, vpos_twips,
+ width_twips, height_twips,
+ flags,
+ active_sheet,
+ first_tab_index, selected_tabs, tab_width):
+ self._rec_data = pack('<9H', hpos_twips, vpos_twips,
+ width_twips, height_twips,
+ flags,
+ active_sheet,
+ first_tab_index, selected_tabs, tab_width)
+
+class FontRecord(BiffRecord):
+ """
+ WARNING
+ The font with index 4 is omitted in all BIFF versions.
+ This means the first four fonts have zero-based indexes, and
+ the fifth font and all following fonts are referenced with one-based
+ indexes.
+
+ Offset Size Contents
+ 0 2 Height of the font (in twips = 1/20 of a point)
+ 2 2 Option flags:
+ Bit Mask Contents
+ 0 0001H 1 = Characters are bold (redundant, see below)
+ 1 0002H 1 = Characters are italic
+ 2 0004H 1 = Characters are underlined (redundant, see below)
+ 3 0008H 1 = Characters are struck out
+ 0010H 1 = Outline
+ 0020H 1 = Shadow
+ 4 2 Colour index
+ 6 2 Font weight (100-1000).
+ Standard values are 0190H (400) for normal text and 02BCH
+ (700) for bold text.
+ 8 2 Escapement type:
+ 0000H = None
+ 0001H = Superscript
+ 0002H = Subscript
+ 10 1 Underline type:
+ 00H = None
+ 01H = Single
+ 21H = Single accounting
+ 02H = Double
+ 22H = Double accounting
+ 11 1 Font family:
+ 00H = None (unknown or don't care)
+ 01H = Roman (variable width, serifed)
+ 02H = Swiss (variable width, sans-serifed)
+ 03H = Modern (fixed width, serifed or sans-serifed)
+ 04H = Script (cursive)
+ 05H = Decorative (specialised, i.e. Old English, Fraktur)
+ 12 1 Character set:
+ 00H = 0 = ANSI Latin
+ 01H = 1 = System default
+ 02H = 2 = Symbol
+ 4DH = 77 = Apple Roman
+ 80H = 128 = ANSI Japanese Shift-JIS
+ 81H = 129 = ANSI Korean (Hangul)
+ 82H = 130 = ANSI Korean (Johab)
+ 86H = 134 = ANSI Chinese Simplified GBK
+ 88H = 136 = ANSI Chinese Traditional BIG5
+ A1H = 161 = ANSI Greek
+ A2H = 162 = ANSI Turkish
+ A3H = 163 = ANSI Vietnamese
+ B1H = 177 = ANSI Hebrew
+ B2H = 178 = ANSI Arabic
+ BAH = 186 = ANSI Baltic
+ CCH = 204 = ANSI Cyrillic
+ DEH = 222 = ANSI Thai
+ EEH = 238 = ANSI Latin II (Central European)
+ FFH = 255 = OEM Latin I
+ 13 1 Not used
+ 14 var. Font name:
+ BIFF5/BIFF7: Byte string, 8-bit string length
+ BIFF8: Unicode string, 8-bit string length
+ The boldness and underline flags are still set in the options field,
+ but not used on reading the font. Font weight and underline type
+ are specified in separate fields instead.
+ """
+ _REC_ID = 0x0031
+
+ def __init__(self,
+ height, options, colour_index, weight, escapement,
+ underline, family, charset,
+ name):
+ uname = upack1(name)
+ uname_len = len(uname)
+
+ self._rec_data = pack('<5H4B%ds' % uname_len, height, options, colour_index, weight, escapement,
+ underline, family, charset, 0x00,
+ uname)
+
+class NumberFormatRecord(BiffRecord):
+ """
+ Record FORMAT, BIFF8:
+ Offset Size Contents
+ 0 2 Format index used in other records
+ 2 var. Number format string (Unicode string, 16-bit string length)
+
+ From BIFF5 on, the built-in number formats will be omitted. The built-in
+ formats are dependent on the current regional settings of the operating
+ system. The following table shows which number formats are used by default
+ in a US-English environment. All indexes from 0 to 163 are reserved for
+ built-in formats. The first user-defined format starts at 164.
+
+ The built-in number formats, BIFF5-BIFF8
+
+ Index Type Format string
+ 0 General General
+ 1 Decimal 0
+ 2 Decimal 0.00
+ 3 Decimal #,##0
+ 4 Decimal #,##0.00
+ 5 Currency "$"#,##0_);("$"#,##
+ 6 Currency "$"#,##0_);[Red]("$"#,##
+ 7 Currency "$"#,##0.00_);("$"#,##
+ 8 Currency "$"#,##0.00_);[Red]("$"#,##
+ 9 Percent 0%
+ 10 Percent 0.00%
+ 11 Scientific 0.00E+00
+ 12 Fraction # ?/?
+ 13 Fraction # ??/??
+ 14 Date M/D/YY
+ 15 Date D-MMM-YY
+ 16 Date D-MMM
+ 17 Date MMM-YY
+ 18 Time h:mm AM/PM
+ 19 Time h:mm:ss AM/PM
+ 20 Time h:mm
+ 21 Time h:mm:ss
+ 22 Date/Time M/D/YY h:mm
+ 37 Account _(#,##0_);(#,##0)
+ 38 Account _(#,##0_);[Red](#,##0)
+ 39 Account _(#,##0.00_);(#,##0.00)
+ 40 Account _(#,##0.00_);[Red](#,##0.00)
+ 41 Currency _("$"* #,##0_);_("$"* (#,##0);_("$"* "-"_);_(@_)
+ 42 Currency _(* #,##0_);_(* (#,##0);_(* "-"_);_(@_)
+ 43 Currency _("$"* #,##0.00_);_("$"* (#,##0.00);_("$"* "-"??_);_(@_)
+ 44 Currency _(* #,##0.00_);_(* (#,##0.00);_(* "-"??_);_(@_)
+ 45 Time mm:ss
+ 46 Time [h]:mm:ss
+ 47 Time mm:ss.0
+ 48 Scientific ##0.0E+0
+ 49 Text @
+ """
+ _REC_ID = 0x041E
+
+ def __init__(self, idx, fmtstr):
+ ufmtstr = upack2(fmtstr)
+ ufmtstr_len = len(ufmtstr)
+
+ self._rec_data = pack('<H%ds' % ufmtstr_len, idx, ufmtstr)
+
+
+class XFRecord(BiffRecord):
+ """
+ XF Substructures
+ -------------------------------------------------------------------------
+ XF_TYPE_PROT XF Type and Cell Protection (3 Bits), BIFF3-BIFF8
+ These 3 bits are part of a specific data byte.
+ Bit Mask Contents
+ 0 01H 1 = Cell is locked
+ 1 02H 1 = Formula is hidden
+ 2 04H 0 = Cell XF; 1 = Style XF
+
+ XF_USED_ATTRIB Attributes Used from Parent Style XF (6 Bits),
+ BIFF3-BIFF8 Each bit describes the validity of a specific group
+ of attributes. In cell XFs a cleared bit means the attributes of the
+ parent style XF are used (but only if the attributes are valid there),
+ a set bit means the attributes of this XF are used. In style XFs
+ a cleared bit means the attribute setting is valid, a set bit means the
+ attribute should be ignored.
+ Bit Mask Contents
+ 0 01H Flag for number format
+ 1 02H Flag for font
+ 2 04H Flag for horizontal and vertical alignment, text wrap, indentation, orientation, rotation, and
+ text direction
+ 3 08H Flag for border lines
+ 4 10H Flag for background area style
+ 5 20H Flag for cell protection (cell locked and formula hidden)
+
+ XF_HOR_ALIGN Horizontal Alignment (3 Bits), BIFF2-BIFF8 The horizontal
+ alignment consists of 3 bits and is part of a specific data byte.
+ Value Horizontal alignment
+ 00H General
+ 01H Left
+ 02H Centred
+ 03H Right
+ 04H Filled
+ 05H Justified (BIFF4-BIFF8X)
+ 06H Centred across selection (BIFF4-BIFF8X)
+ 07H Distributed (BIFF8X)
+
+ XF_VERT_ALIGN Vertical Alignment (2 or 3 Bits), BIFF4-BIFF8
+ The vertical alignment consists of 2 bits (BIFF4) or 3 bits (BIFF5-BIFF8)
+ and is part of a specific data byte. Vertical alignment is not available
+ in BIFF2 and BIFF3.
+ Value Vertical alignment
+ 00H Top
+ 01H Centred
+ 02H Bottom
+ 03H Justified (BIFF5-BIFF8X)
+ 04H Distributed (BIFF8X)
+
+ XF_ORIENTATION Text Orientation (2 Bits), BIFF4-BIFF7 In the BIFF
+ versions BIFF4-BIFF7, text can be rotated in steps of 90 degrees
+ or stacked. The orientation mode consists of 2 bits and is part of
+ a specific data byte. In BIFF8 a rotation angle occurs instead of these
+ flags.
+ Value Text orientation
+ 00H Not rotated
+ 01H Letters are stacked top-to-bottom, but not rotated
+ 02H Text is rotated 90 degrees counterclockwise
+ 03H Text is rotated 90 degrees clockwise
+
+ XF_ROTATION Text Rotation Angle (1 Byte), BIFF8
+ Value Text rotation
+ 0 Not rotated
+ 1-90 1 to 90 degrees counterclockwise
+ 91-180 1 to 90 degrees clockwise
+ 255 Letters are stacked top-to-bottom, but not rotated
+
+ XF_BORDER_34 Cell Border Style (4 Bytes), BIFF3-BIFF4 Cell borders
+ contain a line style and a line colour for each line of the border.
+ Bit Mask Contents
+ 2-0 00000007H Top line style
+ 7-3 000000F8H Colour index for top line colour
+ 10-8 00000700H Left line style
+ 15-11 0000F800H Colour index for left line colour
+ 18-16 00070000H Bottom line style
+ 23-19 00F80000H Colour index for bottom line colour
+ 26-24 07000000H Right line style
+ 31-27 F8000000H Colour index for right line colour
+
+ XF_AREA_34 Cell Background Area Style (2 Bytes), BIFF3-BIFF4 A cell
+ background area style contains an area pattern and a foreground and
+ background colour.
+ Bit Mask Contents
+ 5-0 003FH Fill pattern
+ 10-6 07C0H Colour index for pattern colour
+ 15-11 F800H Colour index for pattern background
+ ---------------------------------------------------------------------------------------------
+ Record XF, BIFF8:
+ Offset Size Contents
+ 0 2 Index to FONT record
+ 2 2 Index to FORMAT record
+ 4 2 Bit Mask Contents
+ 2-0 0007H XF_TYPE_PROT . XF type, cell protection (see above)
+ 15-4 FFF0H Index to parent style XF (always FFFH in style XFs)
+ 6 1 Bit Mask Contents
+ 2-0 07H XF_HOR_ALIGN . Horizontal alignment (see above)
+ 3 08H 1 = Text is wrapped at right border
+ 6-4 70H XF_VERT_ALIGN . Vertical alignment (see above)
+ 7 1 XF_ROTATION: Text rotation angle (see above)
+ 8 1 Bit Mask Contents
+ 3-0 0FH Indent level
+ 4 10H 1 = Shrink content to fit into cell
+ 5 merge
+ 7-6 C0H Text direction (BIFF8X only)
+ 00b = According to context
+ 01b = Left-to-right
+ 10b = Right-to-left
+ 9 1 Bit Mask Contents
+ 7-2 FCH XF_USED_ATTRIB . Used attributes (see above)
+ 10 4 Cell border lines and background area:
+ Bit Mask Contents
+ 3-0 0000000FH Left line style
+ 7-4 000000F0H Right line style
+ 11-8 00000F00H Top line style
+ 15-12 0000F000H Bottom line style
+ 22-16 007F0000H Colour index for left line colour
+ 29-23 3F800000H Colour index for right line colour
+ 30 40000000H 1 = Diagonal line from top left to right bottom
+ 31 80000000H 1 = Diagonal line from bottom left to right top
+ 14 4 Bit Mask Contents
+ 6-0 0000007FH Colour index for top line colour
+ 13-7 00003F80H Colour index for bottom line colour
+ 20-14 001FC000H Colour index for diagonal line colour
+ 24-21 01E00000H Diagonal line style
+ 31-26 FC000000H Fill pattern
+ 18 2 Bit Mask Contents
+ 6-0 007FH Colour index for pattern colour
+ 13-7 3F80H Colour index for pattern background
+
+ """
+ _REC_ID = 0x00E0
+
+ def __init__(self, xf, xftype='cell'):
+ font_xf_idx, fmt_str_xf_idx, alignment, borders, pattern, protection = xf
+ fnt = pack('<H', font_xf_idx)
+ fmt = pack('<H', fmt_str_xf_idx)
+ if xftype == 'cell':
+ prt = pack('<H',
+ ((protection.cell_locked & 0x01) << 0) |
+ ((protection.formula_hidden & 0x01) << 1)
+ )
+ else:
+ prt = pack('<H', 0xFFF5)
+ aln = pack('B',
+ ((alignment.horz & 0x07) << 0) |
+ ((alignment.wrap & 0x01) << 3) |
+ ((alignment.vert & 0x07) << 4)
+ )
+ rot = pack('B', alignment.rota)
+ txt = pack('B',
+ ((alignment.inde & 0x0F) << 0) |
+ ((alignment.shri & 0x01) << 4) |
+ ((alignment.merg & 0x01) << 5) |
+ ((alignment.dire & 0x03) << 6)
+ )
+ if xftype == 'cell':
+ used_attr = pack('B', 0xF8)
+ else:
+ used_attr = pack('B', 0xF4)
+
+ if borders.left == borders.NO_LINE:
+ borders.left_colour = 0x00
+ if borders.right == borders.NO_LINE:
+ borders.right_colour = 0x00
+ if borders.top == borders.NO_LINE:
+ borders.top_colour = 0x00
+ if borders.bottom == borders.NO_LINE:
+ borders.bottom_colour = 0x00
+ if borders.diag == borders.NO_LINE:
+ borders.diag_colour = 0x00
+ brd1 = pack('<L',
+ ((borders.left & 0x0F) << 0 ) |
+ ((borders.right & 0x0F) << 4 ) |
+ ((borders.top & 0x0F) << 8 ) |
+ ((borders.bottom & 0x0F) << 12) |
+ ((borders.left_colour & 0x7F) << 16) |
+ ((borders.right_colour & 0x7F) << 23) |
+ ((borders.need_diag1 & 0x01) << 30) |
+ ((borders.need_diag2 & 0x01) << 31)
+ )
+ brd2 = pack('<L',
+ ((borders.top_colour & 0x7F) << 0 ) |
+ ((borders.bottom_colour & 0x7F) << 7 ) |
+ ((borders.diag_colour & 0x7F) << 14) |
+ ((borders.diag & 0x0F) << 21) |
+ ((pattern.pattern & 0x3F) << 26)
+ )
+ pat = pack('<H',
+ ((pattern.pattern_fore_colour & 0x7F) << 0 ) |
+ ((pattern.pattern_back_colour & 0x7F) << 7 )
+ )
+ self._rec_data = fnt + fmt + prt + \
+ aln + rot + txt + used_attr + \
+ brd1 + brd2 + \
+ pat
+
+class StyleRecord(BiffRecord):
+ """
+ STYLE record for user-defined cell styles, BIFF3-BIFF8:
+ Offset Size Contents
+ 0 2 Bit Mask Contents
+ 11-0 0FFFH Index to style XF record
+ 15 8000H Always 0 for user-defined styles
+ 2 var. BIFF2-BIFF7: Non-empty byte string, 8-bit string length
+ BIFF8: Non-empty Unicode string, 16-bit string length
+ STYLE record for built-in cell styles, BIFF3-BIFF8:
+ Offset Size Contents
+ 0 2 Bit Mask Contents
+ 11-0 0FFFH Index to style XF record
+ 15 8000H Always 1 for built-in styles
+ 2 1 Identifier of the built-in cell style:
+ 00H = Normal
+ 01H = RowLevel_lv (see next field)
+ 02H = ColLevel_lv (see next field)
+ 03H = Comma
+ 04H = Currency
+ 05H = Percent
+ 06H = Comma [0] (BIFF4-BIFF8)
+ 07H = Currency [0] (BIFF4-BIFF8)
+ 08H = Hyperlink (BIFF8)
+ 09H = Followed Hyperlink (BIFF8)
+ 3 1 Level for RowLevel or ColLevel style
+ (zero-based, lv), FFH otherwise
+ The RowLevel and ColLevel styles specify the formatting of subtotal
+ cells in a specific outline level. The level is specified by the last
+ field in the STYLE record. Valid values are 0-6 for the outline levels
+ 1-7.
+ """
+ _REC_ID = 0x0293
+
+ def __init__(self):
+ self._rec_data = pack('<HBB', 0x8000, 0x00, 0xFF)
+ # TODO: implement user-defined styles???
+
+
+class PaletteRecord(BiffRecord):
+ """
+ This record contains the definition of all user-defined colours
+ available for cell and object formatting.
+
+ Record PALETTE, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 Number of following colours (nm). Contains 16 in BIFF3-BIFF4 and 56 in BIFF5-BIFF8.
+ 2 4*nm List of nm RGB colours
+
+ The following table shows how colour indexes are used in other records:
+
+ Colour index Resulting colour or internal list index
+ 00H Built-in Black (R = 00H, G = 00H, B = 00H)
+ 01H Built-in White (R = FFH, G = FFH, B = FFH)
+ 02H Built-in Red (R = FFH, G = 00H, B = 00H)
+ 03H Built-in Green (R = 00H, G = FFH, B = 00H)
+ 04H Built-in Blue (R = 00H, G = 00H, B = FFH)
+ 05H Built-in Yellow (R = FFH, G = FFH, B = 00H)
+ 06H Built-in Magenta (R = FFH, G = 00H, B = FFH)
+ 07H Built-in Cyan (R = 00H, G = FFH, B = FFH)
+ 08H First user-defined colour from the PALETTE record (entry 0 from record colour list)
+ .........................
+
+ 17H (BIFF3-BIFF4) Last user-defined colour from the PALETTE record (entry 15 or 55 from record colour list)
+ 3FH (BIFF5-BIFF8)
+
+ 18H (BIFF3-BIFF4) System window text colour for border lines (used in records XF, CF, and
+ 40H (BIFF5-BIFF8) WINDOW2 (BIFF8 only))
+
+ 19H (BIFF3-BIFF4) System window background colour for pattern background (used in records XF, and CF)
+ 41H (BIFF5-BIFF8)
+
+ 43H System face colour (dialogue background colour)
+ 4DH System window text colour for chart border lines
+ 4EH System window background colour for chart areas
+ 4FH Automatic colour for chart border lines (seems to be always Black)
+ 50H System ToolTip background colour (used in note objects)
+ 51H System ToolTip text colour (used in note objects)
+ 7FFFH System window text colour for fonts (used in records FONT, EFONT, and CF)
+
+ """
+ _REC_ID = 0x0092
+
+
+class BoundSheetRecord(BiffRecord):
+ """
+ This record is located in the workbook globals area and represents
+ a sheet inside of the workbook. For each sheet a BOUNDSHEET record
+ is written. It stores the sheet name and a stream offset to the BOF
+ record within the workbook stream. The record is also known
+ as BUNDLESHEET.
+
+ Record BOUNDSHEET, BIFF5-BIFF8:
+ Offset Size Contents
+ 0 4 Absolute stream position of the BOF record of the sheet represented by this record. This
+ field is never encrypted in protected files.
+ 4 1 Visibility:
+ 00H = Visible
+ 01H = Hidden
+ 02H = Strong hidden
+ 5 1 Sheet type:
+ 00H = Worksheet
+ 02H = Chart
+ 06H = Visual Basic module
+ 6 var. Sheet name:
+ BIFF5/BIFF7: Byte string, 8-bit string length
+ BIFF8: Unicode string, 8-bit string length
+ """
+ _REC_ID = 0x0085
+
+ def __init__(self, stream_pos, visibility, sheetname, encoding='ascii'):
+ usheetname = upack1(sheetname, encoding)
+ uusheetname_len = len(usheetname)
+
+ self._rec_data = pack('<LBB%ds' % uusheetname_len, stream_pos, visibility, 0x00, usheetname)
+
+
+class ContinueRecord(BiffRecord):
+ """
+ Whenever the content of a record exceeds the given limits (see table),
+ the record must be split. Several CONTINUE records containing the
+ additional data are added after the parent record.
+
+ BIFF version Maximum data size of a record
+ BIFF2-BIFF7 2080 bytes (2084 bytes including record header)
+ BIFF8 8224 bytes (8228 bytes including record header) (0x2020)
+
+ Record CONTINUE, BIFF2-BIFF8:
+ Offset Size Contents
+ 0 var. Data continuation of the previous record
+
+ Unicode strings are split in a special way. At the beginning of each
+ CONTINUE record the option flags byte is repeated. Only the character
+ size flag will be set in this flags byte, the Rich-Text flag and the
+ Far-East flag are set to zero. In each CONTINUE record it is possible
+ that the character size changes from 8-bit characters to 16-bit
+ characters and vice versa.
+
+ Never a Unicode string is split until and including the first
+ character. That means, all header fields (string length, option flags,
+ optional Rich-Text size, and optional Far-East data size) and the first
+ character of the string have to occur together in the leading record,
+ or have to be moved completely into the CONTINUE record. Formatting
+ runs cannot be split between their components (character index and FONT
+ record index). If a string is split between two formatting runs, the
+ option flags field will not be repeated in the CONTINUE record.
+ """
+ _REC_ID = 0x003C
+
+
+class SSTRecord(BiffRecord):
+ """
+ This record contains a list of all strings used anywhere in the
+ workbook. Each string occurs only once. The workbook uses indexes into
+ the list to reference the strings.
+
+ Record SST, BIFF8:
+ Offset Size Contents
+ 0 4 Total number of strings in the workbook (see below)
+ 4 4 Number of following strings (nm)
+ 8 var. List of nm Unicode strings, 16-bit string length
+
+ The first field of the SST record counts the total occurrence
+ of strings in the workbook. For instance, the string AAA is used
+ 3 times and the string BBB is used 2 times. The first field contains
+ 5 and the second field contains 2, followed by the two strings.
+ """
+ _REC_ID = 0x00FC
+
+
+class ExtSSTRecord(BiffRecord):
+ """
+ This record occurs in conjunction with the SST record. It is used
+ by Excel to create a hash table with stream offsets to the SST record
+ to optimise string search operations. Excel may not shorten this record
+ if strings are deleted from the shared string table, so the last part
+ might contain invalid data. The stream indexes in this record divide
+ the SST into portions containing a constant number of strings.
+
+ Record EXTSST, BIFF8:
+
+ Offset Size Contents
+ 0 2 Number of strings in a portion, this number is >=8
+ 2 var. List of OFFSET structures for all portions. Each OFFSET contains the following data:
+ Offset Size Contents
+ 0 4 Absolute stream position of first string of the portion
+ 4 2 Position of first string of the portion inside of current record,
+ including record header. This counter restarts at zero, if the SST
+ record is continued with a CONTINUE record.
+ 6 2 Not used
+ """
+ _REC_ID = 0x00FF
+
+ def __init__(self, sst_stream_pos, str_placement, portions_len):
+ extsst = {}
+ abs_stream_pos = sst_stream_pos
+ str_counter = 0
+ portion_counter = 0
+ while str_counter < len(str_placement):
+ str_chunk_num, pos_in_chunk = str_placement[str_counter]
+ if str_chunk_num <> portion_counter:
+ portion_counter = str_chunk_num
+ abs_stream_pos += portions_len[portion_counter-1]
+ #print hex(abs_stream_pos)
+ str_stream_pos = abs_stream_pos + pos_in_chunk + 4 # header
+ extsst[str_counter] = (pos_in_chunk, str_stream_pos)
+ str_counter += 1
+
+ exsst_str_count_delta = max(8, len(str_placement)*8/0x2000) # maybe smth else?
+ self._rec_data = pack('<H', exsst_str_count_delta)
+ str_counter = 0
+ while str_counter < len(str_placement):
+ self._rec_data += pack('<IHH', extsst[str_counter][1], extsst[str_counter][0], 0)
+ str_counter += exsst_str_count_delta
+
+class DimensionsRecord(BiffRecord):
+ """
+ Record DIMENSIONS, BIFF8:
+
+ Offset Size Contents
+ 0 4 Index to first used row
+ 4 4 Index to last used row, increased by 1
+ 8 2 Index to first used column
+ 10 2 Index to last used column, increased by 1
+ 12 2 Not used
+ """
+ _REC_ID = 0x0200
+ def __init__(self, first_used_row, last_used_row, first_used_col, last_used_col):
+ if first_used_row > last_used_row or first_used_col > last_used_col:
+ # Special case: empty worksheet
+ first_used_row = first_used_col = 0
+ last_used_row = last_used_col = -1
+ self._rec_data = pack('<2L3H',
+ first_used_row, last_used_row + 1,
+ first_used_col, last_used_col + 1,
+ 0x00)
+
+
+class Window2Record(BiffRecord):
+ """
+ Record WINDOW2, BIFF8:
+
+ Offset Size Contents
+ 0 2 Option flags (see below)
+ 2 2 Index to first visible row
+ 4 2 Index to first visible column
+ 6 2 Colour index of grid line colour. Note that in BIFF2-BIFF7 an RGB colour is
+ written instead.
+ 8 2 Not used
+ 10 2 Cached magnification factor in page break preview (in percent); 0 = Default (60%)
+ 12 2 Cached magnification factor in normal view (in percent); 0 = Default (100%)
+ 14 4 Not used
+
+ In BIFF8 this record stores used magnification factors for page break
+ preview and normal view. These values are used to restore the
+ magnification, when the view is changed. The real magnification of the
+ currently active view is stored in the SCL record. The type of the
+ active view is stored in the option flags field (see below).
+
+ 0 0001H 0 = Show formula results 1 = Show formulas
+ 1 0002H 0 = Do not show grid lines 1 = Show grid lines
+ 2 0004H 0 = Do not show sheet headers 1 = Show sheet headers
+ 3 0008H 0 = Panes are not frozen 1 = Panes are frozen (freeze)
+ 4 0010H 0 = Show zero values as empty cells 1 = Show zero values
+ 5 0020H 0 = Manual grid line colour 1 = Automatic grid line colour
+ 6 0040H 0 = Columns from left to right 1 = Columns from right to left
+ 7 0080H 0 = Do not show outline symbols 1 = Show outline symbols
+ 8 0100H 0 = Keep splits if pane freeze is removed 1 = Remove splits if pane freeze is removed
+ 9 0200H 0 = Sheet not selected 1 = Sheet selected (BIFF5-BIFF8)
+ 10 0400H 0 = Sheet not visible 1 = Sheet visible (BIFF5-BIFF8)
+ 11 0800H 0 = Show in normal view 1 = Show in page break preview (BIFF8)
+
+ The freeze flag specifies, if a following PANE record describes unfrozen or frozen panes.
+
+ *** This class appends the optional SCL record ***
+
+ Record SCL, BIFF4-BIFF8:
+
+ This record stores the magnification of the active view of the current worksheet.
+ In BIFF8 this can be either the normal view or the page break preview.
+ This is determined in the WINDOW2 record. The SCL record is part of the
+ Sheet View Settings Block.
+
+ Offset Size Contents
+ 0 2 Numerator of the view magnification fraction (num)
+ 2 2 Denumerator [denominator] of the view magnification fraction (den)
+ The magnification is stored as reduced fraction. The magnification results from num/den.
+
+ SJM note: Excel expresses (e.g.) 25% in reduced form i.e. 1/4. Reason unknown. This code
+ writes 25/100, and Excel is happy with that.
+
+ """
+ _REC_ID = 0x023E
+
+ def __init__(self, options, first_visible_row, first_visible_col,
+ grid_colour, preview_magn, normal_magn, scl_magn):
+ self._rec_data = pack('<7HL', options,
+ first_visible_row, first_visible_col,
+ grid_colour,
+ 0x00,
+ preview_magn, normal_magn,
+ 0x00L)
+ if scl_magn:
+ self._scl_rec = pack('<4H', 0x00A0, 4, scl_magn, 100)
+ else:
+ self._scl_rec = ''
+
+ def get(self):
+ return self.get_rec_header() + self._rec_data + self._scl_rec
+
+
+class PanesRecord(BiffRecord):
+ """
+ This record stores the position of window panes. It is part of the Sheet
+ View Settings Block. If the sheet does not contain any splits, this
+ record will not occur.
+ A sheet can be split in two different ways, with unfrozen panes or with
+ frozen panes. A flag in the WINDOW2 record specifies, if the panes are
+ frozen, which affects the contents of this record.
+
+ Record PANE, BIFF2-BIFF8:
+ Offset Size Contents
+ 0 2 Position of the vertical split
+ (px, 0 = No vertical split):
+ Unfrozen pane: Width of the left pane(s)
+ (in twips = 1/20 of a point)
+ Frozen pane: Number of visible
+ columns in left pane(s)
+ 2 2 Position of the horizontal split
+ (py, 0 = No horizontal split):
+ Unfrozen pane: Height of the top pane(s)
+ (in twips = 1/20 of a point)
+ Frozen pane: Number of visible
+ rows in top pane(s)
+ 4 2 Index to first visible row
+ in bottom pane(s)
+ 6 2 Index to first visible column
+ in right pane(s)
+ 8 1 Identifier of pane with active
+ cell cursor
+ [9] 1 Not used (BIFF5-BIFF8 only, not written
+ in BIFF2-BIFF4)
+
+ If the panes are frozen, pane 0 is always active, regardless
+ of the cursor position. The correct identifiers for all possible
+ combinations of visible panes are shown in the following pictures.
+
+ px = 0, py = 0 px = 0, py > 0
+ -------------------------- ------------|-------------
+ | | | |
+ | | | 3 |
+ | | | |
+ - 3 - --------------------------
+ | | | |
+ | | | 2 |
+ | | | |
+ -------------------------- ------------|-------------
+
+ px > 0, py = 0 px > 0, py > 0
+ ------------|------------- ------------|-------------
+ | | | | | |
+ | | | | 3 | 2 |
+ | | | | | |
+ - 3 | 1 - --------------------------
+ | | | | | |
+ | | | | 1 | 0 |
+ | | | | | |
+ ------------|------------- ------------|-------------
+ """
+ _REC_ID = 0x0041
+ def __init__(self, px, py, first_row_bottom, first_col_right, active_pane):
+ self._rec_data = pack('<5H',
+ px, py,
+ first_row_bottom, first_col_right,
+ active_pane)
+
+
+class RowRecord(BiffRecord):
+ """
+ This record contains the properties of a single row in a sheet. Rows
+ and cells in a sheet are divided into blocks of 32 rows.
+
+ Record ROW, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 Index of this row
+ 2 2 Index to column of the first cell which is described by a cell record
+ 4 2 Index to column of the last cell which is described by a cell record,
+ increased by 1
+ 6 2 Bit Mask Contents
+ 14-0 7FFFH Height of the row, in twips = 1/20 of a point
+ 15 8000H 0 = Row has custom height; 1 = Row has default height
+ 8 2 Not used
+ 10 2 In BIFF3-BIFF4 this field contains a relative offset
+ to calculate stream position of the first cell record
+ for this row. In BIFF5-BIFF8 this field is not used
+ anymore, but the DBCELL record instead.
+ 12 4 Option flags and default row formatting:
+ Bit Mask Contents
+ 2-0 00000007H Outline level of the row
+ 4 00000010H 1 = Outline group starts or ends here (depending
+ on where the outline buttons are located,
+ see WSBOOL record), and is collapsed
+ 5 00000020H 1 = Row is hidden (manually, or by a filter or outline group)
+ 6 00000040H 1 = Row height and default font height do not match
+ 7 00000080H 1 = Row has explicit default format (fl)
+ 8 00000100H Always 1
+ 27-16 0FFF0000H If fl=1: Index to default XF record
+ 28 10000000H 1 = Additional space above the row. This flag is set,
+ if the upper border of at least one cell in this row
+ or if the lower border of at least one cell in the row
+ above is formatted with a thick line style.
+ Thin and medium line styles are not taken into account.
+ 29 20000000H 1 = Additional space below the row. This flag is set,
+ if the lower border of at least one cell in this row
+ or if the upper border of at least one cell in the row
+ below is formatted with a medium or thick line style.
+ Thin line styles are not taken into account.
+ """
+
+ _REC_ID = 0x0208
+
+ def __init__(self, index, first_col, last_col, height_options, options):
+ self._rec_data = pack('<6HL', index, first_col, last_col + 1,
+ height_options,
+ 0x00, 0x00,
+ options)
+
+class LabelSSTRecord(BiffRecord):
+ """
+ This record represents a cell that contains a string. It replaces the
+ LABEL record and RSTRING record used in BIFF2-BIFF7.
+ """
+ _REC_ID = 0x00FD
+
+ def __init__(self, row, col, xf_idx, sst_idx):
+ self._rec_data = pack('<3HL', row, col, xf_idx, sst_idx)
+
+
+class MergedCellsRecord(BiffRecord):
+ """
+ This record contains all merged cell ranges of the current sheet.
+
+ Record MERGEDCELLS, BIFF8:
+
+ Offset Size Contents
+ 0 var. Cell range address list with all merged ranges
+
+ ------------------------------------------------------------------
+
+ A cell range address list consists of a field with the number of ranges
+ and the list of the range addresses.
+
+ Cell range address list, BIFF8:
+
+ Offset Size Contents
+ 0 2 Number of following cell range addresses (nm)
+ 2 8*nm List of nm cell range addresses
+
+ ---------------------------------------------------------------------
+ Cell range address, BIFF8:
+
+ Offset Size Contents
+ 0 2 Index to first row
+ 2 2 Index to last row
+ 4 2 Index to first column
+ 6 2 Index to last column
+
+ """
+ _REC_ID = 0x00E5
+
+ def __init__(self, merged_list):
+ i = len(merged_list) - 1
+ while i >= 0:
+ j = 0
+ merged = ''
+ while (i >= 0) and (j < 0x403):
+ r1, r2, c1, c2 = merged_list[i]
+ merged += pack('<4H', r1, r2, c1, c2)
+ i -= 1
+ j += 1
+ self._rec_data += pack('<3H', self._REC_ID, len(merged) + 2, j) + \
+ merged
+
+ # for some reason Excel doesn't use CONTINUE
+ def get(self):
+ return self._rec_data
+
+class MulBlankRecord(BiffRecord):
+ """
+ This record represents a cell range of empty cells. All cells are
+ located in the same row.
+
+ Record MULBLANK, BIFF5-BIFF8:
+
+ Offset Size Contents
+ 0 2 Index to row
+ 2 2 Index to first column (fc)
+ 4 2*nc List of nc=lc-fc+1 16-bit indexes to XF records
+ 4+2*nc 2 Index to last column (lc)
+ """
+ _REC_ID = 0x00BE
+
+ def __init__(self, row, first_col, last_col, xf_index):
+ blanks_count = last_col-first_col+1
+ self._rec_data = pack('%dH' % blanks_count, *([xf_index]*blanks_count))
+ self._rec_data = pack('<2H', row, first_col) + self._rec_data + pack('<H', last_col)
+
+
+class BlankRecord(BiffRecord):
+ """
+ This record represents an empty cell.
+
+ Record BLANK, BIFF5-BIFF8:
+
+ Offset Size Contents
+ 0 2 Index to row
+ 2 2 Index to first column (fc)
+ 4 2 indexes to XF record
+ """
+ _REC_ID = 0x0201
+
+ def __init__(self, row, col, xf_index):
+ self._rec_data = pack('<3H', row, col, xf_index)
+
+
+class RKRecord(BiffRecord):
+ """
+ This record represents a cell that contains an RK value (encoded integer or
+ floating-point value). If a floating-point value cannot be encoded to an RK value,
+ a NUMBER record will be written.
+ """
+ _REC_ID = 0x027E
+
+ def __init__(self, row, col, xf_index, rk_encoded):
+ self._rec_data = pack('<3Hi', row, col, xf_index, rk_encoded)
+
+
+class NumberRecord(BiffRecord):
+ """
+ This record represents a cell that contains an IEEE-754 floating-point value.
+ """
+ _REC_ID = 0x0203
+
+ def __init__(self, row, col, xf_index, number):
+ self._rec_data = pack('<3Hd', row, col, xf_index, number)
+
+class BoolErrRecord(BiffRecord):
+ """
+ This record represents a cell that contains a boolean or error value.
+ """
+ _REC_ID = 0x0205
+
+ def __init__(self, row, col, xf_index, number, is_error):
+ self._rec_data = pack('<3HBB', row, col, xf_index, number, is_error)
+
+
+class FormulaRecord(BiffRecord):
+ """
+ Offset Size Contents
+ 0 2 Index to row
+ 2 2 Index to column
+ 4 2 Index to XF record
+ 6 8 Result of the formula
+ 14 2 Option flags:
+ Bit Mask Contents
+ 0 0001H 1 = Recalculate always
+ 1 0002H 1 = Calculate on open
+ 3 0008H 1 = Part of a shared formula
+ 16 4 Not used
+ 20 var. Formula data (RPN token array)
+
+ """
+ _REC_ID = 0x0006
+
+ def __init__(self, row, col, xf_index, rpn, calc_flags=0):
+ self._rec_data = pack('<3HQHL', row, col, xf_index, 0xFFFF000000000003, calc_flags & 3, 0) + rpn
+
+
+class GutsRecord(BiffRecord):
+ """
+ This record contains information about the layout of outline symbols.
+
+ Record GUTS, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 Width of the area to display row outlines (left of the sheet), in pixel
+ 2 2 Height of the area to display column outlines (above the sheet), in pixel
+ 4 2 Number of visible row outline levels (used row levels + 1; or 0, if not used)
+ 6 2 Number of visible column outline levels (used column levels + 1; or 0, if not used)
+
+ """
+
+ _REC_ID = 0x0080
+
+ def __init__(self, row_gut_width, col_gut_height, row_visible_levels, col_visible_levels):
+ self._rec_data = pack('<4H', row_gut_width, col_gut_height, row_visible_levels, col_visible_levels)
+
+class WSBoolRecord(BiffRecord):
+ """
+ This record stores a 16 bit value with Boolean options for the current
+ sheet. From BIFF5 on the "Save external linked values" option is moved
+ to the record BOOKBOOL.
+
+ Option flags of record WSBOOL, BIFF3-BIFF8:
+
+ Bit Mask Contents
+ 0 0001H 0 = Do not show automatic page breaks
+ 1 = Show automatic page breaks
+ 4 0010H 0 = Standard sheet
+ 1 = Dialogue sheet (BIFF5-BIFF8)
+ 5 0020H 0 = No automatic styles in outlines
+ 1 = Apply automatic styles to outlines
+ 6 0040H 0 = Outline buttons above outline group
+ 1 = Outline buttons below outline group
+ 7 0080H 0 = Outline buttons left of outline group
+ 1 = Outline buttons right of outline group
+ 8 0100H 0 = Scale printout in percent
+ 1 = Fit printout to number of pages
+ 9 0200H 0 = Save external linked values (BIFF3?BIFF4 only)
+ 1 = Do not save external linked values (BIFF3?BIFF4 only)
+ 10 0400H 0 = Do not show row outline symbols
+ 1 = Show row outline symbols
+ 11 0800H 0 = Do not show column outline symbols
+ 1 = Show column outline symbols
+ 13-12 3000H These flags specify the arrangement of windows.
+ They are stored in BIFF4 only.
+ 00 = Arrange windows tiled
+ 01 = Arrange windows horizontal
+ 10 = Arrange windows vertical112 = Arrange windows cascaded
+ The following flags are valid for BIFF4-BIFF8 only:
+ 14 4000H 0 = Standard expression evaluation
+ 1 = Alternative expression evaluation
+ 15 8000H 0 = Standard formula entries
+ 1 = Alternative formula entries
+
+ """
+ _REC_ID = 0x0081
+
+ def __init__(self, options):
+ self._rec_data = pack('<H', options)
+
+class ColInfoRecord(BiffRecord):
+ """
+ This record specifies the width for a given range of columns.
+ If a column does not have a corresponding COLINFO record,
+ the width specified in the record STANDARDWIDTH is used. If
+ this record is also not present, the contents of the record
+ DEFCOLWIDTH is used instead.
+ This record also specifies a default XF record to use for
+ cells in the columns that are not described by any cell record
+ (which contain the XF index for that cell). Additionally,
+ the option flags field contains hidden, outline, and collapsed
+ options applied at the columns.
+
+ Record COLINFO, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 Index to first column in the range
+ 2 2 Index to last column in the range
+ 4 2 Width of the columns in 1/256 of the width of the zero character, using default font
+ (first FONT record in the file)
+ 6 2 Index to XF record for default column formatting
+ 8 2 Option flags:
+ Bits Mask Contents
+ 0 0001H 1 = Columns are hidden
+ 10-8 0700H Outline level of the columns (0 = no outline)
+ 12 1000H 1 = Columns are collapsed
+ 10 2 Not used
+
+ """
+ _REC_ID = 0x007D
+
+ def __init__(self, first_col, last_col, width, xf_index, options):
+ self._rec_data = pack('<6H', first_col, last_col, width, xf_index, options, 0)
+
+class CalcModeRecord(BiffRecord):
+ """
+ This record is part of the Calculation Settings Block.
+ It specifies whether to calculate formulas manually,
+ automatically or automatically except for multiple table operations.
+
+ Record CALCMODE, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 FFFFH = automatic except for multiple table operations
+ 0000H = manually
+ 0001H = automatically (default)
+ """
+ _REC_ID = 0x000D
+
+ def __init__(self, calc_mode):
+ self._rec_data = pack('<h', calc_mode)
+
+
+class CalcCountRecord(BiffRecord):
+ """
+ This record is part of the Calculation Settings Block. It specifies the maximum
+ number of times the formulas should be iteratively calculated. This is a fail-safe
+ against mutually recursive formulas locking up a spreadsheet application.
+
+ Record CALCCOUNT, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 Maximum number of iterations allowed in circular references
+ """
+
+ _REC_ID = 0x000C
+
+ def __init__(self, calc_count):
+ self._rec_data = pack('<H', calc_count)
+
+class RefModeRecord(BiffRecord):
+ """
+ This record is part of the Calculation Settings Block.
+ It stores which method is used to show cell addresses in formulas.
+ The “RC” mode uses numeric indexes for rows and columns,
+ i.e. “R(1)C(-1)”, or “R1C1:R2C2”.
+ The “A1” mode uses characters for columns and numbers for rows,
+ i.e. “B1”, or “$A$1:$B$2”.
+
+ Record REFMODE, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = RC mode; 1 = A1 mode
+
+ """
+ _REC_ID = 0x00F
+
+ def __init__(self, ref_mode):
+ self._rec_data = pack('<H', ref_mode)
+
+class IterationRecord(BiffRecord):
+ """
+ This record is part of the Calculation Settings Block.
+ It stores if iterations are allowed while calculating recursive formulas.
+
+ Record ITERATION, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Iterations off; 1 = Iterations on
+ """
+ _REC_ID = 0x011
+
+ def __init__(self, iterations_on):
+ self._rec_data = pack('<H', iterations_on)
+
+class DeltaRecord(BiffRecord):
+ """
+ This record is part of the Calculation Settings Block.
+ It stores the maximum change of the result to exit an iteration.
+
+ Record DELTA, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 8 Maximum change in iteration
+ (IEEE 754 floating-point value,
+ 64bit double precision)
+ """
+ _REC_ID = 0x010
+
+ def __init__(self, delta):
+ self._rec_data = pack('<d', delta)
+
+class SaveRecalcRecord(BiffRecord):
+ """
+ This record is part of the Calculation Settings Block.
+ It contains the “Recalculate before save” option in
+ Excel's calculation settings dialogue.
+
+ Record SAVERECALC, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Do not recalculate;
+ 1 = Recalculate before saving the document
+
+ """
+ _REC_ID = 0x05F
+
+ def __init__(self, recalc):
+ self._rec_data = pack('<H', recalc)
+
+class PrintHeadersRecord(BiffRecord):
+ """
+ This record stores if the row and column headers
+ (the areas with row numbers and column letters) will be printed.
+
+ Record PRINTHEADERS, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Do not print row/column headers;
+ 1 = Print row/column headers
+ """
+ _REC_ID = 0x02A
+
+ def __init__(self, print_headers):
+ self._rec_data = pack('<H', print_headers)
+
+
+class PrintGridLinesRecord(BiffRecord):
+ """
+ This record stores if sheet grid lines will be printed.
+
+ Record PRINTGRIDLINES, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Do not print sheet grid lines;
+ 1 = Print sheet grid lines
+
+ """
+ _REC_ID = 0x02B
+
+ def __init__(self, print_grid):
+ self._rec_data = pack('<H', print_grid)
+
+
+class GridSetRecord(BiffRecord):
+ """
+ This record specifies if the option to print sheet grid lines
+ (record PRINTGRIDLINES) has ever been changed.
+
+ Record GRIDSET, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Print grid lines option never changed
+ 1 = Print grid lines option changed
+ """
+ _REC_ID = 0x082
+
+ def __init__(self, print_grid_changed):
+ self._rec_data = pack('<H', print_grid_changed)
+
+
+class DefaultRowHeightRecord(BiffRecord):
+ """
+ This record specifies the default height and default flags
+ for rows that do not have a corresponding ROW record.
+
+ Record DEFAULTROWHEIGHT, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 Option flags:
+ Bit Mask Contents
+ 0 0001H 1 = Row height and default font height do not match
+ 1 0002H 1 = Row is hidden
+ 2 0004H 1 = Additional space above the row
+ 3 0008H 1 = Additional space below the row
+ 2 2 Default height for unused rows, in twips = 1/20 of a point
+
+ """
+ _REC_ID = 0x0225
+
+ def __init__(self, options, def_height):
+ self._rec_data = pack('<2H', options, def_height)
+
+
+class DefColWidthRecord(BiffRecord):
+ """
+ This record specifies the default column width for columns that
+ do not have a specific width set using the record COLINFO or COLWIDTH.
+ This record has no effect, if a STANDARDWIDTH record is present in the file.
+
+ Record DEFCOLWIDTH, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 2 Column width in characters, using the width of the zero
+ character from default font (first FONT record in the file)
+ """
+ _REC_ID = 0x0055
+
+ def __init__(self, def_width):
+ self._rec_data = pack('<H', options, def_width)
+
+class HorizontalPageBreaksRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It contains all
+ horizontal manual page breaks.
+
+ Record HORIZONTALPAGEBREAKS, BIFF8:
+ Offset Size Contents
+ 0 2 Number of following row index structures (nm)
+ 2 6nm List of nm row index structures. Each row index
+ structure contains:
+ Offset Size Contents
+ 0 2 Index to first row below the page break
+ 2 2 Index to first column of this page break
+ 4 2 Index to last column of this page break
+
+ The row indexes in the lists must be ordered ascending.
+ If in BIFF8 a row contains several page breaks, they must be ordered
+ ascending by start column index.
+ """
+ _REC_ID = 0x001B
+
+ def __init__(self, breaks_list):
+ self._rec_data = pack('<H', len(breaks_list))
+ for r, c1, c2 in breaks_list:
+ self._rec_data += pack('<3H', r, c1, c2)
+
+class VerticalPageBreaksRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It contains all
+ vertical manual page breaks.
+
+ Record VERTICALPAGEBREAKS, BIFF8:
+ Offset Size Contents
+ 0 2 Number of following column index structures (nm)
+ 2 6nm List of nm column index structures. Each column index
+ structure contains:
+ Offset Size Contents
+ 0 2 Index to first column following the page
+ break
+ 2 2 Index to first row of this page break
+ 4 2 Index to last row of this page break
+
+ The column indexes in the lists must be ordered ascending.
+ If in BIFF8 a column contains several page breaks, they must be ordered
+ ascending by start row index.
+ """
+ _REC_ID = 0x001A
+
+ def __init__(self, breaks_list):
+ self._rec_data = pack('<H', len(breaks_list))
+ for r, c1, c2 in breaks_list:
+ self._rec_data += pack('<3H', r, c1, c2)
+
+class HeaderRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It specifies the
+ page header string for the current worksheet. If this record is not
+ present or completely empty (record size is 0), the sheet does not
+ contain a page header.
+
+ Record HEADER for non-empty page header, BIFF2-BIFF8:
+ Offset Size Contents
+ 0 var. Page header string
+ BIFF2-BIFF7: Non-empty byte string, 8bit string
+ length
+ BIFF8: Non-empty Unicode string, 16bit string length
+ The header string may contain special commands, i.e. placeholders for
+ the page number, current date, or text formatting attributes. These
+ fields are represented by single letters (exception: font name and
+ size, see below) with a leading ampersand ("&"). If the ampersand
+ is part of the regular header text, it will be duplicated ("&&"). The
+ page header is divided into 3 sections: the left, the centred, and the
+ right section. Each section is introduced by a special command. All
+ text and all commands following are part of the selected section. Each
+ section starts with the text formatting specified in the default font
+ (first FONT record in the file). Active formatting attributes from
+ a previous section do not go into the next section.
+
+ The following table shows all available commands:
+
+ Command Contents
+ && The "&" character itself
+ &L Start of the left section
+ &C Start of the centred section
+ &R Start of the right section
+ &P Current page number
+ &N Page count
+ &D Current date
+ &T Current time
+ &A Sheet name (BIFF5-BIFF8)
+ &F File name without path
+ &Z File path without file name (BIFF8X)
+ &G Picture (BIFF8X)
+ &B Bold on/off (BIFF2-BIFF4)
+ &I Italic on/off (BIFF2-BIFF4)
+ &U Underlining on/off
+ &E Double underlining on/off (BIFF5-BIFF8)
+ &S Strikeout on/off
+ &X Superscript on/off (BIFF5-BIFF8)
+ &Y Subscript on/off (BIFF5-BIFF8)
+ &"<fontname>" Set new font <fontname>
+ &"<fontname>,<fontstyle>"
+ Set new font with specified style <fontstyle>.
+ The style <fontstyle> is in most cases one of
+ "Regular", "Bold", "Italic", or "Bold Italic".
+ But this setting is dependent on the used font,
+ it may differ (localised style names, or "Standard",
+ "Oblique", ...). (BIFF5-BIFF8)
+ &<fontheight> Set font height in points (<fontheight> is a decimal value).
+ If this command is followed by a plain number to be printed
+ in the header, it will be separated from the font height
+ with a space character.
+
+ """
+ _REC_ID = 0x0014
+
+ def __init__(self, header_str):
+ self._rec_data = upack2(header_str)
+
+class FooterRecord(BiffRecord):
+ """
+ Semantic is equal to HEADER record
+ """
+ _REC_ID = 0x0015
+
+ def __init__(self, footer_str):
+ self._rec_data = upack2(footer_str)
+
+
+class HCenterRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It specifies if the
+ sheet is centred horizontally when printed.
+
+ Record HCENTER, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Print sheet left aligned
+ 1 = Print sheet centred horizontally
+
+ """
+ _REC_ID = 0x0083
+
+ def __init__(self, is_horz_center):
+ self._rec_data = pack('<H', is_horz_center)
+
+
+class VCenterRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It specifies if the
+ sheet is centred vertically when printed.
+
+ Record VCENTER, BIFF3-BIFF8:
+
+ Offset Size Contents
+ 0 2 0 = Print sheet aligned at top page border
+ 1 = Print sheet vertically centred
+
+ """
+ _REC_ID = 0x0084
+
+ def __init__(self, is_vert_center):
+ self._rec_data = pack('<H', is_vert_center)
+
+
+class LeftMarginRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It contains the left
+ page margin of the current worksheet.
+
+ Record LEFTMARGIN, BIFF2-BIFF8:
+
+ Offset Size Contents
+ 0 8 Left page margin in inches
+ (IEEE 754 floating-point value, 64bit double precision)
+
+ """
+ _REC_ID = 0x0026
+
+ def __init__(self, margin):
+ self._rec_data = pack('<d', margin)
+
+
+class RightMarginRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It contains the right
+ page margin of the current worksheet.
+
+ Offset Size Contents
+ 0 8 Right page margin in inches
+ (IEEE 754 floating-point value, 64?bit double precision)
+
+ """
+ _REC_ID = 0x0027
+
+ def __init__(self, margin):
+ self._rec_data = pack('<d', margin)
+
+class TopMarginRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It contains the top
+ page margin of the current worksheet.
+
+ Offset Size Contents
+ 0 8 Top page margin in inches
+ (IEEE 754 floating-point value, 64?bit double precision)
+
+ """
+ _REC_ID = 0x0028
+
+ def __init__(self, margin):
+ self._rec_data = pack('<d', margin)
+
+
+class BottomMarginRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It contains the bottom
+ page margin of the current worksheet.
+
+ Offset Size Contents
+ 0 8 Bottom page margin in inches
+ (IEEE 754 floating-point value, 64?bit double precision)
+
+ """
+ _REC_ID = 0x0029
+
+ def __init__(self, margin):
+ self._rec_data = pack('<d', margin)
+
+class SetupPageRecord(BiffRecord):
+ """
+ This record is part of the Page Settings Block. It stores the page
+ format settings of the current sheet. The pages may be scaled in
+ percent or by using an absolute number of pages. This setting is
+ located in the WSBOOL record. If pages are scaled in percent,
+ the scaling factor in this record is used, otherwise the "Fit to
+ pages" values. One of the "Fit to pages" values may be 0. In this case
+ the sheet is scaled to fit only to the other value.
+
+ Record SETUP, BIFF5-BIFF8:
+
+ Offset Size Contents
+ 0 2 Paper size (see below)
+ 2 2 Scaling factor in percent
+ 4 2 Start page number
+ 6 2 Fit worksheet width to this number of pages
+ (0 = use as many as needed)
+ 8 2 Fit worksheet height to this number of pages
+ (0 = use as many as needed)
+ 10 2 Option flags:
+ Bit Mask Contents
+ 0 0001H 0 = Print pages in columns
+ 1 = Print pages in rows
+ 1 0002H 0 = Landscape
+ 1 = Portrait
+ 2 0004H 1 = Paper size, scaling factor,
+ paper orientation (portrait/landscape),
+ print resolution and number of copies
+ are not initialised
+ 3 0008H 0 = Print coloured
+ 1 = Print black and white
+ 4 0010H 0 = Default print quality
+ 1 = Draft quality
+ 5 0020H 0 = Do not print cell notes
+ 1 = Print cell notes
+ 6 0040H 0 = Paper orientation setting is valid
+ 1 = Paper orientation setting not
+ initialised
+ 7 0080H 0 = Automatic page numbers
+ 1 = Use start page number
+ The following flags are valid for BIFF8 only:
+ 9 0200H 0 = Print notes as displayed
+ 1 = Print notes at end of sheet
+ 11-10 0C00H 00 = Print errors as displayed
+ 01 = Do not print errors
+ 10 = Print errors as "--"
+ 11 = Print errors as "#N/A!"
+ 12 2 Print resolution in dpi
+ 14 2 Vertical print resolution in dpi
+ 16 8 Header margin (IEEE 754 floating-point value,
+ 64bit double precision)
+ 24 8 Footer margin (IEEE 754 floating-point value,
+ 64bit double precision)
+ 32 2 Number of copies to print
+
+
+ PAPER TYPES:
+
+ Index Paper type Paper size
+ 0 Undefined
+ 1 Letter 8 1/2" x 11"
+ 2 Letter small 8 1/2" x 11"
+ 3 Tabloid 11" x 17"
+ 4 Ledger 17" x 11"
+ 5 Legal 8 1/2" x 14"
+ 6 Statement 5 1/2" x 8 1/2"
+ 7 Executive 7 1/4" x 10 1/2"
+ 8 A3 297mm x 420mm
+ 9 A4 210mm x 297mm
+ 10 A4 small 210mm x 297mm
+ 11 A5 148mm x 210mm
+ 12 B4 (JIS) 257mm x 364mm
+ 13 B5 (JIS) 182mm x 257mm
+ 14 Folio 8 1/2" x 13"
+ 15 Quarto 215mm x 275mm
+ 16 10x14 10" x 14"
+ 17 11x17 11" x 17"
+ 18 Note 8 1/2" x 11"
+ 19 Envelope #9 3 7/8" x 8 7/8"
+ 20 Envelope #10 4 1/8" x 9 1/2"
+ 21 Envelope #11 4 1/2" x 10 3/8"
+ 22 Envelope #12 4 3/4" x 11"
+ 23 Envelope #14 5" x 11 1/2"
+ 24 C 17" x 22"
+ 25 D 22" x 34"
+ 26 E 34" x 44"
+ 27 Envelope DL 110mm x 220mm
+ 28 Envelope C5 162mm x 229mm
+ 29 Envelope C3 324mm x 458mm
+ 30 Envelope C4 229mm x 324mm
+ 31 Envelope C6 114mm x 162mm
+ 32 Envelope C6/C5 114mm x 229mm
+ 33 B4 (ISO) 250mm x 353mm
+ 34 B5 (ISO) 176mm x 250mm
+ 35 B6 (ISO) 125mm x 176mm
+ 36 Envelope Italy 110mm x 230mm
+ 37 Envelope Monarch 3 7/8" x 7 1/2"
+ 38 63/4 Envelope 3 5/8" x 6 1/2"
+ 39 US Standard Fanfold 14 7/8" x 11"
+ 40 German Std. Fanfold 8 1/2" x 12"
+ 41 German Legal Fanfold 8 1/2" x 13"
+ 42 B4 (ISO) 250mm x 353mm
+ 43 Japanese Postcard 100mm x 148mm
+ 44 9x11 9" x 11"
+ 45 10x11 10" x 11"
+ 46 15x11 15" x 11"
+ 47 Envelope Invite 220mm x 220mm
+ 48 Undefined
+ 49 Undefined
+ 50 Letter Extra 9 1/2" x 12"
+ 51 Legal Extra 9 1/2" x 15"
+ 52 Tabloid Extra 11 11/16" x 18"
+ 53 A4 Extra 235mm x 322mm
+ 54 Letter Transverse 8 1/2" x 11"
+ 55 A4 Transverse 210mm x 297mm
+ 56 Letter Extra Transv. 9 1/2" x 12"
+ 57 Super A/A4 227mm x 356mm
+ 58 Super B/A3 305mm x 487mm
+ 59 Letter Plus 8 1/2" x 12 11/16"
+ 60 A4 Plus 210mm x 330mm
+ 61 A5 Transverse 148mm x 210mm
+ 62 B5 (JIS) Transverse 182mm x 257mm
+ 63 A3 Extra 322mm x 445mm
+ 64 A5 Extra 174mm x 235mm
+ 65 B5 (ISO) Extra 201mm x 276mm
+ 66 A2 420mm x 594mm
+ 67 A3 Transverse 297mm x 420mm
+ 68 A3 Extra Transverse 322mm x 445mm
+ 69 Dbl. Japanese Postcard 200mm x 148mm
+ 70 A6 105mm x 148mm
+ 71
+ 72
+ 73
+ 74
+ 75 Letter Rotated 11" x 8 1/2"
+ 76 A3 Rotated 420mm x 297mm
+ 77 A4 Rotated 297mm x 210mm
+ 78 A5 Rotated 210mm x 148mm
+ 79 B4 (JIS) Rotated 364mm x 257mm
+ 80 B5 (JIS) Rotated 257mm x 182mm
+ 81 Japanese Postcard Rot. 148mm x 100mm
+ 82 Dbl. Jap. Postcard Rot. 148mm x 200mm
+ 83 A6 Rotated 148mm x 105mm
+ 84
+ 85
+ 86
+ 87
+ 88 B6 (JIS) 128mm x 182mm
+ 89 B6 (JIS) Rotated 182mm x 128mm
+ 90 12x11 12" x 11"
+
+ """
+ _REC_ID = 0x00A1
+ def __init__(self, paper, scaling, start_num, fit_width_to, fit_height_to,
+ options,
+ hres, vres,
+ header_margin, footer_margin,
+ num_copies):
+ self._rec_data = pack('<8H2dH', paper, scaling, start_num,
+ fit_width_to, fit_height_to, \
+ options,
+ hres, vres,
+ header_margin, footer_margin,
+ num_copies)
+
+class NameRecord(BiffRecord):
+ """
+ This record is part of a Link Table. It contains the name and the token
+ array of an internal defined name. Token arrays of defined names
+ contain tokens with aberrant token classes.
+
+ Record NAME, BIFF5/BIFF7:
+ Offset Size Contents
+ 0 2 Option flags, see below
+ 2 1 Keyboard shortcut (only for command macro names, see below)
+ 3 1 Length of the name (character count, ln)
+ 4 2 Size of the formula data (sz)
+ 6 2 0 = Global name, otherwise index to EXTERNSHEET record (one-based)
+ 8 2 0 = Global name, otherwise index to sheet (one-based)
+ 10 1 Length of menu text (character count, lm)
+ 11 1 Length of description text (character count, ld)
+ 12 1 Length of help topic text (character count, lh)
+ 13 1 Length of status bar text (character count, ls)
+ 14 ln Character array of the name
+ 14+ln sz Formula data (RPN token array without size field, 4)
+ 14+ln+sz lm Character array of menu text
+ var. ld Character array of description text
+ var. lh Character array of help topic text
+ var. ls Character array of status bar text
+
+ Record NAME, BIFF8:
+ Offset Size Contents
+ 0 2 Option flags, see below
+ 2 1 Keyboard shortcut (only for command macro names, see below)
+ 3 1 Length of the name (character count, ln)
+ 4 2 Size of the formula data (sz)
+ 6 2 Not used
+ 8 2 0 = Global name, otherwise index to sheet (one-based)
+ 10 1 Length of menu text (character count, lm)
+ 11 1 Length of description text (character count, ld)
+ 12 1 Length of help topic text (character count, lh)
+ 13 1 Length of status bar text (character count, ls)
+ 14 var. Name (Unicode string without length field, 3.4)
+ var. sz Formula data (RPN token array without size field, 4)
+ [var.] var. (optional, only if lm > 0) Menu text (Unicode string without length field, 3.4)
+ [var.] var. (optional, only if ld > 0) Description text (Unicode string without length field, 3.4)
+ [var.] var. (optional, only if lh > 0) Help topic text (Unicode string without length field, 3.4)
+ [var.] var. (optional, only if ls > 0) Status bar text (Unicode string without length field, 3.4)
+ """
+ _REC_ID = 0x0018
+
+ def __init__(self, options, keyboard_shortcut, name, sheet_index, rpn, menu_text='', desc_text='', help_text='', status_text=''):
+ if type(name) == int:
+ uname = chr(name)
+ else:
+ uname = upack1(name)[1:]
+ uname_len = len(uname)
+
+ #~ self._rec_data = pack('<HBBHHHBBBB%ds%ds' % (uname_len, len(rpn)), options, keyboard_shortcut, uname_len, len(rpn), 0x0000, sheet_index, len(menu_text), len(desc_text), len(help_text), len(status_text), uname, rpn) + menu_text + desc_text + help_text + status_text
+ self._rec_data = pack('<HBBHHHBBBBB%ds%ds' % (uname_len, len(rpn)), options, keyboard_shortcut, uname_len, len(rpn), 0x0000, sheet_index, 0x00, len(menu_text), len(desc_text), len(help_text), len(status_text), uname, rpn) + menu_text + desc_text + help_text + status_text
+
+# Excel (both 2003 and 2007) don't like refs
+# split over a record boundary, which is what the
+# standard BiffRecord.get method does.
+
+# 8224 max data bytes in a BIFF record
+# 6 bytes per ref
+# 1370 = floor((8224 - 2) / 6.0) max refs in a record
+
+_maxRefPerRecord = 1370
+
+class ExternSheetRecord(BiffRecord):
+ """
+ In BIFF8 the record stores a list with indexes to SUPBOOK
+ records (list of REF structures, 6.100). See 5.10.3 for
+ details about external references in BIFF8.
+
+ Record EXTERNSHEET, BIFF8:
+ Offset Size Contents
+ 0 2 Number of following REF structures (nm)
+ 2 6nm List of nm REF structures. Each REF contains the following data:
+ Offset Size Contents
+ 0 2 Index to SUPBOOK record
+ 2 2 Index to first SUPBOOK sheet
+ 4 2 Index to last SUPBOOK sheet
+ """
+ _REC_ID = 0x0017
+
+ def __init__(self, refs):
+
+ # do we always need this ref? or only if there are no refs?
+ # (I believe that if there are no refs then we should not generate the link table - Ruben)
+ #refs.insert(0, (0,0,0))
+
+ self.refs = refs
+
+ def get(self):
+ res = []
+ nrefs = len(self.refs)
+ for idx in xrange(0, nrefs, _maxRefPerRecord):
+ chunk = self.refs[idx:idx+_maxRefPerRecord]
+ krefs = len(chunk)
+ if idx: # CONTINUE record
+ header = pack("<HH", 0x003C, 6 * krefs)
+ else: # ExternSheetRecord
+ header = pack("<HHH", self._REC_ID, 6 * krefs + 2, nrefs)
+ res.append(header)
+ res.extend([pack("<HHH", *r) for r in chunk])
+ return ''.join(res)
+
+class SupBookRecord(BiffRecord):
+ """
+ This record mainly stores the URL of an external document
+ and a list of sheet names inside this document. Furthermore
+ it is used to store DDE and OLE object links, or to indicate
+ an internal 3D reference or an add-in function. See 5.10.3
+ for details about external references in BIFF8.
+
+ """
+ _REC_ID = 0x01AE
+
+class InternalReferenceSupBookRecord(SupBookRecord):
+ """
+ In each file occurs a SUPBOOK that is used for internal 3D
+ references. It stores the number of sheets of the own document.
+
+ Record SUPBOOK for 3D references, BIFF8:
+ Offset Size Contents
+ 0 2 Number of sheets in this document
+ 2 2 01H 04H (relict of BIFF5/BIFF7, the byte string "<04H>", see 3.9.1)
+
+ """
+
+ def __init__(self, num_sheets):
+ self._rec_data = pack('<HBB', num_sheets, 0x01, 0x04)
+
+class XcallSupBookRecord(SupBookRecord):
+ """
+ Add-in function names are stored in EXTERNNAME records following this record.
+
+ Offset Size Contents
+ 0 2 0001H
+ 2 2 01H 3AH (relict of BIFF5, the byte string ':', see EXTERNSHEET record, 5.41)
+
+ """
+
+ def __init__(self):
+ self._rec_data = pack('<HBB', 1, 0x01, 0x3A)
+
+
+class ExternnameRecord(BiffRecord):
+ """
+ Record EXTERNNAME for external names and Analysis add-in functions, BIFF5-BIFF8:
+ Offset Size Contents
+ 0 2 Option flags (see below)
+ 2 2 0 for global names, or:
+ BIFF5: One-based index to EXTERNSHEET record containing the sheet name,
+ BIFF8: One-based index to sheet list in preceding EXTERNALBOOK record.
+ 4 2 Not used
+ 6 var. BIFF5: Name (byte string, 8-bit string length, ?2.5.2).
+ BIFF8: Name (Unicode string, 8-bit string length, ?2.5.3).
+ See DEFINEDNAME record (?5.33) for a list of built-in names, if the built-in flag is set
+ in the option flags above.
+ var. var. Formula data (RPN token array, ?3)
+
+ Option flags for external names (BIFF5-BIFF8)
+ Bit Mask Contents
+ 0 0001H 0 = Standard name; 1 = Built-in name
+ 1 0002H 0 = Manual link; 1 = Automatic link (DDE links and OLE links only)
+ 2 0004H 1 = Picture link (DDE links and OLE links only)
+ 3 0008H 1 = This is the “StdDocumentName” identifier (DDE links only)
+ 4 0010H 1 = OLE link
+ 14-5 7FE0H Clipboard format of last successful update (DDE links and OLE links only)
+ 15 8000H 1 = Iconified picture link (BIFF8 OLE links only)
+ """
+ _REC_ID = 0x0023
+
+ def __init__(self, options=0, index=0, name=None, fmla=None):
+ self._rec_data = pack('<HHH', options, index, 0) + upack1(name) + fmla
+
diff --git a/tablib/packages/xlwt/Bitmap.py b/tablib/packages/xlwt/Bitmap.py
index 5da082b..d271665 100644
--- a/tablib/packages/xlwt/Bitmap.py
+++ b/tablib/packages/xlwt/Bitmap.py
@@ -1,258 +1,262 @@
-# Portions are Copyright (C) 2005 Roman V. Kiseliov
-# Portions are Copyright (c) 2004 Evgeny Filatov <fufff@users.sourceforge.net>
-# Portions are Copyright (c) 2002-2004 John McNamara (Perl Spreadsheet::WriteExcel)
-
-from .BIFFRecords import BiffRecord
-from struct import *
-
-
-def _size_col(sheet, col):
- return sheet.col_width(col)
-
-
-def _size_row(sheet, row):
- return sheet.row_height(row)
-
-
-def _position_image(sheet, row_start, col_start, x1, y1, width, height):
- """Calculate the vertices that define the position of the image as required by
- the OBJ record.
-
- +------------+------------+
- | A | B |
- +-----+------------+------------+
- | |(x1,y1) | |
- | 1 |(A1)._______|______ |
- | | | | |
- | | | | |
- +-----+----| BITMAP |-----+
- | | | | |
- | 2 | |______________. |
- | | | (B2)|
- | | | (x2,y2)|
- +---- +------------+------------+
-
- Example of a bitmap that covers some of the area from cell A1 to cell B2.
-
- Based on the width and height of the bitmap we need to calculate 8 vars:
- col_start, row_start, col_end, row_end, x1, y1, x2, y2.
- The width and height of the cells are also variable and have to be taken into
- account.
- The values of col_start and row_start are passed in from the calling
- function. The values of col_end and row_end are calculated by subtracting
- the width and height of the bitmap from the width and height of the
- underlying cells.
- The vertices are expressed as a percentage of the underlying cell width as
- follows (rhs values are in pixels):
-
- x1 = X / W *1024
- y1 = Y / H *256
- x2 = (X-1) / W *1024
- y2 = (Y-1) / H *256
-
- Where: X is distance from the left side of the underlying cell
- Y is distance from the top of the underlying cell
- W is the width of the cell
- H is the height of the cell
-
- Note: the SDK incorrectly states that the height should be expressed as a
- percentage of 1024.
-
- col_start - Col containing upper left corner of object
- row_start - Row containing top left corner of object
- x1 - Distance to left side of object
- y1 - Distance to top of object
- width - Width of image frame
- height - Height of image frame
-
- """
- # Adjust start column for offsets that are greater than the col width
- while x1 >= _size_col(sheet, col_start):
- x1 -= _size_col(sheet, col_start)
- col_start += 1
- # Adjust start row for offsets that are greater than the row height
- while y1 >= _size_row(sheet, row_start):
- y1 -= _size_row(sheet, row_start)
- row_start += 1
- # Initialise end cell to the same as the start cell
- row_end = row_start # Row containing bottom right corner of object
- col_end = col_start # Col containing lower right corner of object
- width = width + x1 - 1
- height = height + y1 - 1
- # Subtract the underlying cell widths to find the end cell of the image
- while (width >= _size_col(sheet, col_end)):
- width -= _size_col(sheet, col_end)
- col_end += 1
- # Subtract the underlying cell heights to find the end cell of the image
- while (height >= _size_row(sheet, row_end)):
- height -= _size_row(sheet, row_end)
- row_end += 1
- # Bitmap isn't allowed to start or finish in a hidden cell, i.e. a cell
- # with zero height or width.
- if ((_size_col(sheet, col_start) == 0) or (_size_col(sheet, col_end) == 0)
- or (_size_row(sheet, row_start) == 0) or (_size_row(sheet, row_end) == 0)):
- return
- # Convert the pixel values to the percentage value expected by Excel
- x1 = int(float(x1) / _size_col(sheet, col_start) * 1024)
- y1 = int(float(y1) / _size_row(sheet, row_start) * 256)
- # Distance to right side of object
- x2 = int(float(width) / _size_col(sheet, col_end) * 1024)
- # Distance to bottom of object
- y2 = int(float(height) / _size_row(sheet, row_end) * 256)
- return (col_start, x1, row_start, y1, col_end, x2, row_end, y2)
-
-
-class ObjBmpRecord(BiffRecord):
- _REC_ID = 0x005D # Record identifier
-
- def __init__(self, row, col, sheet, im_data_bmp, x, y, scale_x, scale_y):
- # Scale the frame of the image.
- width = im_data_bmp.width * scale_x
- height = im_data_bmp.height * scale_y
-
- # Calculate the vertices of the image and write the OBJ record
- coordinates = _position_image(sheet, row, col, x, y, width, height)
- # print coordinates
- col_start, x1, row_start, y1, col_end, x2, row_end, y2 = coordinates
-
- """Store the OBJ record that precedes an IMDATA record. This could be generalise
- to support other Excel objects.
-
- """
- cObj = 0x0001 # Count of objects in file (set to 1)
- OT = 0x0008 # Object type. 8 = Picture
- id = 0x0001 # Object ID
- grbit = 0x0614 # Option flags
- colL = col_start # Col containing upper left corner of object
- dxL = x1 # Distance from left side of cell
- rwT = row_start # Row containing top left corner of object
- dyT = y1 # Distance from top of cell
- colR = col_end # Col containing lower right corner of object
- dxR = x2 # Distance from right of cell
- rwB = row_end # Row containing bottom right corner of object
- dyB = y2 # Distance from bottom of cell
- cbMacro = 0x0000 # Length of FMLA structure
- Reserved1 = 0x0000 # Reserved
- Reserved2 = 0x0000 # Reserved
- icvBack = 0x09 # Background colour
- icvFore = 0x09 # Foreground colour
- fls = 0x00 # Fill pattern
- fAuto = 0x00 # Automatic fill
- icv = 0x08 # Line colour
- lns = 0xff # Line style
- lnw = 0x01 # Line weight
- fAutoB = 0x00 # Automatic border
- frs = 0x0000 # Frame style
- cf = 0x0009 # Image format, 9 = bitmap
- Reserved3 = 0x0000 # Reserved
- cbPictFmla = 0x0000 # Length of FMLA structure
- Reserved4 = 0x0000 # Reserved
- grbit2 = 0x0001 # Option flags
- Reserved5 = 0x0000 # Reserved
-
- data = pack("<L", cObj)
- data += pack("<H", OT)
- data += pack("<H", id)
- data += pack("<H", grbit)
- data += pack("<H", colL)
- data += pack("<H", dxL)
- data += pack("<H", rwT)
- data += pack("<H", dyT)
- data += pack("<H", colR)
- data += pack("<H", dxR)
- data += pack("<H", rwB)
- data += pack("<H", dyB)
- data += pack("<H", cbMacro)
- data += pack("<L", Reserved1)
- data += pack("<H", Reserved2)
- data += pack("<B", icvBack)
- data += pack("<B", icvFore)
- data += pack("<B", fls)
- data += pack("<B", fAuto)
- data += pack("<B", icv)
- data += pack("<B", lns)
- data += pack("<B", lnw)
- data += pack("<B", fAutoB)
- data += pack("<H", frs)
- data += pack("<L", cf)
- data += pack("<H", Reserved3)
- data += pack("<H", cbPictFmla)
- data += pack("<H", Reserved4)
- data += pack("<H", grbit2)
- data += pack("<L", Reserved5)
-
- self._rec_data = data
-
-def _process_bitmap(bitmap):
- """Convert a 24 bit bitmap into the modified internal format used by Windows.
- This is described in BITMAPCOREHEADER and BITMAPCOREINFO structures in the
- MSDN library.
-
- """
- # Open file and binmode the data in case the platform needs it.
- fh = open(bitmap, 'rb')
- try:
- # Slurp the file into a string.
- data = fh.read()
- finally:
- fh.close()
- # Check that the file is big enough to be a bitmap.
- if len(data) <= 0x36:
- raise Exception("bitmap doesn't contain enough data.")
- # The first 2 bytes are used to identify the bitmap.
- if (data[:2] != b"BM"):
- raise Exception("bitmap doesn't appear to to be a valid bitmap image.")
- # Remove bitmap data: ID.
- data = data[2:]
- # Read and remove the bitmap size. This is more reliable than reading
- # the data size at offset 0x22.
- #
- size = unpack("<L", data[:4])[0]
- size -= 0x36 # Subtract size of bitmap header.
- size += 0x0C # Add size of BIFF header.
- data = data[4:]
- # Remove bitmap data: reserved, offset, header length.
- data = data[12:]
- # Read and remove the bitmap width and height. Verify the sizes.
- width, height = unpack("<LL", data[:8])
- data = data[8:]
- if (width > 0xFFFF):
- raise Exception("bitmap: largest image width supported is 65k.")
- if (height > 0xFFFF):
- raise Exception("bitmap: largest image height supported is 65k.")
- # Read and remove the bitmap planes and bpp data. Verify them.
- planes, bitcount = unpack("<HH", data[:4])
- data = data[4:]
- if (bitcount != 24):
- raise Exception("bitmap isn't a 24bit true color bitmap.")
- if (planes != 1):
- raise Exception("bitmap: only 1 plane supported in bitmap image.")
- # Read and remove the bitmap compression. Verify compression.
- compression = unpack("<L", data[:4])[0]
- data = data[4:]
- if (compression != 0):
- raise Exception("bitmap: compression not supported in bitmap image.")
- # Remove bitmap data: data size, hres, vres, colours, imp. colours.
- data = data[20:]
- # Add the BITMAPCOREHEADER data
- header = pack("<LHHHH", 0x000c, width, height, 0x01, 0x18)
- data = header + data
- return (width, height, size, data)
-
-
-class ImDataBmpRecord(BiffRecord):
- _REC_ID = 0x007F
-
- def __init__(self, filename):
- """Insert a 24bit bitmap image in a worksheet. The main record required is
- IMDATA but it must be proceeded by a OBJ record to define its position.
-
- """
- BiffRecord.__init__(self)
-
- self.width, self.height, self.size, data = _process_bitmap(filename)
- # Write the IMDATA record to store the bitmap data
- cf = 0x09
- env = 0x01
- lcb = self.size
- self._rec_data = pack("<HHL", cf, env, lcb) + data
+# -*- coding: windows-1251 -*-
+
+# Portions are Copyright (C) 2005 Roman V. Kiseliov
+# Portions are Copyright (c) 2004 Evgeny Filatov <fufff@users.sourceforge.net>
+# Portions are Copyright (c) 2002-2004 John McNamara (Perl Spreadsheet::WriteExcel)
+
+from BIFFRecords import BiffRecord
+from struct import *
+
+
+def _size_col(sheet, col):
+ return sheet.col_width(col)
+
+
+def _size_row(sheet, row):
+ return sheet.row_height(row)
+
+
+def _position_image(sheet, row_start, col_start, x1, y1, width, height):
+ """Calculate the vertices that define the position of the image as required by
+ the OBJ record.
+
+ +------------+------------+
+ | A | B |
+ +-----+------------+------------+
+ | |(x1,y1) | |
+ | 1 |(A1)._______|______ |
+ | | | | |
+ | | | | |
+ +-----+----| BITMAP |-----+
+ | | | | |
+ | 2 | |______________. |
+ | | | (B2)|
+ | | | (x2,y2)|
+ +---- +------------+------------+
+
+ Example of a bitmap that covers some of the area from cell A1 to cell B2.
+
+ Based on the width and height of the bitmap we need to calculate 8 vars:
+ col_start, row_start, col_end, row_end, x1, y1, x2, y2.
+ The width and height of the cells are also variable and have to be taken into
+ account.
+ The values of col_start and row_start are passed in from the calling
+ function. The values of col_end and row_end are calculated by subtracting
+ the width and height of the bitmap from the width and height of the
+ underlying cells.
+ The vertices are expressed as a percentage of the underlying cell width as
+ follows (rhs values are in pixels):
+
+ x1 = X / W *1024
+ y1 = Y / H *256
+ x2 = (X-1) / W *1024
+ y2 = (Y-1) / H *256
+
+ Where: X is distance from the left side of the underlying cell
+ Y is distance from the top of the underlying cell
+ W is the width of the cell
+ H is the height of the cell
+
+ Note: the SDK incorrectly states that the height should be expressed as a
+ percentage of 1024.
+
+ col_start - Col containing upper left corner of object
+ row_start - Row containing top left corner of object
+ x1 - Distance to left side of object
+ y1 - Distance to top of object
+ width - Width of image frame
+ height - Height of image frame
+
+ """
+ # Adjust start column for offsets that are greater than the col width
+ while x1 >= _size_col(sheet, col_start):
+ x1 -= _size_col(sheet, col_start)
+ col_start += 1
+ # Adjust start row for offsets that are greater than the row height
+ while y1 >= _size_row(sheet, row_start):
+ y1 -= _size_row(sheet, row_start)
+ row_start += 1
+ # Initialise end cell to the same as the start cell
+ row_end = row_start # Row containing bottom right corner of object
+ col_end = col_start # Col containing lower right corner of object
+ width = width + x1 - 1
+ height = height + y1 - 1
+ # Subtract the underlying cell widths to find the end cell of the image
+ while (width >= _size_col(sheet, col_end)):
+ width -= _size_col(sheet, col_end)
+ col_end += 1
+ # Subtract the underlying cell heights to find the end cell of the image
+ while (height >= _size_row(sheet, row_end)):
+ height -= _size_row(sheet, row_end)
+ row_end += 1
+ # Bitmap isn't allowed to start or finish in a hidden cell, i.e. a cell
+ # with zero height or width.
+ if ((_size_col(sheet, col_start) == 0) or (_size_col(sheet, col_end) == 0)
+ or (_size_row(sheet, row_start) == 0) or (_size_row(sheet, row_end) == 0)):
+ return
+ # Convert the pixel values to the percentage value expected by Excel
+ x1 = int(float(x1) / _size_col(sheet, col_start) * 1024)
+ y1 = int(float(y1) / _size_row(sheet, row_start) * 256)
+ # Distance to right side of object
+ x2 = int(float(width) / _size_col(sheet, col_end) * 1024)
+ # Distance to bottom of object
+ y2 = int(float(height) / _size_row(sheet, row_end) * 256)
+ return (col_start, x1, row_start, y1, col_end, x2, row_end, y2)
+
+
+class ObjBmpRecord(BiffRecord):
+ _REC_ID = 0x005D # Record identifier
+
+ def __init__(self, row, col, sheet, im_data_bmp, x, y, scale_x, scale_y):
+ # Scale the frame of the image.
+ width = im_data_bmp.width * scale_x
+ height = im_data_bmp.height * scale_y
+
+ # Calculate the vertices of the image and write the OBJ record
+ coordinates = _position_image(sheet, row, col, x, y, width, height)
+ # print coordinates
+ col_start, x1, row_start, y1, col_end, x2, row_end, y2 = coordinates
+
+ """Store the OBJ record that precedes an IMDATA record. This could be generalise
+ to support other Excel objects.
+
+ """
+ cObj = 0x0001 # Count of objects in file (set to 1)
+ OT = 0x0008 # Object type. 8 = Picture
+ id = 0x0001 # Object ID
+ grbit = 0x0614 # Option flags
+ colL = col_start # Col containing upper left corner of object
+ dxL = x1 # Distance from left side of cell
+ rwT = row_start # Row containing top left corner of object
+ dyT = y1 # Distance from top of cell
+ colR = col_end # Col containing lower right corner of object
+ dxR = x2 # Distance from right of cell
+ rwB = row_end # Row containing bottom right corner of object
+ dyB = y2 # Distance from bottom of cell
+ cbMacro = 0x0000 # Length of FMLA structure
+ Reserved1 = 0x0000 # Reserved
+ Reserved2 = 0x0000 # Reserved
+ icvBack = 0x09 # Background colour
+ icvFore = 0x09 # Foreground colour
+ fls = 0x00 # Fill pattern
+ fAuto = 0x00 # Automatic fill
+ icv = 0x08 # Line colour
+ lns = 0xff # Line style
+ lnw = 0x01 # Line weight
+ fAutoB = 0x00 # Automatic border
+ frs = 0x0000 # Frame style
+ cf = 0x0009 # Image format, 9 = bitmap
+ Reserved3 = 0x0000 # Reserved
+ cbPictFmla = 0x0000 # Length of FMLA structure
+ Reserved4 = 0x0000 # Reserved
+ grbit2 = 0x0001 # Option flags
+ Reserved5 = 0x0000 # Reserved
+
+ data = pack("<L", cObj)
+ data += pack("<H", OT)
+ data += pack("<H", id)
+ data += pack("<H", grbit)
+ data += pack("<H", colL)
+ data += pack("<H", dxL)
+ data += pack("<H", rwT)
+ data += pack("<H", dyT)
+ data += pack("<H", colR)
+ data += pack("<H", dxR)
+ data += pack("<H", rwB)
+ data += pack("<H", dyB)
+ data += pack("<H", cbMacro)
+ data += pack("<L", Reserved1)
+ data += pack("<H", Reserved2)
+ data += pack("<B", icvBack)
+ data += pack("<B", icvFore)
+ data += pack("<B", fls)
+ data += pack("<B", fAuto)
+ data += pack("<B", icv)
+ data += pack("<B", lns)
+ data += pack("<B", lnw)
+ data += pack("<B", fAutoB)
+ data += pack("<H", frs)
+ data += pack("<L", cf)
+ data += pack("<H", Reserved3)
+ data += pack("<H", cbPictFmla)
+ data += pack("<H", Reserved4)
+ data += pack("<H", grbit2)
+ data += pack("<L", Reserved5)
+
+ self._rec_data = data
+
+def _process_bitmap(bitmap):
+ """Convert a 24 bit bitmap into the modified internal format used by Windows.
+ This is described in BITMAPCOREHEADER and BITMAPCOREINFO structures in the
+ MSDN library.
+
+ """
+ # Open file and binmode the data in case the platform needs it.
+ fh = file(bitmap, "rb")
+ try:
+ # Slurp the file into a string.
+ data = fh.read()
+ finally:
+ fh.close()
+ # Check that the file is big enough to be a bitmap.
+ if len(data) <= 0x36:
+ raise Exception("bitmap doesn't contain enough data.")
+ # The first 2 bytes are used to identify the bitmap.
+ if (data[:2] != "BM"):
+ raise Exception("bitmap doesn't appear to to be a valid bitmap image.")
+ # Remove bitmap data: ID.
+ data = data[2:]
+ # Read and remove the bitmap size. This is more reliable than reading
+ # the data size at offset 0x22.
+ #
+ size = unpack("<L", data[:4])[0]
+ size -= 0x36 # Subtract size of bitmap header.
+ size += 0x0C # Add size of BIFF header.
+ data = data[4:]
+ # Remove bitmap data: reserved, offset, header length.
+ data = data[12:]
+ # Read and remove the bitmap width and height. Verify the sizes.
+ width, height = unpack("<LL", data[:8])
+ data = data[8:]
+ if (width > 0xFFFF):
+ raise Exception("bitmap: largest image width supported is 65k.")
+ if (height > 0xFFFF):
+ raise Exception("bitmap: largest image height supported is 65k.")
+ # Read and remove the bitmap planes and bpp data. Verify them.
+ planes, bitcount = unpack("<HH", data[:4])
+ data = data[4:]
+ if (bitcount != 24):
+ raise Exception("bitmap isn't a 24bit true color bitmap.")
+ if (planes != 1):
+ raise Exception("bitmap: only 1 plane supported in bitmap image.")
+ # Read and remove the bitmap compression. Verify compression.
+ compression = unpack("<L", data[:4])[0]
+ data = data[4:]
+ if (compression != 0):
+ raise Exception("bitmap: compression not supported in bitmap image.")
+ # Remove bitmap data: data size, hres, vres, colours, imp. colours.
+ data = data[20:]
+ # Add the BITMAPCOREHEADER data
+ header = pack("<LHHHH", 0x000c, width, height, 0x01, 0x18)
+ data = header + data
+ return (width, height, size, data)
+
+
+class ImDataBmpRecord(BiffRecord):
+ _REC_ID = 0x007F
+
+ def __init__(self, filename):
+ """Insert a 24bit bitmap image in a worksheet. The main record required is
+ IMDATA but it must be proceeded by a OBJ record to define its position.
+
+ """
+ BiffRecord.__init__(self)
+
+ self.width, self.height, self.size, data = _process_bitmap(filename)
+ # Write the IMDATA record to store the bitmap data
+ cf = 0x09
+ env = 0x01
+ lcb = self.size
+ self._rec_data = pack("<HHL", cf, env, lcb) + data
+
+
diff --git a/tablib/packages/xlwt/Cell.py b/tablib/packages/xlwt/Cell.py
index 08a9e42..23adf8a 100644
--- a/tablib/packages/xlwt/Cell.py
+++ b/tablib/packages/xlwt/Cell.py
@@ -1,233 +1,243 @@
-from struct import unpack, pack
-from . import BIFFRecords
-
-class StrCell(object):
- __slots__ = ["rowx", "colx", "xf_idx", "sst_idx"]
-
- def __init__(self, rowx, colx, xf_idx, sst_idx):
- self.rowx = rowx
- self.colx = colx
- self.xf_idx = xf_idx
- self.sst_idx = sst_idx
-
- def get_biff_data(self):
- return pack('<5HL', 0x00FD, 10, self.rowx, self.colx, self.xf_idx, self.sst_idx)
-
-class BlankCell(object):
- __slots__ = ["rowx", "colx", "xf_idx"]
-
- def __init__(self, rowx, colx, xf_idx):
- self.rowx = rowx
- self.colx = colx
- self.xf_idx = xf_idx
-
- def get_biff_data(self):
- return pack('<5H', 0x0201, 6, self.rowx, self.colx, self.xf_idx)
-
-class MulBlankCell(object):
- __slots__ = ["rowx", "colx1", "colx2", "xf_idx"]
-
- def __init__(self, rowx, colx1, colx2, xf_idx):
- self.rowx = rowx
- self.colx1 = colx1
- self.colx2 = colx2
- self.xf_idx = xf_idx
-
- def get_biff_data(self):
- return BIFFRecords.MulBlankRecord(self.rowx,
- self.colx1, self.colx2, self.xf_idx).get()
-
-class NumberCell(object):
- __slots__ = ["rowx", "colx", "xf_idx", "number"]
-
- def __init__(self, rowx, colx, xf_idx, number):
- self.rowx = rowx
- self.colx = colx
- self.xf_idx = xf_idx
- self.number = float(number)
-
- def get_encoded_data(self):
- rk_encoded = 0
- num = self.number
-
- # The four possible kinds of RK encoding are *not* mutually exclusive.
- # The 30-bit integer variety picks up the most.
- # In the code below, the four varieties are checked in descending order
- # of bangs per buck, or not at all.
- # SJM 2007-10-01
-
- if -0x20000000 <= num < 0x20000000: # fits in 30-bit *signed* int
- inum = int(num)
- if inum == num: # survives round-trip
- rk_encoded = 2 | (inum << 2)
- return 1, rk_encoded
-
- temp = num * 100
-
- if -0x20000000 <= temp < 0x20000000:
- # That was step 1: the coded value will fit in
- # a 30-bit signed integer.
- itemp = int(round(temp, 0))
- # That was step 2: "itemp" is the best candidate coded value.
- # Now for step 3: simulate the decoding,
- # to check for round-trip correctness.
- if itemp / 100.0 == num:
- rk_encoded = 3 | (itemp << 2)
- return 1, rk_encoded
-
- if 0: # Cost of extra pack+unpack not justified by tiny yield.
- packed = pack('<d', num)
- w01, w23 = unpack('<2i', packed)
- if not w01 and not(w23 & 3):
- return 1, w23
-
- packed100 = pack('<d', temp)
- w01, w23 = unpack('<2i', packed100)
- if not w01 and not(w23 & 3):
- return 1, w23 | 1
-
- return 0, pack('<5Hd', 0x0203, 14, self.rowx, self.colx, self.xf_idx, num)
-
- def get_biff_data(self):
- isRK, value = self.get_encoded_data()
- if isRK:
- return pack('<5Hi', 0x27E, 10, self.rowx, self.colx, self.xf_idx, value)
- return value # NUMBER record already packed
-
-class BooleanCell(object):
- __slots__ = ["rowx", "colx", "xf_idx", "number"]
-
- def __init__(self, rowx, colx, xf_idx, number):
- self.rowx = rowx
- self.colx = colx
- self.xf_idx = xf_idx
- self.number = number
-
- def get_biff_data(self):
- return BIFFRecords.BoolErrRecord(self.rowx,
- self.colx, self.xf_idx, self.number, 0).get()
-
-error_code_map = {
- 0x00: 0, # Intersection of two cell ranges is empty
- 0x07: 7, # Division by zero
- 0x0F: 15, # Wrong type of operand
- 0x17: 23, # Illegal or deleted cell reference
- 0x1D: 29, # Wrong function or range name
- 0x24: 36, # Value range overflow
- 0x2A: 42, # Argument or function not available
- '#NULL!' : 0, # Intersection of two cell ranges is empty
- '#DIV/0!': 7, # Division by zero
- '#VALUE!': 36, # Wrong type of operand
- '#REF!' : 23, # Illegal or deleted cell reference
- '#NAME?' : 29, # Wrong function or range name
- '#NUM!' : 36, # Value range overflow
- '#N/A!' : 42, # Argument or function not available
-}
-
-class ErrorCell(object):
- __slots__ = ["rowx", "colx", "xf_idx", "number"]
-
- def __init__(self, rowx, colx, xf_idx, error_string_or_code):
- self.rowx = rowx
- self.colx = colx
- self.xf_idx = xf_idx
- try:
- self.number = error_code_map[error_string_or_code]
- except KeyError:
- raise Exception('Illegal error value (%r)' % error_string_or_code)
-
- def get_biff_data(self):
- return BIFFRecords.BoolErrRecord(self.rowx,
- self.colx, self.xf_idx, self.number, 1).get()
-
-class FormulaCell(object):
- __slots__ = ["rowx", "colx", "xf_idx", "frmla", "calc_flags"]
-
- def __init__(self, rowx, colx, xf_idx, frmla, calc_flags=0):
- self.rowx = rowx
- self.colx = colx
- self.xf_idx = xf_idx
- self.frmla = frmla
- self.calc_flags = calc_flags
-
- def get_biff_data(self):
- return BIFFRecords.FormulaRecord(self.rowx,
- self.colx, self.xf_idx, self.frmla.rpn(), self.calc_flags).get()
-
-# module-level function for *internal* use by the Row module
-
-def _get_cells_biff_data_mul(rowx, cell_items):
- # Return the BIFF data for all cell records in the row.
- # Adjacent BLANK|RK records are combined into MUL(BLANK|RK) records.
- pieces = []
- nitems = len(cell_items)
- i = 0
- while i < nitems:
- icolx, icell = cell_items[i]
- if isinstance(icell, NumberCell):
- isRK, value = icell.get_encoded_data()
- if not isRK:
- pieces.append(value) # pre-packed NUMBER record
- i += 1
- continue
- muldata = [(value, icell.xf_idx)]
- target = NumberCell
- elif isinstance(icell, BlankCell):
- muldata = [icell.xf_idx]
- target = BlankCell
- else:
- pieces.append(icell.get_biff_data())
- i += 1
- continue
- lastcolx = icolx
- j = i
-
- packed_record = b'' # (to_py3): 'b' binary data
- for j in range(i+1, nitems):
- jcolx, jcell = cell_items[j]
- if jcolx != lastcolx + 1:
- nexti = j
- break
- if not isinstance(jcell, target):
- nexti = j
- break
- if target == NumberCell:
- isRK, value = jcell.get_encoded_data()
- if not isRK:
- packed_record = value
- nexti = j + 1
- break
- muldata.append((value, jcell.xf_idx))
- else:
- muldata.append(jcell.xf_idx)
- lastcolx = jcolx
- else:
- nexti = j + 1
- if target == NumberCell:
- if lastcolx == icolx:
- # RK record
- value, xf_idx = muldata[0]
- pieces.append(pack('<5Hi', 0x027E, 10, rowx, icolx, xf_idx, value))
- else:
- # MULRK record
- nc = lastcolx - icolx + 1
- pieces.append(pack('<4H', 0x00BD, 6 * nc + 6, rowx, icolx))
- # (to_py3): 'b' binary data
- pieces.append(b''.join([pack('<Hi', xf_idx, value) for value, xf_idx in muldata]))
- pieces.append(pack('<H', lastcolx))
- else:
- if lastcolx == icolx:
- # BLANK record
- xf_idx = muldata[0]
- pieces.append(pack('<5H', 0x0201, 6, rowx, icolx, xf_idx))
- else:
- # MULBLANK record
- nc = lastcolx - icolx + 1
- pieces.append(pack('<4H', 0x00BE, 2 * nc + 6, rowx, icolx))
- # (to_py3): 'b' binary data
- pieces.append(b''.join([pack('<H', xf_idx) for xf_idx in muldata]))
- pieces.append(pack('<H', lastcolx))
- if packed_record:
- pieces.append(packed_record)
- i = nexti
- return b''.join(pieces) # (to_py3): 'b' binary data
+# -*- coding: windows-1252 -*-
+
+from struct import unpack, pack
+import BIFFRecords
+
+class StrCell(object):
+ __slots__ = ["rowx", "colx", "xf_idx", "sst_idx"]
+
+ def __init__(self, rowx, colx, xf_idx, sst_idx):
+ self.rowx = rowx
+ self.colx = colx
+ self.xf_idx = xf_idx
+ self.sst_idx = sst_idx
+
+ def get_biff_data(self):
+ # return BIFFRecords.LabelSSTRecord(self.rowx, self.colx, self.xf_idx, self.sst_idx).get()
+ return pack('<5HL', 0x00FD, 10, self.rowx, self.colx, self.xf_idx, self.sst_idx)
+
+class BlankCell(object):
+ __slots__ = ["rowx", "colx", "xf_idx"]
+
+ def __init__(self, rowx, colx, xf_idx):
+ self.rowx = rowx
+ self.colx = colx
+ self.xf_idx = xf_idx
+
+ def get_biff_data(self):
+ # return BIFFRecords.BlankRecord(self.rowx, self.colx, self.xf_idx).get()
+ return pack('<5H', 0x0201, 6, self.rowx, self.colx, self.xf_idx)
+
+class MulBlankCell(object):
+ __slots__ = ["rowx", "colx1", "colx2", "xf_idx"]
+
+ def __init__(self, rowx, colx1, colx2, xf_idx):
+ self.rowx = rowx
+ self.colx1 = colx1
+ self.colx2 = colx2
+ self.xf_idx = xf_idx
+
+ def get_biff_data(self):
+ return BIFFRecords.MulBlankRecord(self.rowx,
+ self.colx1, self.colx2, self.xf_idx).get()
+
+class NumberCell(object):
+ __slots__ = ["rowx", "colx", "xf_idx", "number"]
+
+ def __init__(self, rowx, colx, xf_idx, number):
+ self.rowx = rowx
+ self.colx = colx
+ self.xf_idx = xf_idx
+ self.number = float(number)
+
+ def get_encoded_data(self):
+ rk_encoded = 0
+ num = self.number
+
+ # The four possible kinds of RK encoding are *not* mutually exclusive.
+ # The 30-bit integer variety picks up the most.
+ # In the code below, the four varieties are checked in descending order
+ # of bangs per buck, or not at all.
+ # SJM 2007-10-01
+
+ if -0x20000000 <= num < 0x20000000: # fits in 30-bit *signed* int
+ inum = int(num)
+ if inum == num: # survives round-trip
+ # print "30-bit integer RK", inum, hex(inum)
+ rk_encoded = 2 | (inum << 2)
+ return 1, rk_encoded
+
+ temp = num * 100
+
+ if -0x20000000 <= temp < 0x20000000:
+ # That was step 1: the coded value will fit in
+ # a 30-bit signed integer.
+ itemp = int(round(temp, 0))
+ # That was step 2: "itemp" is the best candidate coded value.
+ # Now for step 3: simulate the decoding,
+ # to check for round-trip correctness.
+ if itemp / 100.0 == num:
+ # print "30-bit integer RK*100", itemp, hex(itemp)
+ rk_encoded = 3 | (itemp << 2)
+ return 1, rk_encoded
+
+ if 0: # Cost of extra pack+unpack not justified by tiny yield.
+ packed = pack('<d', num)
+ w01, w23 = unpack('<2i', packed)
+ if not w01 and not(w23 & 3):
+ # 34 lsb are 0
+ # print "float RK", w23, hex(w23)
+ return 1, w23
+
+ packed100 = pack('<d', temp)
+ w01, w23 = unpack('<2i', packed100)
+ if not w01 and not(w23 & 3):
+ # 34 lsb are 0
+ # print "float RK*100", w23, hex(w23)
+ return 1, w23 | 1
+
+ #print "Number"
+ #print
+ return 0, pack('<5Hd', 0x0203, 14, self.rowx, self.colx, self.xf_idx, num)
+
+ def get_biff_data(self):
+ isRK, value = self.get_encoded_data()
+ if isRK:
+ return pack('<5Hi', 0x27E, 10, self.rowx, self.colx, self.xf_idx, value)
+ return value # NUMBER record already packed
+
+class BooleanCell(object):
+ __slots__ = ["rowx", "colx", "xf_idx", "number"]
+
+ def __init__(self, rowx, colx, xf_idx, number):
+ self.rowx = rowx
+ self.colx = colx
+ self.xf_idx = xf_idx
+ self.number = number
+
+ def get_biff_data(self):
+ return BIFFRecords.BoolErrRecord(self.rowx,
+ self.colx, self.xf_idx, self.number, 0).get()
+
+error_code_map = {
+ 0x00: 0, # Intersection of two cell ranges is empty
+ 0x07: 7, # Division by zero
+ 0x0F: 15, # Wrong type of operand
+ 0x17: 23, # Illegal or deleted cell reference
+ 0x1D: 29, # Wrong function or range name
+ 0x24: 36, # Value range overflow
+ 0x2A: 42, # Argument or function not available
+ '#NULL!' : 0, # Intersection of two cell ranges is empty
+ '#DIV/0!': 7, # Division by zero
+ '#VALUE!': 36, # Wrong type of operand
+ '#REF!' : 23, # Illegal or deleted cell reference
+ '#NAME?' : 29, # Wrong function or range name
+ '#NUM!' : 36, # Value range overflow
+ '#N/A!' : 42, # Argument or function not available
+}
+
+class ErrorCell(object):
+ __slots__ = ["rowx", "colx", "xf_idx", "number"]
+
+ def __init__(self, rowx, colx, xf_idx, error_string_or_code):
+ self.rowx = rowx
+ self.colx = colx
+ self.xf_idx = xf_idx
+ try:
+ self.number = error_code_map[error_string_or_code]
+ except KeyError:
+ raise Exception('Illegal error value (%r)' % error_string_or_code)
+
+ def get_biff_data(self):
+ return BIFFRecords.BoolErrRecord(self.rowx,
+ self.colx, self.xf_idx, self.number, 1).get()
+
+class FormulaCell(object):
+ __slots__ = ["rowx", "colx", "xf_idx", "frmla", "calc_flags"]
+
+ def __init__(self, rowx, colx, xf_idx, frmla, calc_flags=0):
+ self.rowx = rowx
+ self.colx = colx
+ self.xf_idx = xf_idx
+ self.frmla = frmla
+ self.calc_flags = calc_flags
+
+ def get_biff_data(self):
+ return BIFFRecords.FormulaRecord(self.rowx,
+ self.colx, self.xf_idx, self.frmla.rpn(), self.calc_flags).get()
+
+# module-level function for *internal* use by the Row module
+
+def _get_cells_biff_data_mul(rowx, cell_items):
+ # Return the BIFF data for all cell records in the row.
+ # Adjacent BLANK|RK records are combined into MUL(BLANK|RK) records.
+ pieces = []
+ nitems = len(cell_items)
+ i = 0
+ while i < nitems:
+ icolx, icell = cell_items[i]
+ if isinstance(icell, NumberCell):
+ isRK, value = icell.get_encoded_data()
+ if not isRK:
+ pieces.append(value) # pre-packed NUMBER record
+ i += 1
+ continue
+ muldata = [(value, icell.xf_idx)]
+ target = NumberCell
+ elif isinstance(icell, BlankCell):
+ muldata = [icell.xf_idx]
+ target = BlankCell
+ else:
+ pieces.append(icell.get_biff_data())
+ i += 1
+ continue
+ lastcolx = icolx
+ j = i
+ packed_record = ''
+ for j in xrange(i+1, nitems):
+ jcolx, jcell = cell_items[j]
+ if jcolx != lastcolx + 1:
+ nexti = j
+ break
+ if not isinstance(jcell, target):
+ nexti = j
+ break
+ if target == NumberCell:
+ isRK, value = jcell.get_encoded_data()
+ if not isRK:
+ packed_record = value
+ nexti = j + 1
+ break
+ muldata.append((value, jcell.xf_idx))
+ else:
+ muldata.append(jcell.xf_idx)
+ lastcolx = jcolx
+ else:
+ nexti = j + 1
+ if target == NumberCell:
+ if lastcolx == icolx:
+ # RK record
+ value, xf_idx = muldata[0]
+ pieces.append(pack('<5Hi', 0x027E, 10, rowx, icolx, xf_idx, value))
+ else:
+ # MULRK record
+ nc = lastcolx - icolx + 1
+ pieces.append(pack('<4H', 0x00BD, 6 * nc + 6, rowx, icolx))
+ pieces.append(''.join([pack('<Hi', xf_idx, value) for value, xf_idx in muldata]))
+ pieces.append(pack('<H', lastcolx))
+ else:
+ if lastcolx == icolx:
+ # BLANK record
+ xf_idx = muldata[0]
+ pieces.append(pack('<5H', 0x0201, 6, rowx, icolx, xf_idx))
+ else:
+ # MULBLANK record
+ nc = lastcolx - icolx + 1
+ pieces.append(pack('<4H', 0x00BE, 2 * nc + 6, rowx, icolx))
+ pieces.append(''.join([pack('<H', xf_idx) for xf_idx in muldata]))
+ pieces.append(pack('<H', lastcolx))
+ if packed_record:
+ pieces.append(packed_record)
+ i = nexti
+ return ''.join(pieces)
+
diff --git a/tablib/packages/xlwt/Column.py b/tablib/packages/xlwt/Column.py
index 4c75a2c..aac35bf 100644
--- a/tablib/packages/xlwt/Column.py
+++ b/tablib/packages/xlwt/Column.py
@@ -1,34 +1,34 @@
-# -*- coding: windows-1252 -*-
-
-from .BIFFRecords import ColInfoRecord
-
-class Column(object):
- def __init__(self, colx, parent_sheet):
- if not(isinstance(colx, int) and 0 <= colx <= 255):
- raise ValueError("column index (%r) not an int in range(256)" % colx)
- self._index = colx
- self._parent = parent_sheet
- self._parent_wb = parent_sheet.get_parent()
- self._xf_index = 0x0F
-
- self.width = 0x0B92
- self.hidden = 0
- self.level = 0
- self.collapse = 0
-
- def set_style(self, style):
- self._xf_index = self._parent_wb.add_style(style)
-
- def width_in_pixels(self):
- # *** Approximation ****
- return int(round(self.width * 0.0272 + 0.446, 0))
-
- def get_biff_record(self):
- options = (self.hidden & 0x01) << 0
- options |= (self.level & 0x07) << 8
- options |= (self.collapse & 0x01) << 12
-
- return ColInfoRecord(self._index, self._index, self.width, self._xf_index, options).get()
-
-
-
+# -*- coding: windows-1252 -*-
+
+from BIFFRecords import ColInfoRecord
+
+class Column(object):
+ def __init__(self, colx, parent_sheet):
+ if not(isinstance(colx, int) and 0 <= colx <= 255):
+ raise ValueError("column index (%r) not an int in range(256)" % colx)
+ self._index = colx
+ self._parent = parent_sheet
+ self._parent_wb = parent_sheet.get_parent()
+ self._xf_index = 0x0F
+
+ self.width = 0x0B92
+ self.hidden = 0
+ self.level = 0
+ self.collapse = 0
+
+ def set_style(self, style):
+ self._xf_index = self._parent_wb.add_style(style)
+
+ def width_in_pixels(self):
+ # *** Approximation ****
+ return int(round(self.width * 0.0272 + 0.446, 0))
+
+ def get_biff_record(self):
+ options = (self.hidden & 0x01) << 0
+ options |= (self.level & 0x07) << 8
+ options |= (self.collapse & 0x01) << 12
+
+ return ColInfoRecord(self._index, self._index, self.width, self._xf_index, options).get()
+
+
+
diff --git a/tablib/packages/xlwt/CompoundDoc.py b/tablib/packages/xlwt/CompoundDoc.py
index 9a11879..f60856b 100644
--- a/tablib/packages/xlwt/CompoundDoc.py
+++ b/tablib/packages/xlwt/CompoundDoc.py
@@ -1,516 +1,516 @@
-import sys
-import struct
-
-ENCODING = 'utf-16-le'
-
-class Reader:
- def __init__(self, filename, dump = False):
- self.dump = dump
- self.STREAMS = {}
-
- doc = file(filename, 'rb').read()
- self.header, self.data = doc[0:512], doc[512:]
- del doc
-
- self.__build_header()
- self.__build_MSAT()
- self.__build_SAT()
- self.__build_directory()
- self.__build_short_sectors_data()
-
- if len(self.short_sectors_data) > 0:
- self.__build_SSAT()
- else:
- if self.dump and (self.total_ssat_sectors != 0 or self.ssat_start_sid != -2):
- print('NOTE: header says that must be', self.total_ssat_sectors, 'short sectors')
- print('NOTE: starting at', self.ssat_start_sid, 'sector')
- print('NOTE: but file does not contains data in short sectors')
- self.ssat_start_sid = -2
- self.total_ssat_sectors = 0
- self.SSAT = [-2]
-
- for dentry in self.dir_entry_list[1:]:
- (did,
- sz, name,
- t, c,
- did_left, did_right, did_root,
- dentry_start_sid,
- stream_size
- ) = dentry
- stream_data = b''
- if stream_size > 0:
- if stream_size >= self.min_stream_size:
- args = (self.data, self.SAT, dentry_start_sid, self.sect_size)
- else:
- args = (self.short_sectors_data, self.SSAT, dentry_start_sid, self.short_sect_size)
- stream_data = self.get_stream_data(*args)
-
- if name != b'':
- # BAD IDEA: names may be equal. NEED use full paths...
- self.STREAMS[name] = stream_data
-
-
- def __build_header(self):
- self.doc_magic = self.header[0:8]
-
- if self.doc_magic != b'\xD0\xCF\x11\xE0\xA1\xB1\x1A\xE1':
- raise Exception('Not an OLE file.')
-
- self.file_uid = self.header[8:24]
- self.rev_num = self.header[24:26]
- self.ver_num = self.header[26:28]
- self.byte_order = self.header[28:30]
- self.log2_sect_size, = struct.unpack('<H', self.header[30:32])
- self.log2_short_sect_size, = struct.unpack('<H', self.header[32:34])
- self.total_sat_sectors, = struct.unpack('<L', self.header[44:48])
- self.dir_start_sid, = struct.unpack('<l', self.header[48:52])
- self.min_stream_size, = struct.unpack('<L', self.header[56:60])
- self.ssat_start_sid, = struct.unpack('<l', self.header[60:64])
- self.total_ssat_sectors, = struct.unpack('<L', self.header[64:68])
- self.msat_start_sid, = struct.unpack('<l', self.header[68:72])
- self.total_msat_sectors, = struct.unpack('<L', self.header[72:76])
-
- self.sect_size = 1 << self.log2_sect_size
- self.short_sect_size = 1 << self.log2_short_sect_size
-
- if self.dump:
- print('file magic: ')
- print_bin_data(self.doc_magic)
-
- print('file uid: ')
- print_bin_data(self.file_uid)
-
- print('revision number: ')
- print_bin_data(self.rev_num)
-
- print('version number: ')
- print_bin_data(self.ver_num)
-
- print('byte order: ')
- print_bin_data(self.byte_order)
-
- print('sector size :', hex(self.sect_size), self.sect_size)
- #print 'total sectors in file :', hex(self.total_sectors), self.total_sectors
- print('short sector size :', hex(self.short_sect_size), self.short_sect_size)
- print('Total number of sectors used for the SAT :', hex(self.total_sat_sectors), self.total_sat_sectors)
- print('SID of first sector of the directory stream:', hex(self.dir_start_sid), self.dir_start_sid)
- print('Minimum size of a standard stream :', hex(self.min_stream_size), self.min_stream_size)
- print('SID of first sector of the SSAT :', hex(self.ssat_start_sid), self.ssat_start_sid)
- print('Total number of sectors used for the SSAT :', hex(self.total_ssat_sectors), self.total_ssat_sectors)
- print('SID of first additional sector of the MSAT :', hex(self.msat_start_sid), self.msat_start_sid)
- print('Total number of sectors used for the MSAT :', hex(self.total_msat_sectors), self.total_msat_sectors)
-
-
- def __build_MSAT(self):
- self.MSAT = list(struct.unpack('<109l', self.header[76:]))
-
- next = self.msat_start_sid
- while next > 0:
- msat_sector = struct.unpack('<128l', self.data[next*self.sect_size:(next+1)*self.sect_size])
- self.MSAT.extend(msat_sector[:127])
- next = msat_sector[-1]
-
- if self.dump:
- print('MSAT (header part): \n', self.MSAT[:109])
- print('additional MSAT sectors: \n', self.MSAT[109:])
-
-
- def __build_SAT(self):
- sat_stream = b''.join([self.data[i*self.sect_size:(i+1)*self.sect_size] for i in self.MSAT if i >= 0])
-
- sat_sids_count = len(sat_stream) >> 2
- self.SAT = struct.unpack('<%dl' % sat_sids_count, sat_stream) # SIDs tuple
-
- if self.dump:
- print('SAT sid count:\n', sat_sids_count)
- print('SAT content:\n', self.SAT)
-
-
- def __build_SSAT(self):
- ssat_stream = self.get_stream_data(self.data, self.SAT, self.ssat_start_sid, self.sect_size)
-
- ssids_count = len(ssat_stream) >> 2
- self.SSAT = struct.unpack('<%dl' % ssids_count, ssat_stream)
-
- if self.dump:
- print('SSID count:', ssids_count)
- print('SSAT content:\n', self.SSAT)
-
-
- def __build_directory(self):
- dir_stream = self.get_stream_data(self.data, self.SAT, self.dir_start_sid, self.sect_size)
-
- self.dir_entry_list = []
-
- i = 0
- while i < len(dir_stream):
- dentry = dir_stream[i:i+128] # 128 -- dir entry size
- i += 128
-
- did = len(self.dir_entry_list)
- sz, = struct.unpack('<H', dentry[64:66])
- if sz > 0 :
- name = dentry[0:sz-2].decode('utf_16_le', 'replace')
- else:
- name = b''
- t, = struct.unpack('B', dentry[66])
- c, = struct.unpack('B', dentry[67])
- did_left , = struct.unpack('<l', dentry[68:72])
- did_right , = struct.unpack('<l', dentry[72:76])
- did_root , = struct.unpack('<l', dentry[76:80])
- dentry_start_sid , = struct.unpack('<l', dentry[116:120])
- stream_size , = struct.unpack('<L', dentry[120:124])
-
- self.dir_entry_list.extend([(did, sz, name, t, c,
- did_left, did_right, did_root,
- dentry_start_sid, stream_size)])
-
- if self.dump:
- dentry_types = {
- 0x00: 'Empty',
- 0x01: 'User storage',
- 0x02: 'User stream',
- 0x03: 'LockBytes',
- 0x04: 'Property',
- 0x05: 'Root storage'
- }
- node_colours = {
- 0x00: 'Red',
- 0x01: 'Black'
- }
- print('total directory entries:', len(self.dir_entry_list))
-
- for dentry in self.dir_entry_list:
- (did, sz, name, t, c,
- did_left, did_right, did_root,
- dentry_start_sid, stream_size) = dentry
- print('DID', did)
- print('Size of the used area of the character buffer of the name:', sz)
- print('dir entry name:', repr(name))
- print('type of entry:', t, dentry_types[t])
- print('entry colour:', c, node_colours[c])
- print('left child DID :', did_left)
- print('right child DID:', did_right)
- print('root DID :', did_root)
- print('start SID :', dentry_start_sid)
- print('stream size :', stream_size)
- if stream_size == 0:
- print('stream is empty')
- elif stream_size >= self.min_stream_size:
- print('stream stored as normal stream')
- else:
- print('stream stored as short-stream')
-
-
- def __build_short_sectors_data(self):
- (did, sz, name, t, c,
- did_left, did_right, did_root,
- dentry_start_sid, stream_size) = self.dir_entry_list[0]
- assert t == 0x05 # Short-Stream Container Stream (SSCS) resides in Root Storage
- if stream_size == 0:
- self.short_sectors_data = b''
- else:
- self.short_sectors_data = self.get_stream_data(self.data, self.SAT, dentry_start_sid, self.sect_size)
-
-
- def get_stream_data(self, data, SAT, start_sid, sect_size):
- sid = start_sid
- chunks = [(sid, sid)]
- stream_data = b''
-
- while SAT[sid] >= 0:
- next_in_chain = SAT[sid]
- last_chunk_start, last_chunk_finish = chunks[-1]
- if next_in_chain == last_chunk_finish + 1:
- chunks[-1] = last_chunk_start, next_in_chain
- else:
- chunks.extend([(next_in_chain, next_in_chain)])
- sid = next_in_chain
- for s, f in chunks:
- stream_data += data[s*sect_size:(f+1)*sect_size]
- #print chunks
- return stream_data
-
-
-def print_bin_data(data):
- i = 0
- while i < len(data):
- j = 0
- while (i < len(data)) and (j < 16):
- c = b'0x%02X' % ord(data[i])
- sys.stdout.write(c)
- sys.stdout.write(' ')
- i += 1
- j += 1
- print()
- if i == 0:
- print('<NO DATA>')
-
-
-
-# This implementation writes only 'Root Entry', 'Workbook' streams
-# and 2 empty streams for aligning directory stream on sector boundary
-#
-# LAYOUT:
-# 0 header
-# 76 MSAT (1st part: 109 SID)
-# 512 workbook stream
-# ... additional MSAT sectors if streams' size > about 7 Mb == (109*512 * 128)
-# ... SAT
-# ... directory stream
-#
-# NOTE: this layout is "ad hoc". It can be more general. RTFM
-
-class XlsDoc:
- SECTOR_SIZE = 0x0200
- MIN_LIMIT = 0x1000
-
- SID_FREE_SECTOR = -1
- SID_END_OF_CHAIN = -2
- SID_USED_BY_SAT = -3
- SID_USED_BY_MSAT = -4
-
- def __init__(self):
- self.book_stream_sect = []
-
- self.dir_stream = b''
- self.dir_stream_sect = []
-
- self.packed_SAT = b''
- self.SAT_sect = []
-
- self.packed_MSAT_1st = b''
- self.packed_MSAT_2nd = b''
- self.MSAT_sect_2nd = []
-
- self.header = b''
-
- def __build_directory(self): # align on sector boundary
- self.dir_stream = b''
-
- #(to_py3): replaced = b'\x00'.join(b'Root Entry\x00') + b'\x00'
- dentry_name = 'Root Entry\x00'.encode(ENCODING)
- dentry_name_sz = len(dentry_name)
- dentry_name_pad = b'\x00'*(64 - dentry_name_sz)
- dentry_type = 0x05 # root storage
- dentry_colour = 0x01 # black
- dentry_did_left = -1
- dentry_did_right = -1
- dentry_did_root = 1
- dentry_start_sid = -2
- dentry_stream_sz = 0
-
- self.dir_stream += struct.pack('<64s H 2B 3l 9L l L L',
- dentry_name + dentry_name_pad,
- dentry_name_sz,
- dentry_type,
- dentry_colour,
- dentry_did_left,
- dentry_did_right,
- dentry_did_root,
- 0, 0, 0, 0, 0, 0, 0, 0, 0,
- dentry_start_sid,
- dentry_stream_sz,
- 0
- )
- # (to_py3): replaced = b'\x00'.join(b'Workbook\x00') + b'\x00'
- dentry_name = 'Workbook\x00'.encode(ENCODING)
- dentry_name_sz = len(dentry_name)
- dentry_name_pad = b'\x00'*(64 - dentry_name_sz)
- dentry_type = 0x02 # user stream
- dentry_colour = 0x01 # black
- dentry_did_left = -1
- dentry_did_right = -1
- dentry_did_root = -1
- dentry_start_sid = 0
- dentry_stream_sz = self.book_stream_len
-
- self.dir_stream += struct.pack('<64s H 2B 3l 9L l L L',
- dentry_name + dentry_name_pad,
- dentry_name_sz,
- dentry_type,
- dentry_colour,
- dentry_did_left,
- dentry_did_right,
- dentry_did_root,
- 0, 0, 0, 0, 0, 0, 0, 0, 0,
- dentry_start_sid,
- dentry_stream_sz,
- 0
- )
-
- # padding
- dentry_name = b''
- dentry_name_sz = len(dentry_name)
- dentry_name_pad = b'\x00'*(64 - dentry_name_sz)
- dentry_type = 0x00 # empty
- dentry_colour = 0x01 # black
- dentry_did_left = -1
- dentry_did_right = -1
- dentry_did_root = -1
- dentry_start_sid = -2
- dentry_stream_sz = 0
-
- self.dir_stream += struct.pack('<64s H 2B 3l 9L l L L',
- dentry_name + dentry_name_pad,
- dentry_name_sz,
- dentry_type,
- dentry_colour,
- dentry_did_left,
- dentry_did_right,
- dentry_did_root,
- 0, 0, 0, 0, 0, 0, 0, 0, 0,
- dentry_start_sid,
- dentry_stream_sz,
- 0
- ) * 2
-
- def __build_sat(self):
- # Build SAT
- book_sect_count = self.book_stream_len >> 9
- dir_sect_count = len(self.dir_stream) >> 9
-
- total_sect_count = book_sect_count + dir_sect_count
- SAT_sect_count = 0
- MSAT_sect_count = 0
- SAT_sect_count_limit = 109
- while total_sect_count > 128*SAT_sect_count or SAT_sect_count > SAT_sect_count_limit:
- SAT_sect_count += 1
- total_sect_count += 1
- if SAT_sect_count > SAT_sect_count_limit:
- MSAT_sect_count += 1
- total_sect_count += 1
- SAT_sect_count_limit += 127
-
-
- SAT = [self.SID_FREE_SECTOR]*128*SAT_sect_count
-
- sect = 0
- while sect < book_sect_count - 1:
- self.book_stream_sect.append(sect)
- SAT[sect] = sect + 1
- sect += 1
- self.book_stream_sect.append(sect)
- SAT[sect] = self.SID_END_OF_CHAIN
- sect += 1
-
- while sect < book_sect_count + MSAT_sect_count:
- self.MSAT_sect_2nd.append(sect)
- SAT[sect] = self.SID_USED_BY_MSAT
- sect += 1
-
- while sect < book_sect_count + MSAT_sect_count + SAT_sect_count:
- self.SAT_sect.append(sect)
- SAT[sect] = self.SID_USED_BY_SAT
- sect += 1
-
- while sect < book_sect_count + MSAT_sect_count + SAT_sect_count + dir_sect_count - 1:
- self.dir_stream_sect.append(sect)
- SAT[sect] = sect + 1
- sect += 1
- self.dir_stream_sect.append(sect)
- SAT[sect] = self.SID_END_OF_CHAIN
- sect += 1
-
- self.packed_SAT = struct.pack('<%dl' % (SAT_sect_count*128), *SAT)
-
- MSAT_1st = [self.SID_FREE_SECTOR]*109
- for i, SAT_sect_num in zip(list(range(0, 109)), self.SAT_sect):
- MSAT_1st[i] = SAT_sect_num
- self.packed_MSAT_1st = struct.pack('<109l', *MSAT_1st)
-
- MSAT_2nd = [self.SID_FREE_SECTOR]*128*MSAT_sect_count
- if MSAT_sect_count > 0:
- MSAT_2nd[- 1] = self.SID_END_OF_CHAIN
-
- i = 109
- msat_sect = 0
- sid_num = 0
- while i < SAT_sect_count:
- if (sid_num + 1) % 128 == 0:
- #print 'link: ',
- msat_sect += 1
- if msat_sect < len(self.MSAT_sect_2nd):
- MSAT_2nd[sid_num] = self.MSAT_sect_2nd[msat_sect]
- else:
- #print 'sid: ',
- MSAT_2nd[sid_num] = self.SAT_sect[i]
- i += 1
- #print sid_num, MSAT_2nd[sid_num]
- sid_num += 1
-
- self.packed_MSAT_2nd = struct.pack('<%dl' % (MSAT_sect_count*128), *MSAT_2nd)
-
- #print vars()
- #print zip(range(0, sect), SAT)
- #print self.book_stream_sect
- #print self.MSAT_sect_2nd
- #print MSAT_2nd
- #print self.SAT_sect
- #print self.dir_stream_sect
-
-
- def __build_header(self):
- doc_magic = b'\xD0\xCF\x11\xE0\xA1\xB1\x1A\xE1'
- file_uid = b'\x00'*16
- rev_num = b'\x3E\x00'
- ver_num = b'\x03\x00'
- byte_order = b'\xFE\xFF'
- log_sect_size = struct.pack('<H', 9)
- log_short_sect_size = struct.pack('<H', 6)
- not_used0 = b'\x00'*10
- total_sat_sectors = struct.pack('<L', len(self.SAT_sect))
- dir_start_sid = struct.pack('<l', self.dir_stream_sect[0])
- not_used1 = b'\x00'*4
- min_stream_size = struct.pack('<L', 0x1000)
- ssat_start_sid = struct.pack('<l', -2)
- total_ssat_sectors = struct.pack('<L', 0)
-
- if len(self.MSAT_sect_2nd) == 0:
- msat_start_sid = struct.pack('<l', -2)
- else:
- msat_start_sid = struct.pack('<l', self.MSAT_sect_2nd[0])
-
- total_msat_sectors = struct.pack('<L', len(self.MSAT_sect_2nd))
-
- self.header = b''.join([ doc_magic,
- file_uid,
- rev_num,
- ver_num,
- byte_order,
- log_sect_size,
- log_short_sect_size,
- not_used0,
- total_sat_sectors,
- dir_start_sid,
- not_used1,
- min_stream_size,
- ssat_start_sid,
- total_ssat_sectors,
- msat_start_sid,
- total_msat_sectors
- ])
-
-
- def save(self, file_name_or_filelike_obj, stream):
- # 1. Align stream on 0x1000 boundary (and therefore on sector boundary)
- padding = b'\x00' * (0x1000 - (len(stream) % 0x1000))
- self.book_stream_len = len(stream) + len(padding)
-
- self.__build_directory()
- self.__build_sat()
- self.__build_header()
-
- f = file_name_or_filelike_obj
- we_own_it = not hasattr(f, 'write')
- if we_own_it:
- f = open(file_name_or_filelike_obj, 'wb')
- f.write((self.header))
- f.write((self.packed_MSAT_1st))
- f.write((stream))
- f.write((padding))
- f.write((self.packed_MSAT_2nd))
- f.write((self.packed_SAT))
- f.write((self.dir_stream))
- if we_own_it:
- f.close()
+# -*- coding: windows-1252 -*-
+
+import sys
+import struct
+
+class Reader:
+ def __init__(self, filename, dump = False):
+ self.dump = dump
+ self.STREAMS = {}
+
+ doc = file(filename, 'rb').read()
+ self.header, self.data = doc[0:512], doc[512:]
+ del doc
+
+ self.__build_header()
+ self.__build_MSAT()
+ self.__build_SAT()
+ self.__build_directory()
+ self.__build_short_sectors_data()
+
+ if len(self.short_sectors_data) > 0:
+ self.__build_SSAT()
+ else:
+ if self.dump and (self.total_ssat_sectors != 0 or self.ssat_start_sid != -2):
+ print 'NOTE: header says that must be', self.total_ssat_sectors, 'short sectors'
+ print 'NOTE: starting at', self.ssat_start_sid, 'sector'
+ print 'NOTE: but file does not contains data in short sectors'
+ self.ssat_start_sid = -2
+ self.total_ssat_sectors = 0
+ self.SSAT = [-2]
+
+ for dentry in self.dir_entry_list[1:]:
+ (did,
+ sz, name,
+ t, c,
+ did_left, did_right, did_root,
+ dentry_start_sid,
+ stream_size
+ ) = dentry
+ stream_data = ''
+ if stream_size > 0:
+ if stream_size >= self.min_stream_size:
+ args = (self.data, self.SAT, dentry_start_sid, self.sect_size)
+ else:
+ args = (self.short_sectors_data, self.SSAT, dentry_start_sid, self.short_sect_size)
+ stream_data = self.get_stream_data(*args)
+
+ if name != '':
+ # BAD IDEA: names may be equal. NEED use full paths...
+ self.STREAMS[name] = stream_data
+
+
+ def __build_header(self):
+ self.doc_magic = self.header[0:8]
+
+ if self.doc_magic != '\xD0\xCF\x11\xE0\xA1\xB1\x1A\xE1':
+ raise Exception, 'Not an OLE file.'
+
+ self.file_uid = self.header[8:24]
+ self.rev_num = self.header[24:26]
+ self.ver_num = self.header[26:28]
+ self.byte_order = self.header[28:30]
+ self.log2_sect_size, = struct.unpack('<H', self.header[30:32])
+ self.log2_short_sect_size, = struct.unpack('<H', self.header[32:34])
+ self.total_sat_sectors, = struct.unpack('<L', self.header[44:48])
+ self.dir_start_sid, = struct.unpack('<l', self.header[48:52])
+ self.min_stream_size, = struct.unpack('<L', self.header[56:60])
+ self.ssat_start_sid, = struct.unpack('<l', self.header[60:64])
+ self.total_ssat_sectors, = struct.unpack('<L', self.header[64:68])
+ self.msat_start_sid, = struct.unpack('<l', self.header[68:72])
+ self.total_msat_sectors, = struct.unpack('<L', self.header[72:76])
+
+ self.sect_size = 1 << self.log2_sect_size
+ self.short_sect_size = 1 << self.log2_short_sect_size
+
+ if self.dump:
+ print 'file magic: '
+ print_bin_data(self.doc_magic)
+
+ print 'file uid: '
+ print_bin_data(self.file_uid)
+
+ print 'revision number: '
+ print_bin_data(self.rev_num)
+
+ print 'version number: '
+ print_bin_data(self.ver_num)
+
+ print 'byte order: '
+ print_bin_data(self.byte_order)
+
+ print 'sector size :', hex(self.sect_size), self.sect_size
+ #print 'total sectors in file :', hex(self.total_sectors), self.total_sectors
+ print 'short sector size :', hex(self.short_sect_size), self.short_sect_size
+ print 'Total number of sectors used for the SAT :', hex(self.total_sat_sectors), self.total_sat_sectors
+ print 'SID of first sector of the directory stream:', hex(self.dir_start_sid), self.dir_start_sid
+ print 'Minimum size of a standard stream :', hex(self.min_stream_size), self.min_stream_size
+ print 'SID of first sector of the SSAT :', hex(self.ssat_start_sid), self.ssat_start_sid
+ print 'Total number of sectors used for the SSAT :', hex(self.total_ssat_sectors), self.total_ssat_sectors
+ print 'SID of first additional sector of the MSAT :', hex(self.msat_start_sid), self.msat_start_sid
+ print 'Total number of sectors used for the MSAT :', hex(self.total_msat_sectors), self.total_msat_sectors
+
+
+ def __build_MSAT(self):
+ self.MSAT = list(struct.unpack('<109l', self.header[76:]))
+
+ next = self.msat_start_sid
+ while next > 0:
+ msat_sector = struct.unpack('<128l', self.data[next*self.sect_size:(next+1)*self.sect_size])
+ self.MSAT.extend(msat_sector[:127])
+ next = msat_sector[-1]
+
+ if self.dump:
+ print 'MSAT (header part): \n', self.MSAT[:109]
+ print 'additional MSAT sectors: \n', self.MSAT[109:]
+
+
+ def __build_SAT(self):
+ sat_stream = ''.join([self.data[i*self.sect_size:(i+1)*self.sect_size] for i in self.MSAT if i >= 0])
+
+ sat_sids_count = len(sat_stream) >> 2
+ self.SAT = struct.unpack('<%dl' % sat_sids_count, sat_stream) # SIDs tuple
+
+ if self.dump:
+ print 'SAT sid count:\n', sat_sids_count
+ print 'SAT content:\n', self.SAT
+
+
+ def __build_SSAT(self):
+ ssat_stream = self.get_stream_data(self.data, self.SAT, self.ssat_start_sid, self.sect_size)
+
+ ssids_count = len(ssat_stream) >> 2
+ self.SSAT = struct.unpack('<%dl' % ssids_count, ssat_stream)
+
+ if self.dump:
+ print 'SSID count:', ssids_count
+ print 'SSAT content:\n', self.SSAT
+
+
+ def __build_directory(self):
+ dir_stream = self.get_stream_data(self.data, self.SAT, self.dir_start_sid, self.sect_size)
+
+ self.dir_entry_list = []
+
+ i = 0
+ while i < len(dir_stream):
+ dentry = dir_stream[i:i+128] # 128 -- dir entry size
+ i += 128
+
+ did = len(self.dir_entry_list)
+ sz, = struct.unpack('<H', dentry[64:66])
+ if sz > 0 :
+ name = dentry[0:sz-2].decode('utf_16_le', 'replace')
+ else:
+ name = u''
+ t, = struct.unpack('B', dentry[66])
+ c, = struct.unpack('B', dentry[67])
+ did_left , = struct.unpack('<l', dentry[68:72])
+ did_right , = struct.unpack('<l', dentry[72:76])
+ did_root , = struct.unpack('<l', dentry[76:80])
+ dentry_start_sid , = struct.unpack('<l', dentry[116:120])
+ stream_size , = struct.unpack('<L', dentry[120:124])
+
+ self.dir_entry_list.extend([(did, sz, name, t, c,
+ did_left, did_right, did_root,
+ dentry_start_sid, stream_size)])
+
+ if self.dump:
+ dentry_types = {
+ 0x00: 'Empty',
+ 0x01: 'User storage',
+ 0x02: 'User stream',
+ 0x03: 'LockBytes',
+ 0x04: 'Property',
+ 0x05: 'Root storage'
+ }
+ node_colours = {
+ 0x00: 'Red',
+ 0x01: 'Black'
+ }
+ print 'total directory entries:', len(self.dir_entry_list)
+
+ for dentry in self.dir_entry_list:
+ (did, sz, name, t, c,
+ did_left, did_right, did_root,
+ dentry_start_sid, stream_size) = dentry
+ print 'DID', did
+ print 'Size of the used area of the character buffer of the name:', sz
+ print 'dir entry name:', repr(name)
+ print 'type of entry:', t, dentry_types[t]
+ print 'entry colour:', c, node_colours[c]
+ print 'left child DID :', did_left
+ print 'right child DID:', did_right
+ print 'root DID :', did_root
+ print 'start SID :', dentry_start_sid
+ print 'stream size :', stream_size
+ if stream_size == 0:
+ print 'stream is empty'
+ elif stream_size >= self.min_stream_size:
+ print 'stream stored as normal stream'
+ else:
+ print 'stream stored as short-stream'
+
+
+ def __build_short_sectors_data(self):
+ (did, sz, name, t, c,
+ did_left, did_right, did_root,
+ dentry_start_sid, stream_size) = self.dir_entry_list[0]
+ assert t == 0x05 # Short-Stream Container Stream (SSCS) resides in Root Storage
+ if stream_size == 0:
+ self.short_sectors_data = ''
+ else:
+ self.short_sectors_data = self.get_stream_data(self.data, self.SAT, dentry_start_sid, self.sect_size)
+
+
+ def get_stream_data(self, data, SAT, start_sid, sect_size):
+ sid = start_sid
+ chunks = [(sid, sid)]
+ stream_data = ''
+
+ while SAT[sid] >= 0:
+ next_in_chain = SAT[sid]
+ last_chunk_start, last_chunk_finish = chunks[-1]
+ if next_in_chain == last_chunk_finish + 1:
+ chunks[-1] = last_chunk_start, next_in_chain
+ else:
+ chunks.extend([(next_in_chain, next_in_chain)])
+ sid = next_in_chain
+ for s, f in chunks:
+ stream_data += data[s*sect_size:(f+1)*sect_size]
+ #print chunks
+ return stream_data
+
+
+def print_bin_data(data):
+ i = 0
+ while i < len(data):
+ j = 0
+ while (i < len(data)) and (j < 16):
+ c = '0x%02X' % ord(data[i])
+ sys.stdout.write(c)
+ sys.stdout.write(' ')
+ i += 1
+ j += 1
+ print
+ if i == 0:
+ print '<NO DATA>'
+
+
+
+# This implementation writes only 'Root Entry', 'Workbook' streams
+# and 2 empty streams for aligning directory stream on sector boundary
+#
+# LAYOUT:
+# 0 header
+# 76 MSAT (1st part: 109 SID)
+# 512 workbook stream
+# ... additional MSAT sectors if streams' size > about 7 Mb == (109*512 * 128)
+# ... SAT
+# ... directory stream
+#
+# NOTE: this layout is "ad hoc". It can be more general. RTFM
+
+class XlsDoc:
+ SECTOR_SIZE = 0x0200
+ MIN_LIMIT = 0x1000
+
+ SID_FREE_SECTOR = -1
+ SID_END_OF_CHAIN = -2
+ SID_USED_BY_SAT = -3
+ SID_USED_BY_MSAT = -4
+
+ def __init__(self):
+ #self.book_stream = '' # padded
+ self.book_stream_sect = []
+
+ self.dir_stream = ''
+ self.dir_stream_sect = []
+
+ self.packed_SAT = ''
+ self.SAT_sect = []
+
+ self.packed_MSAT_1st = ''
+ self.packed_MSAT_2nd = ''
+ self.MSAT_sect_2nd = []
+
+ self.header = ''
+
+ def __build_directory(self): # align on sector boundary
+ self.dir_stream = ''
+
+ dentry_name = '\x00'.join('Root Entry\x00') + '\x00'
+ dentry_name_sz = len(dentry_name)
+ dentry_name_pad = '\x00'*(64 - dentry_name_sz)
+ dentry_type = 0x05 # root storage
+ dentry_colour = 0x01 # black
+ dentry_did_left = -1
+ dentry_did_right = -1
+ dentry_did_root = 1
+ dentry_start_sid = -2
+ dentry_stream_sz = 0
+
+ self.dir_stream += struct.pack('<64s H 2B 3l 9L l L L',
+ dentry_name + dentry_name_pad,
+ dentry_name_sz,
+ dentry_type,
+ dentry_colour,
+ dentry_did_left,
+ dentry_did_right,
+ dentry_did_root,
+ 0, 0, 0, 0, 0, 0, 0, 0, 0,
+ dentry_start_sid,
+ dentry_stream_sz,
+ 0
+ )
+
+ dentry_name = '\x00'.join('Workbook\x00') + '\x00'
+ dentry_name_sz = len(dentry_name)
+ dentry_name_pad = '\x00'*(64 - dentry_name_sz)
+ dentry_type = 0x02 # user stream
+ dentry_colour = 0x01 # black
+ dentry_did_left = -1
+ dentry_did_right = -1
+ dentry_did_root = -1
+ dentry_start_sid = 0
+ dentry_stream_sz = self.book_stream_len
+
+ self.dir_stream += struct.pack('<64s H 2B 3l 9L l L L',
+ dentry_name + dentry_name_pad,
+ dentry_name_sz,
+ dentry_type,
+ dentry_colour,
+ dentry_did_left,
+ dentry_did_right,
+ dentry_did_root,
+ 0, 0, 0, 0, 0, 0, 0, 0, 0,
+ dentry_start_sid,
+ dentry_stream_sz,
+ 0
+ )
+
+ # padding
+ dentry_name = ''
+ dentry_name_sz = len(dentry_name)
+ dentry_name_pad = '\x00'*(64 - dentry_name_sz)
+ dentry_type = 0x00 # empty
+ dentry_colour = 0x01 # black
+ dentry_did_left = -1
+ dentry_did_right = -1
+ dentry_did_root = -1
+ dentry_start_sid = -2
+ dentry_stream_sz = 0
+
+ self.dir_stream += struct.pack('<64s H 2B 3l 9L l L L',
+ dentry_name + dentry_name_pad,
+ dentry_name_sz,
+ dentry_type,
+ dentry_colour,
+ dentry_did_left,
+ dentry_did_right,
+ dentry_did_root,
+ 0, 0, 0, 0, 0, 0, 0, 0, 0,
+ dentry_start_sid,
+ dentry_stream_sz,
+ 0
+ ) * 2
+
+ def __build_sat(self):
+ # Build SAT
+ book_sect_count = self.book_stream_len >> 9
+ dir_sect_count = len(self.dir_stream) >> 9
+
+ total_sect_count = book_sect_count + dir_sect_count
+ SAT_sect_count = 0
+ MSAT_sect_count = 0
+ SAT_sect_count_limit = 109
+ while total_sect_count > 128*SAT_sect_count or SAT_sect_count > SAT_sect_count_limit:
+ SAT_sect_count += 1
+ total_sect_count += 1
+ if SAT_sect_count > SAT_sect_count_limit:
+ MSAT_sect_count += 1
+ total_sect_count += 1
+ SAT_sect_count_limit += 127
+
+
+ SAT = [self.SID_FREE_SECTOR]*128*SAT_sect_count
+
+ sect = 0
+ while sect < book_sect_count - 1:
+ self.book_stream_sect.append(sect)
+ SAT[sect] = sect + 1
+ sect += 1
+ self.book_stream_sect.append(sect)
+ SAT[sect] = self.SID_END_OF_CHAIN
+ sect += 1
+
+ while sect < book_sect_count + MSAT_sect_count:
+ self.MSAT_sect_2nd.append(sect)
+ SAT[sect] = self.SID_USED_BY_MSAT
+ sect += 1
+
+ while sect < book_sect_count + MSAT_sect_count + SAT_sect_count:
+ self.SAT_sect.append(sect)
+ SAT[sect] = self.SID_USED_BY_SAT
+ sect += 1
+
+ while sect < book_sect_count + MSAT_sect_count + SAT_sect_count + dir_sect_count - 1:
+ self.dir_stream_sect.append(sect)
+ SAT[sect] = sect + 1
+ sect += 1
+ self.dir_stream_sect.append(sect)
+ SAT[sect] = self.SID_END_OF_CHAIN
+ sect += 1
+
+ self.packed_SAT = struct.pack('<%dl' % (SAT_sect_count*128), *SAT)
+
+ MSAT_1st = [self.SID_FREE_SECTOR]*109
+ for i, SAT_sect_num in zip(range(0, 109), self.SAT_sect):
+ MSAT_1st[i] = SAT_sect_num
+ self.packed_MSAT_1st = struct.pack('<109l', *MSAT_1st)
+
+ MSAT_2nd = [self.SID_FREE_SECTOR]*128*MSAT_sect_count
+ if MSAT_sect_count > 0:
+ MSAT_2nd[- 1] = self.SID_END_OF_CHAIN
+
+ i = 109
+ msat_sect = 0
+ sid_num = 0
+ while i < SAT_sect_count:
+ if (sid_num + 1) % 128 == 0:
+ #print 'link: ',
+ msat_sect += 1
+ if msat_sect < len(self.MSAT_sect_2nd):
+ MSAT_2nd[sid_num] = self.MSAT_sect_2nd[msat_sect]
+ else:
+ #print 'sid: ',
+ MSAT_2nd[sid_num] = self.SAT_sect[i]
+ i += 1
+ #print sid_num, MSAT_2nd[sid_num]
+ sid_num += 1
+
+ self.packed_MSAT_2nd = struct.pack('<%dl' % (MSAT_sect_count*128), *MSAT_2nd)
+
+ #print vars()
+ #print zip(range(0, sect), SAT)
+ #print self.book_stream_sect
+ #print self.MSAT_sect_2nd
+ #print MSAT_2nd
+ #print self.SAT_sect
+ #print self.dir_stream_sect
+
+
+ def __build_header(self):
+ doc_magic = '\xD0\xCF\x11\xE0\xA1\xB1\x1A\xE1'
+ file_uid = '\x00'*16
+ rev_num = '\x3E\x00'
+ ver_num = '\x03\x00'
+ byte_order = '\xFE\xFF'
+ log_sect_size = struct.pack('<H', 9)
+ log_short_sect_size = struct.pack('<H', 6)
+ not_used0 = '\x00'*10
+ total_sat_sectors = struct.pack('<L', len(self.SAT_sect))
+ dir_start_sid = struct.pack('<l', self.dir_stream_sect[0])
+ not_used1 = '\x00'*4
+ min_stream_size = struct.pack('<L', 0x1000)
+ ssat_start_sid = struct.pack('<l', -2)
+ total_ssat_sectors = struct.pack('<L', 0)
+
+ if len(self.MSAT_sect_2nd) == 0:
+ msat_start_sid = struct.pack('<l', -2)
+ else:
+ msat_start_sid = struct.pack('<l', self.MSAT_sect_2nd[0])
+
+ total_msat_sectors = struct.pack('<L', len(self.MSAT_sect_2nd))
+
+ self.header = ''.join([ doc_magic,
+ file_uid,
+ rev_num,
+ ver_num,
+ byte_order,
+ log_sect_size,
+ log_short_sect_size,
+ not_used0,
+ total_sat_sectors,
+ dir_start_sid,
+ not_used1,
+ min_stream_size,
+ ssat_start_sid,
+ total_ssat_sectors,
+ msat_start_sid,
+ total_msat_sectors
+ ])
+
+
+ def save(self, file_name_or_filelike_obj, stream):
+ # 1. Align stream on 0x1000 boundary (and therefore on sector boundary)
+ padding = '\x00' * (0x1000 - (len(stream) % 0x1000))
+ self.book_stream_len = len(stream) + len(padding)
+
+ self.__build_directory()
+ self.__build_sat()
+ self.__build_header()
+
+ f = file_name_or_filelike_obj
+ we_own_it = not hasattr(f, 'write')
+ if we_own_it:
+ f = open(file_name_or_filelike_obj, 'wb')
+ f.write(self.header)
+ f.write(self.packed_MSAT_1st)
+ f.write(stream)
+ f.write(padding)
+ f.write(self.packed_MSAT_2nd)
+ f.write(self.packed_SAT)
+ f.write(self.dir_stream)
+ if we_own_it:
+ f.close()
diff --git a/tablib/packages/xlwt/ExcelFormula.py b/tablib/packages/xlwt/ExcelFormula.py
index c72cb86..698d970 100644
--- a/tablib/packages/xlwt/ExcelFormula.py
+++ b/tablib/packages/xlwt/ExcelFormula.py
@@ -1,41 +1,43 @@
-from . import ExcelFormulaParser, ExcelFormulaLexer
-import struct
-from .antlr import ANTLRException
-
-
-class Formula(object):
- __slots__ = ["__init__", "__s", "__parser", "__sheet_refs", "__xcall_refs"]
-
-
- def __init__(self, s):
- try:
- self.__s = s
- lexer = ExcelFormulaLexer.Lexer(s)
- self.__parser = ExcelFormulaParser.Parser(lexer)
- self.__parser.formula()
- self.__sheet_refs = self.__parser.sheet_references
- self.__xcall_refs = self.__parser.xcall_references
- except ANTLRException as e:
- # print e
- raise ExcelFormulaParser.FormulaParseException("can't parse formula " + s)
-
- def get_references(self):
- return self.__sheet_refs, self.__xcall_refs
-
- def patch_references(self, patches):
- for offset, idx in patches:
- self.__parser.rpn = self.__parser.rpn[:offset] + struct.pack('<H', idx) + self.__parser.rpn[offset+2:]
-
- def text(self):
- return self.__s
-
- def rpn(self):
- '''
- Offset Size Contents
- 0 2 Size of the following formula data (sz)
- 2 sz Formula data (RPN token array)
- [2+sz] var. (optional) Additional data for specific tokens
-
- '''
- return struct.pack("<H", len(self.__parser.rpn)) + self.__parser.rpn
-
+# -*- coding: windows-1252 -*-
+
+import ExcelFormulaParser, ExcelFormulaLexer
+import struct
+from antlr import ANTLRException
+
+
+class Formula(object):
+ __slots__ = ["__init__", "__s", "__parser", "__sheet_refs", "__xcall_refs"]
+
+
+ def __init__(self, s):
+ try:
+ self.__s = s
+ lexer = ExcelFormulaLexer.Lexer(s)
+ self.__parser = ExcelFormulaParser.Parser(lexer)
+ self.__parser.formula()
+ self.__sheet_refs = self.__parser.sheet_references
+ self.__xcall_refs = self.__parser.xcall_references
+ except ANTLRException, e:
+ # print e
+ raise ExcelFormulaParser.FormulaParseException, "can't parse formula " + s
+
+ def get_references(self):
+ return self.__sheet_refs, self.__xcall_refs
+
+ def patch_references(self, patches):
+ for offset, idx in patches:
+ self.__parser.rpn = self.__parser.rpn[:offset] + struct.pack('<H', idx) + self.__parser.rpn[offset+2:]
+
+ def text(self):
+ return self.__s
+
+ def rpn(self):
+ '''
+ Offset Size Contents
+ 0 2 Size of the following formula data (sz)
+ 2 sz Formula data (RPN token array)
+ [2+sz] var. (optional) Additional data for specific tokens
+
+ '''
+ return struct.pack("<H", len(self.__parser.rpn)) + self.__parser.rpn
+
diff --git a/tablib/packages/xlwt/ExcelFormulaLexer.py b/tablib/packages/xlwt/ExcelFormulaLexer.py
index 5dc546c..91d999f 100644
--- a/tablib/packages/xlwt/ExcelFormulaLexer.py
+++ b/tablib/packages/xlwt/ExcelFormulaLexer.py
@@ -1,126 +1,128 @@
-import sys
-from .antlr import EOF, CommonToken as Tok, TokenStream, TokenStreamException
-import struct
-from . import ExcelFormulaParser
-from re import compile as recompile, match, LOCALE, UNICODE, IGNORECASE, VERBOSE
-
-
-int_const_pattern = r"\d+\b"
-flt_const_pattern = r"""
- (?:
- (?: \d* \. \d+ ) # .1 .12 .123 etc 9.1 etc 98.1 etc
- |
- (?: \d+ \. ) # 1. 12. 123. etc
- )
- # followed by optional exponent part
- (?: [Ee] [+-]? \d+ ) ?
- """
-str_const_pattern = r'"(?:[^"]|"")*"'
-#range2d_pattern = recompile(r"\$?[A-I]?[A-Z]\$?\d+:\$?[A-I]?[A-Z]\$?\d+"
-ref2d_r1c1_pattern = r"[Rr]0*[1-9][0-9]*[Cc]0*[1-9][0-9]*"
-ref2d_pattern = r"\$?[A-I]?[A-Z]\$?0*[1-9][0-9]*"
-true_pattern = r"TRUE\b"
-false_pattern = r"FALSE\b"
-if_pattern = r"IF\b"
-choose_pattern = r"CHOOSE\b"
-name_pattern = r"\w[\.\w]*"
-quotename_pattern = r"'(?:[^']|'')*'" #### It's essential that this bracket be non-grouping.
-ne_pattern = r"<>"
-ge_pattern = r">="
-le_pattern = r"<="
-
-pattern_type_tuples = (
- (flt_const_pattern, ExcelFormulaParser.NUM_CONST),
- (int_const_pattern, ExcelFormulaParser.INT_CONST),
- (str_const_pattern, ExcelFormulaParser.STR_CONST),
-# (range2d_pattern , ExcelFormulaParser.RANGE2D),
- (ref2d_r1c1_pattern, ExcelFormulaParser.REF2D_R1C1),
- (ref2d_pattern , ExcelFormulaParser.REF2D),
- (true_pattern , ExcelFormulaParser.TRUE_CONST),
- (false_pattern , ExcelFormulaParser.FALSE_CONST),
- (if_pattern , ExcelFormulaParser.FUNC_IF),
- (choose_pattern , ExcelFormulaParser.FUNC_CHOOSE),
- (name_pattern , ExcelFormulaParser.NAME),
- (quotename_pattern, ExcelFormulaParser.QUOTENAME),
- (ne_pattern, ExcelFormulaParser.NE),
- (ge_pattern, ExcelFormulaParser.GE),
- (le_pattern, ExcelFormulaParser.LE),
-)
-
-_re = recompile(
- '(' + ')|('.join([i[0] for i in pattern_type_tuples]) + ')',
- VERBOSE+LOCALE+IGNORECASE)
-
-_toktype = [None] + [i[1] for i in pattern_type_tuples]
-# need dummy at start because re.MatchObject.lastindex counts from 1
-
-single_char_lookup = {
- '=': ExcelFormulaParser.EQ,
- '<': ExcelFormulaParser.LT,
- '>': ExcelFormulaParser.GT,
- '+': ExcelFormulaParser.ADD,
- '-': ExcelFormulaParser.SUB,
- '*': ExcelFormulaParser.MUL,
- '/': ExcelFormulaParser.DIV,
- ':': ExcelFormulaParser.COLON,
- ';': ExcelFormulaParser.SEMICOLON,
- ',': ExcelFormulaParser.COMMA,
- '(': ExcelFormulaParser.LP,
- ')': ExcelFormulaParser.RP,
- '&': ExcelFormulaParser.CONCAT,
- '%': ExcelFormulaParser.PERCENT,
- '^': ExcelFormulaParser.POWER,
- '!': ExcelFormulaParser.BANG,
- }
-
-class Lexer(TokenStream):
- def __init__(self, text):
- self._text = text[:]
- self._pos = 0
- self._line = 0
-
- def isEOF(self):
- return len(self._text) <= self._pos
-
- def curr_ch(self):
- return self._text[self._pos]
-
- def next_ch(self, n = 1):
- self._pos += n
-
- def is_whitespace(self):
- return self.curr_ch() in " \t\n\r\f\v"
-
- def match_pattern(self):
- m = _re.match(self._text, self._pos)
- if not m:
- return None
- self._pos = m.end(0)
- return Tok(type = _toktype[m.lastindex], text = m.group(0), col = m.start(0) + 1)
-
- def nextToken(self):
- # skip whitespace
- while not self.isEOF() and self.is_whitespace():
- self.next_ch()
- if self.isEOF():
- return Tok(type = EOF)
- # first, try to match token with 2 or more chars
- t = self.match_pattern()
- if t:
- return t
- # second, we want 1-char tokens
- te = self.curr_ch()
- try:
- ty = single_char_lookup[te]
- except KeyError:
- raise TokenStreamException(
- "Unexpected char %r in column %u." % (self.curr_ch(), self._pos))
- self.next_ch()
- return Tok(type=ty, text=te, col=self._pos)
-
-if __name__ == '__main__':
- try:
- for t in Lexer(""" 1.23 456 "abcd" R2C2 a1 iv65536 true false if choose a_name 'qname' <> >= <= """):
- print(t)
- except TokenStreamException as e:
- print("error:", e)
+# -*- coding: windows-1252 -*-
+
+import sys
+from antlr import EOF, CommonToken as Tok, TokenStream, TokenStreamException
+import struct
+import ExcelFormulaParser
+from re import compile as recompile, match, LOCALE, UNICODE, IGNORECASE, VERBOSE
+
+
+int_const_pattern = r"\d+\b"
+flt_const_pattern = r"""
+ (?:
+ (?: \d* \. \d+ ) # .1 .12 .123 etc 9.1 etc 98.1 etc
+ |
+ (?: \d+ \. ) # 1. 12. 123. etc
+ )
+ # followed by optional exponent part
+ (?: [Ee] [+-]? \d+ ) ?
+ """
+str_const_pattern = r'"(?:[^"]|"")*"'
+#range2d_pattern = recompile(r"\$?[A-I]?[A-Z]\$?\d+:\$?[A-I]?[A-Z]\$?\d+"
+ref2d_r1c1_pattern = r"[Rr]0*[1-9][0-9]*[Cc]0*[1-9][0-9]*"
+ref2d_pattern = r"\$?[A-I]?[A-Z]\$?0*[1-9][0-9]*"
+true_pattern = r"TRUE\b"
+false_pattern = r"FALSE\b"
+if_pattern = r"IF\b"
+choose_pattern = r"CHOOSE\b"
+name_pattern = r"\w[\.\w]*"
+quotename_pattern = r"'(?:[^']|'')*'" #### It's essential that this bracket be non-grouping.
+ne_pattern = r"<>"
+ge_pattern = r">="
+le_pattern = r"<="
+
+pattern_type_tuples = (
+ (flt_const_pattern, ExcelFormulaParser.NUM_CONST),
+ (int_const_pattern, ExcelFormulaParser.INT_CONST),
+ (str_const_pattern, ExcelFormulaParser.STR_CONST),
+# (range2d_pattern , ExcelFormulaParser.RANGE2D),
+ (ref2d_r1c1_pattern, ExcelFormulaParser.REF2D_R1C1),
+ (ref2d_pattern , ExcelFormulaParser.REF2D),
+ (true_pattern , ExcelFormulaParser.TRUE_CONST),
+ (false_pattern , ExcelFormulaParser.FALSE_CONST),
+ (if_pattern , ExcelFormulaParser.FUNC_IF),
+ (choose_pattern , ExcelFormulaParser.FUNC_CHOOSE),
+ (name_pattern , ExcelFormulaParser.NAME),
+ (quotename_pattern, ExcelFormulaParser.QUOTENAME),
+ (ne_pattern, ExcelFormulaParser.NE),
+ (ge_pattern, ExcelFormulaParser.GE),
+ (le_pattern, ExcelFormulaParser.LE),
+)
+
+_re = recompile(
+ '(' + ')|('.join([i[0] for i in pattern_type_tuples]) + ')',
+ VERBOSE+LOCALE+IGNORECASE)
+
+_toktype = [None] + [i[1] for i in pattern_type_tuples]
+# need dummy at start because re.MatchObject.lastindex counts from 1
+
+single_char_lookup = {
+ '=': ExcelFormulaParser.EQ,
+ '<': ExcelFormulaParser.LT,
+ '>': ExcelFormulaParser.GT,
+ '+': ExcelFormulaParser.ADD,
+ '-': ExcelFormulaParser.SUB,
+ '*': ExcelFormulaParser.MUL,
+ '/': ExcelFormulaParser.DIV,
+ ':': ExcelFormulaParser.COLON,
+ ';': ExcelFormulaParser.SEMICOLON,
+ ',': ExcelFormulaParser.COMMA,
+ '(': ExcelFormulaParser.LP,
+ ')': ExcelFormulaParser.RP,
+ '&': ExcelFormulaParser.CONCAT,
+ '%': ExcelFormulaParser.PERCENT,
+ '^': ExcelFormulaParser.POWER,
+ '!': ExcelFormulaParser.BANG,
+ }
+
+class Lexer(TokenStream):
+ def __init__(self, text):
+ self._text = text[:]
+ self._pos = 0
+ self._line = 0
+
+ def isEOF(self):
+ return len(self._text) <= self._pos
+
+ def curr_ch(self):
+ return self._text[self._pos]
+
+ def next_ch(self, n = 1):
+ self._pos += n
+
+ def is_whitespace(self):
+ return self.curr_ch() in " \t\n\r\f\v"
+
+ def match_pattern(self):
+ m = _re.match(self._text, self._pos)
+ if not m:
+ return None
+ self._pos = m.end(0)
+ return Tok(type = _toktype[m.lastindex], text = m.group(0), col = m.start(0) + 1)
+
+ def nextToken(self):
+ # skip whitespace
+ while not self.isEOF() and self.is_whitespace():
+ self.next_ch()
+ if self.isEOF():
+ return Tok(type = EOF)
+ # first, try to match token with 2 or more chars
+ t = self.match_pattern()
+ if t:
+ return t
+ # second, we want 1-char tokens
+ te = self.curr_ch()
+ try:
+ ty = single_char_lookup[te]
+ except KeyError:
+ raise TokenStreamException(
+ "Unexpected char %r in column %u." % (self.curr_ch(), self._pos))
+ self.next_ch()
+ return Tok(type=ty, text=te, col=self._pos)
+
+if __name__ == '__main__':
+ try:
+ for t in Lexer(""" 1.23 456 "abcd" R2C2 a1 iv65536 true false if choose a_name 'qname' <> >= <= """):
+ print t
+ except TokenStreamException, e:
+ print "error:", e
diff --git a/tablib/packages/xlwt/ExcelFormulaParser.py b/tablib/packages/xlwt/ExcelFormulaParser.py
index 5e73934..000a8a0 100644
--- a/tablib/packages/xlwt/ExcelFormulaParser.py
+++ b/tablib/packages/xlwt/ExcelFormulaParser.py
@@ -1,659 +1,677 @@
-### $ANTLR 2.7.7 (20060930): "xlwt/excel-formula.g" -> "ExcelFormulaParser.py"$
-### import antlr and other modules ..
-import sys
-from . import antlr
-
-### header action >>>
-import struct
-from . import Utils
-from .UnicodeUtils import upack1
-from .ExcelMagic import *
-
-_RVAdelta = {"R": 0, "V": 0x20, "A": 0x40}
-_RVAdeltaRef = {"R": 0, "V": 0x20, "A": 0x40, "D": 0x20}
-_RVAdeltaArea = {"R": 0, "V": 0x20, "A": 0x40, "D": 0}
-
-
-class FormulaParseException(Exception):
- """
- An exception indicating that a Formula could not be successfully parsed.
- """
-### header action <<<
-### preamble action>>>
-
-### preamble action <<<
-
-### import antlr.Token
-from .antlr import Token
-### >>>The Known Token Types <<<
-SKIP = antlr.SKIP
-INVALID_TYPE = antlr.INVALID_TYPE
-EOF_TYPE = antlr.EOF_TYPE
-EOF = antlr.EOF
-NULL_TREE_LOOKAHEAD = antlr.NULL_TREE_LOOKAHEAD
-MIN_USER_TYPE = antlr.MIN_USER_TYPE
-TRUE_CONST = 4
-FALSE_CONST = 5
-STR_CONST = 6
-NUM_CONST = 7
-INT_CONST = 8
-FUNC_IF = 9
-FUNC_CHOOSE = 10
-NAME = 11
-QUOTENAME = 12
-EQ = 13
-NE = 14
-GT = 15
-LT = 16
-GE = 17
-LE = 18
-ADD = 19
-SUB = 20
-MUL = 21
-DIV = 22
-POWER = 23
-PERCENT = 24
-LP = 25
-RP = 26
-LB = 27
-RB = 28
-COLON = 29
-COMMA = 30
-SEMICOLON = 31
-REF2D = 32
-REF2D_R1C1 = 33
-BANG = 34
-CONCAT = 35
-
-class Parser(antlr.LLkParser):
- ### user action >>>
- ### user action <<<
-
- def __init__(self, *args, **kwargs):
- antlr.LLkParser.__init__(self, *args, **kwargs)
- self.tokenNames = _tokenNames
- ### __init__ header action >>>
- self.rpn = b""
- self.sheet_references = []
- self.xcall_references = []
- ### __init__ header action <<<
-
- def formula(self):
- self.expr("V")
-
- def expr(self, arg_type):
- self.prec0_expr(arg_type)
- while True:
- if ((self.LA(1) >= EQ and self.LA(1) <= LE)):
- pass
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [EQ]:
- pass
- self.match(EQ)
- op = struct.pack('B', ptgEQ)
- elif la1 and la1 in [NE]:
- pass
- self.match(NE)
- op = struct.pack('B', ptgNE)
- elif la1 and la1 in [GT]:
- pass
- self.match(GT)
- op = struct.pack('B', ptgGT)
- elif la1 and la1 in [LT]:
- pass
- self.match(LT)
- op = struct.pack('B', ptgLT)
- elif la1 and la1 in [GE]:
- pass
- self.match(GE)
- op = struct.pack('B', ptgGE)
- elif la1 and la1 in [LE]:
- pass
- self.match(LE)
- op = struct.pack('B', ptgLE)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- self.prec0_expr(arg_type)
- self.rpn += op
- else:
- break
-
-
- def prec0_expr(self,
- arg_type
- ):
-
- pass
- self.prec1_expr(arg_type)
- while True:
- if (self.LA(1)==CONCAT):
- pass
- pass
- self.match(CONCAT)
- op = struct.pack('B', ptgConcat)
- self.prec1_expr(arg_type)
- self.rpn += op
- else:
- break
-
-
- def prec1_expr(self,
- arg_type
- ):
-
- pass
- self.prec2_expr(arg_type)
- while True:
- if (self.LA(1)==ADD or self.LA(1)==SUB):
- pass
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [ADD]:
- pass
- self.match(ADD)
- op = struct.pack('B', ptgAdd)
- elif la1 and la1 in [SUB]:
- pass
- self.match(SUB)
- op = struct.pack('B', ptgSub)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- self.prec2_expr(arg_type)
- self.rpn += op;
- # print "**prec1_expr4 %s" % arg_type
- else:
- break
-
-
- def prec2_expr(self,
- arg_type
- ):
-
- pass
- self.prec3_expr(arg_type)
- while True:
- if (self.LA(1)==MUL or self.LA(1)==DIV):
- pass
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [MUL]:
- pass
- self.match(MUL)
- op = struct.pack('B', ptgMul)
- elif la1 and la1 in [DIV]:
- pass
- self.match(DIV)
- op = struct.pack('B', ptgDiv)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- self.prec3_expr(arg_type)
- self.rpn += op
- else:
- break
-
-
- def prec3_expr(self,
- arg_type
- ):
-
- pass
- self.prec4_expr(arg_type)
- while True:
- if (self.LA(1)==POWER):
- pass
- pass
- self.match(POWER)
- op = struct.pack('B', ptgPower)
- self.prec4_expr(arg_type)
- self.rpn += op
- else:
- break
-
-
- def prec4_expr(self,
- arg_type
- ):
-
- pass
- self.prec5_expr(arg_type)
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [PERCENT]:
- pass
- self.match(PERCENT)
- self.rpn += struct.pack('B', ptgPercent)
- elif la1 and la1 in [EOF,EQ,NE,GT,LT,GE,LE,ADD,SUB,MUL,DIV,POWER,RP,COMMA,SEMICOLON,CONCAT]:
- pass
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
-
- def prec5_expr(self,
- arg_type
- ):
-
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,LP,REF2D]:
- pass
- self.primary(arg_type)
- elif la1 and la1 in [SUB]:
- pass
- self.match(SUB)
- self.primary(arg_type)
- self.rpn += struct.pack('B', ptgUminus)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
-
- def primary(self,
- arg_type
- ):
-
- str_tok = None
- int_tok = None
- num_tok = None
- ref2d_tok = None
- ref2d1_tok = None
- ref2d2_tok = None
- ref3d_ref2d = None
- ref3d_ref2d2 = None
- name_tok = None
- func_tok = None
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [TRUE_CONST]:
- pass
- self.match(TRUE_CONST)
- self.rpn += struct.pack("2B", ptgBool, 1)
- elif la1 and la1 in [FALSE_CONST]:
- pass
- self.match(FALSE_CONST)
- self.rpn += struct.pack("2B", ptgBool, 0)
- elif la1 and la1 in [STR_CONST]:
- pass
- str_tok = self.LT(1)
- self.match(STR_CONST)
- self.rpn += struct.pack("B", ptgStr) + upack1(str_tok.text[1:-1].replace("\"\"", "\""))
- elif la1 and la1 in [NUM_CONST]:
- pass
- num_tok = self.LT(1)
- self.match(NUM_CONST)
- self.rpn += struct.pack("<Bd", ptgNum, float(num_tok.text))
- elif la1 and la1 in [FUNC_IF]:
- pass
- self.match(FUNC_IF)
- self.match(LP)
- self.expr("V")
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [SEMICOLON]:
- pass
- self.match(SEMICOLON)
- elif la1 and la1 in [COMMA]:
- pass
- self.match(COMMA)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- self.rpn += struct.pack("<BBH", ptgAttr, 0x02, 0) # tAttrIf
- pos0 = len(self.rpn) - 2
- self.expr(arg_type)
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [SEMICOLON]:
- pass
- self.match(SEMICOLON)
- elif la1 and la1 in [COMMA]:
- pass
- self.match(COMMA)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- self.rpn += struct.pack("<BBH", ptgAttr, 0x08, 0) # tAttrSkip
- pos1 = len(self.rpn) - 2
- self.rpn = self.rpn[:pos0] + struct.pack("<H", pos1-pos0) + self.rpn[pos0+2:]
- self.expr(arg_type)
- self.match(RP)
- self.rpn += struct.pack("<BBH", ptgAttr, 0x08, 3) # tAttrSkip
- self.rpn += struct.pack("<BBH", ptgFuncVarR, 3, 1) # 3 = nargs, 1 = IF func
- pos2 = len(self.rpn)
- self.rpn = self.rpn[:pos1] + struct.pack("<H", pos2-(pos1+2)-1) + self.rpn[pos1+2:]
- elif la1 and la1 in [FUNC_CHOOSE]:
- pass
- self.match(FUNC_CHOOSE)
- arg_type = b"R"
- rpn_chunks = []
- self.match(LP)
- self.expr("V")
- rpn_start = len(self.rpn)
- ref_markers = [len(self.sheet_references)]
- while True:
- if (self.LA(1)==COMMA or self.LA(1)==SEMICOLON):
- pass
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [SEMICOLON]:
- pass
- self.match(SEMICOLON)
- elif la1 and la1 in [COMMA]:
- pass
- self.match(COMMA)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- mark = len(self.rpn)
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,SUB,LP,REF2D]:
- pass
- self.expr(arg_type)
- elif la1 and la1 in [RP,COMMA,SEMICOLON]:
- pass
- self.rpn += struct.pack("B", ptgMissArg)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- rpn_chunks.append(self.rpn[mark:])
- ref_markers.append(len(self.sheet_references))
- else:
- break
-
- self.match(RP)
- self.rpn = self.rpn[:rpn_start]
- nc = len(rpn_chunks)
- chunklens = [len(chunk) for chunk in rpn_chunks]
- skiplens = [0] * nc
- skiplens[-1] = 3
- for ic in range(nc-1, 0, -1):
- skiplens[ic-1] = skiplens[ic] + chunklens[ic] + 4
- jump_pos = [2 * nc + 2]
- for ic in range(nc):
- jump_pos.append(jump_pos[-1] + chunklens[ic] + 4)
- chunk_shift = 2 * nc + 6 # size of tAttrChoose
- for ic in range(nc):
- for refx in range(ref_markers[ic], ref_markers[ic+1]):
- ref = self.sheet_references[refx]
- self.sheet_references[refx] = (ref[0], ref[1], ref[2] + chunk_shift)
- chunk_shift += 4 # size of tAttrSkip
- choose_rpn = []
- choose_rpn.append(struct.pack("<BBH", ptgAttr, 0x04, nc)) # 0x04 is tAttrChoose
- choose_rpn.append(struct.pack("<%dH" % (nc+1), *jump_pos))
- for ic in range(nc):
- choose_rpn.append(rpn_chunks[ic])
- choose_rpn.append(struct.pack("<BBH", ptgAttr, 0x08, skiplens[ic])) # 0x08 is tAttrSkip
- choose_rpn.append(struct.pack("<BBH", ptgFuncVarV, nc+1, 100)) # 100 is CHOOSE fn
- self.rpn += b"".join(choose_rpn)
- elif la1 and la1 in [LP]:
- pass
- self.match(LP)
- self.expr(arg_type)
- self.match(RP)
- self.rpn += struct.pack("B", ptgParen)
- else:
- if (self.LA(1)==INT_CONST) and (_tokenSet_0.member(self.LA(2))):
- pass
- int_tok = self.LT(1)
- self.match(INT_CONST)
- # print "**int_const", int_tok.text
- int_value = int(int_tok.text)
- if int_value <= 65535:
- self.rpn += struct.pack("<BH", ptgInt, int_value)
- else:
- self.rpn += struct.pack("<Bd", ptgNum, float(int_value))
- elif (self.LA(1)==REF2D) and (_tokenSet_0.member(self.LA(2))):
- pass
- ref2d_tok = self.LT(1)
- self.match(REF2D)
- # print "**ref2d %s %s" % (ref2d_tok.text, arg_type)
- r, c = Utils.cell_to_packed_rowcol(ref2d_tok.text)
- ptg = ptgRefR + _RVAdeltaRef[arg_type]
- self.rpn += struct.pack("<B2H", ptg, r, c)
- elif (self.LA(1)==REF2D) and (self.LA(2)==COLON):
- pass
- ref2d1_tok = self.LT(1)
- self.match(REF2D)
- self.match(COLON)
- ref2d2_tok = self.LT(1)
- self.match(REF2D)
- r1, c1 = Utils.cell_to_packed_rowcol(ref2d1_tok.text)
- r2, c2 = Utils.cell_to_packed_rowcol(ref2d2_tok.text)
- ptg = ptgAreaR + _RVAdeltaArea[arg_type]
- self.rpn += struct.pack("<B4H", ptg, r1, r2, c1, c2)
- elif (self.LA(1)==INT_CONST or self.LA(1)==NAME or self.LA(1)==QUOTENAME) and (self.LA(2)==COLON or self.LA(2)==BANG):
- pass
- sheet1=self.sheet()
- sheet2 = sheet1
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [COLON]:
- pass
- self.match(COLON)
- sheet2=self.sheet()
- elif la1 and la1 in [BANG]:
- pass
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- self.match(BANG)
- ref3d_ref2d = self.LT(1)
- self.match(REF2D)
- ptg = ptgRef3dR + _RVAdeltaRef[arg_type]
- rpn_ref2d = b""
- r1, c1 = Utils.cell_to_packed_rowcol(ref3d_ref2d.text)
- rpn_ref2d = struct.pack("<3H", 0x0000, r1, c1)
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [COLON]:
- pass
- self.match(COLON)
- ref3d_ref2d2 = self.LT(1)
- self.match(REF2D)
- ptg = ptgArea3dR + _RVAdeltaArea[arg_type]
- r2, c2 = Utils.cell_to_packed_rowcol(ref3d_ref2d2.text)
- rpn_ref2d = struct.pack("<5H", 0x0000, r1, r2, c1, c2)
- elif la1 and la1 in [EOF,EQ,NE,GT,LT,GE,LE,ADD,SUB,MUL,DIV,POWER,PERCENT,RP,COMMA,SEMICOLON,CONCAT]:
- pass
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- self.rpn += struct.pack("<B", ptg)
- self.sheet_references.append((sheet1, sheet2, len(self.rpn)))
- self.rpn += rpn_ref2d
- elif (self.LA(1)==NAME) and (_tokenSet_0.member(self.LA(2))):
- name_tok = self.LT(1)
- self.match(NAME)
- raise Exception("[formula] found unexpected NAME token (%r)" % name_tok.txt)
- # #### TODO: handle references to defined names here
- elif (self.LA(1)==NAME) and (self.LA(2)==LP):
- func_tok = self.LT(1)
- self.match(NAME)
- func_toku = func_tok.text.upper()
- if func_toku in all_funcs_by_name:
- (opcode,
- min_argc,
- max_argc,
- func_type,
- arg_type_str) = all_funcs_by_name[func_toku]
- arg_type_list = list(arg_type_str)
- else:
- raise Exception("[formula] unknown function (%s)" % func_tok.text)
- # print "**func_tok1 %s %s" % (func_toku, func_type)
- xcall = opcode < 0
- if xcall:
- # The name of the add-in function is passed as the 1st arg
- # of the hidden XCALL function
- self.xcall_references.append((func_toku, len(self.rpn) + 1))
- self.rpn += struct.pack("<BHHH",
- ptgNameXR,
- 0xadde, # ##PATCHME## index to REF entry in EXTERNSHEET record
- 0xefbe, # ##PATCHME## one-based index to EXTERNNAME record
- 0x0000) # unused
- self.match(LP)
- arg_count=self.expr_list(arg_type_list, min_argc, max_argc)
- self.match(RP)
- if arg_count > max_argc or arg_count < min_argc:
- raise Exception("%d parameters for function: %s" % (arg_count, func_tok.text))
- if xcall:
- func_ptg = ptgFuncVarR + _RVAdelta[func_type]
- self.rpn += struct.pack("<2BH", func_ptg, arg_count + 1, 255) # 255 is magic XCALL function
- elif min_argc == max_argc:
- func_ptg = ptgFuncR + _RVAdelta[func_type]
- self.rpn += struct.pack("<BH", func_ptg, opcode)
- elif arg_count == 1 and func_tok.text.upper() == "SUM":
- self.rpn += struct.pack("<BBH", ptgAttr, 0x10, 0) # tAttrSum
- else:
- func_ptg = ptgFuncVarR + _RVAdelta[func_type]
- self.rpn += struct.pack("<2BH", func_ptg, arg_count, opcode)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- def sheet(self):
- ref = None
- sheet_ref_name = None
- sheet_ref_int = None
- sheet_ref_quote = None
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [NAME]:
- sheet_ref_name = self.LT(1)
- self.match(NAME)
- ref = sheet_ref_name.text
- elif la1 and la1 in [INT_CONST]:
- sheet_ref_int = self.LT(1)
- self.match(INT_CONST)
- ref = sheet_ref_int.text
- elif la1 and la1 in [QUOTENAME]:
- sheet_ref_quote = self.LT(1)
- self.match(QUOTENAME)
- ref = sheet_ref_quote.text[1:-1].replace("''", "'")
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- return ref
-
- def expr_list(self,
- arg_type_list, min_argc, max_argc
- ):
- arg_cnt = None
-
- arg_cnt = 0
- arg_type = arg_type_list[arg_cnt]
- # print "**expr_list1[%d] req=%s" % (arg_cnt, arg_type)
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,SUB,LP,REF2D]:
- pass
- self.expr(arg_type)
- arg_cnt += 1
- while True:
- if (self.LA(1)==COMMA or self.LA(1)==SEMICOLON):
- pass
- if arg_cnt < len(arg_type_list):
- arg_type = arg_type_list[arg_cnt]
- else:
- arg_type = arg_type_list[-1]
- if arg_type == "+":
- arg_type = arg_type_list[-2]
- # print "**expr_list2[%d] req=%s" % (arg_cnt, arg_type)
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [SEMICOLON]:
- pass
- self.match(SEMICOLON)
- elif la1 and la1 in [COMMA]:
- pass
- self.match(COMMA)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- la1 = self.LA(1)
- if False:
- pass
- elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,SUB,LP,REF2D]:
- pass
- self.expr(arg_type)
- elif la1 and la1 in [RP,COMMA,SEMICOLON]:
- pass
- self.rpn += struct.pack("B", ptgMissArg)
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- arg_cnt += 1
- else:
- break
-
- elif la1 and la1 in [RP]:
- pass
- else:
- raise antlr.NoViableAltException(self.LT(1), self.getFilename())
-
- return arg_cnt
-
-
-_tokenNames = [
- "<0>",
- "EOF",
- "<2>",
- "NULL_TREE_LOOKAHEAD",
- "TRUE_CONST",
- "FALSE_CONST",
- "STR_CONST",
- "NUM_CONST",
- "INT_CONST",
- "FUNC_IF",
- "FUNC_CHOOSE",
- "NAME",
- "QUOTENAME",
- "EQ",
- "NE",
- "GT",
- "LT",
- "GE",
- "LE",
- "ADD",
- "SUB",
- "MUL",
- "DIV",
- "POWER",
- "PERCENT",
- "LP",
- "RP",
- "LB",
- "RB",
- "COLON",
- "COMMA",
- "SEMICOLON",
- "REF2D",
- "REF2D_R1C1",
- "BANG",
- "CONCAT"
-]
-
-
-### generate bit set
-def mk_tokenSet_0():
- ### var1
- data = [ 37681618946, 0]
- return data
-_tokenSet_0 = antlr.BitSet(mk_tokenSet_0())
-
+### $ANTLR 2.7.7 (20060930): "xlwt/excel-formula.g" -> "ExcelFormulaParser.py"$
+### import antlr and other modules ..
+import sys
+import antlr
+
+version = sys.version.split()[0]
+if version < '2.2.1':
+ False = 0
+if version < '2.3':
+ True = not False
+### header action >>>
+import struct
+import Utils
+from UnicodeUtils import upack1
+from ExcelMagic import *
+
+_RVAdelta = {"R": 0, "V": 0x20, "A": 0x40}
+_RVAdeltaRef = {"R": 0, "V": 0x20, "A": 0x40, "D": 0x20}
+_RVAdeltaArea = {"R": 0, "V": 0x20, "A": 0x40, "D": 0}
+
+
+class FormulaParseException(Exception):
+ """
+ An exception indicating that a Formula could not be successfully parsed.
+ """
+### header action <<<
+### preamble action>>>
+
+### preamble action <<<
+
+### import antlr.Token
+from antlr import Token
+### >>>The Known Token Types <<<
+SKIP = antlr.SKIP
+INVALID_TYPE = antlr.INVALID_TYPE
+EOF_TYPE = antlr.EOF_TYPE
+EOF = antlr.EOF
+NULL_TREE_LOOKAHEAD = antlr.NULL_TREE_LOOKAHEAD
+MIN_USER_TYPE = antlr.MIN_USER_TYPE
+TRUE_CONST = 4
+FALSE_CONST = 5
+STR_CONST = 6
+NUM_CONST = 7
+INT_CONST = 8
+FUNC_IF = 9
+FUNC_CHOOSE = 10
+NAME = 11
+QUOTENAME = 12
+EQ = 13
+NE = 14
+GT = 15
+LT = 16
+GE = 17
+LE = 18
+ADD = 19
+SUB = 20
+MUL = 21
+DIV = 22
+POWER = 23
+PERCENT = 24
+LP = 25
+RP = 26
+LB = 27
+RB = 28
+COLON = 29
+COMMA = 30
+SEMICOLON = 31
+REF2D = 32
+REF2D_R1C1 = 33
+BANG = 34
+CONCAT = 35
+
+class Parser(antlr.LLkParser):
+ ### user action >>>
+ ### user action <<<
+
+ def __init__(self, *args, **kwargs):
+ antlr.LLkParser.__init__(self, *args, **kwargs)
+ self.tokenNames = _tokenNames
+ ### __init__ header action >>>
+ self.rpn = ""
+ self.sheet_references = []
+ self.xcall_references = []
+ ### __init__ header action <<<
+
+ def formula(self):
+
+ pass
+ self.expr("V")
+
+ def expr(self,
+ arg_type
+ ):
+
+ pass
+ self.prec0_expr(arg_type)
+ while True:
+ if ((self.LA(1) >= EQ and self.LA(1) <= LE)):
+ pass
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [EQ]:
+ pass
+ self.match(EQ)
+ op = struct.pack('B', ptgEQ)
+ elif la1 and la1 in [NE]:
+ pass
+ self.match(NE)
+ op = struct.pack('B', ptgNE)
+ elif la1 and la1 in [GT]:
+ pass
+ self.match(GT)
+ op = struct.pack('B', ptgGT)
+ elif la1 and la1 in [LT]:
+ pass
+ self.match(LT)
+ op = struct.pack('B', ptgLT)
+ elif la1 and la1 in [GE]:
+ pass
+ self.match(GE)
+ op = struct.pack('B', ptgGE)
+ elif la1 and la1 in [LE]:
+ pass
+ self.match(LE)
+ op = struct.pack('B', ptgLE)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ self.prec0_expr(arg_type)
+ self.rpn += op
+ else:
+ break
+
+
+ def prec0_expr(self,
+ arg_type
+ ):
+
+ pass
+ self.prec1_expr(arg_type)
+ while True:
+ if (self.LA(1)==CONCAT):
+ pass
+ pass
+ self.match(CONCAT)
+ op = struct.pack('B', ptgConcat)
+ self.prec1_expr(arg_type)
+ self.rpn += op
+ else:
+ break
+
+
+ def prec1_expr(self,
+ arg_type
+ ):
+
+ pass
+ self.prec2_expr(arg_type)
+ while True:
+ if (self.LA(1)==ADD or self.LA(1)==SUB):
+ pass
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [ADD]:
+ pass
+ self.match(ADD)
+ op = struct.pack('B', ptgAdd)
+ elif la1 and la1 in [SUB]:
+ pass
+ self.match(SUB)
+ op = struct.pack('B', ptgSub)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ self.prec2_expr(arg_type)
+ self.rpn += op;
+ # print "**prec1_expr4 %s" % arg_type
+ else:
+ break
+
+
+ def prec2_expr(self,
+ arg_type
+ ):
+
+ pass
+ self.prec3_expr(arg_type)
+ while True:
+ if (self.LA(1)==MUL or self.LA(1)==DIV):
+ pass
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [MUL]:
+ pass
+ self.match(MUL)
+ op = struct.pack('B', ptgMul)
+ elif la1 and la1 in [DIV]:
+ pass
+ self.match(DIV)
+ op = struct.pack('B', ptgDiv)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ self.prec3_expr(arg_type)
+ self.rpn += op
+ else:
+ break
+
+
+ def prec3_expr(self,
+ arg_type
+ ):
+
+ pass
+ self.prec4_expr(arg_type)
+ while True:
+ if (self.LA(1)==POWER):
+ pass
+ pass
+ self.match(POWER)
+ op = struct.pack('B', ptgPower)
+ self.prec4_expr(arg_type)
+ self.rpn += op
+ else:
+ break
+
+
+ def prec4_expr(self,
+ arg_type
+ ):
+
+ pass
+ self.prec5_expr(arg_type)
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [PERCENT]:
+ pass
+ self.match(PERCENT)
+ self.rpn += struct.pack('B', ptgPercent)
+ elif la1 and la1 in [EOF,EQ,NE,GT,LT,GE,LE,ADD,SUB,MUL,DIV,POWER,RP,COMMA,SEMICOLON,CONCAT]:
+ pass
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+
+ def prec5_expr(self,
+ arg_type
+ ):
+
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,LP,REF2D]:
+ pass
+ self.primary(arg_type)
+ elif la1 and la1 in [SUB]:
+ pass
+ self.match(SUB)
+ self.primary(arg_type)
+ self.rpn += struct.pack('B', ptgUminus)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+
+ def primary(self,
+ arg_type
+ ):
+
+ str_tok = None
+ int_tok = None
+ num_tok = None
+ ref2d_tok = None
+ ref2d1_tok = None
+ ref2d2_tok = None
+ ref3d_ref2d = None
+ ref3d_ref2d2 = None
+ name_tok = None
+ func_tok = None
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [TRUE_CONST]:
+ pass
+ self.match(TRUE_CONST)
+ self.rpn += struct.pack("2B", ptgBool, 1)
+ elif la1 and la1 in [FALSE_CONST]:
+ pass
+ self.match(FALSE_CONST)
+ self.rpn += struct.pack("2B", ptgBool, 0)
+ elif la1 and la1 in [STR_CONST]:
+ pass
+ str_tok = self.LT(1)
+ self.match(STR_CONST)
+ self.rpn += struct.pack("B", ptgStr) + upack1(str_tok.text[1:-1].replace("\"\"", "\""))
+ elif la1 and la1 in [NUM_CONST]:
+ pass
+ num_tok = self.LT(1)
+ self.match(NUM_CONST)
+ self.rpn += struct.pack("<Bd", ptgNum, float(num_tok.text))
+ elif la1 and la1 in [FUNC_IF]:
+ pass
+ self.match(FUNC_IF)
+ self.match(LP)
+ self.expr("V")
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [SEMICOLON]:
+ pass
+ self.match(SEMICOLON)
+ elif la1 and la1 in [COMMA]:
+ pass
+ self.match(COMMA)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x02, 0) # tAttrIf
+ pos0 = len(self.rpn) - 2
+ self.expr(arg_type)
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [SEMICOLON]:
+ pass
+ self.match(SEMICOLON)
+ elif la1 and la1 in [COMMA]:
+ pass
+ self.match(COMMA)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x08, 0) # tAttrSkip
+ pos1 = len(self.rpn) - 2
+ self.rpn = self.rpn[:pos0] + struct.pack("<H", pos1-pos0) + self.rpn[pos0+2:]
+ self.expr(arg_type)
+ self.match(RP)
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x08, 3) # tAttrSkip
+ self.rpn += struct.pack("<BBH", ptgFuncVarR, 3, 1) # 3 = nargs, 1 = IF func
+ pos2 = len(self.rpn)
+ self.rpn = self.rpn[:pos1] + struct.pack("<H", pos2-(pos1+2)-1) + self.rpn[pos1+2:]
+ elif la1 and la1 in [FUNC_CHOOSE]:
+ pass
+ self.match(FUNC_CHOOSE)
+ arg_type = "R"
+ rpn_chunks = []
+ self.match(LP)
+ self.expr("V")
+ rpn_start = len(self.rpn)
+ ref_markers = [len(self.sheet_references)]
+ while True:
+ if (self.LA(1)==COMMA or self.LA(1)==SEMICOLON):
+ pass
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [SEMICOLON]:
+ pass
+ self.match(SEMICOLON)
+ elif la1 and la1 in [COMMA]:
+ pass
+ self.match(COMMA)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ mark = len(self.rpn)
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,SUB,LP,REF2D]:
+ pass
+ self.expr(arg_type)
+ elif la1 and la1 in [RP,COMMA,SEMICOLON]:
+ pass
+ self.rpn += struct.pack("B", ptgMissArg)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ rpn_chunks.append(self.rpn[mark:])
+ ref_markers.append(len(self.sheet_references))
+ else:
+ break
+
+ self.match(RP)
+ self.rpn = self.rpn[:rpn_start]
+ nc = len(rpn_chunks)
+ chunklens = [len(chunk) for chunk in rpn_chunks]
+ skiplens = [0] * nc
+ skiplens[-1] = 3
+ for ic in xrange(nc-1, 0, -1):
+ skiplens[ic-1] = skiplens[ic] + chunklens[ic] + 4
+ jump_pos = [2 * nc + 2]
+ for ic in xrange(nc):
+ jump_pos.append(jump_pos[-1] + chunklens[ic] + 4)
+ chunk_shift = 2 * nc + 6 # size of tAttrChoose
+ for ic in xrange(nc):
+ for refx in xrange(ref_markers[ic], ref_markers[ic+1]):
+ ref = self.sheet_references[refx]
+ self.sheet_references[refx] = (ref[0], ref[1], ref[2] + chunk_shift)
+ chunk_shift += 4 # size of tAttrSkip
+ choose_rpn = []
+ choose_rpn.append(struct.pack("<BBH", ptgAttr, 0x04, nc)) # 0x04 is tAttrChoose
+ choose_rpn.append(struct.pack("<%dH" % (nc+1), *jump_pos))
+ for ic in xrange(nc):
+ choose_rpn.append(rpn_chunks[ic])
+ choose_rpn.append(struct.pack("<BBH", ptgAttr, 0x08, skiplens[ic])) # 0x08 is tAttrSkip
+ choose_rpn.append(struct.pack("<BBH", ptgFuncVarV, nc+1, 100)) # 100 is CHOOSE fn
+ self.rpn += "".join(choose_rpn)
+ elif la1 and la1 in [LP]:
+ pass
+ self.match(LP)
+ self.expr(arg_type)
+ self.match(RP)
+ self.rpn += struct.pack("B", ptgParen)
+ else:
+ if (self.LA(1)==INT_CONST) and (_tokenSet_0.member(self.LA(2))):
+ pass
+ int_tok = self.LT(1)
+ self.match(INT_CONST)
+ # print "**int_const", int_tok.text
+ int_value = int(int_tok.text)
+ if int_value <= 65535:
+ self.rpn += struct.pack("<BH", ptgInt, int_value)
+ else:
+ self.rpn += struct.pack("<Bd", ptgNum, float(int_value))
+ elif (self.LA(1)==REF2D) and (_tokenSet_0.member(self.LA(2))):
+ pass
+ ref2d_tok = self.LT(1)
+ self.match(REF2D)
+ # print "**ref2d %s %s" % (ref2d_tok.text, arg_type)
+ r, c = Utils.cell_to_packed_rowcol(ref2d_tok.text)
+ ptg = ptgRefR + _RVAdeltaRef[arg_type]
+ self.rpn += struct.pack("<B2H", ptg, r, c)
+ elif (self.LA(1)==REF2D) and (self.LA(2)==COLON):
+ pass
+ ref2d1_tok = self.LT(1)
+ self.match(REF2D)
+ self.match(COLON)
+ ref2d2_tok = self.LT(1)
+ self.match(REF2D)
+ r1, c1 = Utils.cell_to_packed_rowcol(ref2d1_tok.text)
+ r2, c2 = Utils.cell_to_packed_rowcol(ref2d2_tok.text)
+ ptg = ptgAreaR + _RVAdeltaArea[arg_type]
+ self.rpn += struct.pack("<B4H", ptg, r1, r2, c1, c2)
+ elif (self.LA(1)==INT_CONST or self.LA(1)==NAME or self.LA(1)==QUOTENAME) and (self.LA(2)==COLON or self.LA(2)==BANG):
+ pass
+ sheet1=self.sheet()
+ sheet2 = sheet1
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [COLON]:
+ pass
+ self.match(COLON)
+ sheet2=self.sheet()
+ elif la1 and la1 in [BANG]:
+ pass
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ self.match(BANG)
+ ref3d_ref2d = self.LT(1)
+ self.match(REF2D)
+ ptg = ptgRef3dR + _RVAdeltaRef[arg_type]
+ rpn_ref2d = ""
+ r1, c1 = Utils.cell_to_packed_rowcol(ref3d_ref2d.text)
+ rpn_ref2d = struct.pack("<3H", 0x0000, r1, c1)
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [COLON]:
+ pass
+ self.match(COLON)
+ ref3d_ref2d2 = self.LT(1)
+ self.match(REF2D)
+ ptg = ptgArea3dR + _RVAdeltaArea[arg_type]
+ r2, c2 = Utils.cell_to_packed_rowcol(ref3d_ref2d2.text)
+ rpn_ref2d = struct.pack("<5H", 0x0000, r1, r2, c1, c2)
+ elif la1 and la1 in [EOF,EQ,NE,GT,LT,GE,LE,ADD,SUB,MUL,DIV,POWER,PERCENT,RP,COMMA,SEMICOLON,CONCAT]:
+ pass
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ self.rpn += struct.pack("<B", ptg)
+ self.sheet_references.append((sheet1, sheet2, len(self.rpn)))
+ self.rpn += rpn_ref2d
+ elif (self.LA(1)==NAME) and (_tokenSet_0.member(self.LA(2))):
+ pass
+ name_tok = self.LT(1)
+ self.match(NAME)
+ raise Exception("[formula] found unexpected NAME token (%r)" % name_tok.txt)
+ # #### TODO: handle references to defined names here
+ elif (self.LA(1)==NAME) and (self.LA(2)==LP):
+ pass
+ func_tok = self.LT(1)
+ self.match(NAME)
+ func_toku = func_tok.text.upper()
+ if func_toku in all_funcs_by_name:
+ (opcode,
+ min_argc,
+ max_argc,
+ func_type,
+ arg_type_str) = all_funcs_by_name[func_toku]
+ arg_type_list = list(arg_type_str)
+ else:
+ raise Exception("[formula] unknown function (%s)" % func_tok.text)
+ # print "**func_tok1 %s %s" % (func_toku, func_type)
+ xcall = opcode < 0
+ if xcall:
+ # The name of the add-in function is passed as the 1st arg
+ # of the hidden XCALL function
+ self.xcall_references.append((func_toku, len(self.rpn) + 1))
+ self.rpn += struct.pack("<BHHH",
+ ptgNameXR,
+ 0xadde, # ##PATCHME## index to REF entry in EXTERNSHEET record
+ 0xefbe, # ##PATCHME## one-based index to EXTERNNAME record
+ 0x0000) # unused
+ self.match(LP)
+ arg_count=self.expr_list(arg_type_list, min_argc, max_argc)
+ self.match(RP)
+ if arg_count > max_argc or arg_count < min_argc:
+ raise Exception, "%d parameters for function: %s" % (arg_count, func_tok.text)
+ if xcall:
+ func_ptg = ptgFuncVarR + _RVAdelta[func_type]
+ self.rpn += struct.pack("<2BH", func_ptg, arg_count + 1, 255) # 255 is magic XCALL function
+ elif min_argc == max_argc:
+ func_ptg = ptgFuncR + _RVAdelta[func_type]
+ self.rpn += struct.pack("<BH", func_ptg, opcode)
+ elif arg_count == 1 and func_tok.text.upper() == "SUM":
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x10, 0) # tAttrSum
+ else:
+ func_ptg = ptgFuncVarR + _RVAdelta[func_type]
+ self.rpn += struct.pack("<2BH", func_ptg, arg_count, opcode)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+
+ def sheet(self):
+ ref = None
+
+ sheet_ref_name = None
+ sheet_ref_int = None
+ sheet_ref_quote = None
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [NAME]:
+ pass
+ sheet_ref_name = self.LT(1)
+ self.match(NAME)
+ ref = sheet_ref_name.text
+ elif la1 and la1 in [INT_CONST]:
+ pass
+ sheet_ref_int = self.LT(1)
+ self.match(INT_CONST)
+ ref = sheet_ref_int.text
+ elif la1 and la1 in [QUOTENAME]:
+ pass
+ sheet_ref_quote = self.LT(1)
+ self.match(QUOTENAME)
+ ref = sheet_ref_quote.text[1:-1].replace("''", "'")
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ return ref
+
+ def expr_list(self,
+ arg_type_list, min_argc, max_argc
+ ):
+ arg_cnt = None
+
+ arg_cnt = 0
+ arg_type = arg_type_list[arg_cnt]
+ # print "**expr_list1[%d] req=%s" % (arg_cnt, arg_type)
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,SUB,LP,REF2D]:
+ pass
+ self.expr(arg_type)
+ arg_cnt += 1
+ while True:
+ if (self.LA(1)==COMMA or self.LA(1)==SEMICOLON):
+ pass
+ if arg_cnt < len(arg_type_list):
+ arg_type = arg_type_list[arg_cnt]
+ else:
+ arg_type = arg_type_list[-1]
+ if arg_type == "+":
+ arg_type = arg_type_list[-2]
+ # print "**expr_list2[%d] req=%s" % (arg_cnt, arg_type)
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [SEMICOLON]:
+ pass
+ self.match(SEMICOLON)
+ elif la1 and la1 in [COMMA]:
+ pass
+ self.match(COMMA)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ la1 = self.LA(1)
+ if False:
+ pass
+ elif la1 and la1 in [TRUE_CONST,FALSE_CONST,STR_CONST,NUM_CONST,INT_CONST,FUNC_IF,FUNC_CHOOSE,NAME,QUOTENAME,SUB,LP,REF2D]:
+ pass
+ self.expr(arg_type)
+ elif la1 and la1 in [RP,COMMA,SEMICOLON]:
+ pass
+ self.rpn += struct.pack("B", ptgMissArg)
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ arg_cnt += 1
+ else:
+ break
+
+ elif la1 and la1 in [RP]:
+ pass
+ else:
+ raise antlr.NoViableAltException(self.LT(1), self.getFilename())
+
+ return arg_cnt
+
+
+_tokenNames = [
+ "<0>",
+ "EOF",
+ "<2>",
+ "NULL_TREE_LOOKAHEAD",
+ "TRUE_CONST",
+ "FALSE_CONST",
+ "STR_CONST",
+ "NUM_CONST",
+ "INT_CONST",
+ "FUNC_IF",
+ "FUNC_CHOOSE",
+ "NAME",
+ "QUOTENAME",
+ "EQ",
+ "NE",
+ "GT",
+ "LT",
+ "GE",
+ "LE",
+ "ADD",
+ "SUB",
+ "MUL",
+ "DIV",
+ "POWER",
+ "PERCENT",
+ "LP",
+ "RP",
+ "LB",
+ "RB",
+ "COLON",
+ "COMMA",
+ "SEMICOLON",
+ "REF2D",
+ "REF2D_R1C1",
+ "BANG",
+ "CONCAT"
+]
+
+
+### generate bit set
+def mk_tokenSet_0():
+ ### var1
+ data = [ 37681618946L, 0L]
+ return data
+_tokenSet_0 = antlr.BitSet(mk_tokenSet_0())
+
diff --git a/tablib/packages/xlwt/ExcelMagic.py b/tablib/packages/xlwt/ExcelMagic.py
index 90372b4..a49ae1f 100644
--- a/tablib/packages/xlwt/ExcelMagic.py
+++ b/tablib/packages/xlwt/ExcelMagic.py
@@ -1,859 +1,862 @@
-""" lots of Excel Magic Numbers """
-
-# Boundaries BIFF8+
-
-MAX_ROW = 65536
-MAX_COL = 256
-
-
-biff_records = {
- 0x0000: "DIMENSIONS",
- 0x0001: "BLANK",
- 0x0002: "INTEGER",
- 0x0003: "NUMBER",
- 0x0004: "LABEL",
- 0x0005: "BOOLERR",
- 0x0006: "FORMULA",
- 0x0007: "STRING",
- 0x0008: "ROW",
- 0x0009: "BOF",
- 0x000A: "EOF",
- 0x000B: "INDEX",
- 0x000C: "CALCCOUNT",
- 0x000D: "CALCMODE",
- 0x000E: "PRECISION",
- 0x000F: "REFMODE",
- 0x0010: "DELTA",
- 0x0011: "ITERATION",
- 0x0012: "PROTECT",
- 0x0013: "PASSWORD",
- 0x0014: "HEADER",
- 0x0015: "FOOTER",
- 0x0016: "EXTERNCOUNT",
- 0x0017: "EXTERNSHEET",
- 0x0018: "NAME",
- 0x0019: "WINDOWPROTECT",
- 0x001A: "VERTICALPAGEBREAKS",
- 0x001B: "HORIZONTALPAGEBREAKS",
- 0x001C: "NOTE",
- 0x001D: "SELECTION",
- 0x001E: "FORMAT",
- 0x001F: "FORMATCOUNT",
- 0x0020: "COLUMNDEFAULT",
- 0x0021: "ARRAY",
- 0x0022: "1904",
- 0x0023: "EXTERNNAME",
- 0x0024: "COLWIDTH",
- 0x0025: "DEFAULTROWHEIGHT",
- 0x0026: "LEFTMARGIN",
- 0x0027: "RIGHTMARGIN",
- 0x0028: "TOPMARGIN",
- 0x0029: "BOTTOMMARGIN",
- 0x002A: "PRINTHEADERS",
- 0x002B: "PRINTGRIDLINES",
- 0x002F: "FILEPASS",
- 0x0031: "FONT",
- 0x0036: "TABLE",
- 0x003C: "CONTINUE",
- 0x003D: "WINDOW1",
- 0x003E: "WINDOW2",
- 0x0040: "BACKUP",
- 0x0041: "PANE",
- 0x0042: "CODEPAGE",
- 0x0043: "XF",
- 0x0044: "IXFE",
- 0x0045: "EFONT",
- 0x004D: "PLS",
- 0x0050: "DCON",
- 0x0051: "DCONREF",
- 0x0053: "DCONNAME",
- 0x0055: "DEFCOLWIDTH",
- 0x0056: "BUILTINFMTCNT",
- 0x0059: "XCT",
- 0x005A: "CRN",
- 0x005B: "FILESHARING",
- 0x005C: "WRITEACCESS",
- 0x005D: "OBJ",
- 0x005E: "UNCALCED",
- 0x005F: "SAFERECALC",
- 0x0060: "TEMPLATE",
- 0x0063: "OBJPROTECT",
- 0x007D: "COLINFO",
- 0x007E: "RK",
- 0x007F: "IMDATA",
- 0x0080: "GUTS",
- 0x0081: "WSBOOL",
- 0x0082: "GRIDSET",
- 0x0083: "HCENTER",
- 0x0084: "VCENTER",
- 0x0085: "BOUNDSHEET",
- 0x0086: "WRITEPROT",
- 0x0087: "ADDIN",
- 0x0088: "EDG",
- 0x0089: "PUB",
- 0x008C: "COUNTRY",
- 0x008D: "HIDEOBJ",
- 0x008E: "BUNDLESOFFSET",
- 0x008F: "BUNDLEHEADER",
- 0x0090: "SORT",
- 0x0091: "SUB",
- 0x0092: "PALETTE",
- 0x0093: "STYLE",
- 0x0094: "LHRECORD",
- 0x0095: "LHNGRAPH",
- 0x0096: "SOUND",
- 0x0098: "LPR",
- 0x0099: "STANDARDWIDTH",
- 0x009A: "FNGROUPNAME",
- 0x009B: "FILTERMODE",
- 0x009C: "FNGROUPCOUNT",
- 0x009D: "AUTOFILTERINFO",
- 0x009E: "AUTOFILTER",
- 0x00A0: "SCL",
- 0x00A1: "SETUP",
- 0x00A9: "COORDLIST",
- 0x00AB: "GCW",
- 0x00AE: "SCENMAN",
- 0x00AF: "SCENARIO",
- 0x00B0: "SXVIEW",
- 0x00B1: "SXVD",
- 0x00B2: "SXVI",
- 0x00B4: "SXIVD",
- 0x00B5: "SXLI",
- 0x00B6: "SXPI",
- 0x00B8: "DOCROUTE",
- 0x00B9: "RECIPNAME",
- 0x00BC: "SHRFMLA",
- 0x00BD: "MULRK",
- 0x00BE: "MULBLANK",
- 0x00C1: "MMS",
- 0x00C2: "ADDMENU",
- 0x00C3: "DELMENU",
- 0x00C5: "SXDI",
- 0x00C6: "SXDB",
- 0x00C7: "SXFIELD",
- 0x00C8: "SXINDEXLIST",
- 0x00C9: "SXDOUBLE",
- 0x00CD: "SXSTRING",
- 0x00CE: "SXDATETIME",
- 0x00D0: "SXTBL",
- 0x00D1: "SXTBRGITEM",
- 0x00D2: "SXTBPG",
- 0x00D3: "OBPROJ",
- 0x00D5: "SXIDSTM",
- 0x00D6: "RSTRING",
- 0x00D7: "DBCELL",
- 0x00DA: "BOOKBOOL",
- 0x00DC: "SXEXT|PARAMQRY",
- 0x00DD: "SCENPROTECT",
- 0x00DE: "OLESIZE",
- 0x00DF: "UDDESC",
- 0x00E0: "XF",
- 0x00E1: "INTERFACEHDR",
- 0x00E2: "INTERFACEEND",
- 0x00E3: "SXVS",
- 0x00E5: "MERGEDCELLS",
- 0x00E9: "BITMAP",
- 0x00EB: "MSODRAWINGGROUP",
- 0x00EC: "MSODRAWING",
- 0x00ED: "MSODRAWINGSELECTION",
- 0x00F0: "SXRULE",
- 0x00F1: "SXEX",
- 0x00F2: "SXFILT",
- 0x00F6: "SXNAME",
- 0x00F7: "SXSELECT",
- 0x00F8: "SXPAIR",
- 0x00F9: "SXFMLA",
- 0x00FB: "SXFORMAT",
- 0x00FC: "SST",
- 0x00FD: "LABELSST",
- 0x00FF: "EXTSST",
- 0x0100: "SXVDEX",
- 0x0103: "SXFORMULA",
- 0x0122: "SXDBEX",
- 0x0137: "CHTRINSERT",
- 0x0138: "CHTRINFO",
- 0x013B: "CHTRCELLCONTENT",
- 0x013D: "TABID",
- 0x0140: "CHTRMOVERANGE",
- 0x014D: "CHTRINSERTTAB",
- 0x015F: "LABELRANGES",
- 0x0160: "USESELFS",
- 0x0161: "DSF",
- 0x0162: "XL5MODIFY",
- 0x0196: "CHTRHEADER",
- 0x01A9: "USERBVIEW",
- 0x01AA: "USERSVIEWBEGIN",
- 0x01AB: "USERSVIEWEND",
- 0x01AD: "QSI",
- 0x01AE: "SUPBOOK",
- 0x01AF: "PROT4REV",
- 0x01B0: "CONDFMT",
- 0x01B1: "CF",
- 0x01B2: "DVAL",
- 0x01B5: "DCONBIN",
- 0x01B6: "TXO",
- 0x01B7: "REFRESHALL",
- 0x01B8: "HLINK",
- 0x01BA: "CODENAME",
- 0x01BB: "SXFDBTYPE",
- 0x01BC: "PROT4REVPASS",
- 0x01BE: "DV",
- 0x01C0: "XL9FILE",
- 0x01C1: "RECALCID",
- 0x0200: "DIMENSIONS",
- 0x0201: "BLANK",
- 0x0203: "NUMBER",
- 0x0204: "LABEL",
- 0x0205: "BOOLERR",
- 0x0206: "FORMULA",
- 0x0207: "STRING",
- 0x0208: "ROW",
- 0x0209: "BOF",
- 0x020B: "INDEX",
- 0x0218: "NAME",
- 0x0221: "ARRAY",
- 0x0223: "EXTERNNAME",
- 0x0225: "DEFAULTROWHEIGHT",
- 0x0231: "FONT",
- 0x0236: "TABLE",
- 0x023E: "WINDOW2",
- 0x0243: "XF",
- 0x027E: "RK",
- 0x0293: "STYLE",
- 0x0406: "FORMULA",
- 0x0409: "BOF",
- 0x041E: "FORMAT",
- 0x0443: "XF",
- 0x04BC: "SHRFMLA",
- 0x0800: "SCREENTIP",
- 0x0803: "WEBQRYSETTINGS",
- 0x0804: "WEBQRYTABLES",
- 0x0809: "BOF",
- 0x0862: "SHEETLAYOUT",
- 0x0867: "SHEETPROTECTION",
- 0x1001: "UNITS",
- 0x1002: "ChartChart",
- 0x1003: "ChartSeries",
- 0x1006: "ChartDataformat",
- 0x1007: "ChartLineformat",
- 0x1009: "ChartMarkerformat",
- 0x100A: "ChartAreaformat",
- 0x100B: "ChartPieformat",
- 0x100C: "ChartAttachedlabel",
- 0x100D: "ChartSeriestext",
- 0x1014: "ChartChartformat",
- 0x1015: "ChartLegend",
- 0x1016: "ChartSerieslist",
- 0x1017: "ChartBar",
- 0x1018: "ChartLine",
- 0x1019: "ChartPie",
- 0x101A: "ChartArea",
- 0x101B: "ChartScatter",
- 0x101C: "ChartChartline",
- 0x101D: "ChartAxis",
- 0x101E: "ChartTick",
- 0x101F: "ChartValuerange",
- 0x1020: "ChartCatserrange",
- 0x1021: "ChartAxislineformat",
- 0x1022: "ChartFormatlink",
- 0x1024: "ChartDefaulttext",
- 0x1025: "ChartText",
- 0x1026: "ChartFontx",
- 0x1027: "ChartObjectLink",
- 0x1032: "ChartFrame",
- 0x1033: "BEGIN",
- 0x1034: "END",
- 0x1035: "ChartPlotarea",
- 0x103A: "Chart3D",
- 0x103C: "ChartPicf",
- 0x103D: "ChartDropbar",
- 0x103E: "ChartRadar",
- 0x103F: "ChartSurface",
- 0x1040: "ChartRadararea",
- 0x1041: "ChartAxisparent",
- 0x1043: "ChartLegendxn",
- 0x1044: "ChartShtprops",
- 0x1045: "ChartSertocrt",
- 0x1046: "ChartAxesused",
- 0x1048: "ChartSbaseref",
- 0x104A: "ChartSerparent",
- 0x104B: "ChartSerauxtrend",
- 0x104E: "ChartIfmt",
- 0x104F: "ChartPos",
- 0x1050: "ChartAlruns",
- 0x1051: "ChartAI",
- 0x105B: "ChartSerauxerrbar",
- 0x105D: "ChartSerfmt",
- 0x105F: "Chart3DDataFormat",
- 0x1060: "ChartFbi",
- 0x1061: "ChartBoppop",
- 0x1062: "ChartAxcext",
- 0x1063: "ChartDat",
- 0x1064: "ChartPlotgrowth",
- 0x1065: "ChartSiindex",
- 0x1066: "ChartGelframe",
- 0x1067: "ChartBoppcustom",
- 0xFFFF: ""
-}
-
-
-all_funcs_by_name = {
- # Includes Analysis ToolPak aka ATP aka add-in aka xcall functions,
- # distinguished by -ve opcode.
- # name: (opcode, min # args, max # args, func return type, func arg types)
- # + in func arg types means more of the same.
- 'ABS' : ( 24, 1, 1, 'V', 'V'),
- 'ACCRINT' : ( -1, 6, 7, 'V', 'VVVVVVV'),
- 'ACCRINTM' : ( -1, 3, 5, 'V', 'VVVVV'),
- 'ACOS' : ( 99, 1, 1, 'V', 'V'),
- 'ACOSH' : (233, 1, 1, 'V', 'V'),
- 'ADDRESS' : (219, 2, 5, 'V', 'VVVVV'),
- 'AMORDEGRC' : ( -1, 7, 7, 'V', 'VVVVVVV'),
- 'AMORLINC' : ( -1, 7, 7, 'V', 'VVVVVVV'),
- 'AND' : ( 36, 1, 30, 'V', 'D+'),
- 'AREAS' : ( 75, 1, 1, 'V', 'R'),
- 'ASC' : (214, 1, 1, 'V', 'V'),
- 'ASIN' : ( 98, 1, 1, 'V', 'V'),
- 'ASINH' : (232, 1, 1, 'V', 'V'),
- 'ATAN' : ( 18, 1, 1, 'V', 'V'),
- 'ATAN2' : ( 97, 2, 2, 'V', 'VV'),
- 'ATANH' : (234, 1, 1, 'V', 'V'),
- 'AVEDEV' : (269, 1, 30, 'V', 'D+'),
- 'AVERAGE' : ( 5, 1, 30, 'V', 'D+'),
- 'AVERAGEA' : (361, 1, 30, 'V', 'D+'),
- 'BAHTTEXT' : (368, 1, 1, 'V', 'V'),
- 'BESSELI' : ( -1, 2, 2, 'V', 'VV'),
- 'BESSELJ' : ( -1, 2, 2, 'V', 'VV'),
- 'BESSELK' : ( -1, 2, 2, 'V', 'VV'),
- 'BESSELY' : ( -1, 2, 2, 'V', 'VV'),
- 'BETADIST' : (270, 3, 5, 'V', 'VVVVV'),
- 'BETAINV' : (272, 3, 5, 'V', 'VVVVV'),
- 'BIN2DEC' : ( -1, 1, 1, 'V', 'V'),
- 'BIN2HEX' : ( -1, 1, 2, 'V', 'VV'),
- 'BIN2OCT' : ( -1, 1, 2, 'V', 'VV'),
- 'BINOMDIST' : (273, 4, 4, 'V', 'VVVV'),
- 'CEILING' : (288, 2, 2, 'V', 'VV'),
- 'CELL' : (125, 1, 2, 'V', 'VR'),
- 'CHAR' : (111, 1, 1, 'V', 'V'),
- 'CHIDIST' : (274, 2, 2, 'V', 'VV'),
- 'CHIINV' : (275, 2, 2, 'V', 'VV'),
- 'CHITEST' : (306, 2, 2, 'V', 'AA'),
- 'CHOOSE' : (100, 2, 30, 'R', 'VR+'),
- 'CLEAN' : (162, 1, 1, 'V', 'V'),
- 'CODE' : (121, 1, 1, 'V', 'V'),
- 'COLUMN' : ( 9, 0, 1, 'V', 'R'),
- 'COLUMNS' : ( 77, 1, 1, 'V', 'R'),
- 'COMBIN' : (276, 2, 2, 'V', 'VV'),
- 'COMPLEX' : ( -1, 2, 3, 'V', 'VVV'),
- 'CONCATENATE' : (336, 1, 30, 'V', 'V+'),
- 'CONFIDENCE' : (277, 3, 3, 'V', 'VVV'),
- 'CONVERT' : ( -1, 3, 3, 'V', 'VVV'),
- 'CORREL' : (307, 2, 2, 'V', 'AA'),
- 'COS' : ( 16, 1, 1, 'V', 'V'),
- 'COSH' : (230, 1, 1, 'V', 'V'),
- 'COUNT' : ( 0, 1, 30, 'V', 'D+'),
- 'COUNTA' : (169, 1, 30, 'V', 'D+'),
- 'COUNTBLANK' : (347, 1, 1, 'V', 'R'),
- 'COUNTIF' : (346, 2, 2, 'V', 'RV'),
- 'COUPDAYBS' : ( -1, 3, 5, 'V', 'VVVVV'),
- 'COUPDAYS' : ( -1, 3, 5, 'V', 'VVVVV'),
- 'COUPDAYSNC' : ( -1, 3, 5, 'V', 'VVVVV'),
- 'COUPNCD' : ( -1, 3, 5, 'V', 'VVVVV'),
- 'COUPNUM' : ( -1, 3, 5, 'V', 'VVVVV'),
- 'COUPPCD' : ( -1, 3, 5, 'V', 'VVVVV'),
- 'COVAR' : (308, 2, 2, 'V', 'AA'),
- 'CRITBINOM' : (278, 3, 3, 'V', 'VVV'),
- 'CUMIPMT' : ( -1, 6, 6, 'V', 'VVVVVV'),
- 'CUMPRINC' : ( -1, 6, 6, 'V', 'VVVVVV'),
- 'DATE' : ( 65, 3, 3, 'V', 'VVV'),
- 'DATEDIF' : (351, 3, 3, 'V', 'VVV'),
- 'DATEVALUE' : (140, 1, 1, 'V', 'V'),
- 'DAVERAGE' : ( 42, 3, 3, 'V', 'RRR'),
- 'DAY' : ( 67, 1, 1, 'V', 'V'),
- 'DAYS360' : (220, 2, 3, 'V', 'VVV'),
- 'DB' : (247, 4, 5, 'V', 'VVVVV'),
- 'DBCS' : (215, 1, 1, 'V', 'V'),
- 'DCOUNT' : ( 40, 3, 3, 'V', 'RRR'),
- 'DCOUNTA' : (199, 3, 3, 'V', 'RRR'),
- 'DDB' : (144, 4, 5, 'V', 'VVVVV'),
- 'DEC2BIN' : ( -1, 1, 2, 'V', 'VV'),
- 'DEC2HEX' : ( -1, 1, 2, 'V', 'VV'),
- 'DEC2OCT' : ( -1, 1, 2, 'V', 'VV'),
- 'DEGREES' : (343, 1, 1, 'V', 'V'),
- 'DELTA' : ( -1, 1, 2, 'V', 'VV'),
- 'DEVSQ' : (318, 1, 30, 'V', 'D+'),
- 'DGET' : (235, 3, 3, 'V', 'RRR'),
- 'DISC' : ( -1, 4, 5, 'V', 'VVVVV'),
- 'DMAX' : ( 44, 3, 3, 'V', 'RRR'),
- 'DMIN' : ( 43, 3, 3, 'V', 'RRR'),
- 'DOLLAR' : ( 13, 1, 2, 'V', 'VV'),
- 'DOLLARDE' : ( -1, 2, 2, 'V', 'VV'),
- 'DOLLARFR' : ( -1, 2, 2, 'V', 'VV'),
- 'DPRODUCT' : (189, 3, 3, 'V', 'RRR'),
- 'DSTDEV' : ( 45, 3, 3, 'V', 'RRR'),
- 'DSTDEVP' : (195, 3, 3, 'V', 'RRR'),
- 'DSUM' : ( 41, 3, 3, 'V', 'RRR'),
- 'DURATION' : ( -1, 5, 6, 'V', 'VVVVVV'),
- 'DVAR' : ( 47, 3, 3, 'V', 'RRR'),
- 'DVARP' : (196, 3, 3, 'V', 'RRR'),
- 'EDATE' : ( -1, 2, 2, 'V', 'VV'),
- 'EFFECT' : ( -1, 2, 2, 'V', 'VV'),
- 'EOMONTH' : ( -1, 1, 2, 'V', 'VV'),
- 'ERF' : ( -1, 1, 2, 'V', 'VV'),
- 'ERFC' : ( -1, 1, 1, 'V', 'V'),
- 'ERROR.TYPE' : (261, 1, 1, 'V', 'V'),
- 'EVEN' : (279, 1, 1, 'V', 'V'),
- 'EXACT' : (117, 2, 2, 'V', 'VV'),
- 'EXP' : ( 21, 1, 1, 'V', 'V'),
- 'EXPONDIST' : (280, 3, 3, 'V', 'VVV'),
- 'FACT' : (184, 1, 1, 'V', 'V'),
- 'FACTDOUBLE' : ( -1, 1, 1, 'V', 'V'),
- 'FALSE' : ( 35, 0, 0, 'V', '-'),
- 'FDIST' : (281, 3, 3, 'V', 'VVV'),
- 'FIND' : (124, 2, 3, 'V', 'VVV'),
- 'FINDB' : (205, 2, 3, 'V', 'VVV'),
- 'FINV' : (282, 3, 3, 'V', 'VVV'),
- 'FISHER' : (283, 1, 1, 'V', 'V'),
- 'FISHERINV' : (284, 1, 1, 'V', 'V'),
- 'FIXED' : ( 14, 2, 3, 'V', 'VVV'),
- 'FLOOR' : (285, 2, 2, 'V', 'VV'),
- 'FORECAST' : (309, 3, 3, 'V', 'VAA'),
- 'FREQUENCY' : (252, 2, 2, 'A', 'RR'),
- 'FTEST' : (310, 2, 2, 'V', 'AA'),
- 'FV' : ( 57, 3, 5, 'V', 'VVVVV'),
- 'FVSCHEDULE' : ( -1, 2, 2, 'V', 'VA'),
- 'GAMMADIST' : (286, 4, 4, 'V', 'VVVV'),
- 'GAMMAINV' : (287, 3, 3, 'V', 'VVV'),
- 'GAMMALN' : (271, 1, 1, 'V', 'V'),
- 'GCD' : ( -1, 1, 29, 'V', 'V+'),
- 'GEOMEAN' : (319, 1, 30, 'V', 'D+'),
- 'GESTEP' : ( -1, 1, 2, 'V', 'VV'),
- 'GETPIVOTDATA': (358, 2, 30, 'A', 'VAV+'),
- 'GROWTH' : ( 52, 1, 4, 'A', 'RRRV'),
- 'HARMEAN' : (320, 1, 30, 'V', 'D+'),
- 'HEX2BIN' : ( -1, 1, 2, 'V', 'VV'),
- 'HEX2DEC' : ( -1, 1, 1, 'V', 'V'),
- 'HEX2OCT' : ( -1, 1, 2, 'V', 'VV'),
- 'HLOOKUP' : (101, 3, 4, 'V', 'VRRV'),
- 'HOUR' : ( 71, 1, 1, 'V', 'V'),
- 'HYPERLINK' : (359, 1, 2, 'V', 'VV'),
- 'HYPGEOMDIST' : (289, 4, 4, 'V', 'VVVV'),
- 'IF' : ( 1, 2, 3, 'R', 'VRR'),
- 'IMABS' : ( -1, 1, 1, 'V', 'V'),
- 'IMAGINARY' : ( -1, 1, 1, 'V', 'V'),
- 'IMARGUMENT' : ( -1, 1, 1, 'V', 'V'),
- 'IMCONJUGATE' : ( -1, 1, 1, 'V', 'V'),
- 'IMCOS' : ( -1, 1, 1, 'V', 'V'),
- 'IMDIV' : ( -1, 2, 2, 'V', 'VV'),
- 'IMEXP' : ( -1, 1, 1, 'V', 'V'),
- 'IMLN' : ( -1, 1, 1, 'V', 'V'),
- 'IMLOG10' : ( -1, 1, 1, 'V', 'V'),
- 'IMLOG2' : ( -1, 1, 1, 'V', 'V'),
- 'IMPOWER' : ( -1, 2, 2, 'V', 'VV'),
- 'IMPRODUCT' : ( -1, 2, 2, 'V', 'VV'),
- 'IMREAL' : ( -1, 1, 1, 'V', 'V'),
- 'IMSIN' : ( -1, 1, 1, 'V', 'V'),
- 'IMSQRT' : ( -1, 1, 1, 'V', 'V'),
- 'IMSUB' : ( -1, 2, 2, 'V', 'VV'),
- 'IMSUM' : ( -1, 1, 29, 'V', 'V+'),
- 'INDEX' : ( 29, 2, 4, 'R', 'RVVV'),
- 'INDIRECT' : (148, 1, 2, 'R', 'VV'),
- 'INFO' : (244, 1, 1, 'V', 'V'),
- 'INT' : ( 25, 1, 1, 'V', 'V'),
- 'INTERCEPT' : (311, 2, 2, 'V', 'AA'),
- 'INTRATE' : ( -1, 4, 5, 'V', 'VVVVV'),
- 'IPMT' : (167, 4, 6, 'V', 'VVVVVV'),
- 'IRR' : ( 62, 1, 2, 'V', 'RV'),
- 'ISBLANK' : (129, 1, 1, 'V', 'V'),
- 'ISERR' : (126, 1, 1, 'V', 'V'),
- 'ISERROR' : ( 3, 1, 1, 'V', 'V'),
- 'ISEVEN' : ( -1, 1, 1, 'V', 'V'),
- 'ISLOGICAL' : (198, 1, 1, 'V', 'V'),
- 'ISNA' : ( 2, 1, 1, 'V', 'V'),
- 'ISNONTEXT' : (190, 1, 1, 'V', 'V'),
- 'ISNUMBER' : (128, 1, 1, 'V', 'V'),
- 'ISODD' : ( -1, 1, 1, 'V', 'V'),
- 'ISPMT' : (350, 4, 4, 'V', 'VVVV'),
- 'ISREF' : (105, 1, 1, 'V', 'R'),
- 'ISTEXT' : (127, 1, 1, 'V', 'V'),
- 'KURT' : (322, 1, 30, 'V', 'D+'),
- 'LARGE' : (325, 2, 2, 'V', 'RV'),
- 'LCM' : ( -1, 1, 29, 'V', 'V+'),
- 'LEFT' : (115, 1, 2, 'V', 'VV'),
- 'LEFTB' : (208, 1, 2, 'V', 'VV'),
- 'LEN' : ( 32, 1, 1, 'V', 'V'),
- 'LENB' : (211, 1, 1, 'V', 'V'),
- 'LINEST' : ( 49, 1, 4, 'A', 'RRVV'),
- 'LN' : ( 22, 1, 1, 'V', 'V'),
- 'LOG' : (109, 1, 2, 'V', 'VV'),
- 'LOG10' : ( 23, 1, 1, 'V', 'V'),
- 'LOGEST' : ( 51, 1, 4, 'A', 'RRVV'),
- 'LOGINV' : (291, 3, 3, 'V', 'VVV'),
- 'LOGNORMDIST' : (290, 3, 3, 'V', 'VVV'),
- 'LOOKUP' : ( 28, 2, 3, 'V', 'VRR'),
- 'LOWER' : (112, 1, 1, 'V', 'V'),
- 'MATCH' : ( 64, 2, 3, 'V', 'VRR'),
- 'MAX' : ( 7, 1, 30, 'V', 'D+'),
- 'MAXA' : (362, 1, 30, 'V', 'D+'),
- 'MDETERM' : (163, 1, 1, 'V', 'A'),
- 'MDURATION' : ( -1, 5, 6, 'V', 'VVVVVV'),
- 'MEDIAN' : (227, 1, 30, 'V', 'D+'),
- 'MID' : ( 31, 3, 3, 'V', 'VVV'),
- 'MIDB' : (210, 3, 3, 'V', 'VVV'),
- 'MIN' : ( 6, 1, 30, 'V', 'D+'),
- 'MINA' : (363, 1, 30, 'V', 'D+'),
- 'MINUTE' : ( 72, 1, 1, 'V', 'V'),
- 'MINVERSE' : (164, 1, 1, 'A', 'A'),
- 'MIRR' : ( 61, 3, 3, 'V', 'RVV'),
- 'MMULT' : (165, 2, 2, 'A', 'AA'),
- 'MOD' : ( 39, 2, 2, 'V', 'VV'),
- 'MODE' : (330, 1, 30, 'V', 'A+'), ################ weird #################
- 'MONTH' : ( 68, 1, 1, 'V', 'V'),
- 'MROUND' : ( -1, 2, 2, 'V', 'VV'),
- 'MULTINOMIAL' : ( -1, 1, 29, 'V', 'V+'),
- 'N' : (131, 1, 1, 'V', 'R'),
- 'NA' : ( 10, 0, 0, 'V', '-'),
- 'NEGBINOMDIST': (292, 3, 3, 'V', 'VVV'),
- 'NETWORKDAYS' : ( -1, 2, 3, 'V', 'VVR'),
- 'NOMINAL' : ( -1, 2, 2, 'V', 'VV'),
- 'NORMDIST' : (293, 4, 4, 'V', 'VVVV'),
- 'NORMINV' : (295, 3, 3, 'V', 'VVV'),
- 'NORMSDIST' : (294, 1, 1, 'V', 'V'),
- 'NORMSINV' : (296, 1, 1, 'V', 'V'),
- 'NOT' : ( 38, 1, 1, 'V', 'V'),
- 'NOW' : ( 74, 0, 0, 'V', '-'),
- 'NPER' : ( 58, 3, 5, 'V', 'VVVVV'),
- 'NPV' : ( 11, 2, 30, 'V', 'VD+'),
- 'OCT2BIN' : ( -1, 1, 2, 'V', 'VV'),
- 'OCT2DEC' : ( -1, 1, 1, 'V', 'V'),
- 'OCT2HEX' : ( -1, 1, 2, 'V', 'VV'),
- 'ODD' : (298, 1, 1, 'V', 'V'),
- 'ODDFPRICE' : ( -1, 9, 9, 'V', 'VVVVVVVVV'),
- 'ODDFYIELD' : ( -1, 9, 9, 'V', 'VVVVVVVVV'),
- 'ODDLPRICE' : ( -1, 8, 8, 'V', 'VVVVVVVV'),
- 'ODDLYIELD' : ( -1, 8, 8, 'V', 'VVVVVVVV'),
- 'OFFSET' : ( 78, 3, 5, 'R', 'RVVVV'),
- 'OR' : ( 37, 1, 30, 'V', 'D+'),
- 'PEARSON' : (312, 2, 2, 'V', 'AA'),
- 'PERCENTILE' : (328, 2, 2, 'V', 'RV'),
- 'PERCENTRANK' : (329, 2, 3, 'V', 'RVV'),
- 'PERMUT' : (299, 2, 2, 'V', 'VV'),
- 'PHONETIC' : (360, 1, 1, 'V', 'R'),
- 'PI' : ( 19, 0, 0, 'V', '-'),
- 'PMT' : ( 59, 3, 5, 'V', 'VVVVV'),
- 'POISSON' : (300, 3, 3, 'V', 'VVV'),
- 'POWER' : (337, 2, 2, 'V', 'VV'),
- 'PPMT' : (168, 4, 6, 'V', 'VVVVVV'),
- 'PRICE' : ( -1, 6, 7, 'V', 'VVVVVVV'),
- 'PRICEDISC' : ( -1, 4, 5, 'V', 'VVVVV'),
- 'PRICEMAT' : ( -1, 5, 6, 'V', 'VVVVVV'),
- 'PROB' : (317, 3, 4, 'V', 'AAVV'),
- 'PRODUCT' : (183, 1, 30, 'V', 'D+'),
- 'PROPER' : (114, 1, 1, 'V', 'V'),
- 'PV' : ( 56, 3, 5, 'V', 'VVVVV'),
- 'QUARTILE' : (327, 2, 2, 'V', 'RV'),
- 'QUOTIENT' : ( -1, 2, 2, 'V', 'VV'),
- 'RADIANS' : (342, 1, 1, 'V', 'V'),
- 'RAND' : ( 63, 0, 0, 'V', '-'),
- 'RANDBETWEEN' : ( -1, 2, 2, 'V', 'VV'),
- 'RANK' : (216, 2, 3, 'V', 'VRV'),
- 'RATE' : ( 60, 3, 6, 'V', 'VVVVVV'),
- 'RECEIVED' : ( -1, 4, 5, 'V', 'VVVVV'),
- 'REPLACE' : (119, 4, 4, 'V', 'VVVV'),
- 'REPLACEB' : (207, 4, 4, 'V', 'VVVV'),
- 'REPT' : ( 30, 2, 2, 'V', 'VV'),
- 'RIGHT' : (116, 1, 2, 'V', 'VV'),
- 'RIGHTB' : (209, 1, 2, 'V', 'VV'),
- 'ROMAN' : (354, 1, 2, 'V', 'VV'),
- 'ROUND' : ( 27, 2, 2, 'V', 'VV'),
- 'ROUNDDOWN' : (213, 2, 2, 'V', 'VV'),
- 'ROUNDUP' : (212, 2, 2, 'V', 'VV'),
- 'ROW' : ( 8, 0, 1, 'V', 'R'),
- 'ROWS' : ( 76, 1, 1, 'V', 'R'),
- 'RSQ' : (313, 2, 2, 'V', 'AA'),
- 'RTD' : (379, 3, 30, 'A', 'VVV+'),
- 'SEARCH' : ( 82, 2, 3, 'V', 'VVV'),
- 'SEARCHB' : (206, 2, 3, 'V', 'VVV'),
- 'SECOND' : ( 73, 1, 1, 'V', 'V'),
- 'SERIESSUM' : ( -1, 4, 4, 'V', 'VVVA'),
- 'SIGN' : ( 26, 1, 1, 'V', 'V'),
- 'SIN' : ( 15, 1, 1, 'V', 'V'),
- 'SINH' : (229, 1, 1, 'V', 'V'),
- 'SKEW' : (323, 1, 30, 'V', 'D+'),
- 'SLN' : (142, 3, 3, 'V', 'VVV'),
- 'SLOPE' : (315, 2, 2, 'V', 'AA'),
- 'SMALL' : (326, 2, 2, 'V', 'RV'),
- 'SQRT' : ( 20, 1, 1, 'V', 'V'),
- 'SQRTPI' : ( -1, 1, 1, 'V', 'V'),
- 'STANDARDIZE' : (297, 3, 3, 'V', 'VVV'),
- 'STDEV' : ( 12, 1, 30, 'V', 'D+'),
- 'STDEVA' : (366, 1, 30, 'V', 'D+'),
- 'STDEVP' : (193, 1, 30, 'V', 'D+'),
- 'STDEVPA' : (364, 1, 30, 'V', 'D+'),
- 'STEYX' : (314, 2, 2, 'V', 'AA'),
- 'SUBSTITUTE' : (120, 3, 4, 'V', 'VVVV'),
- 'SUBTOTAL' : (344, 2, 30, 'V', 'VR+'),
- 'SUM' : ( 4, 1, 30, 'V', 'D+'),
- 'SUMIF' : (345, 2, 3, 'V', 'RVR'),
- 'SUMPRODUCT' : (228, 1, 30, 'V', 'A+'),
- 'SUMSQ' : (321, 1, 30, 'V', 'D+'),
- 'SUMX2MY2' : (304, 2, 2, 'V', 'AA'),
- 'SUMX2PY2' : (305, 2, 2, 'V', 'AA'),
- 'SUMXMY2' : (303, 2, 2, 'V', 'AA'),
- 'SYD' : (143, 4, 4, 'V', 'VVVV'),
- 'T' : (130, 1, 1, 'V', 'R'),
- 'TAN' : ( 17, 1, 1, 'V', 'V'),
- 'TANH' : (231, 1, 1, 'V', 'V'),
- 'TBILLEQ' : ( -1, 3, 3, 'V', 'VVV'),
- 'TBILLPRICE' : ( -1, 3, 3, 'V', 'VVV'),
- 'TBILLYIELD' : ( -1, 3, 3, 'V', 'VVV'),
- 'TDIST' : (301, 3, 3, 'V', 'VVV'),
- 'TEXT' : ( 48, 2, 2, 'V', 'VV'),
- 'TIME' : ( 66, 3, 3, 'V', 'VVV'),
- 'TIMEVALUE' : (141, 1, 1, 'V', 'V'),
- 'TINV' : (332, 2, 2, 'V', 'VV'),
- 'TODAY' : (221, 0, 0, 'V', '-'),
- 'TRANSPOSE' : ( 83, 1, 1, 'A', 'A'),
- 'TREND' : ( 50, 1, 4, 'A', 'RRRV'),
- 'TRIM' : (118, 1, 1, 'V', 'V'),
- 'TRIMMEAN' : (331, 2, 2, 'V', 'RV'),
- 'TRUE' : ( 34, 0, 0, 'V', '-'),
- 'TRUNC' : (197, 1, 2, 'V', 'VV'),
- 'TTEST' : (316, 4, 4, 'V', 'AAVV'),
- 'TYPE' : ( 86, 1, 1, 'V', 'V'),
- 'UPPER' : (113, 1, 1, 'V', 'V'),
- 'USDOLLAR' : (204, 1, 2, 'V', 'VV'),
- 'VALUE' : ( 33, 1, 1, 'V', 'V'),
- 'VAR' : ( 46, 1, 30, 'V', 'D+'),
- 'VARA' : (367, 1, 30, 'V', 'D+'),
- 'VARP' : (194, 1, 30, 'V', 'D+'),
- 'VARPA' : (365, 1, 30, 'V', 'D+'),
- 'VDB' : (222, 5, 7, 'V', 'VVVVVVV'),
- 'VLOOKUP' : (102, 3, 4, 'V', 'VRRV'),
- 'WEEKDAY' : ( 70, 1, 2, 'V', 'VV'),
- 'WEEKNUM' : ( -1, 1, 2, 'V', 'VV'),
- 'WEIBULL' : (302, 4, 4, 'V', 'VVVV'),
- 'WORKDAY' : ( -1, 2, 3, 'V', 'VVR'),
- 'XIRR' : ( -1, 2, 3, 'V', 'AAV'),
- 'XNPV' : ( -1, 3, 3, 'V', 'VAA'),
- 'YEAR' : ( 69, 1, 1, 'V', 'V'),
- 'YEARFRAC' : ( -1, 2, 3, 'V', 'VVV'),
- 'YIELD' : ( -1, 6, 7, 'V', 'VVVVVVV'),
- 'YIELDDISC' : ( -1, 4, 5, 'V', 'VVVVV'),
- 'YIELDMAT' : ( -1, 5, 6, 'V', 'VVVVVV'),
- 'ZTEST' : (324, 2, 3, 'V', 'RVV'),
- }
-
-# Formulas Parse things
-
-ptgExp = 0x01
-ptgTbl = 0x02
-ptgAdd = 0x03
-ptgSub = 0x04
-ptgMul = 0x05
-ptgDiv = 0x06
-ptgPower = 0x07
-ptgConcat = 0x08
-ptgLT = 0x09
-ptgLE = 0x0a
-ptgEQ = 0x0b
-ptgGE = 0x0c
-ptgGT = 0x0d
-ptgNE = 0x0e
-ptgIsect = 0x0f
-ptgUnion = 0x10
-ptgRange = 0x11
-ptgUplus = 0x12
-ptgUminus = 0x13
-ptgPercent = 0x14
-ptgParen = 0x15
-ptgMissArg = 0x16
-ptgStr = 0x17
-ptgExtend = 0x18
-ptgAttr = 0x19
-ptgSheet = 0x1a
-ptgEndSheet = 0x1b
-ptgErr = 0x1c
-ptgBool = 0x1d
-ptgInt = 0x1e
-ptgNum = 0x1f
-
-ptgArrayR = 0x20
-ptgFuncR = 0x21
-ptgFuncVarR = 0x22
-ptgNameR = 0x23
-ptgRefR = 0x24
-ptgAreaR = 0x25
-ptgMemAreaR = 0x26
-ptgMemErrR = 0x27
-ptgMemNoMemR = 0x28
-ptgMemFuncR = 0x29
-ptgRefErrR = 0x2a
-ptgAreaErrR = 0x2b
-ptgRefNR = 0x2c
-ptgAreaNR = 0x2d
-ptgMemAreaNR = 0x2e
-ptgMemNoMemNR = 0x2f
-ptgNameXR = 0x39
-ptgRef3dR = 0x3a
-ptgArea3dR = 0x3b
-ptgRefErr3dR = 0x3c
-ptgAreaErr3dR = 0x3d
-
-ptgArrayV = 0x40
-ptgFuncV = 0x41
-ptgFuncVarV = 0x42
-ptgNameV = 0x43
-ptgRefV = 0x44
-ptgAreaV = 0x45
-ptgMemAreaV = 0x46
-ptgMemErrV = 0x47
-ptgMemNoMemV = 0x48
-ptgMemFuncV = 0x49
-ptgRefErrV = 0x4a
-ptgAreaErrV = 0x4b
-ptgRefNV = 0x4c
-ptgAreaNV = 0x4d
-ptgMemAreaNV = 0x4e
-ptgMemNoMemNV = 0x4f
-ptgFuncCEV = 0x58
-ptgNameXV = 0x59
-ptgRef3dV = 0x5a
-ptgArea3dV = 0x5b
-ptgRefErr3dV = 0x5c
-ptgAreaErr3dV = 0x5d
-
-ptgArrayA = 0x60
-ptgFuncA = 0x61
-ptgFuncVarA = 0x62
-ptgNameA = 0x63
-ptgRefA = 0x64
-ptgAreaA = 0x65
-ptgMemAreaA = 0x66
-ptgMemErrA = 0x67
-ptgMemNoMemA = 0x68
-ptgMemFuncA = 0x69
-ptgRefErrA = 0x6a
-ptgAreaErrA = 0x6b
-ptgRefNA = 0x6c
-ptgAreaNA = 0x6d
-ptgMemAreaNA = 0x6e
-ptgMemNoMemNA = 0x6f
-ptgFuncCEA = 0x78
-ptgNameXA = 0x79
-ptgRef3dA = 0x7a
-ptgArea3dA = 0x7b
-ptgRefErr3dA = 0x7c
-ptgAreaErr3dA = 0x7d
-
-
-PtgNames = {
- ptgExp : "ptgExp",
- ptgTbl : "ptgTbl",
- ptgAdd : "ptgAdd",
- ptgSub : "ptgSub",
- ptgMul : "ptgMul",
- ptgDiv : "ptgDiv",
- ptgPower : "ptgPower",
- ptgConcat : "ptgConcat",
- ptgLT : "ptgLT",
- ptgLE : "ptgLE",
- ptgEQ : "ptgEQ",
- ptgGE : "ptgGE",
- ptgGT : "ptgGT",
- ptgNE : "ptgNE",
- ptgIsect : "ptgIsect",
- ptgUnion : "ptgUnion",
- ptgRange : "ptgRange",
- ptgUplus : "ptgUplus",
- ptgUminus : "ptgUminus",
- ptgPercent : "ptgPercent",
- ptgParen : "ptgParen",
- ptgMissArg : "ptgMissArg",
- ptgStr : "ptgStr",
- ptgExtend : "ptgExtend",
- ptgAttr : "ptgAttr",
- ptgSheet : "ptgSheet",
- ptgEndSheet : "ptgEndSheet",
- ptgErr : "ptgErr",
- ptgBool : "ptgBool",
- ptgInt : "ptgInt",
- ptgNum : "ptgNum",
- ptgArrayR : "ptgArrayR",
- ptgFuncR : "ptgFuncR",
- ptgFuncVarR : "ptgFuncVarR",
- ptgNameR : "ptgNameR",
- ptgRefR : "ptgRefR",
- ptgAreaR : "ptgAreaR",
- ptgMemAreaR : "ptgMemAreaR",
- ptgMemErrR : "ptgMemErrR",
- ptgMemNoMemR : "ptgMemNoMemR",
- ptgMemFuncR : "ptgMemFuncR",
- ptgRefErrR : "ptgRefErrR",
- ptgAreaErrR : "ptgAreaErrR",
- ptgRefNR : "ptgRefNR",
- ptgAreaNR : "ptgAreaNR",
- ptgMemAreaNR : "ptgMemAreaNR",
- ptgMemNoMemNR : "ptgMemNoMemNR",
- ptgNameXR : "ptgNameXR",
- ptgRef3dR : "ptgRef3dR",
- ptgArea3dR : "ptgArea3dR",
- ptgRefErr3dR : "ptgRefErr3dR",
- ptgAreaErr3dR : "ptgAreaErr3dR",
- ptgArrayV : "ptgArrayV",
- ptgFuncV : "ptgFuncV",
- ptgFuncVarV : "ptgFuncVarV",
- ptgNameV : "ptgNameV",
- ptgRefV : "ptgRefV",
- ptgAreaV : "ptgAreaV",
- ptgMemAreaV : "ptgMemAreaV",
- ptgMemErrV : "ptgMemErrV",
- ptgMemNoMemV : "ptgMemNoMemV",
- ptgMemFuncV : "ptgMemFuncV",
- ptgRefErrV : "ptgRefErrV",
- ptgAreaErrV : "ptgAreaErrV",
- ptgRefNV : "ptgRefNV",
- ptgAreaNV : "ptgAreaNV",
- ptgMemAreaNV : "ptgMemAreaNV",
- ptgMemNoMemNV : "ptgMemNoMemNV",
- ptgFuncCEV : "ptgFuncCEV",
- ptgNameXV : "ptgNameXV",
- ptgRef3dV : "ptgRef3dV",
- ptgArea3dV : "ptgArea3dV",
- ptgRefErr3dV : "ptgRefErr3dV",
- ptgAreaErr3dV : "ptgAreaErr3dV",
- ptgArrayA : "ptgArrayA",
- ptgFuncA : "ptgFuncA",
- ptgFuncVarA : "ptgFuncVarA",
- ptgNameA : "ptgNameA",
- ptgRefA : "ptgRefA",
- ptgAreaA : "ptgAreaA",
- ptgMemAreaA : "ptgMemAreaA",
- ptgMemErrA : "ptgMemErrA",
- ptgMemNoMemA : "ptgMemNoMemA",
- ptgMemFuncA : "ptgMemFuncA",
- ptgRefErrA : "ptgRefErrA",
- ptgAreaErrA : "ptgAreaErrA",
- ptgRefNA : "ptgRefNA",
- ptgAreaNA : "ptgAreaNA",
- ptgMemAreaNA : "ptgMemAreaNA",
- ptgMemNoMemNA : "ptgMemNoMemNA",
- ptgFuncCEA : "ptgFuncCEA",
- ptgNameXA : "ptgNameXA",
- ptgRef3dA : "ptgRef3dA",
- ptgArea3dA : "ptgArea3dA",
- ptgRefErr3dA : "ptgRefErr3dA",
- ptgAreaErr3dA : "ptgAreaErr3dA"
-}
-
-
-error_msg_by_code = {
- 0x00: "#NULL!", # intersection of two cell ranges is empty
- 0x07: "#DIV/0!", # division by zero
- 0x0F: "#VALUE!", # wrong type of operand
- 0x17: "#REF!", # illegal or deleted cell reference
- 0x1D: "#NAME?", # wrong function or range name
- 0x24: "#NUM!", # value range overflow
- 0x2A: "#N/A!" # argument or function not available
-}
+# -*- coding: ascii -*-
+"""
+lots of Excel Magic Numbers
+"""
+
+# Boundaries BIFF8+
+
+MAX_ROW = 65536
+MAX_COL = 256
+
+
+biff_records = {
+ 0x0000: "DIMENSIONS",
+ 0x0001: "BLANK",
+ 0x0002: "INTEGER",
+ 0x0003: "NUMBER",
+ 0x0004: "LABEL",
+ 0x0005: "BOOLERR",
+ 0x0006: "FORMULA",
+ 0x0007: "STRING",
+ 0x0008: "ROW",
+ 0x0009: "BOF",
+ 0x000A: "EOF",
+ 0x000B: "INDEX",
+ 0x000C: "CALCCOUNT",
+ 0x000D: "CALCMODE",
+ 0x000E: "PRECISION",
+ 0x000F: "REFMODE",
+ 0x0010: "DELTA",
+ 0x0011: "ITERATION",
+ 0x0012: "PROTECT",
+ 0x0013: "PASSWORD",
+ 0x0014: "HEADER",
+ 0x0015: "FOOTER",
+ 0x0016: "EXTERNCOUNT",
+ 0x0017: "EXTERNSHEET",
+ 0x0018: "NAME",
+ 0x0019: "WINDOWPROTECT",
+ 0x001A: "VERTICALPAGEBREAKS",
+ 0x001B: "HORIZONTALPAGEBREAKS",
+ 0x001C: "NOTE",
+ 0x001D: "SELECTION",
+ 0x001E: "FORMAT",
+ 0x001F: "FORMATCOUNT",
+ 0x0020: "COLUMNDEFAULT",
+ 0x0021: "ARRAY",
+ 0x0022: "1904",
+ 0x0023: "EXTERNNAME",
+ 0x0024: "COLWIDTH",
+ 0x0025: "DEFAULTROWHEIGHT",
+ 0x0026: "LEFTMARGIN",
+ 0x0027: "RIGHTMARGIN",
+ 0x0028: "TOPMARGIN",
+ 0x0029: "BOTTOMMARGIN",
+ 0x002A: "PRINTHEADERS",
+ 0x002B: "PRINTGRIDLINES",
+ 0x002F: "FILEPASS",
+ 0x0031: "FONT",
+ 0x0036: "TABLE",
+ 0x003C: "CONTINUE",
+ 0x003D: "WINDOW1",
+ 0x003E: "WINDOW2",
+ 0x0040: "BACKUP",
+ 0x0041: "PANE",
+ 0x0042: "CODEPAGE",
+ 0x0043: "XF",
+ 0x0044: "IXFE",
+ 0x0045: "EFONT",
+ 0x004D: "PLS",
+ 0x0050: "DCON",
+ 0x0051: "DCONREF",
+ 0x0053: "DCONNAME",
+ 0x0055: "DEFCOLWIDTH",
+ 0x0056: "BUILTINFMTCNT",
+ 0x0059: "XCT",
+ 0x005A: "CRN",
+ 0x005B: "FILESHARING",
+ 0x005C: "WRITEACCESS",
+ 0x005D: "OBJ",
+ 0x005E: "UNCALCED",
+ 0x005F: "SAFERECALC",
+ 0x0060: "TEMPLATE",
+ 0x0063: "OBJPROTECT",
+ 0x007D: "COLINFO",
+ 0x007E: "RK",
+ 0x007F: "IMDATA",
+ 0x0080: "GUTS",
+ 0x0081: "WSBOOL",
+ 0x0082: "GRIDSET",
+ 0x0083: "HCENTER",
+ 0x0084: "VCENTER",
+ 0x0085: "BOUNDSHEET",
+ 0x0086: "WRITEPROT",
+ 0x0087: "ADDIN",
+ 0x0088: "EDG",
+ 0x0089: "PUB",
+ 0x008C: "COUNTRY",
+ 0x008D: "HIDEOBJ",
+ 0x008E: "BUNDLESOFFSET",
+ 0x008F: "BUNDLEHEADER",
+ 0x0090: "SORT",
+ 0x0091: "SUB",
+ 0x0092: "PALETTE",
+ 0x0093: "STYLE",
+ 0x0094: "LHRECORD",
+ 0x0095: "LHNGRAPH",
+ 0x0096: "SOUND",
+ 0x0098: "LPR",
+ 0x0099: "STANDARDWIDTH",
+ 0x009A: "FNGROUPNAME",
+ 0x009B: "FILTERMODE",
+ 0x009C: "FNGROUPCOUNT",
+ 0x009D: "AUTOFILTERINFO",
+ 0x009E: "AUTOFILTER",
+ 0x00A0: "SCL",
+ 0x00A1: "SETUP",
+ 0x00A9: "COORDLIST",
+ 0x00AB: "GCW",
+ 0x00AE: "SCENMAN",
+ 0x00AF: "SCENARIO",
+ 0x00B0: "SXVIEW",
+ 0x00B1: "SXVD",
+ 0x00B2: "SXVI",
+ 0x00B4: "SXIVD",
+ 0x00B5: "SXLI",
+ 0x00B6: "SXPI",
+ 0x00B8: "DOCROUTE",
+ 0x00B9: "RECIPNAME",
+ 0x00BC: "SHRFMLA",
+ 0x00BD: "MULRK",
+ 0x00BE: "MULBLANK",
+ 0x00C1: "MMS",
+ 0x00C2: "ADDMENU",
+ 0x00C3: "DELMENU",
+ 0x00C5: "SXDI",
+ 0x00C6: "SXDB",
+ 0x00C7: "SXFIELD",
+ 0x00C8: "SXINDEXLIST",
+ 0x00C9: "SXDOUBLE",
+ 0x00CD: "SXSTRING",
+ 0x00CE: "SXDATETIME",
+ 0x00D0: "SXTBL",
+ 0x00D1: "SXTBRGITEM",
+ 0x00D2: "SXTBPG",
+ 0x00D3: "OBPROJ",
+ 0x00D5: "SXIDSTM",
+ 0x00D6: "RSTRING",
+ 0x00D7: "DBCELL",
+ 0x00DA: "BOOKBOOL",
+ 0x00DC: "SXEXT|PARAMQRY",
+ 0x00DD: "SCENPROTECT",
+ 0x00DE: "OLESIZE",
+ 0x00DF: "UDDESC",
+ 0x00E0: "XF",
+ 0x00E1: "INTERFACEHDR",
+ 0x00E2: "INTERFACEEND",
+ 0x00E3: "SXVS",
+ 0x00E5: "MERGEDCELLS",
+ 0x00E9: "BITMAP",
+ 0x00EB: "MSODRAWINGGROUP",
+ 0x00EC: "MSODRAWING",
+ 0x00ED: "MSODRAWINGSELECTION",
+ 0x00F0: "SXRULE",
+ 0x00F1: "SXEX",
+ 0x00F2: "SXFILT",
+ 0x00F6: "SXNAME",
+ 0x00F7: "SXSELECT",
+ 0x00F8: "SXPAIR",
+ 0x00F9: "SXFMLA",
+ 0x00FB: "SXFORMAT",
+ 0x00FC: "SST",
+ 0x00FD: "LABELSST",
+ 0x00FF: "EXTSST",
+ 0x0100: "SXVDEX",
+ 0x0103: "SXFORMULA",
+ 0x0122: "SXDBEX",
+ 0x0137: "CHTRINSERT",
+ 0x0138: "CHTRINFO",
+ 0x013B: "CHTRCELLCONTENT",
+ 0x013D: "TABID",
+ 0x0140: "CHTRMOVERANGE",
+ 0x014D: "CHTRINSERTTAB",
+ 0x015F: "LABELRANGES",
+ 0x0160: "USESELFS",
+ 0x0161: "DSF",
+ 0x0162: "XL5MODIFY",
+ 0x0196: "CHTRHEADER",
+ 0x01A9: "USERBVIEW",
+ 0x01AA: "USERSVIEWBEGIN",
+ 0x01AB: "USERSVIEWEND",
+ 0x01AD: "QSI",
+ 0x01AE: "SUPBOOK",
+ 0x01AF: "PROT4REV",
+ 0x01B0: "CONDFMT",
+ 0x01B1: "CF",
+ 0x01B2: "DVAL",
+ 0x01B5: "DCONBIN",
+ 0x01B6: "TXO",
+ 0x01B7: "REFRESHALL",
+ 0x01B8: "HLINK",
+ 0x01BA: "CODENAME",
+ 0x01BB: "SXFDBTYPE",
+ 0x01BC: "PROT4REVPASS",
+ 0x01BE: "DV",
+ 0x01C0: "XL9FILE",
+ 0x01C1: "RECALCID",
+ 0x0200: "DIMENSIONS",
+ 0x0201: "BLANK",
+ 0x0203: "NUMBER",
+ 0x0204: "LABEL",
+ 0x0205: "BOOLERR",
+ 0x0206: "FORMULA",
+ 0x0207: "STRING",
+ 0x0208: "ROW",
+ 0x0209: "BOF",
+ 0x020B: "INDEX",
+ 0x0218: "NAME",
+ 0x0221: "ARRAY",
+ 0x0223: "EXTERNNAME",
+ 0x0225: "DEFAULTROWHEIGHT",
+ 0x0231: "FONT",
+ 0x0236: "TABLE",
+ 0x023E: "WINDOW2",
+ 0x0243: "XF",
+ 0x027E: "RK",
+ 0x0293: "STYLE",
+ 0x0406: "FORMULA",
+ 0x0409: "BOF",
+ 0x041E: "FORMAT",
+ 0x0443: "XF",
+ 0x04BC: "SHRFMLA",
+ 0x0800: "SCREENTIP",
+ 0x0803: "WEBQRYSETTINGS",
+ 0x0804: "WEBQRYTABLES",
+ 0x0809: "BOF",
+ 0x0862: "SHEETLAYOUT",
+ 0x0867: "SHEETPROTECTION",
+ 0x1001: "UNITS",
+ 0x1002: "ChartChart",
+ 0x1003: "ChartSeries",
+ 0x1006: "ChartDataformat",
+ 0x1007: "ChartLineformat",
+ 0x1009: "ChartMarkerformat",
+ 0x100A: "ChartAreaformat",
+ 0x100B: "ChartPieformat",
+ 0x100C: "ChartAttachedlabel",
+ 0x100D: "ChartSeriestext",
+ 0x1014: "ChartChartformat",
+ 0x1015: "ChartLegend",
+ 0x1016: "ChartSerieslist",
+ 0x1017: "ChartBar",
+ 0x1018: "ChartLine",
+ 0x1019: "ChartPie",
+ 0x101A: "ChartArea",
+ 0x101B: "ChartScatter",
+ 0x101C: "ChartChartline",
+ 0x101D: "ChartAxis",
+ 0x101E: "ChartTick",
+ 0x101F: "ChartValuerange",
+ 0x1020: "ChartCatserrange",
+ 0x1021: "ChartAxislineformat",
+ 0x1022: "ChartFormatlink",
+ 0x1024: "ChartDefaulttext",
+ 0x1025: "ChartText",
+ 0x1026: "ChartFontx",
+ 0x1027: "ChartObjectLink",
+ 0x1032: "ChartFrame",
+ 0x1033: "BEGIN",
+ 0x1034: "END",
+ 0x1035: "ChartPlotarea",
+ 0x103A: "Chart3D",
+ 0x103C: "ChartPicf",
+ 0x103D: "ChartDropbar",
+ 0x103E: "ChartRadar",
+ 0x103F: "ChartSurface",
+ 0x1040: "ChartRadararea",
+ 0x1041: "ChartAxisparent",
+ 0x1043: "ChartLegendxn",
+ 0x1044: "ChartShtprops",
+ 0x1045: "ChartSertocrt",
+ 0x1046: "ChartAxesused",
+ 0x1048: "ChartSbaseref",
+ 0x104A: "ChartSerparent",
+ 0x104B: "ChartSerauxtrend",
+ 0x104E: "ChartIfmt",
+ 0x104F: "ChartPos",
+ 0x1050: "ChartAlruns",
+ 0x1051: "ChartAI",
+ 0x105B: "ChartSerauxerrbar",
+ 0x105D: "ChartSerfmt",
+ 0x105F: "Chart3DDataFormat",
+ 0x1060: "ChartFbi",
+ 0x1061: "ChartBoppop",
+ 0x1062: "ChartAxcext",
+ 0x1063: "ChartDat",
+ 0x1064: "ChartPlotgrowth",
+ 0x1065: "ChartSiindex",
+ 0x1066: "ChartGelframe",
+ 0x1067: "ChartBoppcustom",
+ 0xFFFF: ""
+}
+
+
+all_funcs_by_name = {
+ # Includes Analysis ToolPak aka ATP aka add-in aka xcall functions,
+ # distinguished by -ve opcode.
+ # name: (opcode, min # args, max # args, func return type, func arg types)
+ # + in func arg types means more of the same.
+ 'ABS' : ( 24, 1, 1, 'V', 'V'),
+ 'ACCRINT' : ( -1, 6, 7, 'V', 'VVVVVVV'),
+ 'ACCRINTM' : ( -1, 3, 5, 'V', 'VVVVV'),
+ 'ACOS' : ( 99, 1, 1, 'V', 'V'),
+ 'ACOSH' : (233, 1, 1, 'V', 'V'),
+ 'ADDRESS' : (219, 2, 5, 'V', 'VVVVV'),
+ 'AMORDEGRC' : ( -1, 7, 7, 'V', 'VVVVVVV'),
+ 'AMORLINC' : ( -1, 7, 7, 'V', 'VVVVVVV'),
+ 'AND' : ( 36, 1, 30, 'V', 'D+'),
+ 'AREAS' : ( 75, 1, 1, 'V', 'R'),
+ 'ASC' : (214, 1, 1, 'V', 'V'),
+ 'ASIN' : ( 98, 1, 1, 'V', 'V'),
+ 'ASINH' : (232, 1, 1, 'V', 'V'),
+ 'ATAN' : ( 18, 1, 1, 'V', 'V'),
+ 'ATAN2' : ( 97, 2, 2, 'V', 'VV'),
+ 'ATANH' : (234, 1, 1, 'V', 'V'),
+ 'AVEDEV' : (269, 1, 30, 'V', 'D+'),
+ 'AVERAGE' : ( 5, 1, 30, 'V', 'D+'),
+ 'AVERAGEA' : (361, 1, 30, 'V', 'D+'),
+ 'BAHTTEXT' : (368, 1, 1, 'V', 'V'),
+ 'BESSELI' : ( -1, 2, 2, 'V', 'VV'),
+ 'BESSELJ' : ( -1, 2, 2, 'V', 'VV'),
+ 'BESSELK' : ( -1, 2, 2, 'V', 'VV'),
+ 'BESSELY' : ( -1, 2, 2, 'V', 'VV'),
+ 'BETADIST' : (270, 3, 5, 'V', 'VVVVV'),
+ 'BETAINV' : (272, 3, 5, 'V', 'VVVVV'),
+ 'BIN2DEC' : ( -1, 1, 1, 'V', 'V'),
+ 'BIN2HEX' : ( -1, 1, 2, 'V', 'VV'),
+ 'BIN2OCT' : ( -1, 1, 2, 'V', 'VV'),
+ 'BINOMDIST' : (273, 4, 4, 'V', 'VVVV'),
+ 'CEILING' : (288, 2, 2, 'V', 'VV'),
+ 'CELL' : (125, 1, 2, 'V', 'VR'),
+ 'CHAR' : (111, 1, 1, 'V', 'V'),
+ 'CHIDIST' : (274, 2, 2, 'V', 'VV'),
+ 'CHIINV' : (275, 2, 2, 'V', 'VV'),
+ 'CHITEST' : (306, 2, 2, 'V', 'AA'),
+ 'CHOOSE' : (100, 2, 30, 'R', 'VR+'),
+ 'CLEAN' : (162, 1, 1, 'V', 'V'),
+ 'CODE' : (121, 1, 1, 'V', 'V'),
+ 'COLUMN' : ( 9, 0, 1, 'V', 'R'),
+ 'COLUMNS' : ( 77, 1, 1, 'V', 'R'),
+ 'COMBIN' : (276, 2, 2, 'V', 'VV'),
+ 'COMPLEX' : ( -1, 2, 3, 'V', 'VVV'),
+ 'CONCATENATE' : (336, 1, 30, 'V', 'V+'),
+ 'CONFIDENCE' : (277, 3, 3, 'V', 'VVV'),
+ 'CONVERT' : ( -1, 3, 3, 'V', 'VVV'),
+ 'CORREL' : (307, 2, 2, 'V', 'AA'),
+ 'COS' : ( 16, 1, 1, 'V', 'V'),
+ 'COSH' : (230, 1, 1, 'V', 'V'),
+ 'COUNT' : ( 0, 1, 30, 'V', 'D+'),
+ 'COUNTA' : (169, 1, 30, 'V', 'D+'),
+ 'COUNTBLANK' : (347, 1, 1, 'V', 'R'),
+ 'COUNTIF' : (346, 2, 2, 'V', 'RV'),
+ 'COUPDAYBS' : ( -1, 3, 5, 'V', 'VVVVV'),
+ 'COUPDAYS' : ( -1, 3, 5, 'V', 'VVVVV'),
+ 'COUPDAYSNC' : ( -1, 3, 5, 'V', 'VVVVV'),
+ 'COUPNCD' : ( -1, 3, 5, 'V', 'VVVVV'),
+ 'COUPNUM' : ( -1, 3, 5, 'V', 'VVVVV'),
+ 'COUPPCD' : ( -1, 3, 5, 'V', 'VVVVV'),
+ 'COVAR' : (308, 2, 2, 'V', 'AA'),
+ 'CRITBINOM' : (278, 3, 3, 'V', 'VVV'),
+ 'CUMIPMT' : ( -1, 6, 6, 'V', 'VVVVVV'),
+ 'CUMPRINC' : ( -1, 6, 6, 'V', 'VVVVVV'),
+ 'DATE' : ( 65, 3, 3, 'V', 'VVV'),
+ 'DATEDIF' : (351, 3, 3, 'V', 'VVV'),
+ 'DATEVALUE' : (140, 1, 1, 'V', 'V'),
+ 'DAVERAGE' : ( 42, 3, 3, 'V', 'RRR'),
+ 'DAY' : ( 67, 1, 1, 'V', 'V'),
+ 'DAYS360' : (220, 2, 3, 'V', 'VVV'),
+ 'DB' : (247, 4, 5, 'V', 'VVVVV'),
+ 'DBCS' : (215, 1, 1, 'V', 'V'),
+ 'DCOUNT' : ( 40, 3, 3, 'V', 'RRR'),
+ 'DCOUNTA' : (199, 3, 3, 'V', 'RRR'),
+ 'DDB' : (144, 4, 5, 'V', 'VVVVV'),
+ 'DEC2BIN' : ( -1, 1, 2, 'V', 'VV'),
+ 'DEC2HEX' : ( -1, 1, 2, 'V', 'VV'),
+ 'DEC2OCT' : ( -1, 1, 2, 'V', 'VV'),
+ 'DEGREES' : (343, 1, 1, 'V', 'V'),
+ 'DELTA' : ( -1, 1, 2, 'V', 'VV'),
+ 'DEVSQ' : (318, 1, 30, 'V', 'D+'),
+ 'DGET' : (235, 3, 3, 'V', 'RRR'),
+ 'DISC' : ( -1, 4, 5, 'V', 'VVVVV'),
+ 'DMAX' : ( 44, 3, 3, 'V', 'RRR'),
+ 'DMIN' : ( 43, 3, 3, 'V', 'RRR'),
+ 'DOLLAR' : ( 13, 1, 2, 'V', 'VV'),
+ 'DOLLARDE' : ( -1, 2, 2, 'V', 'VV'),
+ 'DOLLARFR' : ( -1, 2, 2, 'V', 'VV'),
+ 'DPRODUCT' : (189, 3, 3, 'V', 'RRR'),
+ 'DSTDEV' : ( 45, 3, 3, 'V', 'RRR'),
+ 'DSTDEVP' : (195, 3, 3, 'V', 'RRR'),
+ 'DSUM' : ( 41, 3, 3, 'V', 'RRR'),
+ 'DURATION' : ( -1, 5, 6, 'V', 'VVVVVV'),
+ 'DVAR' : ( 47, 3, 3, 'V', 'RRR'),
+ 'DVARP' : (196, 3, 3, 'V', 'RRR'),
+ 'EDATE' : ( -1, 2, 2, 'V', 'VV'),
+ 'EFFECT' : ( -1, 2, 2, 'V', 'VV'),
+ 'EOMONTH' : ( -1, 1, 2, 'V', 'VV'),
+ 'ERF' : ( -1, 1, 2, 'V', 'VV'),
+ 'ERFC' : ( -1, 1, 1, 'V', 'V'),
+ 'ERROR.TYPE' : (261, 1, 1, 'V', 'V'),
+ 'EVEN' : (279, 1, 1, 'V', 'V'),
+ 'EXACT' : (117, 2, 2, 'V', 'VV'),
+ 'EXP' : ( 21, 1, 1, 'V', 'V'),
+ 'EXPONDIST' : (280, 3, 3, 'V', 'VVV'),
+ 'FACT' : (184, 1, 1, 'V', 'V'),
+ 'FACTDOUBLE' : ( -1, 1, 1, 'V', 'V'),
+ 'FALSE' : ( 35, 0, 0, 'V', '-'),
+ 'FDIST' : (281, 3, 3, 'V', 'VVV'),
+ 'FIND' : (124, 2, 3, 'V', 'VVV'),
+ 'FINDB' : (205, 2, 3, 'V', 'VVV'),
+ 'FINV' : (282, 3, 3, 'V', 'VVV'),
+ 'FISHER' : (283, 1, 1, 'V', 'V'),
+ 'FISHERINV' : (284, 1, 1, 'V', 'V'),
+ 'FIXED' : ( 14, 2, 3, 'V', 'VVV'),
+ 'FLOOR' : (285, 2, 2, 'V', 'VV'),
+ 'FORECAST' : (309, 3, 3, 'V', 'VAA'),
+ 'FREQUENCY' : (252, 2, 2, 'A', 'RR'),
+ 'FTEST' : (310, 2, 2, 'V', 'AA'),
+ 'FV' : ( 57, 3, 5, 'V', 'VVVVV'),
+ 'FVSCHEDULE' : ( -1, 2, 2, 'V', 'VA'),
+ 'GAMMADIST' : (286, 4, 4, 'V', 'VVVV'),
+ 'GAMMAINV' : (287, 3, 3, 'V', 'VVV'),
+ 'GAMMALN' : (271, 1, 1, 'V', 'V'),
+ 'GCD' : ( -1, 1, 29, 'V', 'V+'),
+ 'GEOMEAN' : (319, 1, 30, 'V', 'D+'),
+ 'GESTEP' : ( -1, 1, 2, 'V', 'VV'),
+ 'GETPIVOTDATA': (358, 2, 30, 'A', 'VAV+'),
+ 'GROWTH' : ( 52, 1, 4, 'A', 'RRRV'),
+ 'HARMEAN' : (320, 1, 30, 'V', 'D+'),
+ 'HEX2BIN' : ( -1, 1, 2, 'V', 'VV'),
+ 'HEX2DEC' : ( -1, 1, 1, 'V', 'V'),
+ 'HEX2OCT' : ( -1, 1, 2, 'V', 'VV'),
+ 'HLOOKUP' : (101, 3, 4, 'V', 'VRRV'),
+ 'HOUR' : ( 71, 1, 1, 'V', 'V'),
+ 'HYPERLINK' : (359, 1, 2, 'V', 'VV'),
+ 'HYPGEOMDIST' : (289, 4, 4, 'V', 'VVVV'),
+ 'IF' : ( 1, 2, 3, 'R', 'VRR'),
+ 'IMABS' : ( -1, 1, 1, 'V', 'V'),
+ 'IMAGINARY' : ( -1, 1, 1, 'V', 'V'),
+ 'IMARGUMENT' : ( -1, 1, 1, 'V', 'V'),
+ 'IMCONJUGATE' : ( -1, 1, 1, 'V', 'V'),
+ 'IMCOS' : ( -1, 1, 1, 'V', 'V'),
+ 'IMDIV' : ( -1, 2, 2, 'V', 'VV'),
+ 'IMEXP' : ( -1, 1, 1, 'V', 'V'),
+ 'IMLN' : ( -1, 1, 1, 'V', 'V'),
+ 'IMLOG10' : ( -1, 1, 1, 'V', 'V'),
+ 'IMLOG2' : ( -1, 1, 1, 'V', 'V'),
+ 'IMPOWER' : ( -1, 2, 2, 'V', 'VV'),
+ 'IMPRODUCT' : ( -1, 2, 2, 'V', 'VV'),
+ 'IMREAL' : ( -1, 1, 1, 'V', 'V'),
+ 'IMSIN' : ( -1, 1, 1, 'V', 'V'),
+ 'IMSQRT' : ( -1, 1, 1, 'V', 'V'),
+ 'IMSUB' : ( -1, 2, 2, 'V', 'VV'),
+ 'IMSUM' : ( -1, 1, 29, 'V', 'V+'),
+ 'INDEX' : ( 29, 2, 4, 'R', 'RVVV'),
+ 'INDIRECT' : (148, 1, 2, 'R', 'VV'),
+ 'INFO' : (244, 1, 1, 'V', 'V'),
+ 'INT' : ( 25, 1, 1, 'V', 'V'),
+ 'INTERCEPT' : (311, 2, 2, 'V', 'AA'),
+ 'INTRATE' : ( -1, 4, 5, 'V', 'VVVVV'),
+ 'IPMT' : (167, 4, 6, 'V', 'VVVVVV'),
+ 'IRR' : ( 62, 1, 2, 'V', 'RV'),
+ 'ISBLANK' : (129, 1, 1, 'V', 'V'),
+ 'ISERR' : (126, 1, 1, 'V', 'V'),
+ 'ISERROR' : ( 3, 1, 1, 'V', 'V'),
+ 'ISEVEN' : ( -1, 1, 1, 'V', 'V'),
+ 'ISLOGICAL' : (198, 1, 1, 'V', 'V'),
+ 'ISNA' : ( 2, 1, 1, 'V', 'V'),
+ 'ISNONTEXT' : (190, 1, 1, 'V', 'V'),
+ 'ISNUMBER' : (128, 1, 1, 'V', 'V'),
+ 'ISODD' : ( -1, 1, 1, 'V', 'V'),
+ 'ISPMT' : (350, 4, 4, 'V', 'VVVV'),
+ 'ISREF' : (105, 1, 1, 'V', 'R'),
+ 'ISTEXT' : (127, 1, 1, 'V', 'V'),
+ 'KURT' : (322, 1, 30, 'V', 'D+'),
+ 'LARGE' : (325, 2, 2, 'V', 'RV'),
+ 'LCM' : ( -1, 1, 29, 'V', 'V+'),
+ 'LEFT' : (115, 1, 2, 'V', 'VV'),
+ 'LEFTB' : (208, 1, 2, 'V', 'VV'),
+ 'LEN' : ( 32, 1, 1, 'V', 'V'),
+ 'LENB' : (211, 1, 1, 'V', 'V'),
+ 'LINEST' : ( 49, 1, 4, 'A', 'RRVV'),
+ 'LN' : ( 22, 1, 1, 'V', 'V'),
+ 'LOG' : (109, 1, 2, 'V', 'VV'),
+ 'LOG10' : ( 23, 1, 1, 'V', 'V'),
+ 'LOGEST' : ( 51, 1, 4, 'A', 'RRVV'),
+ 'LOGINV' : (291, 3, 3, 'V', 'VVV'),
+ 'LOGNORMDIST' : (290, 3, 3, 'V', 'VVV'),
+ 'LOOKUP' : ( 28, 2, 3, 'V', 'VRR'),
+ 'LOWER' : (112, 1, 1, 'V', 'V'),
+ 'MATCH' : ( 64, 2, 3, 'V', 'VRR'),
+ 'MAX' : ( 7, 1, 30, 'V', 'D+'),
+ 'MAXA' : (362, 1, 30, 'V', 'D+'),
+ 'MDETERM' : (163, 1, 1, 'V', 'A'),
+ 'MDURATION' : ( -1, 5, 6, 'V', 'VVVVVV'),
+ 'MEDIAN' : (227, 1, 30, 'V', 'D+'),
+ 'MID' : ( 31, 3, 3, 'V', 'VVV'),
+ 'MIDB' : (210, 3, 3, 'V', 'VVV'),
+ 'MIN' : ( 6, 1, 30, 'V', 'D+'),
+ 'MINA' : (363, 1, 30, 'V', 'D+'),
+ 'MINUTE' : ( 72, 1, 1, 'V', 'V'),
+ 'MINVERSE' : (164, 1, 1, 'A', 'A'),
+ 'MIRR' : ( 61, 3, 3, 'V', 'RVV'),
+ 'MMULT' : (165, 2, 2, 'A', 'AA'),
+ 'MOD' : ( 39, 2, 2, 'V', 'VV'),
+ 'MODE' : (330, 1, 30, 'V', 'A+'), ################ weird #################
+ 'MONTH' : ( 68, 1, 1, 'V', 'V'),
+ 'MROUND' : ( -1, 2, 2, 'V', 'VV'),
+ 'MULTINOMIAL' : ( -1, 1, 29, 'V', 'V+'),
+ 'N' : (131, 1, 1, 'V', 'R'),
+ 'NA' : ( 10, 0, 0, 'V', '-'),
+ 'NEGBINOMDIST': (292, 3, 3, 'V', 'VVV'),
+ 'NETWORKDAYS' : ( -1, 2, 3, 'V', 'VVR'),
+ 'NOMINAL' : ( -1, 2, 2, 'V', 'VV'),
+ 'NORMDIST' : (293, 4, 4, 'V', 'VVVV'),
+ 'NORMINV' : (295, 3, 3, 'V', 'VVV'),
+ 'NORMSDIST' : (294, 1, 1, 'V', 'V'),
+ 'NORMSINV' : (296, 1, 1, 'V', 'V'),
+ 'NOT' : ( 38, 1, 1, 'V', 'V'),
+ 'NOW' : ( 74, 0, 0, 'V', '-'),
+ 'NPER' : ( 58, 3, 5, 'V', 'VVVVV'),
+ 'NPV' : ( 11, 2, 30, 'V', 'VD+'),
+ 'OCT2BIN' : ( -1, 1, 2, 'V', 'VV'),
+ 'OCT2DEC' : ( -1, 1, 1, 'V', 'V'),
+ 'OCT2HEX' : ( -1, 1, 2, 'V', 'VV'),
+ 'ODD' : (298, 1, 1, 'V', 'V'),
+ 'ODDFPRICE' : ( -1, 9, 9, 'V', 'VVVVVVVVV'),
+ 'ODDFYIELD' : ( -1, 9, 9, 'V', 'VVVVVVVVV'),
+ 'ODDLPRICE' : ( -1, 8, 8, 'V', 'VVVVVVVV'),
+ 'ODDLYIELD' : ( -1, 8, 8, 'V', 'VVVVVVVV'),
+ 'OFFSET' : ( 78, 3, 5, 'R', 'RVVVV'),
+ 'OR' : ( 37, 1, 30, 'V', 'D+'),
+ 'PEARSON' : (312, 2, 2, 'V', 'AA'),
+ 'PERCENTILE' : (328, 2, 2, 'V', 'RV'),
+ 'PERCENTRANK' : (329, 2, 3, 'V', 'RVV'),
+ 'PERMUT' : (299, 2, 2, 'V', 'VV'),
+ 'PHONETIC' : (360, 1, 1, 'V', 'R'),
+ 'PI' : ( 19, 0, 0, 'V', '-'),
+ 'PMT' : ( 59, 3, 5, 'V', 'VVVVV'),
+ 'POISSON' : (300, 3, 3, 'V', 'VVV'),
+ 'POWER' : (337, 2, 2, 'V', 'VV'),
+ 'PPMT' : (168, 4, 6, 'V', 'VVVVVV'),
+ 'PRICE' : ( -1, 6, 7, 'V', 'VVVVVVV'),
+ 'PRICEDISC' : ( -1, 4, 5, 'V', 'VVVVV'),
+ 'PRICEMAT' : ( -1, 5, 6, 'V', 'VVVVVV'),
+ 'PROB' : (317, 3, 4, 'V', 'AAVV'),
+ 'PRODUCT' : (183, 1, 30, 'V', 'D+'),
+ 'PROPER' : (114, 1, 1, 'V', 'V'),
+ 'PV' : ( 56, 3, 5, 'V', 'VVVVV'),
+ 'QUARTILE' : (327, 2, 2, 'V', 'RV'),
+ 'QUOTIENT' : ( -1, 2, 2, 'V', 'VV'),
+ 'RADIANS' : (342, 1, 1, 'V', 'V'),
+ 'RAND' : ( 63, 0, 0, 'V', '-'),
+ 'RANDBETWEEN' : ( -1, 2, 2, 'V', 'VV'),
+ 'RANK' : (216, 2, 3, 'V', 'VRV'),
+ 'RATE' : ( 60, 3, 6, 'V', 'VVVVVV'),
+ 'RECEIVED' : ( -1, 4, 5, 'V', 'VVVVV'),
+ 'REPLACE' : (119, 4, 4, 'V', 'VVVV'),
+ 'REPLACEB' : (207, 4, 4, 'V', 'VVVV'),
+ 'REPT' : ( 30, 2, 2, 'V', 'VV'),
+ 'RIGHT' : (116, 1, 2, 'V', 'VV'),
+ 'RIGHTB' : (209, 1, 2, 'V', 'VV'),
+ 'ROMAN' : (354, 1, 2, 'V', 'VV'),
+ 'ROUND' : ( 27, 2, 2, 'V', 'VV'),
+ 'ROUNDDOWN' : (213, 2, 2, 'V', 'VV'),
+ 'ROUNDUP' : (212, 2, 2, 'V', 'VV'),
+ 'ROW' : ( 8, 0, 1, 'V', 'R'),
+ 'ROWS' : ( 76, 1, 1, 'V', 'R'),
+ 'RSQ' : (313, 2, 2, 'V', 'AA'),
+ 'RTD' : (379, 3, 30, 'A', 'VVV+'),
+ 'SEARCH' : ( 82, 2, 3, 'V', 'VVV'),
+ 'SEARCHB' : (206, 2, 3, 'V', 'VVV'),
+ 'SECOND' : ( 73, 1, 1, 'V', 'V'),
+ 'SERIESSUM' : ( -1, 4, 4, 'V', 'VVVA'),
+ 'SIGN' : ( 26, 1, 1, 'V', 'V'),
+ 'SIN' : ( 15, 1, 1, 'V', 'V'),
+ 'SINH' : (229, 1, 1, 'V', 'V'),
+ 'SKEW' : (323, 1, 30, 'V', 'D+'),
+ 'SLN' : (142, 3, 3, 'V', 'VVV'),
+ 'SLOPE' : (315, 2, 2, 'V', 'AA'),
+ 'SMALL' : (326, 2, 2, 'V', 'RV'),
+ 'SQRT' : ( 20, 1, 1, 'V', 'V'),
+ 'SQRTPI' : ( -1, 1, 1, 'V', 'V'),
+ 'STANDARDIZE' : (297, 3, 3, 'V', 'VVV'),
+ 'STDEV' : ( 12, 1, 30, 'V', 'D+'),
+ 'STDEVA' : (366, 1, 30, 'V', 'D+'),
+ 'STDEVP' : (193, 1, 30, 'V', 'D+'),
+ 'STDEVPA' : (364, 1, 30, 'V', 'D+'),
+ 'STEYX' : (314, 2, 2, 'V', 'AA'),
+ 'SUBSTITUTE' : (120, 3, 4, 'V', 'VVVV'),
+ 'SUBTOTAL' : (344, 2, 30, 'V', 'VR+'),
+ 'SUM' : ( 4, 1, 30, 'V', 'D+'),
+ 'SUMIF' : (345, 2, 3, 'V', 'RVR'),
+ 'SUMPRODUCT' : (228, 1, 30, 'V', 'A+'),
+ 'SUMSQ' : (321, 1, 30, 'V', 'D+'),
+ 'SUMX2MY2' : (304, 2, 2, 'V', 'AA'),
+ 'SUMX2PY2' : (305, 2, 2, 'V', 'AA'),
+ 'SUMXMY2' : (303, 2, 2, 'V', 'AA'),
+ 'SYD' : (143, 4, 4, 'V', 'VVVV'),
+ 'T' : (130, 1, 1, 'V', 'R'),
+ 'TAN' : ( 17, 1, 1, 'V', 'V'),
+ 'TANH' : (231, 1, 1, 'V', 'V'),
+ 'TBILLEQ' : ( -1, 3, 3, 'V', 'VVV'),
+ 'TBILLPRICE' : ( -1, 3, 3, 'V', 'VVV'),
+ 'TBILLYIELD' : ( -1, 3, 3, 'V', 'VVV'),
+ 'TDIST' : (301, 3, 3, 'V', 'VVV'),
+ 'TEXT' : ( 48, 2, 2, 'V', 'VV'),
+ 'TIME' : ( 66, 3, 3, 'V', 'VVV'),
+ 'TIMEVALUE' : (141, 1, 1, 'V', 'V'),
+ 'TINV' : (332, 2, 2, 'V', 'VV'),
+ 'TODAY' : (221, 0, 0, 'V', '-'),
+ 'TRANSPOSE' : ( 83, 1, 1, 'A', 'A'),
+ 'TREND' : ( 50, 1, 4, 'A', 'RRRV'),
+ 'TRIM' : (118, 1, 1, 'V', 'V'),
+ 'TRIMMEAN' : (331, 2, 2, 'V', 'RV'),
+ 'TRUE' : ( 34, 0, 0, 'V', '-'),
+ 'TRUNC' : (197, 1, 2, 'V', 'VV'),
+ 'TTEST' : (316, 4, 4, 'V', 'AAVV'),
+ 'TYPE' : ( 86, 1, 1, 'V', 'V'),
+ 'UPPER' : (113, 1, 1, 'V', 'V'),
+ 'USDOLLAR' : (204, 1, 2, 'V', 'VV'),
+ 'VALUE' : ( 33, 1, 1, 'V', 'V'),
+ 'VAR' : ( 46, 1, 30, 'V', 'D+'),
+ 'VARA' : (367, 1, 30, 'V', 'D+'),
+ 'VARP' : (194, 1, 30, 'V', 'D+'),
+ 'VARPA' : (365, 1, 30, 'V', 'D+'),
+ 'VDB' : (222, 5, 7, 'V', 'VVVVVVV'),
+ 'VLOOKUP' : (102, 3, 4, 'V', 'VRRV'),
+ 'WEEKDAY' : ( 70, 1, 2, 'V', 'VV'),
+ 'WEEKNUM' : ( -1, 1, 2, 'V', 'VV'),
+ 'WEIBULL' : (302, 4, 4, 'V', 'VVVV'),
+ 'WORKDAY' : ( -1, 2, 3, 'V', 'VVR'),
+ 'XIRR' : ( -1, 2, 3, 'V', 'AAV'),
+ 'XNPV' : ( -1, 3, 3, 'V', 'VAA'),
+ 'YEAR' : ( 69, 1, 1, 'V', 'V'),
+ 'YEARFRAC' : ( -1, 2, 3, 'V', 'VVV'),
+ 'YIELD' : ( -1, 6, 7, 'V', 'VVVVVVV'),
+ 'YIELDDISC' : ( -1, 4, 5, 'V', 'VVVVV'),
+ 'YIELDMAT' : ( -1, 5, 6, 'V', 'VVVVVV'),
+ 'ZTEST' : (324, 2, 3, 'V', 'RVV'),
+ }
+
+# Formulas Parse things
+
+ptgExp = 0x01
+ptgTbl = 0x02
+ptgAdd = 0x03
+ptgSub = 0x04
+ptgMul = 0x05
+ptgDiv = 0x06
+ptgPower = 0x07
+ptgConcat = 0x08
+ptgLT = 0x09
+ptgLE = 0x0a
+ptgEQ = 0x0b
+ptgGE = 0x0c
+ptgGT = 0x0d
+ptgNE = 0x0e
+ptgIsect = 0x0f
+ptgUnion = 0x10
+ptgRange = 0x11
+ptgUplus = 0x12
+ptgUminus = 0x13
+ptgPercent = 0x14
+ptgParen = 0x15
+ptgMissArg = 0x16
+ptgStr = 0x17
+ptgExtend = 0x18
+ptgAttr = 0x19
+ptgSheet = 0x1a
+ptgEndSheet = 0x1b
+ptgErr = 0x1c
+ptgBool = 0x1d
+ptgInt = 0x1e
+ptgNum = 0x1f
+
+ptgArrayR = 0x20
+ptgFuncR = 0x21
+ptgFuncVarR = 0x22
+ptgNameR = 0x23
+ptgRefR = 0x24
+ptgAreaR = 0x25
+ptgMemAreaR = 0x26
+ptgMemErrR = 0x27
+ptgMemNoMemR = 0x28
+ptgMemFuncR = 0x29
+ptgRefErrR = 0x2a
+ptgAreaErrR = 0x2b
+ptgRefNR = 0x2c
+ptgAreaNR = 0x2d
+ptgMemAreaNR = 0x2e
+ptgMemNoMemNR = 0x2f
+ptgNameXR = 0x39
+ptgRef3dR = 0x3a
+ptgArea3dR = 0x3b
+ptgRefErr3dR = 0x3c
+ptgAreaErr3dR = 0x3d
+
+ptgArrayV = 0x40
+ptgFuncV = 0x41
+ptgFuncVarV = 0x42
+ptgNameV = 0x43
+ptgRefV = 0x44
+ptgAreaV = 0x45
+ptgMemAreaV = 0x46
+ptgMemErrV = 0x47
+ptgMemNoMemV = 0x48
+ptgMemFuncV = 0x49
+ptgRefErrV = 0x4a
+ptgAreaErrV = 0x4b
+ptgRefNV = 0x4c
+ptgAreaNV = 0x4d
+ptgMemAreaNV = 0x4e
+ptgMemNoMemNV = 0x4f
+ptgFuncCEV = 0x58
+ptgNameXV = 0x59
+ptgRef3dV = 0x5a
+ptgArea3dV = 0x5b
+ptgRefErr3dV = 0x5c
+ptgAreaErr3dV = 0x5d
+
+ptgArrayA = 0x60
+ptgFuncA = 0x61
+ptgFuncVarA = 0x62
+ptgNameA = 0x63
+ptgRefA = 0x64
+ptgAreaA = 0x65
+ptgMemAreaA = 0x66
+ptgMemErrA = 0x67
+ptgMemNoMemA = 0x68
+ptgMemFuncA = 0x69
+ptgRefErrA = 0x6a
+ptgAreaErrA = 0x6b
+ptgRefNA = 0x6c
+ptgAreaNA = 0x6d
+ptgMemAreaNA = 0x6e
+ptgMemNoMemNA = 0x6f
+ptgFuncCEA = 0x78
+ptgNameXA = 0x79
+ptgRef3dA = 0x7a
+ptgArea3dA = 0x7b
+ptgRefErr3dA = 0x7c
+ptgAreaErr3dA = 0x7d
+
+
+PtgNames = {
+ ptgExp : "ptgExp",
+ ptgTbl : "ptgTbl",
+ ptgAdd : "ptgAdd",
+ ptgSub : "ptgSub",
+ ptgMul : "ptgMul",
+ ptgDiv : "ptgDiv",
+ ptgPower : "ptgPower",
+ ptgConcat : "ptgConcat",
+ ptgLT : "ptgLT",
+ ptgLE : "ptgLE",
+ ptgEQ : "ptgEQ",
+ ptgGE : "ptgGE",
+ ptgGT : "ptgGT",
+ ptgNE : "ptgNE",
+ ptgIsect : "ptgIsect",
+ ptgUnion : "ptgUnion",
+ ptgRange : "ptgRange",
+ ptgUplus : "ptgUplus",
+ ptgUminus : "ptgUminus",
+ ptgPercent : "ptgPercent",
+ ptgParen : "ptgParen",
+ ptgMissArg : "ptgMissArg",
+ ptgStr : "ptgStr",
+ ptgExtend : "ptgExtend",
+ ptgAttr : "ptgAttr",
+ ptgSheet : "ptgSheet",
+ ptgEndSheet : "ptgEndSheet",
+ ptgErr : "ptgErr",
+ ptgBool : "ptgBool",
+ ptgInt : "ptgInt",
+ ptgNum : "ptgNum",
+ ptgArrayR : "ptgArrayR",
+ ptgFuncR : "ptgFuncR",
+ ptgFuncVarR : "ptgFuncVarR",
+ ptgNameR : "ptgNameR",
+ ptgRefR : "ptgRefR",
+ ptgAreaR : "ptgAreaR",
+ ptgMemAreaR : "ptgMemAreaR",
+ ptgMemErrR : "ptgMemErrR",
+ ptgMemNoMemR : "ptgMemNoMemR",
+ ptgMemFuncR : "ptgMemFuncR",
+ ptgRefErrR : "ptgRefErrR",
+ ptgAreaErrR : "ptgAreaErrR",
+ ptgRefNR : "ptgRefNR",
+ ptgAreaNR : "ptgAreaNR",
+ ptgMemAreaNR : "ptgMemAreaNR",
+ ptgMemNoMemNR : "ptgMemNoMemNR",
+ ptgNameXR : "ptgNameXR",
+ ptgRef3dR : "ptgRef3dR",
+ ptgArea3dR : "ptgArea3dR",
+ ptgRefErr3dR : "ptgRefErr3dR",
+ ptgAreaErr3dR : "ptgAreaErr3dR",
+ ptgArrayV : "ptgArrayV",
+ ptgFuncV : "ptgFuncV",
+ ptgFuncVarV : "ptgFuncVarV",
+ ptgNameV : "ptgNameV",
+ ptgRefV : "ptgRefV",
+ ptgAreaV : "ptgAreaV",
+ ptgMemAreaV : "ptgMemAreaV",
+ ptgMemErrV : "ptgMemErrV",
+ ptgMemNoMemV : "ptgMemNoMemV",
+ ptgMemFuncV : "ptgMemFuncV",
+ ptgRefErrV : "ptgRefErrV",
+ ptgAreaErrV : "ptgAreaErrV",
+ ptgRefNV : "ptgRefNV",
+ ptgAreaNV : "ptgAreaNV",
+ ptgMemAreaNV : "ptgMemAreaNV",
+ ptgMemNoMemNV : "ptgMemNoMemNV",
+ ptgFuncCEV : "ptgFuncCEV",
+ ptgNameXV : "ptgNameXV",
+ ptgRef3dV : "ptgRef3dV",
+ ptgArea3dV : "ptgArea3dV",
+ ptgRefErr3dV : "ptgRefErr3dV",
+ ptgAreaErr3dV : "ptgAreaErr3dV",
+ ptgArrayA : "ptgArrayA",
+ ptgFuncA : "ptgFuncA",
+ ptgFuncVarA : "ptgFuncVarA",
+ ptgNameA : "ptgNameA",
+ ptgRefA : "ptgRefA",
+ ptgAreaA : "ptgAreaA",
+ ptgMemAreaA : "ptgMemAreaA",
+ ptgMemErrA : "ptgMemErrA",
+ ptgMemNoMemA : "ptgMemNoMemA",
+ ptgMemFuncA : "ptgMemFuncA",
+ ptgRefErrA : "ptgRefErrA",
+ ptgAreaErrA : "ptgAreaErrA",
+ ptgRefNA : "ptgRefNA",
+ ptgAreaNA : "ptgAreaNA",
+ ptgMemAreaNA : "ptgMemAreaNA",
+ ptgMemNoMemNA : "ptgMemNoMemNA",
+ ptgFuncCEA : "ptgFuncCEA",
+ ptgNameXA : "ptgNameXA",
+ ptgRef3dA : "ptgRef3dA",
+ ptgArea3dA : "ptgArea3dA",
+ ptgRefErr3dA : "ptgRefErr3dA",
+ ptgAreaErr3dA : "ptgAreaErr3dA"
+}
+
+
+error_msg_by_code = {
+ 0x00: u"#NULL!", # intersection of two cell ranges is empty
+ 0x07: u"#DIV/0!", # division by zero
+ 0x0F: u"#VALUE!", # wrong type of operand
+ 0x17: u"#REF!", # illegal or deleted cell reference
+ 0x1D: u"#NAME?", # wrong function or range name
+ 0x24: u"#NUM!", # value range overflow
+ 0x2A: u"#N/A!" # argument or function not available
+}
diff --git a/tablib/packages/xlwt/Formatting.py b/tablib/packages/xlwt/Formatting.py
index c92498b..76b8e8f 100644
--- a/tablib/packages/xlwt/Formatting.py
+++ b/tablib/packages/xlwt/Formatting.py
@@ -1,261 +1,261 @@
-#!/usr/bin/env python
-'''
-The XF record is able to store explicit cell formatting attributes or the
-attributes of a cell style. Explicit formatting includes the reference to
-a cell style XF record. This allows to extend a defined cell style with
-some explicit attributes. The formatting attributes are divided into
-6 groups:
-
-Group Attributes
--------------------------------------
-Number format Number format index (index to FORMAT record)
-Font Font index (index to FONT record)
-Alignment Horizontal and vertical alignment, text wrap, indentation,
- orientation/rotation, text direction
-Border Border line styles and colours
-Background Background area style and colours
-Protection Cell locked, formula hidden
-
-For each group a flag in the cell XF record specifies whether to use the
-attributes contained in that XF record or in the referenced style
-XF record. In style XF records, these flags specify whether the attributes
-will overwrite explicit cell formatting when the style is applied to
-a cell. Changing a cell style (without applying this style to a cell) will
-change all cells which already use that style and do not contain explicit
-cell attributes for the changed style attributes. If a cell XF record does
-not contain explicit attributes in a group (if the attribute group flag
-is not set), it repeats the attributes of its style XF record.
-
-'''
-
-from . import BIFFRecords
-
-class Font(object):
-
- ESCAPEMENT_NONE = 0x00
- ESCAPEMENT_SUPERSCRIPT = 0x01
- ESCAPEMENT_SUBSCRIPT = 0x02
-
- UNDERLINE_NONE = 0x00
- UNDERLINE_SINGLE = 0x01
- UNDERLINE_SINGLE_ACC = 0x21
- UNDERLINE_DOUBLE = 0x02
- UNDERLINE_DOUBLE_ACC = 0x22
-
- FAMILY_NONE = 0x00
- FAMILY_ROMAN = 0x01
- FAMILY_SWISS = 0x02
- FAMILY_MODERN = 0x03
- FAMILY_SCRIPT = 0x04
- FAMILY_DECORATIVE = 0x05
-
- CHARSET_ANSI_LATIN = 0x00
- CHARSET_SYS_DEFAULT = 0x01
- CHARSET_SYMBOL = 0x02
- CHARSET_APPLE_ROMAN = 0x4D
- CHARSET_ANSI_JAP_SHIFT_JIS = 0x80
- CHARSET_ANSI_KOR_HANGUL = 0x81
- CHARSET_ANSI_KOR_JOHAB = 0x82
- CHARSET_ANSI_CHINESE_GBK = 0x86
- CHARSET_ANSI_CHINESE_BIG5 = 0x88
- CHARSET_ANSI_GREEK = 0xA1
- CHARSET_ANSI_TURKISH = 0xA2
- CHARSET_ANSI_VIETNAMESE = 0xA3
- CHARSET_ANSI_HEBREW = 0xB1
- CHARSET_ANSI_ARABIC = 0xB2
- CHARSET_ANSI_BALTIC = 0xBA
- CHARSET_ANSI_CYRILLIC = 0xCC
- CHARSET_ANSI_THAI = 0xDE
- CHARSET_ANSI_LATIN_II = 0xEE
- CHARSET_OEM_LATIN_I = 0xFF
-
- def __init__(self):
- # twip = 1/20 of a point = 1/1440 of a inch
- # usually resolution == 96 pixels per 1 inch
- # (rarely 120 pixels per 1 inch or another one)
-
- self.height = 0x00C8 # 200: this is font with height 10 points
- self.italic = False
- self.struck_out = False
- self.outline = False
- self.shadow = False
- self.colour_index = 0x7FFF
- self.bold = False
- self._weight = 0x0190 # 0x02BC gives bold font
- self.escapement = self.ESCAPEMENT_NONE
- self.underline = self.UNDERLINE_NONE
- self.family = self.FAMILY_NONE
- self.charset = self.CHARSET_SYS_DEFAULT
- self.name = b'Arial'
-
- def get_biff_record(self):
- height = self.height
-
- options = 0x00
- if self.bold:
- options |= 0x01
- self._weight = 0x02BC
- if self.italic:
- options |= 0x02
- if self.underline != self.UNDERLINE_NONE:
- options |= 0x04
- if self.struck_out:
- options |= 0x08
- if self.outline:
- options |= 0x010
- if self.shadow:
- options |= 0x020
-
- colour_index = self.colour_index
- weight = self._weight
- escapement = self.escapement
- underline = self.underline
- family = self.family
- charset = self.charset
- name = self.name
-
- return BIFFRecords.FontRecord(height, options, colour_index, weight, escapement,
- underline, family, charset,
- name)
-
- def _search_key(self):
- return (
- self.height,
- self.italic,
- self.struck_out,
- self.outline,
- self.shadow,
- self.colour_index,
- self.bold,
- self._weight,
- self.escapement,
- self.underline,
- self.family,
- self.charset,
- self.name,
- )
-
-class Alignment(object):
- HORZ_GENERAL = 0x00
- HORZ_LEFT = 0x01
- HORZ_CENTER = 0x02
- HORZ_RIGHT = 0x03
- HORZ_FILLED = 0x04
- HORZ_JUSTIFIED = 0x05 # BIFF4-BIFF8X
- HORZ_CENTER_ACROSS_SEL = 0x06 # Centred across selection (BIFF4-BIFF8X)
- HORZ_DISTRIBUTED = 0x07 # Distributed (BIFF8X)
-
- VERT_TOP = 0x00
- VERT_CENTER = 0x01
- VERT_BOTTOM = 0x02
- VERT_JUSTIFIED = 0x03 # Justified (BIFF5-BIFF8X)
- VERT_DISTRIBUTED = 0x04 # Distributed (BIFF8X)
-
- DIRECTION_GENERAL = 0x00 # BIFF8X
- DIRECTION_LR = 0x01
- DIRECTION_RL = 0x02
-
- ORIENTATION_NOT_ROTATED = 0x00
- ORIENTATION_STACKED = 0x01
- ORIENTATION_90_CC = 0x02
- ORIENTATION_90_CW = 0x03
-
- ROTATION_0_ANGLE = 0x00
- ROTATION_STACKED = 0xFF
-
- WRAP_AT_RIGHT = 0x01
- NOT_WRAP_AT_RIGHT = 0x00
-
- SHRINK_TO_FIT = 0x01
- NOT_SHRINK_TO_FIT = 0x00
-
- def __init__(self):
- self.horz = self.HORZ_GENERAL
- self.vert = self.VERT_BOTTOM
- self.dire = self.DIRECTION_GENERAL
- self.orie = self.ORIENTATION_NOT_ROTATED
- self.rota = self.ROTATION_0_ANGLE
- self.wrap = self.NOT_WRAP_AT_RIGHT
- self.shri = self.NOT_SHRINK_TO_FIT
- self.inde = 0
- self.merg = 0
-
- def _search_key(self):
- return (
- self.horz, self.vert, self.dire, self.orie, self.rota,
- self.wrap, self.shri, self.inde, self.merg,
- )
-
-class Borders(object):
- NO_LINE = 0x00
- THIN = 0x01
- MEDIUM = 0x02
- DASHED = 0x03
- DOTTED = 0x04
- THICK = 0x05
- DOUBLE = 0x06
- HAIR = 0x07
- #The following for BIFF8
- MEDIUM_DASHED = 0x08
- THIN_DASH_DOTTED = 0x09
- MEDIUM_DASH_DOTTED = 0x0A
- THIN_DASH_DOT_DOTTED = 0x0B
- MEDIUM_DASH_DOT_DOTTED = 0x0C
- SLANTED_MEDIUM_DASH_DOTTED = 0x0D
-
- NEED_DIAG1 = 0x01
- NEED_DIAG2 = 0x01
- NO_NEED_DIAG1 = 0x00
- NO_NEED_DIAG2 = 0x00
-
- def __init__(self):
- self.left = self.NO_LINE
- self.right = self.NO_LINE
- self.top = self.NO_LINE
- self.bottom = self.NO_LINE
- self.diag = self.NO_LINE
-
- self.left_colour = 0x40
- self.right_colour = 0x40
- self.top_colour = 0x40
- self.bottom_colour = 0x40
- self.diag_colour = 0x40
-
- self.need_diag1 = self.NO_NEED_DIAG1
- self.need_diag2 = self.NO_NEED_DIAG2
-
- def _search_key(self):
- return (
- self.left, self.right, self.top, self.bottom, self.diag,
- self.left_colour, self.right_colour, self.top_colour,
- self.bottom_colour, self.diag_colour,
- self.need_diag1, self.need_diag2,
- )
-
-class Pattern(object):
- # patterns 0x00 - 0x12
- NO_PATTERN = 0x00
- SOLID_PATTERN = 0x01
-
- def __init__(self):
- self.pattern = self.NO_PATTERN
- self.pattern_fore_colour = 0x40
- self.pattern_back_colour = 0x41
-
- def _search_key(self):
- return (
- self.pattern,
- self.pattern_fore_colour,
- self.pattern_back_colour,
- )
-
-class Protection(object):
- def __init__(self):
- self.cell_locked = 1
- self.formula_hidden = 0
-
- def _search_key(self):
- return (
- self.cell_locked,
- self.formula_hidden,
- )
+#!/usr/bin/env python
+'''
+The XF record is able to store explicit cell formatting attributes or the
+attributes of a cell style. Explicit formatting includes the reference to
+a cell style XF record. This allows to extend a defined cell style with
+some explicit attributes. The formatting attributes are divided into
+6 groups:
+
+Group Attributes
+-------------------------------------
+Number format Number format index (index to FORMAT record)
+Font Font index (index to FONT record)
+Alignment Horizontal and vertical alignment, text wrap, indentation,
+ orientation/rotation, text direction
+Border Border line styles and colours
+Background Background area style and colours
+Protection Cell locked, formula hidden
+
+For each group a flag in the cell XF record specifies whether to use the
+attributes contained in that XF record or in the referenced style
+XF record. In style XF records, these flags specify whether the attributes
+will overwrite explicit cell formatting when the style is applied to
+a cell. Changing a cell style (without applying this style to a cell) will
+change all cells which already use that style and do not contain explicit
+cell attributes for the changed style attributes. If a cell XF record does
+not contain explicit attributes in a group (if the attribute group flag
+is not set), it repeats the attributes of its style XF record.
+
+'''
+
+import BIFFRecords
+
+class Font(object):
+
+ ESCAPEMENT_NONE = 0x00
+ ESCAPEMENT_SUPERSCRIPT = 0x01
+ ESCAPEMENT_SUBSCRIPT = 0x02
+
+ UNDERLINE_NONE = 0x00
+ UNDERLINE_SINGLE = 0x01
+ UNDERLINE_SINGLE_ACC = 0x21
+ UNDERLINE_DOUBLE = 0x02
+ UNDERLINE_DOUBLE_ACC = 0x22
+
+ FAMILY_NONE = 0x00
+ FAMILY_ROMAN = 0x01
+ FAMILY_SWISS = 0x02
+ FAMILY_MODERN = 0x03
+ FAMILY_SCRIPT = 0x04
+ FAMILY_DECORATIVE = 0x05
+
+ CHARSET_ANSI_LATIN = 0x00
+ CHARSET_SYS_DEFAULT = 0x01
+ CHARSET_SYMBOL = 0x02
+ CHARSET_APPLE_ROMAN = 0x4D
+ CHARSET_ANSI_JAP_SHIFT_JIS = 0x80
+ CHARSET_ANSI_KOR_HANGUL = 0x81
+ CHARSET_ANSI_KOR_JOHAB = 0x82
+ CHARSET_ANSI_CHINESE_GBK = 0x86
+ CHARSET_ANSI_CHINESE_BIG5 = 0x88
+ CHARSET_ANSI_GREEK = 0xA1
+ CHARSET_ANSI_TURKISH = 0xA2
+ CHARSET_ANSI_VIETNAMESE = 0xA3
+ CHARSET_ANSI_HEBREW = 0xB1
+ CHARSET_ANSI_ARABIC = 0xB2
+ CHARSET_ANSI_BALTIC = 0xBA
+ CHARSET_ANSI_CYRILLIC = 0xCC
+ CHARSET_ANSI_THAI = 0xDE
+ CHARSET_ANSI_LATIN_II = 0xEE
+ CHARSET_OEM_LATIN_I = 0xFF
+
+ def __init__(self):
+ # twip = 1/20 of a point = 1/1440 of a inch
+ # usually resolution == 96 pixels per 1 inch
+ # (rarely 120 pixels per 1 inch or another one)
+
+ self.height = 0x00C8 # 200: this is font with height 10 points
+ self.italic = False
+ self.struck_out = False
+ self.outline = False
+ self.shadow = False
+ self.colour_index = 0x7FFF
+ self.bold = False
+ self._weight = 0x0190 # 0x02BC gives bold font
+ self.escapement = self.ESCAPEMENT_NONE
+ self.underline = self.UNDERLINE_NONE
+ self.family = self.FAMILY_NONE
+ self.charset = self.CHARSET_SYS_DEFAULT
+ self.name = 'Arial'
+
+ def get_biff_record(self):
+ height = self.height
+
+ options = 0x00
+ if self.bold:
+ options |= 0x01
+ self._weight = 0x02BC
+ if self.italic:
+ options |= 0x02
+ if self.underline != self.UNDERLINE_NONE:
+ options |= 0x04
+ if self.struck_out:
+ options |= 0x08
+ if self.outline:
+ options |= 0x010
+ if self.shadow:
+ options |= 0x020
+
+ colour_index = self.colour_index
+ weight = self._weight
+ escapement = self.escapement
+ underline = self.underline
+ family = self.family
+ charset = self.charset
+ name = self.name
+
+ return BIFFRecords.FontRecord(height, options, colour_index, weight, escapement,
+ underline, family, charset,
+ name)
+
+ def _search_key(self):
+ return (
+ self.height,
+ self.italic,
+ self.struck_out,
+ self.outline,
+ self.shadow,
+ self.colour_index,
+ self.bold,
+ self._weight,
+ self.escapement,
+ self.underline,
+ self.family,
+ self.charset,
+ self.name,
+ )
+
+class Alignment(object):
+ HORZ_GENERAL = 0x00
+ HORZ_LEFT = 0x01
+ HORZ_CENTER = 0x02
+ HORZ_RIGHT = 0x03
+ HORZ_FILLED = 0x04
+ HORZ_JUSTIFIED = 0x05 # BIFF4-BIFF8X
+ HORZ_CENTER_ACROSS_SEL = 0x06 # Centred across selection (BIFF4-BIFF8X)
+ HORZ_DISTRIBUTED = 0x07 # Distributed (BIFF8X)
+
+ VERT_TOP = 0x00
+ VERT_CENTER = 0x01
+ VERT_BOTTOM = 0x02
+ VERT_JUSTIFIED = 0x03 # Justified (BIFF5-BIFF8X)
+ VERT_DISTRIBUTED = 0x04 # Distributed (BIFF8X)
+
+ DIRECTION_GENERAL = 0x00 # BIFF8X
+ DIRECTION_LR = 0x01
+ DIRECTION_RL = 0x02
+
+ ORIENTATION_NOT_ROTATED = 0x00
+ ORIENTATION_STACKED = 0x01
+ ORIENTATION_90_CC = 0x02
+ ORIENTATION_90_CW = 0x03
+
+ ROTATION_0_ANGLE = 0x00
+ ROTATION_STACKED = 0xFF
+
+ WRAP_AT_RIGHT = 0x01
+ NOT_WRAP_AT_RIGHT = 0x00
+
+ SHRINK_TO_FIT = 0x01
+ NOT_SHRINK_TO_FIT = 0x00
+
+ def __init__(self):
+ self.horz = self.HORZ_GENERAL
+ self.vert = self.VERT_BOTTOM
+ self.dire = self.DIRECTION_GENERAL
+ self.orie = self.ORIENTATION_NOT_ROTATED
+ self.rota = self.ROTATION_0_ANGLE
+ self.wrap = self.NOT_WRAP_AT_RIGHT
+ self.shri = self.NOT_SHRINK_TO_FIT
+ self.inde = 0
+ self.merg = 0
+
+ def _search_key(self):
+ return (
+ self.horz, self.vert, self.dire, self.orie, self.rota,
+ self.wrap, self.shri, self.inde, self.merg,
+ )
+
+class Borders(object):
+ NO_LINE = 0x00
+ THIN = 0x01
+ MEDIUM = 0x02
+ DASHED = 0x03
+ DOTTED = 0x04
+ THICK = 0x05
+ DOUBLE = 0x06
+ HAIR = 0x07
+ #The following for BIFF8
+ MEDIUM_DASHED = 0x08
+ THIN_DASH_DOTTED = 0x09
+ MEDIUM_DASH_DOTTED = 0x0A
+ THIN_DASH_DOT_DOTTED = 0x0B
+ MEDIUM_DASH_DOT_DOTTED = 0x0C
+ SLANTED_MEDIUM_DASH_DOTTED = 0x0D
+
+ NEED_DIAG1 = 0x01
+ NEED_DIAG2 = 0x01
+ NO_NEED_DIAG1 = 0x00
+ NO_NEED_DIAG2 = 0x00
+
+ def __init__(self):
+ self.left = self.NO_LINE
+ self.right = self.NO_LINE
+ self.top = self.NO_LINE
+ self.bottom = self.NO_LINE
+ self.diag = self.NO_LINE
+
+ self.left_colour = 0x40
+ self.right_colour = 0x40
+ self.top_colour = 0x40
+ self.bottom_colour = 0x40
+ self.diag_colour = 0x40
+
+ self.need_diag1 = self.NO_NEED_DIAG1
+ self.need_diag2 = self.NO_NEED_DIAG2
+
+ def _search_key(self):
+ return (
+ self.left, self.right, self.top, self.bottom, self.diag,
+ self.left_colour, self.right_colour, self.top_colour,
+ self.bottom_colour, self.diag_colour,
+ self.need_diag1, self.need_diag2,
+ )
+
+class Pattern(object):
+ # patterns 0x00 - 0x12
+ NO_PATTERN = 0x00
+ SOLID_PATTERN = 0x01
+
+ def __init__(self):
+ self.pattern = self.NO_PATTERN
+ self.pattern_fore_colour = 0x40
+ self.pattern_back_colour = 0x41
+
+ def _search_key(self):
+ return (
+ self.pattern,
+ self.pattern_fore_colour,
+ self.pattern_back_colour,
+ )
+
+class Protection(object):
+ def __init__(self):
+ self.cell_locked = 1
+ self.formula_hidden = 0
+
+ def _search_key(self):
+ return (
+ self.cell_locked,
+ self.formula_hidden,
+ )
diff --git a/tablib/packages/xlwt/Row.py b/tablib/packages/xlwt/Row.py
index 46447b8..a834ea1 100644
--- a/tablib/packages/xlwt/Row.py
+++ b/tablib/packages/xlwt/Row.py
@@ -1,253 +1,253 @@
-# -*- coding: windows-1252 -*-
-
-from . import BIFFRecords
-from . import Style
-from .Cell import StrCell, BlankCell, NumberCell, FormulaCell, MulBlankCell, BooleanCell, ErrorCell, \
- _get_cells_biff_data_mul
-from . import ExcelFormula
-import datetime as dt
-try:
- from decimal import Decimal
-except ImportError:
- # Python 2.3: decimal not supported; create dummy Decimal class
- class Decimal(object):
- pass
-
-
-class Row(object):
- __slots__ = [# private variables
- "__idx",
- "__parent",
- "__parent_wb",
- "__cells",
- "__min_col_idx",
- "__max_col_idx",
- "__xf_index",
- "__has_default_xf_index",
- "__height_in_pixels",
- # public variables
- "height",
- "has_default_height",
- "height_mismatch",
- "level",
- "collapse",
- "hidden",
- "space_above",
- "space_below"]
-
- def __init__(self, rowx, parent_sheet):
- if not (isinstance(rowx, int) and 0 <= rowx <= 65535):
- raise ValueError("row index (%r) not an int in range(65536)" % rowx)
- self.__idx = rowx
- self.__parent = parent_sheet
- self.__parent_wb = parent_sheet.get_parent()
- self.__cells = {}
- self.__min_col_idx = 0
- self.__max_col_idx = 0
- self.__xf_index = 0x0F
- self.__has_default_xf_index = 0
- self.__height_in_pixels = 0x11
-
- self.height = 0x00FF
- self.has_default_height = 0x00
- self.height_mismatch = 0
- self.level = 0
- self.collapse = 0
- self.hidden = 0
- self.space_above = 0
- self.space_below = 0
-
-
- def __adjust_height(self, style):
- twips = style.font.height
- points = float(twips)/20.0
- # Cell height in pixels can be calcuted by following approx. formula:
- # cell height in pixels = font height in points * 83/50 + 2/5
- # It works when screen resolution is 96 dpi
- pix = int(round(points*83.0/50.0 + 2.0/5.0))
- if pix > self.__height_in_pixels:
- self.__height_in_pixels = pix
-
-
- def __adjust_bound_col_idx(self, *args):
- for arg in args:
- iarg = int(arg)
- if not ((0 <= iarg <= 255) and arg == iarg):
- raise ValueError("column index (%r) not an int in range(256)" % arg)
- sheet = self.__parent
- if iarg < self.__min_col_idx:
- self.__min_col_idx = iarg
- if iarg > self.__max_col_idx:
- self.__max_col_idx = iarg
- if iarg < sheet.first_used_col:
- sheet.first_used_col = iarg
- if iarg > sheet.last_used_col:
- sheet.last_used_col = iarg
-
- def __excel_date_dt(self, date):
- if isinstance(date, dt.date) and (not isinstance(date, dt.datetime)):
- epoch = dt.date(1899, 12, 31)
- elif isinstance(date, dt.time):
- date = dt.datetime.combine(dt.datetime(1900, 1, 1), date)
- epoch = dt.datetime(1900, 1, 1, 0, 0, 0)
- else:
- epoch = dt.datetime(1899, 12, 31, 0, 0, 0)
- delta = date - epoch
- xldate = delta.days + float(delta.seconds) / (24*60*60)
- # Add a day for Excel's missing leap day in 1900
- if xldate > 59:
- xldate += 1
- return xldate
-
- def get_height_in_pixels(self):
- return self.__height_in_pixels
-
-
- def set_style(self, style):
- self.__adjust_height(style)
- self.__xf_index = self.__parent_wb.add_style(style)
- self.__has_default_xf_index = 1
-
-
- def get_xf_index(self):
- return self.__xf_index
-
-
- def get_cells_count(self):
- return len(self.__cells)
-
-
- def get_min_col(self):
- return self.__min_col_idx
-
-
- def get_max_col(self):
- return self.__max_col_idx
-
-
- def get_row_biff_data(self):
- height_options = (self.height & 0x07FFF)
- height_options |= (self.has_default_height & 0x01) << 15
-
- options = (self.level & 0x07) << 0
- options |= (self.collapse & 0x01) << 4
- options |= (self.hidden & 0x01) << 5
- options |= (self.height_mismatch & 0x01) << 6
- options |= (self.__has_default_xf_index & 0x01) << 7
- options |= (0x01 & 0x01) << 8
- options |= (self.__xf_index & 0x0FFF) << 16
- options |= (self.space_above & 1) << 28
- options |= (self.space_below & 1) << 29
-
- return BIFFRecords.RowRecord(self.__idx, self.__min_col_idx,
- self.__max_col_idx, height_options, options).get()
-
- def insert_cell(self, col_index, cell_obj):
- if col_index in self.__cells:
- if not self.__parent._cell_overwrite_ok:
- msg = "Attempt to overwrite cell: sheetname=%r rowx=%d colx=%d" \
- % (self.__parent.name, self.__idx, col_index)
- raise Exception(msg)
- prev_cell_obj = self.__cells[col_index]
- sst_idx = getattr(prev_cell_obj, 'sst_idx', None)
- if sst_idx is not None:
- self.__parent_wb.del_str(sst_idx)
- self.__cells[col_index] = cell_obj
-
- def insert_mulcells(self, colx1, colx2, cell_obj):
- self.insert_cell(colx1, cell_obj)
- for col_index in range(colx1+1, colx2+1):
- self.insert_cell(col_index, None)
-
- def get_cells_biff_data(self):
- cell_items = [item for item in self.__cells.items() if item[1] is not None]
- cell_items.sort() # in column order
- return _get_cells_biff_data_mul(self.__idx, cell_items)
- # previously:
- # return ''.join([cell.get_biff_data() for colx, cell in cell_items])
-
- def get_index(self):
- return self.__idx
-
- def set_cell_text(self, colx, value, style=Style.default_style):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(colx)
- xf_index = self.__parent_wb.add_style(style)
- self.insert_cell(colx, StrCell(self.__idx, colx, xf_index, self.__parent_wb.add_str(value)))
-
- def set_cell_blank(self, colx, style=Style.default_style):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(colx)
- xf_index = self.__parent_wb.add_style(style)
- self.insert_cell(colx, BlankCell(self.__idx, colx, xf_index))
-
- def set_cell_mulblanks(self, first_colx, last_colx, style=Style.default_style):
- assert 0 <= first_colx <= last_colx <= 255
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(first_colx, last_colx)
- xf_index = self.__parent_wb.add_style(style)
- # ncols = last_colx - first_colx + 1
- self.insert_mulcells(first_colx, last_colx, MulBlankCell(self.__idx, first_colx, last_colx, xf_index))
-
- def set_cell_number(self, colx, number, style=Style.default_style):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(colx)
- xf_index = self.__parent_wb.add_style(style)
- self.insert_cell(colx, NumberCell(self.__idx, colx, xf_index, number))
-
- def set_cell_date(self, colx, datetime_obj, style=Style.default_style):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(colx)
- xf_index = self.__parent_wb.add_style(style)
- self.insert_cell(colx,
- NumberCell(self.__idx, colx, xf_index, self.__excel_date_dt(datetime_obj)))
-
- def set_cell_formula(self, colx, formula, style=Style.default_style, calc_flags=0):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(colx)
- xf_index = self.__parent_wb.add_style(style)
- self.__parent_wb.add_sheet_reference(formula)
- self.insert_cell(colx, FormulaCell(self.__idx, colx, xf_index, formula, calc_flags=0))
-
- def set_cell_boolean(self, colx, value, style=Style.default_style):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(colx)
- xf_index = self.__parent_wb.add_style(style)
- self.insert_cell(colx, BooleanCell(self.__idx, colx, xf_index, bool(value)))
-
- def set_cell_error(self, colx, error_string_or_code, style=Style.default_style):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(colx)
- xf_index = self.__parent_wb.add_style(style)
- self.insert_cell(colx, ErrorCell(self.__idx, colx, xf_index, error_string_or_code))
-
- def write(self, col, label, style=Style.default_style):
- self.__adjust_height(style)
- self.__adjust_bound_col_idx(col)
- style_index = self.__parent_wb.add_style(style)
- if isinstance(label, str):
- if len(label) > 0:
- self.insert_cell(col,
- StrCell(self.__idx, col, style_index, self.__parent_wb.add_str(label))
- )
- else:
- self.insert_cell(col, BlankCell(self.__idx, col, style_index))
- elif isinstance(label, bool): # bool is subclass of int; test bool first
- self.insert_cell(col, BooleanCell(self.__idx, col, style_index, label))
- elif isinstance(label, (float, int, Decimal)):
- self.insert_cell(col, NumberCell(self.__idx, col, style_index, label))
- elif isinstance(label, (dt.datetime, dt.date, dt.time)):
- date_number = self.__excel_date_dt(label)
- self.insert_cell(col, NumberCell(self.__idx, col, style_index, date_number))
- elif label is None:
- self.insert_cell(col, BlankCell(self.__idx, col, style_index))
- elif isinstance(label, ExcelFormula.Formula):
- self.__parent_wb.add_sheet_reference(label)
- self.insert_cell(col, FormulaCell(self.__idx, col, style_index, label))
- else:
- raise Exception("Unexpected data type %r" % type(label))
-
- write_blanks = set_cell_mulblanks
-
-
-
+# -*- coding: windows-1252 -*-
+
+import BIFFRecords
+import Style
+from Cell import StrCell, BlankCell, NumberCell, FormulaCell, MulBlankCell, BooleanCell, ErrorCell, \
+ _get_cells_biff_data_mul
+import ExcelFormula
+import datetime as dt
+try:
+ from decimal import Decimal
+except ImportError:
+ # Python 2.3: decimal not supported; create dummy Decimal class
+ class Decimal(object):
+ pass
+
+
+class Row(object):
+ __slots__ = [# private variables
+ "__idx",
+ "__parent",
+ "__parent_wb",
+ "__cells",
+ "__min_col_idx",
+ "__max_col_idx",
+ "__xf_index",
+ "__has_default_xf_index",
+ "__height_in_pixels",
+ # public variables
+ "height",
+ "has_default_height",
+ "height_mismatch",
+ "level",
+ "collapse",
+ "hidden",
+ "space_above",
+ "space_below"]
+
+ def __init__(self, rowx, parent_sheet):
+ if not (isinstance(rowx, int) and 0 <= rowx <= 65535):
+ raise ValueError("row index (%r) not an int in range(65536)" % rowx)
+ self.__idx = rowx
+ self.__parent = parent_sheet
+ self.__parent_wb = parent_sheet.get_parent()
+ self.__cells = {}
+ self.__min_col_idx = 0
+ self.__max_col_idx = 0
+ self.__xf_index = 0x0F
+ self.__has_default_xf_index = 0
+ self.__height_in_pixels = 0x11
+
+ self.height = 0x00FF
+ self.has_default_height = 0x00
+ self.height_mismatch = 0
+ self.level = 0
+ self.collapse = 0
+ self.hidden = 0
+ self.space_above = 0
+ self.space_below = 0
+
+
+ def __adjust_height(self, style):
+ twips = style.font.height
+ points = float(twips)/20.0
+ # Cell height in pixels can be calcuted by following approx. formula:
+ # cell height in pixels = font height in points * 83/50 + 2/5
+ # It works when screen resolution is 96 dpi
+ pix = int(round(points*83.0/50.0 + 2.0/5.0))
+ if pix > self.__height_in_pixels:
+ self.__height_in_pixels = pix
+
+
+ def __adjust_bound_col_idx(self, *args):
+ for arg in args:
+ iarg = int(arg)
+ if not ((0 <= iarg <= 255) and arg == iarg):
+ raise ValueError("column index (%r) not an int in range(256)" % arg)
+ sheet = self.__parent
+ if iarg < self.__min_col_idx:
+ self.__min_col_idx = iarg
+ if iarg > self.__max_col_idx:
+ self.__max_col_idx = iarg
+ if iarg < sheet.first_used_col:
+ sheet.first_used_col = iarg
+ if iarg > sheet.last_used_col:
+ sheet.last_used_col = iarg
+
+ def __excel_date_dt(self, date):
+ if isinstance(date, dt.date) and (not isinstance(date, dt.datetime)):
+ epoch = dt.date(1899, 12, 31)
+ elif isinstance(date, dt.time):
+ date = dt.datetime.combine(dt.datetime(1900, 1, 1), date)
+ epoch = dt.datetime(1900, 1, 1, 0, 0, 0)
+ else:
+ epoch = dt.datetime(1899, 12, 31, 0, 0, 0)
+ delta = date - epoch
+ xldate = delta.days + float(delta.seconds) / (24*60*60)
+ # Add a day for Excel's missing leap day in 1900
+ if xldate > 59:
+ xldate += 1
+ return xldate
+
+ def get_height_in_pixels(self):
+ return self.__height_in_pixels
+
+
+ def set_style(self, style):
+ self.__adjust_height(style)
+ self.__xf_index = self.__parent_wb.add_style(style)
+ self.__has_default_xf_index = 1
+
+
+ def get_xf_index(self):
+ return self.__xf_index
+
+
+ def get_cells_count(self):
+ return len(self.__cells)
+
+
+ def get_min_col(self):
+ return self.__min_col_idx
+
+
+ def get_max_col(self):
+ return self.__max_col_idx
+
+
+ def get_row_biff_data(self):
+ height_options = (self.height & 0x07FFF)
+ height_options |= (self.has_default_height & 0x01) << 15
+
+ options = (self.level & 0x07) << 0
+ options |= (self.collapse & 0x01) << 4
+ options |= (self.hidden & 0x01) << 5
+ options |= (self.height_mismatch & 0x01) << 6
+ options |= (self.__has_default_xf_index & 0x01) << 7
+ options |= (0x01 & 0x01) << 8
+ options |= (self.__xf_index & 0x0FFF) << 16
+ options |= (self.space_above & 1) << 28
+ options |= (self.space_below & 1) << 29
+
+ return BIFFRecords.RowRecord(self.__idx, self.__min_col_idx,
+ self.__max_col_idx, height_options, options).get()
+
+ def insert_cell(self, col_index, cell_obj):
+ if col_index in self.__cells:
+ if not self.__parent._cell_overwrite_ok:
+ msg = "Attempt to overwrite cell: sheetname=%r rowx=%d colx=%d" \
+ % (self.__parent.name, self.__idx, col_index)
+ raise Exception(msg)
+ prev_cell_obj = self.__cells[col_index]
+ sst_idx = getattr(prev_cell_obj, 'sst_idx', None)
+ if sst_idx is not None:
+ self.__parent_wb.del_str(sst_idx)
+ self.__cells[col_index] = cell_obj
+
+ def insert_mulcells(self, colx1, colx2, cell_obj):
+ self.insert_cell(colx1, cell_obj)
+ for col_index in xrange(colx1+1, colx2+1):
+ self.insert_cell(col_index, None)
+
+ def get_cells_biff_data(self):
+ cell_items = [item for item in self.__cells.iteritems() if item[1] is not None]
+ cell_items.sort() # in column order
+ return _get_cells_biff_data_mul(self.__idx, cell_items)
+ # previously:
+ # return ''.join([cell.get_biff_data() for colx, cell in cell_items])
+
+ def get_index(self):
+ return self.__idx
+
+ def set_cell_text(self, colx, value, style=Style.default_style):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(colx)
+ xf_index = self.__parent_wb.add_style(style)
+ self.insert_cell(colx, StrCell(self.__idx, colx, xf_index, self.__parent_wb.add_str(value)))
+
+ def set_cell_blank(self, colx, style=Style.default_style):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(colx)
+ xf_index = self.__parent_wb.add_style(style)
+ self.insert_cell(colx, BlankCell(self.__idx, colx, xf_index))
+
+ def set_cell_mulblanks(self, first_colx, last_colx, style=Style.default_style):
+ assert 0 <= first_colx <= last_colx <= 255
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(first_colx, last_colx)
+ xf_index = self.__parent_wb.add_style(style)
+ # ncols = last_colx - first_colx + 1
+ self.insert_mulcells(first_colx, last_colx, MulBlankCell(self.__idx, first_colx, last_colx, xf_index))
+
+ def set_cell_number(self, colx, number, style=Style.default_style):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(colx)
+ xf_index = self.__parent_wb.add_style(style)
+ self.insert_cell(colx, NumberCell(self.__idx, colx, xf_index, number))
+
+ def set_cell_date(self, colx, datetime_obj, style=Style.default_style):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(colx)
+ xf_index = self.__parent_wb.add_style(style)
+ self.insert_cell(colx,
+ NumberCell(self.__idx, colx, xf_index, self.__excel_date_dt(datetime_obj)))
+
+ def set_cell_formula(self, colx, formula, style=Style.default_style, calc_flags=0):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(colx)
+ xf_index = self.__parent_wb.add_style(style)
+ self.__parent_wb.add_sheet_reference(formula)
+ self.insert_cell(colx, FormulaCell(self.__idx, colx, xf_index, formula, calc_flags=0))
+
+ def set_cell_boolean(self, colx, value, style=Style.default_style):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(colx)
+ xf_index = self.__parent_wb.add_style(style)
+ self.insert_cell(colx, BooleanCell(self.__idx, colx, xf_index, bool(value)))
+
+ def set_cell_error(self, colx, error_string_or_code, style=Style.default_style):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(colx)
+ xf_index = self.__parent_wb.add_style(style)
+ self.insert_cell(colx, ErrorCell(self.__idx, colx, xf_index, error_string_or_code))
+
+ def write(self, col, label, style=Style.default_style):
+ self.__adjust_height(style)
+ self.__adjust_bound_col_idx(col)
+ style_index = self.__parent_wb.add_style(style)
+ if isinstance(label, basestring):
+ if len(label) > 0:
+ self.insert_cell(col,
+ StrCell(self.__idx, col, style_index, self.__parent_wb.add_str(label))
+ )
+ else:
+ self.insert_cell(col, BlankCell(self.__idx, col, style_index))
+ elif isinstance(label, bool): # bool is subclass of int; test bool first
+ self.insert_cell(col, BooleanCell(self.__idx, col, style_index, label))
+ elif isinstance(label, (float, int, long, Decimal)):
+ self.insert_cell(col, NumberCell(self.__idx, col, style_index, label))
+ elif isinstance(label, (dt.datetime, dt.date, dt.time)):
+ date_number = self.__excel_date_dt(label)
+ self.insert_cell(col, NumberCell(self.__idx, col, style_index, date_number))
+ elif label is None:
+ self.insert_cell(col, BlankCell(self.__idx, col, style_index))
+ elif isinstance(label, ExcelFormula.Formula):
+ self.__parent_wb.add_sheet_reference(label)
+ self.insert_cell(col, FormulaCell(self.__idx, col, style_index, label))
+ else:
+ raise Exception("Unexpected data type %r" % type(label))
+
+ write_blanks = set_cell_mulblanks
+
+
+
diff --git a/tablib/packages/xlwt/Style.py b/tablib/packages/xlwt/Style.py
index 182fc07..bf5fb4c 100644
--- a/tablib/packages/xlwt/Style.py
+++ b/tablib/packages/xlwt/Style.py
@@ -1,593 +1,592 @@
-# -*- coding: windows-1252 -*-
-
-from . import Formatting
-from .BIFFRecords import *
-import collections
-
-FIRST_USER_DEFINED_NUM_FORMAT_IDX = 164
-
-class XFStyle(object):
-
- def __init__(self):
- self.num_format_str = 'General'
- self.font = Formatting.Font()
- self.alignment = Formatting.Alignment()
- self.borders = Formatting.Borders()
- self.pattern = Formatting.Pattern()
- self.protection = Formatting.Protection()
-
-default_style = XFStyle()
-
-class StyleCollection(object):
- _std_num_fmt_list = [
- 'general',
- '0',
- '0.00',
- '#,##0',
- '#,##0.00',
- '"$"#,##0_);("$"#,##',
- '"$"#,##0_);[Red]("$"#,##',
- '"$"#,##0.00_);("$"#,##',
- '"$"#,##0.00_);[Red]("$"#,##',
- '0%',
- '0.00%',
- '0.00E+00',
- '# ?/?',
- '# ??/??',
- 'M/D/YY',
- 'D-MMM-YY',
- 'D-MMM',
- 'MMM-YY',
- 'h:mm AM/PM',
- 'h:mm:ss AM/PM',
- 'h:mm',
- 'h:mm:ss',
- 'M/D/YY h:mm',
- '_(#,##0_);(#,##0)',
- '_(#,##0_);[Red](#,##0)',
- '_(#,##0.00_);(#,##0.00)',
- '_(#,##0.00_);[Red](#,##0.00)',
- '_("$"* #,##0_);_("$"* (#,##0);_("$"* "-"_);_(@_)',
- '_(* #,##0_);_(* (#,##0);_(* "-"_);_(@_)',
- '_("$"* #,##0.00_);_("$"* (#,##0.00);_("$"* "-"??_);_(@_)',
- '_(* #,##0.00_);_(* (#,##0.00);_(* "-"??_);_(@_)',
- 'mm:ss',
- '[h]:mm:ss',
- 'mm:ss.0',
- '##0.0E+0',
- '@'
- ]
-
- def __init__(self, style_compression=0):
- self.style_compression = style_compression
- self.stats = [0, 0, 0, 0, 0, 0]
- self._font_id2x = {}
- self._font_x2id = {}
- self._font_val2x = {}
-
- for x in (0, 1, 2, 3, 5): # The font with index 4 is omitted in all BIFF versions
- font = Formatting.Font()
- search_key = font._search_key()
- self._font_id2x[font] = x
- self._font_x2id[x] = font
- self._font_val2x[search_key] = x
-
- self._xf_id2x = {}
- self._xf_x2id = {}
- self._xf_val2x = {}
-
- self._num_formats = {}
- for fmtidx, fmtstr in zip(list(range(0, 23)), StyleCollection._std_num_fmt_list[0:23]):
- self._num_formats[fmtstr] = fmtidx
- for fmtidx, fmtstr in zip(list(range(37, 50)), StyleCollection._std_num_fmt_list[23:]):
- self._num_formats[fmtstr] = fmtidx
-
- self.default_style = XFStyle()
- self._default_xf = self._add_style(self.default_style)[0]
-
- def add(self, style):
- if style == None:
- return 0x10
- return self._add_style(style)[1]
-
- def _add_style(self, style):
- num_format_str = style.num_format_str
- if num_format_str in self._num_formats:
- num_format_idx = self._num_formats[num_format_str]
- else:
- num_format_idx = (
- FIRST_USER_DEFINED_NUM_FORMAT_IDX
- + len(self._num_formats)
- - len(StyleCollection._std_num_fmt_list)
- )
- self._num_formats[num_format_str] = num_format_idx
-
- font = style.font
- if font in self._font_id2x:
- font_idx = self._font_id2x[font]
- self.stats[0] += 1
- elif self.style_compression:
- search_key = font._search_key()
- font_idx = self._font_val2x.get(search_key)
- if font_idx is not None:
- self._font_id2x[font] = font_idx
- self.stats[1] += 1
- else:
- font_idx = len(self._font_x2id) + 1 # Why plus 1? Font 4 is missing
- self._font_id2x[font] = font_idx
- self._font_val2x[search_key] = font_idx
- self._font_x2id[font_idx] = font
- self.stats[2] += 1
- else:
- font_idx = len(self._font_id2x) + 1
- self._font_id2x[font] = font_idx
- self.stats[2] += 1
-
- gof = (style.alignment, style.borders, style.pattern, style.protection)
- xf = (font_idx, num_format_idx) + gof
- if xf in self._xf_id2x:
- xf_index = self._xf_id2x[xf]
- self.stats[3] += 1
- elif self.style_compression == 2:
- xf_key = (font_idx, num_format_idx) + tuple([obj._search_key() for obj in gof])
- xf_index = self._xf_val2x.get(xf_key)
- if xf_index is not None:
- self._xf_id2x[xf] = xf_index
- self.stats[4] += 1
- else:
- xf_index = 0x10 + len(self._xf_x2id)
- self._xf_id2x[xf] = xf_index
- self._xf_val2x[xf_key] = xf_index
- self._xf_x2id[xf_index] = xf
- self.stats[5] += 1
- else:
- xf_index = 0x10 + len(self._xf_id2x)
- self._xf_id2x[xf] = xf_index
- self.stats[5] += 1
-
- if xf_index >= 0xFFF:
- # 12 bits allowed, 0xFFF is a sentinel value
- raise ValueError("More than 4094 XFs (styles)")
-
- return xf, xf_index
-
- def get_biff_data(self):
- result = b''
- result += self._all_fonts()
- result += self._all_num_formats()
- result += self._all_cell_styles()
- result += self._all_styles()
- return result
-
- def _all_fonts(self):
- result = b''
- if self.style_compression:
- alist = list(self._font_x2id.items())
- else:
- alist = [(x, o) for o, x in list(self._font_id2x.items())]
- alist.sort()
- for font_idx, font in alist:
- result += font.get_biff_record().get()
- return result
-
- def _all_num_formats(self):
- result = b''
- alist = [
- (v, k)
- for k, v in list(self._num_formats.items())
- if v >= FIRST_USER_DEFINED_NUM_FORMAT_IDX
- ]
- alist.sort()
- for fmtidx, fmtstr in alist:
- result += NumberFormatRecord(fmtidx, fmtstr).get()
- return result
-
- def _all_cell_styles(self):
- result = b''
- for i in range(0, 16):
- result += XFRecord(self._default_xf, 'style').get()
- if self.style_compression == 2:
- alist = list(self._xf_x2id.items())
- else:
- alist = [(x, o) for o, x in list(self._xf_id2x.items())]
- alist.sort()
- for xf_idx, xf in alist:
- result += XFRecord(xf).get()
- return result
-
- def _all_styles(self):
- return StyleRecord().get()
-
-# easyxf and its supporting objects ###################################
-
-class EasyXFException(Exception):
- pass
-
-class EasyXFCallerError(EasyXFException):
- pass
-
-class EasyXFAuthorError(EasyXFException):
- pass
-
-class IntULim(object):
- # If astring represents a valid unsigned integer ('123', '0xabcd', etc)
- # and it is <= limit, return the int value; otherwise return None.
-
- def __init__(self, limit):
- self.limit = limit
-
- def __call__(self, astring):
- try:
- value = int(astring, 0)
- except ValueError:
- return None
- if not 0 <= value <= self.limit:
- return None
- return value
-
-bool_map = {
- # Text values for all Boolean attributes
- '1': 1, 'yes': 1, 'true': 1, 'on': 1,
- '0': 0, 'no': 0, 'false': 0, 'off': 0,
- }
-
-border_line_map = {
- # Text values for these borders attributes:
- # left, right, top, bottom and diag
- 'no_line': 0x00,
- 'thin': 0x01,
- 'medium': 0x02,
- 'dashed': 0x03,
- 'dotted': 0x04,
- 'thick': 0x05,
- 'double': 0x06,
- 'hair': 0x07,
- 'medium_dashed': 0x08,
- 'thin_dash_dotted': 0x09,
- 'medium_dash_dotted': 0x0a,
- 'thin_dash_dot_dotted': 0x0b,
- 'medium_dash_dot_dotted': 0x0c,
- 'slanted_medium_dash_dotted': 0x0d,
- }
-
-charset_map = {
- # Text values for font.charset
- 'ansi_latin': 0x00,
- 'sys_default': 0x01,
- 'symbol': 0x02,
- 'apple_roman': 0x4d,
- 'ansi_jap_shift_jis': 0x80,
- 'ansi_kor_hangul': 0x81,
- 'ansi_kor_johab': 0x82,
- 'ansi_chinese_gbk': 0x86,
- 'ansi_chinese_big5': 0x88,
- 'ansi_greek': 0xa1,
- 'ansi_turkish': 0xa2,
- 'ansi_vietnamese': 0xa3,
- 'ansi_hebrew': 0xb1,
- 'ansi_arabic': 0xb2,
- 'ansi_baltic': 0xba,
- 'ansi_cyrillic': 0xcc,
- 'ansi_thai': 0xde,
- 'ansi_latin_ii': 0xee,
- 'oem_latin_i': 0xff,
- }
-
-
-# Text values for colour indices. "grey" is a synonym of "gray".
-# The names are those given by Microsoft Excel 2003 to the colours
-# in the default palette. There is no great correspondence with
-# any W3C name-to-RGB mapping.
-_colour_map_text = """\
-aqua 0x31
-black 0x08
-blue 0x0C
-blue_gray 0x36
-bright_green 0x0B
-brown 0x3C
-coral 0x1D
-cyan_ega 0x0F
-dark_blue 0x12
-dark_blue_ega 0x12
-dark_green 0x3A
-dark_green_ega 0x11
-dark_purple 0x1C
-dark_red 0x10
-dark_red_ega 0x10
-dark_teal 0x38
-dark_yellow 0x13
-gold 0x33
-gray_ega 0x17
-gray25 0x16
-gray40 0x37
-gray50 0x17
-gray80 0x3F
-green 0x11
-ice_blue 0x1F
-indigo 0x3E
-ivory 0x1A
-lavender 0x2E
-light_blue 0x30
-light_green 0x2A
-light_orange 0x34
-light_turquoise 0x29
-light_yellow 0x2B
-lime 0x32
-magenta_ega 0x0E
-ocean_blue 0x1E
-olive_ega 0x13
-olive_green 0x3B
-orange 0x35
-pale_blue 0x2C
-periwinkle 0x18
-pink 0x0E
-plum 0x3D
-purple_ega 0x14
-red 0x0A
-rose 0x2D
-sea_green 0x39
-silver_ega 0x16
-sky_blue 0x28
-tan 0x2F
-teal 0x15
-teal_ega 0x15
-turquoise 0x0F
-violet 0x14
-white 0x09
-yellow 0x0D"""
-
-colour_map = {}
-for _line in _colour_map_text.splitlines():
- _name, _num = _line.split()
- _num = int(_num, 0)
- colour_map[_name] = _num
- if 'gray' in _name:
- colour_map[_name.replace('gray', 'grey')] = _num
-del _colour_map_text, _line, _name, _num
-
-
-pattern_map = {
- # Text values for pattern.pattern
- # xlwt/doc/pattern_examples.xls showcases all of these patterns.
- 'no_fill': 0,
- 'none': 0,
- 'solid': 1,
- 'solid_fill': 1,
- 'solid_pattern': 1,
- 'fine_dots': 2,
- 'alt_bars': 3,
- 'sparse_dots': 4,
- 'thick_horz_bands': 5,
- 'thick_vert_bands': 6,
- 'thick_backward_diag': 7,
- 'thick_forward_diag': 8,
- 'big_spots': 9,
- 'bricks': 10,
- 'thin_horz_bands': 11,
- 'thin_vert_bands': 12,
- 'thin_backward_diag': 13,
- 'thin_forward_diag': 14,
- 'squares': 15,
- 'diamonds': 16,
- }
-
-def any_str_func(s):
- return s.strip()
-
-def colour_index_func(s, maxval=0x7F):
- try:
- value = int(s, 0)
- except ValueError:
- return None
- if not (0 <= value <= maxval):
- return None
- return value
-
-colour_index_func_7 = colour_index_func
-
-def colour_index_func_15(s):
- return colour_index_func(s, maxval=0x7FFF)
-
-def rotation_func(s):
- try:
- value = int(s, 0)
- except ValueError:
- return None
- if not (-90 <= value <= 90):
- raise EasyXFCallerError("rotation %d: should be -90 to +90 degrees" % value)
- if value < 0:
- value = 90 - value # encode as 91 to 180 (clockwise)
- return value
-
-xf_dict = {
- 'align': 'alignment', # synonym
- 'alignment': {
- 'dire': {
- 'general': 0,
- 'lr': 1,
- 'rl': 2,
- },
- 'direction': 'dire',
- 'horiz': 'horz',
- 'horizontal': 'horz',
- 'horz': {
- 'general': 0,
- 'left': 1,
- 'center': 2,
- 'centre': 2, # "align: horiz centre" means xf.alignment.horz is set to 2
- 'right': 3,
- 'filled': 4,
- 'justified': 5,
- 'center_across_selection': 6,
- 'centre_across_selection': 6,
- 'distributed': 7,
- },
- 'inde': IntULim(15), # restriction: 0 <= value <= 15
- 'indent': 'inde',
- 'rota': [{'stacked': 255, 'none': 0, }, rotation_func],
- 'rotation': 'rota',
- 'shri': bool_map,
- 'shrink': 'shri',
- 'shrink_to_fit': 'shri',
- 'vert': {
- 'top': 0,
- 'center': 1,
- 'centre': 1,
- 'bottom': 2,
- 'justified': 3,
- 'distributed': 4,
- },
- 'vertical': 'vert',
- 'wrap': bool_map,
- },
- 'border': 'borders',
- 'borders': {
- 'left': [border_line_map, IntULim(0x0d)],
- 'right': [border_line_map, IntULim(0x0d)],
- 'top': [border_line_map, IntULim(0x0d)],
- 'bottom': [border_line_map, IntULim(0x0d)],
- 'diag': [border_line_map, IntULim(0x0d)],
- 'top_colour': [colour_map, colour_index_func_7],
- 'bottom_colour': [colour_map, colour_index_func_7],
- 'left_colour': [colour_map, colour_index_func_7],
- 'right_colour': [colour_map, colour_index_func_7],
- 'diag_colour': [colour_map, colour_index_func_7],
- 'top_color': 'top_colour',
- 'bottom_color': 'bottom_colour',
- 'left_color': 'left_colour',
- 'right_color': 'right_colour',
- 'diag_color': 'diag-colour',
- 'need_diag_1': bool_map,
- 'need_diag_2': bool_map,
- },
- 'font': {
- 'bold': bool_map,
- 'charset': charset_map,
- 'color': 'colour_index',
- 'color_index': 'colour_index',
- 'colour': 'colour_index',
- 'colour_index': [colour_map, colour_index_func_15],
- 'escapement': {'none': 0, 'superscript': 1, 'subscript': 2},
- 'family': {'none': 0, 'roman': 1, 'swiss': 2, 'modern': 3, 'script': 4, 'decorative': 5, },
- 'height': IntULim(0xFFFF), # practical limits are much narrower e.g. 160 to 1440 (8pt to 72pt)
- 'italic': bool_map,
- 'name': any_str_func,
- 'outline': bool_map,
- 'shadow': bool_map,
- 'struck_out': bool_map,
- 'underline': [bool_map, {'none': 0, 'single': 1, 'single_acc': 0x21, 'double': 2, 'double_acc': 0x22, }],
- },
- 'pattern': {
- 'back_color': 'pattern_back_colour',
- 'back_colour': 'pattern_back_colour',
- 'fore_color': 'pattern_fore_colour',
- 'fore_colour': 'pattern_fore_colour',
- 'pattern': [pattern_map, IntULim(16)],
- 'pattern_back_color': 'pattern_back_colour',
- 'pattern_back_colour': [colour_map, colour_index_func_7],
- 'pattern_fore_color': 'pattern_fore_colour',
- 'pattern_fore_colour': [colour_map, colour_index_func_7],
- },
- 'protection': {
- 'cell_locked' : bool_map,
- 'formula_hidden': bool_map,
- },
- }
-
-def _esplit(s, split_char, esc_char="\\"):
- escaped = False
- olist = ['']
- for c in s:
- if escaped:
- olist[-1] += c
- escaped = False
- elif c == esc_char:
- escaped = True
- elif c == split_char:
- olist.append('')
- else:
- olist[-1] += c
- return olist
-
-def _parse_strg_to_obj(strg, obj, parse_dict,
- field_sep=",", line_sep=";", intro_sep=":", esc_char="\\", debug=False):
- for line in _esplit(strg, line_sep, esc_char):
- line = line.strip()
- if not line:
- break
- split_line = _esplit(line, intro_sep, esc_char)
- if len(split_line) != 2:
- raise EasyXFCallerError('line %r should have exactly 1 "%c"' % (line, intro_sep))
- section, item_str = split_line
- section = section.strip().lower()
- for counter in range(2):
- result = parse_dict.get(section)
- if result is None:
- raise EasyXFCallerError('section %r is unknown' % section)
- if isinstance(result, dict):
- break
- if not isinstance(result, str):
- raise EasyXFAuthorError(
- 'section %r should map to dict or str object; found %r' % (section, type(result)))
- # synonym
- old_section = section
- section = result
- else:
- raise EasyXFAuthorError('Attempt to define synonym of synonym (%r: %r)' % (old_section, result))
- section_dict = result
- section_obj = getattr(obj, section, None)
- if section_obj is None:
- raise EasyXFAuthorError('instance of %s class has no attribute named %s' % (obj.__class__.__name__, section))
- for kv_str in _esplit(item_str, field_sep, esc_char):
- guff = kv_str.split()
- if not guff:
- continue
- k = guff[0].lower().replace('-', '_')
- v = ' '.join(guff[1:])
- if not v:
- raise EasyXFCallerError("no value supplied for %s.%s" % (section, k))
- for counter in range(2):
- result = section_dict.get(k)
- if result is None:
- raise EasyXFCallerError('%s.%s is not a known attribute' % (section, k))
- if not isinstance(result, str):
- break
- # synonym
- old_k = k
- k = result
- else:
- raise EasyXFAuthorError('Attempt to define synonym of synonym (%r: %r)' % (old_k, result))
- value_info = result
- if not isinstance(value_info, list):
- value_info = [value_info]
- for value_rule in value_info:
- if isinstance(value_rule, dict):
- # dict maps strings to integer field values
- vl = v.lower().replace('-', '_')
- if vl in value_rule:
- value = value_rule[vl]
- break
- elif isinstance(value_rule, collections.Callable):
- value = value_rule(v)
- if value is not None:
- break
- else:
- raise EasyXFAuthorError("unknown value rule for attribute %r: %r" % (k, value_rule))
- else:
- raise EasyXFCallerError("unexpected value %r for %s.%s" % (v, section, k))
- try:
- orig = getattr(section_obj, k)
- except AttributeError:
- raise EasyXFAuthorError('%s.%s in dictionary but not in supplied object' % (section, k))
- if debug: print("+++ %s.%s = %r # %s; was %r" % (section, k, value, v, orig))
- setattr(section_obj, k, value)
-
-def easyxf(strg_to_parse="", num_format_str=None,
- field_sep=",", line_sep=";", intro_sep=":", esc_char="\\", debug=False):
- xfobj = XFStyle()
- if num_format_str is not None:
- xfobj.num_format_str = num_format_str
- if strg_to_parse:
- _parse_strg_to_obj(strg_to_parse, xfobj, xf_dict,
- field_sep=field_sep, line_sep=line_sep, intro_sep=intro_sep, esc_char=esc_char, debug=debug)
- return xfobj
+# -*- coding: windows-1252 -*-
+
+import Formatting
+from BIFFRecords import *
+
+FIRST_USER_DEFINED_NUM_FORMAT_IDX = 164
+
+class XFStyle(object):
+
+ def __init__(self):
+ self.num_format_str = 'General'
+ self.font = Formatting.Font()
+ self.alignment = Formatting.Alignment()
+ self.borders = Formatting.Borders()
+ self.pattern = Formatting.Pattern()
+ self.protection = Formatting.Protection()
+
+default_style = XFStyle()
+
+class StyleCollection(object):
+ _std_num_fmt_list = [
+ 'general',
+ '0',
+ '0.00',
+ '#,##0',
+ '#,##0.00',
+ '"$"#,##0_);("$"#,##',
+ '"$"#,##0_);[Red]("$"#,##',
+ '"$"#,##0.00_);("$"#,##',
+ '"$"#,##0.00_);[Red]("$"#,##',
+ '0%',
+ '0.00%',
+ '0.00E+00',
+ '# ?/?',
+ '# ??/??',
+ 'M/D/YY',
+ 'D-MMM-YY',
+ 'D-MMM',
+ 'MMM-YY',
+ 'h:mm AM/PM',
+ 'h:mm:ss AM/PM',
+ 'h:mm',
+ 'h:mm:ss',
+ 'M/D/YY h:mm',
+ '_(#,##0_);(#,##0)',
+ '_(#,##0_);[Red](#,##0)',
+ '_(#,##0.00_);(#,##0.00)',
+ '_(#,##0.00_);[Red](#,##0.00)',
+ '_("$"* #,##0_);_("$"* (#,##0);_("$"* "-"_);_(@_)',
+ '_(* #,##0_);_(* (#,##0);_(* "-"_);_(@_)',
+ '_("$"* #,##0.00_);_("$"* (#,##0.00);_("$"* "-"??_);_(@_)',
+ '_(* #,##0.00_);_(* (#,##0.00);_(* "-"??_);_(@_)',
+ 'mm:ss',
+ '[h]:mm:ss',
+ 'mm:ss.0',
+ '##0.0E+0',
+ '@'
+ ]
+
+ def __init__(self, style_compression=0):
+ self.style_compression = style_compression
+ self.stats = [0, 0, 0, 0, 0, 0]
+ self._font_id2x = {}
+ self._font_x2id = {}
+ self._font_val2x = {}
+
+ for x in (0, 1, 2, 3, 5): # The font with index 4 is omitted in all BIFF versions
+ font = Formatting.Font()
+ search_key = font._search_key()
+ self._font_id2x[font] = x
+ self._font_x2id[x] = font
+ self._font_val2x[search_key] = x
+
+ self._xf_id2x = {}
+ self._xf_x2id = {}
+ self._xf_val2x = {}
+
+ self._num_formats = {}
+ for fmtidx, fmtstr in zip(range(0, 23), StyleCollection._std_num_fmt_list[0:23]):
+ self._num_formats[fmtstr] = fmtidx
+ for fmtidx, fmtstr in zip(range(37, 50), StyleCollection._std_num_fmt_list[23:]):
+ self._num_formats[fmtstr] = fmtidx
+
+ self.default_style = XFStyle()
+ self._default_xf = self._add_style(self.default_style)[0]
+
+ def add(self, style):
+ if style == None:
+ return 0x10
+ return self._add_style(style)[1]
+
+ def _add_style(self, style):
+ num_format_str = style.num_format_str
+ if num_format_str in self._num_formats:
+ num_format_idx = self._num_formats[num_format_str]
+ else:
+ num_format_idx = (
+ FIRST_USER_DEFINED_NUM_FORMAT_IDX
+ + len(self._num_formats)
+ - len(StyleCollection._std_num_fmt_list)
+ )
+ self._num_formats[num_format_str] = num_format_idx
+
+ font = style.font
+ if font in self._font_id2x:
+ font_idx = self._font_id2x[font]
+ self.stats[0] += 1
+ elif self.style_compression:
+ search_key = font._search_key()
+ font_idx = self._font_val2x.get(search_key)
+ if font_idx is not None:
+ self._font_id2x[font] = font_idx
+ self.stats[1] += 1
+ else:
+ font_idx = len(self._font_x2id) + 1 # Why plus 1? Font 4 is missing
+ self._font_id2x[font] = font_idx
+ self._font_val2x[search_key] = font_idx
+ self._font_x2id[font_idx] = font
+ self.stats[2] += 1
+ else:
+ font_idx = len(self._font_id2x) + 1
+ self._font_id2x[font] = font_idx
+ self.stats[2] += 1
+
+ gof = (style.alignment, style.borders, style.pattern, style.protection)
+ xf = (font_idx, num_format_idx) + gof
+ if xf in self._xf_id2x:
+ xf_index = self._xf_id2x[xf]
+ self.stats[3] += 1
+ elif self.style_compression == 2:
+ xf_key = (font_idx, num_format_idx) + tuple([obj._search_key() for obj in gof])
+ xf_index = self._xf_val2x.get(xf_key)
+ if xf_index is not None:
+ self._xf_id2x[xf] = xf_index
+ self.stats[4] += 1
+ else:
+ xf_index = 0x10 + len(self._xf_x2id)
+ self._xf_id2x[xf] = xf_index
+ self._xf_val2x[xf_key] = xf_index
+ self._xf_x2id[xf_index] = xf
+ self.stats[5] += 1
+ else:
+ xf_index = 0x10 + len(self._xf_id2x)
+ self._xf_id2x[xf] = xf_index
+ self.stats[5] += 1
+
+ if xf_index >= 0xFFF:
+ # 12 bits allowed, 0xFFF is a sentinel value
+ raise ValueError("More than 4094 XFs (styles)")
+
+ return xf, xf_index
+
+ def get_biff_data(self):
+ result = ''
+ result += self._all_fonts()
+ result += self._all_num_formats()
+ result += self._all_cell_styles()
+ result += self._all_styles()
+ return result
+
+ def _all_fonts(self):
+ result = ''
+ if self.style_compression:
+ alist = self._font_x2id.items()
+ else:
+ alist = [(x, o) for o, x in self._font_id2x.items()]
+ alist.sort()
+ for font_idx, font in alist:
+ result += font.get_biff_record().get()
+ return result
+
+ def _all_num_formats(self):
+ result = ''
+ alist = [
+ (v, k)
+ for k, v in self._num_formats.items()
+ if v >= FIRST_USER_DEFINED_NUM_FORMAT_IDX
+ ]
+ alist.sort()
+ for fmtidx, fmtstr in alist:
+ result += NumberFormatRecord(fmtidx, fmtstr).get()
+ return result
+
+ def _all_cell_styles(self):
+ result = ''
+ for i in range(0, 16):
+ result += XFRecord(self._default_xf, 'style').get()
+ if self.style_compression == 2:
+ alist = self._xf_x2id.items()
+ else:
+ alist = [(x, o) for o, x in self._xf_id2x.items()]
+ alist.sort()
+ for xf_idx, xf in alist:
+ result += XFRecord(xf).get()
+ return result
+
+ def _all_styles(self):
+ return StyleRecord().get()
+
+# easyxf and its supporting objects ###################################
+
+class EasyXFException(Exception):
+ pass
+
+class EasyXFCallerError(EasyXFException):
+ pass
+
+class EasyXFAuthorError(EasyXFException):
+ pass
+
+class IntULim(object):
+ # If astring represents a valid unsigned integer ('123', '0xabcd', etc)
+ # and it is <= limit, return the int value; otherwise return None.
+
+ def __init__(self, limit):
+ self.limit = limit
+
+ def __call__(self, astring):
+ try:
+ value = int(astring, 0)
+ except ValueError:
+ return None
+ if not 0 <= value <= self.limit:
+ return None
+ return value
+
+bool_map = {
+ # Text values for all Boolean attributes
+ '1': 1, 'yes': 1, 'true': 1, 'on': 1,
+ '0': 0, 'no': 0, 'false': 0, 'off': 0,
+ }
+
+border_line_map = {
+ # Text values for these borders attributes:
+ # left, right, top, bottom and diag
+ 'no_line': 0x00,
+ 'thin': 0x01,
+ 'medium': 0x02,
+ 'dashed': 0x03,
+ 'dotted': 0x04,
+ 'thick': 0x05,
+ 'double': 0x06,
+ 'hair': 0x07,
+ 'medium_dashed': 0x08,
+ 'thin_dash_dotted': 0x09,
+ 'medium_dash_dotted': 0x0a,
+ 'thin_dash_dot_dotted': 0x0b,
+ 'medium_dash_dot_dotted': 0x0c,
+ 'slanted_medium_dash_dotted': 0x0d,
+ }
+
+charset_map = {
+ # Text values for font.charset
+ 'ansi_latin': 0x00,
+ 'sys_default': 0x01,
+ 'symbol': 0x02,
+ 'apple_roman': 0x4d,
+ 'ansi_jap_shift_jis': 0x80,
+ 'ansi_kor_hangul': 0x81,
+ 'ansi_kor_johab': 0x82,
+ 'ansi_chinese_gbk': 0x86,
+ 'ansi_chinese_big5': 0x88,
+ 'ansi_greek': 0xa1,
+ 'ansi_turkish': 0xa2,
+ 'ansi_vietnamese': 0xa3,
+ 'ansi_hebrew': 0xb1,
+ 'ansi_arabic': 0xb2,
+ 'ansi_baltic': 0xba,
+ 'ansi_cyrillic': 0xcc,
+ 'ansi_thai': 0xde,
+ 'ansi_latin_ii': 0xee,
+ 'oem_latin_i': 0xff,
+ }
+
+
+# Text values for colour indices. "grey" is a synonym of "gray".
+# The names are those given by Microsoft Excel 2003 to the colours
+# in the default palette. There is no great correspondence with
+# any W3C name-to-RGB mapping.
+_colour_map_text = """\
+aqua 0x31
+black 0x08
+blue 0x0C
+blue_gray 0x36
+bright_green 0x0B
+brown 0x3C
+coral 0x1D
+cyan_ega 0x0F
+dark_blue 0x12
+dark_blue_ega 0x12
+dark_green 0x3A
+dark_green_ega 0x11
+dark_purple 0x1C
+dark_red 0x10
+dark_red_ega 0x10
+dark_teal 0x38
+dark_yellow 0x13
+gold 0x33
+gray_ega 0x17
+gray25 0x16
+gray40 0x37
+gray50 0x17
+gray80 0x3F
+green 0x11
+ice_blue 0x1F
+indigo 0x3E
+ivory 0x1A
+lavender 0x2E
+light_blue 0x30
+light_green 0x2A
+light_orange 0x34
+light_turquoise 0x29
+light_yellow 0x2B
+lime 0x32
+magenta_ega 0x0E
+ocean_blue 0x1E
+olive_ega 0x13
+olive_green 0x3B
+orange 0x35
+pale_blue 0x2C
+periwinkle 0x18
+pink 0x0E
+plum 0x3D
+purple_ega 0x14
+red 0x0A
+rose 0x2D
+sea_green 0x39
+silver_ega 0x16
+sky_blue 0x28
+tan 0x2F
+teal 0x15
+teal_ega 0x15
+turquoise 0x0F
+violet 0x14
+white 0x09
+yellow 0x0D"""
+
+colour_map = {}
+for _line in _colour_map_text.splitlines():
+ _name, _num = _line.split()
+ _num = int(_num, 0)
+ colour_map[_name] = _num
+ if 'gray' in _name:
+ colour_map[_name.replace('gray', 'grey')] = _num
+del _colour_map_text, _line, _name, _num
+
+
+pattern_map = {
+ # Text values for pattern.pattern
+ # xlwt/doc/pattern_examples.xls showcases all of these patterns.
+ 'no_fill': 0,
+ 'none': 0,
+ 'solid': 1,
+ 'solid_fill': 1,
+ 'solid_pattern': 1,
+ 'fine_dots': 2,
+ 'alt_bars': 3,
+ 'sparse_dots': 4,
+ 'thick_horz_bands': 5,
+ 'thick_vert_bands': 6,
+ 'thick_backward_diag': 7,
+ 'thick_forward_diag': 8,
+ 'big_spots': 9,
+ 'bricks': 10,
+ 'thin_horz_bands': 11,
+ 'thin_vert_bands': 12,
+ 'thin_backward_diag': 13,
+ 'thin_forward_diag': 14,
+ 'squares': 15,
+ 'diamonds': 16,
+ }
+
+def any_str_func(s):
+ return s.strip()
+
+def colour_index_func(s, maxval=0x7F):
+ try:
+ value = int(s, 0)
+ except ValueError:
+ return None
+ if not (0 <= value <= maxval):
+ return None
+ return value
+
+colour_index_func_7 = colour_index_func
+
+def colour_index_func_15(s):
+ return colour_index_func(s, maxval=0x7FFF)
+
+def rotation_func(s):
+ try:
+ value = int(s, 0)
+ except ValueError:
+ return None
+ if not (-90 <= value <= 90):
+ raise EasyXFCallerError("rotation %d: should be -90 to +90 degrees" % value)
+ if value < 0:
+ value = 90 - value # encode as 91 to 180 (clockwise)
+ return value
+
+xf_dict = {
+ 'align': 'alignment', # synonym
+ 'alignment': {
+ 'dire': {
+ 'general': 0,
+ 'lr': 1,
+ 'rl': 2,
+ },
+ 'direction': 'dire',
+ 'horiz': 'horz',
+ 'horizontal': 'horz',
+ 'horz': {
+ 'general': 0,
+ 'left': 1,
+ 'center': 2,
+ 'centre': 2, # "align: horiz centre" means xf.alignment.horz is set to 2
+ 'right': 3,
+ 'filled': 4,
+ 'justified': 5,
+ 'center_across_selection': 6,
+ 'centre_across_selection': 6,
+ 'distributed': 7,
+ },
+ 'inde': IntULim(15), # restriction: 0 <= value <= 15
+ 'indent': 'inde',
+ 'rota': [{'stacked': 255, 'none': 0, }, rotation_func],
+ 'rotation': 'rota',
+ 'shri': bool_map,
+ 'shrink': 'shri',
+ 'shrink_to_fit': 'shri',
+ 'vert': {
+ 'top': 0,
+ 'center': 1,
+ 'centre': 1,
+ 'bottom': 2,
+ 'justified': 3,
+ 'distributed': 4,
+ },
+ 'vertical': 'vert',
+ 'wrap': bool_map,
+ },
+ 'border': 'borders',
+ 'borders': {
+ 'left': [border_line_map, IntULim(0x0d)],
+ 'right': [border_line_map, IntULim(0x0d)],
+ 'top': [border_line_map, IntULim(0x0d)],
+ 'bottom': [border_line_map, IntULim(0x0d)],
+ 'diag': [border_line_map, IntULim(0x0d)],
+ 'top_colour': [colour_map, colour_index_func_7],
+ 'bottom_colour': [colour_map, colour_index_func_7],
+ 'left_colour': [colour_map, colour_index_func_7],
+ 'right_colour': [colour_map, colour_index_func_7],
+ 'diag_colour': [colour_map, colour_index_func_7],
+ 'top_color': 'top_colour',
+ 'bottom_color': 'bottom_colour',
+ 'left_color': 'left_colour',
+ 'right_color': 'right_colour',
+ 'diag_color': 'diag-colour',
+ 'need_diag_1': bool_map,
+ 'need_diag_2': bool_map,
+ },
+ 'font': {
+ 'bold': bool_map,
+ 'charset': charset_map,
+ 'color': 'colour_index',
+ 'color_index': 'colour_index',
+ 'colour': 'colour_index',
+ 'colour_index': [colour_map, colour_index_func_15],
+ 'escapement': {'none': 0, 'superscript': 1, 'subscript': 2},
+ 'family': {'none': 0, 'roman': 1, 'swiss': 2, 'modern': 3, 'script': 4, 'decorative': 5, },
+ 'height': IntULim(0xFFFF), # practical limits are much narrower e.g. 160 to 1440 (8pt to 72pt)
+ 'italic': bool_map,
+ 'name': any_str_func,
+ 'outline': bool_map,
+ 'shadow': bool_map,
+ 'struck_out': bool_map,
+ 'underline': [bool_map, {'none': 0, 'single': 1, 'single_acc': 0x21, 'double': 2, 'double_acc': 0x22, }],
+ },
+ 'pattern': {
+ 'back_color': 'pattern_back_colour',
+ 'back_colour': 'pattern_back_colour',
+ 'fore_color': 'pattern_fore_colour',
+ 'fore_colour': 'pattern_fore_colour',
+ 'pattern': [pattern_map, IntULim(16)],
+ 'pattern_back_color': 'pattern_back_colour',
+ 'pattern_back_colour': [colour_map, colour_index_func_7],
+ 'pattern_fore_color': 'pattern_fore_colour',
+ 'pattern_fore_colour': [colour_map, colour_index_func_7],
+ },
+ 'protection': {
+ 'cell_locked' : bool_map,
+ 'formula_hidden': bool_map,
+ },
+ }
+
+def _esplit(s, split_char, esc_char="\\"):
+ escaped = False
+ olist = ['']
+ for c in s:
+ if escaped:
+ olist[-1] += c
+ escaped = False
+ elif c == esc_char:
+ escaped = True
+ elif c == split_char:
+ olist.append('')
+ else:
+ olist[-1] += c
+ return olist
+
+def _parse_strg_to_obj(strg, obj, parse_dict,
+ field_sep=",", line_sep=";", intro_sep=":", esc_char="\\", debug=False):
+ for line in _esplit(strg, line_sep, esc_char):
+ line = line.strip()
+ if not line:
+ break
+ split_line = _esplit(line, intro_sep, esc_char)
+ if len(split_line) != 2:
+ raise EasyXFCallerError('line %r should have exactly 1 "%c"' % (line, intro_sep))
+ section, item_str = split_line
+ section = section.strip().lower()
+ for counter in range(2):
+ result = parse_dict.get(section)
+ if result is None:
+ raise EasyXFCallerError('section %r is unknown' % section)
+ if isinstance(result, dict):
+ break
+ if not isinstance(result, str):
+ raise EasyXFAuthorError(
+ 'section %r should map to dict or str object; found %r' % (section, type(result)))
+ # synonym
+ old_section = section
+ section = result
+ else:
+ raise EasyXFAuthorError('Attempt to define synonym of synonym (%r: %r)' % (old_section, result))
+ section_dict = result
+ section_obj = getattr(obj, section, None)
+ if section_obj is None:
+ raise EasyXFAuthorError('instance of %s class has no attribute named %s' % (obj.__class__.__name__, section))
+ for kv_str in _esplit(item_str, field_sep, esc_char):
+ guff = kv_str.split()
+ if not guff:
+ continue
+ k = guff[0].lower().replace('-', '_')
+ v = ' '.join(guff[1:])
+ if not v:
+ raise EasyXFCallerError("no value supplied for %s.%s" % (section, k))
+ for counter in xrange(2):
+ result = section_dict.get(k)
+ if result is None:
+ raise EasyXFCallerError('%s.%s is not a known attribute' % (section, k))
+ if not isinstance(result, basestring):
+ break
+ # synonym
+ old_k = k
+ k = result
+ else:
+ raise EasyXFAuthorError('Attempt to define synonym of synonym (%r: %r)' % (old_k, result))
+ value_info = result
+ if not isinstance(value_info, list):
+ value_info = [value_info]
+ for value_rule in value_info:
+ if isinstance(value_rule, dict):
+ # dict maps strings to integer field values
+ vl = v.lower().replace('-', '_')
+ if vl in value_rule:
+ value = value_rule[vl]
+ break
+ elif callable(value_rule):
+ value = value_rule(v)
+ if value is not None:
+ break
+ else:
+ raise EasyXFAuthorError("unknown value rule for attribute %r: %r" % (k, value_rule))
+ else:
+ raise EasyXFCallerError("unexpected value %r for %s.%s" % (v, section, k))
+ try:
+ orig = getattr(section_obj, k)
+ except AttributeError:
+ raise EasyXFAuthorError('%s.%s in dictionary but not in supplied object' % (section, k))
+ if debug: print "+++ %s.%s = %r # %s; was %r" % (section, k, value, v, orig)
+ setattr(section_obj, k, value)
+
+def easyxf(strg_to_parse="", num_format_str=None,
+ field_sep=",", line_sep=";", intro_sep=":", esc_char="\\", debug=False):
+ xfobj = XFStyle()
+ if num_format_str is not None:
+ xfobj.num_format_str = num_format_str
+ if strg_to_parse:
+ _parse_strg_to_obj(strg_to_parse, xfobj, xf_dict,
+ field_sep=field_sep, line_sep=line_sep, intro_sep=intro_sep, esc_char=esc_char, debug=debug)
+ return xfobj
diff --git a/tablib/packages/xlwt/UnicodeUtils.py b/tablib/packages/xlwt/UnicodeUtils.py
index ff1c2d2..630c259 100644
--- a/tablib/packages/xlwt/UnicodeUtils.py
+++ b/tablib/packages/xlwt/UnicodeUtils.py
@@ -1,81 +1,81 @@
-# -*- coding: utf-8 -*-
-
-'''
-From BIFF8 on, strings are always stored using UTF-16LE text encoding. The
-character array is a sequence of 16-bit values4. Additionally it is
-possible to use a compressed format, which omits the high bytes of all
-characters, if they are all zero.
-
-The following tables describe the standard format of the entire string, but
-in many records the strings differ from this format. This will be mentioned
-separately. It is possible (but not required) to store Rich-Text formatting
-information and Asian phonetic information inside a Unicode string. This
-results in four different ways to store a string. The character array
-is not zero-terminated.
-
-The string consists of the character count (as usual an 8-bit value or
-a 16-bit value), option flags, the character array and optional formatting
-information. If the string is empty, sometimes the option flags field will
-not occur. This is mentioned at the respective place.
-
-Offset Size Contents
-0 1 or 2 Length of the string (character count, ln)
-1 or 2 1 Option flags:
- Bit Mask Contents
- 0 01H Character compression (ccompr):
- 0 = Compressed (8-bit characters)
- 1 = Uncompressed (16-bit characters)
- 2 04H Asian phonetic settings (phonetic):
- 0 = Does not contain Asian phonetic settings
- 1 = Contains Asian phonetic settings
- 3 08H Rich-Text settings (richtext):
- 0 = Does not contain Rich-Text settings
- 1 = Contains Rich-Text settings
-[2 or 3] 2 (optional, only if richtext=1) Number of Rich-Text formatting runs (rt)
-[var.] 4 (optional, only if phonetic=1) Size of Asian phonetic settings block (in bytes, sz)
-var. ln or
- 2·ln Character array (8-bit characters or 16-bit characters, dependent on ccompr)
-[var.] 4·rt (optional, only if richtext=1) List of rt formatting runs
-[var.] sz (optional, only if phonetic=1) Asian Phonetic Settings Block
-'''
-
-
-from struct import pack
-
-def upack2(s, encoding='ascii'):
- # If not unicode, make it so.
- if isinstance(s, str):
- us = s
- else:
- us = str(s, encoding)
- # Limit is based on number of content characters
- # (not on number of bytes in packed result)
- len_us = len(us)
- if len_us > 65535:
- raise Exception('String longer than 65535 characters')
- try:
- encs = us.encode('latin1')
- # Success here means all chars are in U+0000 to U+00FF
- # inclusive, meaning that we can use "compressed format".
- flag = 0
- except UnicodeEncodeError:
- encs = us.encode('utf_16_le')
- flag = 1
- return pack('<HB', len_us, flag) + encs
-
-def upack1(s, encoding='ascii'):
- # Same as upack2(), but with a one-byte length field.
- if isinstance(s, str):
- us = s
- else:
- us = str(s, encoding)
- len_us = len(us)
- if len_us > 255:
- raise Exception('String longer than 255 characters')
- try:
- encs = us.encode('latin1')
- flag = 0
- except UnicodeEncodeError:
- encs = us.encode('utf_16_le')
- flag = 1
- return pack('<BB', len_us, flag) + encs
+# -*- coding: windows-1252 -*-
+
+'''
+From BIFF8 on, strings are always stored using UTF-16LE text encoding. The
+character array is a sequence of 16-bit values4. Additionally it is
+possible to use a compressed format, which omits the high bytes of all
+characters, if they are all zero.
+
+The following tables describe the standard format of the entire string, but
+in many records the strings differ from this format. This will be mentioned
+separately. It is possible (but not required) to store Rich-Text formatting
+information and Asian phonetic information inside a Unicode string. This
+results in four different ways to store a string. The character array
+is not zero-terminated.
+
+The string consists of the character count (as usual an 8-bit value or
+a 16-bit value), option flags, the character array and optional formatting
+information. If the string is empty, sometimes the option flags field will
+not occur. This is mentioned at the respective place.
+
+Offset Size Contents
+0 1 or 2 Length of the string (character count, ln)
+1 or 2 1 Option flags:
+ Bit Mask Contents
+ 0 01H Character compression (ccompr):
+ 0 = Compressed (8-bit characters)
+ 1 = Uncompressed (16-bit characters)
+ 2 04H Asian phonetic settings (phonetic):
+ 0 = Does not contain Asian phonetic settings
+ 1 = Contains Asian phonetic settings
+ 3 08H Rich-Text settings (richtext):
+ 0 = Does not contain Rich-Text settings
+ 1 = Contains Rich-Text settings
+[2 or 3] 2 (optional, only if richtext=1) Number of Rich-Text formatting runs (rt)
+[var.] 4 (optional, only if phonetic=1) Size of Asian phonetic settings block (in bytes, sz)
+var. ln or
+ 2·ln Character array (8-bit characters or 16-bit characters, dependent on ccompr)
+[var.] 4·rt (optional, only if richtext=1) List of rt formatting runs
+[var.] sz (optional, only if phonetic=1) Asian Phonetic Settings Block
+'''
+
+
+from struct import pack
+
+def upack2(s, encoding='ascii'):
+ # If not unicode, make it so.
+ if isinstance(s, unicode):
+ us = s
+ else:
+ us = unicode(s, encoding)
+ # Limit is based on number of content characters
+ # (not on number of bytes in packed result)
+ len_us = len(us)
+ if len_us > 65535:
+ raise Exception('String longer than 65535 characters')
+ try:
+ encs = us.encode('latin1')
+ # Success here means all chars are in U+0000 to U+00FF
+ # inclusive, meaning that we can use "compressed format".
+ flag = 0
+ except UnicodeEncodeError:
+ encs = us.encode('utf_16_le')
+ flag = 1
+ return pack('<HB', len_us, flag) + encs
+
+def upack1(s, encoding='ascii'):
+ # Same as upack2(), but with a one-byte length field.
+ if isinstance(s, unicode):
+ us = s
+ else:
+ us = unicode(s, encoding)
+ len_us = len(us)
+ if len_us > 255:
+ raise Exception('String longer than 255 characters')
+ try:
+ encs = us.encode('latin1')
+ flag = 0
+ except UnicodeEncodeError:
+ encs = us.encode('utf_16_le')
+ flag = 1
+ return pack('<BB', len_us, flag) + encs
diff --git a/tablib/packages/xlwt/Utils.py b/tablib/packages/xlwt/Utils.py
index 3509f03..19e8d21 100644
--- a/tablib/packages/xlwt/Utils.py
+++ b/tablib/packages/xlwt/Utils.py
@@ -1,196 +1,196 @@
-# pyXLWriter: A library for generating Excel Spreadsheets
-# Copyright (c) 2004 Evgeny Filatov <fufff@users.sourceforge.net>
-# Copyright (c) 2002-2004 John McNamara (Perl Spreadsheet::WriteExcel)
-#
-# This library is free software; you can redistribute it and/or modify it
-# under the terms of the GNU Lesser General Public License as published by
-# the Free Software Foundation; either version 2.1 of the License, or
-# (at your option) any later version.
-#
-# This library is distributed in the hope that it will be useful, but
-# WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser
-# General Public License for more details.
-#
-# You should have received a copy of the GNU Lesser General Public License
-# along with this library; if not, write to the Free Software Foundation,
-# Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
-#----------------------------------------------------------------------------
-# This module was written/ported from PERL Spreadsheet::WriteExcel module
-# The author of the PERL Spreadsheet::WriteExcel module is John McNamara
-# <jmcnamara@cpan.org>
-#----------------------------------------------------------------------------
-# See the README.txt distributed with pyXLWriter for more details.
-
-# Portions are (C) Roman V. Kiseliov, 2005
-
-
-# Utilities for work with reference to cells and with sheetnames
-
-
-__rev_id__ = """$Id: Utils.py 3844 2009-05-20 01:02:54Z sjmachin $"""
-
-import re
-from struct import pack
-from .ExcelMagic import MAX_ROW, MAX_COL
-
-
-_re_cell_ex = re.compile(r"(\$?)([A-I]?[A-Z])(\$?)(\d+)", re.IGNORECASE)
-_re_row_range = re.compile(r"\$?(\d+):\$?(\d+)")
-_re_col_range = re.compile(r"\$?([A-I]?[A-Z]):\$?([A-I]?[A-Z])", re.IGNORECASE)
-_re_cell_range = re.compile(r"\$?([A-I]?[A-Z]\$?\d+):\$?([A-I]?[A-Z]\$?\d+)", re.IGNORECASE)
-_re_cell_ref = re.compile(r"\$?([A-I]?[A-Z]\$?\d+)", re.IGNORECASE)
-
-
-def col_by_name(colname):
- """
- """
- col = 0
- pow = 1
- for i in range(len(colname)-1, -1, -1):
- ch = colname[i]
- col += (ord(ch) - ord('A') + 1) * pow
- pow *= 26
- return col - 1
-
-
-def cell_to_rowcol(cell):
- """Convert an Excel cell reference string in A1 notation
- to numeric row/col notation.
-
- Returns: row, col, row_abs, col_abs
-
- """
- m = _re_cell_ex.match(cell)
- if not m:
- raise Exception("Ill-formed single_cell reference: %s" % cell)
- col_abs, col, row_abs, row = m.groups()
- row_abs = bool(row_abs)
- col_abs = bool(col_abs)
- row = int(row) - 1
- col = col_by_name(col.upper())
- return row, col, row_abs, col_abs
-
-
-def cell_to_rowcol2(cell):
- """Convert an Excel cell reference string in A1 notation
- to numeric row/col notation.
-
- Returns: row, col
-
- """
- m = _re_cell_ex.match(cell)
- if not m:
- raise Exception("Error in cell format")
- col_abs, col, row_abs, row = m.groups()
- # Convert base26 column string to number
- # All your Base are belong to us.
- row = int(row) - 1
- col = col_by_name(col.upper())
- return row, col
-
-
-def rowcol_to_cell(row, col, row_abs=False, col_abs=False):
- """Convert numeric row/col notation to an Excel cell reference string in
- A1 notation.
-
- """
- assert 0 <= row < MAX_ROW # MAX_ROW counts from 1
- assert 0 <= col < MAX_COL # MAX_COL counts from 1
- d = col // 26
- m = col % 26
- chr1 = "" # Most significant character in AA1
- if row_abs:
- row_abs = '$'
- else:
- row_abs = ''
- if col_abs:
- col_abs = '$'
- else:
- col_abs = ''
- if d > 0:
- chr1 = chr(ord('A') + d - 1)
- chr2 = chr(ord('A') + m)
- # Zero index to 1-index
- return col_abs + chr1 + chr2 + row_abs + str(row + 1)
-
-def rowcol_pair_to_cellrange(row1, col1, row2, col2,
- row1_abs=False, col1_abs=False, row2_abs=False, col2_abs=False):
- """Convert two (row,column) pairs
- into a cell range string in A1:B2 notation.
-
- Returns: cell range string
- """
- assert row1 <= row2
- assert col1 <= col2
- return (
- rowcol_to_cell(row1, col1, row1_abs, col1_abs)
- + ":"
- + rowcol_to_cell(row2, col2, row2_abs, col2_abs)
- )
-
-def cellrange_to_rowcol_pair(cellrange):
- """Convert cell range string in A1 notation to numeric row/col
- pair.
-
- Returns: row1, col1, row2, col2
-
- """
- cellrange = cellrange.upper()
- # Convert a row range: '1:3'
- res = _re_row_range.match(cellrange)
- if res:
- row1 = int(res.group(1)) - 1
- col1 = 0
- row2 = int(res.group(2)) - 1
- col2 = -1
- return row1, col1, row2, col2
- # Convert a column range: 'A:A' or 'B:G'.
- # A range such as A:A is equivalent to A1:A16384, so add rows as required
- res = _re_col_range.match(cellrange)
- if res:
- col1 = col_by_name(res.group(1).upper())
- row1 = 0
- col2 = col_by_name(res.group(2).upper())
- row2 = -1
- return row1, col1, row2, col2
- # Convert a cell range: 'A1:B7'
- res = _re_cell_range.match(cellrange)
- if res:
- row1, col1 = cell_to_rowcol2(res.group(1))
- row2, col2 = cell_to_rowcol2(res.group(2))
- return row1, col1, row2, col2
- # Convert a cell reference: 'A1' or 'AD2000'
- res = _re_cell_ref.match(cellrange)
- if res:
- row1, col1 = cell_to_rowcol2(res.group(1))
- return row1, col1, row1, col1
- raise Exception("Unknown cell reference %s" % (cell))
-
-
-def cell_to_packed_rowcol(cell):
- """ pack row and column into the required 4 byte format """
- row, col, row_abs, col_abs = cell_to_rowcol(cell)
- if col >= MAX_COL:
- raise Exception("Column %s greater than IV in formula" % cell)
- if row >= MAX_ROW: # this for BIFF8. for BIFF7 available 2^14
- raise Exception("Row %s greater than %d in formula" % (cell, MAX_ROW))
- col |= int(not row_abs) << 15
- col |= int(not col_abs) << 14
- return row, col
-
-# === sheetname functions ===
-
-def valid_sheet_name(sheet_name):
- if sheet_name == "" or sheet_name[0] == "'" or len(sheet_name) > 31:
- return False
- for c in sheet_name:
- if c in "[]:\\?/*\x00":
- return False
- return True
-
-def quote_sheet_name(unquoted_sheet_name):
- if not valid_sheet_name(unquoted_sheet_name):
- raise Exception(
- 'attempt to quote an invalid worksheet name %r' % unquoted_sheet_name)
- return "'" + unquoted_sheet_name.replace("'", "''") + "'"
+# pyXLWriter: A library for generating Excel Spreadsheets
+# Copyright (c) 2004 Evgeny Filatov <fufff@users.sourceforge.net>
+# Copyright (c) 2002-2004 John McNamara (Perl Spreadsheet::WriteExcel)
+#
+# This library is free software; you can redistribute it and/or modify it
+# under the terms of the GNU Lesser General Public License as published by
+# the Free Software Foundation; either version 2.1 of the License, or
+# (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser
+# General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public License
+# along with this library; if not, write to the Free Software Foundation,
+# Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+#----------------------------------------------------------------------------
+# This module was written/ported from PERL Spreadsheet::WriteExcel module
+# The author of the PERL Spreadsheet::WriteExcel module is John McNamara
+# <jmcnamara@cpan.org>
+#----------------------------------------------------------------------------
+# See the README.txt distributed with pyXLWriter for more details.
+
+# Portions are (C) Roman V. Kiseliov, 2005
+
+
+# Utilities for work with reference to cells and with sheetnames
+
+
+__rev_id__ = """$Id: Utils.py 3844 2009-05-20 01:02:54Z sjmachin $"""
+
+import re
+from struct import pack
+from ExcelMagic import MAX_ROW, MAX_COL
+
+
+_re_cell_ex = re.compile(r"(\$?)([A-I]?[A-Z])(\$?)(\d+)", re.IGNORECASE)
+_re_row_range = re.compile(r"\$?(\d+):\$?(\d+)")
+_re_col_range = re.compile(r"\$?([A-I]?[A-Z]):\$?([A-I]?[A-Z])", re.IGNORECASE)
+_re_cell_range = re.compile(r"\$?([A-I]?[A-Z]\$?\d+):\$?([A-I]?[A-Z]\$?\d+)", re.IGNORECASE)
+_re_cell_ref = re.compile(r"\$?([A-I]?[A-Z]\$?\d+)", re.IGNORECASE)
+
+
+def col_by_name(colname):
+ """
+ """
+ col = 0
+ pow = 1
+ for i in xrange(len(colname)-1, -1, -1):
+ ch = colname[i]
+ col += (ord(ch) - ord('A') + 1) * pow
+ pow *= 26
+ return col - 1
+
+
+def cell_to_rowcol(cell):
+ """Convert an Excel cell reference string in A1 notation
+ to numeric row/col notation.
+
+ Returns: row, col, row_abs, col_abs
+
+ """
+ m = _re_cell_ex.match(cell)
+ if not m:
+ raise Exception("Ill-formed single_cell reference: %s" % cell)
+ col_abs, col, row_abs, row = m.groups()
+ row_abs = bool(row_abs)
+ col_abs = bool(col_abs)
+ row = int(row) - 1
+ col = col_by_name(col.upper())
+ return row, col, row_abs, col_abs
+
+
+def cell_to_rowcol2(cell):
+ """Convert an Excel cell reference string in A1 notation
+ to numeric row/col notation.
+
+ Returns: row, col
+
+ """
+ m = _re_cell_ex.match(cell)
+ if not m:
+ raise Exception("Error in cell format")
+ col_abs, col, row_abs, row = m.groups()
+ # Convert base26 column string to number
+ # All your Base are belong to us.
+ row = int(row) - 1
+ col = col_by_name(col.upper())
+ return row, col
+
+
+def rowcol_to_cell(row, col, row_abs=False, col_abs=False):
+ """Convert numeric row/col notation to an Excel cell reference string in
+ A1 notation.
+
+ """
+ assert 0 <= row < MAX_ROW # MAX_ROW counts from 1
+ assert 0 <= col < MAX_COL # MAX_COL counts from 1
+ d = col // 26
+ m = col % 26
+ chr1 = "" # Most significant character in AA1
+ if row_abs:
+ row_abs = '$'
+ else:
+ row_abs = ''
+ if col_abs:
+ col_abs = '$'
+ else:
+ col_abs = ''
+ if d > 0:
+ chr1 = chr(ord('A') + d - 1)
+ chr2 = chr(ord('A') + m)
+ # Zero index to 1-index
+ return col_abs + chr1 + chr2 + row_abs + str(row + 1)
+
+def rowcol_pair_to_cellrange(row1, col1, row2, col2,
+ row1_abs=False, col1_abs=False, row2_abs=False, col2_abs=False):
+ """Convert two (row,column) pairs
+ into a cell range string in A1:B2 notation.
+
+ Returns: cell range string
+ """
+ assert row1 <= row2
+ assert col1 <= col2
+ return (
+ rowcol_to_cell(row1, col1, row1_abs, col1_abs)
+ + ":"
+ + rowcol_to_cell(row2, col2, row2_abs, col2_abs)
+ )
+
+def cellrange_to_rowcol_pair(cellrange):
+ """Convert cell range string in A1 notation to numeric row/col
+ pair.
+
+ Returns: row1, col1, row2, col2
+
+ """
+ cellrange = cellrange.upper()
+ # Convert a row range: '1:3'
+ res = _re_row_range.match(cellrange)
+ if res:
+ row1 = int(res.group(1)) - 1
+ col1 = 0
+ row2 = int(res.group(2)) - 1
+ col2 = -1
+ return row1, col1, row2, col2
+ # Convert a column range: 'A:A' or 'B:G'.
+ # A range such as A:A is equivalent to A1:A16384, so add rows as required
+ res = _re_col_range.match(cellrange)
+ if res:
+ col1 = col_by_name(res.group(1).upper())
+ row1 = 0
+ col2 = col_by_name(res.group(2).upper())
+ row2 = -1
+ return row1, col1, row2, col2
+ # Convert a cell range: 'A1:B7'
+ res = _re_cell_range.match(cellrange)
+ if res:
+ row1, col1 = cell_to_rowcol2(res.group(1))
+ row2, col2 = cell_to_rowcol2(res.group(2))
+ return row1, col1, row2, col2
+ # Convert a cell reference: 'A1' or 'AD2000'
+ res = _re_cell_ref.match(cellrange)
+ if res:
+ row1, col1 = cell_to_rowcol2(res.group(1))
+ return row1, col1, row1, col1
+ raise Exception("Unknown cell reference %s" % (cell))
+
+
+def cell_to_packed_rowcol(cell):
+ """ pack row and column into the required 4 byte format """
+ row, col, row_abs, col_abs = cell_to_rowcol(cell)
+ if col >= MAX_COL:
+ raise Exception("Column %s greater than IV in formula" % cell)
+ if row >= MAX_ROW: # this for BIFF8. for BIFF7 available 2^14
+ raise Exception("Row %s greater than %d in formula" % (cell, MAX_ROW))
+ col |= int(not row_abs) << 15
+ col |= int(not col_abs) << 14
+ return row, col
+
+# === sheetname functions ===
+
+def valid_sheet_name(sheet_name):
+ if sheet_name == u"" or sheet_name[0] == u"'" or len(sheet_name) > 31:
+ return False
+ for c in sheet_name:
+ if c in u"[]:\\?/*\x00":
+ return False
+ return True
+
+def quote_sheet_name(unquoted_sheet_name):
+ if not valid_sheet_name(unquoted_sheet_name):
+ raise Exception(
+ 'attempt to quote an invalid worksheet name %r' % unquoted_sheet_name)
+ return u"'" + unquoted_sheet_name.replace(u"'", u"''") + u"'"
diff --git a/tablib/packages/xlwt/Workbook.py b/tablib/packages/xlwt/Workbook.py
index ba42e6b..b24282b 100644
--- a/tablib/packages/xlwt/Workbook.py
+++ b/tablib/packages/xlwt/Workbook.py
@@ -1,635 +1,636 @@
-'''
-Record Order in BIFF8
- Workbook Globals Substream
- BOF Type = workbook globals
- Interface Header
- MMS
- Interface End
- WRITEACCESS
- CODEPAGE
- DSF
- TABID
- FNGROUPCOUNT
- Workbook Protection Block
- WINDOWPROTECT
- PROTECT
- PASSWORD
- PROT4REV
- PROT4REVPASS
- BACKUP
- HIDEOBJ
- WINDOW1
- DATEMODE
- PRECISION
- REFRESHALL
- BOOKBOOL
- FONT +
- FORMAT *
- XF +
- STYLE +
- ? PALETTE
- USESELFS
-
- BOUNDSHEET +
-
- COUNTRY
- ? Link Table
- SST
- ExtSST
- EOF
-'''
-
-from . import BIFFRecords
-from . import Style
-
-class Workbook(object):
-
- #################################################################
- ## Constructor
- #################################################################
- def __init__(self, encoding='ascii', style_compression=0):
- self.encoding = encoding
- self.__owner = 'None'
- self.__country_code = None # 0x07 is Russia :-)
- self.__wnd_protect = 0
- self.__obj_protect = 0
- self.__protect = 0
- self.__backup_on_save = 0
- # for WINDOW1 record
- self.__hpos_twips = 0x01E0
- self.__vpos_twips = 0x005A
- self.__width_twips = 0x3FCF
- self.__height_twips = 0x2A4E
-
- self.__active_sheet = 0
- self.__first_tab_index = 0
- self.__selected_tabs = 0x01
- self.__tab_width_twips = 0x0258
-
- self.__wnd_hidden = 0
- self.__wnd_mini = 0
- self.__hscroll_visible = 1
- self.__vscroll_visible = 1
- self.__tabs_visible = 1
-
- self.__styles = Style.StyleCollection(style_compression)
-
- self.__dates_1904 = 0
- self.__use_cell_values = 1
-
- self.__sst = BIFFRecords.SharedStringTable(self.encoding)
-
- self.__worksheets = []
- self.__worksheet_idx_from_name = {}
- self.__sheet_refs = {}
- self._supbook_xref = {}
- self._xcall_xref = {}
- self._ownbook_supbookx = None
- self._ownbook_supbook_ref = None
- self._xcall_supbookx = None
- self._xcall_supbook_ref = None
-
-
-
- #################################################################
- ## Properties, "getters", "setters"
- #################################################################
-
- def get_style_stats(self):
- return self.__styles.stats[:]
-
- def set_owner(self, value):
- self.__owner = value
-
- def get_owner(self):
- return self.__owner
-
- owner = property(get_owner, set_owner)
-
- #################################################################
-
- def set_country_code(self, value):
- self.__country_code = value
-
- def get_country_code(self):
- return self.__country_code
-
- country_code = property(get_country_code, set_country_code)
-
- #################################################################
-
- def set_wnd_protect(self, value):
- self.__wnd_protect = int(value)
-
- def get_wnd_protect(self):
- return bool(self.__wnd_protect)
-
- wnd_protect = property(get_wnd_protect, set_wnd_protect)
-
- #################################################################
-
- def set_obj_protect(self, value):
- self.__obj_protect = int(value)
-
- def get_obj_protect(self):
- return bool(self.__obj_protect)
-
- obj_protect = property(get_obj_protect, set_obj_protect)
-
- #################################################################
-
- def set_protect(self, value):
- self.__protect = int(value)
-
- def get_protect(self):
- return bool(self.__protect)
-
- protect = property(get_protect, set_protect)
-
- #################################################################
-
- def set_backup_on_save(self, value):
- self.__backup_on_save = int(value)
-
- def get_backup_on_save(self):
- return bool(self.__backup_on_save)
-
- backup_on_save = property(get_backup_on_save, set_backup_on_save)
-
- #################################################################
-
- def set_hpos(self, value):
- self.__hpos_twips = value & 0xFFFF
-
- def get_hpos(self):
- return self.__hpos_twips
-
- hpos = property(get_hpos, set_hpos)
-
- #################################################################
-
- def set_vpos(self, value):
- self.__vpos_twips = value & 0xFFFF
-
- def get_vpos(self):
- return self.__vpos_twips
-
- vpos = property(get_vpos, set_vpos)
-
- #################################################################
-
- def set_width(self, value):
- self.__width_twips = value & 0xFFFF
-
- def get_width(self):
- return self.__width_twips
-
- width = property(get_width, set_width)
-
- #################################################################
-
- def set_height(self, value):
- self.__height_twips = value & 0xFFFF
-
- def get_height(self):
- return self.__height_twips
-
- height = property(get_height, set_height)
-
- #################################################################
-
- def set_active_sheet(self, value):
- self.__active_sheet = value & 0xFFFF
- self.__first_tab_index = self.__active_sheet
-
- def get_active_sheet(self):
- return self.__active_sheet
-
- active_sheet = property(get_active_sheet, set_active_sheet)
-
- #################################################################
-
- def set_tab_width(self, value):
- self.__tab_width_twips = value & 0xFFFF
-
- def get_tab_width(self):
- return self.__tab_width_twips
-
- tab_width = property(get_tab_width, set_tab_width)
-
- #################################################################
-
- def set_wnd_visible(self, value):
- self.__wnd_hidden = int(not value)
-
- def get_wnd_visible(self):
- return not bool(self.__wnd_hidden)
-
- wnd_visible = property(get_wnd_visible, set_wnd_visible)
-
- #################################################################
-
- def set_wnd_mini(self, value):
- self.__wnd_mini = int(value)
-
- def get_wnd_mini(self):
- return bool(self.__wnd_mini)
-
- wnd_mini = property(get_wnd_mini, set_wnd_mini)
-
- #################################################################
-
- def set_hscroll_visible(self, value):
- self.__hscroll_visible = int(value)
-
- def get_hscroll_visible(self):
- return bool(self.__hscroll_visible)
-
- hscroll_visible = property(get_hscroll_visible, set_hscroll_visible)
-
- #################################################################
-
- def set_vscroll_visible(self, value):
- self.__vscroll_visible = int(value)
-
- def get_vscroll_visible(self):
- return bool(self.__vscroll_visible)
-
- vscroll_visible = property(get_vscroll_visible, set_vscroll_visible)
-
- #################################################################
-
- def set_tabs_visible(self, value):
- self.__tabs_visible = int(value)
-
- def get_tabs_visible(self):
- return bool(self.__tabs_visible)
-
- tabs_visible = property(get_tabs_visible, set_tabs_visible)
-
- #################################################################
-
- def set_dates_1904(self, value):
- self.__dates_1904 = int(value)
-
- def get_dates_1904(self):
- return bool(self.__dates_1904)
-
- dates_1904 = property(get_dates_1904, set_dates_1904)
-
- #################################################################
-
- def set_use_cell_values(self, value):
- self.__use_cell_values = int(value)
-
- def get_use_cell_values(self):
- return bool(self.__use_cell_values)
-
- use_cell_values = property(get_use_cell_values, set_use_cell_values)
-
- #################################################################
-
- def get_default_style(self):
- return self.__styles.default_style
-
- default_style = property(get_default_style)
-
- ##################################################################
- ## Methods
- ##################################################################
-
- def add_style(self, style):
- return self.__styles.add(style)
-
- def add_str(self, s):
- return self.__sst.add_str(s)
-
- def del_str(self, sst_idx):
- self.__sst.del_str(sst_idx)
-
- def str_index(self, s):
- return self.__sst.str_index(s)
-
- def add_sheet(self, sheetname, cell_overwrite_ok=False):
- from . import Worksheet, Utils
- if not isinstance(sheetname, str):
- sheetname = sheetname.decode(self.encoding)
- if not Utils.valid_sheet_name(sheetname):
- raise Exception("invalid worksheet name %r" % sheetname)
- lower_name = sheetname.lower()
- if lower_name in self.__worksheet_idx_from_name:
- raise Exception("duplicate worksheet name %r" % sheetname)
- self.__worksheet_idx_from_name[lower_name] = len(self.__worksheets)
- self.__worksheets.append(Worksheet(sheetname, self, cell_overwrite_ok))
- return self.__worksheets[-1]
-
- def get_sheet(self, sheetnum):
- return self.__worksheets[sheetnum]
-
- def raise_bad_sheetname(self, sheetname):
- raise Exception("Formula: unknown sheet name %s" % sheetname)
-
- def convert_sheetindex(self, strg_ref, n_sheets):
- idx = int(strg_ref)
- if 0 <= idx < n_sheets:
- return idx
- msg = "Formula: sheet index (%s) >= number of sheets (%d)" % (strg_ref, n_sheets)
- raise Exception(msg)
-
- def _get_supbook_index(self, tag):
- if tag in self._supbook_xref:
- return self._supbook_xref[tag]
- self._supbook_xref[tag] = idx = len(self._supbook_xref)
- return idx
-
- def setup_ownbook(self):
- self._ownbook_supbookx = self._get_supbook_index(('ownbook', 0))
- self._ownbook_supbook_ref = None
- reference = (self._ownbook_supbookx, 0xFFFE, 0xFFFE)
- if reference in self.__sheet_refs:
- raise Exception("can't happen")
- self.__sheet_refs[reference] = self._ownbook_supbook_ref = len(self.__sheet_refs)
-
- def setup_xcall(self):
- self._xcall_supbookx = self._get_supbook_index(('xcall', 0))
- self._xcall_supbook_ref = None
- reference = (self._xcall_supbookx, 0xFFFE, 0xFFFE)
- if reference in self.__sheet_refs:
- raise Exception("can't happen")
- self.__sheet_refs[reference] = self._xcall_supbook_ref = len(self.__sheet_refs)
-
- def add_sheet_reference(self, formula):
- patches = []
- n_sheets = len(self.__worksheets)
- sheet_refs, xcall_refs = formula.get_references()
-
- for ref0, ref1, offset in sheet_refs:
- if not ref0.isdigit():
- try:
- ref0n = self.__worksheet_idx_from_name[ref0.lower()]
- except KeyError:
- self.raise_bad_sheetname(ref0)
- else:
- ref0n = self.convert_sheetindex(ref0, n_sheets)
- if ref1 == ref0:
- ref1n = ref0n
- elif not ref1.isdigit():
- try:
- ref1n = self.__worksheet_idx_from_name[ref1.lower()]
- except KeyError:
- self.raise_bad_sheetname(ref1)
- else:
- ref1n = self.convert_sheetindex(ref1, n_sheets)
- if ref1n < ref0n:
- msg = "Formula: sheets out of order; %r:%r -> (%d, %d)" \
- % (ref0, ref1, ref0n, ref1n)
- raise Exception(msg)
- if self._ownbook_supbookx is None:
- self.setup_ownbook()
- reference = (self._ownbook_supbookx, ref0n, ref1n)
- if reference in self.__sheet_refs:
- patches.append((offset, self.__sheet_refs[reference]))
- else:
- nrefs = len(self.__sheet_refs)
- if nrefs > 65535:
- raise Exception('More than 65536 inter-sheet references')
- self.__sheet_refs[reference] = nrefs
- patches.append((offset, nrefs))
-
- for funcname, offset in xcall_refs:
- if self._ownbook_supbookx is None:
- self.setup_ownbook()
- if self._xcall_supbookx is None:
- self.setup_xcall()
- # print funcname, self._supbook_xref
- patches.append((offset, self._xcall_supbook_ref))
- if not isinstance(funcname, str):
- funcname = funcname.decode(self.encoding)
- if funcname in self._xcall_xref:
- idx = self._xcall_xref[funcname]
- else:
- self._xcall_xref[funcname] = idx = len(self._xcall_xref)
- patches.append((offset + 2, idx + 1))
-
- formula.patch_references(patches)
-
- ##################################################################
- ## BIFF records generation
- ##################################################################
-
- def __bof_rec(self):
- return BIFFRecords.Biff8BOFRecord(BIFFRecords.Biff8BOFRecord.BOOK_GLOBAL).get()
-
- def __eof_rec(self):
- return BIFFRecords.EOFRecord().get()
-
- def __intf_hdr_rec(self):
- return BIFFRecords.InteraceHdrRecord().get()
-
- def __intf_end_rec(self):
- return BIFFRecords.InteraceEndRecord().get()
-
- def __intf_mms_rec(self):
- return BIFFRecords.MMSRecord().get()
-
- def __write_access_rec(self):
- return BIFFRecords.WriteAccessRecord(self.__owner).get()
-
- def __wnd_protect_rec(self):
- return BIFFRecords.WindowProtectRecord(self.__wnd_protect).get()
-
- def __obj_protect_rec(self):
- return BIFFRecords.ObjectProtectRecord(self.__obj_protect).get()
-
- def __protect_rec(self):
- return BIFFRecords.ProtectRecord(self.__protect).get()
-
- def __password_rec(self):
- return BIFFRecords.PasswordRecord().get()
-
- def __prot4rev_rec(self):
- return BIFFRecords.Prot4RevRecord().get()
-
- def __prot4rev_pass_rec(self):
- return BIFFRecords.Prot4RevPassRecord().get()
-
- def __backup_rec(self):
- return BIFFRecords.BackupRecord(self.__backup_on_save).get()
-
- def __hide_obj_rec(self):
- return BIFFRecords.HideObjRecord().get()
-
- def __window1_rec(self):
- flags = 0
- flags |= (self.__wnd_hidden) << 0
- flags |= (self.__wnd_mini) << 1
- flags |= (self.__hscroll_visible) << 3
- flags |= (self.__vscroll_visible) << 4
- flags |= (self.__tabs_visible) << 5
-
- return BIFFRecords.Window1Record(self.__hpos_twips, self.__vpos_twips,
- self.__width_twips, self.__height_twips,
- flags,
- self.__active_sheet, self.__first_tab_index,
- self.__selected_tabs, self.__tab_width_twips).get()
-
- def __codepage_rec(self):
- return BIFFRecords.CodepageBiff8Record().get()
-
- def __country_rec(self):
- if not self.__country_code:
- return b''
- return BIFFRecords.CountryRecord(self.__country_code, self.__country_code).get()
-
- def __dsf_rec(self):
- return BIFFRecords.DSFRecord().get()
-
- def __tabid_rec(self):
- return BIFFRecords.TabIDRecord(len(self.__worksheets)).get()
-
- def __fngroupcount_rec(self):
- return BIFFRecords.FnGroupCountRecord().get()
-
- def __datemode_rec(self):
- return BIFFRecords.DateModeRecord(self.__dates_1904).get()
-
- def __precision_rec(self):
- return BIFFRecords.PrecisionRecord(self.__use_cell_values).get()
-
- def __refresh_all_rec(self):
- return BIFFRecords.RefreshAllRecord().get()
-
- def __bookbool_rec(self):
- return BIFFRecords.BookBoolRecord().get()
-
- def __all_fonts_num_formats_xf_styles_rec(self):
- return self.__styles.get_biff_data()
-
- def __palette_rec(self):
- result = b''
- return result
-
- def __useselfs_rec(self):
- return BIFFRecords.UseSelfsRecord().get()
-
- def __boundsheets_rec(self, data_len_before, data_len_after, sheet_biff_lens):
- # .................................
- # BOUNDSEHEET0
- # BOUNDSEHEET1
- # BOUNDSEHEET2
- # ..................................
- # WORKSHEET0
- # WORKSHEET1
- # WORKSHEET2
- boundsheets_len = 0
- for sheet in self.__worksheets:
- boundsheets_len += len(BIFFRecords.BoundSheetRecord(
- 0x00, sheet.visibility, sheet.name, self.encoding
- ).get())
-
- start = data_len_before + boundsheets_len + data_len_after
-
- result = b''
- for sheet_biff_len, sheet in zip(sheet_biff_lens, self.__worksheets):
- result += BIFFRecords.BoundSheetRecord(
- start, sheet.visibility, sheet.name, self.encoding
- ).get()
- start += sheet_biff_len
- return result
-
- def __all_links_rec(self):
- pieces = []
- temp = [(idx, tag) for tag, idx in list(self._supbook_xref.items())]
- temp.sort()
- for idx, tag in temp:
- stype, snum = tag
- if stype == 'ownbook':
- rec = BIFFRecords.InternalReferenceSupBookRecord(len(self.__worksheets)).get()
- pieces.append(rec)
- elif stype == 'xcall':
- rec = BIFFRecords.XcallSupBookRecord().get()
- pieces.append(rec)
- temp = [(idx, name) for name, idx in list(self._xcall_xref.items())]
- temp.sort()
- for idx, name in temp:
- rec = BIFFRecords.ExternnameRecord(
- options=0, index=0, name=name, fmla='\x02\x00\x1c\x17').get()
- pieces.append(rec)
- else:
- raise Exception('unknown supbook stype %r' % stype)
- if len(self.__sheet_refs) > 0:
- # get references in index order
- temp = [(idx, ref) for ref, idx in list(self.__sheet_refs.items())]
- temp.sort()
- temp = [ref for idx, ref in temp]
- externsheet_record = BIFFRecords.ExternSheetRecord(temp).get()
- pieces.append(externsheet_record)
- return b''.join(pieces)
-
- def __sst_rec(self):
- return self.__sst.get_biff_record()
-
- def __ext_sst_rec(self, abs_stream_pos):
- return b''
- #return BIFFRecords.ExtSSTRecord(abs_stream_pos, self.sst_record.str_placement,
- #self.sst_record.portions_len).get()
-
- def get_biff_data(self):
- before = b''
- before += self.__bof_rec()
- before += self.__intf_hdr_rec()
- before += self.__intf_mms_rec()
- before += self.__intf_end_rec()
- before += self.__write_access_rec()
- before += self.__codepage_rec()
- before += self.__dsf_rec()
- before += self.__tabid_rec()
- before += self.__fngroupcount_rec()
- before += self.__wnd_protect_rec()
- before += self.__protect_rec()
- before += self.__obj_protect_rec()
- before += self.__password_rec()
- before += self.__prot4rev_rec()
- before += self.__prot4rev_pass_rec()
- before += self.__backup_rec()
- before += self.__hide_obj_rec()
- before += self.__window1_rec()
- before += self.__datemode_rec()
- before += self.__precision_rec()
- before += self.__refresh_all_rec()
- before += self.__bookbool_rec()
- before += self.__all_fonts_num_formats_xf_styles_rec()
- before += self.__palette_rec()
- before += self.__useselfs_rec()
-
- country = self.__country_rec()
- all_links = self.__all_links_rec()
-
- shared_str_table = self.__sst_rec()
- after = country + all_links + shared_str_table
-
- ext_sst = self.__ext_sst_rec(0) # need fake cause we need calc stream pos
- eof = self.__eof_rec()
-
- self.__worksheets[self.__active_sheet].selected = True
- sheets = b''
- sheet_biff_lens = []
- for sheet in self.__worksheets:
- data = sheet.get_biff_data()
- sheets += data
- sheet_biff_lens.append(len(data))
-
- bundlesheets = self.__boundsheets_rec(len(before), len(after)+len(ext_sst)+len(eof), sheet_biff_lens)
-
- sst_stream_pos = len(before) + len(bundlesheets) + len(country) + len(all_links)
- ext_sst = self.__ext_sst_rec(sst_stream_pos)
-
- return before + bundlesheets + after + ext_sst + eof + sheets
-
- def save(self, filename):
- from . import CompoundDoc
-
- doc = CompoundDoc.XlsDoc()
- doc.save(filename, self.get_biff_data())
-
-
+# -*- coding: windows-1252 -*-
+'''
+Record Order in BIFF8
+ Workbook Globals Substream
+ BOF Type = workbook globals
+ Interface Header
+ MMS
+ Interface End
+ WRITEACCESS
+ CODEPAGE
+ DSF
+ TABID
+ FNGROUPCOUNT
+ Workbook Protection Block
+ WINDOWPROTECT
+ PROTECT
+ PASSWORD
+ PROT4REV
+ PROT4REVPASS
+ BACKUP
+ HIDEOBJ
+ WINDOW1
+ DATEMODE
+ PRECISION
+ REFRESHALL
+ BOOKBOOL
+ FONT +
+ FORMAT *
+ XF +
+ STYLE +
+ ? PALETTE
+ USESELFS
+
+ BOUNDSHEET +
+
+ COUNTRY
+ ? Link Table
+ SST
+ ExtSST
+ EOF
+'''
+
+import BIFFRecords
+import Style
+
+class Workbook(object):
+
+ #################################################################
+ ## Constructor
+ #################################################################
+ def __init__(self, encoding='ascii', style_compression=0):
+ self.encoding = encoding
+ self.__owner = 'None'
+ self.__country_code = None # 0x07 is Russia :-)
+ self.__wnd_protect = 0
+ self.__obj_protect = 0
+ self.__protect = 0
+ self.__backup_on_save = 0
+ # for WINDOW1 record
+ self.__hpos_twips = 0x01E0
+ self.__vpos_twips = 0x005A
+ self.__width_twips = 0x3FCF
+ self.__height_twips = 0x2A4E
+
+ self.__active_sheet = 0
+ self.__first_tab_index = 0
+ self.__selected_tabs = 0x01
+ self.__tab_width_twips = 0x0258
+
+ self.__wnd_hidden = 0
+ self.__wnd_mini = 0
+ self.__hscroll_visible = 1
+ self.__vscroll_visible = 1
+ self.__tabs_visible = 1
+
+ self.__styles = Style.StyleCollection(style_compression)
+
+ self.__dates_1904 = 0
+ self.__use_cell_values = 1
+
+ self.__sst = BIFFRecords.SharedStringTable(self.encoding)
+
+ self.__worksheets = []
+ self.__worksheet_idx_from_name = {}
+ self.__sheet_refs = {}
+ self._supbook_xref = {}
+ self._xcall_xref = {}
+ self._ownbook_supbookx = None
+ self._ownbook_supbook_ref = None
+ self._xcall_supbookx = None
+ self._xcall_supbook_ref = None
+
+
+
+ #################################################################
+ ## Properties, "getters", "setters"
+ #################################################################
+
+ def get_style_stats(self):
+ return self.__styles.stats[:]
+
+ def set_owner(self, value):
+ self.__owner = value
+
+ def get_owner(self):
+ return self.__owner
+
+ owner = property(get_owner, set_owner)
+
+ #################################################################
+
+ def set_country_code(self, value):
+ self.__country_code = value
+
+ def get_country_code(self):
+ return self.__country_code
+
+ country_code = property(get_country_code, set_country_code)
+
+ #################################################################
+
+ def set_wnd_protect(self, value):
+ self.__wnd_protect = int(value)
+
+ def get_wnd_protect(self):
+ return bool(self.__wnd_protect)
+
+ wnd_protect = property(get_wnd_protect, set_wnd_protect)
+
+ #################################################################
+
+ def set_obj_protect(self, value):
+ self.__obj_protect = int(value)
+
+ def get_obj_protect(self):
+ return bool(self.__obj_protect)
+
+ obj_protect = property(get_obj_protect, set_obj_protect)
+
+ #################################################################
+
+ def set_protect(self, value):
+ self.__protect = int(value)
+
+ def get_protect(self):
+ return bool(self.__protect)
+
+ protect = property(get_protect, set_protect)
+
+ #################################################################
+
+ def set_backup_on_save(self, value):
+ self.__backup_on_save = int(value)
+
+ def get_backup_on_save(self):
+ return bool(self.__backup_on_save)
+
+ backup_on_save = property(get_backup_on_save, set_backup_on_save)
+
+ #################################################################
+
+ def set_hpos(self, value):
+ self.__hpos_twips = value & 0xFFFF
+
+ def get_hpos(self):
+ return self.__hpos_twips
+
+ hpos = property(get_hpos, set_hpos)
+
+ #################################################################
+
+ def set_vpos(self, value):
+ self.__vpos_twips = value & 0xFFFF
+
+ def get_vpos(self):
+ return self.__vpos_twips
+
+ vpos = property(get_vpos, set_vpos)
+
+ #################################################################
+
+ def set_width(self, value):
+ self.__width_twips = value & 0xFFFF
+
+ def get_width(self):
+ return self.__width_twips
+
+ width = property(get_width, set_width)
+
+ #################################################################
+
+ def set_height(self, value):
+ self.__height_twips = value & 0xFFFF
+
+ def get_height(self):
+ return self.__height_twips
+
+ height = property(get_height, set_height)
+
+ #################################################################
+
+ def set_active_sheet(self, value):
+ self.__active_sheet = value & 0xFFFF
+ self.__first_tab_index = self.__active_sheet
+
+ def get_active_sheet(self):
+ return self.__active_sheet
+
+ active_sheet = property(get_active_sheet, set_active_sheet)
+
+ #################################################################
+
+ def set_tab_width(self, value):
+ self.__tab_width_twips = value & 0xFFFF
+
+ def get_tab_width(self):
+ return self.__tab_width_twips
+
+ tab_width = property(get_tab_width, set_tab_width)
+
+ #################################################################
+
+ def set_wnd_visible(self, value):
+ self.__wnd_hidden = int(not value)
+
+ def get_wnd_visible(self):
+ return not bool(self.__wnd_hidden)
+
+ wnd_visible = property(get_wnd_visible, set_wnd_visible)
+
+ #################################################################
+
+ def set_wnd_mini(self, value):
+ self.__wnd_mini = int(value)
+
+ def get_wnd_mini(self):
+ return bool(self.__wnd_mini)
+
+ wnd_mini = property(get_wnd_mini, set_wnd_mini)
+
+ #################################################################
+
+ def set_hscroll_visible(self, value):
+ self.__hscroll_visible = int(value)
+
+ def get_hscroll_visible(self):
+ return bool(self.__hscroll_visible)
+
+ hscroll_visible = property(get_hscroll_visible, set_hscroll_visible)
+
+ #################################################################
+
+ def set_vscroll_visible(self, value):
+ self.__vscroll_visible = int(value)
+
+ def get_vscroll_visible(self):
+ return bool(self.__vscroll_visible)
+
+ vscroll_visible = property(get_vscroll_visible, set_vscroll_visible)
+
+ #################################################################
+
+ def set_tabs_visible(self, value):
+ self.__tabs_visible = int(value)
+
+ def get_tabs_visible(self):
+ return bool(self.__tabs_visible)
+
+ tabs_visible = property(get_tabs_visible, set_tabs_visible)
+
+ #################################################################
+
+ def set_dates_1904(self, value):
+ self.__dates_1904 = int(value)
+
+ def get_dates_1904(self):
+ return bool(self.__dates_1904)
+
+ dates_1904 = property(get_dates_1904, set_dates_1904)
+
+ #################################################################
+
+ def set_use_cell_values(self, value):
+ self.__use_cell_values = int(value)
+
+ def get_use_cell_values(self):
+ return bool(self.__use_cell_values)
+
+ use_cell_values = property(get_use_cell_values, set_use_cell_values)
+
+ #################################################################
+
+ def get_default_style(self):
+ return self.__styles.default_style
+
+ default_style = property(get_default_style)
+
+ ##################################################################
+ ## Methods
+ ##################################################################
+
+ def add_style(self, style):
+ return self.__styles.add(style)
+
+ def add_str(self, s):
+ return self.__sst.add_str(s)
+
+ def del_str(self, sst_idx):
+ self.__sst.del_str(sst_idx)
+
+ def str_index(self, s):
+ return self.__sst.str_index(s)
+
+ def add_sheet(self, sheetname, cell_overwrite_ok=False):
+ import Worksheet, Utils
+ if not isinstance(sheetname, unicode):
+ sheetname = sheetname.decode(self.encoding)
+ if not Utils.valid_sheet_name(sheetname):
+ raise Exception("invalid worksheet name %r" % sheetname)
+ lower_name = sheetname.lower()
+ if lower_name in self.__worksheet_idx_from_name:
+ raise Exception("duplicate worksheet name %r" % sheetname)
+ self.__worksheet_idx_from_name[lower_name] = len(self.__worksheets)
+ self.__worksheets.append(Worksheet.Worksheet(sheetname, self, cell_overwrite_ok))
+ return self.__worksheets[-1]
+
+ def get_sheet(self, sheetnum):
+ return self.__worksheets[sheetnum]
+
+ def raise_bad_sheetname(self, sheetname):
+ raise Exception("Formula: unknown sheet name %s" % sheetname)
+
+ def convert_sheetindex(self, strg_ref, n_sheets):
+ idx = int(strg_ref)
+ if 0 <= idx < n_sheets:
+ return idx
+ msg = "Formula: sheet index (%s) >= number of sheets (%d)" % (strg_ref, n_sheets)
+ raise Exception(msg)
+
+ def _get_supbook_index(self, tag):
+ if tag in self._supbook_xref:
+ return self._supbook_xref[tag]
+ self._supbook_xref[tag] = idx = len(self._supbook_xref)
+ return idx
+
+ def setup_ownbook(self):
+ self._ownbook_supbookx = self._get_supbook_index(('ownbook', 0))
+ self._ownbook_supbook_ref = None
+ reference = (self._ownbook_supbookx, 0xFFFE, 0xFFFE)
+ if reference in self.__sheet_refs:
+ raise Exception("can't happen")
+ self.__sheet_refs[reference] = self._ownbook_supbook_ref = len(self.__sheet_refs)
+
+ def setup_xcall(self):
+ self._xcall_supbookx = self._get_supbook_index(('xcall', 0))
+ self._xcall_supbook_ref = None
+ reference = (self._xcall_supbookx, 0xFFFE, 0xFFFE)
+ if reference in self.__sheet_refs:
+ raise Exception("can't happen")
+ self.__sheet_refs[reference] = self._xcall_supbook_ref = len(self.__sheet_refs)
+
+ def add_sheet_reference(self, formula):
+ patches = []
+ n_sheets = len(self.__worksheets)
+ sheet_refs, xcall_refs = formula.get_references()
+
+ for ref0, ref1, offset in sheet_refs:
+ if not ref0.isdigit():
+ try:
+ ref0n = self.__worksheet_idx_from_name[ref0.lower()]
+ except KeyError:
+ self.raise_bad_sheetname(ref0)
+ else:
+ ref0n = self.convert_sheetindex(ref0, n_sheets)
+ if ref1 == ref0:
+ ref1n = ref0n
+ elif not ref1.isdigit():
+ try:
+ ref1n = self.__worksheet_idx_from_name[ref1.lower()]
+ except KeyError:
+ self.raise_bad_sheetname(ref1)
+ else:
+ ref1n = self.convert_sheetindex(ref1, n_sheets)
+ if ref1n < ref0n:
+ msg = "Formula: sheets out of order; %r:%r -> (%d, %d)" \
+ % (ref0, ref1, ref0n, ref1n)
+ raise Exception(msg)
+ if self._ownbook_supbookx is None:
+ self.setup_ownbook()
+ reference = (self._ownbook_supbookx, ref0n, ref1n)
+ if reference in self.__sheet_refs:
+ patches.append((offset, self.__sheet_refs[reference]))
+ else:
+ nrefs = len(self.__sheet_refs)
+ if nrefs > 65535:
+ raise Exception('More than 65536 inter-sheet references')
+ self.__sheet_refs[reference] = nrefs
+ patches.append((offset, nrefs))
+
+ for funcname, offset in xcall_refs:
+ if self._ownbook_supbookx is None:
+ self.setup_ownbook()
+ if self._xcall_supbookx is None:
+ self.setup_xcall()
+ # print funcname, self._supbook_xref
+ patches.append((offset, self._xcall_supbook_ref))
+ if not isinstance(funcname, unicode):
+ funcname = funcname.decode(self.encoding)
+ if funcname in self._xcall_xref:
+ idx = self._xcall_xref[funcname]
+ else:
+ self._xcall_xref[funcname] = idx = len(self._xcall_xref)
+ patches.append((offset + 2, idx + 1))
+
+ formula.patch_references(patches)
+
+ ##################################################################
+ ## BIFF records generation
+ ##################################################################
+
+ def __bof_rec(self):
+ return BIFFRecords.Biff8BOFRecord(BIFFRecords.Biff8BOFRecord.BOOK_GLOBAL).get()
+
+ def __eof_rec(self):
+ return BIFFRecords.EOFRecord().get()
+
+ def __intf_hdr_rec(self):
+ return BIFFRecords.InteraceHdrRecord().get()
+
+ def __intf_end_rec(self):
+ return BIFFRecords.InteraceEndRecord().get()
+
+ def __intf_mms_rec(self):
+ return BIFFRecords.MMSRecord().get()
+
+ def __write_access_rec(self):
+ return BIFFRecords.WriteAccessRecord(self.__owner).get()
+
+ def __wnd_protect_rec(self):
+ return BIFFRecords.WindowProtectRecord(self.__wnd_protect).get()
+
+ def __obj_protect_rec(self):
+ return BIFFRecords.ObjectProtectRecord(self.__obj_protect).get()
+
+ def __protect_rec(self):
+ return BIFFRecords.ProtectRecord(self.__protect).get()
+
+ def __password_rec(self):
+ return BIFFRecords.PasswordRecord().get()
+
+ def __prot4rev_rec(self):
+ return BIFFRecords.Prot4RevRecord().get()
+
+ def __prot4rev_pass_rec(self):
+ return BIFFRecords.Prot4RevPassRecord().get()
+
+ def __backup_rec(self):
+ return BIFFRecords.BackupRecord(self.__backup_on_save).get()
+
+ def __hide_obj_rec(self):
+ return BIFFRecords.HideObjRecord().get()
+
+ def __window1_rec(self):
+ flags = 0
+ flags |= (self.__wnd_hidden) << 0
+ flags |= (self.__wnd_mini) << 1
+ flags |= (self.__hscroll_visible) << 3
+ flags |= (self.__vscroll_visible) << 4
+ flags |= (self.__tabs_visible) << 5
+
+ return BIFFRecords.Window1Record(self.__hpos_twips, self.__vpos_twips,
+ self.__width_twips, self.__height_twips,
+ flags,
+ self.__active_sheet, self.__first_tab_index,
+ self.__selected_tabs, self.__tab_width_twips).get()
+
+ def __codepage_rec(self):
+ return BIFFRecords.CodepageBiff8Record().get()
+
+ def __country_rec(self):
+ if not self.__country_code:
+ return ''
+ return BIFFRecords.CountryRecord(self.__country_code, self.__country_code).get()
+
+ def __dsf_rec(self):
+ return BIFFRecords.DSFRecord().get()
+
+ def __tabid_rec(self):
+ return BIFFRecords.TabIDRecord(len(self.__worksheets)).get()
+
+ def __fngroupcount_rec(self):
+ return BIFFRecords.FnGroupCountRecord().get()
+
+ def __datemode_rec(self):
+ return BIFFRecords.DateModeRecord(self.__dates_1904).get()
+
+ def __precision_rec(self):
+ return BIFFRecords.PrecisionRecord(self.__use_cell_values).get()
+
+ def __refresh_all_rec(self):
+ return BIFFRecords.RefreshAllRecord().get()
+
+ def __bookbool_rec(self):
+ return BIFFRecords.BookBoolRecord().get()
+
+ def __all_fonts_num_formats_xf_styles_rec(self):
+ return self.__styles.get_biff_data()
+
+ def __palette_rec(self):
+ result = ''
+ return result
+
+ def __useselfs_rec(self):
+ return BIFFRecords.UseSelfsRecord().get()
+
+ def __boundsheets_rec(self, data_len_before, data_len_after, sheet_biff_lens):
+ # .................................
+ # BOUNDSEHEET0
+ # BOUNDSEHEET1
+ # BOUNDSEHEET2
+ # ..................................
+ # WORKSHEET0
+ # WORKSHEET1
+ # WORKSHEET2
+ boundsheets_len = 0
+ for sheet in self.__worksheets:
+ boundsheets_len += len(BIFFRecords.BoundSheetRecord(
+ 0x00L, sheet.visibility, sheet.name, self.encoding
+ ).get())
+
+ start = data_len_before + boundsheets_len + data_len_after
+
+ result = ''
+ for sheet_biff_len, sheet in zip(sheet_biff_lens, self.__worksheets):
+ result += BIFFRecords.BoundSheetRecord(
+ start, sheet.visibility, sheet.name, self.encoding
+ ).get()
+ start += sheet_biff_len
+ return result
+
+ def __all_links_rec(self):
+ pieces = []
+ temp = [(idx, tag) for tag, idx in self._supbook_xref.items()]
+ temp.sort()
+ for idx, tag in temp:
+ stype, snum = tag
+ if stype == 'ownbook':
+ rec = BIFFRecords.InternalReferenceSupBookRecord(len(self.__worksheets)).get()
+ pieces.append(rec)
+ elif stype == 'xcall':
+ rec = BIFFRecords.XcallSupBookRecord().get()
+ pieces.append(rec)
+ temp = [(idx, name) for name, idx in self._xcall_xref.items()]
+ temp.sort()
+ for idx, name in temp:
+ rec = BIFFRecords.ExternnameRecord(
+ options=0, index=0, name=name, fmla='\x02\x00\x1c\x17').get()
+ pieces.append(rec)
+ else:
+ raise Exception('unknown supbook stype %r' % stype)
+ if len(self.__sheet_refs) > 0:
+ # get references in index order
+ temp = [(idx, ref) for ref, idx in self.__sheet_refs.items()]
+ temp.sort()
+ temp = [ref for idx, ref in temp]
+ externsheet_record = BIFFRecords.ExternSheetRecord(temp).get()
+ pieces.append(externsheet_record)
+ return ''.join(pieces)
+
+ def __sst_rec(self):
+ return self.__sst.get_biff_record()
+
+ def __ext_sst_rec(self, abs_stream_pos):
+ return ''
+ #return BIFFRecords.ExtSSTRecord(abs_stream_pos, self.sst_record.str_placement,
+ #self.sst_record.portions_len).get()
+
+ def get_biff_data(self):
+ before = ''
+ before += self.__bof_rec()
+ before += self.__intf_hdr_rec()
+ before += self.__intf_mms_rec()
+ before += self.__intf_end_rec()
+ before += self.__write_access_rec()
+ before += self.__codepage_rec()
+ before += self.__dsf_rec()
+ before += self.__tabid_rec()
+ before += self.__fngroupcount_rec()
+ before += self.__wnd_protect_rec()
+ before += self.__protect_rec()
+ before += self.__obj_protect_rec()
+ before += self.__password_rec()
+ before += self.__prot4rev_rec()
+ before += self.__prot4rev_pass_rec()
+ before += self.__backup_rec()
+ before += self.__hide_obj_rec()
+ before += self.__window1_rec()
+ before += self.__datemode_rec()
+ before += self.__precision_rec()
+ before += self.__refresh_all_rec()
+ before += self.__bookbool_rec()
+ before += self.__all_fonts_num_formats_xf_styles_rec()
+ before += self.__palette_rec()
+ before += self.__useselfs_rec()
+
+ country = self.__country_rec()
+ all_links = self.__all_links_rec()
+
+ shared_str_table = self.__sst_rec()
+ after = country + all_links + shared_str_table
+
+ ext_sst = self.__ext_sst_rec(0) # need fake cause we need calc stream pos
+ eof = self.__eof_rec()
+
+ self.__worksheets[self.__active_sheet].selected = True
+ sheets = ''
+ sheet_biff_lens = []
+ for sheet in self.__worksheets:
+ data = sheet.get_biff_data()
+ sheets += data
+ sheet_biff_lens.append(len(data))
+
+ bundlesheets = self.__boundsheets_rec(len(before), len(after)+len(ext_sst)+len(eof), sheet_biff_lens)
+
+ sst_stream_pos = len(before) + len(bundlesheets) + len(country) + len(all_links)
+ ext_sst = self.__ext_sst_rec(sst_stream_pos)
+
+ return before + bundlesheets + after + ext_sst + eof + sheets
+
+ def save(self, filename):
+ import CompoundDoc
+
+ doc = CompoundDoc.XlsDoc()
+ doc.save(filename, self.get_biff_data())
+
+
diff --git a/tablib/packages/xlwt/Worksheet.py b/tablib/packages/xlwt/Worksheet.py
index f358dd6..ff36f1d 100644
--- a/tablib/packages/xlwt/Worksheet.py
+++ b/tablib/packages/xlwt/Worksheet.py
@@ -1,1296 +1,1297 @@
-'''
- BOF
- UNCALCED
- INDEX
- Calculation Settings Block
- PRINTHEADERS
- PRINTGRIDLINES
- GRIDSET
- GUTS
- DEFAULTROWHEIGHT
- WSBOOL
- Page Settings Block
- Worksheet Protection Block
- DEFCOLWIDTH
- COLINFO
- SORT
- DIMENSIONS
- Row Blocks
- WINDOW2
- SCL
- PANE
- SELECTION
- STANDARDWIDTH
- MERGEDCELLS
- LABELRANGES
- PHONETIC
- Conditional Formatting Table
- Hyperlink Table
- Data Validity Table
- SHEETLAYOUT (BIFF8X only)
- SHEETPROTECTION (BIFF8X only)
- RANGEPROTECTION (BIFF8X only)
- EOF
-'''
-
-from . import BIFFRecords
-from . import Bitmap
-from . import Formatting
-from . import Style
-import tempfile
-
-
-class Worksheet(object):
- from .Workbook import Workbook
-
- #################################################################
- ## Constructor
- #################################################################
- def __init__(self, sheetname, parent_book, cell_overwrite_ok=False):
- from . import Row
- self.Row = Row #(to_py3): Row.Row -> Row
-
- from . import Column
- self.Column = Column #(to_py3): Column.Column -> Column
-
- self.__name = sheetname
- self.__parent = parent_book
- self._cell_overwrite_ok = cell_overwrite_ok
-
- self.__rows = {}
- self.__cols = {}
- self.__merged_ranges = []
- self.__bmp_rec = b''
-
- self.__show_formulas = 0
- self.__show_grid = 1
- self.__show_headers = 1
- self.__panes_frozen = 0
- ### self.__show_empty_as_zero = 1 ### deprecated with extreme prejudice 2009-05-19
- self.show_zero_values = 1
- self.__auto_colour_grid = 1
- self.__cols_right_to_left = 0
- self.__show_outline = 1
- self.__remove_splits = 0
- self.__selected = 0
- # RED HERRING ALERT: "sheet_visible" is a clone of the "selected" attribute.
- # Typically a workbook created by the Excel UI will have one sheet
- # (the sheet that was selected when the user saved it)
- # with both bits set to 1, and all other sheets will have both
- # bits set to 0. The true visibility of the sheet is found in the "visibility"
- # attribute obtained from the BOUNDSHEET record.
- self.__sheet_visible = 0
- self.__page_preview = 0
-
- self.__first_visible_row = 0
- self.__first_visible_col = 0
- self.__grid_colour = 0x40
- self.__preview_magn = 60 # percent
- self.__normal_magn = 100 # percent
-
- self.visibility = 0 # from/to BOUNDSHEET record.
-
- self.__vert_split_pos = None
- self.__horz_split_pos = None
- self.__vert_split_first_visible = None
- self.__horz_split_first_visible = None
- self.__split_active_pane = None
-
- self.__row_gut_width = 0
- self.__col_gut_height = 0
-
- self.__show_auto_page_breaks = 1
- self.__dialogue_sheet = 0
- self.__auto_style_outline = 0
- self.__outline_below = 0
- self.__outline_right = 0
- self.__fit_num_pages = 0
- self.__show_row_outline = 1
- self.__show_col_outline = 1
- self.__alt_expr_eval = 0
- self.__alt_formula_entries = 0
-
- self.__row_default_height = 0x00FF
- self.row_default_height_mismatch = 0
- self.row_default_hidden = 0
- self.row_default_space_above = 0
- self.row_default_space_below = 0
-
- self.__col_default_width = 0x0008
-
- self.__calc_mode = 1
- self.__calc_count = 0x0064
- self.__RC_ref_mode = 1
- self.__iterations_on = 0
- self.__delta = 0.001
- self.__save_recalc = 0
-
- self.__print_headers = 0
- self.__print_grid = 0
- self.__grid_set = 1
- self.__vert_page_breaks = []
- self.__horz_page_breaks = []
- self.__header_str = '&P'
- self.__footer_str = '&F'
- self.__print_centered_vert = 0
- self.__print_centered_horz = 1
- self.__left_margin = 0.3 #0.5
- self.__right_margin = 0.3 #0.5
- self.__top_margin = 0.61 #1.0
- self.__bottom_margin = 0.37 #1.0
- self.__paper_size_code = 9 # A4
- self.__print_scaling = 100
- self.__start_page_number = 1
- self.__fit_width_to_pages = 1
- self.__fit_height_to_pages = 1
- self.__print_in_rows = 1
- self.__portrait = 1
- self.__print_not_colour = 0
- self.__print_draft = 0
- self.__print_notes = 0
- self.__print_notes_at_end = 0
- self.__print_omit_errors = 0
- self.__print_hres = 0x012C # 300 dpi
- self.__print_vres = 0x012C # 300 dpi
- self.__header_margin = 0.1
- self.__footer_margin = 0.1
- self.__copies_num = 1
-
- self.__wnd_protect = 0
- self.__obj_protect = 0
- self.__protect = 0
- self.__scen_protect = 0
- self.__password = b''
-
- self.last_used_row = 0
- self.first_used_row = 65535
- self.last_used_col = 0
- self.first_used_col = 255
- self.row_tempfile = None
- self.__flushed_rows = {}
- self.__row_visible_levels = 0
-
- #################################################################
- ## Properties, "getters", "setters"
- #################################################################
-
- def set_name(self, value):
- self.__name = value
-
- def get_name(self):
- return self.__name
-
- name = property(get_name, set_name)
-
- #################################################################
-
- def get_parent(self):
- return self.__parent
-
- parent = property(get_parent)
-
- #################################################################
-
- def get_rows(self):
- return self.__rows
-
- rows = property(get_rows)
-
- #################################################################
-
- def get_cols(self):
- return self.__cols
-
- cols = property(get_cols)
-
- #################################################################
-
- def get_merged_ranges(self):
- return self.__merged_ranges
-
- merged_ranges = property(get_merged_ranges)
-
- #################################################################
-
- def get_bmp_rec(self):
- return self.__bmp_rec
-
- bmp_rec = property(get_bmp_rec)
-
- #################################################################
-
- def set_show_formulas(self, value):
- self.__show_formulas = int(value)
-
- def get_show_formulas(self):
- return bool(self.__show_formulas)
-
- show_formulas = property(get_show_formulas, set_show_formulas)
-
- #################################################################
-
- def set_show_grid(self, value):
- self.__show_grid = int(value)
-
- def get_show_grid(self):
- return bool(self.__show_grid)
-
- show_grid = property(get_show_grid, set_show_grid)
-
- #################################################################
-
- def set_show_headers(self, value):
- self.__show_headers = int(value)
-
- def get_show_headers(self):
- return bool(self.__show_headers)
-
- show_headers = property(get_show_headers, set_show_headers)
-
- #################################################################
-
- def set_panes_frozen(self, value):
- self.__panes_frozen = int(value)
-
- def get_panes_frozen(self):
- return bool(self.__panes_frozen)
-
- panes_frozen = property(get_panes_frozen, set_panes_frozen)
-
- #################################################################
-
- ### def set_show_empty_as_zero(self, value):
- ### self.__show_empty_as_zero = int(value)
-
- ### def get_show_empty_as_zero(self):
- ### return bool(self.__show_empty_as_zero)
-
- ### show_empty_as_zero = property(get_show_empty_as_zero, set_show_empty_as_zero)
-
- #################################################################
-
- def set_auto_colour_grid(self, value):
- self.__auto_colour_grid = int(value)
-
- def get_auto_colour_grid(self):
- return bool(self.__auto_colour_grid)
-
- auto_colour_grid = property(get_auto_colour_grid, set_auto_colour_grid)
-
- #################################################################
-
- def set_cols_right_to_left(self, value):
- self.__cols_right_to_left = int(value)
-
- def get_cols_right_to_left(self):
- return bool(self.__cols_right_to_left)
-
- cols_right_to_left = property(get_cols_right_to_left, set_cols_right_to_left)
-
- #################################################################
-
- def set_show_outline(self, value):
- self.__show_outline = int(value)
-
- def get_show_outline(self):
- return bool(self.__show_outline)
-
- show_outline = property(get_show_outline, set_show_outline)
-
- #################################################################
-
- def set_remove_splits(self, value):
- self.__remove_splits = int(value)
-
- def get_remove_splits(self):
- return bool(self.__remove_splits)
-
- remove_splits = property(get_remove_splits, set_remove_splits)
-
- #################################################################
-
- def set_selected(self, value):
- self.__selected = int(value)
-
- def get_selected(self):
- return bool(self.__selected)
-
- selected = property(get_selected, set_selected)
-
- #################################################################
-
- def set_sheet_visible(self, value):
- self.__sheet_visible = int(value)
-
- def get_sheet_visible(self):
- return bool(self.__sheet_visible)
-
- sheet_visible = property(get_sheet_visible, set_sheet_visible)
-
- #################################################################
-
- def set_page_preview(self, value):
- self.__page_preview = int(value)
-
- def get_page_preview(self):
- return bool(self.__page_preview)
-
- page_preview = property(get_page_preview, set_page_preview)
-
- #################################################################
-
- def set_first_visible_row(self, value):
- self.__first_visible_row = value
-
- def get_first_visible_row(self):
- return self.__first_visible_row
-
- first_visible_row = property(get_first_visible_row, set_first_visible_row)
-
- #################################################################
-
- def set_first_visible_col(self, value):
- self.__first_visible_col = value
-
- def get_first_visible_col(self):
- return self.__first_visible_col
-
- first_visible_col = property(get_first_visible_col, set_first_visible_col)
-
- #################################################################
-
- def set_grid_colour(self, value):
- self.__grid_colour = value
-
- def get_grid_colour(self):
- return self.__grid_colour
-
- grid_colour = property(get_grid_colour, set_grid_colour)
-
- #################################################################
-
- def set_preview_magn(self, value):
- self.__preview_magn = value
-
- def get_preview_magn(self):
- return self.__preview_magn
-
- preview_magn = property(get_preview_magn, set_preview_magn)
-
- #################################################################
-
- def set_normal_magn(self, value):
- self.__normal_magn = value
-
- def get_normal_magn(self):
- return self.__normal_magn
-
- normal_magn = property(get_normal_magn, set_normal_magn)
-
- #################################################################
-
- def set_vert_split_pos(self, value):
- self.__vert_split_pos = abs(value)
-
- def get_vert_split_pos(self):
- return self.__vert_split_pos
-
- vert_split_pos = property(get_vert_split_pos, set_vert_split_pos)
-
- #################################################################
-
- def set_horz_split_pos(self, value):
- self.__horz_split_pos = abs(value)
-
- def get_horz_split_pos(self):
- return self.__horz_split_pos
-
- horz_split_pos = property(get_horz_split_pos, set_horz_split_pos)
-
- #################################################################
-
- def set_vert_split_first_visible(self, value):
- self.__vert_split_first_visible = abs(value)
-
- def get_vert_split_first_visible(self):
- return self.__vert_split_first_visible
-
- vert_split_first_visible = property(get_vert_split_first_visible, set_vert_split_first_visible)
-
- #################################################################
-
- def set_horz_split_first_visible(self, value):
- self.__horz_split_first_visible = abs(value)
-
- def get_horz_split_first_visible(self):
- return self.__horz_split_first_visible
-
- horz_split_first_visible = property(get_horz_split_first_visible, set_horz_split_first_visible)
-
- #################################################################
-
- #def set_split_active_pane(self, value):
- # self.__split_active_pane = abs(value) & 0x03
- #
- #def get_split_active_pane(self):
- # return self.__split_active_pane
- #
- #split_active_pane = property(get_split_active_pane, set_split_active_pane)
-
- #################################################################
-
- #def set_row_gut_width(self, value):
- # self.__row_gut_width = value
- #
- #def get_row_gut_width(self):
- # return self.__row_gut_width
- #
- #row_gut_width = property(get_row_gut_width, set_row_gut_width)
- #
- #################################################################
- #
- #def set_col_gut_height(self, value):
- # self.__col_gut_height = value
- #
- #def get_col_gut_height(self):
- # return self.__col_gut_height
- #
- #col_gut_height = property(get_col_gut_height, set_col_gut_height)
- #
- #################################################################
-
- def set_show_auto_page_breaks(self, value):
- self.__show_auto_page_breaks = int(value)
-
- def get_show_auto_page_breaks(self):
- return bool(self.__show_auto_page_breaks)
-
- show_auto_page_breaks = property(get_show_auto_page_breaks, set_show_auto_page_breaks)
-
- #################################################################
-
- def set_dialogue_sheet(self, value):
- self.__dialogue_sheet = int(value)
-
- def get_dialogue_sheet(self):
- return bool(self.__dialogue_sheet)
-
- dialogue_sheet = property(get_dialogue_sheet, set_dialogue_sheet)
-
- #################################################################
-
- def set_auto_style_outline(self, value):
- self.__auto_style_outline = int(value)
-
- def get_auto_style_outline(self):
- return bool(self.__auto_style_outline)
-
- auto_style_outline = property(get_auto_style_outline, set_auto_style_outline)
-
- #################################################################
-
- def set_outline_below(self, value):
- self.__outline_below = int(value)
-
- def get_outline_below(self):
- return bool(self.__outline_below)
-
- outline_below = property(get_outline_below, set_outline_below)
-
- #################################################################
-
- def set_outline_right(self, value):
- self.__outline_right = int(value)
-
- def get_outline_right(self):
- return bool(self.__outline_right)
-
- outline_right = property(get_outline_right, set_outline_right)
-
- #################################################################
-
- def set_fit_num_pages(self, value):
- self.__fit_num_pages = value
-
- def get_fit_num_pages(self):
- return self.__fit_num_pages
-
- fit_num_pages = property(get_fit_num_pages, set_fit_num_pages)
-
- #################################################################
-
- def set_show_row_outline(self, value):
- self.__show_row_outline = int(value)
-
- def get_show_row_outline(self):
- return bool(self.__show_row_outline)
-
- show_row_outline = property(get_show_row_outline, set_show_row_outline)
-
- #################################################################
-
- def set_show_col_outline(self, value):
- self.__show_col_outline = int(value)
-
- def get_show_col_outline(self):
- return bool(self.__show_col_outline)
-
- show_col_outline = property(get_show_col_outline, set_show_col_outline)
-
- #################################################################
-
- def set_alt_expr_eval(self, value):
- self.__alt_expr_eval = int(value)
-
- def get_alt_expr_eval(self):
- return bool(self.__alt_expr_eval)
-
- alt_expr_eval = property(get_alt_expr_eval, set_alt_expr_eval)
-
- #################################################################
-
- def set_alt_formula_entries(self, value):
- self.__alt_formula_entries = int(value)
-
- def get_alt_formula_entries(self):
- return bool(self.__alt_formula_entries)
-
- alt_formula_entries = property(get_alt_formula_entries, set_alt_formula_entries)
-
- #################################################################
-
- def set_row_default_height(self, value):
- self.__row_default_height = value
-
- def get_row_default_height(self):
- return self.__row_default_height
-
- row_default_height = property(get_row_default_height, set_row_default_height)
-
- #################################################################
-
- def set_col_default_width(self, value):
- self.__col_default_width = value
-
- def get_col_default_width(self):
- return self.__col_default_width
-
- col_default_width = property(get_col_default_width, set_col_default_width)
-
- #################################################################
-
- def set_calc_mode(self, value):
- self.__calc_mode = value & 0x03
-
- def get_calc_mode(self):
- return self.__calc_mode
-
- calc_mode = property(get_calc_mode, set_calc_mode)
-
- #################################################################
-
- def set_calc_count(self, value):
- self.__calc_count = value
-
- def get_calc_count(self):
- return self.__calc_count
-
- calc_count = property(get_calc_count, set_calc_count)
-
- #################################################################
-
- def set_RC_ref_mode(self, value):
- self.__RC_ref_mode = int(value)
-
- def get_RC_ref_mode(self):
- return bool(self.__RC_ref_mode)
-
- RC_ref_mode = property(get_RC_ref_mode, set_RC_ref_mode)
-
- #################################################################
-
- def set_iterations_on(self, value):
- self.__iterations_on = int(value)
-
- def get_iterations_on(self):
- return bool(self.__iterations_on)
-
- iterations_on = property(get_iterations_on, set_iterations_on)
-
- #################################################################
-
- def set_delta(self, value):
- self.__delta = value
-
- def get_delta(self):
- return self.__delta
-
- delta = property(get_delta, set_delta)
-
- #################################################################
-
- def set_save_recalc(self, value):
- self.__save_recalc = int(value)
-
- def get_save_recalc(self):
- return bool(self.__save_recalc)
-
- save_recalc = property(get_save_recalc, set_save_recalc)
-
- #################################################################
-
- def set_print_headers(self, value):
- self.__print_headers = int(value)
-
- def get_print_headers(self):
- return bool(self.__print_headers)
-
- print_headers = property(get_print_headers, set_print_headers)
-
- #################################################################
-
- def set_print_grid(self, value):
- self.__print_grid = int(value)
-
- def get_print_grid(self):
- return bool(self.__print_grid)
-
- print_grid = property(get_print_grid, set_print_grid)
-
- #################################################################
- #
- #def set_grid_set(self, value):
- # self.__grid_set = int(value)
- #
- #def get_grid_set(self):
- # return bool(self.__grid_set)
- #
- #grid_set = property(get_grid_set, set_grid_set)
- #
- #################################################################
-
- def set_vert_page_breaks(self, value):
- self.__vert_page_breaks = value
-
- def get_vert_page_breaks(self):
- return self.__vert_page_breaks
-
- vert_page_breaks = property(get_vert_page_breaks, set_vert_page_breaks)
-
- #################################################################
-
- def set_horz_page_breaks(self, value):
- self.__horz_page_breaks = value
-
- def get_horz_page_breaks(self):
- return self.__horz_page_breaks
-
- horz_page_breaks = property(get_horz_page_breaks, set_horz_page_breaks)
-
- #################################################################
-
- def set_header_str(self, value):
- if isinstance(value, str):
- value = str(value, self.__parent.encoding)
- self.__header_str = value
-
- def get_header_str(self):
- return self.__header_str
-
- header_str = property(get_header_str, set_header_str)
-
- #################################################################
-
- def set_footer_str(self, value):
- if isinstance(value, str):
- value = str(value, self.__parent.encoding)
- self.__footer_str = value
-
- def get_footer_str(self):
- return self.__footer_str
-
- footer_str = property(get_footer_str, set_footer_str)
-
- #################################################################
-
- def set_print_centered_vert(self, value):
- self.__print_centered_vert = int(value)
-
- def get_print_centered_vert(self):
- return bool(self.__print_centered_vert)
-
- print_centered_vert = property(get_print_centered_vert, set_print_centered_vert)
-
- #################################################################
-
- def set_print_centered_horz(self, value):
- self.__print_centered_horz = int(value)
-
- def get_print_centered_horz(self):
- return bool(self.__print_centered_horz)
-
- print_centered_horz = property(get_print_centered_horz, set_print_centered_horz)
-
- #################################################################
-
- def set_left_margin(self, value):
- self.__left_margin = value
-
- def get_left_margin(self):
- return self.__left_margin
-
- left_margin = property(get_left_margin, set_left_margin)
-
- #################################################################
-
- def set_right_margin(self, value):
- self.__right_margin = value
-
- def get_right_margin(self):
- return self.__right_margin
-
- right_margin = property(get_right_margin, set_right_margin)
-
- #################################################################
-
- def set_top_margin(self, value):
- self.__top_margin = value
-
- def get_top_margin(self):
- return self.__top_margin
-
- top_margin = property(get_top_margin, set_top_margin)
-
- #################################################################
-
- def set_bottom_margin(self, value):
- self.__bottom_margin = value
-
- def get_bottom_margin(self):
- return self.__bottom_margin
-
- bottom_margin = property(get_bottom_margin, set_bottom_margin)
-
- #################################################################
-
- def set_paper_size_code(self, value):
- self.__paper_size_code = value
-
- def get_paper_size_code(self):
- return self.__paper_size_code
-
- paper_size_code = property(get_paper_size_code, set_paper_size_code)
-
- #################################################################
-
- def set_print_scaling(self, value):
- self.__print_scaling = value
-
- def get_print_scaling(self):
- return self.__print_scaling
-
- print_scaling = property(get_print_scaling, set_print_scaling)
-
- #################################################################
-
- def set_start_page_number(self, value):
- self.__start_page_number = value
-
- def get_start_page_number(self):
- return self.__start_page_number
-
- start_page_number = property(get_start_page_number, set_start_page_number)
-
- #################################################################
-
- def set_fit_width_to_pages(self, value):
- self.__fit_width_to_pages = value
-
- def get_fit_width_to_pages(self):
- return self.__fit_width_to_pages
-
- fit_width_to_pages = property(get_fit_width_to_pages, set_fit_width_to_pages)
-
- #################################################################
-
- def set_fit_height_to_pages(self, value):
- self.__fit_height_to_pages = value
-
- def get_fit_height_to_pages(self):
- return self.__fit_height_to_pages
-
- fit_height_to_pages = property(get_fit_height_to_pages, set_fit_height_to_pages)
-
- #################################################################
-
- def set_print_in_rows(self, value):
- self.__print_in_rows = int(value)
-
- def get_print_in_rows(self):
- return bool(self.__print_in_rows)
-
- print_in_rows = property(get_print_in_rows, set_print_in_rows)
-
- #################################################################
-
- def set_portrait(self, value):
- self.__portrait = int(value)
-
- def get_portrait(self):
- return bool(self.__portrait)
-
- portrait = property(get_portrait, set_portrait)
-
- #################################################################
-
- def set_print_colour(self, value):
- self.__print_not_colour = int(not value)
-
- def get_print_colour(self):
- return not bool(self.__print_not_colour)
-
- print_colour = property(get_print_colour, set_print_colour)
-
- #################################################################
-
- def set_print_draft(self, value):
- self.__print_draft = int(value)
-
- def get_print_draft(self):
- return bool(self.__print_draft)
-
- print_draft = property(get_print_draft, set_print_draft)
-
- #################################################################
-
- def set_print_notes(self, value):
- self.__print_notes = int(value)
-
- def get_print_notes(self):
- return bool(self.__print_notes)
-
- print_notes = property(get_print_notes, set_print_notes)
-
- #################################################################
-
- def set_print_notes_at_end(self, value):
- self.__print_notes_at_end = int(value)
-
- def get_print_notes_at_end(self):
- return bool(self.__print_notes_at_end)
-
- print_notes_at_end = property(get_print_notes_at_end, set_print_notes_at_end)
-
- #################################################################
-
- def set_print_omit_errors(self, value):
- self.__print_omit_errors = int(value)
-
- def get_print_omit_errors(self):
- return bool(self.__print_omit_errors)
-
- print_omit_errors = property(get_print_omit_errors, set_print_omit_errors)
-
- #################################################################
-
- def set_print_hres(self, value):
- self.__print_hres = value
-
- def get_print_hres(self):
- return self.__print_hres
-
- print_hres = property(get_print_hres, set_print_hres)
-
- #################################################################
-
- def set_print_vres(self, value):
- self.__print_vres = value
-
- def get_print_vres(self):
- return self.__print_vres
-
- print_vres = property(get_print_vres, set_print_vres)
-
- #################################################################
-
- def set_header_margin(self, value):
- self.__header_margin = value
-
- def get_header_margin(self):
- return self.__header_margin
-
- header_margin = property(get_header_margin, set_header_margin)
-
- #################################################################
-
- def set_footer_margin(self, value):
- self.__footer_margin = value
-
- def get_footer_margin(self):
- return self.__footer_margin
-
- footer_margin = property(get_footer_margin, set_footer_margin)
-
- #################################################################
-
- def set_copies_num(self, value):
- self.__copies_num = value
-
- def get_copies_num(self):
- return self.__copies_num
-
- copies_num = property(get_copies_num, set_copies_num)
-
- ##################################################################
-
- def set_wnd_protect(self, value):
- self.__wnd_protect = int(value)
-
- def get_wnd_protect(self):
- return bool(self.__wnd_protect)
-
- wnd_protect = property(get_wnd_protect, set_wnd_protect)
-
- #################################################################
-
- def set_obj_protect(self, value):
- self.__obj_protect = int(value)
-
- def get_obj_protect(self):
- return bool(self.__obj_protect)
-
- obj_protect = property(get_obj_protect, set_obj_protect)
-
- #################################################################
-
- def set_protect(self, value):
- self.__protect = int(value)
-
- def get_protect(self):
- return bool(self.__protect)
-
- protect = property(get_protect, set_protect)
-
- #################################################################
-
- def set_scen_protect(self, value):
- self.__scen_protect = int(value)
-
- def get_scen_protect(self):
- return bool(self.__scen_protect)
-
- scen_protect = property(get_scen_protect, set_scen_protect)
-
- #################################################################
-
- def set_password(self, value):
- self.__password = value
-
- def get_password(self):
- return self.__password
-
- password = property(get_password, set_password)
-
- ##################################################################
- ## Methods
- ##################################################################
-
- def get_parent(self):
- return self.__parent
-
- def write(self, r, c, label=b"", style=Style.default_style):
- self.row(r).write(c, label, style)
-
- def merge(self, r1, r2, c1, c2, style=Style.default_style):
- # Stand-alone merge of previously written cells.
- # Problems: (1) style to be used should be existing style of
- # the top-left cell, not an arg.
- # (2) should ensure that any previous data value in
- # non-top-left cells is nobbled.
- # Note: if a cell is set by a data record then later
- # is referenced by a [MUL]BLANK record, Excel will blank
- # out the cell on the screen, but OOo & Gnu will not
- # blank it out. Need to do something better than writing
- # multiple records. In the meantime, avoid this method and use
- # write_merge() instead.
- if c2 > c1:
- self.row(r1).write_blanks(c1 + 1, c2, style)
- for r in range(r1+1, r2+1):
- self.row(r).write_blanks(c1, c2, style)
- self.__merged_ranges.append((r1, r2, c1, c2))
-
- def write_merge(self, r1, r2, c1, c2, label=b"", style=Style.default_style):
- assert 0 <= c1 <= c2 <= 255
- assert 0 <= r1 <= r2 <= 65535
- self.write(r1, c1, label, style)
- if c2 > c1:
- self.row(r1).write_blanks(c1 + 1, c2, style) # skip (r1, c1)
- for r in range(r1+1, r2+1):
- self.row(r).write_blanks(c1, c2, style)
- self.__merged_ranges.append((r1, r2, c1, c2))
-
- def insert_bitmap(self, filename, row, col, x = 0, y = 0, scale_x = 1, scale_y = 1):
- bmp = Bitmap.ImDataBmpRecord(filename)
- obj = Bitmap.ObjBmpRecord(row, col, self, bmp, x, y, scale_x, scale_y)
-
- self.__bmp_rec += obj.get() + bmp.get()
-
- def col(self, indx):
- if indx not in self.__cols:
- self.__cols[indx] = self.Column(indx, self)
- return self.__cols[indx]
-
- def row(self, indx):
- if indx not in self.__rows:
- if indx in self.__flushed_rows:
- raise Exception("Attempt to reuse row index %d of sheet %r after flushing" % (indx, self.__name))
- self.__rows[indx] = self.Row(indx, self)
- if indx > self.last_used_row:
- self.last_used_row = indx
- if indx < self.first_used_row:
- self.first_used_row = indx
- return self.__rows[indx]
-
- def row_height(self, row): # in pixels
- if row in self.__rows:
- return self.__rows[row].get_height_in_pixels()
- else:
- return 17
-
- def col_width(self, col): # in pixels
- if col in self.__cols:
- return self.__cols[col].width_in_pixels()
- else:
- return 64
-
-
- ##################################################################
- ## BIFF records generation
- ##################################################################
-
- def __bof_rec(self):
- return BIFFRecords.Biff8BOFRecord(BIFFRecords.Biff8BOFRecord.WORKSHEET).get()
-
- def __update_row_visible_levels(self):
- if self.__rows:
- temp = max([self.__rows[r].level for r in self.__rows]) + 1
- self.__row_visible_levels = max(temp, self.__row_visible_levels)
-
- def __guts_rec(self):
- self.__update_row_visible_levels()
- col_visible_levels = 0
- if len(self.__cols) != 0:
- col_visible_levels = max([self.__cols[c].level for c in self.__cols]) + 1
- return BIFFRecords.GutsRecord(
- self.__row_gut_width, self.__col_gut_height, self.__row_visible_levels, col_visible_levels).get()
-
- def __defaultrowheight_rec(self):
- options = 0x0000
- options |= (self.row_default_height_mismatch & 1) << 0
- options |= (self.row_default_hidden & 1) << 1
- options |= (self.row_default_space_above & 1) << 2
- options |= (self.row_default_space_below & 1) << 3
- defht = self.__row_default_height
- return BIFFRecords.DefaultRowHeightRecord(options, defht).get()
-
- def __wsbool_rec(self):
- options = 0x00
- options |= (self.__show_auto_page_breaks & 0x01) << 0
- options |= (self.__dialogue_sheet & 0x01) << 4
- options |= (self.__auto_style_outline & 0x01) << 5
- options |= (self.__outline_below & 0x01) << 6
- options |= (self.__outline_right & 0x01) << 7
- options |= (self.__fit_num_pages & 0x01) << 8
- options |= (self.__show_row_outline & 0x01) << 10
- options |= (self.__show_col_outline & 0x01) << 11
- options |= (self.__alt_expr_eval & 0x01) << 14
- options |= (self.__alt_formula_entries & 0x01) << 15
-
- return BIFFRecords.WSBoolRecord(options).get()
-
- def __eof_rec(self):
- return BIFFRecords.EOFRecord().get()
-
- def __colinfo_rec(self):
- result = b''
- for col in self.__cols:
- result += self.__cols[col].get_biff_record()
- return result
-
- def __dimensions_rec(self):
- return BIFFRecords.DimensionsRecord(
- self.first_used_row, self.last_used_row,
- self.first_used_col, self.last_used_col
- ).get()
-
- def __window2_rec(self):
- # Appends SCL record.
- options = 0
- options |= (self.__show_formulas & 0x01) << 0
- options |= (self.__show_grid & 0x01) << 1
- options |= (self.__show_headers & 0x01) << 2
- options |= (self.__panes_frozen & 0x01) << 3
- options |= (self.show_zero_values & 0x01) << 4
- options |= (self.__auto_colour_grid & 0x01) << 5
- options |= (self.__cols_right_to_left & 0x01) << 6
- options |= (self.__show_outline & 0x01) << 7
- options |= (self.__remove_splits & 0x01) << 8
- options |= (self.__selected & 0x01) << 9
- options |= (self.__sheet_visible & 0x01) << 10
- options |= (self.__page_preview & 0x01) << 11
- if self.__page_preview:
- scl_magn = self.__preview_magn
- else:
- scl_magn = self.__normal_magn
- return BIFFRecords.Window2Record(
- options, self.__first_visible_row, self.__first_visible_col,
- self.__grid_colour,
- self.__preview_magn, self.__normal_magn, scl_magn).get()
-
- def __panes_rec(self):
- if self.__vert_split_pos is None and self.__horz_split_pos is None:
- return b""
-
- if self.__vert_split_pos is None:
- self.__vert_split_pos = 0
- if self.__horz_split_pos is None:
- self.__horz_split_pos = 0
-
- if self.__panes_frozen:
- if self.__vert_split_first_visible is None:
- self.__vert_split_first_visible = self.__vert_split_pos
- if self.__horz_split_first_visible is None:
- self.__horz_split_first_visible = self.__horz_split_pos
- else:
- if self.__vert_split_first_visible is None:
- self.__vert_split_first_visible = 0
- if self.__horz_split_first_visible is None:
- self.__horz_split_first_visible = 0
- # inspired by pyXLWriter
- self.__horz_split_pos = 20*self.__horz_split_pos + 255
- self.__vert_split_pos = int(113.879*self.__vert_split_pos + 390)
-
- if self.__vert_split_pos > 0 and self.__horz_split_pos > 0:
- self.__split_active_pane = 0
- elif self.__vert_split_pos > 0 and self.__horz_split_pos == 0:
- self.__split_active_pane = 1
- elif self.__vert_split_pos == 0 and self.__horz_split_pos > 0:
- self.__split_active_pane = 2
- else:
- self.__split_active_pane = 3
-
- result = BIFFRecords.PanesRecord(self.__vert_split_pos,
- self.__horz_split_pos,
- self.__horz_split_first_visible,
- self.__vert_split_first_visible,
- self.__split_active_pane).get()
- return result
-
- def __row_blocks_rec(self):
- result = []
- for row in self.__rows.values():
- result.append(row.get_row_biff_data())
- result.append(row.get_cells_biff_data())
- return b''.join(result)
-
- def __merged_rec(self):
- return BIFFRecords.MergedCellsRecord(self.__merged_ranges).get()
-
- def __bitmaps_rec(self):
- return self.__bmp_rec
-
- def __calc_settings_rec(self):
- result = b''
- result += BIFFRecords.CalcModeRecord(self.__calc_mode & 0x01).get()
- result += BIFFRecords.CalcCountRecord(self.__calc_count & 0xFFFF).get()
- result += BIFFRecords.RefModeRecord(self.__RC_ref_mode & 0x01).get()
- result += BIFFRecords.IterationRecord(self.__iterations_on & 0x01).get()
- result += BIFFRecords.DeltaRecord(self.__delta).get()
- result += BIFFRecords.SaveRecalcRecord(self.__save_recalc & 0x01).get()
- return result
-
- def __print_settings_rec(self):
- result = b''
- result += BIFFRecords.PrintHeadersRecord(self.__print_headers).get()
- result += BIFFRecords.PrintGridLinesRecord(self.__print_grid).get()
- result += BIFFRecords.GridSetRecord(self.__grid_set).get()
- result += BIFFRecords.HorizontalPageBreaksRecord(self.__horz_page_breaks).get()
- result += BIFFRecords.VerticalPageBreaksRecord(self.__vert_page_breaks).get()
- result += BIFFRecords.HeaderRecord(self.__header_str).get()
- result += BIFFRecords.FooterRecord(self.__footer_str).get()
- result += BIFFRecords.HCenterRecord(self.__print_centered_horz).get()
- result += BIFFRecords.VCenterRecord(self.__print_centered_vert).get()
- result += BIFFRecords.LeftMarginRecord(self.__left_margin).get()
- result += BIFFRecords.RightMarginRecord(self.__right_margin).get()
- result += BIFFRecords.TopMarginRecord(self.__top_margin).get()
- result += BIFFRecords.BottomMarginRecord(self.__bottom_margin).get()
-
- setup_page_options = (self.__print_in_rows & 0x01) << 0
- setup_page_options |= (self.__portrait & 0x01) << 1
- setup_page_options |= (0x00 & 0x01) << 2
- setup_page_options |= (self.__print_not_colour & 0x01) << 3
- setup_page_options |= (self.__print_draft & 0x01) << 4
- setup_page_options |= (self.__print_notes & 0x01) << 5
- setup_page_options |= (0x00 & 0x01) << 6
- setup_page_options |= (0x01 & 0x01) << 7
- setup_page_options |= (self.__print_notes_at_end & 0x01) << 9
- setup_page_options |= (self.__print_omit_errors & 0x03) << 10
-
- result += BIFFRecords.SetupPageRecord(self.__paper_size_code,
- self.__print_scaling,
- self.__start_page_number,
- self.__fit_width_to_pages,
- self.__fit_height_to_pages,
- setup_page_options,
- self.__print_hres,
- self.__print_vres,
- self.__header_margin,
- self.__footer_margin,
- self.__copies_num).get()
- return result
-
- def __protection_rec(self):
- result = b''
- result += BIFFRecords.ProtectRecord(self.__protect).get()
- result += BIFFRecords.ScenProtectRecord(self.__scen_protect).get()
- result += BIFFRecords.WindowProtectRecord(self.__wnd_protect).get()
- result += BIFFRecords.ObjectProtectRecord(self.__obj_protect).get()
- result += BIFFRecords.PasswordRecord(self.__password).get()
- return result
-
- def get_biff_data(self):
- result = [
- self.__bof_rec(),
- self.__calc_settings_rec(),
- self.__guts_rec(),
- self.__defaultrowheight_rec(),
- self.__wsbool_rec(),
- self.__colinfo_rec(),
- self.__dimensions_rec(),
- self.__print_settings_rec(),
- self.__protection_rec(),
- ]
- if self.row_tempfile:
- self.row_tempfile.flush()
- self.row_tempfile.seek(0)
- result.append(self.row_tempfile.read())
- result.extend([
- self.__row_blocks_rec(),
- self.__merged_rec(),
- self.__bitmaps_rec(),
- self.__window2_rec(),
- self.__panes_rec(),
- self.__eof_rec(),
- ])
- return b''.join(result)
-
- def flush_row_data(self):
- if self.row_tempfile is None:
- self.row_tempfile = tempfile.TemporaryFile()
- self.row_tempfile.write(self.__row_blocks_rec())
- for rowx in self.__rows:
- self.__flushed_rows[rowx] = 1
- self.__update_row_visible_levels()
- self.__rows = {}
-
-
+# -*- coding: windows-1252 -*-
+'''
+ BOF
+ UNCALCED
+ INDEX
+ Calculation Settings Block
+ PRINTHEADERS
+ PRINTGRIDLINES
+ GRIDSET
+ GUTS
+ DEFAULTROWHEIGHT
+ WSBOOL
+ Page Settings Block
+ Worksheet Protection Block
+ DEFCOLWIDTH
+ COLINFO
+ SORT
+ DIMENSIONS
+ Row Blocks
+ WINDOW2
+ SCL
+ PANE
+ SELECTION
+ STANDARDWIDTH
+ MERGEDCELLS
+ LABELRANGES
+ PHONETIC
+ Conditional Formatting Table
+ Hyperlink Table
+ Data Validity Table
+ SHEETLAYOUT (BIFF8X only)
+ SHEETPROTECTION (BIFF8X only)
+ RANGEPROTECTION (BIFF8X only)
+ EOF
+'''
+
+import BIFFRecords
+import Bitmap
+import Formatting
+import Style
+import tempfile
+
+
+class Worksheet(object):
+ from Workbook import Workbook
+
+ #################################################################
+ ## Constructor
+ #################################################################
+ def __init__(self, sheetname, parent_book, cell_overwrite_ok=False):
+ import Row
+ self.Row = Row.Row
+
+ import Column
+ self.Column = Column.Column
+
+ self.__name = sheetname
+ self.__parent = parent_book
+ self._cell_overwrite_ok = cell_overwrite_ok
+
+ self.__rows = {}
+ self.__cols = {}
+ self.__merged_ranges = []
+ self.__bmp_rec = ''
+
+ self.__show_formulas = 0
+ self.__show_grid = 1
+ self.__show_headers = 1
+ self.__panes_frozen = 0
+ ### self.__show_empty_as_zero = 1 ### deprecated with extreme prejudice 2009-05-19
+ self.show_zero_values = 1
+ self.__auto_colour_grid = 1
+ self.__cols_right_to_left = 0
+ self.__show_outline = 1
+ self.__remove_splits = 0
+ self.__selected = 0
+ # RED HERRING ALERT: "sheet_visible" is a clone of the "selected" attribute.
+ # Typically a workbook created by the Excel UI will have one sheet
+ # (the sheet that was selected when the user saved it)
+ # with both bits set to 1, and all other sheets will have both
+ # bits set to 0. The true visibility of the sheet is found in the "visibility"
+ # attribute obtained from the BOUNDSHEET record.
+ self.__sheet_visible = 0
+ self.__page_preview = 0
+
+ self.__first_visible_row = 0
+ self.__first_visible_col = 0
+ self.__grid_colour = 0x40
+ self.__preview_magn = 60 # percent
+ self.__normal_magn = 100 # percent
+
+ self.visibility = 0 # from/to BOUNDSHEET record.
+
+ self.__vert_split_pos = None
+ self.__horz_split_pos = None
+ self.__vert_split_first_visible = None
+ self.__horz_split_first_visible = None
+ self.__split_active_pane = None
+
+ self.__row_gut_width = 0
+ self.__col_gut_height = 0
+
+ self.__show_auto_page_breaks = 1
+ self.__dialogue_sheet = 0
+ self.__auto_style_outline = 0
+ self.__outline_below = 0
+ self.__outline_right = 0
+ self.__fit_num_pages = 0
+ self.__show_row_outline = 1
+ self.__show_col_outline = 1
+ self.__alt_expr_eval = 0
+ self.__alt_formula_entries = 0
+
+ self.__row_default_height = 0x00FF
+ self.row_default_height_mismatch = 0
+ self.row_default_hidden = 0
+ self.row_default_space_above = 0
+ self.row_default_space_below = 0
+
+ self.__col_default_width = 0x0008
+
+ self.__calc_mode = 1
+ self.__calc_count = 0x0064
+ self.__RC_ref_mode = 1
+ self.__iterations_on = 0
+ self.__delta = 0.001
+ self.__save_recalc = 0
+
+ self.__print_headers = 0
+ self.__print_grid = 0
+ self.__grid_set = 1
+ self.__vert_page_breaks = []
+ self.__horz_page_breaks = []
+ self.__header_str = '&P'
+ self.__footer_str = '&F'
+ self.__print_centered_vert = 0
+ self.__print_centered_horz = 1
+ self.__left_margin = 0.3 #0.5
+ self.__right_margin = 0.3 #0.5
+ self.__top_margin = 0.61 #1.0
+ self.__bottom_margin = 0.37 #1.0
+ self.__paper_size_code = 9 # A4
+ self.__print_scaling = 100
+ self.__start_page_number = 1
+ self.__fit_width_to_pages = 1
+ self.__fit_height_to_pages = 1
+ self.__print_in_rows = 1
+ self.__portrait = 1
+ self.__print_not_colour = 0
+ self.__print_draft = 0
+ self.__print_notes = 0
+ self.__print_notes_at_end = 0
+ self.__print_omit_errors = 0
+ self.__print_hres = 0x012C # 300 dpi
+ self.__print_vres = 0x012C # 300 dpi
+ self.__header_margin = 0.1
+ self.__footer_margin = 0.1
+ self.__copies_num = 1
+
+ self.__wnd_protect = 0
+ self.__obj_protect = 0
+ self.__protect = 0
+ self.__scen_protect = 0
+ self.__password = ''
+
+ self.last_used_row = 0
+ self.first_used_row = 65535
+ self.last_used_col = 0
+ self.first_used_col = 255
+ self.row_tempfile = None
+ self.__flushed_rows = {}
+ self.__row_visible_levels = 0
+
+ #################################################################
+ ## Properties, "getters", "setters"
+ #################################################################
+
+ def set_name(self, value):
+ self.__name = value
+
+ def get_name(self):
+ return self.__name
+
+ name = property(get_name, set_name)
+
+ #################################################################
+
+ def get_parent(self):
+ return self.__parent
+
+ parent = property(get_parent)
+
+ #################################################################
+
+ def get_rows(self):
+ return self.__rows
+
+ rows = property(get_rows)
+
+ #################################################################
+
+ def get_cols(self):
+ return self.__cols
+
+ cols = property(get_cols)
+
+ #################################################################
+
+ def get_merged_ranges(self):
+ return self.__merged_ranges
+
+ merged_ranges = property(get_merged_ranges)
+
+ #################################################################
+
+ def get_bmp_rec(self):
+ return self.__bmp_rec
+
+ bmp_rec = property(get_bmp_rec)
+
+ #################################################################
+
+ def set_show_formulas(self, value):
+ self.__show_formulas = int(value)
+
+ def get_show_formulas(self):
+ return bool(self.__show_formulas)
+
+ show_formulas = property(get_show_formulas, set_show_formulas)
+
+ #################################################################
+
+ def set_show_grid(self, value):
+ self.__show_grid = int(value)
+
+ def get_show_grid(self):
+ return bool(self.__show_grid)
+
+ show_grid = property(get_show_grid, set_show_grid)
+
+ #################################################################
+
+ def set_show_headers(self, value):
+ self.__show_headers = int(value)
+
+ def get_show_headers(self):
+ return bool(self.__show_headers)
+
+ show_headers = property(get_show_headers, set_show_headers)
+
+ #################################################################
+
+ def set_panes_frozen(self, value):
+ self.__panes_frozen = int(value)
+
+ def get_panes_frozen(self):
+ return bool(self.__panes_frozen)
+
+ panes_frozen = property(get_panes_frozen, set_panes_frozen)
+
+ #################################################################
+
+ ### def set_show_empty_as_zero(self, value):
+ ### self.__show_empty_as_zero = int(value)
+
+ ### def get_show_empty_as_zero(self):
+ ### return bool(self.__show_empty_as_zero)
+
+ ### show_empty_as_zero = property(get_show_empty_as_zero, set_show_empty_as_zero)
+
+ #################################################################
+
+ def set_auto_colour_grid(self, value):
+ self.__auto_colour_grid = int(value)
+
+ def get_auto_colour_grid(self):
+ return bool(self.__auto_colour_grid)
+
+ auto_colour_grid = property(get_auto_colour_grid, set_auto_colour_grid)
+
+ #################################################################
+
+ def set_cols_right_to_left(self, value):
+ self.__cols_right_to_left = int(value)
+
+ def get_cols_right_to_left(self):
+ return bool(self.__cols_right_to_left)
+
+ cols_right_to_left = property(get_cols_right_to_left, set_cols_right_to_left)
+
+ #################################################################
+
+ def set_show_outline(self, value):
+ self.__show_outline = int(value)
+
+ def get_show_outline(self):
+ return bool(self.__show_outline)
+
+ show_outline = property(get_show_outline, set_show_outline)
+
+ #################################################################
+
+ def set_remove_splits(self, value):
+ self.__remove_splits = int(value)
+
+ def get_remove_splits(self):
+ return bool(self.__remove_splits)
+
+ remove_splits = property(get_remove_splits, set_remove_splits)
+
+ #################################################################
+
+ def set_selected(self, value):
+ self.__selected = int(value)
+
+ def get_selected(self):
+ return bool(self.__selected)
+
+ selected = property(get_selected, set_selected)
+
+ #################################################################
+
+ def set_sheet_visible(self, value):
+ self.__sheet_visible = int(value)
+
+ def get_sheet_visible(self):
+ return bool(self.__sheet_visible)
+
+ sheet_visible = property(get_sheet_visible, set_sheet_visible)
+
+ #################################################################
+
+ def set_page_preview(self, value):
+ self.__page_preview = int(value)
+
+ def get_page_preview(self):
+ return bool(self.__page_preview)
+
+ page_preview = property(get_page_preview, set_page_preview)
+
+ #################################################################
+
+ def set_first_visible_row(self, value):
+ self.__first_visible_row = value
+
+ def get_first_visible_row(self):
+ return self.__first_visible_row
+
+ first_visible_row = property(get_first_visible_row, set_first_visible_row)
+
+ #################################################################
+
+ def set_first_visible_col(self, value):
+ self.__first_visible_col = value
+
+ def get_first_visible_col(self):
+ return self.__first_visible_col
+
+ first_visible_col = property(get_first_visible_col, set_first_visible_col)
+
+ #################################################################
+
+ def set_grid_colour(self, value):
+ self.__grid_colour = value
+
+ def get_grid_colour(self):
+ return self.__grid_colour
+
+ grid_colour = property(get_grid_colour, set_grid_colour)
+
+ #################################################################
+
+ def set_preview_magn(self, value):
+ self.__preview_magn = value
+
+ def get_preview_magn(self):
+ return self.__preview_magn
+
+ preview_magn = property(get_preview_magn, set_preview_magn)
+
+ #################################################################
+
+ def set_normal_magn(self, value):
+ self.__normal_magn = value
+
+ def get_normal_magn(self):
+ return self.__normal_magn
+
+ normal_magn = property(get_normal_magn, set_normal_magn)
+
+ #################################################################
+
+ def set_vert_split_pos(self, value):
+ self.__vert_split_pos = abs(value)
+
+ def get_vert_split_pos(self):
+ return self.__vert_split_pos
+
+ vert_split_pos = property(get_vert_split_pos, set_vert_split_pos)
+
+ #################################################################
+
+ def set_horz_split_pos(self, value):
+ self.__horz_split_pos = abs(value)
+
+ def get_horz_split_pos(self):
+ return self.__horz_split_pos
+
+ horz_split_pos = property(get_horz_split_pos, set_horz_split_pos)
+
+ #################################################################
+
+ def set_vert_split_first_visible(self, value):
+ self.__vert_split_first_visible = abs(value)
+
+ def get_vert_split_first_visible(self):
+ return self.__vert_split_first_visible
+
+ vert_split_first_visible = property(get_vert_split_first_visible, set_vert_split_first_visible)
+
+ #################################################################
+
+ def set_horz_split_first_visible(self, value):
+ self.__horz_split_first_visible = abs(value)
+
+ def get_horz_split_first_visible(self):
+ return self.__horz_split_first_visible
+
+ horz_split_first_visible = property(get_horz_split_first_visible, set_horz_split_first_visible)
+
+ #################################################################
+
+ #def set_split_active_pane(self, value):
+ # self.__split_active_pane = abs(value) & 0x03
+ #
+ #def get_split_active_pane(self):
+ # return self.__split_active_pane
+ #
+ #split_active_pane = property(get_split_active_pane, set_split_active_pane)
+
+ #################################################################
+
+ #def set_row_gut_width(self, value):
+ # self.__row_gut_width = value
+ #
+ #def get_row_gut_width(self):
+ # return self.__row_gut_width
+ #
+ #row_gut_width = property(get_row_gut_width, set_row_gut_width)
+ #
+ #################################################################
+ #
+ #def set_col_gut_height(self, value):
+ # self.__col_gut_height = value
+ #
+ #def get_col_gut_height(self):
+ # return self.__col_gut_height
+ #
+ #col_gut_height = property(get_col_gut_height, set_col_gut_height)
+ #
+ #################################################################
+
+ def set_show_auto_page_breaks(self, value):
+ self.__show_auto_page_breaks = int(value)
+
+ def get_show_auto_page_breaks(self):
+ return bool(self.__show_auto_page_breaks)
+
+ show_auto_page_breaks = property(get_show_auto_page_breaks, set_show_auto_page_breaks)
+
+ #################################################################
+
+ def set_dialogue_sheet(self, value):
+ self.__dialogue_sheet = int(value)
+
+ def get_dialogue_sheet(self):
+ return bool(self.__dialogue_sheet)
+
+ dialogue_sheet = property(get_dialogue_sheet, set_dialogue_sheet)
+
+ #################################################################
+
+ def set_auto_style_outline(self, value):
+ self.__auto_style_outline = int(value)
+
+ def get_auto_style_outline(self):
+ return bool(self.__auto_style_outline)
+
+ auto_style_outline = property(get_auto_style_outline, set_auto_style_outline)
+
+ #################################################################
+
+ def set_outline_below(self, value):
+ self.__outline_below = int(value)
+
+ def get_outline_below(self):
+ return bool(self.__outline_below)
+
+ outline_below = property(get_outline_below, set_outline_below)
+
+ #################################################################
+
+ def set_outline_right(self, value):
+ self.__outline_right = int(value)
+
+ def get_outline_right(self):
+ return bool(self.__outline_right)
+
+ outline_right = property(get_outline_right, set_outline_right)
+
+ #################################################################
+
+ def set_fit_num_pages(self, value):
+ self.__fit_num_pages = value
+
+ def get_fit_num_pages(self):
+ return self.__fit_num_pages
+
+ fit_num_pages = property(get_fit_num_pages, set_fit_num_pages)
+
+ #################################################################
+
+ def set_show_row_outline(self, value):
+ self.__show_row_outline = int(value)
+
+ def get_show_row_outline(self):
+ return bool(self.__show_row_outline)
+
+ show_row_outline = property(get_show_row_outline, set_show_row_outline)
+
+ #################################################################
+
+ def set_show_col_outline(self, value):
+ self.__show_col_outline = int(value)
+
+ def get_show_col_outline(self):
+ return bool(self.__show_col_outline)
+
+ show_col_outline = property(get_show_col_outline, set_show_col_outline)
+
+ #################################################################
+
+ def set_alt_expr_eval(self, value):
+ self.__alt_expr_eval = int(value)
+
+ def get_alt_expr_eval(self):
+ return bool(self.__alt_expr_eval)
+
+ alt_expr_eval = property(get_alt_expr_eval, set_alt_expr_eval)
+
+ #################################################################
+
+ def set_alt_formula_entries(self, value):
+ self.__alt_formula_entries = int(value)
+
+ def get_alt_formula_entries(self):
+ return bool(self.__alt_formula_entries)
+
+ alt_formula_entries = property(get_alt_formula_entries, set_alt_formula_entries)
+
+ #################################################################
+
+ def set_row_default_height(self, value):
+ self.__row_default_height = value
+
+ def get_row_default_height(self):
+ return self.__row_default_height
+
+ row_default_height = property(get_row_default_height, set_row_default_height)
+
+ #################################################################
+
+ def set_col_default_width(self, value):
+ self.__col_default_width = value
+
+ def get_col_default_width(self):
+ return self.__col_default_width
+
+ col_default_width = property(get_col_default_width, set_col_default_width)
+
+ #################################################################
+
+ def set_calc_mode(self, value):
+ self.__calc_mode = value & 0x03
+
+ def get_calc_mode(self):
+ return self.__calc_mode
+
+ calc_mode = property(get_calc_mode, set_calc_mode)
+
+ #################################################################
+
+ def set_calc_count(self, value):
+ self.__calc_count = value
+
+ def get_calc_count(self):
+ return self.__calc_count
+
+ calc_count = property(get_calc_count, set_calc_count)
+
+ #################################################################
+
+ def set_RC_ref_mode(self, value):
+ self.__RC_ref_mode = int(value)
+
+ def get_RC_ref_mode(self):
+ return bool(self.__RC_ref_mode)
+
+ RC_ref_mode = property(get_RC_ref_mode, set_RC_ref_mode)
+
+ #################################################################
+
+ def set_iterations_on(self, value):
+ self.__iterations_on = int(value)
+
+ def get_iterations_on(self):
+ return bool(self.__iterations_on)
+
+ iterations_on = property(get_iterations_on, set_iterations_on)
+
+ #################################################################
+
+ def set_delta(self, value):
+ self.__delta = value
+
+ def get_delta(self):
+ return self.__delta
+
+ delta = property(get_delta, set_delta)
+
+ #################################################################
+
+ def set_save_recalc(self, value):
+ self.__save_recalc = int(value)
+
+ def get_save_recalc(self):
+ return bool(self.__save_recalc)
+
+ save_recalc = property(get_save_recalc, set_save_recalc)
+
+ #################################################################
+
+ def set_print_headers(self, value):
+ self.__print_headers = int(value)
+
+ def get_print_headers(self):
+ return bool(self.__print_headers)
+
+ print_headers = property(get_print_headers, set_print_headers)
+
+ #################################################################
+
+ def set_print_grid(self, value):
+ self.__print_grid = int(value)
+
+ def get_print_grid(self):
+ return bool(self.__print_grid)
+
+ print_grid = property(get_print_grid, set_print_grid)
+
+ #################################################################
+ #
+ #def set_grid_set(self, value):
+ # self.__grid_set = int(value)
+ #
+ #def get_grid_set(self):
+ # return bool(self.__grid_set)
+ #
+ #grid_set = property(get_grid_set, set_grid_set)
+ #
+ #################################################################
+
+ def set_vert_page_breaks(self, value):
+ self.__vert_page_breaks = value
+
+ def get_vert_page_breaks(self):
+ return self.__vert_page_breaks
+
+ vert_page_breaks = property(get_vert_page_breaks, set_vert_page_breaks)
+
+ #################################################################
+
+ def set_horz_page_breaks(self, value):
+ self.__horz_page_breaks = value
+
+ def get_horz_page_breaks(self):
+ return self.__horz_page_breaks
+
+ horz_page_breaks = property(get_horz_page_breaks, set_horz_page_breaks)
+
+ #################################################################
+
+ def set_header_str(self, value):
+ if isinstance(value, str):
+ value = unicode(value, self.__parent.encoding)
+ self.__header_str = value
+
+ def get_header_str(self):
+ return self.__header_str
+
+ header_str = property(get_header_str, set_header_str)
+
+ #################################################################
+
+ def set_footer_str(self, value):
+ if isinstance(value, str):
+ value = unicode(value, self.__parent.encoding)
+ self.__footer_str = value
+
+ def get_footer_str(self):
+ return self.__footer_str
+
+ footer_str = property(get_footer_str, set_footer_str)
+
+ #################################################################
+
+ def set_print_centered_vert(self, value):
+ self.__print_centered_vert = int(value)
+
+ def get_print_centered_vert(self):
+ return bool(self.__print_centered_vert)
+
+ print_centered_vert = property(get_print_centered_vert, set_print_centered_vert)
+
+ #################################################################
+
+ def set_print_centered_horz(self, value):
+ self.__print_centered_horz = int(value)
+
+ def get_print_centered_horz(self):
+ return bool(self.__print_centered_horz)
+
+ print_centered_horz = property(get_print_centered_horz, set_print_centered_horz)
+
+ #################################################################
+
+ def set_left_margin(self, value):
+ self.__left_margin = value
+
+ def get_left_margin(self):
+ return self.__left_margin
+
+ left_margin = property(get_left_margin, set_left_margin)
+
+ #################################################################
+
+ def set_right_margin(self, value):
+ self.__right_margin = value
+
+ def get_right_margin(self):
+ return self.__right_margin
+
+ right_margin = property(get_right_margin, set_right_margin)
+
+ #################################################################
+
+ def set_top_margin(self, value):
+ self.__top_margin = value
+
+ def get_top_margin(self):
+ return self.__top_margin
+
+ top_margin = property(get_top_margin, set_top_margin)
+
+ #################################################################
+
+ def set_bottom_margin(self, value):
+ self.__bottom_margin = value
+
+ def get_bottom_margin(self):
+ return self.__bottom_margin
+
+ bottom_margin = property(get_bottom_margin, set_bottom_margin)
+
+ #################################################################
+
+ def set_paper_size_code(self, value):
+ self.__paper_size_code = value
+
+ def get_paper_size_code(self):
+ return self.__paper_size_code
+
+ paper_size_code = property(get_paper_size_code, set_paper_size_code)
+
+ #################################################################
+
+ def set_print_scaling(self, value):
+ self.__print_scaling = value
+
+ def get_print_scaling(self):
+ return self.__print_scaling
+
+ print_scaling = property(get_print_scaling, set_print_scaling)
+
+ #################################################################
+
+ def set_start_page_number(self, value):
+ self.__start_page_number = value
+
+ def get_start_page_number(self):
+ return self.__start_page_number
+
+ start_page_number = property(get_start_page_number, set_start_page_number)
+
+ #################################################################
+
+ def set_fit_width_to_pages(self, value):
+ self.__fit_width_to_pages = value
+
+ def get_fit_width_to_pages(self):
+ return self.__fit_width_to_pages
+
+ fit_width_to_pages = property(get_fit_width_to_pages, set_fit_width_to_pages)
+
+ #################################################################
+
+ def set_fit_height_to_pages(self, value):
+ self.__fit_height_to_pages = value
+
+ def get_fit_height_to_pages(self):
+ return self.__fit_height_to_pages
+
+ fit_height_to_pages = property(get_fit_height_to_pages, set_fit_height_to_pages)
+
+ #################################################################
+
+ def set_print_in_rows(self, value):
+ self.__print_in_rows = int(value)
+
+ def get_print_in_rows(self):
+ return bool(self.__print_in_rows)
+
+ print_in_rows = property(get_print_in_rows, set_print_in_rows)
+
+ #################################################################
+
+ def set_portrait(self, value):
+ self.__portrait = int(value)
+
+ def get_portrait(self):
+ return bool(self.__portrait)
+
+ portrait = property(get_portrait, set_portrait)
+
+ #################################################################
+
+ def set_print_colour(self, value):
+ self.__print_not_colour = int(not value)
+
+ def get_print_colour(self):
+ return not bool(self.__print_not_colour)
+
+ print_colour = property(get_print_colour, set_print_colour)
+
+ #################################################################
+
+ def set_print_draft(self, value):
+ self.__print_draft = int(value)
+
+ def get_print_draft(self):
+ return bool(self.__print_draft)
+
+ print_draft = property(get_print_draft, set_print_draft)
+
+ #################################################################
+
+ def set_print_notes(self, value):
+ self.__print_notes = int(value)
+
+ def get_print_notes(self):
+ return bool(self.__print_notes)
+
+ print_notes = property(get_print_notes, set_print_notes)
+
+ #################################################################
+
+ def set_print_notes_at_end(self, value):
+ self.__print_notes_at_end = int(value)
+
+ def get_print_notes_at_end(self):
+ return bool(self.__print_notes_at_end)
+
+ print_notes_at_end = property(get_print_notes_at_end, set_print_notes_at_end)
+
+ #################################################################
+
+ def set_print_omit_errors(self, value):
+ self.__print_omit_errors = int(value)
+
+ def get_print_omit_errors(self):
+ return bool(self.__print_omit_errors)
+
+ print_omit_errors = property(get_print_omit_errors, set_print_omit_errors)
+
+ #################################################################
+
+ def set_print_hres(self, value):
+ self.__print_hres = value
+
+ def get_print_hres(self):
+ return self.__print_hres
+
+ print_hres = property(get_print_hres, set_print_hres)
+
+ #################################################################
+
+ def set_print_vres(self, value):
+ self.__print_vres = value
+
+ def get_print_vres(self):
+ return self.__print_vres
+
+ print_vres = property(get_print_vres, set_print_vres)
+
+ #################################################################
+
+ def set_header_margin(self, value):
+ self.__header_margin = value
+
+ def get_header_margin(self):
+ return self.__header_margin
+
+ header_margin = property(get_header_margin, set_header_margin)
+
+ #################################################################
+
+ def set_footer_margin(self, value):
+ self.__footer_margin = value
+
+ def get_footer_margin(self):
+ return self.__footer_margin
+
+ footer_margin = property(get_footer_margin, set_footer_margin)
+
+ #################################################################
+
+ def set_copies_num(self, value):
+ self.__copies_num = value
+
+ def get_copies_num(self):
+ return self.__copies_num
+
+ copies_num = property(get_copies_num, set_copies_num)
+
+ ##################################################################
+
+ def set_wnd_protect(self, value):
+ self.__wnd_protect = int(value)
+
+ def get_wnd_protect(self):
+ return bool(self.__wnd_protect)
+
+ wnd_protect = property(get_wnd_protect, set_wnd_protect)
+
+ #################################################################
+
+ def set_obj_protect(self, value):
+ self.__obj_protect = int(value)
+
+ def get_obj_protect(self):
+ return bool(self.__obj_protect)
+
+ obj_protect = property(get_obj_protect, set_obj_protect)
+
+ #################################################################
+
+ def set_protect(self, value):
+ self.__protect = int(value)
+
+ def get_protect(self):
+ return bool(self.__protect)
+
+ protect = property(get_protect, set_protect)
+
+ #################################################################
+
+ def set_scen_protect(self, value):
+ self.__scen_protect = int(value)
+
+ def get_scen_protect(self):
+ return bool(self.__scen_protect)
+
+ scen_protect = property(get_scen_protect, set_scen_protect)
+
+ #################################################################
+
+ def set_password(self, value):
+ self.__password = value
+
+ def get_password(self):
+ return self.__password
+
+ password = property(get_password, set_password)
+
+ ##################################################################
+ ## Methods
+ ##################################################################
+
+ def get_parent(self):
+ return self.__parent
+
+ def write(self, r, c, label="", style=Style.default_style):
+ self.row(r).write(c, label, style)
+
+ def merge(self, r1, r2, c1, c2, style=Style.default_style):
+ # Stand-alone merge of previously written cells.
+ # Problems: (1) style to be used should be existing style of
+ # the top-left cell, not an arg.
+ # (2) should ensure that any previous data value in
+ # non-top-left cells is nobbled.
+ # Note: if a cell is set by a data record then later
+ # is referenced by a [MUL]BLANK record, Excel will blank
+ # out the cell on the screen, but OOo & Gnu will not
+ # blank it out. Need to do something better than writing
+ # multiple records. In the meantime, avoid this method and use
+ # write_merge() instead.
+ if c2 > c1:
+ self.row(r1).write_blanks(c1 + 1, c2, style)
+ for r in range(r1+1, r2+1):
+ self.row(r).write_blanks(c1, c2, style)
+ self.__merged_ranges.append((r1, r2, c1, c2))
+
+ def write_merge(self, r1, r2, c1, c2, label="", style=Style.default_style):
+ assert 0 <= c1 <= c2 <= 255
+ assert 0 <= r1 <= r2 <= 65535
+ self.write(r1, c1, label, style)
+ if c2 > c1:
+ self.row(r1).write_blanks(c1 + 1, c2, style) # skip (r1, c1)
+ for r in range(r1+1, r2+1):
+ self.row(r).write_blanks(c1, c2, style)
+ self.__merged_ranges.append((r1, r2, c1, c2))
+
+ def insert_bitmap(self, filename, row, col, x = 0, y = 0, scale_x = 1, scale_y = 1):
+ bmp = Bitmap.ImDataBmpRecord(filename)
+ obj = Bitmap.ObjBmpRecord(row, col, self, bmp, x, y, scale_x, scale_y)
+
+ self.__bmp_rec += obj.get() + bmp.get()
+
+ def col(self, indx):
+ if indx not in self.__cols:
+ self.__cols[indx] = self.Column(indx, self)
+ return self.__cols[indx]
+
+ def row(self, indx):
+ if indx not in self.__rows:
+ if indx in self.__flushed_rows:
+ raise Exception("Attempt to reuse row index %d of sheet %r after flushing" % (indx, self.__name))
+ self.__rows[indx] = self.Row(indx, self)
+ if indx > self.last_used_row:
+ self.last_used_row = indx
+ if indx < self.first_used_row:
+ self.first_used_row = indx
+ return self.__rows[indx]
+
+ def row_height(self, row): # in pixels
+ if row in self.__rows:
+ return self.__rows[row].get_height_in_pixels()
+ else:
+ return 17
+
+ def col_width(self, col): # in pixels
+ if col in self.__cols:
+ return self.__cols[col].width_in_pixels()
+ else:
+ return 64
+
+
+ ##################################################################
+ ## BIFF records generation
+ ##################################################################
+
+ def __bof_rec(self):
+ return BIFFRecords.Biff8BOFRecord(BIFFRecords.Biff8BOFRecord.WORKSHEET).get()
+
+ def __update_row_visible_levels(self):
+ if self.__rows:
+ temp = max([self.__rows[r].level for r in self.__rows]) + 1
+ self.__row_visible_levels = max(temp, self.__row_visible_levels)
+
+ def __guts_rec(self):
+ self.__update_row_visible_levels()
+ col_visible_levels = 0
+ if len(self.__cols) != 0:
+ col_visible_levels = max([self.__cols[c].level for c in self.__cols]) + 1
+ return BIFFRecords.GutsRecord(
+ self.__row_gut_width, self.__col_gut_height, self.__row_visible_levels, col_visible_levels).get()
+
+ def __defaultrowheight_rec(self):
+ options = 0x0000
+ options |= (self.row_default_height_mismatch & 1) << 0
+ options |= (self.row_default_hidden & 1) << 1
+ options |= (self.row_default_space_above & 1) << 2
+ options |= (self.row_default_space_below & 1) << 3
+ defht = self.__row_default_height
+ return BIFFRecords.DefaultRowHeightRecord(options, defht).get()
+
+ def __wsbool_rec(self):
+ options = 0x00
+ options |= (self.__show_auto_page_breaks & 0x01) << 0
+ options |= (self.__dialogue_sheet & 0x01) << 4
+ options |= (self.__auto_style_outline & 0x01) << 5
+ options |= (self.__outline_below & 0x01) << 6
+ options |= (self.__outline_right & 0x01) << 7
+ options |= (self.__fit_num_pages & 0x01) << 8
+ options |= (self.__show_row_outline & 0x01) << 10
+ options |= (self.__show_col_outline & 0x01) << 11
+ options |= (self.__alt_expr_eval & 0x01) << 14
+ options |= (self.__alt_formula_entries & 0x01) << 15
+
+ return BIFFRecords.WSBoolRecord(options).get()
+
+ def __eof_rec(self):
+ return BIFFRecords.EOFRecord().get()
+
+ def __colinfo_rec(self):
+ result = ''
+ for col in self.__cols:
+ result += self.__cols[col].get_biff_record()
+ return result
+
+ def __dimensions_rec(self):
+ return BIFFRecords.DimensionsRecord(
+ self.first_used_row, self.last_used_row,
+ self.first_used_col, self.last_used_col
+ ).get()
+
+ def __window2_rec(self):
+ # Appends SCL record.
+ options = 0
+ options |= (self.__show_formulas & 0x01) << 0
+ options |= (self.__show_grid & 0x01) << 1
+ options |= (self.__show_headers & 0x01) << 2
+ options |= (self.__panes_frozen & 0x01) << 3
+ options |= (self.show_zero_values & 0x01) << 4
+ options |= (self.__auto_colour_grid & 0x01) << 5
+ options |= (self.__cols_right_to_left & 0x01) << 6
+ options |= (self.__show_outline & 0x01) << 7
+ options |= (self.__remove_splits & 0x01) << 8
+ options |= (self.__selected & 0x01) << 9
+ options |= (self.__sheet_visible & 0x01) << 10
+ options |= (self.__page_preview & 0x01) << 11
+ if self.__page_preview:
+ scl_magn = self.__preview_magn
+ else:
+ scl_magn = self.__normal_magn
+ return BIFFRecords.Window2Record(
+ options, self.__first_visible_row, self.__first_visible_col,
+ self.__grid_colour,
+ self.__preview_magn, self.__normal_magn, scl_magn).get()
+
+ def __panes_rec(self):
+ if self.__vert_split_pos is None and self.__horz_split_pos is None:
+ return ""
+
+ if self.__vert_split_pos is None:
+ self.__vert_split_pos = 0
+ if self.__horz_split_pos is None:
+ self.__horz_split_pos = 0
+
+ if self.__panes_frozen:
+ if self.__vert_split_first_visible is None:
+ self.__vert_split_first_visible = self.__vert_split_pos
+ if self.__horz_split_first_visible is None:
+ self.__horz_split_first_visible = self.__horz_split_pos
+ else:
+ if self.__vert_split_first_visible is None:
+ self.__vert_split_first_visible = 0
+ if self.__horz_split_first_visible is None:
+ self.__horz_split_first_visible = 0
+ # inspired by pyXLWriter
+ self.__horz_split_pos = 20*self.__horz_split_pos + 255
+ self.__vert_split_pos = 113.879*self.__vert_split_pos + 390
+
+ if self.__vert_split_pos > 0 and self.__horz_split_pos > 0:
+ self.__split_active_pane = 0
+ elif self.__vert_split_pos > 0 and self.__horz_split_pos == 0:
+ self.__split_active_pane = 1
+ elif self.__vert_split_pos == 0 and self.__horz_split_pos > 0:
+ self.__split_active_pane = 2
+ else:
+ self.__split_active_pane = 3
+
+ result = BIFFRecords.PanesRecord(self.__vert_split_pos,
+ self.__horz_split_pos,
+ self.__horz_split_first_visible,
+ self.__vert_split_first_visible,
+ self.__split_active_pane).get()
+ return result
+
+ def __row_blocks_rec(self):
+ result = []
+ for row in self.__rows.itervalues():
+ result.append(row.get_row_biff_data())
+ result.append(row.get_cells_biff_data())
+ return ''.join(result)
+
+ def __merged_rec(self):
+ return BIFFRecords.MergedCellsRecord(self.__merged_ranges).get()
+
+ def __bitmaps_rec(self):
+ return self.__bmp_rec
+
+ def __calc_settings_rec(self):
+ result = ''
+ result += BIFFRecords.CalcModeRecord(self.__calc_mode & 0x01).get()
+ result += BIFFRecords.CalcCountRecord(self.__calc_count & 0xFFFF).get()
+ result += BIFFRecords.RefModeRecord(self.__RC_ref_mode & 0x01).get()
+ result += BIFFRecords.IterationRecord(self.__iterations_on & 0x01).get()
+ result += BIFFRecords.DeltaRecord(self.__delta).get()
+ result += BIFFRecords.SaveRecalcRecord(self.__save_recalc & 0x01).get()
+ return result
+
+ def __print_settings_rec(self):
+ result = ''
+ result += BIFFRecords.PrintHeadersRecord(self.__print_headers).get()
+ result += BIFFRecords.PrintGridLinesRecord(self.__print_grid).get()
+ result += BIFFRecords.GridSetRecord(self.__grid_set).get()
+ result += BIFFRecords.HorizontalPageBreaksRecord(self.__horz_page_breaks).get()
+ result += BIFFRecords.VerticalPageBreaksRecord(self.__vert_page_breaks).get()
+ result += BIFFRecords.HeaderRecord(self.__header_str).get()
+ result += BIFFRecords.FooterRecord(self.__footer_str).get()
+ result += BIFFRecords.HCenterRecord(self.__print_centered_horz).get()
+ result += BIFFRecords.VCenterRecord(self.__print_centered_vert).get()
+ result += BIFFRecords.LeftMarginRecord(self.__left_margin).get()
+ result += BIFFRecords.RightMarginRecord(self.__right_margin).get()
+ result += BIFFRecords.TopMarginRecord(self.__top_margin).get()
+ result += BIFFRecords.BottomMarginRecord(self.__bottom_margin).get()
+
+ setup_page_options = (self.__print_in_rows & 0x01) << 0
+ setup_page_options |= (self.__portrait & 0x01) << 1
+ setup_page_options |= (0x00 & 0x01) << 2
+ setup_page_options |= (self.__print_not_colour & 0x01) << 3
+ setup_page_options |= (self.__print_draft & 0x01) << 4
+ setup_page_options |= (self.__print_notes & 0x01) << 5
+ setup_page_options |= (0x00 & 0x01) << 6
+ setup_page_options |= (0x01 & 0x01) << 7
+ setup_page_options |= (self.__print_notes_at_end & 0x01) << 9
+ setup_page_options |= (self.__print_omit_errors & 0x03) << 10
+
+ result += BIFFRecords.SetupPageRecord(self.__paper_size_code,
+ self.__print_scaling,
+ self.__start_page_number,
+ self.__fit_width_to_pages,
+ self.__fit_height_to_pages,
+ setup_page_options,
+ self.__print_hres,
+ self.__print_vres,
+ self.__header_margin,
+ self.__footer_margin,
+ self.__copies_num).get()
+ return result
+
+ def __protection_rec(self):
+ result = ''
+ result += BIFFRecords.ProtectRecord(self.__protect).get()
+ result += BIFFRecords.ScenProtectRecord(self.__scen_protect).get()
+ result += BIFFRecords.WindowProtectRecord(self.__wnd_protect).get()
+ result += BIFFRecords.ObjectProtectRecord(self.__obj_protect).get()
+ result += BIFFRecords.PasswordRecord(self.__password).get()
+ return result
+
+ def get_biff_data(self):
+ result = [
+ self.__bof_rec(),
+ self.__calc_settings_rec(),
+ self.__guts_rec(),
+ self.__defaultrowheight_rec(),
+ self.__wsbool_rec(),
+ self.__colinfo_rec(),
+ self.__dimensions_rec(),
+ self.__print_settings_rec(),
+ self.__protection_rec(),
+ ]
+ if self.row_tempfile:
+ self.row_tempfile.flush()
+ self.row_tempfile.seek(0)
+ result.append(self.row_tempfile.read())
+ result.extend([
+ self.__row_blocks_rec(),
+ self.__merged_rec(),
+ self.__bitmaps_rec(),
+ self.__window2_rec(),
+ self.__panes_rec(),
+ self.__eof_rec(),
+ ])
+ return ''.join(result)
+
+ def flush_row_data(self):
+ if self.row_tempfile is None:
+ self.row_tempfile = tempfile.TemporaryFile()
+ self.row_tempfile.write(self.__row_blocks_rec())
+ for rowx in self.__rows:
+ self.__flushed_rows[rowx] = 1
+ self.__update_row_visible_levels()
+ self.__rows = {}
+
+
diff --git a/tablib/packages/xlwt/__init__.py b/tablib/packages/xlwt/__init__.py
index ee8373e..dcc23f0 100644
--- a/tablib/packages/xlwt/__init__.py
+++ b/tablib/packages/xlwt/__init__.py
@@ -1,9 +1,16 @@
-import sys
-
-from .Workbook import Workbook
-from .Worksheet import Worksheet
-from .Row import Row
-from .Column import Column
-from .Formatting import Font, Alignment, Borders, Pattern, Protection
-from .Style import XFStyle, easyxf
-from .ExcelFormula import *
+# -*- coding: windows-1252 -*-
+
+__VERSION__ = '0.7.2'
+
+import sys
+if sys.version_info[:2] < (2, 3):
+ print >> sys.stderr, "Sorry, xlwt requires Python 2.3 or later"
+ sys.exit(1)
+
+from Workbook import Workbook
+from Worksheet import Worksheet
+from Row import Row
+from Column import Column
+from Formatting import Font, Alignment, Borders, Pattern, Protection
+from Style import XFStyle, easyxf
+from ExcelFormula import *
diff --git a/tablib/packages/xlwt/antlr.py b/tablib/packages/xlwt/antlr.py
index 1f37f64..aaad447 100644
--- a/tablib/packages/xlwt/antlr.py
+++ b/tablib/packages/xlwt/antlr.py
@@ -1,2869 +1,2874 @@
-## This file is part of PyANTLR. See LICENSE.txt for license
-## details..........Copyright (C) Wolfgang Haefelinger, 2004.
-
-## This file was copied for use with xlwt from the 2.7.7 ANTLR distribution. Yes, it
-## says 2.7.5 below. The 2.7.5 distribution version didn't have a
-## version in it.
-
-## Here is the contents of the ANTLR 2.7.7 LICENSE.txt referred to above.
-
-# SOFTWARE RIGHTS
-#
-# ANTLR 1989-2006 Developed by Terence Parr
-# Partially supported by University of San Francisco & jGuru.com
-#
-# We reserve no legal rights to the ANTLR--it is fully in the
-# public domain. An individual or company may do whatever
-# they wish with source code distributed with ANTLR or the
-# code generated by ANTLR, including the incorporation of
-# ANTLR, or its output, into commerical software.
-#
-# We encourage users to develop software with ANTLR. However,
-# we do ask that credit is given to us for developing
-# ANTLR. By "credit", we mean that if you use ANTLR or
-# incorporate any source code into one of your programs
-# (commercial product, research project, or otherwise) that
-# you acknowledge this fact somewhere in the documentation,
-# research report, etc... If you like ANTLR and have
-# developed a nice tool with the output, please mention that
-# you developed it using ANTLR. In addition, we ask that the
-# headers remain intact in our source code. As long as these
-# guidelines are kept, we expect to continue enhancing this
-# system and expect to make other tools available as they are
-# completed.
-#
-# The primary ANTLR guy:
-#
-# Terence Parr
-# parrt@cs.usfca.edu
-# parrt@antlr.org
-
-## End of contents of the ANTLR 2.7.7 LICENSE.txt ########################
-
-## get sys module
-import sys
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### global symbols ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-### ANTLR Standard Tokens
-SKIP = -1
-INVALID_TYPE = 0
-EOF_TYPE = 1
-EOF = 1
-NULL_TREE_LOOKAHEAD = 3
-MIN_USER_TYPE = 4
-
-### ANTLR's EOF Symbol
-EOF_CHAR = ''
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### general functions ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-## Version should be automatically derived from configure.in. For now,
-## we need to bump it ourselfs. Don't remove the <version> tags.
-## <version>
-def version():
- r = {
- 'major' : '2',
- 'minor' : '7',
- 'micro' : '5',
- 'patch' : '' ,
- 'version': '2.7.5'
- }
- return r
-## </version>
-
-def error(fmt,*args):
- if fmt:
- print("error: ", fmt % tuple(args))
-
-def ifelse(cond,_then,_else):
- if cond :
- r = _then
- else:
- r = _else
- return r
-
-def is_string_type(x):
- # return (isinstance(x,str) or isinstance(x,unicode))
- # Simplify; xlwt doesn't support Python < 2.3
- return isinstance(str)
-
-def assert_string_type(x):
- assert is_string_type(x)
- pass
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### ANTLR Exceptions ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class ANTLRException(Exception):
-
- def __init__(self, *args):
- Exception.__init__(self, *args)
-
-
-class RecognitionException(ANTLRException):
-
- def __init__(self, *args):
- ANTLRException.__init__(self, *args)
- self.fileName = None
- self.line = -1
- self.column = -1
- if len(args) >= 2:
- self.fileName = args[1]
- if len(args) >= 3:
- self.line = args[2]
- if len(args) >= 4:
- self.column = args[3]
-
- def __str__(self):
- buf = ['']
- if self.fileName:
- buf.append(self.fileName + ":")
- if self.line != -1:
- if not self.fileName:
- buf.append("line ")
- buf.append(str(self.line))
- if self.column != -1:
- buf.append(":" + str(self.column))
- buf.append(":")
- buf.append(" ")
- return str('').join(buf)
-
- __repr__ = __str__
-
-
-class NoViableAltException(RecognitionException):
-
- def __init__(self, *args):
- RecognitionException.__init__(self, *args)
- self.token = None
- self.node = None
- if isinstance(args[0],AST):
- self.node = args[0]
- elif isinstance(args[0],Token):
- self.token = args[0]
- else:
- raise TypeError("NoViableAltException requires Token or AST argument")
-
- def __str__(self):
- if self.token:
- line = self.token.getLine()
- col = self.token.getColumn()
- text = self.token.getText()
- return "unexpected symbol at line %s (column %s): \"%s\"" % (line,col,text)
- if self.node == ASTNULL:
- return "unexpected end of subtree"
- assert self.node
- ### hackish, we assume that an AST contains method getText
- return "unexpected node: %s" % (self.node.getText())
-
- __repr__ = __str__
-
-
-class NoViableAltForCharException(RecognitionException):
-
- def __init__(self, *args):
- self.foundChar = None
- if len(args) == 2:
- self.foundChar = args[0]
- scanner = args[1]
- RecognitionException.__init__(self, "NoViableAlt",
- scanner.getFilename(),
- scanner.getLine(),
- scanner.getColumn())
- elif len(args) == 4:
- self.foundChar = args[0]
- fileName = args[1]
- line = args[2]
- column = args[3]
- RecognitionException.__init__(self, "NoViableAlt",
- fileName, line, column)
- else:
- RecognitionException.__init__(self, "NoViableAlt",
- '', -1, -1)
-
- def __str__(self):
- mesg = "unexpected char: "
- if self.foundChar >= ' ' and self.foundChar <= '~':
- mesg += "'" + self.foundChar + "'"
- elif self.foundChar:
- mesg += "0x" + hex(ord(self.foundChar)).upper()[2:]
- else:
- mesg += "<None>"
- return mesg
-
- __repr__ = __str__
-
-
-class SemanticException(RecognitionException):
-
- def __init__(self, *args):
- RecognitionException.__init__(self, *args)
-
-
-class MismatchedCharException(RecognitionException):
-
- NONE = 0
- CHAR = 1
- NOT_CHAR = 2
- RANGE = 3
- NOT_RANGE = 4
- SET = 5
- NOT_SET = 6
-
- def __init__(self, *args):
- self.args = args
- if len(args) == 5:
- # Expected range / not range
- if args[3]:
- self.mismatchType = MismatchedCharException.NOT_RANGE
- else:
- self.mismatchType = MismatchedCharException.RANGE
- self.foundChar = args[0]
- self.expecting = args[1]
- self.upper = args[2]
- self.scanner = args[4]
- RecognitionException.__init__(self, "Mismatched char range",
- self.scanner.getFilename(),
- self.scanner.getLine(),
- self.scanner.getColumn())
- elif len(args) == 4 and is_string_type(args[1]):
- # Expected char / not char
- if args[2]:
- self.mismatchType = MismatchedCharException.NOT_CHAR
- else:
- self.mismatchType = MismatchedCharException.CHAR
- self.foundChar = args[0]
- self.expecting = args[1]
- self.scanner = args[3]
- RecognitionException.__init__(self, "Mismatched char",
- self.scanner.getFilename(),
- self.scanner.getLine(),
- self.scanner.getColumn())
- elif len(args) == 4 and isinstance(args[1], BitSet):
- # Expected BitSet / not BitSet
- if args[2]:
- self.mismatchType = MismatchedCharException.NOT_SET
- else:
- self.mismatchType = MismatchedCharException.SET
- self.foundChar = args[0]
- self.set = args[1]
- self.scanner = args[3]
- RecognitionException.__init__(self, "Mismatched char set",
- self.scanner.getFilename(),
- self.scanner.getLine(),
- self.scanner.getColumn())
- else:
- self.mismatchType = MismatchedCharException.NONE
- RecognitionException.__init__(self, "Mismatched char")
-
- ## Append a char to the msg buffer. If special,
- # then show escaped version
- #
- def appendCharName(self, sb, c):
- if not c or c == 65535:
- # 65535 = (char) -1 = EOF
- sb.append("'<EOF>'")
- elif c == '\n':
- sb.append("'\\n'")
- elif c == '\r':
- sb.append("'\\r'");
- elif c == '\t':
- sb.append("'\\t'")
- else:
- sb.append('\'' + c + '\'')
-
- ##
- # Returns an error message with line number/column information
- #
- def __str__(self):
- sb = ['']
- sb.append(RecognitionException.__str__(self))
-
- if self.mismatchType == MismatchedCharException.CHAR:
- sb.append("expecting ")
- self.appendCharName(sb, self.expecting)
- sb.append(", found ")
- self.appendCharName(sb, self.foundChar)
- elif self.mismatchType == MismatchedCharException.NOT_CHAR:
- sb.append("expecting anything but '")
- self.appendCharName(sb, self.expecting)
- sb.append("'; got it anyway")
- elif self.mismatchType in [MismatchedCharException.RANGE, MismatchedCharException.NOT_RANGE]:
- sb.append("expecting char ")
- if self.mismatchType == MismatchedCharException.NOT_RANGE:
- sb.append("NOT ")
- sb.append("in range: ")
- appendCharName(sb, self.expecting)
- sb.append("..")
- appendCharName(sb, self.upper)
- sb.append(", found ")
- appendCharName(sb, self.foundChar)
- elif self.mismatchType in [MismatchedCharException.SET, MismatchedCharException.NOT_SET]:
- sb.append("expecting ")
- if self.mismatchType == MismatchedCharException.NOT_SET:
- sb.append("NOT ")
- sb.append("one of (")
- for i in range(len(self.set)):
- self.appendCharName(sb, self.set[i])
- sb.append("), found ")
- self.appendCharName(sb, self.foundChar)
-
- return str().join(sb).strip()
-
- __repr__ = __str__
-
-
-class MismatchedTokenException(RecognitionException):
-
- NONE = 0
- TOKEN = 1
- NOT_TOKEN = 2
- RANGE = 3
- NOT_RANGE = 4
- SET = 5
- NOT_SET = 6
-
- def __init__(self, *args):
- self.args = args
- self.tokenNames = []
- self.token = None
- self.tokenText = ''
- self.node = None
- if len(args) == 6:
- # Expected range / not range
- if args[3]:
- self.mismatchType = MismatchedTokenException.NOT_RANGE
- else:
- self.mismatchType = MismatchedTokenException.RANGE
- self.tokenNames = args[0]
- self.expecting = args[2]
- self.upper = args[3]
- self.fileName = args[5]
-
- elif len(args) == 4 and isinstance(args[2], int):
- # Expected token / not token
- if args[3]:
- self.mismatchType = MismatchedTokenException.NOT_TOKEN
- else:
- self.mismatchType = MismatchedTokenException.TOKEN
- self.tokenNames = args[0]
- self.expecting = args[2]
-
- elif len(args) == 4 and isinstance(args[2], BitSet):
- # Expected BitSet / not BitSet
- if args[3]:
- self.mismatchType = MismatchedTokenException.NOT_SET
- else:
- self.mismatchType = MismatchedTokenException.SET
- self.tokenNames = args[0]
- self.set = args[2]
-
- else:
- self.mismatchType = MismatchedTokenException.NONE
- RecognitionException.__init__(self, "Mismatched Token: expecting any AST node", "<AST>", -1, -1)
-
- if len(args) >= 2:
- if isinstance(args[1],Token):
- self.token = args[1]
- self.tokenText = self.token.getText()
- RecognitionException.__init__(self, "Mismatched Token",
- self.fileName,
- self.token.getLine(),
- self.token.getColumn())
- elif isinstance(args[1],AST):
- self.node = args[1]
- self.tokenText = str(self.node)
- RecognitionException.__init__(self, "Mismatched Token",
- "<AST>",
- self.node.getLine(),
- self.node.getColumn())
- else:
- self.tokenText = "<empty tree>"
- RecognitionException.__init__(self, "Mismatched Token",
- "<AST>", -1, -1)
-
- def appendTokenName(self, sb, tokenType):
- if tokenType == INVALID_TYPE:
- sb.append("<Set of tokens>")
- elif tokenType < 0 or tokenType >= len(self.tokenNames):
- sb.append("<" + str(tokenType) + ">")
- else:
- sb.append(self.tokenNames[tokenType])
-
- ##
- # Returns an error message with line number/column information
- #
- def __str__(self):
- sb = ['']
- sb.append(RecognitionException.__str__(self))
-
- if self.mismatchType == MismatchedTokenException.TOKEN:
- sb.append("expecting ")
- self.appendTokenName(sb, self.expecting)
- sb.append(", found " + self.tokenText)
- elif self.mismatchType == MismatchedTokenException.NOT_TOKEN:
- sb.append("expecting anything but '")
- self.appendTokenName(sb, self.expecting)
- sb.append("'; got it anyway")
- elif self.mismatchType in [MismatchedTokenException.RANGE, MismatchedTokenException.NOT_RANGE]:
- sb.append("expecting token ")
- if self.mismatchType == MismatchedTokenException.NOT_RANGE:
- sb.append("NOT ")
- sb.append("in range: ")
- appendTokenName(sb, self.expecting)
- sb.append("..")
- appendTokenName(sb, self.upper)
- sb.append(", found " + self.tokenText)
- elif self.mismatchType in [MismatchedTokenException.SET, MismatchedTokenException.NOT_SET]:
- sb.append("expecting ")
- if self.mismatchType == MismatchedTokenException.NOT_SET:
- sb.append("NOT ")
- sb.append("one of (")
- for i in range(len(self.set)):
- self.appendTokenName(sb, self.set[i])
- sb.append("), found " + self.tokenText)
-
- return str().join(sb).strip()
-
- __repr__ = __str__
-
-
-class TokenStreamException(ANTLRException):
-
- def __init__(self, *args):
- ANTLRException.__init__(self, *args)
-
-
-# Wraps an Exception in a TokenStreamException
-class TokenStreamIOException(TokenStreamException):
-
- def __init__(self, *args):
- if args and isinstance(args[0], Exception):
- io = args[0]
- TokenStreamException.__init__(self, str(io))
- self.io = io
- else:
- TokenStreamException.__init__(self, *args)
- self.io = self
-
-
-# Wraps a RecognitionException in a TokenStreamException
-class TokenStreamRecognitionException(TokenStreamException):
-
- def __init__(self, *args):
- if args and isinstance(args[0], RecognitionException):
- recog = args[0]
- TokenStreamException.__init__(self, str(recog))
- self.recog = recog
- else:
- raise TypeError("TokenStreamRecognitionException requires RecognitionException argument")
-
- def __str__(self):
- return str(self.recog)
-
- __repr__ = __str__
-
-
-class TokenStreamRetryException(TokenStreamException):
-
- def __init__(self, *args):
- TokenStreamException.__init__(self, *args)
-
-
-class CharStreamException(ANTLRException):
-
- def __init__(self, *args):
- ANTLRException.__init__(self, *args)
-
-
-# Wraps an Exception in a CharStreamException
-class CharStreamIOException(CharStreamException):
-
- def __init__(self, *args):
- if args and isinstance(args[0], Exception):
- io = args[0]
- CharStreamException.__init__(self, str(io))
- self.io = io
- else:
- CharStreamException.__init__(self, *args)
- self.io = self
-
-
-class TryAgain(Exception):
- pass
-
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### Token ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class Token(object):
- SKIP = -1
- INVALID_TYPE = 0
- EOF_TYPE = 1
- EOF = 1
- NULL_TREE_LOOKAHEAD = 3
- MIN_USER_TYPE = 4
-
- def __init__(self,**argv):
- try:
- self.type = argv['type']
- except:
- self.type = INVALID_TYPE
- try:
- self.text = argv['text']
- except:
- self.text = "<no text>"
-
- def isEOF(self):
- return (self.type == EOF_TYPE)
-
- def getColumn(self):
- return 0
-
- def getLine(self):
- return 0
-
- def getFilename(self):
- return None
-
- def setFilename(self,name):
- return self
-
- def getText(self):
- return "<no text>"
-
- def setText(self,text):
- if is_string_type(text):
- pass
- else:
- raise TypeError("Token.setText requires string argument")
- return self
-
- def setColumn(self,column):
- return self
-
- def setLine(self,line):
- return self
-
- def getType(self):
- return self.type
-
- def setType(self,type):
- if isinstance(type,int):
- self.type = type
- else:
- raise TypeError("Token.setType requires integer argument")
- return self
-
- def toString(self):
- ## not optimal
- type_ = self.type
- if type_ == 3:
- tval = 'NULL_TREE_LOOKAHEAD'
- elif type_ == 1:
- tval = 'EOF_TYPE'
- elif type_ == 0:
- tval = 'INVALID_TYPE'
- elif type_ == -1:
- tval = 'SKIP'
- else:
- tval = type_
- return '["%s",<%s>]' % (self.getText(),tval)
-
- __str__ = toString
- __repr__ = toString
-
-### static attribute ..
-Token.badToken = Token( type=INVALID_TYPE, text="<no text>")
-
-if __name__ == "__main__":
- print("testing ..")
- T = Token.badToken
- print(T)
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### CommonToken ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class CommonToken(Token):
-
- def __init__(self,**argv):
- Token.__init__(self,**argv)
- self.line = 0
- self.col = 0
- try:
- self.line = argv['line']
- except:
- pass
- try:
- self.col = argv['col']
- except:
- pass
-
- def getLine(self):
- return self.line
-
- def getText(self):
- return self.text
-
- def getColumn(self):
- return self.col
-
- def setLine(self,line):
- self.line = line
- return self
-
- def setText(self,text):
- self.text = text
- return self
-
- def setColumn(self,col):
- self.col = col
- return self
-
- def toString(self):
- ## not optimal
- type_ = self.type
- if type_ == 3:
- tval = 'NULL_TREE_LOOKAHEAD'
- elif type_ == 1:
- tval = 'EOF_TYPE'
- elif type_ == 0:
- tval = 'INVALID_TYPE'
- elif type_ == -1:
- tval = 'SKIP'
- else:
- tval = type_
- d = {
- 'text' : self.text,
- 'type' : tval,
- 'line' : self.line,
- 'colm' : self.col
- }
-
- fmt = '["%(text)s",<%(type)s>,line=%(line)s,col=%(colm)s]'
- return fmt % d
-
- __str__ = toString
- __repr__ = toString
-
-
-if __name__ == '__main__' :
- T = CommonToken()
- print(T)
- T = CommonToken(col=15,line=1,text="some text", type=5)
- print(T)
- T = CommonToken()
- T.setLine(1).setColumn(15).setText("some text").setType(5)
- print(T)
- print(T.getLine())
- print(T.getColumn())
- print(T.getText())
- print(T.getType())
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### CommonHiddenStreamToken ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class CommonHiddenStreamToken(CommonToken):
- def __init__(self,*args):
- CommonToken.__init__(self,*args)
- self.hiddenBefore = None
- self.hiddenAfter = None
-
- def getHiddenAfter(self):
- return self.hiddenAfter
-
- def getHiddenBefore(self):
- return self.hiddenBefore
-
- def setHiddenAfter(self,t):
- self.hiddenAfter = t
-
- def setHiddenBefore(self, t):
- self.hiddenBefore = t
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### Queue ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-## Shall be a circular buffer on tokens ..
-class Queue(object):
-
- def __init__(self):
- self.buffer = [] # empty list
-
- def append(self,item):
- self.buffer.append(item)
-
- def elementAt(self,index):
- return self.buffer[index]
-
- def reset(self):
- self.buffer = []
-
- def removeFirst(self):
- self.buffer.pop(0)
-
- def length(self):
- return len(self.buffer)
-
- def __str__(self):
- return str(self.buffer)
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### InputBuffer ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class InputBuffer(object):
- def __init__(self):
- self.nMarkers = 0
- self.markerOffset = 0
- self.numToConsume = 0
- self.queue = Queue()
-
- def __str__(self):
- return "(%s,%s,%s,%s)" % (
- self.nMarkers,
- self.markerOffset,
- self.numToConsume,
- self.queue)
-
- def __repr__(self):
- return str(self)
-
- def commit(self):
- self.nMarkers -= 1
-
- def consume(self) :
- self.numToConsume += 1
-
- ## probably better to return a list of items
- ## because of unicode. Or return a unicode
- ## string ..
- def getLAChars(self) :
- i = self.markerOffset
- n = self.queue.length()
- s = ''
- while i<n:
- s += self.queue.elementAt(i)
- return s
-
- ## probably better to return a list of items
- ## because of unicode chars
- def getMarkedChars(self) :
- s = ''
- i = 0
- n = self.markerOffset
- while i<n:
- s += self.queue.elementAt(i)
- return s
-
- def isMarked(self) :
- return self.nMarkers != 0
-
- def fill(self,k):
- ### abstract method
- raise NotImplementedError()
-
- def LA(self,k) :
- self.fill(k)
- return self.queue.elementAt(self.markerOffset + k - 1)
-
- def mark(self) :
- self.syncConsume()
- self.nMarkers += 1
- return self.markerOffset
-
- def rewind(self,mark) :
- self.syncConsume()
- self.markerOffset = mark
- self.nMarkers -= 1
-
- def reset(self) :
- self.nMarkers = 0
- self.markerOffset = 0
- self.numToConsume = 0
- self.queue.reset()
-
- def syncConsume(self) :
- while self.numToConsume > 0:
- if self.nMarkers > 0:
- # guess mode -- leave leading characters and bump offset.
- self.markerOffset += 1
- else:
- # normal mode -- remove first character
- self.queue.removeFirst()
- self.numToConsume -= 1
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### CharBuffer ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class CharBuffer(InputBuffer):
- def __init__(self,reader):
- ##assert isinstance(reader,file)
- super(CharBuffer,self).__init__()
- ## a reader is supposed to be anything that has
- ## a method 'read(int)'.
- self.input = reader
-
- def __str__(self):
- base = super(CharBuffer,self).__str__()
- return "CharBuffer{%s,%s" % (base,str(input))
-
- def fill(self,amount):
- try:
- self.syncConsume()
- while self.queue.length() < (amount + self.markerOffset) :
- ## retrieve just one char - what happend at end
- ## of input?
- c = self.input.read(1)
- ### python's behaviour is to return the empty string on
- ### EOF, ie. no exception whatsoever is thrown. An empty
- ### python string has the nice feature that it is of
- ### type 'str' and "not ''" would return true. Contrary,
- ### one can't do this: '' in 'abc'. This should return
- ### false, but all we get is then a TypeError as an
- ### empty string is not a character.
-
- ### Let's assure then that we have either seen a
- ### character or an empty string (EOF).
- assert len(c) == 0 or len(c) == 1
-
- ### And it shall be of type string (ASCII or UNICODE).
- assert is_string_type(c)
-
- ### Just append EOF char to buffer. Note that buffer may
- ### contain then just more than one EOF char ..
-
- ### use unicode chars instead of ASCII ..
- self.queue.append(c)
- except Exception as e:
- raise CharStreamIOException(e)
- ##except: # (mk) Cannot happen ...
- ##error ("unexpected exception caught ..")
- ##assert 0
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### LexerSharedInputState ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class LexerSharedInputState(object):
- def __init__(self,ibuf):
- assert isinstance(ibuf,InputBuffer)
- self.input = ibuf
- self.column = 1
- self.line = 1
- self.tokenStartColumn = 1
- self.tokenStartLine = 1
- self.guessing = 0
- self.filename = None
-
- def reset(self):
- self.column = 1
- self.line = 1
- self.tokenStartColumn = 1
- self.tokenStartLine = 1
- self.guessing = 0
- self.filename = None
- self.input.reset()
-
- def LA(self,k):
- return self.input.LA(k)
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TokenStream ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TokenStream(object):
- def nextToken(self):
- pass
-
- def __iter__(self):
- return TokenStreamIterator(self)
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TokenStreamIterator ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TokenStreamIterator(object):
- def __init__(self,inst):
- if isinstance(inst,TokenStream):
- self.inst = inst
- return
- raise TypeError("TokenStreamIterator requires TokenStream object")
-
- def __next__(self):
- assert self.inst
- item = self.inst.nextToken()
- if not item or item.isEOF():
- raise StopIteration()
- return item
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TokenStreamSelector ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TokenStreamSelector(TokenStream):
-
- def __init__(self):
- self._input = None
- self._stmap = {}
- self._stack = []
-
- def addInputStream(self,stream,key):
- self._stmap[key] = stream
-
- def getCurrentStream(self):
- return self._input
-
- def getStream(self,sname):
- try:
- stream = self._stmap[sname]
- except:
- raise ValueError("TokenStream " + sname + " not found");
- return stream;
-
- def nextToken(self):
- while 1:
- try:
- return self._input.nextToken()
- except TokenStreamRetryException as r:
- ### just retry "forever"
- pass
-
- def pop(self):
- stream = self._stack.pop();
- self.select(stream);
- return stream;
-
- def push(self,arg):
- self._stack.append(self._input);
- self.select(arg)
-
- def retry(self):
- raise TokenStreamRetryException()
-
- def select(self,arg):
- if isinstance(arg,TokenStream):
- self._input = arg
- return
- if is_string_type(arg):
- self._input = self.getStream(arg)
- return
- raise TypeError("TokenStreamSelector.select requires " +
- "TokenStream or string argument")
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TokenStreamBasicFilter ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TokenStreamBasicFilter(TokenStream):
-
- def __init__(self,input):
-
- self.input = input;
- self.discardMask = BitSet()
-
- def discard(self,arg):
- if isinstance(arg,int):
- self.discardMask.add(arg)
- return
- if isinstance(arg,BitSet):
- self.discardMark = arg
- return
- raise TypeError("TokenStreamBasicFilter.discard requires" +
- "integer or BitSet argument")
-
- def nextToken(self):
- tok = self.input.nextToken()
- while tok and self.discardMask.member(tok.getType()):
- tok = self.input.nextToken()
- return tok
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TokenStreamHiddenTokenFilter ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TokenStreamHiddenTokenFilter(TokenStreamBasicFilter):
-
- def __init__(self,input):
- TokenStreamBasicFilter.__init__(self,input)
- self.hideMask = BitSet()
- self.nextMonitoredToken = None
- self.lastHiddenToken = None
- self.firstHidden = None
-
- def consume(self):
- self.nextMonitoredToken = self.input.nextToken()
-
- def consumeFirst(self):
- self.consume()
-
- p = None;
- while self.hideMask.member(self.LA(1).getType()) or \
- self.discardMask.member(self.LA(1).getType()):
- if self.hideMask.member(self.LA(1).getType()):
- if not p:
- p = self.LA(1)
- else:
- p.setHiddenAfter(self.LA(1))
- self.LA(1).setHiddenBefore(p)
- p = self.LA(1)
- self.lastHiddenToken = p
- if not self.firstHidden:
- self.firstHidden = p
- self.consume()
-
- def getDiscardMask(self):
- return self.discardMask
-
- def getHiddenAfter(self,t):
- return t.getHiddenAfter()
-
- def getHiddenBefore(self,t):
- return t.getHiddenBefore()
-
- def getHideMask(self):
- return self.hideMask
-
- def getInitialHiddenToken(self):
- return self.firstHidden
-
- def hide(self,m):
- if isinstance(m,int):
- self.hideMask.add(m)
- return
- if isinstance(m.BitMask):
- self.hideMask = m
- return
-
- def LA(self,i):
- return self.nextMonitoredToken
-
- def nextToken(self):
- if not self.LA(1):
- self.consumeFirst()
-
- monitored = self.LA(1)
-
- monitored.setHiddenBefore(self.lastHiddenToken)
- self.lastHiddenToken = None
-
- self.consume()
- p = monitored
-
- while self.hideMask.member(self.LA(1).getType()) or \
- self.discardMask.member(self.LA(1).getType()):
- if self.hideMask.member(self.LA(1).getType()):
- p.setHiddenAfter(self.LA(1))
- if p != monitored:
- self.LA(1).setHiddenBefore(p)
- p = self.lastHiddenToken = self.LA(1)
- self.consume()
- return monitored
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### StringBuffer ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class StringBuffer:
- def __init__(self,string=None):
- if string:
- self.text = list(string)
- else:
- self.text = []
-
- def setLength(self,sz):
- if not sz :
- self.text = []
- return
- assert sz>0
- if sz >= self.length():
- return
- ### just reset to empty buffer
- self.text = self.text[0:sz]
-
- def length(self):
- return len(self.text)
-
- def append(self,c):
- self.text.append(c)
-
- ### return buffer as string. Arg 'a' is used as index
- ## into the buffer and 2nd argument shall be the length.
- ## If 2nd args is absent, we return chars till end of
- ## buffer starting with 'a'.
- def getString(self,a=None,length=None):
- if not a :
- a = 0
- assert a>=0
- if a>= len(self.text) :
- return ""
-
- if not length:
- ## no second argument
- L = self.text[a:]
- else:
- assert (a+length) <= len(self.text)
- b = a + length
- L = self.text[a:b]
- s = ""
- for x in L : s += x
- return s
-
- toString = getString ## alias
-
- def __str__(self):
- return str(self.text)
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### Reader ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-## When reading Japanese chars, it happens that a stream returns a
-## 'char' of length 2. This looks like a bug in the appropriate
-## codecs - but I'm rather unsure about this. Anyway, if this is
-## the case, I'm going to split this string into a list of chars
-## and put them on hold, ie. on a buffer. Next time when called
-## we read from buffer until buffer is empty.
-## wh: nov, 25th -> problem does not appear in Python 2.4.0.c1.
-
-class Reader(object):
- def __init__(self,stream):
- self.cin = stream
- self.buf = []
-
- def read(self,num):
- assert num==1
-
- if len(self.buf):
- return self.buf.pop()
-
- ## Read a char - this may return a string.
- ## Is this a bug in codecs/Python?
- c = self.cin.read(1)
-
- if not c or len(c)==1:
- return c
-
- L = list(c)
- L.reverse()
- for x in L:
- self.buf.append(x)
-
- ## read one char ..
- return self.read(1)
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### CharScanner ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class CharScanner(TokenStream):
- ## class members
- NO_CHAR = 0
- EOF_CHAR = '' ### EOF shall be the empty string.
-
- def __init__(self, *argv, **kwargs):
- super(CharScanner, self).__init__()
- self.saveConsumedInput = True
- self.tokenClass = None
- self.caseSensitive = True
- self.caseSensitiveLiterals = True
- self.literals = None
- self.tabsize = 8
- self._returnToken = None
- self.commitToPath = False
- self.traceDepth = 0
- self.text = StringBuffer()
- self.hashString = hash(self)
- self.setTokenObjectClass(CommonToken)
- self.setInput(*argv)
-
- def __iter__(self):
- return CharScannerIterator(self)
-
- def setInput(self,*argv):
- ## case 1:
- ## if there's no arg we default to read from
- ## standard input
- if not argv:
- import sys
- self.setInput(sys.stdin)
- return
-
- ## get 1st argument
- arg1 = argv[0]
-
- ## case 2:
- ## if arg1 is a string, we assume it's a file name
- ## and open a stream using 2nd argument as open
- ## mode. If there's no 2nd argument we fall back to
- ## mode '+rb'.
- if is_string_type(arg1):
- f = open(arg1,"rb")
- self.setInput(f)
- self.setFilename(arg1)
- return
-
- ## case 3:
- ## if arg1 is a file we wrap it by a char buffer (
- ## some additional checks?? No, can't do this in
- ## general).
- if isinstance(arg1,file):
- self.setInput(CharBuffer(arg1))
- return
-
- ## case 4:
- ## if arg1 is of type SharedLexerInputState we use
- ## argument as is.
- if isinstance(arg1,LexerSharedInputState):
- self.inputState = arg1
- return
-
- ## case 5:
- ## check whether argument type is of type input
- ## buffer. If so create a SharedLexerInputState and
- ## go ahead.
- if isinstance(arg1,InputBuffer):
- self.setInput(LexerSharedInputState(arg1))
- return
-
- ## case 6:
- ## check whether argument type has a method read(int)
- ## If so create CharBuffer ...
- try:
- if arg1.read:
- rd = Reader(arg1)
- cb = CharBuffer(rd)
- ss = LexerSharedInputState(cb)
- self.inputState = ss
- return
- except:
- pass
-
- ## case 7:
- ## raise wrong argument exception
- raise TypeError(argv)
-
- def setTabSize(self,size) :
- self.tabsize = size
-
- def getTabSize(self) :
- return self.tabsize
-
- def setCaseSensitive(self,t) :
- self.caseSensitive = t
-
- def setCommitToPath(self,commit) :
- self.commitToPath = commit
-
- def setFilename(self,f) :
- self.inputState.filename = f
-
- def setLine(self,line) :
- self.inputState.line = line
-
- def setText(self,s) :
- self.resetText()
- self.text.append(s)
-
- def getCaseSensitive(self) :
- return self.caseSensitive
-
- def getCaseSensitiveLiterals(self) :
- return self.caseSensitiveLiterals
-
- def getColumn(self) :
- return self.inputState.column
-
- def setColumn(self,c) :
- self.inputState.column = c
-
- def getCommitToPath(self) :
- return self.commitToPath
-
- def getFilename(self) :
- return self.inputState.filename
-
- def getInputBuffer(self) :
- return self.inputState.input
-
- def getInputState(self) :
- return self.inputState
-
- def setInputState(self,state) :
- assert isinstance(state,LexerSharedInputState)
- self.inputState = state
-
- def getLine(self) :
- return self.inputState.line
-
- def getText(self) :
- return str(self.text)
-
- def getTokenObject(self) :
- return self._returnToken
-
- def LA(self,i) :
- c = self.inputState.input.LA(i)
- if not self.caseSensitive:
- ### E0006
- c = c.__class__.lower(c)
- return c
-
- def makeToken(self,type) :
- try:
- ## dynamically load a class
- assert self.tokenClass
- tok = self.tokenClass()
- tok.setType(type)
- tok.setColumn(self.inputState.tokenStartColumn)
- tok.setLine(self.inputState.tokenStartLine)
- return tok
- except:
- self.panic("unable to create new token")
- return Token.badToken
-
- def mark(self) :
- return self.inputState.input.mark()
-
- def _match_bitset(self,b) :
- if b.member(self.LA(1)):
- self.consume()
- else:
- raise MismatchedCharException(self.LA(1), b, False, self)
-
- def _match_string(self,s) :
- for c in s:
- if self.LA(1) == c:
- self.consume()
- else:
- raise MismatchedCharException(self.LA(1), c, False, self)
-
- def match(self,item):
- if is_string_type(item):
- return self._match_string(item)
- else:
- return self._match_bitset(item)
-
- def matchNot(self,c) :
- if self.LA(1) != c:
- self.consume()
- else:
- raise MismatchedCharException(self.LA(1), c, True, self)
-
- def matchRange(self,c1,c2) :
- if self.LA(1) < c1 or self.LA(1) > c2 :
- raise MismatchedCharException(self.LA(1), c1, c2, False, self)
- else:
- self.consume()
-
- def newline(self) :
- self.inputState.line += 1
- self.inputState.column = 1
-
- def tab(self) :
- c = self.getColumn()
- nc = ( ((c-1)/self.tabsize) + 1) * self.tabsize + 1
- self.setColumn(nc)
-
- def panic(self,s='') :
- print("CharScanner: panic: " + s)
- sys.exit(1)
-
- def reportError(self,ex) :
- print(ex)
-
- def reportError(self,s) :
- if not self.getFilename():
- print("error: " + str(s))
- else:
- print(self.getFilename() + ": error: " + str(s))
-
- def reportWarning(self,s) :
- if not self.getFilename():
- print("warning: " + str(s))
- else:
- print(self.getFilename() + ": warning: " + str(s))
-
- def resetText(self) :
- self.text.setLength(0)
- self.inputState.tokenStartColumn = self.inputState.column
- self.inputState.tokenStartLine = self.inputState.line
-
- def rewind(self,pos) :
- self.inputState.input.rewind(pos)
-
- def setTokenObjectClass(self,cl):
- self.tokenClass = cl
-
- def testForLiteral(self,token):
- if not token:
- return
- assert isinstance(token,Token)
-
- _type = token.getType()
-
- ## special tokens can't be literals
- if _type in [SKIP,INVALID_TYPE,EOF_TYPE,NULL_TREE_LOOKAHEAD] :
- return
-
- _text = token.getText()
- if not _text:
- return
-
- assert is_string_type(_text)
- _type = self.testLiteralsTable(_text,_type)
- token.setType(_type)
- return _type
-
- def testLiteralsTable(self,*args):
- if is_string_type(args[0]):
- s = args[0]
- i = args[1]
- else:
- s = self.text.getString()
- i = args[0]
-
- ## check whether integer has been given
- if not isinstance(i,int):
- assert isinstance(i,int)
-
- ## check whether we have a dict
- assert isinstance(self.literals,dict)
- try:
- ## E0010
- if not self.caseSensitiveLiterals:
- s = s.__class__.lower(s)
- i = self.literals[s]
- except:
- pass
- return i
-
- def toLower(self,c):
- return c.__class__.lower()
-
- def traceIndent(self):
- print(' ' * self.traceDepth)
-
- def traceIn(self,rname):
- self.traceDepth += 1
- self.traceIndent()
- print("> lexer %s c== %s" % (rname,self.LA(1)))
-
- def traceOut(self,rname):
- self.traceIndent()
- print("< lexer %s c== %s" % (rname,self.LA(1)))
- self.traceDepth -= 1
-
- def uponEOF(self):
- pass
-
- def append(self,c):
- if self.saveConsumedInput :
- self.text.append(c)
-
- def commit(self):
- self.inputState.input.commit()
-
- def consume(self):
- if not self.inputState.guessing:
- c = self.LA(1)
- if self.caseSensitive:
- self.append(c)
- else:
- # use input.LA(), not LA(), to get original case
- # CharScanner.LA() would toLower it.
- c = self.inputState.input.LA(1)
- self.append(c)
-
- if c and c in "\t":
- self.tab()
- else:
- self.inputState.column += 1
- self.inputState.input.consume()
-
- ## Consume chars until one matches the given char
- def consumeUntil_char(self,c):
- while self.LA(1) != EOF_CHAR and self.LA(1) != c:
- self.consume()
-
- ## Consume chars until one matches the given set
- def consumeUntil_bitset(self,bitset):
- while self.LA(1) != EOF_CHAR and not self.set.member(self.LA(1)):
- self.consume()
-
- ### If symbol seen is EOF then generate and set token, otherwise
- ### throw exception.
- def default(self,la1):
- if not la1 :
- self.uponEOF()
- self._returnToken = self.makeToken(EOF_TYPE)
- else:
- self.raise_NoViableAlt(la1)
-
- def filterdefault(self,la1,*args):
- if not la1:
- self.uponEOF()
- self._returnToken = self.makeToken(EOF_TYPE)
- return
-
- if not args:
- self.consume()
- raise TryAgain()
- else:
- ### apply filter object
- self.commit();
- try:
- func=args[0]
- args=args[1:]
- func(*args)
- except RecognitionException as e:
- ## catastrophic failure
- self.reportError(e);
- self.consume();
- raise TryAgain()
-
- def raise_NoViableAlt(self,la1=None):
- if not la1: la1 = self.LA(1)
- fname = self.getFilename()
- line = self.getLine()
- col = self.getColumn()
- raise NoViableAltForCharException(la1,fname,line,col)
-
- def set_return_token(self,_create,_token,_ttype,_offset):
- if _create and not _token and (not _ttype == SKIP):
- string = self.text.getString(_offset)
- _token = self.makeToken(_ttype)
- _token.setText(string)
- self._returnToken = _token
- return _token
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### CharScannerIterator ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class CharScannerIterator:
-
- def __init__(self,inst):
- if isinstance(inst,CharScanner):
- self.inst = inst
- return
- raise TypeError("CharScannerIterator requires CharScanner object")
-
- def __next__(self):
- assert self.inst
- item = self.inst.nextToken()
- if not item or item.isEOF():
- raise StopIteration()
- return item
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### BitSet ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-### I'm assuming here that a long is 64bits. It appears however, that
-### a long is of any size. That means we can use a single long as the
-### bitset (!), ie. Python would do almost all the work (TBD).
-
-class BitSet(object):
- BITS = 64
- NIBBLE = 4
- LOG_BITS = 6
- MOD_MASK = BITS -1
-
- def __init__(self,data=None):
- if not data:
- BitSet.__init__(self,[int(0)])
- return
- if isinstance(data,int):
- BitSet.__init__(self,[int(data)])
- return
- if isinstance(data,int):
- BitSet.__init__(self,[data])
- return
- if not isinstance(data,list):
- raise TypeError("BitSet requires integer, long, or " +
- "list argument")
- for x in data:
- if not isinstance(x,int):
- raise TypeError(self,"List argument item is " +
- "not a long: %s" % (x))
- self.data = data
-
- def __str__(self):
- bits = len(self.data) * BitSet.BITS
- s = ""
- for i in range(0,bits):
- if self.at(i):
- s += "1"
- else:
- s += "o"
- if not ((i+1) % 10):
- s += '|%s|' % (i+1)
- return s
-
- def __repr__(self):
- return str(self)
-
- def member(self,item):
- if not item:
- return False
-
- if isinstance(item,int):
- return self.at(item)
-
- if not is_string_type(item):
- raise TypeError(self,"char or unichar expected: %s" % (item))
-
- ## char is a (unicode) string with at most lenght 1, ie.
- ## a char.
-
- if len(item) != 1:
- raise TypeError(self,"char expected: %s" % (item))
-
- ### handle ASCII/UNICODE char
- num = ord(item)
-
- ### check whether position num is in bitset
- return self.at(num)
-
- def wordNumber(self,bit):
- return bit >> BitSet.LOG_BITS
-
- def bitMask(self,bit):
- pos = bit & BitSet.MOD_MASK ## bit mod BITS
- return (1 << pos)
-
- def set(self,bit,on=True):
- # grow bitset as required (use with care!)
- i = self.wordNumber(bit)
- mask = self.bitMask(bit)
- if i>=len(self.data):
- d = i - len(self.data) + 1
- for x in range(0,d):
- self.data.append(0)
- assert len(self.data) == i+1
- if on:
- self.data[i] |= mask
- else:
- self.data[i] &= (~mask)
-
- ### make add an alias for set
- add = set
-
- def off(self,bit,off=True):
- self.set(bit,not off)
-
- def at(self,bit):
- i = self.wordNumber(bit)
- v = self.data[i]
- m = self.bitMask(bit)
- return v & m
-
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### some further funcs ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-def illegalarg_ex(func):
- raise ValueError(
- "%s is only valid if parser is built for debugging" %
- (func.__name__))
-
-def runtime_ex(func):
- raise RuntimeException(
- "%s is only valid if parser is built for debugging" %
- (func.__name__))
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TokenBuffer ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TokenBuffer(object):
- def __init__(self,stream):
- self.input = stream
- self.nMarkers = 0
- self.markerOffset = 0
- self.numToConsume = 0
- self.queue = Queue()
-
- def reset(self) :
- self.nMarkers = 0
- self.markerOffset = 0
- self.numToConsume = 0
- self.queue.reset()
-
- def consume(self) :
- self.numToConsume += 1
-
- def fill(self, amount):
- self.syncConsume()
- while self.queue.length() < (amount + self.markerOffset):
- self.queue.append(self.input.nextToken())
-
- def getInput(self):
- return self.input
-
- def LA(self,k) :
- self.fill(k)
- return self.queue.elementAt(self.markerOffset + k - 1).type
-
- def LT(self,k) :
- self.fill(k)
- return self.queue.elementAt(self.markerOffset + k - 1)
-
- def mark(self) :
- self.syncConsume()
- self.nMarkers += 1
- return self.markerOffset
-
- def rewind(self,mark) :
- self.syncConsume()
- self.markerOffset = mark
- self.nMarkers -= 1
-
- def syncConsume(self) :
- while self.numToConsume > 0:
- if self.nMarkers > 0:
- # guess mode -- leave leading characters and bump offset.
- self.markerOffset += 1
- else:
- # normal mode -- remove first character
- self.queue.removeFirst()
- self.numToConsume -= 1
-
- def __str__(self):
- return "(%s,%s,%s,%s,%s)" % (
- self.input,
- self.nMarkers,
- self.markerOffset,
- self.numToConsume,
- self.queue)
-
- def __repr__(self):
- return str(self)
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### ParserSharedInputState ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class ParserSharedInputState(object):
-
- def __init__(self):
- self.input = None
- self.reset()
-
- def reset(self):
- self.guessing = 0
- self.filename = None
- if self.input:
- self.input.reset()
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### Parser ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class Parser(object):
-
- def __init__(self, *args, **kwargs):
- self.tokenNames = None
- self.returnAST = None
- self.astFactory = None
- self.tokenTypeToASTClassMap = {}
- self.ignoreInvalidDebugCalls = False
- self.traceDepth = 0
- if not args:
- self.inputState = ParserSharedInputState()
- return
- arg0 = args[0]
- assert isinstance(arg0,ParserSharedInputState)
- self.inputState = arg0
- return
-
- def getTokenTypeToASTClassMap(self):
- return self.tokenTypeToASTClassMap
-
-
- def addMessageListener(self, l):
- if not self.ignoreInvalidDebugCalls:
- illegalarg_ex(addMessageListener)
-
- def addParserListener(self,l) :
- if (not self.ignoreInvalidDebugCalls) :
- illegalarg_ex(addParserListener)
-
- def addParserMatchListener(self, l) :
- if (not self.ignoreInvalidDebugCalls) :
- illegalarg_ex(addParserMatchListener)
-
- def addParserTokenListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- illegalarg_ex(addParserTokenListener)
-
- def addSemanticPredicateListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- illegalarg_ex(addSemanticPredicateListener)
-
- def addSyntacticPredicateListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- illegalarg_ex(addSyntacticPredicateListener)
-
- def addTraceListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- illegalarg_ex(addTraceListener)
-
- def consume(self):
- raise NotImplementedError()
-
- def _consumeUntil_type(self,tokenType):
- while self.LA(1) != EOF_TYPE and self.LA(1) != tokenType:
- self.consume()
-
- def _consumeUntil_bitset(self, set):
- while self.LA(1) != EOF_TYPE and not set.member(self.LA(1)):
- self.consume()
-
- def consumeUntil(self,arg):
- if isinstance(arg,int):
- self._consumeUntil_type(arg)
- else:
- self._consumeUntil_bitset(arg)
-
- def defaultDebuggingSetup(self):
- pass
-
- def getAST(self) :
- return self.returnAST
-
- def getASTFactory(self) :
- return self.astFactory
-
- def getFilename(self) :
- return self.inputState.filename
-
- def getInputState(self) :
- return self.inputState
-
- def setInputState(self, state) :
- self.inputState = state
-
- def getTokenName(self,num) :
- return self.tokenNames[num]
-
- def getTokenNames(self) :
- return self.tokenNames
-
- def isDebugMode(self) :
- return self.false
-
- def LA(self, i):
- raise NotImplementedError()
-
- def LT(self, i):
- raise NotImplementedError()
-
- def mark(self):
- return self.inputState.input.mark()
-
- def _match_int(self,t):
- if (self.LA(1) != t):
- raise MismatchedTokenException(
- self.tokenNames, self.LT(1), t, False, self.getFilename())
- else:
- self.consume()
-
- def _match_set(self, b):
- if (not b.member(self.LA(1))):
- raise MismatchedTokenException(
- self.tokenNames,self.LT(1), b, False, self.getFilename())
- else:
- self.consume()
-
- def match(self,set) :
- if isinstance(set,int):
- self._match_int(set)
- return
- if isinstance(set,BitSet):
- self._match_set(set)
- return
- raise TypeError("Parser.match requires integer ot BitSet argument")
-
- def matchNot(self,t):
- if self.LA(1) == t:
- raise MismatchedTokenException(
- tokenNames, self.LT(1), t, True, self.getFilename())
- else:
- self.consume()
-
- def removeMessageListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(removeMessageListener)
-
- def removeParserListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(removeParserListener)
-
- def removeParserMatchListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(removeParserMatchListener)
-
- def removeParserTokenListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(removeParserTokenListener)
-
- def removeSemanticPredicateListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(removeSemanticPredicateListener)
-
- def removeSyntacticPredicateListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(removeSyntacticPredicateListener)
-
- def removeTraceListener(self, l) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(removeTraceListener)
-
- def reportError(self,x) :
- fmt = "syntax error:"
- f = self.getFilename()
- if f:
- fmt = ("%s:" % f) + fmt
- if isinstance(x,Token):
- line = x.getColumn()
- col = x.getLine()
- text = x.getText()
- fmt = fmt + 'unexpected symbol at line %s (column %s) : "%s"'
- # print(fmt % (line,col,text), file=sys.stderr)
- else:
- # print(fmt,str(x), file=sys.stderr)
- pass
-
- def reportWarning(self,s):
- f = self.getFilename()
- if f:
- print("%s:warning: %s" % (f,str(x)))
- else:
- print("warning: %s" % (str(x)))
-
- def rewind(self, pos) :
- self.inputState.input.rewind(pos)
-
- def setASTFactory(self, f) :
- self.astFactory = f
-
- def setASTNodeClass(self, cl) :
- self.astFactory.setASTNodeType(cl)
-
- def setASTNodeType(self, nodeType) :
- self.setASTNodeClass(nodeType)
-
- def setDebugMode(self, debugMode) :
- if (not self.ignoreInvalidDebugCalls):
- runtime_ex(setDebugMode)
-
- def setFilename(self, f) :
- self.inputState.filename = f
-
- def setIgnoreInvalidDebugCalls(self, value) :
- self.ignoreInvalidDebugCalls = value
-
- def setTokenBuffer(self, t) :
- self.inputState.input = t
-
- def traceIndent(self):
- print(" " * self.traceDepth)
-
- def traceIn(self,rname):
- self.traceDepth += 1
- self.trace("> ", rname)
-
- def traceOut(self,rname):
- self.trace("< ", rname)
- self.traceDepth -= 1
-
- ### wh: moved from ASTFactory to Parser
- def addASTChild(self,currentAST, child):
- if not child:
- return
- if not currentAST.root:
- currentAST.root = child
- elif not currentAST.child:
- currentAST.root.setFirstChild(child)
- else:
- currentAST.child.setNextSibling(child)
- currentAST.child = child
- currentAST.advanceChildToEnd()
-
- ### wh: moved from ASTFactory to Parser
- def makeASTRoot(self,currentAST,root) :
- if root:
- ### Add the current root as a child of new root
- root.addChild(currentAST.root)
- ### The new current child is the last sibling of the old root
- currentAST.child = currentAST.root
- currentAST.advanceChildToEnd()
- ### Set the new root
- currentAST.root = root
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### LLkParser ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class LLkParser(Parser):
-
- def __init__(self, *args, **kwargs):
- try:
- arg1 = args[0]
- except:
- arg1 = 1
-
- if isinstance(arg1,int):
- super(LLkParser,self).__init__()
- self.k = arg1
- return
-
- if isinstance(arg1,ParserSharedInputState):
- super(LLkParser,self).__init__(arg1)
- self.set_k(1,*args)
- return
-
- if isinstance(arg1,TokenBuffer):
- super(LLkParser,self).__init__()
- self.setTokenBuffer(arg1)
- self.set_k(1,*args)
- return
-
- if isinstance(arg1,TokenStream):
- super(LLkParser,self).__init__()
- tokenBuf = TokenBuffer(arg1)
- self.setTokenBuffer(tokenBuf)
- self.set_k(1,*args)
- return
-
- ### unknown argument
- raise TypeError("LLkParser requires integer, " +
- "ParserSharedInputStream or TokenStream argument")
-
- def consume(self):
- self.inputState.input.consume()
-
- def LA(self,i):
- return self.inputState.input.LA(i)
-
- def LT(self,i):
- return self.inputState.input.LT(i)
-
- def set_k(self,index,*args):
- try:
- self.k = args[index]
- except:
- self.k = 1
-
- def trace(self,ee,rname):
- print(type(self))
- self.traceIndent()
- guess = ""
- if self.inputState.guessing > 0:
- guess = " [guessing]"
- print((ee + rname + guess))
- for i in range(1,self.k+1):
- if i != 1:
- print(", ")
- if self.LT(i) :
- v = self.LT(i).getText()
- else:
- v = "null"
- print("LA(%s) == %s" % (i,v))
- print("\n")
-
- def traceIn(self,rname):
- self.traceDepth += 1;
- self.trace("> ", rname);
-
- def traceOut(self,rname):
- self.trace("< ", rname);
- self.traceDepth -= 1;
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TreeParserSharedInputState ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TreeParserSharedInputState(object):
- def __init__(self):
- self.guessing = 0
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### TreeParser ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class TreeParser(object):
-
- def __init__(self, *args, **kwargs):
- self.inputState = TreeParserSharedInputState()
- self._retTree = None
- self.tokenNames = []
- self.returnAST = None
- self.astFactory = ASTFactory()
- self.traceDepth = 0
-
- def getAST(self):
- return self.returnAST
-
- def getASTFactory(self):
- return self.astFactory
-
- def getTokenName(self,num) :
- return self.tokenNames[num]
-
- def getTokenNames(self):
- return self.tokenNames
-
- def match(self,t,set) :
- assert isinstance(set,int) or isinstance(set,BitSet)
- if not t or t == ASTNULL:
- raise MismatchedTokenException(self.getTokenNames(), t,set, False)
-
- if isinstance(set,int) and t.getType() != set:
- raise MismatchedTokenException(self.getTokenNames(), t,set, False)
-
- if isinstance(set,BitSet) and not set.member(t.getType):
- raise MismatchedTokenException(self.getTokenNames(), t,set, False)
-
- def matchNot(self,t, ttype) :
- if not t or (t == ASTNULL) or (t.getType() == ttype):
- raise MismatchedTokenException(getTokenNames(), t, ttype, True)
-
- def reportError(self,ex):
- print("error:".format(ex, file=sys.stderr))
-
- def reportWarning(self, s):
- print("warning:".format(s))
-
- def setASTFactory(self,f):
- self.astFactory = f
-
- def setASTNodeType(self,nodeType):
- self.setASTNodeClass(nodeType)
-
- def setASTNodeClass(self,nodeType):
- self.astFactory.setASTNodeType(nodeType)
-
- def traceIndent(self):
- print(" " * self.traceDepth)
-
- def traceIn(self,rname,t):
- self.traceDepth += 1
- self.traceIndent()
- print(("> " + rname + "(" +
- ifelse(t,str(t),"null") + ")" +
- ifelse(self.inputState.guessing>0,"[guessing]","")))
-
- def traceOut(self,rname,t):
- self.traceIndent()
- print(("< " + rname + "(" +
- ifelse(t,str(t),"null") + ")" +
- ifelse(self.inputState.guessing>0,"[guessing]","")))
- self.traceDepth -= 1
-
- ### wh: moved from ASTFactory to TreeParser
- def addASTChild(self,currentAST, child):
- if not child:
- return
- if not currentAST.root:
- currentAST.root = child
- elif not currentAST.child:
- currentAST.root.setFirstChild(child)
- else:
- currentAST.child.setNextSibling(child)
- currentAST.child = child
- currentAST.advanceChildToEnd()
-
- ### wh: moved from ASTFactory to TreeParser
- def makeASTRoot(self,currentAST,root):
- if root:
- ### Add the current root as a child of new root
- root.addChild(currentAST.root)
- ### The new current child is the last sibling of the old root
- currentAST.child = currentAST.root
- currentAST.advanceChildToEnd()
- ### Set the new root
- currentAST.root = root
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### funcs to work on trees ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-def rightmost(ast):
- if ast:
- while(ast.right):
- ast = ast.right
- return ast
-
-def cmptree(s,t,partial):
- while(s and t):
- ### as a quick optimization, check roots first.
- if not s.equals(t):
- return False
-
- ### if roots match, do full list match test on children.
- if not cmptree(s.getFirstChild(),t.getFirstChild(),partial):
- return False
-
- s = s.getNextSibling()
- t = t.getNextSibling()
-
- r = ifelse(partial,not t,not s and not t)
- return r
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### AST ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class AST(object):
- def __init__(self):
- pass
-
- def addChild(self, c):
- pass
-
- def equals(self, t):
- return False
-
- def equalsList(self, t):
- return False
-
- def equalsListPartial(self, t):
- return False
-
- def equalsTree(self, t):
- return False
-
- def equalsTreePartial(self, t):
- return False
-
- def findAll(self, tree):
- return None
-
- def findAllPartial(self, subtree):
- return None
-
- def getFirstChild(self):
- return self
-
- def getNextSibling(self):
- return self
-
- def getText(self):
- return ""
-
- def getType(self):
- return INVALID_TYPE
-
- def getLine(self):
- return 0
-
- def getColumn(self):
- return 0
-
- def getNumberOfChildren(self):
- return 0
-
- def initialize(self, t, txt):
- pass
-
- def initialize(self, t):
- pass
-
- def setFirstChild(self, c):
- pass
-
- def setNextSibling(self, n):
- pass
-
- def setText(self, text):
- pass
-
- def setType(self, ttype):
- pass
-
- def toString(self):
- self.getText()
-
- __str__ = toString
-
- def toStringList(self):
- return self.getText()
-
- def toStringTree(self):
- return self.getText()
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### ASTNULLType ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-### There is only one instance of this class **/
-class ASTNULLType(AST):
- def __init__(self):
- AST.__init__(self)
- pass
-
- def getText(self):
- return "<ASTNULL>"
-
- def getType(self):
- return NULL_TREE_LOOKAHEAD
-
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### BaseAST ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class BaseAST(AST):
-
- verboseStringConversion = False
- tokenNames = None
-
- def __init__(self):
- self.down = None ## kid
- self.right = None ## sibling
-
- def addChild(self,node):
- if node:
- t = rightmost(self.down)
- if t:
- t.right = node
- else:
- assert not self.down
- self.down = node
-
- def getNumberOfChildren(self):
- t = self.down
- n = 0
- while t:
- n += 1
- t = t.right
- return n
-
- def doWorkForFindAll(self,v,target,partialMatch):
- sibling = self
-
- while sibling:
- c1 = partialMatch and sibling.equalsTreePartial(target)
- if c1:
- v.append(sibling)
- else:
- c2 = not partialMatch and sibling.equalsTree(target)
- if c2:
- v.append(sibling)
-
- ### regardless of match or not, check any children for matches
- if sibling.getFirstChild():
- sibling.getFirstChild().doWorkForFindAll(v,target,partialMatch)
-
- sibling = sibling.getNextSibling()
-
- ### Is node t equal to 'self' in terms of token type and text?
- def equals(self,t):
- if not t:
- return False
- return self.getText() == t.getText() and self.getType() == t.getType()
-
- ### Is t an exact structural and equals() match of this tree. The
- ### 'self' reference is considered the start of a sibling list.
- ###
- def equalsList(self, t):
- return cmptree(self, t, partial=False)
-
- ### Is 't' a subtree of this list?
- ### The siblings of the root are NOT ignored.
- ###
- def equalsListPartial(self,t):
- return cmptree(self,t,partial=True)
-
- ### Is tree rooted at 'self' equal to 't'? The siblings
- ### of 'self' are ignored.
- ###
- def equalsTree(self, t):
- return self.equals(t) and \
- cmptree(self.getFirstChild(), t.getFirstChild(), partial=False)
-
- ### Is 't' a subtree of the tree rooted at 'self'? The siblings
- ### of 'self' are ignored.
- ###
- def equalsTreePartial(self, t):
- if not t:
- return True
- return self.equals(t) and cmptree(
- self.getFirstChild(), t.getFirstChild(), partial=True)
-
- ### Walk the tree looking for all exact subtree matches. Return
- ### an ASTEnumerator that lets the caller walk the list
- ### of subtree roots found herein.
- def findAll(self,target):
- roots = []
-
- ### the empty tree cannot result in an enumeration
- if not target:
- return None
- # find all matches recursively
- self.doWorkForFindAll(roots, target, False)
- return roots
-
- ### Walk the tree looking for all subtrees. Return
- ### an ASTEnumerator that lets the caller walk the list
- ### of subtree roots found herein.
- def findAllPartial(self,sub):
- roots = []
-
- ### the empty tree cannot result in an enumeration
- if not sub:
- return None
-
- self.doWorkForFindAll(roots, sub, True) ### find all matches recursively
- return roots
-
- ### Get the first child of this node None if not children
- def getFirstChild(self):
- return self.down
-
- ### Get the next sibling in line after this one
- def getNextSibling(self):
- return self.right
-
- ### Get the token text for this node
- def getText(self):
- return ""
-
- ### Get the token type for this node
- def getType(self):
- return 0
-
- def getLine(self):
- return 0
-
- def getColumn(self):
- return 0
-
- ### Remove all children */
- def removeChildren(self):
- self.down = None
-
- def setFirstChild(self,c):
- self.down = c
-
- def setNextSibling(self, n):
- self.right = n
-
- ### Set the token text for this node
- def setText(self, text):
- pass
-
- ### Set the token type for this node
- def setType(self, ttype):
- pass
-
- ### static
- def setVerboseStringConversion(verbose,names):
- verboseStringConversion = verbose
- tokenNames = names
- setVerboseStringConversion = staticmethod(setVerboseStringConversion)
-
- ### Return an array of strings that maps token ID to it's text.
- ## @since 2.7.3
- def getTokenNames():
- return tokenNames
-
- def toString(self):
- return self.getText()
-
- ### return tree as lisp string - sibling included
- def toStringList(self):
- ts = self.toStringTree()
- sib = self.getNextSibling()
- if sib:
- ts += sib.toStringList()
- return ts
-
- __str__ = toStringList
-
- ### return tree as string - siblings ignored
- def toStringTree(self):
- ts = ""
- kid = self.getFirstChild()
- if kid:
- ts += " ("
- ts += " " + self.toString()
- if kid:
- ts += kid.toStringList()
- ts += " )"
- return ts
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### CommonAST ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-### Common AST node implementation
-class CommonAST(BaseAST):
- def __init__(self,token=None):
- super(CommonAST,self).__init__()
- self.ttype = INVALID_TYPE
- self.text = "<no text>"
- self.line = 0
- self.column= 0
- self.initialize(token)
- #assert self.text
-
- ### Get the token text for this node
- def getText(self):
- return self.text
-
- ### Get the token type for this node
- def getType(self):
- return self.ttype
-
- ### Get the line for this node
- def getLine(self):
- return self.line
-
- ### Get the column for this node
- def getColumn(self):
- return self.column
-
- def initialize(self,*args):
- if not args:
- return
-
- arg0 = args[0]
-
- if isinstance(arg0,int):
- arg1 = args[1]
- self.setType(arg0)
- self.setText(arg1)
- return
-
- if isinstance(arg0,AST) or isinstance(arg0,Token):
- self.setText(arg0.getText())
- self.setType(arg0.getType())
- self.line = arg0.getLine()
- self.column = arg0.getColumn()
- return
-
- ### Set the token text for this node
- def setText(self,text_):
- assert is_string_type(text_)
- self.text = text_
-
- ### Set the token type for this node
- def setType(self,ttype_):
- assert isinstance(ttype_,int)
- self.ttype = ttype_
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### CommonASTWithHiddenTokens ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class CommonASTWithHiddenTokens(CommonAST):
-
- def __init__(self,*args):
- CommonAST.__init__(self,*args)
- self.hiddenBefore = None
- self.hiddenAfter = None
-
- def getHiddenAfter(self):
- return self.hiddenAfter
-
- def getHiddenBefore(self):
- return self.hiddenBefore
-
- def initialize(self,*args):
- CommonAST.initialize(self,*args)
- if args and isinstance(args[0],Token):
- assert isinstance(args[0],CommonHiddenStreamToken)
- self.hiddenBefore = args[0].getHiddenBefore()
- self.hiddenAfter = args[0].getHiddenAfter()
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### ASTPair ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class ASTPair(object):
- def __init__(self):
- self.root = None ### current root of tree
- self.child = None ### current child to which siblings are added
-
- ### Make sure that child is the last sibling */
- def advanceChildToEnd(self):
- if self.child:
- while self.child.getNextSibling():
- self.child = self.child.getNextSibling()
-
- ### Copy an ASTPair. Don't call it clone() because we want type-safety */
- def copy(self):
- tmp = ASTPair()
- tmp.root = self.root
- tmp.child = self.child
- return tmp
-
- def toString(self):
- r = ifelse(not root,"null",self.root.getText())
- c = ifelse(not child,"null",self.child.getText())
- return "[%s,%s]" % (r,c)
-
- __str__ = toString
- __repr__ = toString
-
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### ASTFactory ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class ASTFactory(object):
- def __init__(self,table=None):
- self._class = None
- self._classmap = ifelse(table,table,None)
-
- def create(self,*args):
- if not args:
- return self.create(INVALID_TYPE)
-
- arg0 = args[0]
- arg1 = None
- arg2 = None
-
- try:
- arg1 = args[1]
- arg2 = args[2]
- except:
- pass
-
- # ctor(int)
- if isinstance(arg0,int) and not arg2:
- ### get class for 'self' type
- c = self.getASTNodeType(arg0)
- t = self.create(c)
- if t:
- t.initialize(arg0, ifelse(arg1,arg1,""))
- return t
-
- # ctor(int,something)
- if isinstance(arg0,int) and arg2:
- t = self.create(arg2)
- if t:
- t.initialize(arg0,arg1)
- return t
-
- # ctor(AST)
- if isinstance(arg0,AST):
- t = self.create(arg0.getType())
- if t:
- t.initialize(arg0)
- return t
-
- # ctor(token)
- if isinstance(arg0,Token) and not arg1:
- ttype = arg0.getType()
- assert isinstance(ttype,int)
- t = self.create(ttype)
- if t:
- t.initialize(arg0)
- return t
-
- # ctor(token,class)
- if isinstance(arg0,Token) and arg1:
- assert isinstance(arg1,type)
- assert issubclass(arg1,AST)
- # this creates instance of 'arg1' using 'arg0' as
- # argument. Wow, that's magic!
- t = arg1(arg0)
- assert t and isinstance(t,AST)
- return t
-
- # ctor(class)
- if isinstance(arg0,type):
- ### next statement creates instance of type (!)
- t = arg0()
- assert isinstance(t,AST)
- return t
-
-
- def setASTNodeClass(self,className=None):
- if not className:
- return
- assert isinstance(className,type)
- assert issubclass(className,AST)
- self._class = className
-
- ### kind of misnomer - use setASTNodeClass instead.
- setASTNodeType = setASTNodeClass
-
- def getASTNodeClass(self):
- return self._class
-
-
-
- def getTokenTypeToASTClassMap(self):
- return self._classmap
-
- def setTokenTypeToASTClassMap(self,amap):
- self._classmap = amap
-
- def error(self, e):
- import sys
- print(e.format(file=sys.stderr))
-
- def setTokenTypeASTNodeType(self, tokenType, className):
- """
- Specify a mapping between a token type and a (AST) class.
- """
- if not self._classmap:
- self._classmap = {}
-
- if not className:
- try:
- del self._classmap[tokenType]
- except:
- pass
- else:
- ### here we should also perform actions to ensure that
- ### a. class can be loaded
- ### b. class is a subclass of AST
- ###
- assert isinstance(className,type)
- assert issubclass(className,AST) ## a & b
- ### enter the class
- self._classmap[tokenType] = className
-
- def getASTNodeType(self,tokenType):
- """
- For a given token type return the AST node type. First we
- lookup a mapping table, second we try _class
- and finally we resolve to "antlr.CommonAST".
- """
-
- # first
- if self._classmap:
- try:
- c = self._classmap[tokenType]
- if c:
- return c
- except:
- pass
- # second
- if self._class:
- return self._class
-
- # default
- return CommonAST
-
- ### methods that have been moved to file scope - just listed
- ### here to be somewhat consistent with original API
- def dup(self,t):
- return antlr.dup(t,self)
-
- def dupList(self,t):
- return antlr.dupList(t,self)
-
- def dupTree(self,t):
- return antlr.dupTree(t,self)
-
- ### methods moved to other classes
- ### 1. makeASTRoot -> Parser
- ### 2. addASTChild -> Parser
-
- ### non-standard: create alias for longish method name
- maptype = setTokenTypeASTNodeType
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### ASTVisitor ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-class ASTVisitor(object):
- def __init__(self,*args):
- pass
-
- def visit(self,ast):
- pass
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-### static methods and variables ###
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
-
-ASTNULL = ASTNULLType()
-
-### wh: moved from ASTFactory as there's nothing ASTFactory-specific
-### in this method.
-def make(*nodes):
- if not nodes:
- return None
-
- for i in range(0,len(nodes)):
- node = nodes[i]
- if node:
- assert isinstance(node,AST)
-
- root = nodes[0]
- tail = None
- if root:
- root.setFirstChild(None)
-
- for i in range(1,len(nodes)):
- if not nodes[i]:
- continue
- if not root:
- root = tail = nodes[i]
- elif not tail:
- root.setFirstChild(nodes[i])
- tail = root.getFirstChild()
- else:
- tail.setNextSibling(nodes[i])
- tail = tail.getNextSibling()
-
- ### Chase tail to last sibling
- while tail.getNextSibling():
- tail = tail.getNextSibling()
- return root
-
-def dup(t,factory):
- if not t:
- return None
-
- if factory:
- dup_t = factory.create(t.__class__)
- else:
- raise TypeError("dup function requires ASTFactory argument")
- dup_t.initialize(t)
- return dup_t
-
-def dupList(t,factory):
- result = dupTree(t,factory)
- nt = result
- while t:
- ## for each sibling of the root
- t = t.getNextSibling()
- nt.setNextSibling(dupTree(t,factory))
- nt = nt.getNextSibling()
- return result
-
-def dupTree(t,factory):
- result = dup(t,factory)
- if t:
- result.setFirstChild(dupList(t.getFirstChild(),factory))
- return result
-
-###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
-### $Id: antlr.py 3750 2009-02-13 00:13:04Z sjmachin $
-
-# Local Variables: ***
-# mode: python ***
-# py-indent-offset: 4 ***
-# End: ***
+## This file is part of PyANTLR. See LICENSE.txt for license
+## details..........Copyright (C) Wolfgang Haefelinger, 2004.
+
+## This file was copied for use with xlwt from the 2.7.7 ANTLR distribution. Yes, it
+## says 2.7.5 below. The 2.7.5 distribution version didn't have a
+## version in it.
+
+## Here is the contents of the ANTLR 2.7.7 LICENSE.txt referred to above.
+
+# SOFTWARE RIGHTS
+#
+# ANTLR 1989-2006 Developed by Terence Parr
+# Partially supported by University of San Francisco & jGuru.com
+#
+# We reserve no legal rights to the ANTLR--it is fully in the
+# public domain. An individual or company may do whatever
+# they wish with source code distributed with ANTLR or the
+# code generated by ANTLR, including the incorporation of
+# ANTLR, or its output, into commerical software.
+#
+# We encourage users to develop software with ANTLR. However,
+# we do ask that credit is given to us for developing
+# ANTLR. By "credit", we mean that if you use ANTLR or
+# incorporate any source code into one of your programs
+# (commercial product, research project, or otherwise) that
+# you acknowledge this fact somewhere in the documentation,
+# research report, etc... If you like ANTLR and have
+# developed a nice tool with the output, please mention that
+# you developed it using ANTLR. In addition, we ask that the
+# headers remain intact in our source code. As long as these
+# guidelines are kept, we expect to continue enhancing this
+# system and expect to make other tools available as they are
+# completed.
+#
+# The primary ANTLR guy:
+#
+# Terence Parr
+# parrt@cs.usfca.edu
+# parrt@antlr.org
+
+## End of contents of the ANTLR 2.7.7 LICENSE.txt ########################
+
+## get sys module
+import sys
+
+version = sys.version.split()[0]
+if version < '2.2.1':
+ False = 0
+if version < '2.3':
+ True = not False
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### global symbols ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+### ANTLR Standard Tokens
+SKIP = -1
+INVALID_TYPE = 0
+EOF_TYPE = 1
+EOF = 1
+NULL_TREE_LOOKAHEAD = 3
+MIN_USER_TYPE = 4
+
+### ANTLR's EOF Symbol
+EOF_CHAR = ''
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### general functions ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+## Version should be automatically derived from configure.in. For now,
+## we need to bump it ourselfs. Don't remove the <version> tags.
+## <version>
+def version():
+ r = {
+ 'major' : '2',
+ 'minor' : '7',
+ 'micro' : '5',
+ 'patch' : '' ,
+ 'version': '2.7.5'
+ }
+ return r
+## </version>
+
+def error(fmt,*args):
+ if fmt:
+ print "error: ", fmt % tuple(args)
+
+def ifelse(cond,_then,_else):
+ if cond :
+ r = _then
+ else:
+ r = _else
+ return r
+
+def is_string_type(x):
+ # return (isinstance(x,str) or isinstance(x,unicode))
+ # Simplify; xlwt doesn't support Python < 2.3
+ return isinstance(basestring)
+
+def assert_string_type(x):
+ assert is_string_type(x)
+ pass
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### ANTLR Exceptions ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class ANTLRException(Exception):
+
+ def __init__(self, *args):
+ Exception.__init__(self, *args)
+
+
+class RecognitionException(ANTLRException):
+
+ def __init__(self, *args):
+ ANTLRException.__init__(self, *args)
+ self.fileName = None
+ self.line = -1
+ self.column = -1
+ if len(args) >= 2:
+ self.fileName = args[1]
+ if len(args) >= 3:
+ self.line = args[2]
+ if len(args) >= 4:
+ self.column = args[3]
+
+ def __str__(self):
+ buf = ['']
+ if self.fileName:
+ buf.append(self.fileName + ":")
+ if self.line != -1:
+ if not self.fileName:
+ buf.append("line ")
+ buf.append(str(self.line))
+ if self.column != -1:
+ buf.append(":" + str(self.column))
+ buf.append(":")
+ buf.append(" ")
+ return str('').join(buf)
+
+ __repr__ = __str__
+
+
+class NoViableAltException(RecognitionException):
+
+ def __init__(self, *args):
+ RecognitionException.__init__(self, *args)
+ self.token = None
+ self.node = None
+ if isinstance(args[0],AST):
+ self.node = args[0]
+ elif isinstance(args[0],Token):
+ self.token = args[0]
+ else:
+ raise TypeError("NoViableAltException requires Token or AST argument")
+
+ def __str__(self):
+ if self.token:
+ line = self.token.getLine()
+ col = self.token.getColumn()
+ text = self.token.getText()
+ return "unexpected symbol at line %s (column %s): \"%s\"" % (line,col,text)
+ if self.node == ASTNULL:
+ return "unexpected end of subtree"
+ assert self.node
+ ### hackish, we assume that an AST contains method getText
+ return "unexpected node: %s" % (self.node.getText())
+
+ __repr__ = __str__
+
+
+class NoViableAltForCharException(RecognitionException):
+
+ def __init__(self, *args):
+ self.foundChar = None
+ if len(args) == 2:
+ self.foundChar = args[0]
+ scanner = args[1]
+ RecognitionException.__init__(self, "NoViableAlt",
+ scanner.getFilename(),
+ scanner.getLine(),
+ scanner.getColumn())
+ elif len(args) == 4:
+ self.foundChar = args[0]
+ fileName = args[1]
+ line = args[2]
+ column = args[3]
+ RecognitionException.__init__(self, "NoViableAlt",
+ fileName, line, column)
+ else:
+ RecognitionException.__init__(self, "NoViableAlt",
+ '', -1, -1)
+
+ def __str__(self):
+ mesg = "unexpected char: "
+ if self.foundChar >= ' ' and self.foundChar <= '~':
+ mesg += "'" + self.foundChar + "'"
+ elif self.foundChar:
+ mesg += "0x" + hex(ord(self.foundChar)).upper()[2:]
+ else:
+ mesg += "<None>"
+ return mesg
+
+ __repr__ = __str__
+
+
+class SemanticException(RecognitionException):
+
+ def __init__(self, *args):
+ RecognitionException.__init__(self, *args)
+
+
+class MismatchedCharException(RecognitionException):
+
+ NONE = 0
+ CHAR = 1
+ NOT_CHAR = 2
+ RANGE = 3
+ NOT_RANGE = 4
+ SET = 5
+ NOT_SET = 6
+
+ def __init__(self, *args):
+ self.args = args
+ if len(args) == 5:
+ # Expected range / not range
+ if args[3]:
+ self.mismatchType = MismatchedCharException.NOT_RANGE
+ else:
+ self.mismatchType = MismatchedCharException.RANGE
+ self.foundChar = args[0]
+ self.expecting = args[1]
+ self.upper = args[2]
+ self.scanner = args[4]
+ RecognitionException.__init__(self, "Mismatched char range",
+ self.scanner.getFilename(),
+ self.scanner.getLine(),
+ self.scanner.getColumn())
+ elif len(args) == 4 and is_string_type(args[1]):
+ # Expected char / not char
+ if args[2]:
+ self.mismatchType = MismatchedCharException.NOT_CHAR
+ else:
+ self.mismatchType = MismatchedCharException.CHAR
+ self.foundChar = args[0]
+ self.expecting = args[1]
+ self.scanner = args[3]
+ RecognitionException.__init__(self, "Mismatched char",
+ self.scanner.getFilename(),
+ self.scanner.getLine(),
+ self.scanner.getColumn())
+ elif len(args) == 4 and isinstance(args[1], BitSet):
+ # Expected BitSet / not BitSet
+ if args[2]:
+ self.mismatchType = MismatchedCharException.NOT_SET
+ else:
+ self.mismatchType = MismatchedCharException.SET
+ self.foundChar = args[0]
+ self.set = args[1]
+ self.scanner = args[3]
+ RecognitionException.__init__(self, "Mismatched char set",
+ self.scanner.getFilename(),
+ self.scanner.getLine(),
+ self.scanner.getColumn())
+ else:
+ self.mismatchType = MismatchedCharException.NONE
+ RecognitionException.__init__(self, "Mismatched char")
+
+ ## Append a char to the msg buffer. If special,
+ # then show escaped version
+ #
+ def appendCharName(self, sb, c):
+ if not c or c == 65535:
+ # 65535 = (char) -1 = EOF
+ sb.append("'<EOF>'")
+ elif c == '\n':
+ sb.append("'\\n'")
+ elif c == '\r':
+ sb.append("'\\r'");
+ elif c == '\t':
+ sb.append("'\\t'")
+ else:
+ sb.append('\'' + c + '\'')
+
+ ##
+ # Returns an error message with line number/column information
+ #
+ def __str__(self):
+ sb = ['']
+ sb.append(RecognitionException.__str__(self))
+
+ if self.mismatchType == MismatchedCharException.CHAR:
+ sb.append("expecting ")
+ self.appendCharName(sb, self.expecting)
+ sb.append(", found ")
+ self.appendCharName(sb, self.foundChar)
+ elif self.mismatchType == MismatchedCharException.NOT_CHAR:
+ sb.append("expecting anything but '")
+ self.appendCharName(sb, self.expecting)
+ sb.append("'; got it anyway")
+ elif self.mismatchType in [MismatchedCharException.RANGE, MismatchedCharException.NOT_RANGE]:
+ sb.append("expecting char ")
+ if self.mismatchType == MismatchedCharException.NOT_RANGE:
+ sb.append("NOT ")
+ sb.append("in range: ")
+ appendCharName(sb, self.expecting)
+ sb.append("..")
+ appendCharName(sb, self.upper)
+ sb.append(", found ")
+ appendCharName(sb, self.foundChar)
+ elif self.mismatchType in [MismatchedCharException.SET, MismatchedCharException.NOT_SET]:
+ sb.append("expecting ")
+ if self.mismatchType == MismatchedCharException.NOT_SET:
+ sb.append("NOT ")
+ sb.append("one of (")
+ for i in range(len(self.set)):
+ self.appendCharName(sb, self.set[i])
+ sb.append("), found ")
+ self.appendCharName(sb, self.foundChar)
+
+ return str().join(sb).strip()
+
+ __repr__ = __str__
+
+
+class MismatchedTokenException(RecognitionException):
+
+ NONE = 0
+ TOKEN = 1
+ NOT_TOKEN = 2
+ RANGE = 3
+ NOT_RANGE = 4
+ SET = 5
+ NOT_SET = 6
+
+ def __init__(self, *args):
+ self.args = args
+ self.tokenNames = []
+ self.token = None
+ self.tokenText = ''
+ self.node = None
+ if len(args) == 6:
+ # Expected range / not range
+ if args[3]:
+ self.mismatchType = MismatchedTokenException.NOT_RANGE
+ else:
+ self.mismatchType = MismatchedTokenException.RANGE
+ self.tokenNames = args[0]
+ self.expecting = args[2]
+ self.upper = args[3]
+ self.fileName = args[5]
+
+ elif len(args) == 4 and isinstance(args[2], int):
+ # Expected token / not token
+ if args[3]:
+ self.mismatchType = MismatchedTokenException.NOT_TOKEN
+ else:
+ self.mismatchType = MismatchedTokenException.TOKEN
+ self.tokenNames = args[0]
+ self.expecting = args[2]
+
+ elif len(args) == 4 and isinstance(args[2], BitSet):
+ # Expected BitSet / not BitSet
+ if args[3]:
+ self.mismatchType = MismatchedTokenException.NOT_SET
+ else:
+ self.mismatchType = MismatchedTokenException.SET
+ self.tokenNames = args[0]
+ self.set = args[2]
+
+ else:
+ self.mismatchType = MismatchedTokenException.NONE
+ RecognitionException.__init__(self, "Mismatched Token: expecting any AST node", "<AST>", -1, -1)
+
+ if len(args) >= 2:
+ if isinstance(args[1],Token):
+ self.token = args[1]
+ self.tokenText = self.token.getText()
+ RecognitionException.__init__(self, "Mismatched Token",
+ self.fileName,
+ self.token.getLine(),
+ self.token.getColumn())
+ elif isinstance(args[1],AST):
+ self.node = args[1]
+ self.tokenText = str(self.node)
+ RecognitionException.__init__(self, "Mismatched Token",
+ "<AST>",
+ self.node.getLine(),
+ self.node.getColumn())
+ else:
+ self.tokenText = "<empty tree>"
+ RecognitionException.__init__(self, "Mismatched Token",
+ "<AST>", -1, -1)
+
+ def appendTokenName(self, sb, tokenType):
+ if tokenType == INVALID_TYPE:
+ sb.append("<Set of tokens>")
+ elif tokenType < 0 or tokenType >= len(self.tokenNames):
+ sb.append("<" + str(tokenType) + ">")
+ else:
+ sb.append(self.tokenNames[tokenType])
+
+ ##
+ # Returns an error message with line number/column information
+ #
+ def __str__(self):
+ sb = ['']
+ sb.append(RecognitionException.__str__(self))
+
+ if self.mismatchType == MismatchedTokenException.TOKEN:
+ sb.append("expecting ")
+ self.appendTokenName(sb, self.expecting)
+ sb.append(", found " + self.tokenText)
+ elif self.mismatchType == MismatchedTokenException.NOT_TOKEN:
+ sb.append("expecting anything but '")
+ self.appendTokenName(sb, self.expecting)
+ sb.append("'; got it anyway")
+ elif self.mismatchType in [MismatchedTokenException.RANGE, MismatchedTokenException.NOT_RANGE]:
+ sb.append("expecting token ")
+ if self.mismatchType == MismatchedTokenException.NOT_RANGE:
+ sb.append("NOT ")
+ sb.append("in range: ")
+ appendTokenName(sb, self.expecting)
+ sb.append("..")
+ appendTokenName(sb, self.upper)
+ sb.append(", found " + self.tokenText)
+ elif self.mismatchType in [MismatchedTokenException.SET, MismatchedTokenException.NOT_SET]:
+ sb.append("expecting ")
+ if self.mismatchType == MismatchedTokenException.NOT_SET:
+ sb.append("NOT ")
+ sb.append("one of (")
+ for i in range(len(self.set)):
+ self.appendTokenName(sb, self.set[i])
+ sb.append("), found " + self.tokenText)
+
+ return str().join(sb).strip()
+
+ __repr__ = __str__
+
+
+class TokenStreamException(ANTLRException):
+
+ def __init__(self, *args):
+ ANTLRException.__init__(self, *args)
+
+
+# Wraps an Exception in a TokenStreamException
+class TokenStreamIOException(TokenStreamException):
+
+ def __init__(self, *args):
+ if args and isinstance(args[0], Exception):
+ io = args[0]
+ TokenStreamException.__init__(self, str(io))
+ self.io = io
+ else:
+ TokenStreamException.__init__(self, *args)
+ self.io = self
+
+
+# Wraps a RecognitionException in a TokenStreamException
+class TokenStreamRecognitionException(TokenStreamException):
+
+ def __init__(self, *args):
+ if args and isinstance(args[0], RecognitionException):
+ recog = args[0]
+ TokenStreamException.__init__(self, str(recog))
+ self.recog = recog
+ else:
+ raise TypeError("TokenStreamRecognitionException requires RecognitionException argument")
+
+ def __str__(self):
+ return str(self.recog)
+
+ __repr__ = __str__
+
+
+class TokenStreamRetryException(TokenStreamException):
+
+ def __init__(self, *args):
+ TokenStreamException.__init__(self, *args)
+
+
+class CharStreamException(ANTLRException):
+
+ def __init__(self, *args):
+ ANTLRException.__init__(self, *args)
+
+
+# Wraps an Exception in a CharStreamException
+class CharStreamIOException(CharStreamException):
+
+ def __init__(self, *args):
+ if args and isinstance(args[0], Exception):
+ io = args[0]
+ CharStreamException.__init__(self, str(io))
+ self.io = io
+ else:
+ CharStreamException.__init__(self, *args)
+ self.io = self
+
+
+class TryAgain(Exception):
+ pass
+
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### Token ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class Token(object):
+ SKIP = -1
+ INVALID_TYPE = 0
+ EOF_TYPE = 1
+ EOF = 1
+ NULL_TREE_LOOKAHEAD = 3
+ MIN_USER_TYPE = 4
+
+ def __init__(self,**argv):
+ try:
+ self.type = argv['type']
+ except:
+ self.type = INVALID_TYPE
+ try:
+ self.text = argv['text']
+ except:
+ self.text = "<no text>"
+
+ def isEOF(self):
+ return (self.type == EOF_TYPE)
+
+ def getColumn(self):
+ return 0
+
+ def getLine(self):
+ return 0
+
+ def getFilename(self):
+ return None
+
+ def setFilename(self,name):
+ return self
+
+ def getText(self):
+ return "<no text>"
+
+ def setText(self,text):
+ if is_string_type(text):
+ pass
+ else:
+ raise TypeError("Token.setText requires string argument")
+ return self
+
+ def setColumn(self,column):
+ return self
+
+ def setLine(self,line):
+ return self
+
+ def getType(self):
+ return self.type
+
+ def setType(self,type):
+ if isinstance(type,int):
+ self.type = type
+ else:
+ raise TypeError("Token.setType requires integer argument")
+ return self
+
+ def toString(self):
+ ## not optimal
+ type_ = self.type
+ if type_ == 3:
+ tval = 'NULL_TREE_LOOKAHEAD'
+ elif type_ == 1:
+ tval = 'EOF_TYPE'
+ elif type_ == 0:
+ tval = 'INVALID_TYPE'
+ elif type_ == -1:
+ tval = 'SKIP'
+ else:
+ tval = type_
+ return '["%s",<%s>]' % (self.getText(),tval)
+
+ __str__ = toString
+ __repr__ = toString
+
+### static attribute ..
+Token.badToken = Token( type=INVALID_TYPE, text="<no text>")
+
+if __name__ == "__main__":
+ print "testing .."
+ T = Token.badToken
+ print T
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### CommonToken ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class CommonToken(Token):
+
+ def __init__(self,**argv):
+ Token.__init__(self,**argv)
+ self.line = 0
+ self.col = 0
+ try:
+ self.line = argv['line']
+ except:
+ pass
+ try:
+ self.col = argv['col']
+ except:
+ pass
+
+ def getLine(self):
+ return self.line
+
+ def getText(self):
+ return self.text
+
+ def getColumn(self):
+ return self.col
+
+ def setLine(self,line):
+ self.line = line
+ return self
+
+ def setText(self,text):
+ self.text = text
+ return self
+
+ def setColumn(self,col):
+ self.col = col
+ return self
+
+ def toString(self):
+ ## not optimal
+ type_ = self.type
+ if type_ == 3:
+ tval = 'NULL_TREE_LOOKAHEAD'
+ elif type_ == 1:
+ tval = 'EOF_TYPE'
+ elif type_ == 0:
+ tval = 'INVALID_TYPE'
+ elif type_ == -1:
+ tval = 'SKIP'
+ else:
+ tval = type_
+ d = {
+ 'text' : self.text,
+ 'type' : tval,
+ 'line' : self.line,
+ 'colm' : self.col
+ }
+
+ fmt = '["%(text)s",<%(type)s>,line=%(line)s,col=%(colm)s]'
+ return fmt % d
+
+ __str__ = toString
+ __repr__ = toString
+
+
+if __name__ == '__main__' :
+ T = CommonToken()
+ print T
+ T = CommonToken(col=15,line=1,text="some text", type=5)
+ print T
+ T = CommonToken()
+ T.setLine(1).setColumn(15).setText("some text").setType(5)
+ print T
+ print T.getLine()
+ print T.getColumn()
+ print T.getText()
+ print T.getType()
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### CommonHiddenStreamToken ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class CommonHiddenStreamToken(CommonToken):
+ def __init__(self,*args):
+ CommonToken.__init__(self,*args)
+ self.hiddenBefore = None
+ self.hiddenAfter = None
+
+ def getHiddenAfter(self):
+ return self.hiddenAfter
+
+ def getHiddenBefore(self):
+ return self.hiddenBefore
+
+ def setHiddenAfter(self,t):
+ self.hiddenAfter = t
+
+ def setHiddenBefore(self, t):
+ self.hiddenBefore = t
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### Queue ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+## Shall be a circular buffer on tokens ..
+class Queue(object):
+
+ def __init__(self):
+ self.buffer = [] # empty list
+
+ def append(self,item):
+ self.buffer.append(item)
+
+ def elementAt(self,index):
+ return self.buffer[index]
+
+ def reset(self):
+ self.buffer = []
+
+ def removeFirst(self):
+ self.buffer.pop(0)
+
+ def length(self):
+ return len(self.buffer)
+
+ def __str__(self):
+ return str(self.buffer)
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### InputBuffer ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class InputBuffer(object):
+ def __init__(self):
+ self.nMarkers = 0
+ self.markerOffset = 0
+ self.numToConsume = 0
+ self.queue = Queue()
+
+ def __str__(self):
+ return "(%s,%s,%s,%s)" % (
+ self.nMarkers,
+ self.markerOffset,
+ self.numToConsume,
+ self.queue)
+
+ def __repr__(self):
+ return str(self)
+
+ def commit(self):
+ self.nMarkers -= 1
+
+ def consume(self) :
+ self.numToConsume += 1
+
+ ## probably better to return a list of items
+ ## because of unicode. Or return a unicode
+ ## string ..
+ def getLAChars(self) :
+ i = self.markerOffset
+ n = self.queue.length()
+ s = ''
+ while i<n:
+ s += self.queue.elementAt(i)
+ return s
+
+ ## probably better to return a list of items
+ ## because of unicode chars
+ def getMarkedChars(self) :
+ s = ''
+ i = 0
+ n = self.markerOffset
+ while i<n:
+ s += self.queue.elementAt(i)
+ return s
+
+ def isMarked(self) :
+ return self.nMarkers != 0
+
+ def fill(self,k):
+ ### abstract method
+ raise NotImplementedError()
+
+ def LA(self,k) :
+ self.fill(k)
+ return self.queue.elementAt(self.markerOffset + k - 1)
+
+ def mark(self) :
+ self.syncConsume()
+ self.nMarkers += 1
+ return self.markerOffset
+
+ def rewind(self,mark) :
+ self.syncConsume()
+ self.markerOffset = mark
+ self.nMarkers -= 1
+
+ def reset(self) :
+ self.nMarkers = 0
+ self.markerOffset = 0
+ self.numToConsume = 0
+ self.queue.reset()
+
+ def syncConsume(self) :
+ while self.numToConsume > 0:
+ if self.nMarkers > 0:
+ # guess mode -- leave leading characters and bump offset.
+ self.markerOffset += 1
+ else:
+ # normal mode -- remove first character
+ self.queue.removeFirst()
+ self.numToConsume -= 1
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### CharBuffer ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class CharBuffer(InputBuffer):
+ def __init__(self,reader):
+ ##assert isinstance(reader,file)
+ super(CharBuffer,self).__init__()
+ ## a reader is supposed to be anything that has
+ ## a method 'read(int)'.
+ self.input = reader
+
+ def __str__(self):
+ base = super(CharBuffer,self).__str__()
+ return "CharBuffer{%s,%s" % (base,str(input))
+
+ def fill(self,amount):
+ try:
+ self.syncConsume()
+ while self.queue.length() < (amount + self.markerOffset) :
+ ## retrieve just one char - what happend at end
+ ## of input?
+ c = self.input.read(1)
+ ### python's behaviour is to return the empty string on
+ ### EOF, ie. no exception whatsoever is thrown. An empty
+ ### python string has the nice feature that it is of
+ ### type 'str' and "not ''" would return true. Contrary,
+ ### one can't do this: '' in 'abc'. This should return
+ ### false, but all we get is then a TypeError as an
+ ### empty string is not a character.
+
+ ### Let's assure then that we have either seen a
+ ### character or an empty string (EOF).
+ assert len(c) == 0 or len(c) == 1
+
+ ### And it shall be of type string (ASCII or UNICODE).
+ assert is_string_type(c)
+
+ ### Just append EOF char to buffer. Note that buffer may
+ ### contain then just more than one EOF char ..
+
+ ### use unicode chars instead of ASCII ..
+ self.queue.append(c)
+ except Exception,e:
+ raise CharStreamIOException(e)
+ ##except: # (mk) Cannot happen ...
+ ##error ("unexpected exception caught ..")
+ ##assert 0
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### LexerSharedInputState ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class LexerSharedInputState(object):
+ def __init__(self,ibuf):
+ assert isinstance(ibuf,InputBuffer)
+ self.input = ibuf
+ self.column = 1
+ self.line = 1
+ self.tokenStartColumn = 1
+ self.tokenStartLine = 1
+ self.guessing = 0
+ self.filename = None
+
+ def reset(self):
+ self.column = 1
+ self.line = 1
+ self.tokenStartColumn = 1
+ self.tokenStartLine = 1
+ self.guessing = 0
+ self.filename = None
+ self.input.reset()
+
+ def LA(self,k):
+ return self.input.LA(k)
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TokenStream ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TokenStream(object):
+ def nextToken(self):
+ pass
+
+ def __iter__(self):
+ return TokenStreamIterator(self)
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TokenStreamIterator ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TokenStreamIterator(object):
+ def __init__(self,inst):
+ if isinstance(inst,TokenStream):
+ self.inst = inst
+ return
+ raise TypeError("TokenStreamIterator requires TokenStream object")
+
+ def next(self):
+ assert self.inst
+ item = self.inst.nextToken()
+ if not item or item.isEOF():
+ raise StopIteration()
+ return item
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TokenStreamSelector ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TokenStreamSelector(TokenStream):
+
+ def __init__(self):
+ self._input = None
+ self._stmap = {}
+ self._stack = []
+
+ def addInputStream(self,stream,key):
+ self._stmap[key] = stream
+
+ def getCurrentStream(self):
+ return self._input
+
+ def getStream(self,sname):
+ try:
+ stream = self._stmap[sname]
+ except:
+ raise ValueError("TokenStream " + sname + " not found");
+ return stream;
+
+ def nextToken(self):
+ while 1:
+ try:
+ return self._input.nextToken()
+ except TokenStreamRetryException,r:
+ ### just retry "forever"
+ pass
+
+ def pop(self):
+ stream = self._stack.pop();
+ self.select(stream);
+ return stream;
+
+ def push(self,arg):
+ self._stack.append(self._input);
+ self.select(arg)
+
+ def retry(self):
+ raise TokenStreamRetryException()
+
+ def select(self,arg):
+ if isinstance(arg,TokenStream):
+ self._input = arg
+ return
+ if is_string_type(arg):
+ self._input = self.getStream(arg)
+ return
+ raise TypeError("TokenStreamSelector.select requires " +
+ "TokenStream or string argument")
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TokenStreamBasicFilter ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TokenStreamBasicFilter(TokenStream):
+
+ def __init__(self,input):
+
+ self.input = input;
+ self.discardMask = BitSet()
+
+ def discard(self,arg):
+ if isinstance(arg,int):
+ self.discardMask.add(arg)
+ return
+ if isinstance(arg,BitSet):
+ self.discardMark = arg
+ return
+ raise TypeError("TokenStreamBasicFilter.discard requires" +
+ "integer or BitSet argument")
+
+ def nextToken(self):
+ tok = self.input.nextToken()
+ while tok and self.discardMask.member(tok.getType()):
+ tok = self.input.nextToken()
+ return tok
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TokenStreamHiddenTokenFilter ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TokenStreamHiddenTokenFilter(TokenStreamBasicFilter):
+
+ def __init__(self,input):
+ TokenStreamBasicFilter.__init__(self,input)
+ self.hideMask = BitSet()
+ self.nextMonitoredToken = None
+ self.lastHiddenToken = None
+ self.firstHidden = None
+
+ def consume(self):
+ self.nextMonitoredToken = self.input.nextToken()
+
+ def consumeFirst(self):
+ self.consume()
+
+ p = None;
+ while self.hideMask.member(self.LA(1).getType()) or \
+ self.discardMask.member(self.LA(1).getType()):
+ if self.hideMask.member(self.LA(1).getType()):
+ if not p:
+ p = self.LA(1)
+ else:
+ p.setHiddenAfter(self.LA(1))
+ self.LA(1).setHiddenBefore(p)
+ p = self.LA(1)
+ self.lastHiddenToken = p
+ if not self.firstHidden:
+ self.firstHidden = p
+ self.consume()
+
+ def getDiscardMask(self):
+ return self.discardMask
+
+ def getHiddenAfter(self,t):
+ return t.getHiddenAfter()
+
+ def getHiddenBefore(self,t):
+ return t.getHiddenBefore()
+
+ def getHideMask(self):
+ return self.hideMask
+
+ def getInitialHiddenToken(self):
+ return self.firstHidden
+
+ def hide(self,m):
+ if isinstance(m,int):
+ self.hideMask.add(m)
+ return
+ if isinstance(m.BitMask):
+ self.hideMask = m
+ return
+
+ def LA(self,i):
+ return self.nextMonitoredToken
+
+ def nextToken(self):
+ if not self.LA(1):
+ self.consumeFirst()
+
+ monitored = self.LA(1)
+
+ monitored.setHiddenBefore(self.lastHiddenToken)
+ self.lastHiddenToken = None
+
+ self.consume()
+ p = monitored
+
+ while self.hideMask.member(self.LA(1).getType()) or \
+ self.discardMask.member(self.LA(1).getType()):
+ if self.hideMask.member(self.LA(1).getType()):
+ p.setHiddenAfter(self.LA(1))
+ if p != monitored:
+ self.LA(1).setHiddenBefore(p)
+ p = self.lastHiddenToken = self.LA(1)
+ self.consume()
+ return monitored
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### StringBuffer ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class StringBuffer:
+ def __init__(self,string=None):
+ if string:
+ self.text = list(string)
+ else:
+ self.text = []
+
+ def setLength(self,sz):
+ if not sz :
+ self.text = []
+ return
+ assert sz>0
+ if sz >= self.length():
+ return
+ ### just reset to empty buffer
+ self.text = self.text[0:sz]
+
+ def length(self):
+ return len(self.text)
+
+ def append(self,c):
+ self.text.append(c)
+
+ ### return buffer as string. Arg 'a' is used as index
+ ## into the buffer and 2nd argument shall be the length.
+ ## If 2nd args is absent, we return chars till end of
+ ## buffer starting with 'a'.
+ def getString(self,a=None,length=None):
+ if not a :
+ a = 0
+ assert a>=0
+ if a>= len(self.text) :
+ return ""
+
+ if not length:
+ ## no second argument
+ L = self.text[a:]
+ else:
+ assert (a+length) <= len(self.text)
+ b = a + length
+ L = self.text[a:b]
+ s = ""
+ for x in L : s += x
+ return s
+
+ toString = getString ## alias
+
+ def __str__(self):
+ return str(self.text)
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### Reader ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+## When reading Japanese chars, it happens that a stream returns a
+## 'char' of length 2. This looks like a bug in the appropriate
+## codecs - but I'm rather unsure about this. Anyway, if this is
+## the case, I'm going to split this string into a list of chars
+## and put them on hold, ie. on a buffer. Next time when called
+## we read from buffer until buffer is empty.
+## wh: nov, 25th -> problem does not appear in Python 2.4.0.c1.
+
+class Reader(object):
+ def __init__(self,stream):
+ self.cin = stream
+ self.buf = []
+
+ def read(self,num):
+ assert num==1
+
+ if len(self.buf):
+ return self.buf.pop()
+
+ ## Read a char - this may return a string.
+ ## Is this a bug in codecs/Python?
+ c = self.cin.read(1)
+
+ if not c or len(c)==1:
+ return c
+
+ L = list(c)
+ L.reverse()
+ for x in L:
+ self.buf.append(x)
+
+ ## read one char ..
+ return self.read(1)
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### CharScanner ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class CharScanner(TokenStream):
+ ## class members
+ NO_CHAR = 0
+ EOF_CHAR = '' ### EOF shall be the empty string.
+
+ def __init__(self, *argv, **kwargs):
+ super(CharScanner, self).__init__()
+ self.saveConsumedInput = True
+ self.tokenClass = None
+ self.caseSensitive = True
+ self.caseSensitiveLiterals = True
+ self.literals = None
+ self.tabsize = 8
+ self._returnToken = None
+ self.commitToPath = False
+ self.traceDepth = 0
+ self.text = StringBuffer()
+ self.hashString = hash(self)
+ self.setTokenObjectClass(CommonToken)
+ self.setInput(*argv)
+
+ def __iter__(self):
+ return CharScannerIterator(self)
+
+ def setInput(self,*argv):
+ ## case 1:
+ ## if there's no arg we default to read from
+ ## standard input
+ if not argv:
+ import sys
+ self.setInput(sys.stdin)
+ return
+
+ ## get 1st argument
+ arg1 = argv[0]
+
+ ## case 2:
+ ## if arg1 is a string, we assume it's a file name
+ ## and open a stream using 2nd argument as open
+ ## mode. If there's no 2nd argument we fall back to
+ ## mode '+rb'.
+ if is_string_type(arg1):
+ f = open(arg1,"rb")
+ self.setInput(f)
+ self.setFilename(arg1)
+ return
+
+ ## case 3:
+ ## if arg1 is a file we wrap it by a char buffer (
+ ## some additional checks?? No, can't do this in
+ ## general).
+ if isinstance(arg1,file):
+ self.setInput(CharBuffer(arg1))
+ return
+
+ ## case 4:
+ ## if arg1 is of type SharedLexerInputState we use
+ ## argument as is.
+ if isinstance(arg1,LexerSharedInputState):
+ self.inputState = arg1
+ return
+
+ ## case 5:
+ ## check whether argument type is of type input
+ ## buffer. If so create a SharedLexerInputState and
+ ## go ahead.
+ if isinstance(arg1,InputBuffer):
+ self.setInput(LexerSharedInputState(arg1))
+ return
+
+ ## case 6:
+ ## check whether argument type has a method read(int)
+ ## If so create CharBuffer ...
+ try:
+ if arg1.read:
+ rd = Reader(arg1)
+ cb = CharBuffer(rd)
+ ss = LexerSharedInputState(cb)
+ self.inputState = ss
+ return
+ except:
+ pass
+
+ ## case 7:
+ ## raise wrong argument exception
+ raise TypeError(argv)
+
+ def setTabSize(self,size) :
+ self.tabsize = size
+
+ def getTabSize(self) :
+ return self.tabsize
+
+ def setCaseSensitive(self,t) :
+ self.caseSensitive = t
+
+ def setCommitToPath(self,commit) :
+ self.commitToPath = commit
+
+ def setFilename(self,f) :
+ self.inputState.filename = f
+
+ def setLine(self,line) :
+ self.inputState.line = line
+
+ def setText(self,s) :
+ self.resetText()
+ self.text.append(s)
+
+ def getCaseSensitive(self) :
+ return self.caseSensitive
+
+ def getCaseSensitiveLiterals(self) :
+ return self.caseSensitiveLiterals
+
+ def getColumn(self) :
+ return self.inputState.column
+
+ def setColumn(self,c) :
+ self.inputState.column = c
+
+ def getCommitToPath(self) :
+ return self.commitToPath
+
+ def getFilename(self) :
+ return self.inputState.filename
+
+ def getInputBuffer(self) :
+ return self.inputState.input
+
+ def getInputState(self) :
+ return self.inputState
+
+ def setInputState(self,state) :
+ assert isinstance(state,LexerSharedInputState)
+ self.inputState = state
+
+ def getLine(self) :
+ return self.inputState.line
+
+ def getText(self) :
+ return str(self.text)
+
+ def getTokenObject(self) :
+ return self._returnToken
+
+ def LA(self,i) :
+ c = self.inputState.input.LA(i)
+ if not self.caseSensitive:
+ ### E0006
+ c = c.__class__.lower(c)
+ return c
+
+ def makeToken(self,type) :
+ try:
+ ## dynamically load a class
+ assert self.tokenClass
+ tok = self.tokenClass()
+ tok.setType(type)
+ tok.setColumn(self.inputState.tokenStartColumn)
+ tok.setLine(self.inputState.tokenStartLine)
+ return tok
+ except:
+ self.panic("unable to create new token")
+ return Token.badToken
+
+ def mark(self) :
+ return self.inputState.input.mark()
+
+ def _match_bitset(self,b) :
+ if b.member(self.LA(1)):
+ self.consume()
+ else:
+ raise MismatchedCharException(self.LA(1), b, False, self)
+
+ def _match_string(self,s) :
+ for c in s:
+ if self.LA(1) == c:
+ self.consume()
+ else:
+ raise MismatchedCharException(self.LA(1), c, False, self)
+
+ def match(self,item):
+ if is_string_type(item):
+ return self._match_string(item)
+ else:
+ return self._match_bitset(item)
+
+ def matchNot(self,c) :
+ if self.LA(1) != c:
+ self.consume()
+ else:
+ raise MismatchedCharException(self.LA(1), c, True, self)
+
+ def matchRange(self,c1,c2) :
+ if self.LA(1) < c1 or self.LA(1) > c2 :
+ raise MismatchedCharException(self.LA(1), c1, c2, False, self)
+ else:
+ self.consume()
+
+ def newline(self) :
+ self.inputState.line += 1
+ self.inputState.column = 1
+
+ def tab(self) :
+ c = self.getColumn()
+ nc = ( ((c-1)/self.tabsize) + 1) * self.tabsize + 1
+ self.setColumn(nc)
+
+ def panic(self,s='') :
+ print "CharScanner: panic: " + s
+ sys.exit(1)
+
+ def reportError(self,ex) :
+ print ex
+
+ def reportError(self,s) :
+ if not self.getFilename():
+ print "error: " + str(s)
+ else:
+ print self.getFilename() + ": error: " + str(s)
+
+ def reportWarning(self,s) :
+ if not self.getFilename():
+ print "warning: " + str(s)
+ else:
+ print self.getFilename() + ": warning: " + str(s)
+
+ def resetText(self) :
+ self.text.setLength(0)
+ self.inputState.tokenStartColumn = self.inputState.column
+ self.inputState.tokenStartLine = self.inputState.line
+
+ def rewind(self,pos) :
+ self.inputState.input.rewind(pos)
+
+ def setTokenObjectClass(self,cl):
+ self.tokenClass = cl
+
+ def testForLiteral(self,token):
+ if not token:
+ return
+ assert isinstance(token,Token)
+
+ _type = token.getType()
+
+ ## special tokens can't be literals
+ if _type in [SKIP,INVALID_TYPE,EOF_TYPE,NULL_TREE_LOOKAHEAD] :
+ return
+
+ _text = token.getText()
+ if not _text:
+ return
+
+ assert is_string_type(_text)
+ _type = self.testLiteralsTable(_text,_type)
+ token.setType(_type)
+ return _type
+
+ def testLiteralsTable(self,*args):
+ if is_string_type(args[0]):
+ s = args[0]
+ i = args[1]
+ else:
+ s = self.text.getString()
+ i = args[0]
+
+ ## check whether integer has been given
+ if not isinstance(i,int):
+ assert isinstance(i,int)
+
+ ## check whether we have a dict
+ assert isinstance(self.literals,dict)
+ try:
+ ## E0010
+ if not self.caseSensitiveLiterals:
+ s = s.__class__.lower(s)
+ i = self.literals[s]
+ except:
+ pass
+ return i
+
+ def toLower(self,c):
+ return c.__class__.lower()
+
+ def traceIndent(self):
+ print ' ' * self.traceDepth
+
+ def traceIn(self,rname):
+ self.traceDepth += 1
+ self.traceIndent()
+ print "> lexer %s c== %s" % (rname,self.LA(1))
+
+ def traceOut(self,rname):
+ self.traceIndent()
+ print "< lexer %s c== %s" % (rname,self.LA(1))
+ self.traceDepth -= 1
+
+ def uponEOF(self):
+ pass
+
+ def append(self,c):
+ if self.saveConsumedInput :
+ self.text.append(c)
+
+ def commit(self):
+ self.inputState.input.commit()
+
+ def consume(self):
+ if not self.inputState.guessing:
+ c = self.LA(1)
+ if self.caseSensitive:
+ self.append(c)
+ else:
+ # use input.LA(), not LA(), to get original case
+ # CharScanner.LA() would toLower it.
+ c = self.inputState.input.LA(1)
+ self.append(c)
+
+ if c and c in "\t":
+ self.tab()
+ else:
+ self.inputState.column += 1
+ self.inputState.input.consume()
+
+ ## Consume chars until one matches the given char
+ def consumeUntil_char(self,c):
+ while self.LA(1) != EOF_CHAR and self.LA(1) != c:
+ self.consume()
+
+ ## Consume chars until one matches the given set
+ def consumeUntil_bitset(self,bitset):
+ while self.LA(1) != EOF_CHAR and not self.set.member(self.LA(1)):
+ self.consume()
+
+ ### If symbol seen is EOF then generate and set token, otherwise
+ ### throw exception.
+ def default(self,la1):
+ if not la1 :
+ self.uponEOF()
+ self._returnToken = self.makeToken(EOF_TYPE)
+ else:
+ self.raise_NoViableAlt(la1)
+
+ def filterdefault(self,la1,*args):
+ if not la1:
+ self.uponEOF()
+ self._returnToken = self.makeToken(EOF_TYPE)
+ return
+
+ if not args:
+ self.consume()
+ raise TryAgain()
+ else:
+ ### apply filter object
+ self.commit();
+ try:
+ func=args[0]
+ args=args[1:]
+ apply(func,args)
+ except RecognitionException, e:
+ ## catastrophic failure
+ self.reportError(e);
+ self.consume();
+ raise TryAgain()
+
+ def raise_NoViableAlt(self,la1=None):
+ if not la1: la1 = self.LA(1)
+ fname = self.getFilename()
+ line = self.getLine()
+ col = self.getColumn()
+ raise NoViableAltForCharException(la1,fname,line,col)
+
+ def set_return_token(self,_create,_token,_ttype,_offset):
+ if _create and not _token and (not _ttype == SKIP):
+ string = self.text.getString(_offset)
+ _token = self.makeToken(_ttype)
+ _token.setText(string)
+ self._returnToken = _token
+ return _token
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### CharScannerIterator ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class CharScannerIterator:
+
+ def __init__(self,inst):
+ if isinstance(inst,CharScanner):
+ self.inst = inst
+ return
+ raise TypeError("CharScannerIterator requires CharScanner object")
+
+ def next(self):
+ assert self.inst
+ item = self.inst.nextToken()
+ if not item or item.isEOF():
+ raise StopIteration()
+ return item
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### BitSet ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+### I'm assuming here that a long is 64bits. It appears however, that
+### a long is of any size. That means we can use a single long as the
+### bitset (!), ie. Python would do almost all the work (TBD).
+
+class BitSet(object):
+ BITS = 64
+ NIBBLE = 4
+ LOG_BITS = 6
+ MOD_MASK = BITS -1
+
+ def __init__(self,data=None):
+ if not data:
+ BitSet.__init__(self,[long(0)])
+ return
+ if isinstance(data,int):
+ BitSet.__init__(self,[long(data)])
+ return
+ if isinstance(data,long):
+ BitSet.__init__(self,[data])
+ return
+ if not isinstance(data,list):
+ raise TypeError("BitSet requires integer, long, or " +
+ "list argument")
+ for x in data:
+ if not isinstance(x,long):
+ raise TypeError(self,"List argument item is " +
+ "not a long: %s" % (x))
+ self.data = data
+
+ def __str__(self):
+ bits = len(self.data) * BitSet.BITS
+ s = ""
+ for i in xrange(0,bits):
+ if self.at(i):
+ s += "1"
+ else:
+ s += "o"
+ if not ((i+1) % 10):
+ s += '|%s|' % (i+1)
+ return s
+
+ def __repr__(self):
+ return str(self)
+
+ def member(self,item):
+ if not item:
+ return False
+
+ if isinstance(item,int):
+ return self.at(item)
+
+ if not is_string_type(item):
+ raise TypeError(self,"char or unichar expected: %s" % (item))
+
+ ## char is a (unicode) string with at most lenght 1, ie.
+ ## a char.
+
+ if len(item) != 1:
+ raise TypeError(self,"char expected: %s" % (item))
+
+ ### handle ASCII/UNICODE char
+ num = ord(item)
+
+ ### check whether position num is in bitset
+ return self.at(num)
+
+ def wordNumber(self,bit):
+ return bit >> BitSet.LOG_BITS
+
+ def bitMask(self,bit):
+ pos = bit & BitSet.MOD_MASK ## bit mod BITS
+ return (1L << pos)
+
+ def set(self,bit,on=True):
+ # grow bitset as required (use with care!)
+ i = self.wordNumber(bit)
+ mask = self.bitMask(bit)
+ if i>=len(self.data):
+ d = i - len(self.data) + 1
+ for x in xrange(0,d):
+ self.data.append(0L)
+ assert len(self.data) == i+1
+ if on:
+ self.data[i] |= mask
+ else:
+ self.data[i] &= (~mask)
+
+ ### make add an alias for set
+ add = set
+
+ def off(self,bit,off=True):
+ self.set(bit,not off)
+
+ def at(self,bit):
+ i = self.wordNumber(bit)
+ v = self.data[i]
+ m = self.bitMask(bit)
+ return v & m
+
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### some further funcs ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+def illegalarg_ex(func):
+ raise ValueError(
+ "%s is only valid if parser is built for debugging" %
+ (func.func_name))
+
+def runtime_ex(func):
+ raise RuntimeException(
+ "%s is only valid if parser is built for debugging" %
+ (func.func_name))
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TokenBuffer ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TokenBuffer(object):
+ def __init__(self,stream):
+ self.input = stream
+ self.nMarkers = 0
+ self.markerOffset = 0
+ self.numToConsume = 0
+ self.queue = Queue()
+
+ def reset(self) :
+ self.nMarkers = 0
+ self.markerOffset = 0
+ self.numToConsume = 0
+ self.queue.reset()
+
+ def consume(self) :
+ self.numToConsume += 1
+
+ def fill(self, amount):
+ self.syncConsume()
+ while self.queue.length() < (amount + self.markerOffset):
+ self.queue.append(self.input.nextToken())
+
+ def getInput(self):
+ return self.input
+
+ def LA(self,k) :
+ self.fill(k)
+ return self.queue.elementAt(self.markerOffset + k - 1).type
+
+ def LT(self,k) :
+ self.fill(k)
+ return self.queue.elementAt(self.markerOffset + k - 1)
+
+ def mark(self) :
+ self.syncConsume()
+ self.nMarkers += 1
+ return self.markerOffset
+
+ def rewind(self,mark) :
+ self.syncConsume()
+ self.markerOffset = mark
+ self.nMarkers -= 1
+
+ def syncConsume(self) :
+ while self.numToConsume > 0:
+ if self.nMarkers > 0:
+ # guess mode -- leave leading characters and bump offset.
+ self.markerOffset += 1
+ else:
+ # normal mode -- remove first character
+ self.queue.removeFirst()
+ self.numToConsume -= 1
+
+ def __str__(self):
+ return "(%s,%s,%s,%s,%s)" % (
+ self.input,
+ self.nMarkers,
+ self.markerOffset,
+ self.numToConsume,
+ self.queue)
+
+ def __repr__(self):
+ return str(self)
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### ParserSharedInputState ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class ParserSharedInputState(object):
+
+ def __init__(self):
+ self.input = None
+ self.reset()
+
+ def reset(self):
+ self.guessing = 0
+ self.filename = None
+ if self.input:
+ self.input.reset()
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### Parser ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class Parser(object):
+
+ def __init__(self, *args, **kwargs):
+ self.tokenNames = None
+ self.returnAST = None
+ self.astFactory = None
+ self.tokenTypeToASTClassMap = {}
+ self.ignoreInvalidDebugCalls = False
+ self.traceDepth = 0
+ if not args:
+ self.inputState = ParserSharedInputState()
+ return
+ arg0 = args[0]
+ assert isinstance(arg0,ParserSharedInputState)
+ self.inputState = arg0
+ return
+
+ def getTokenTypeToASTClassMap(self):
+ return self.tokenTypeToASTClassMap
+
+
+ def addMessageListener(self, l):
+ if not self.ignoreInvalidDebugCalls:
+ illegalarg_ex(addMessageListener)
+
+ def addParserListener(self,l) :
+ if (not self.ignoreInvalidDebugCalls) :
+ illegalarg_ex(addParserListener)
+
+ def addParserMatchListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls) :
+ illegalarg_ex(addParserMatchListener)
+
+ def addParserTokenListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ illegalarg_ex(addParserTokenListener)
+
+ def addSemanticPredicateListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ illegalarg_ex(addSemanticPredicateListener)
+
+ def addSyntacticPredicateListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ illegalarg_ex(addSyntacticPredicateListener)
+
+ def addTraceListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ illegalarg_ex(addTraceListener)
+
+ def consume(self):
+ raise NotImplementedError()
+
+ def _consumeUntil_type(self,tokenType):
+ while self.LA(1) != EOF_TYPE and self.LA(1) != tokenType:
+ self.consume()
+
+ def _consumeUntil_bitset(self, set):
+ while self.LA(1) != EOF_TYPE and not set.member(self.LA(1)):
+ self.consume()
+
+ def consumeUntil(self,arg):
+ if isinstance(arg,int):
+ self._consumeUntil_type(arg)
+ else:
+ self._consumeUntil_bitset(arg)
+
+ def defaultDebuggingSetup(self):
+ pass
+
+ def getAST(self) :
+ return self.returnAST
+
+ def getASTFactory(self) :
+ return self.astFactory
+
+ def getFilename(self) :
+ return self.inputState.filename
+
+ def getInputState(self) :
+ return self.inputState
+
+ def setInputState(self, state) :
+ self.inputState = state
+
+ def getTokenName(self,num) :
+ return self.tokenNames[num]
+
+ def getTokenNames(self) :
+ return self.tokenNames
+
+ def isDebugMode(self) :
+ return self.false
+
+ def LA(self, i):
+ raise NotImplementedError()
+
+ def LT(self, i):
+ raise NotImplementedError()
+
+ def mark(self):
+ return self.inputState.input.mark()
+
+ def _match_int(self,t):
+ if (self.LA(1) != t):
+ raise MismatchedTokenException(
+ self.tokenNames, self.LT(1), t, False, self.getFilename())
+ else:
+ self.consume()
+
+ def _match_set(self, b):
+ if (not b.member(self.LA(1))):
+ raise MismatchedTokenException(
+ self.tokenNames,self.LT(1), b, False, self.getFilename())
+ else:
+ self.consume()
+
+ def match(self,set) :
+ if isinstance(set,int):
+ self._match_int(set)
+ return
+ if isinstance(set,BitSet):
+ self._match_set(set)
+ return
+ raise TypeError("Parser.match requires integer ot BitSet argument")
+
+ def matchNot(self,t):
+ if self.LA(1) == t:
+ raise MismatchedTokenException(
+ tokenNames, self.LT(1), t, True, self.getFilename())
+ else:
+ self.consume()
+
+ def removeMessageListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(removeMessageListener)
+
+ def removeParserListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(removeParserListener)
+
+ def removeParserMatchListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(removeParserMatchListener)
+
+ def removeParserTokenListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(removeParserTokenListener)
+
+ def removeSemanticPredicateListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(removeSemanticPredicateListener)
+
+ def removeSyntacticPredicateListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(removeSyntacticPredicateListener)
+
+ def removeTraceListener(self, l) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(removeTraceListener)
+
+ def reportError(self,x) :
+ fmt = "syntax error:"
+ f = self.getFilename()
+ if f:
+ fmt = ("%s:" % f) + fmt
+ if isinstance(x,Token):
+ line = x.getColumn()
+ col = x.getLine()
+ text = x.getText()
+ fmt = fmt + 'unexpected symbol at line %s (column %s) : "%s"'
+ print >>sys.stderr, fmt % (line,col,text)
+ else:
+ print >>sys.stderr, fmt,str(x)
+
+ def reportWarning(self,s):
+ f = self.getFilename()
+ if f:
+ print "%s:warning: %s" % (f,str(x))
+ else:
+ print "warning: %s" % (str(x))
+
+ def rewind(self, pos) :
+ self.inputState.input.rewind(pos)
+
+ def setASTFactory(self, f) :
+ self.astFactory = f
+
+ def setASTNodeClass(self, cl) :
+ self.astFactory.setASTNodeType(cl)
+
+ def setASTNodeType(self, nodeType) :
+ self.setASTNodeClass(nodeType)
+
+ def setDebugMode(self, debugMode) :
+ if (not self.ignoreInvalidDebugCalls):
+ runtime_ex(setDebugMode)
+
+ def setFilename(self, f) :
+ self.inputState.filename = f
+
+ def setIgnoreInvalidDebugCalls(self, value) :
+ self.ignoreInvalidDebugCalls = value
+
+ def setTokenBuffer(self, t) :
+ self.inputState.input = t
+
+ def traceIndent(self):
+ print " " * self.traceDepth
+
+ def traceIn(self,rname):
+ self.traceDepth += 1
+ self.trace("> ", rname)
+
+ def traceOut(self,rname):
+ self.trace("< ", rname)
+ self.traceDepth -= 1
+
+ ### wh: moved from ASTFactory to Parser
+ def addASTChild(self,currentAST, child):
+ if not child:
+ return
+ if not currentAST.root:
+ currentAST.root = child
+ elif not currentAST.child:
+ currentAST.root.setFirstChild(child)
+ else:
+ currentAST.child.setNextSibling(child)
+ currentAST.child = child
+ currentAST.advanceChildToEnd()
+
+ ### wh: moved from ASTFactory to Parser
+ def makeASTRoot(self,currentAST,root) :
+ if root:
+ ### Add the current root as a child of new root
+ root.addChild(currentAST.root)
+ ### The new current child is the last sibling of the old root
+ currentAST.child = currentAST.root
+ currentAST.advanceChildToEnd()
+ ### Set the new root
+ currentAST.root = root
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### LLkParser ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class LLkParser(Parser):
+
+ def __init__(self, *args, **kwargs):
+ try:
+ arg1 = args[0]
+ except:
+ arg1 = 1
+
+ if isinstance(arg1,int):
+ super(LLkParser,self).__init__()
+ self.k = arg1
+ return
+
+ if isinstance(arg1,ParserSharedInputState):
+ super(LLkParser,self).__init__(arg1)
+ self.set_k(1,*args)
+ return
+
+ if isinstance(arg1,TokenBuffer):
+ super(LLkParser,self).__init__()
+ self.setTokenBuffer(arg1)
+ self.set_k(1,*args)
+ return
+
+ if isinstance(arg1,TokenStream):
+ super(LLkParser,self).__init__()
+ tokenBuf = TokenBuffer(arg1)
+ self.setTokenBuffer(tokenBuf)
+ self.set_k(1,*args)
+ return
+
+ ### unknown argument
+ raise TypeError("LLkParser requires integer, " +
+ "ParserSharedInputStream or TokenStream argument")
+
+ def consume(self):
+ self.inputState.input.consume()
+
+ def LA(self,i):
+ return self.inputState.input.LA(i)
+
+ def LT(self,i):
+ return self.inputState.input.LT(i)
+
+ def set_k(self,index,*args):
+ try:
+ self.k = args[index]
+ except:
+ self.k = 1
+
+ def trace(self,ee,rname):
+ print type(self)
+ self.traceIndent()
+ guess = ""
+ if self.inputState.guessing > 0:
+ guess = " [guessing]"
+ print(ee + rname + guess)
+ for i in xrange(1,self.k+1):
+ if i != 1:
+ print(", ")
+ if self.LT(i) :
+ v = self.LT(i).getText()
+ else:
+ v = "null"
+ print "LA(%s) == %s" % (i,v)
+ print("\n")
+
+ def traceIn(self,rname):
+ self.traceDepth += 1;
+ self.trace("> ", rname);
+
+ def traceOut(self,rname):
+ self.trace("< ", rname);
+ self.traceDepth -= 1;
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TreeParserSharedInputState ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TreeParserSharedInputState(object):
+ def __init__(self):
+ self.guessing = 0
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### TreeParser ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class TreeParser(object):
+
+ def __init__(self, *args, **kwargs):
+ self.inputState = TreeParserSharedInputState()
+ self._retTree = None
+ self.tokenNames = []
+ self.returnAST = None
+ self.astFactory = ASTFactory()
+ self.traceDepth = 0
+
+ def getAST(self):
+ return self.returnAST
+
+ def getASTFactory(self):
+ return self.astFactory
+
+ def getTokenName(self,num) :
+ return self.tokenNames[num]
+
+ def getTokenNames(self):
+ return self.tokenNames
+
+ def match(self,t,set) :
+ assert isinstance(set,int) or isinstance(set,BitSet)
+ if not t or t == ASTNULL:
+ raise MismatchedTokenException(self.getTokenNames(), t,set, False)
+
+ if isinstance(set,int) and t.getType() != set:
+ raise MismatchedTokenException(self.getTokenNames(), t,set, False)
+
+ if isinstance(set,BitSet) and not set.member(t.getType):
+ raise MismatchedTokenException(self.getTokenNames(), t,set, False)
+
+ def matchNot(self,t, ttype) :
+ if not t or (t == ASTNULL) or (t.getType() == ttype):
+ raise MismatchedTokenException(getTokenNames(), t, ttype, True)
+
+ def reportError(self,ex):
+ print >>sys.stderr,"error:",ex
+
+ def reportWarning(self, s):
+ print "warning:",s
+
+ def setASTFactory(self,f):
+ self.astFactory = f
+
+ def setASTNodeType(self,nodeType):
+ self.setASTNodeClass(nodeType)
+
+ def setASTNodeClass(self,nodeType):
+ self.astFactory.setASTNodeType(nodeType)
+
+ def traceIndent(self):
+ print " " * self.traceDepth
+
+ def traceIn(self,rname,t):
+ self.traceDepth += 1
+ self.traceIndent()
+ print("> " + rname + "(" +
+ ifelse(t,str(t),"null") + ")" +
+ ifelse(self.inputState.guessing>0,"[guessing]",""))
+
+ def traceOut(self,rname,t):
+ self.traceIndent()
+ print("< " + rname + "(" +
+ ifelse(t,str(t),"null") + ")" +
+ ifelse(self.inputState.guessing>0,"[guessing]",""))
+ self.traceDepth -= 1
+
+ ### wh: moved from ASTFactory to TreeParser
+ def addASTChild(self,currentAST, child):
+ if not child:
+ return
+ if not currentAST.root:
+ currentAST.root = child
+ elif not currentAST.child:
+ currentAST.root.setFirstChild(child)
+ else:
+ currentAST.child.setNextSibling(child)
+ currentAST.child = child
+ currentAST.advanceChildToEnd()
+
+ ### wh: moved from ASTFactory to TreeParser
+ def makeASTRoot(self,currentAST,root):
+ if root:
+ ### Add the current root as a child of new root
+ root.addChild(currentAST.root)
+ ### The new current child is the last sibling of the old root
+ currentAST.child = currentAST.root
+ currentAST.advanceChildToEnd()
+ ### Set the new root
+ currentAST.root = root
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### funcs to work on trees ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+def rightmost(ast):
+ if ast:
+ while(ast.right):
+ ast = ast.right
+ return ast
+
+def cmptree(s,t,partial):
+ while(s and t):
+ ### as a quick optimization, check roots first.
+ if not s.equals(t):
+ return False
+
+ ### if roots match, do full list match test on children.
+ if not cmptree(s.getFirstChild(),t.getFirstChild(),partial):
+ return False
+
+ s = s.getNextSibling()
+ t = t.getNextSibling()
+
+ r = ifelse(partial,not t,not s and not t)
+ return r
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### AST ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class AST(object):
+ def __init__(self):
+ pass
+
+ def addChild(self, c):
+ pass
+
+ def equals(self, t):
+ return False
+
+ def equalsList(self, t):
+ return False
+
+ def equalsListPartial(self, t):
+ return False
+
+ def equalsTree(self, t):
+ return False
+
+ def equalsTreePartial(self, t):
+ return False
+
+ def findAll(self, tree):
+ return None
+
+ def findAllPartial(self, subtree):
+ return None
+
+ def getFirstChild(self):
+ return self
+
+ def getNextSibling(self):
+ return self
+
+ def getText(self):
+ return ""
+
+ def getType(self):
+ return INVALID_TYPE
+
+ def getLine(self):
+ return 0
+
+ def getColumn(self):
+ return 0
+
+ def getNumberOfChildren(self):
+ return 0
+
+ def initialize(self, t, txt):
+ pass
+
+ def initialize(self, t):
+ pass
+
+ def setFirstChild(self, c):
+ pass
+
+ def setNextSibling(self, n):
+ pass
+
+ def setText(self, text):
+ pass
+
+ def setType(self, ttype):
+ pass
+
+ def toString(self):
+ self.getText()
+
+ __str__ = toString
+
+ def toStringList(self):
+ return self.getText()
+
+ def toStringTree(self):
+ return self.getText()
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### ASTNULLType ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+### There is only one instance of this class **/
+class ASTNULLType(AST):
+ def __init__(self):
+ AST.__init__(self)
+ pass
+
+ def getText(self):
+ return "<ASTNULL>"
+
+ def getType(self):
+ return NULL_TREE_LOOKAHEAD
+
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### BaseAST ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class BaseAST(AST):
+
+ verboseStringConversion = False
+ tokenNames = None
+
+ def __init__(self):
+ self.down = None ## kid
+ self.right = None ## sibling
+
+ def addChild(self,node):
+ if node:
+ t = rightmost(self.down)
+ if t:
+ t.right = node
+ else:
+ assert not self.down
+ self.down = node
+
+ def getNumberOfChildren(self):
+ t = self.down
+ n = 0
+ while t:
+ n += 1
+ t = t.right
+ return n
+
+ def doWorkForFindAll(self,v,target,partialMatch):
+ sibling = self
+
+ while sibling:
+ c1 = partialMatch and sibling.equalsTreePartial(target)
+ if c1:
+ v.append(sibling)
+ else:
+ c2 = not partialMatch and sibling.equalsTree(target)
+ if c2:
+ v.append(sibling)
+
+ ### regardless of match or not, check any children for matches
+ if sibling.getFirstChild():
+ sibling.getFirstChild().doWorkForFindAll(v,target,partialMatch)
+
+ sibling = sibling.getNextSibling()
+
+ ### Is node t equal to 'self' in terms of token type and text?
+ def equals(self,t):
+ if not t:
+ return False
+ return self.getText() == t.getText() and self.getType() == t.getType()
+
+ ### Is t an exact structural and equals() match of this tree. The
+ ### 'self' reference is considered the start of a sibling list.
+ ###
+ def equalsList(self, t):
+ return cmptree(self, t, partial=False)
+
+ ### Is 't' a subtree of this list?
+ ### The siblings of the root are NOT ignored.
+ ###
+ def equalsListPartial(self,t):
+ return cmptree(self,t,partial=True)
+
+ ### Is tree rooted at 'self' equal to 't'? The siblings
+ ### of 'self' are ignored.
+ ###
+ def equalsTree(self, t):
+ return self.equals(t) and \
+ cmptree(self.getFirstChild(), t.getFirstChild(), partial=False)
+
+ ### Is 't' a subtree of the tree rooted at 'self'? The siblings
+ ### of 'self' are ignored.
+ ###
+ def equalsTreePartial(self, t):
+ if not t:
+ return True
+ return self.equals(t) and cmptree(
+ self.getFirstChild(), t.getFirstChild(), partial=True)
+
+ ### Walk the tree looking for all exact subtree matches. Return
+ ### an ASTEnumerator that lets the caller walk the list
+ ### of subtree roots found herein.
+ def findAll(self,target):
+ roots = []
+
+ ### the empty tree cannot result in an enumeration
+ if not target:
+ return None
+ # find all matches recursively
+ self.doWorkForFindAll(roots, target, False)
+ return roots
+
+ ### Walk the tree looking for all subtrees. Return
+ ### an ASTEnumerator that lets the caller walk the list
+ ### of subtree roots found herein.
+ def findAllPartial(self,sub):
+ roots = []
+
+ ### the empty tree cannot result in an enumeration
+ if not sub:
+ return None
+
+ self.doWorkForFindAll(roots, sub, True) ### find all matches recursively
+ return roots
+
+ ### Get the first child of this node None if not children
+ def getFirstChild(self):
+ return self.down
+
+ ### Get the next sibling in line after this one
+ def getNextSibling(self):
+ return self.right
+
+ ### Get the token text for this node
+ def getText(self):
+ return ""
+
+ ### Get the token type for this node
+ def getType(self):
+ return 0
+
+ def getLine(self):
+ return 0
+
+ def getColumn(self):
+ return 0
+
+ ### Remove all children */
+ def removeChildren(self):
+ self.down = None
+
+ def setFirstChild(self,c):
+ self.down = c
+
+ def setNextSibling(self, n):
+ self.right = n
+
+ ### Set the token text for this node
+ def setText(self, text):
+ pass
+
+ ### Set the token type for this node
+ def setType(self, ttype):
+ pass
+
+ ### static
+ def setVerboseStringConversion(verbose,names):
+ verboseStringConversion = verbose
+ tokenNames = names
+ setVerboseStringConversion = staticmethod(setVerboseStringConversion)
+
+ ### Return an array of strings that maps token ID to it's text.
+ ## @since 2.7.3
+ def getTokenNames():
+ return tokenNames
+
+ def toString(self):
+ return self.getText()
+
+ ### return tree as lisp string - sibling included
+ def toStringList(self):
+ ts = self.toStringTree()
+ sib = self.getNextSibling()
+ if sib:
+ ts += sib.toStringList()
+ return ts
+
+ __str__ = toStringList
+
+ ### return tree as string - siblings ignored
+ def toStringTree(self):
+ ts = ""
+ kid = self.getFirstChild()
+ if kid:
+ ts += " ("
+ ts += " " + self.toString()
+ if kid:
+ ts += kid.toStringList()
+ ts += " )"
+ return ts
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### CommonAST ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+### Common AST node implementation
+class CommonAST(BaseAST):
+ def __init__(self,token=None):
+ super(CommonAST,self).__init__()
+ self.ttype = INVALID_TYPE
+ self.text = "<no text>"
+ self.line = 0
+ self.column= 0
+ self.initialize(token)
+ #assert self.text
+
+ ### Get the token text for this node
+ def getText(self):
+ return self.text
+
+ ### Get the token type for this node
+ def getType(self):
+ return self.ttype
+
+ ### Get the line for this node
+ def getLine(self):
+ return self.line
+
+ ### Get the column for this node
+ def getColumn(self):
+ return self.column
+
+ def initialize(self,*args):
+ if not args:
+ return
+
+ arg0 = args[0]
+
+ if isinstance(arg0,int):
+ arg1 = args[1]
+ self.setType(arg0)
+ self.setText(arg1)
+ return
+
+ if isinstance(arg0,AST) or isinstance(arg0,Token):
+ self.setText(arg0.getText())
+ self.setType(arg0.getType())
+ self.line = arg0.getLine()
+ self.column = arg0.getColumn()
+ return
+
+ ### Set the token text for this node
+ def setText(self,text_):
+ assert is_string_type(text_)
+ self.text = text_
+
+ ### Set the token type for this node
+ def setType(self,ttype_):
+ assert isinstance(ttype_,int)
+ self.ttype = ttype_
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### CommonASTWithHiddenTokens ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class CommonASTWithHiddenTokens(CommonAST):
+
+ def __init__(self,*args):
+ CommonAST.__init__(self,*args)
+ self.hiddenBefore = None
+ self.hiddenAfter = None
+
+ def getHiddenAfter(self):
+ return self.hiddenAfter
+
+ def getHiddenBefore(self):
+ return self.hiddenBefore
+
+ def initialize(self,*args):
+ CommonAST.initialize(self,*args)
+ if args and isinstance(args[0],Token):
+ assert isinstance(args[0],CommonHiddenStreamToken)
+ self.hiddenBefore = args[0].getHiddenBefore()
+ self.hiddenAfter = args[0].getHiddenAfter()
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### ASTPair ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class ASTPair(object):
+ def __init__(self):
+ self.root = None ### current root of tree
+ self.child = None ### current child to which siblings are added
+
+ ### Make sure that child is the last sibling */
+ def advanceChildToEnd(self):
+ if self.child:
+ while self.child.getNextSibling():
+ self.child = self.child.getNextSibling()
+
+ ### Copy an ASTPair. Don't call it clone() because we want type-safety */
+ def copy(self):
+ tmp = ASTPair()
+ tmp.root = self.root
+ tmp.child = self.child
+ return tmp
+
+ def toString(self):
+ r = ifelse(not root,"null",self.root.getText())
+ c = ifelse(not child,"null",self.child.getText())
+ return "[%s,%s]" % (r,c)
+
+ __str__ = toString
+ __repr__ = toString
+
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### ASTFactory ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class ASTFactory(object):
+ def __init__(self,table=None):
+ self._class = None
+ self._classmap = ifelse(table,table,None)
+
+ def create(self,*args):
+ if not args:
+ return self.create(INVALID_TYPE)
+
+ arg0 = args[0]
+ arg1 = None
+ arg2 = None
+
+ try:
+ arg1 = args[1]
+ arg2 = args[2]
+ except:
+ pass
+
+ # ctor(int)
+ if isinstance(arg0,int) and not arg2:
+ ### get class for 'self' type
+ c = self.getASTNodeType(arg0)
+ t = self.create(c)
+ if t:
+ t.initialize(arg0, ifelse(arg1,arg1,""))
+ return t
+
+ # ctor(int,something)
+ if isinstance(arg0,int) and arg2:
+ t = self.create(arg2)
+ if t:
+ t.initialize(arg0,arg1)
+ return t
+
+ # ctor(AST)
+ if isinstance(arg0,AST):
+ t = self.create(arg0.getType())
+ if t:
+ t.initialize(arg0)
+ return t
+
+ # ctor(token)
+ if isinstance(arg0,Token) and not arg1:
+ ttype = arg0.getType()
+ assert isinstance(ttype,int)
+ t = self.create(ttype)
+ if t:
+ t.initialize(arg0)
+ return t
+
+ # ctor(token,class)
+ if isinstance(arg0,Token) and arg1:
+ assert isinstance(arg1,type)
+ assert issubclass(arg1,AST)
+ # this creates instance of 'arg1' using 'arg0' as
+ # argument. Wow, that's magic!
+ t = arg1(arg0)
+ assert t and isinstance(t,AST)
+ return t
+
+ # ctor(class)
+ if isinstance(arg0,type):
+ ### next statement creates instance of type (!)
+ t = arg0()
+ assert isinstance(t,AST)
+ return t
+
+
+ def setASTNodeClass(self,className=None):
+ if not className:
+ return
+ assert isinstance(className,type)
+ assert issubclass(className,AST)
+ self._class = className
+
+ ### kind of misnomer - use setASTNodeClass instead.
+ setASTNodeType = setASTNodeClass
+
+ def getASTNodeClass(self):
+ return self._class
+
+
+
+ def getTokenTypeToASTClassMap(self):
+ return self._classmap
+
+ def setTokenTypeToASTClassMap(self,amap):
+ self._classmap = amap
+
+ def error(self, e):
+ import sys
+ print >> sys.stderr, e
+
+ def setTokenTypeASTNodeType(self, tokenType, className):
+ """
+ Specify a mapping between a token type and a (AST) class.
+ """
+ if not self._classmap:
+ self._classmap = {}
+
+ if not className:
+ try:
+ del self._classmap[tokenType]
+ except:
+ pass
+ else:
+ ### here we should also perform actions to ensure that
+ ### a. class can be loaded
+ ### b. class is a subclass of AST
+ ###
+ assert isinstance(className,type)
+ assert issubclass(className,AST) ## a & b
+ ### enter the class
+ self._classmap[tokenType] = className
+
+ def getASTNodeType(self,tokenType):
+ """
+ For a given token type return the AST node type. First we
+ lookup a mapping table, second we try _class
+ and finally we resolve to "antlr.CommonAST".
+ """
+
+ # first
+ if self._classmap:
+ try:
+ c = self._classmap[tokenType]
+ if c:
+ return c
+ except:
+ pass
+ # second
+ if self._class:
+ return self._class
+
+ # default
+ return CommonAST
+
+ ### methods that have been moved to file scope - just listed
+ ### here to be somewhat consistent with original API
+ def dup(self,t):
+ return antlr.dup(t,self)
+
+ def dupList(self,t):
+ return antlr.dupList(t,self)
+
+ def dupTree(self,t):
+ return antlr.dupTree(t,self)
+
+ ### methods moved to other classes
+ ### 1. makeASTRoot -> Parser
+ ### 2. addASTChild -> Parser
+
+ ### non-standard: create alias for longish method name
+ maptype = setTokenTypeASTNodeType
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### ASTVisitor ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+class ASTVisitor(object):
+ def __init__(self,*args):
+ pass
+
+ def visit(self,ast):
+ pass
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+### static methods and variables ###
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx###
+
+ASTNULL = ASTNULLType()
+
+### wh: moved from ASTFactory as there's nothing ASTFactory-specific
+### in this method.
+def make(*nodes):
+ if not nodes:
+ return None
+
+ for i in xrange(0,len(nodes)):
+ node = nodes[i]
+ if node:
+ assert isinstance(node,AST)
+
+ root = nodes[0]
+ tail = None
+ if root:
+ root.setFirstChild(None)
+
+ for i in xrange(1,len(nodes)):
+ if not nodes[i]:
+ continue
+ if not root:
+ root = tail = nodes[i]
+ elif not tail:
+ root.setFirstChild(nodes[i])
+ tail = root.getFirstChild()
+ else:
+ tail.setNextSibling(nodes[i])
+ tail = tail.getNextSibling()
+
+ ### Chase tail to last sibling
+ while tail.getNextSibling():
+ tail = tail.getNextSibling()
+ return root
+
+def dup(t,factory):
+ if not t:
+ return None
+
+ if factory:
+ dup_t = factory.create(t.__class__)
+ else:
+ raise TypeError("dup function requires ASTFactory argument")
+ dup_t.initialize(t)
+ return dup_t
+
+def dupList(t,factory):
+ result = dupTree(t,factory)
+ nt = result
+ while t:
+ ## for each sibling of the root
+ t = t.getNextSibling()
+ nt.setNextSibling(dupTree(t,factory))
+ nt = nt.getNextSibling()
+ return result
+
+def dupTree(t,factory):
+ result = dup(t,factory)
+ if t:
+ result.setFirstChild(dupList(t.getFirstChild(),factory))
+ return result
+
+###xxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxxx
+### $Id: antlr.py 3750 2009-02-13 00:13:04Z sjmachin $
+
+# Local Variables: ***
+# mode: python ***
+# py-indent-offset: 4 ***
+# End: ***
diff --git a/tablib/packages/xlwt/doc/xlwt.html b/tablib/packages/xlwt/doc/xlwt.html
new file mode 100644
index 0000000..6efb698
--- /dev/null
+++ b/tablib/packages/xlwt/doc/xlwt.html
@@ -0,0 +1,199 @@
+<!DOCTYPE html PUBLIC '-//W3C//DTD XHTML 1.0 Strict//EN' 'http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd'>
+<html>
+<head>
+<meta http-equiv='Content-Type' content='text/html; charset=us-ascii' />
+<title>The xlwt Module</title>
+</head>
+<body>
+<h1>The xlwt Module</h1>
+<p /><p><b>A Python package for generating Microsoft Excel &#8482; spreadsheet files.
+</b></p>
+
+<h2>General information</h2>
+
+<h3>State of Documentation</h3>
+
+<p>
+This documentation is currently incomplete. There may be methods and
+classes not included and any item marked with a <em
+style="color:red;">[NC]</em> is not complete and may have further
+parameters, methods, attributes and functionality that are not
+documented. In these cases, you'll have to refer to the source if the
+documentation provided is insufficient.
+</p>
+
+</p>
+
+<h2>Module Contents <em style="color:red;">[NC]</em></h2>
+<dl>
+ <dt><b>easyxf</b> (function)</dt>
+ <dd>
+ <p>
+ This function is used to create and configure XFStyle objects
+ for use with (for example) the Worksheet.write method.
+ </p>
+ <dl>
+ <dt><i>strg_to_parse</i></dt>
+ <dd>
+ <p>
+ A string to be parsed to obtain attribute values for Alignment, Borders, Font,
+ Pattern and Protection objects. Refer to the examples
+ in the file .../examples/xlwt_easyxf_simple_demo.py and to the xf_dict
+ dictionary in Style.py. Various synonyms including color/colour, center/centre and gray/grey
+ are allowed. Case is irrelevant (except maybe in font names). '-' may be used instead
+ of '_'.<br />
+ Example: "font: bold on; align: wrap on, vert centre, horiz center"
+ </p>
+ </dd>
+ <dt><i>num_format_str</i></dt>
+ <dd>
+ <p>
+ To get the "number format string" of an existing cell whose format you want to reproduce,
+ select the cell and click on Format/Cells/Number/Custom. Otherwise, refer to Excel help.<br />
+ Examples: "#,##0.00", "dd/mm/yyyy"
+ </p>
+ </dd>
+ <dt>Returns:</dt>
+ <dd>
+ An object of the XFstyle class
+ </dd>
+ </dl>
+ <br />
+
+ </dd>
+
+ <dt><b>Workbook</b> (class) [<a href='#xlwt.Workbook-class'>#</a>]</dt>
+ <dd>
+ <p>The class to instantiate to create a workbook</p>
+ <p>For more information about this class, see <a href='#xlwt.Workbook-class'><i>The Workbook Class</i></a>.</p>
+ </dd>
+ <dt><b>Worksheet</b> (class) [<a href='#xlwt.Worksheet-class'>#</a>]</dt>
+ <dd>
+ <p>A class to represent the contents of a sheet in a workbook.</p>
+ <p>For more information about this class, see <a href='#xlwt.Worksheet-class'><i>The Worksheet Class</i></a>.</p>
+ </dd>
+</dl>
+
+<h2><a id='xlwt.Workbook-class' name='xlwt.Workbook-class'>The Workbook Class</a><em style="color:red;">[NC]</em></h2>
+<dl>
+<dt><b>Workbook(encoding='ascii',style_compression=0)</b> (class) [<a href='#xlwt.Workbook-class'>#</a>]</dt>
+<dd>
+ <p>
+ This is a class representing a workbook and all its contents.
+ When creating Excel files with xlwt, you will normally start by
+ instantiating an object of this class.
+ </p>
+ <dl>
+ <dt><i>encoding</i></dt>
+ <dd>
+ <em style="color:red;">[NC]</em>
+ </dd>
+ <dt><i>style_compression</i></dt>
+ <dd>
+ <em style="color:red;">[NC]</em>
+ </dd>
+ <dt>Returns:</dt>
+ <dd>
+ An object of the <a href="#xlwt.Workbook-class">Workbook</a> class
+ </dd>
+ </dl>
+ <br />
+</dd>
+<dt><a id='xlwt.Workbook.add_sheet-method' name='xlwt.Workbook.add_sheet-method'><b>add_sheet(sheetname)</b></a> [<a href='#xlwt.Workbook.add_sheet-method'>#</a>]</dt>
+<dd>
+ <p>
+ This method is used to create Worksheets in a Workbook.
+ </p>
+ <dl>
+ <dt><i>sheetname</i></dt>
+ <dd>
+ The name to use for this sheet, as it will appear in the tabs at
+ the bottom of the Excel application.
+ </dd>
+ <dt>Returns:</dt>
+ <dd>
+ An object of the <a href="#xlwt.Worksheet-class">Worksheet</a> class
+ </dd>
+ </dl>
+ <br />
+</dd>
+<dt><a id='xlwt.Workbook.save-method' name='xlwt.Workbook.save-method'><b>save(filename_or_stream)</b></a> [<a href='#xlwt.Workbook.save-method'>#</a>]</dt>
+<dd>
+ <p>
+ This method is used to save Workbook to a file in native Excel format.
+ </p>
+ <dl>
+ <dt><i>filename_or_stream</i></dt>
+ <dd>
+ <p>
+ This can be a string containing a filename of the file, in which case
+ the excel file is saved to disk using the name provided.
+ </p>
+ <p>
+ It can also be a stream object with a write method, such as a
+ StringIO, in which case the data for the excel file is written
+ to the stream.
+ </p>
+ </dd>
+ </dl>
+ <br />
+</dd>
+</dl>
+
+<h2><a id='xlwt.Worksheet-class' name='xlwt.Worksheet-class'>The Worksheet Class</a><em style="color:red;">[NC]</em></h2>
+<dl>
+<dt><b>Worksheet(sheetname, parent_book)</b> (class) [<a href='#xlwt.Worksheet-class'>#</a>]</dt>
+<dd>
+ <p>
+ This is a class representing the contents of a sheet in a workbook.
+ </p>
+ <p>
+ WARNING: You don't normally create instances of this class
+ yourself. They are returned from calls to <a href="#xlwt.Workbook.add_sheet-method">Workbook.add_sheet</a>
+ </p>
+</dd>
+<dt><a id='xlwt.Worksheet.write-method'
+name='xlwt.Worksheet.write-method'><b>write(r, c, label="", style=Style.default_style)</b></a> [<a href='#xlwt.Worksheet.write-method'>#</a>]</dt>
+<dd>
+ <p>
+ This method is used to write a cell to a Worksheet..
+ </p>
+ <dl>
+ <dt><i>r</i></dt>
+ <dd>
+ The zero-relative number of the row in the worksheet to which the cell should be written.
+ </dd>
+ <dt><i>c</i></dt>
+ <dd>
+ The zero-relative number of the column in the worksheet to which the cell should be written.
+ </dd>
+ <dt><i>label</i></dt>
+ <dd>
+ The data value to be written.
+ An int, long, or decimal.Decimal instance is converted to float.
+ A unicode instance is written as is.
+ A str instance is converted to unicode using the encoding (default: 'ascii') specified
+ when the Workbook instance was created.
+ A datetime.datetime, datetime.date, or datetime.time instance is converted into Excel date format
+ (a float representing the number of days since (typically) 1899-12-31T00:00:00,
+ under the pretence that 1900 was a leap year).
+ A bool instance will show up as TRUE or FALSE in Excel.
+ None causes the cell to be blank -- no data, only formatting.
+ An xlwt.Formula instance causes an Excel formula to be written.
+ <em style="color:red;">[NC]</em>
+ </dd>
+ <dt><i>style</i></dt>
+ <dd>
+ A style -- also known as an XF (extended format) -- is an XFStyle object, which encapsulates
+ the formatting applied to the cell and its contents. XFStyle objects are best set up using the
+ <i>easyxf</i> function. They may also be set up by setting attributes in
+ Alignment, Borders, Pattern, Font and Protection objects
+ then setting those objects and a format string as attributes of an XFStyle object.
+ <em style="color:red;">[NC]</em>
+ </dd>
+ </dl>
+ <br />
+</dd>
+</dl>
+
+</body></html>
diff --git a/tablib/packages/xlwt/examples/big-16Mb.py b/tablib/packages/xlwt/examples/big-16Mb.py
new file mode 100644
index 0000000..91db123
--- /dev/null
+++ b/tablib/packages/xlwt/examples/big-16Mb.py
@@ -0,0 +1,35 @@
+#!/usr/bin/env python
+# tries stress SST, SAT and MSAT
+
+from time import *
+from xlwt.Workbook import *
+from xlwt.Style import *
+
+style = XFStyle()
+
+wb = Workbook()
+ws0 = wb.add_sheet('0')
+
+colcount = 200 + 1
+rowcount = 6000 + 1
+
+t0 = time()
+print "\nstart: %s" % ctime(t0)
+
+print "Filling..."
+for col in xrange(colcount):
+ print "[%d]" % col,
+ for row in xrange(rowcount):
+ #ws0.write(row, col, "BIG(%d, %d)" % (row, col))
+ ws0.write(row, col, "BIG")
+
+t1 = time() - t0
+print "\nsince starting elapsed %.2f s" % (t1)
+
+print "Storing..."
+wb.save('big-16Mb.xls')
+
+t2 = time() - t0
+print "since starting elapsed %.2f s" % (t2)
+
+
diff --git a/tablib/packages/xlwt/examples/big-35Mb.py b/tablib/packages/xlwt/examples/big-35Mb.py
new file mode 100644
index 0000000..74be5a7
--- /dev/null
+++ b/tablib/packages/xlwt/examples/big-35Mb.py
@@ -0,0 +1,34 @@
+#!/usr/bin/env python
+# tries stress SST, SAT and MSAT
+
+from time import *
+from xlwt import *
+
+style = XFStyle()
+
+wb = Workbook()
+ws0 = wb.add_sheet('0')
+
+colcount = 200 + 1
+rowcount = 6000 + 1
+
+t0 = time()
+print "\nstart: %s" % ctime(t0)
+
+print "Filling..."
+for col in xrange(colcount):
+ print "[%d]" % col,
+ for row in xrange(rowcount):
+ ws0.write(row, col, "BIG(%d, %d)" % (row, col))
+ #ws0.write(row, col, "BIG")
+
+t1 = time() - t0
+print "\nsince starting elapsed %.2f s" % (t1)
+
+print "Storing..."
+wb.save('big-35Mb.xls')
+
+t2 = time() - t0
+print "since starting elapsed %.2f s" % (t2)
+
+
diff --git a/tablib/packages/xlwt/examples/blanks.py b/tablib/packages/xlwt/examples/blanks.py
new file mode 100644
index 0000000..056a3ec
--- /dev/null
+++ b/tablib/packages/xlwt/examples/blanks.py
@@ -0,0 +1,36 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+font0 = Font()
+font0.name = 'Times New Roman'
+font0.struck_out = True
+font0.bold = True
+
+style0 = XFStyle()
+style0.font = font0
+
+
+wb = Workbook()
+ws0 = wb.add_sheet('0')
+
+ws0.write(1, 1, 'Test', style0)
+
+for i in range(0, 0x53):
+ borders = Borders()
+ borders.left = i
+ borders.right = i
+ borders.top = i
+ borders.bottom = i
+
+ style = XFStyle()
+ style.borders = borders
+
+ ws0.write(i, 2, '', style)
+ ws0.write(i, 3, hex(i), style0)
+
+ws0.write_merge(5, 8, 6, 10, "")
+
+wb.save('blanks.xls')
diff --git a/tablib/packages/xlwt/examples/col_width.py b/tablib/packages/xlwt/examples/col_width.py
new file mode 100644
index 0000000..6e6cb33
--- /dev/null
+++ b/tablib/packages/xlwt/examples/col_width.py
@@ -0,0 +1,19 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+__rev_id__ = """$Id: col_width.py 3315 2008-03-14 14:44:52Z chris $"""
+
+
+from xlwt import *
+
+w = Workbook()
+ws = w.add_sheet('Hey, Dude')
+
+for i in range(6, 80):
+ fnt = Font()
+ fnt.height = i*20
+ style = XFStyle()
+ style.font = fnt
+ ws.write(1, i, 'Test')
+ ws.col(i).width = 0x0d00 + i
+w.save('col_width.xls')
diff --git a/tablib/packages/xlwt/examples/country.py b/tablib/packages/xlwt/examples/country.py
new file mode 100644
index 0000000..cb26e29
--- /dev/null
+++ b/tablib/packages/xlwt/examples/country.py
@@ -0,0 +1,10 @@
+#!/usr/bin/env python
+# -*- coding: windows-1252 -*-
+# Copyright (C) 2007 John Machin
+
+from xlwt import *
+
+w = Workbook()
+w.country_code = 61
+ws = w.add_sheet('AU')
+w.save('country.xls')
diff --git a/tablib/packages/xlwt/examples/dates.py b/tablib/packages/xlwt/examples/dates.py
new file mode 100644
index 0000000..389b93b
--- /dev/null
+++ b/tablib/packages/xlwt/examples/dates.py
@@ -0,0 +1,37 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+from datetime import datetime
+
+w = Workbook()
+ws = w.add_sheet('Hey, Dude')
+
+fmts = [
+ 'M/D/YY',
+ 'D-MMM-YY',
+ 'D-MMM',
+ 'MMM-YY',
+ 'h:mm AM/PM',
+ 'h:mm:ss AM/PM',
+ 'h:mm',
+ 'h:mm:ss',
+ 'M/D/YY h:mm',
+ 'mm:ss',
+ '[h]:mm:ss',
+ 'mm:ss.0',
+]
+
+i = 0
+for fmt in fmts:
+ ws.write(i, 0, fmt)
+
+ style = XFStyle()
+ style.num_format_str = fmt
+
+ ws.write(i, 4, datetime.now(), style)
+
+ i += 1
+
+w.save('dates.xls')
diff --git a/tablib/packages/xlwt/examples/format.py b/tablib/packages/xlwt/examples/format.py
new file mode 100644
index 0000000..fd49e0a
--- /dev/null
+++ b/tablib/packages/xlwt/examples/format.py
@@ -0,0 +1,38 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+font0 = Font()
+font0.name = 'Times New Roman'
+font0.struck_out = True
+font0.bold = True
+
+style0 = XFStyle()
+style0.font = font0
+
+
+wb = Workbook()
+ws0 = wb.add_sheet('0')
+
+ws0.write(1, 1, 'Test', style0)
+
+for i in range(0, 0x53):
+ fnt = Font()
+ fnt.name = 'Arial'
+ fnt.colour_index = i
+ fnt.outline = True
+
+ borders = Borders()
+ borders.left = i
+
+ style = XFStyle()
+ style.font = fnt
+ style.borders = borders
+
+ ws0.write(i, 2, 'colour', style)
+ ws0.write(i, 3, hex(i), style0)
+
+
+wb.save('format.xls')
diff --git a/tablib/packages/xlwt/examples/formula_names.py b/tablib/packages/xlwt/examples/formula_names.py
new file mode 100644
index 0000000..f0354bc
--- /dev/null
+++ b/tablib/packages/xlwt/examples/formula_names.py
@@ -0,0 +1,34 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+from xlwt.ExcelFormulaParser import FormulaParseException
+
+w = Workbook()
+ws = w.add_sheet('F')
+
+## This example is a little silly since the formula building is
+## so simplistic that it often fails because the generated text
+## has the wrong number of parameters for the function being
+## tested.
+
+i = 0
+succeed_count = 0
+fail_count = 0
+for n in sorted(ExcelMagic.std_func_by_name):
+ ws.write(i, 0, n)
+ text = n + "($A$1)"
+ try:
+ formula = Formula(text)
+ except FormulaParseException,e:
+ print "Could not parse %r: %s" % (text,e.args[0])
+ fail_count += 1
+ else:
+ ws.write(i, 3, formula)
+ succeed_count += 1
+ i += 1
+
+w.save('formula_names.xls')
+
+print "succeeded with %i functions, failed with %i" % (succeed_count,fail_count)
diff --git a/tablib/packages/xlwt/examples/formulas.py b/tablib/packages/xlwt/examples/formulas.py
new file mode 100644
index 0000000..b89f5f5
--- /dev/null
+++ b/tablib/packages/xlwt/examples/formulas.py
@@ -0,0 +1,47 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws = w.add_sheet('F')
+
+ws.write(0, 0, Formula("-(1+1)"))
+ws.write(1, 0, Formula("-(1+1)/(-2-2)"))
+ws.write(2, 0, Formula("-(134.8780789+1)"))
+ws.write(3, 0, Formula("-(134.8780789e-10+1)"))
+ws.write(4, 0, Formula("-1/(1+1)+9344"))
+
+ws.write(0, 1, Formula("-(1+1)"))
+ws.write(1, 1, Formula("-(1+1)/(-2-2)"))
+ws.write(2, 1, Formula("-(134.8780789+1)"))
+ws.write(3, 1, Formula("-(134.8780789e-10+1)"))
+ws.write(4, 1, Formula("-1/(1+1)+9344"))
+
+ws.write(0, 2, Formula("A1*B1"))
+ws.write(1, 2, Formula("A2*B2"))
+ws.write(2, 2, Formula("A3*B3"))
+ws.write(3, 2, Formula("A4*B4*sin(pi()/4)"))
+ws.write(4, 2, Formula("A5%*B5*pi()/1000"))
+
+##############
+## NOTE: parameters are separated by semicolon!!!
+##############
+
+
+ws.write(5, 2, Formula("C1+C2+C3+C4+C5/(C1+C2+C3+C4/(C1+C2+C3+C4/(C1+C2+C3+C4)+C5)+C5)-20.3e-2"))
+ws.write(5, 3, Formula("C1^2"))
+ws.write(6, 2, Formula("SUM(C1;C2;;;;;C3;;;C4)"))
+ws.write(6, 3, Formula("SUM($A$1:$C$5)"))
+
+ws.write(7, 0, Formula('"lkjljllkllkl"'))
+ws.write(7, 1, Formula('"yuyiyiyiyi"'))
+ws.write(7, 2, Formula('A8 & B8 & A8'))
+ws.write(8, 2, Formula('now()'))
+
+ws.write(10, 2, Formula('TRUE'))
+ws.write(11, 2, Formula('FALSE'))
+ws.write(12, 3, Formula('IF(A1>A2;3;"hkjhjkhk")'))
+
+w.save('formulas.xls')
diff --git a/tablib/packages/xlwt/examples/hyperlinks.py b/tablib/packages/xlwt/examples/hyperlinks.py
new file mode 100644
index 0000000..8de611b
--- /dev/null
+++ b/tablib/packages/xlwt/examples/hyperlinks.py
@@ -0,0 +1,28 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+f = Font()
+f.height = 20*72
+f.name = 'Verdana'
+f.bold = True
+f.underline = Font.UNDERLINE_DOUBLE
+f.colour_index = 4
+
+h_style = XFStyle()
+h_style.font = f
+
+w = Workbook()
+ws = w.add_sheet('F')
+
+##############
+## NOTE: parameters are separated by semicolon!!!
+##############
+
+n = "HYPERLINK"
+ws.write_merge(1, 1, 1, 10, Formula(n + '("http://www.irs.gov/pub/irs-pdf/f1000.pdf";"f1000.pdf")'), h_style)
+ws.write_merge(2, 2, 2, 25, Formula(n + '("mailto:roman.kiseliov@gmail.com?subject=pyExcelerator-feedback&Body=Hello,%20Roman!";"pyExcelerator-feedback")'), h_style)
+
+w.save("hyperlinks.xls")
diff --git a/tablib/packages/xlwt/examples/image.py b/tablib/packages/xlwt/examples/image.py
new file mode 100644
index 0000000..f926b8d
--- /dev/null
+++ b/tablib/packages/xlwt/examples/image.py
@@ -0,0 +1,12 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws = w.add_sheet('Image')
+ws.insert_bitmap('python.bmp', 2, 2)
+ws.insert_bitmap('python.bmp', 10, 2)
+
+w.save('image.xls')
diff --git a/tablib/packages/xlwt/examples/merged.py b/tablib/packages/xlwt/examples/merged.py
new file mode 100644
index 0000000..f7f9c57
--- /dev/null
+++ b/tablib/packages/xlwt/examples/merged.py
@@ -0,0 +1,39 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+fnt = Font()
+fnt.name = 'Arial'
+fnt.colour_index = 4
+fnt.bold = True
+
+borders = Borders()
+borders.left = 6
+borders.right = 6
+borders.top = 6
+borders.bottom = 6
+
+al = Alignment()
+al.horz = Alignment.HORZ_CENTER
+al.vert = Alignment.VERT_CENTER
+
+style = XFStyle()
+style.font = fnt
+style.borders = borders
+style.alignment = al
+
+
+wb = Workbook()
+ws0 = wb.add_sheet('sheet0')
+ws1 = wb.add_sheet('sheet1')
+ws2 = wb.add_sheet('sheet2')
+
+for i in range(0, 0x200, 2):
+ ws0.write_merge(i, i+1, 1, 5, 'test %d' % i, style)
+ ws1.write_merge(i, i, 1, 7, 'test %d' % i, style)
+ ws2.write_merge(i, i+1, 1, 7 + (i%10), 'test %d' % i, style)
+
+
+wb.save('merged.xls')
diff --git a/tablib/packages/xlwt/examples/merged0.py b/tablib/packages/xlwt/examples/merged0.py
new file mode 100644
index 0000000..93496c6
--- /dev/null
+++ b/tablib/packages/xlwt/examples/merged0.py
@@ -0,0 +1,30 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+wb = Workbook()
+ws0 = wb.add_sheet('sheet0')
+
+
+fnt = Font()
+fnt.name = 'Arial'
+fnt.colour_index = 4
+fnt.bold = True
+
+borders = Borders()
+borders.left = 6
+borders.right = 6
+borders.top = 6
+borders.bottom = 6
+
+style = XFStyle()
+style.font = fnt
+style.borders = borders
+
+ws0.write_merge(3, 3, 1, 5, 'test1', style)
+ws0.write_merge(4, 10, 1, 5, 'test2', style)
+ws0.col(1).width = 0x0d00
+
+wb.save('merged0.xls')
diff --git a/tablib/packages/xlwt/examples/merged1.py b/tablib/packages/xlwt/examples/merged1.py
new file mode 100644
index 0000000..813530b
--- /dev/null
+++ b/tablib/packages/xlwt/examples/merged1.py
@@ -0,0 +1,102 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+wb = Workbook()
+ws0 = wb.add_sheet('sheet0')
+
+fnt1 = Font()
+fnt1.name = 'Verdana'
+fnt1.bold = True
+fnt1.height = 18*0x14
+
+pat1 = Pattern()
+pat1.pattern = Pattern.SOLID_PATTERN
+pat1.pattern_fore_colour = 0x16
+
+brd1 = Borders()
+brd1.left = 0x06
+brd1.right = 0x06
+brd1.top = 0x06
+brd1.bottom = 0x06
+
+fnt2 = Font()
+fnt2.name = 'Verdana'
+fnt2.bold = True
+fnt2.height = 14*0x14
+
+brd2 = Borders()
+brd2.left = 0x01
+brd2.right = 0x01
+brd2.top = 0x01
+brd2.bottom = 0x01
+
+pat2 = Pattern()
+pat2.pattern = Pattern.SOLID_PATTERN
+pat2.pattern_fore_colour = 0x01F
+
+fnt3 = Font()
+fnt3.name = 'Verdana'
+fnt3.bold = True
+fnt3.italic = True
+fnt3.height = 12*0x14
+
+brd3 = Borders()
+brd3.left = 0x07
+brd3.right = 0x07
+brd3.top = 0x07
+brd3.bottom = 0x07
+
+fnt4 = Font()
+
+al1 = Alignment()
+al1.horz = Alignment.HORZ_CENTER
+al1.vert = Alignment.VERT_CENTER
+
+al2 = Alignment()
+al2.horz = Alignment.HORZ_RIGHT
+al2.vert = Alignment.VERT_CENTER
+
+al3 = Alignment()
+al3.horz = Alignment.HORZ_LEFT
+al3.vert = Alignment.VERT_CENTER
+
+style1 = XFStyle()
+style1.font = fnt1
+style1.alignment = al1
+style1.pattern = pat1
+style1.borders = brd1
+
+style2 = XFStyle()
+style2.font = fnt2
+style2.alignment = al1
+style2.pattern = pat2
+style2.borders = brd2
+
+style3 = XFStyle()
+style3.font = fnt3
+style3.alignment = al1
+style3.pattern = pat2
+style3.borders = brd3
+
+price_style = XFStyle()
+price_style.font = fnt4
+price_style.alignment = al2
+price_style.borders = brd3
+price_style.num_format_str = '_(#,##0.00_) "money"'
+
+ware_style = XFStyle()
+ware_style.font = fnt4
+ware_style.alignment = al3
+ware_style.borders = brd3
+
+
+ws0.merge(3, 3, 1, 5, style1)
+ws0.merge(4, 10, 1, 6, style2)
+ws0.merge(14, 16, 1, 7, style3)
+ws0.col(1).width = 0x0d00
+
+
+wb.save('merged1.xls')
diff --git a/tablib/packages/xlwt/examples/mini.py b/tablib/packages/xlwt/examples/mini.py
new file mode 100644
index 0000000..61bb30c
--- /dev/null
+++ b/tablib/packages/xlwt/examples/mini.py
@@ -0,0 +1,9 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws = w.add_sheet('xlwt was here')
+w.save('mini.xls')
diff --git a/tablib/packages/xlwt/examples/num_formats.py b/tablib/packages/xlwt/examples/num_formats.py
new file mode 100644
index 0000000..3a56f6c
--- /dev/null
+++ b/tablib/packages/xlwt/examples/num_formats.py
@@ -0,0 +1,60 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws = w.add_sheet('Hey, Dude')
+
+fmts = [
+ 'general',
+ '0',
+ '0.00',
+ '#,##0',
+ '#,##0.00',
+ '"$"#,##0_);("$"#,##',
+ '"$"#,##0_);[Red]("$"#,##',
+ '"$"#,##0.00_);("$"#,##',
+ '"$"#,##0.00_);[Red]("$"#,##',
+ '0%',
+ '0.00%',
+ '0.00E+00',
+ '# ?/?',
+ '# ??/??',
+ 'M/D/YY',
+ 'D-MMM-YY',
+ 'D-MMM',
+ 'MMM-YY',
+ 'h:mm AM/PM',
+ 'h:mm:ss AM/PM',
+ 'h:mm',
+ 'h:mm:ss',
+ 'M/D/YY h:mm',
+ '_(#,##0_);(#,##0)',
+ '_(#,##0_);[Red](#,##0)',
+ '_(#,##0.00_);(#,##0.00)',
+ '_(#,##0.00_);[Red](#,##0.00)',
+ '_("$"* #,##0_);_("$"* (#,##0);_("$"* "-"_);_(@_)',
+ '_(* #,##0_);_(* (#,##0);_(* "-"_);_(@_)',
+ '_("$"* #,##0.00_);_("$"* (#,##0.00);_("$"* "-"??_);_(@_)',
+ '_(* #,##0.00_);_(* (#,##0.00);_(* "-"??_);_(@_)',
+ 'mm:ss',
+ '[h]:mm:ss',
+ 'mm:ss.0',
+ '##0.0E+0',
+ '@'
+]
+
+i = 0
+for fmt in fmts:
+ ws.write(i, 0, fmt)
+
+ style = XFStyle()
+ style.num_format_str = fmt
+
+ ws.write(i, 4, -1278.9078, style)
+
+ i += 1
+
+w.save('num_formats.xls')
diff --git a/tablib/packages/xlwt/examples/numbers.py b/tablib/packages/xlwt/examples/numbers.py
new file mode 100644
index 0000000..524d9fc
--- /dev/null
+++ b/tablib/packages/xlwt/examples/numbers.py
@@ -0,0 +1,25 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws = w.add_sheet('Hey, Dude')
+
+ws.write(0, 0, 1)
+ws.write(1, 0, 1.23)
+ws.write(2, 0, 12345678)
+ws.write(3, 0, 123456.78)
+
+ws.write(0, 1, -1)
+ws.write(1, 1, -1.23)
+ws.write(2, 1, -12345678)
+ws.write(3, 1, -123456.78)
+
+ws.write(0, 2, -17867868678687.0)
+ws.write(1, 2, -1.23e-5)
+ws.write(2, 2, -12345678.90780980)
+ws.write(3, 2, -123456.78)
+
+w.save('numbers.xls')
diff --git a/tablib/packages/xlwt/examples/outline.py b/tablib/packages/xlwt/examples/outline.py
new file mode 100644
index 0000000..45b8df9
--- /dev/null
+++ b/tablib/packages/xlwt/examples/outline.py
@@ -0,0 +1,113 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+fnt = Font()
+fnt.name = 'Arial'
+fnt.colour_index = 4
+fnt.bold = True
+
+borders = Borders()
+borders.left = 6
+borders.right = 6
+borders.top = 6
+borders.bottom = 6
+
+style = XFStyle()
+style.font = fnt
+style.borders = borders
+
+wb = Workbook()
+
+ws0 = wb.add_sheet('Rows Outline')
+
+ws0.write_merge(1, 1, 1, 5, 'test 1', style)
+ws0.write_merge(2, 2, 1, 4, 'test 1', style)
+ws0.write_merge(3, 3, 1, 3, 'test 2', style)
+ws0.write_merge(4, 4, 1, 4, 'test 1', style)
+ws0.write_merge(5, 5, 1, 4, 'test 3', style)
+ws0.write_merge(6, 6, 1, 5, 'test 1', style)
+ws0.write_merge(7, 7, 1, 5, 'test 4', style)
+ws0.write_merge(8, 8, 1, 4, 'test 1', style)
+ws0.write_merge(9, 9, 1, 3, 'test 5', style)
+
+ws0.row(1).level = 1
+ws0.row(2).level = 1
+ws0.row(3).level = 2
+ws0.row(4).level = 2
+ws0.row(5).level = 2
+ws0.row(6).level = 2
+ws0.row(7).level = 2
+ws0.row(8).level = 1
+ws0.row(9).level = 1
+
+
+ws1 = wb.add_sheet('Columns Outline')
+
+ws1.write_merge(1, 1, 1, 5, 'test 1', style)
+ws1.write_merge(2, 2, 1, 4, 'test 1', style)
+ws1.write_merge(3, 3, 1, 3, 'test 2', style)
+ws1.write_merge(4, 4, 1, 4, 'test 1', style)
+ws1.write_merge(5, 5, 1, 4, 'test 3', style)
+ws1.write_merge(6, 6, 1, 5, 'test 1', style)
+ws1.write_merge(7, 7, 1, 5, 'test 4', style)
+ws1.write_merge(8, 8, 1, 4, 'test 1', style)
+ws1.write_merge(9, 9, 1, 3, 'test 5', style)
+
+ws1.col(1).level = 1
+ws1.col(2).level = 1
+ws1.col(3).level = 2
+ws1.col(4).level = 2
+ws1.col(5).level = 2
+ws1.col(6).level = 2
+ws1.col(7).level = 2
+ws1.col(8).level = 1
+ws1.col(9).level = 1
+
+
+ws2 = wb.add_sheet('Rows and Columns Outline')
+
+ws2.write_merge(1, 1, 1, 5, 'test 1', style)
+ws2.write_merge(2, 2, 1, 4, 'test 1', style)
+ws2.write_merge(3, 3, 1, 3, 'test 2', style)
+ws2.write_merge(4, 4, 1, 4, 'test 1', style)
+ws2.write_merge(5, 5, 1, 4, 'test 3', style)
+ws2.write_merge(6, 6, 1, 5, 'test 1', style)
+ws2.write_merge(7, 7, 1, 5, 'test 4', style)
+ws2.write_merge(8, 8, 1, 4, 'test 1', style)
+ws2.write_merge(9, 9, 1, 3, 'test 5', style)
+
+ws2.row(1).level = 1
+ws2.row(2).level = 1
+ws2.row(3).level = 2
+ws2.row(4).level = 2
+ws2.row(5).level = 2
+ws2.row(6).level = 2
+ws2.row(7).level = 2
+ws2.row(8).level = 1
+ws2.row(9).level = 1
+
+ws2.write_merge(1, 1, 1, 5, 'test 1', style)
+ws2.write_merge(2, 2, 1, 4, 'test 1', style)
+ws2.write_merge(3, 3, 1, 3, 'test 2', style)
+ws2.write_merge(4, 4, 1, 4, 'test 1', style)
+ws2.write_merge(5, 5, 1, 4, 'test 3', style)
+ws2.write_merge(6, 6, 1, 5, 'test 1', style)
+ws2.write_merge(7, 7, 1, 5, 'test 4', style)
+ws2.write_merge(8, 8, 1, 4, 'test 1', style)
+ws2.write_merge(9, 9, 1, 3, 'test 5', style)
+
+ws2.col(1).level = 1
+ws2.col(2).level = 1
+ws2.col(3).level = 2
+ws2.col(4).level = 2
+ws2.col(5).level = 2
+ws2.col(6).level = 2
+ws2.col(7).level = 2
+ws2.col(8).level = 1
+ws2.col(9).level = 1
+
+
+wb.save('outline.xls')
diff --git a/tablib/packages/xlwt/examples/panes.py b/tablib/packages/xlwt/examples/panes.py
new file mode 100644
index 0000000..9fd83b0
--- /dev/null
+++ b/tablib/packages/xlwt/examples/panes.py
@@ -0,0 +1,58 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws1 = w.add_sheet('sheet 1')
+ws2 = w.add_sheet('sheet 2')
+ws3 = w.add_sheet('sheet 3')
+ws4 = w.add_sheet('sheet 4')
+ws5 = w.add_sheet('sheet 5')
+ws6 = w.add_sheet('sheet 6')
+
+for i in range(0x100):
+ ws1.write(i/0x10, i%0x10, i)
+
+for i in range(0x100):
+ ws2.write(i/0x10, i%0x10, i)
+
+for i in range(0x100):
+ ws3.write(i/0x10, i%0x10, i)
+
+for i in range(0x100):
+ ws4.write(i/0x10, i%0x10, i)
+
+for i in range(0x100):
+ ws5.write(i/0x10, i%0x10, i)
+
+for i in range(0x100):
+ ws6.write(i/0x10, i%0x10, i)
+
+ws1.panes_frozen = True
+ws1.horz_split_pos = 2
+
+ws2.panes_frozen = True
+ws2.vert_split_pos = 2
+
+ws3.panes_frozen = True
+ws3.horz_split_pos = 1
+ws3.vert_split_pos = 1
+
+ws4.panes_frozen = False
+ws4.horz_split_pos = 12
+ws4.horz_split_first_visible = 2
+
+ws5.panes_frozen = False
+ws5.vert_split_pos = 40
+ws4.vert_split_first_visible = 2
+
+ws6.panes_frozen = False
+ws6.horz_split_pos = 12
+ws4.horz_split_first_visible = 2
+ws6.vert_split_pos = 40
+ws4.vert_split_first_visible = 2
+
+w.save('panes.xls')
+
diff --git a/tablib/packages/xlwt/examples/parse-fmla.py b/tablib/packages/xlwt/examples/parse-fmla.py
new file mode 100644
index 0000000..06f68eb
--- /dev/null
+++ b/tablib/packages/xlwt/examples/parse-fmla.py
@@ -0,0 +1,12 @@
+from xlwt import ExcelFormulaParser, ExcelFormula
+import sys
+
+f = ExcelFormula.Formula(
+""" -((1.80 + 2.898 * 1)/(1.80 + 2.898))*
+AVERAGE((1.80 + 2.898 * 1)/(1.80 + 2.898);
+ (1.80 + 2.898 * 1)/(1.80 + 2.898);
+ (1.80 + 2.898 * 1)/(1.80 + 2.898)) +
+SIN(PI()/4)""")
+
+#for t in f.rpn():
+# print "%15s %15s" % (ExcelFormulaParser.PtgNames[t[0]], t[1])
diff --git a/tablib/packages/xlwt/examples/protection.py b/tablib/packages/xlwt/examples/protection.py
new file mode 100644
index 0000000..db54cb0
--- /dev/null
+++ b/tablib/packages/xlwt/examples/protection.py
@@ -0,0 +1,122 @@
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+fnt = Font()
+fnt.name = 'Arial'
+fnt.colour_index = 4
+fnt.bold = True
+
+borders = Borders()
+borders.left = 6
+borders.right = 6
+borders.top = 6
+borders.bottom = 6
+
+style = XFStyle()
+style.font = fnt
+style.borders = borders
+
+wb = Workbook()
+
+ws0 = wb.add_sheet('Rows Outline')
+
+ws0.write_merge(1, 1, 1, 5, 'test 1', style)
+ws0.write_merge(2, 2, 1, 4, 'test 1', style)
+ws0.write_merge(3, 3, 1, 3, 'test 2', style)
+ws0.write_merge(4, 4, 1, 4, 'test 1', style)
+ws0.write_merge(5, 5, 1, 4, 'test 3', style)
+ws0.write_merge(6, 6, 1, 5, 'test 1', style)
+ws0.write_merge(7, 7, 1, 5, 'test 4', style)
+ws0.write_merge(8, 8, 1, 4, 'test 1', style)
+ws0.write_merge(9, 9, 1, 3, 'test 5', style)
+
+ws0.row(1).level = 1
+ws0.row(2).level = 1
+ws0.row(3).level = 2
+ws0.row(4).level = 2
+ws0.row(5).level = 2
+ws0.row(6).level = 2
+ws0.row(7).level = 2
+ws0.row(8).level = 1
+ws0.row(9).level = 1
+
+
+ws1 = wb.add_sheet('Columns Outline')
+
+ws1.write_merge(1, 1, 1, 5, 'test 1', style)
+ws1.write_merge(2, 2, 1, 4, 'test 1', style)
+ws1.write_merge(3, 3, 1, 3, 'test 2', style)
+ws1.write_merge(4, 4, 1, 4, 'test 1', style)
+ws1.write_merge(5, 5, 1, 4, 'test 3', style)
+ws1.write_merge(6, 6, 1, 5, 'test 1', style)
+ws1.write_merge(7, 7, 1, 5, 'test 4', style)
+ws1.write_merge(8, 8, 1, 4, 'test 1', style)
+ws1.write_merge(9, 9, 1, 3, 'test 5', style)
+
+ws1.col(1).level = 1
+ws1.col(2).level = 1
+ws1.col(3).level = 2
+ws1.col(4).level = 2
+ws1.col(5).level = 2
+ws1.col(6).level = 2
+ws1.col(7).level = 2
+ws1.col(8).level = 1
+ws1.col(9).level = 1
+
+
+ws2 = wb.add_sheet('Rows and Columns Outline')
+
+ws2.write_merge(1, 1, 1, 5, 'test 1', style)
+ws2.write_merge(2, 2, 1, 4, 'test 1', style)
+ws2.write_merge(3, 3, 1, 3, 'test 2', style)
+ws2.write_merge(4, 4, 1, 4, 'test 1', style)
+ws2.write_merge(5, 5, 1, 4, 'test 3', style)
+ws2.write_merge(6, 6, 1, 5, 'test 1', style)
+ws2.write_merge(7, 7, 1, 5, 'test 4', style)
+ws2.write_merge(8, 8, 1, 4, 'test 1', style)
+ws2.write_merge(9, 9, 1, 3, 'test 5', style)
+
+ws2.row(1).level = 1
+ws2.row(2).level = 1
+ws2.row(3).level = 2
+ws2.row(4).level = 2
+ws2.row(5).level = 2
+ws2.row(6).level = 2
+ws2.row(7).level = 2
+ws2.row(8).level = 1
+ws2.row(9).level = 1
+
+ws2.col(1).level = 1
+ws2.col(2).level = 1
+ws2.col(3).level = 2
+ws2.col(4).level = 2
+ws2.col(5).level = 2
+ws2.col(6).level = 2
+ws2.col(7).level = 2
+ws2.col(8).level = 1
+ws2.col(9).level = 1
+
+
+ws0.protect = True
+ws0.wnd_protect = True
+ws0.obj_protect = True
+ws0.scen_protect = True
+ws0.password = "123456"
+
+ws1.protect = True
+ws1.wnd_protect = True
+ws1.obj_protect = True
+ws1.scen_protect = True
+ws1.password = "abcdefghij"
+
+ws2.protect = True
+ws2.wnd_protect = True
+ws2.obj_protect = True
+ws2.scen_protect = True
+ws2.password = "ok"
+
+wb.protect = True
+wb.wnd_protect = True
+wb.obj_protect = True
+wb.save('protection.xls')
diff --git a/tablib/packages/xlwt/examples/python.bmp b/tablib/packages/xlwt/examples/python.bmp
new file mode 100644
index 0000000..bd1ba3f
--- /dev/null
+++ b/tablib/packages/xlwt/examples/python.bmp
Binary files differ
diff --git a/tablib/packages/xlwt/examples/row_styles.py b/tablib/packages/xlwt/examples/row_styles.py
new file mode 100644
index 0000000..dd6d494
--- /dev/null
+++ b/tablib/packages/xlwt/examples/row_styles.py
@@ -0,0 +1,17 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws = w.add_sheet('Hey, Dude')
+
+for i in range(6, 80):
+ fnt = Font()
+ fnt.height = i*20
+ style = XFStyle()
+ style.font = fnt
+ ws.write(i, 1, 'Test')
+ ws.row(i).set_style(style)
+w.save('row_styles.xls')
diff --git a/tablib/packages/xlwt/examples/row_styles_empty.py b/tablib/packages/xlwt/examples/row_styles_empty.py
new file mode 100644
index 0000000..cf6a65c
--- /dev/null
+++ b/tablib/packages/xlwt/examples/row_styles_empty.py
@@ -0,0 +1,18 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+__rev_id__ = """$Id: row_styles_empty.py 3309 2008-03-14 11:04:30Z chris $"""
+
+
+from pyExcelerator import *
+
+w = Workbook()
+ws = w.add_sheet('Hey, Dude')
+
+for i in range(6, 80):
+ fnt = Font()
+ fnt.height = i*20
+ style = XFStyle()
+ style.font = fnt
+ ws.row(i).set_style(style)
+w.save('row_styles_empty.xls')
diff --git a/tablib/packages/xlwt/examples/simple.py b/tablib/packages/xlwt/examples/simple.py
new file mode 100644
index 0000000..44f7622
--- /dev/null
+++ b/tablib/packages/xlwt/examples/simple.py
@@ -0,0 +1,24 @@
+import xlwt
+from datetime import datetime
+
+font0 = xlwt.Font()
+font0.name = 'Times New Roman'
+font0.colour_index = 2
+font0.bold = True
+
+style0 = xlwt.XFStyle()
+style0.font = font0
+
+style1 = xlwt.XFStyle()
+style1.num_format_str = 'D-MMM-YY'
+
+wb = xlwt.Workbook()
+ws = wb.add_sheet('A Test Sheet')
+
+ws.write(0, 0, 'Test', style0)
+ws.write(1, 0, datetime.now(), style1)
+ws.write(2, 0, 1)
+ws.write(2, 1, 1)
+ws.write(2, 2, xlwt.Formula("A3+B3"))
+
+wb.save('example.xls')
diff --git a/tablib/packages/xlwt/examples/sst.py b/tablib/packages/xlwt/examples/sst.py
new file mode 100644
index 0000000..b91c2f5
--- /dev/null
+++ b/tablib/packages/xlwt/examples/sst.py
@@ -0,0 +1,52 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+font0 = Formatting.Font()
+font0.name = 'Arial'
+font1 = Formatting.Font()
+font1.name = 'Arial Cyr'
+font2 = Formatting.Font()
+font2.name = 'Times New Roman'
+font3 = Formatting.Font()
+font3.name = 'Courier New Cyr'
+
+num_format0 = '0.00000'
+num_format1 = '0.000000'
+num_format2 = '0.0000000'
+num_format3 = '0.00000000'
+
+st0 = XFStyle()
+st1 = XFStyle()
+st2 = XFStyle()
+st3 = XFStyle()
+st4 = XFStyle()
+
+st0.font = font0
+st0.num_format = num_format0
+
+st1.font = font1
+st1.num_format = num_format1
+
+st2.font = font2
+st2.num_format = num_format2
+
+st3.font = font3
+st3.num_format = num_format3
+
+wb = Workbook()
+
+wb.add_style(st0)
+wb.add_style(st1)
+wb.add_style(st2)
+wb.add_style(st3)
+
+ws0 = wb.add_sheet('0')
+ws0.write(0, 0, 'Olya'*0x4000, st0)
+
+#for i in range(0, 0x10):
+# ws0.write(i, 2, ('%d'%i)*0x4000, st1)
+
+wb.save('sst.xls')
diff --git a/tablib/packages/xlwt/examples/unicode0.py b/tablib/packages/xlwt/examples/unicode0.py
new file mode 100644
index 0000000..3651ec9
--- /dev/null
+++ b/tablib/packages/xlwt/examples/unicode0.py
@@ -0,0 +1,12 @@
+#!/usr/bin/env python
+import xlwt
+
+# Strings passed to (for example) Worksheet.write can be unicode objects,
+# or str (8-bit) objects, which are then decoded into unicode.
+# The encoding to be used defaults to 'ascii'. This can be overridden
+# when the Workbook instance is created:
+
+book = xlwt.Workbook(encoding='cp1251')
+sheet = book.add_sheet('cp1251-demo')
+sheet.write(0, 0, '\xce\xeb\xff')
+book.save('unicode0.xls')
diff --git a/tablib/packages/xlwt/examples/unicode1.py b/tablib/packages/xlwt/examples/unicode1.py
new file mode 100644
index 0000000..90e99cc
--- /dev/null
+++ b/tablib/packages/xlwt/examples/unicode1.py
@@ -0,0 +1,28 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws1 = w.add_sheet(u'\N{GREEK SMALL LETTER ALPHA}\N{GREEK SMALL LETTER BETA}\N{GREEK SMALL LETTER GAMMA}')
+
+ws1.write(0, 0, u'\N{GREEK SMALL LETTER ALPHA}\N{GREEK SMALL LETTER BETA}\N{GREEK SMALL LETTER GAMMA}')
+ws1.write(1, 1, u'\N{GREEK SMALL LETTER DELTA}x = 1 + \N{GREEK SMALL LETTER DELTA}')
+
+ws1.write(2,0, u'A\u2262\u0391.') # RFC2152 example
+ws1.write(3,0, u'Hi Mom -\u263a-!') # RFC2152 example
+ws1.write(4,0, u'\u65E5\u672C\u8A9E') # RFC2152 example
+ws1.write(5,0, u'Item 3 is \u00a31.') # RFC2152 example
+ws1.write(8,0, u'\N{INTEGRAL}') # RFC2152 example
+
+w.add_sheet(u'A\u2262\u0391.') # RFC2152 example
+w.add_sheet(u'Hi Mom -\u263a-!') # RFC2152 example
+one_more_ws = w.add_sheet(u'\u65E5\u672C\u8A9E') # RFC2152 example
+w.add_sheet(u'Item 3 is \u00a31.') # RFC2152 example
+
+one_more_ws.write(0, 0, u'\u2665\u2665')
+
+w.add_sheet(u'\N{GREEK SMALL LETTER ETA WITH TONOS}')
+w.save('unicode1.xls')
+
diff --git a/tablib/packages/xlwt/examples/unicode2.py b/tablib/packages/xlwt/examples/unicode2.py
new file mode 100644
index 0000000..18904b0
--- /dev/null
+++ b/tablib/packages/xlwt/examples/unicode2.py
@@ -0,0 +1,19 @@
+#!/usr/bin/env python
+# -*- coding: windows-1251 -*-
+# Copyright (C) 2005 Kiseliov Roman
+
+from xlwt import *
+
+w = Workbook()
+ws1 = w.add_sheet(u'\N{GREEK SMALL LETTER ALPHA}\N{GREEK SMALL LETTER BETA}\N{GREEK SMALL LETTER GAMMA}\u2665\u041e\u041b\u042f\u2665')
+
+fnt = Font()
+fnt.height = 26*20
+style = XFStyle()
+style.font = fnt
+
+for i in range(0x10000):
+ ws1.write(i/0x10, i%0x10, unichr(i), style)
+
+w.save('unicode2.xls')
+
diff --git a/tablib/packages/xlwt/examples/wsprops.py b/tablib/packages/xlwt/examples/wsprops.py
new file mode 100644
index 0000000..adc5a04
--- /dev/null
+++ b/tablib/packages/xlwt/examples/wsprops.py
@@ -0,0 +1,155 @@
+props = \
+[
+ 'name',
+ 'parent',
+ 'rows',
+ 'cols',
+ 'merged_ranges',
+ 'bmp_rec',
+ 'show_formulas',
+ 'show_grid',
+ 'show_headers',
+ 'panes_frozen',
+ 'show_empty_as_zero',
+ 'auto_colour_grid',
+ 'cols_right_to_left',
+ 'show_outline',
+ 'remove_splits',
+ 'selected',
+ 'hidden',
+ 'page_preview',
+ 'first_visible_row',
+ 'first_visible_col',
+ 'grid_colour',
+ 'preview_magn',
+ 'normal_magn',
+ 'row_gut_width',
+ 'col_gut_height',
+ 'show_auto_page_breaks',
+ 'dialogue_sheet',
+ 'auto_style_outline',
+ 'outline_below',
+ 'outline_right',
+ 'fit_num_pages',
+ 'show_row_outline',
+ 'show_col_outline',
+ 'alt_expr_eval',
+ 'alt_formula_entries',
+ 'row_default_height',
+ 'col_default_width',
+ 'calc_mode',
+ 'calc_count',
+ 'RC_ref_mode',
+ 'iterations_on',
+ 'delta',
+ 'save_recalc',
+ 'print_headers',
+ 'print_grid',
+ 'grid_set',
+ 'vert_page_breaks',
+ 'horz_page_breaks',
+ 'header_str',
+ 'footer_str',
+ 'print_centered_vert',
+ 'print_centered_horz',
+ 'left_margin',
+ 'right_margin',
+ 'top_margin',
+ 'bottom_margin',
+ 'paper_size_code',
+ 'print_scaling',
+ 'start_page_number',
+ 'fit_width_to_pages',
+ 'fit_height_to_pages',
+ 'print_in_rows',
+ 'portrait',
+ 'print_not_colour',
+ 'print_draft',
+ 'print_notes',
+ 'print_notes_at_end',
+ 'print_omit_errors',
+ 'print_hres',
+ 'print_vres',
+ 'header_margin',
+ 'footer_margin',
+ 'copies_num',
+]
+
+from xlwt import *
+
+wb = Workbook()
+ws = wb.add_sheet('sheet')
+
+print ws.name
+print ws.parent
+print ws.rows
+print ws.cols
+print ws.merged_ranges
+print ws.bmp_rec
+print ws.show_formulas
+print ws.show_grid
+print ws.show_headers
+print ws.panes_frozen
+print ws.show_empty_as_zero
+print ws.auto_colour_grid
+print ws.cols_right_to_left
+print ws.show_outline
+print ws.remove_splits
+print ws.selected
+# print ws.hidden
+print ws.page_preview
+print ws.first_visible_row
+print ws.first_visible_col
+print ws.grid_colour
+print ws.preview_magn
+print ws.normal_magn
+#print ws.row_gut_width
+#print ws.col_gut_height
+print ws.show_auto_page_breaks
+print ws.dialogue_sheet
+print ws.auto_style_outline
+print ws.outline_below
+print ws.outline_right
+print ws.fit_num_pages
+print ws.show_row_outline
+print ws.show_col_outline
+print ws.alt_expr_eval
+print ws.alt_formula_entries
+print ws.row_default_height
+print ws.col_default_width
+print ws.calc_mode
+print ws.calc_count
+print ws.RC_ref_mode
+print ws.iterations_on
+print ws.delta
+print ws.save_recalc
+print ws.print_headers
+print ws.print_grid
+#print ws.grid_set
+print ws.vert_page_breaks
+print ws.horz_page_breaks
+print ws.header_str
+print ws.footer_str
+print ws.print_centered_vert
+print ws.print_centered_horz
+print ws.left_margin
+print ws.right_margin
+print ws.top_margin
+print ws.bottom_margin
+print ws.paper_size_code
+print ws.print_scaling
+print ws.start_page_number
+print ws.fit_width_to_pages
+print ws.fit_height_to_pages
+print ws.print_in_rows
+print ws.portrait
+print ws.print_colour
+print ws.print_draft
+print ws.print_notes
+print ws.print_notes_at_end
+print ws.print_omit_errors
+print ws.print_hres
+print ws.print_vres
+print ws.header_margin
+print ws.footer_margin
+print ws.copies_num
diff --git a/tablib/packages/xlwt/examples/xlwt_easyxf_simple_demo.py b/tablib/packages/xlwt/examples/xlwt_easyxf_simple_demo.py
new file mode 100644
index 0000000..2afa69f
--- /dev/null
+++ b/tablib/packages/xlwt/examples/xlwt_easyxf_simple_demo.py
@@ -0,0 +1,46 @@
+
+# Write an XLS file with a single worksheet, containing
+# a heading row and some rows of data.
+
+import xlwt
+import datetime
+ezxf = xlwt.easyxf
+
+def write_xls(file_name, sheet_name, headings, data, heading_xf, data_xfs):
+ book = xlwt.Workbook()
+ sheet = book.add_sheet(sheet_name)
+ rowx = 0
+ for colx, value in enumerate(headings):
+ sheet.write(rowx, colx, value, heading_xf)
+ sheet.set_panes_frozen(True) # frozen headings instead of split panes
+ sheet.set_horz_split_pos(rowx+1) # in general, freeze after last heading row
+ sheet.set_remove_splits(True) # if user does unfreeze, don't leave a split there
+ for row in data:
+ rowx += 1
+ for colx, value in enumerate(row):
+ sheet.write(rowx, colx, value, data_xfs[colx])
+ book.save(file_name)
+
+if __name__ == '__main__':
+ import sys
+ mkd = datetime.date
+ hdngs = ['Date', 'Stock Code', 'Quantity', 'Unit Price', 'Value', 'Message']
+ kinds = 'date text int price money text'.split()
+ data = [
+ [mkd(2007, 7, 1), 'ABC', 1000, 1.234567, 1234.57, ''],
+ [mkd(2007, 12, 31), 'XYZ', -100, 4.654321, -465.43, 'Goods returned'],
+ ] + [
+ [mkd(2008, 6, 30), 'PQRCD', 100, 2.345678, 234.57, ''],
+ ] * 100
+
+ heading_xf = ezxf('font: bold on; align: wrap on, vert centre, horiz center')
+ kind_to_xf_map = {
+ 'date': ezxf(num_format_str='yyyy-mm-dd'),
+ 'int': ezxf(num_format_str='#,##0'),
+ 'money': ezxf('font: italic on; pattern: pattern solid, fore-colour grey25',
+ num_format_str='$#,##0.00'),
+ 'price': ezxf(num_format_str='#0.000000'),
+ 'text': ezxf(),
+ }
+ data_xfs = [kind_to_xf_map[k] for k in kinds]
+ write_xls('xlwt_easyxf_simple_demo.xls', 'Demo', hdngs, data, heading_xf, data_xfs)
diff --git a/tablib/packages/xlwt/excel-formula.g b/tablib/packages/xlwt/excel-formula.g
new file mode 100644
index 0000000..d98d9b9
--- /dev/null
+++ b/tablib/packages/xlwt/excel-formula.g
@@ -0,0 +1,374 @@
+header {
+ import struct
+ import Utils
+ from UnicodeUtils import upack1
+ from ExcelMagic import *
+
+ _RVAdelta = {"R": 0, "V": 0x20, "A": 0x40}
+ _RVAdeltaRef = {"R": 0, "V": 0x20, "A": 0x40, "D": 0x20}
+ _RVAdeltaArea = {"R": 0, "V": 0x20, "A": 0x40, "D": 0}
+
+
+ class FormulaParseException(Exception):
+ """
+ An exception indicating that a Formula could not be successfully parsed.
+ """
+}
+
+header "ExcelFormulaParser.__init__" {
+ self.rpn = ""
+ self.sheet_references = []
+ self.xcall_references = []
+}
+
+options {
+ language = "Python";
+}
+
+class ExcelFormulaParser extends Parser;
+options {
+ k = 2;
+ defaultErrorHandler = false;
+ buildAST = false;
+}
+
+
+tokens {
+ TRUE_CONST;
+ FALSE_CONST;
+ STR_CONST;
+ NUM_CONST;
+ INT_CONST;
+
+ FUNC_IF;
+ FUNC_CHOOSE;
+ NAME;
+ QUOTENAME;
+
+ EQ;
+ NE;
+ GT;
+ LT;
+ GE;
+ LE;
+
+ ADD;
+ SUB;
+ MUL;
+ DIV;
+
+ POWER;
+ PERCENT;
+
+ LP;
+ RP;
+
+ LB;
+ RB;
+
+ COLON;
+ COMMA;
+ SEMICOLON;
+ REF2D;
+ REF2D_R1C1;
+ BANG;
+}
+
+formula
+ : expr["V"]
+ ;
+
+expr[arg_type]
+ : // {print "\n**expr %s" % arg_type}
+ prec0_expr[arg_type]
+ (
+ (
+ EQ { op = struct.pack('B', ptgEQ) }
+ | NE { op = struct.pack('B', ptgNE) }
+ | GT { op = struct.pack('B', ptgGT) }
+ | LT { op = struct.pack('B', ptgLT) }
+ | GE { op = struct.pack('B', ptgGE) }
+ | LE { op = struct.pack('B', ptgLE) }
+ )
+ prec0_expr[arg_type] { self.rpn += op }
+ )*
+ ;
+
+prec0_expr[arg_type]
+ : prec1_expr[arg_type]
+ (
+ (
+ CONCAT { op = struct.pack('B', ptgConcat) }
+ )
+ prec1_expr[arg_type] { self.rpn += op }
+ )*
+ ;
+
+prec1_expr[arg_type]
+ : // {print "**prec1_expr1 %s" % arg_type}
+ prec2_expr[arg_type]
+ // {print "**prec1_expr2 %s" % arg_type}
+ (
+ (
+ ADD { op = struct.pack('B', ptgAdd) }
+ | SUB { op = struct.pack('B', ptgSub) }
+ )
+ // {print "**prec1_expr3 %s" % arg_type}
+ prec2_expr[arg_type]
+ { self.rpn += op;
+ // print "**prec1_expr4 %s" % arg_type
+ }
+ )*
+ ;
+
+
+prec2_expr[arg_type]
+ : prec3_expr[arg_type]
+ (
+ (
+ MUL { op = struct.pack('B', ptgMul) }
+ | DIV { op = struct.pack('B', ptgDiv) }
+ )
+ prec3_expr[arg_type] { self.rpn += op }
+ )*
+ ;
+
+prec3_expr[arg_type]
+ : prec4_expr[arg_type]
+ (
+ (
+ POWER { op = struct.pack('B', ptgPower) }
+ )
+ prec4_expr[arg_type] { self.rpn += op }
+ )*
+ ;
+
+prec4_expr[arg_type]
+ : prec5_expr[arg_type]
+ (
+ PERCENT { self.rpn += struct.pack('B', ptgPercent) }
+ )?
+ ;
+
+prec5_expr[arg_type]
+ : primary[arg_type]
+ | SUB primary[arg_type] { self.rpn += struct.pack('B', ptgUminus) }
+ ;
+
+primary[arg_type]
+ : TRUE_CONST
+ {
+ self.rpn += struct.pack("2B", ptgBool, 1)
+ }
+ | FALSE_CONST
+ {
+ self.rpn += struct.pack("2B", ptgBool, 0)
+ }
+ | str_tok:STR_CONST
+ {
+ self.rpn += struct.pack("B", ptgStr) + upack1(str_tok.text[1:-1].replace("\"\"", "\""))
+ }
+ | int_tok:INT_CONST
+ {
+ // print "**int_const", int_tok.text
+ int_value = int(int_tok.text)
+ if int_value <= 65535:
+ self.rpn += struct.pack("<BH", ptgInt, int_value)
+ else:
+ self.rpn += struct.pack("<Bd", ptgNum, float(int_value))
+ }
+ | num_tok:NUM_CONST
+ {
+ self.rpn += struct.pack("<Bd", ptgNum, float(num_tok.text))
+ }
+ | ref2d_tok:REF2D
+ {
+ // print "**ref2d %s %s" % (ref2d_tok.text, arg_type)
+ r, c = Utils.cell_to_packed_rowcol(ref2d_tok.text)
+ ptg = ptgRefR + _RVAdeltaRef[arg_type]
+ self.rpn += struct.pack("<B2H", ptg, r, c)
+ }
+ | ref2d1_tok:REF2D COLON ref2d2_tok:REF2D
+ {
+ r1, c1 = Utils.cell_to_packed_rowcol(ref2d1_tok.text)
+ r2, c2 = Utils.cell_to_packed_rowcol(ref2d2_tok.text)
+ ptg = ptgAreaR + _RVAdeltaArea[arg_type]
+ self.rpn += struct.pack("<B4H", ptg, r1, r2, c1, c2)
+ }
+ | sheet1 = sheet
+ {
+ sheet2 = sheet1
+ }
+ ( COLON sheet2 = sheet )? BANG ref3d_ref2d: REF2D
+ {
+ ptg = ptgRef3dR + _RVAdeltaRef[arg_type]
+ rpn_ref2d = ""
+ r1, c1 = Utils.cell_to_packed_rowcol(ref3d_ref2d.text)
+ rpn_ref2d = struct.pack("<3H", 0x0000, r1, c1)
+ }
+ ( COLON ref3d_ref2d2: REF2D
+ {
+ ptg = ptgArea3dR + _RVAdeltaArea[arg_type]
+ r2, c2 = Utils.cell_to_packed_rowcol(ref3d_ref2d2.text)
+ rpn_ref2d = struct.pack("<5H", 0x0000, r1, r2, c1, c2)
+ }
+ )?
+ {
+ self.rpn += struct.pack("<B", ptg)
+ self.sheet_references.append((sheet1, sheet2, len(self.rpn)))
+ self.rpn += rpn_ref2d
+ }
+ | FUNC_IF
+ LP expr["V"] (SEMICOLON | COMMA)
+ {
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x02, 0) // tAttrIf
+ pos0 = len(self.rpn) - 2
+ }
+ expr[arg_type] (SEMICOLON | COMMA)
+ {
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x08, 0) // tAttrSkip
+ pos1 = len(self.rpn) - 2
+ self.rpn = self.rpn[:pos0] + struct.pack("<H", pos1-pos0) + self.rpn[pos0+2:]
+ }
+ expr[arg_type] RP
+ {
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x08, 3) // tAttrSkip
+ self.rpn += struct.pack("<BBH", ptgFuncVarR, 3, 1) // 3 = nargs, 1 = IF func
+ pos2 = len(self.rpn)
+ self.rpn = self.rpn[:pos1] + struct.pack("<H", pos2-(pos1+2)-1) + self.rpn[pos1+2:]
+ }
+ | FUNC_CHOOSE
+ {
+ arg_type = "R"
+ rpn_chunks = []
+ }
+ LP expr["V"] // first argument (the selector)
+ {
+ rpn_start = len(self.rpn)
+ ref_markers = [len(self.sheet_references)]
+ }
+ (
+ (SEMICOLON | COMMA)
+ { mark = len(self.rpn) }
+ (
+ expr[arg_type]
+ | { self.rpn += struct.pack("B", ptgMissArg) }
+ )
+ {
+ rpn_chunks.append(self.rpn[mark:])
+ ref_markers.append(len(self.sheet_references))
+ }
+ )*
+ RP
+ {
+ self.rpn = self.rpn[:rpn_start]
+ nc = len(rpn_chunks)
+ chunklens = [len(chunk) for chunk in rpn_chunks]
+ skiplens = [0] * nc
+ skiplens[-1] = 3
+ for ic in xrange(nc-1, 0, -1):
+ skiplens[ic-1] = skiplens[ic] + chunklens[ic] + 4
+ jump_pos = [2 * nc + 2]
+ for ic in xrange(nc):
+ jump_pos.append(jump_pos[-1] + chunklens[ic] + 4)
+ chunk_shift = 2 * nc + 6 // size of tAttrChoose
+ for ic in xrange(nc):
+ for refx in xrange(ref_markers[ic], ref_markers[ic+1]):
+ ref = self.sheet_references[refx]
+ self.sheet_references[refx] = (ref[0], ref[1], ref[2] + chunk_shift)
+ chunk_shift += 4 // size of tAttrSkip
+ choose_rpn = []
+ choose_rpn.append(struct.pack("<BBH", ptgAttr, 0x04, nc)) // 0x04 is tAttrChoose
+ choose_rpn.append(struct.pack("<%dH" % (nc+1), *jump_pos))
+ for ic in xrange(nc):
+ choose_rpn.append(rpn_chunks[ic])
+ choose_rpn.append(struct.pack("<BBH", ptgAttr, 0x08, skiplens[ic])) // 0x08 is tAttrSkip
+ choose_rpn.append(struct.pack("<BBH", ptgFuncVarV, nc+1, 100)) // 100 is CHOOSE fn
+ self.rpn += "".join(choose_rpn)
+ }
+ | name_tok:NAME
+ {
+ raise Exception("[formula] found unexpected NAME token (%r)" % name_tok.txt)
+ // #### TODO: handle references to defined names here
+ }
+ | func_tok:NAME
+ {
+ func_toku = func_tok.text.upper()
+ if func_toku in all_funcs_by_name:
+ (opcode,
+ min_argc,
+ max_argc,
+ func_type,
+ arg_type_str) = all_funcs_by_name[func_toku]
+ arg_type_list = list(arg_type_str)
+ else:
+ raise Exception("[formula] unknown function (%s)" % func_tok.text)
+ // print "**func_tok1 %s %s" % (func_toku, func_type)
+ xcall = opcode < 0
+ if xcall:
+ // The name of the add-in function is passed as the 1st arg
+ // of the hidden XCALL function
+ self.xcall_references.append((func_toku, len(self.rpn) + 1))
+ self.rpn += struct.pack("<BHHH",
+ ptgNameXR,
+ 0xadde, // ##PATCHME## index to REF entry in EXTERNSHEET record
+ 0xefbe, // ##PATCHME## one-based index to EXTERNNAME record
+ 0x0000) // unused
+ }
+ LP arg_count = expr_list[arg_type_list, min_argc, max_argc] RP
+ {
+ if arg_count > max_argc or arg_count < min_argc:
+ raise Exception, "%d parameters for function: %s" % (arg_count, func_tok.text)
+ if xcall:
+ func_ptg = ptgFuncVarR + _RVAdelta[func_type]
+ self.rpn += struct.pack("<2BH", func_ptg, arg_count + 1, 255) // 255 is magic XCALL function
+ elif min_argc == max_argc:
+ func_ptg = ptgFuncR + _RVAdelta[func_type]
+ self.rpn += struct.pack("<BH", func_ptg, opcode)
+ elif arg_count == 1 and func_tok.text.upper() == "SUM":
+ self.rpn += struct.pack("<BBH", ptgAttr, 0x10, 0) // tAttrSum
+ else:
+ func_ptg = ptgFuncVarR + _RVAdelta[func_type]
+ self.rpn += struct.pack("<2BH", func_ptg, arg_count, opcode)
+ }
+ | LP expr[arg_type] RP
+ {
+ self.rpn += struct.pack("B", ptgParen)
+ }
+ ;
+
+expr_list[arg_type_list, min_argc, max_argc] returns [arg_cnt]
+ {
+ arg_cnt = 0
+ arg_type = arg_type_list[arg_cnt]
+ // print "**expr_list1[%d] req=%s" % (arg_cnt, arg_type)
+ }
+ : expr[arg_type] { arg_cnt += 1 }
+ (
+ {
+ if arg_cnt < len(arg_type_list):
+ arg_type = arg_type_list[arg_cnt]
+ else:
+ arg_type = arg_type_list[-1]
+ if arg_type == "+":
+ arg_type = arg_type_list[-2]
+ // print "**expr_list2[%d] req=%s" % (arg_cnt, arg_type)
+ }
+ (SEMICOLON | COMMA)
+ (
+ expr[arg_type]
+ | { self.rpn += struct.pack("B", ptgMissArg) }
+ )
+ { arg_cnt += 1 }
+ )*
+ |
+ ;
+
+sheet returns[ref]
+ : sheet_ref_name: NAME
+ { ref = sheet_ref_name.text }
+ | sheet_ref_int: INT_CONST
+ { ref = sheet_ref_int.text }
+ | sheet_ref_quote: QUOTENAME
+ { ref = sheet_ref_quote.text[1:-1].replace("''", "'") }
+ ;
diff --git a/tablib/packages/yaml/__init__.py b/tablib/packages/yaml/__init__.py
index f36267a..c0fd1f3 100644
--- a/tablib/packages/yaml/__init__.py
+++ b/tablib/packages/yaml/__init__.py
@@ -1,12 +1,12 @@
-from .error import *
+from error import *
-from .tokens import *
-from .events import *
-from .nodes import *
+from tokens import *
+from events import *
+from nodes import *
-from .loader import *
-from .dumper import *
+from loader import *
+from dumper import *
__version__ = '3.09'
@@ -149,9 +149,9 @@ def dump_all(documents, stream=None, Dumper=Dumper,
getvalue = None
if stream is None:
if encoding is None:
- from io import StringIO
+ from StringIO import StringIO
else:
- from io import StringIO
+ from cStringIO import StringIO
stream = StringIO()
getvalue = stream.getvalue
dumper = Dumper(stream, default_style=default_style,
diff --git a/tablib/packages/yaml/composer.py b/tablib/packages/yaml/composer.py
index d5c6a7a..06e5ac7 100644
--- a/tablib/packages/yaml/composer.py
+++ b/tablib/packages/yaml/composer.py
@@ -1,14 +1,14 @@
__all__ = ['Composer', 'ComposerError']
-from .error import MarkedYAMLError
-from .events import *
-from .nodes import *
+from error import MarkedYAMLError
+from events import *
+from nodes import *
class ComposerError(MarkedYAMLError):
pass
-class Composer:
+class Composer(object):
def __init__(self):
self.anchors = {}
@@ -66,14 +66,14 @@ class Composer:
anchor = event.anchor
if anchor not in self.anchors:
raise ComposerError(None, None, "found undefined alias %r"
- % anchor, event.start_mark)
+ % anchor.encode('utf-8'), event.start_mark)
return self.anchors[anchor]
event = self.peek_event()
anchor = event.anchor
if anchor is not None:
if anchor in self.anchors:
raise ComposerError("found duplicate anchor %r; first occurence"
- % anchor, self.anchors[anchor].start_mark,
+ % anchor.encode('utf-8'), self.anchors[anchor].start_mark,
"second occurence", event.start_mark)
self.descend_resolver(parent, index)
if self.check_event(ScalarEvent):
@@ -88,7 +88,7 @@ class Composer:
def compose_scalar_node(self, anchor):
event = self.get_event()
tag = event.tag
- if tag is None or tag == '!':
+ if tag is None or tag == u'!':
tag = self.resolve(ScalarNode, event.value, event.implicit)
node = ScalarNode(tag, event.value,
event.start_mark, event.end_mark, style=event.style)
@@ -99,7 +99,7 @@ class Composer:
def compose_sequence_node(self, anchor):
start_event = self.get_event()
tag = start_event.tag
- if tag is None or tag == '!':
+ if tag is None or tag == u'!':
tag = self.resolve(SequenceNode, None, start_event.implicit)
node = SequenceNode(tag, [],
start_event.start_mark, None,
@@ -117,7 +117,7 @@ class Composer:
def compose_mapping_node(self, anchor):
start_event = self.get_event()
tag = start_event.tag
- if tag is None or tag == '!':
+ if tag is None or tag == u'!':
tag = self.resolve(MappingNode, None, start_event.implicit)
node = MappingNode(tag, [],
start_event.start_mark, None,
diff --git a/tablib/packages/yaml/constructor.py b/tablib/packages/yaml/constructor.py
index bd25b79..420c434 100644
--- a/tablib/packages/yaml/constructor.py
+++ b/tablib/packages/yaml/constructor.py
@@ -2,15 +2,22 @@
__all__ = ['BaseConstructor', 'SafeConstructor', 'Constructor',
'ConstructorError']
-from .error import *
-from .nodes import *
+from error import *
+from nodes import *
-import collections, datetime, base64, binascii, re, sys, types
+import datetime
+
+try:
+ set
+except NameError:
+ from sets import Set as set
+
+import binascii, re, sys, types
class ConstructorError(MarkedYAMLError):
pass
-class BaseConstructor:
+class BaseConstructor(object):
yaml_constructors = {}
yaml_multi_constructors = {}
@@ -88,7 +95,7 @@ class BaseConstructor:
data = constructor(self, tag_suffix, node)
if isinstance(data, types.GeneratorType):
generator = data
- data = next(generator)
+ data = generator.next()
if self.deep_construct:
for dummy in generator:
pass
@@ -123,9 +130,11 @@ class BaseConstructor:
mapping = {}
for key_node, value_node in node.value:
key = self.construct_object(key_node, deep=deep)
- if not isinstance(key, collections.Hashable):
+ try:
+ hash(key)
+ except TypeError, exc:
raise ConstructorError("while constructing a mapping", node.start_mark,
- "found unhashable key", key_node.start_mark)
+ "found unacceptable key (%s)" % exc, key_node.start_mark)
value = self.construct_object(value_node, deep=deep)
mapping[key] = value
return mapping
@@ -142,33 +151,33 @@ class BaseConstructor:
pairs.append((key, value))
return pairs
- @classmethod
def add_constructor(cls, tag, constructor):
if not 'yaml_constructors' in cls.__dict__:
cls.yaml_constructors = cls.yaml_constructors.copy()
cls.yaml_constructors[tag] = constructor
+ add_constructor = classmethod(add_constructor)
- @classmethod
def add_multi_constructor(cls, tag_prefix, multi_constructor):
if not 'yaml_multi_constructors' in cls.__dict__:
cls.yaml_multi_constructors = cls.yaml_multi_constructors.copy()
cls.yaml_multi_constructors[tag_prefix] = multi_constructor
+ add_multi_constructor = classmethod(add_multi_constructor)
class SafeConstructor(BaseConstructor):
def construct_scalar(self, node):
if isinstance(node, MappingNode):
for key_node, value_node in node.value:
- if key_node.tag == 'tag:yaml.org,2002:value':
+ if key_node.tag == u'tag:yaml.org,2002:value':
return self.construct_scalar(value_node)
- return super().construct_scalar(node)
+ return BaseConstructor.construct_scalar(self, node)
def flatten_mapping(self, node):
merge = []
index = 0
while index < len(node.value):
key_node, value_node = node.value[index]
- if key_node.tag == 'tag:yaml.org,2002:merge':
+ if key_node.tag == u'tag:yaml.org,2002:merge':
del node.value[index]
if isinstance(value_node, MappingNode):
self.flatten_mapping(value_node)
@@ -190,8 +199,8 @@ class SafeConstructor(BaseConstructor):
raise ConstructorError("while constructing a mapping", node.start_mark,
"expected a mapping or list of mappings for merging, but found %s"
% value_node.id, value_node.start_mark)
- elif key_node.tag == 'tag:yaml.org,2002:value':
- key_node.tag = 'tag:yaml.org,2002:str'
+ elif key_node.tag == u'tag:yaml.org,2002:value':
+ key_node.tag = u'tag:yaml.org,2002:str'
index += 1
else:
index += 1
@@ -201,19 +210,19 @@ class SafeConstructor(BaseConstructor):
def construct_mapping(self, node, deep=False):
if isinstance(node, MappingNode):
self.flatten_mapping(node)
- return super().construct_mapping(node, deep=deep)
+ return BaseConstructor.construct_mapping(self, node, deep=deep)
def construct_yaml_null(self, node):
self.construct_scalar(node)
return None
bool_values = {
- 'yes': True,
- 'no': False,
- 'true': True,
- 'false': False,
- 'on': True,
- 'off': False,
+ u'yes': True,
+ u'no': False,
+ u'true': True,
+ u'false': False,
+ u'on': True,
+ u'off': False,
}
def construct_yaml_bool(self, node):
@@ -221,7 +230,7 @@ class SafeConstructor(BaseConstructor):
return self.bool_values[value.lower()]
def construct_yaml_int(self, node):
- value = self.construct_scalar(node)
+ value = str(self.construct_scalar(node))
value = value.replace('_', '')
sign = +1
if value[0] == '-':
@@ -254,7 +263,7 @@ class SafeConstructor(BaseConstructor):
nan_value = -inf_value/inf_value # Trying to make a quiet NaN (like C99).
def construct_yaml_float(self, node):
- value = self.construct_scalar(node)
+ value = str(self.construct_scalar(node))
value = value.replace('_', '').lower()
sign = +1
if value[0] == '-':
@@ -278,23 +287,15 @@ class SafeConstructor(BaseConstructor):
return sign*float(value)
def construct_yaml_binary(self, node):
+ value = self.construct_scalar(node)
try:
- value = self.construct_scalar(node).encode('ascii')
- except UnicodeEncodeError as exc:
- raise ConstructorError(None, None,
- "failed to convert base64 data into ascii: %s" % exc,
- node.start_mark)
- try:
- if hasattr(base64, 'decodebytes'):
- return base64.decodebytes(value)
- else:
- return base64.decodestring(value)
- except binascii.Error as exc:
+ return str(value).decode('base64')
+ except (binascii.Error, UnicodeEncodeError), exc:
raise ConstructorError(None, None,
- "failed to decode base64 data: %s" % exc, node.start_mark)
+ "failed to decode base64 data: %s" % exc, node.start_mark)
timestamp_regexp = re.compile(
- r'''^(?P<year>[0-9][0-9][0-9][0-9])
+ ur'''^(?P<year>[0-9][0-9][0-9][0-9])
-(?P<month>[0-9][0-9]?)
-(?P<day>[0-9][0-9]?)
(?:(?:[Tt]|[ \t]+)
@@ -385,7 +386,11 @@ class SafeConstructor(BaseConstructor):
data.update(value)
def construct_yaml_str(self, node):
- return self.construct_scalar(node)
+ value = self.construct_scalar(node)
+ try:
+ return value.encode('ascii')
+ except UnicodeEncodeError:
+ return value
def construct_yaml_seq(self, node):
data = []
@@ -410,55 +415,55 @@ class SafeConstructor(BaseConstructor):
def construct_undefined(self, node):
raise ConstructorError(None, None,
- "could not determine a constructor for the tag %r" % node.tag,
+ "could not determine a constructor for the tag %r" % node.tag.encode('utf-8'),
node.start_mark)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:null',
+ u'tag:yaml.org,2002:null',
SafeConstructor.construct_yaml_null)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:bool',
+ u'tag:yaml.org,2002:bool',
SafeConstructor.construct_yaml_bool)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:int',
+ u'tag:yaml.org,2002:int',
SafeConstructor.construct_yaml_int)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:float',
+ u'tag:yaml.org,2002:float',
SafeConstructor.construct_yaml_float)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:binary',
+ u'tag:yaml.org,2002:binary',
SafeConstructor.construct_yaml_binary)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:timestamp',
+ u'tag:yaml.org,2002:timestamp',
SafeConstructor.construct_yaml_timestamp)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:omap',
+ u'tag:yaml.org,2002:omap',
SafeConstructor.construct_yaml_omap)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:pairs',
+ u'tag:yaml.org,2002:pairs',
SafeConstructor.construct_yaml_pairs)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:set',
+ u'tag:yaml.org,2002:set',
SafeConstructor.construct_yaml_set)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:str',
+ u'tag:yaml.org,2002:str',
SafeConstructor.construct_yaml_str)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:seq',
+ u'tag:yaml.org,2002:seq',
SafeConstructor.construct_yaml_seq)
SafeConstructor.add_constructor(
- 'tag:yaml.org,2002:map',
+ u'tag:yaml.org,2002:map',
SafeConstructor.construct_yaml_map)
SafeConstructor.add_constructor(None,
@@ -467,29 +472,13 @@ SafeConstructor.add_constructor(None,
class Constructor(SafeConstructor):
def construct_python_str(self, node):
- return self.construct_scalar(node)
+ return self.construct_scalar(node).encode('utf-8')
def construct_python_unicode(self, node):
return self.construct_scalar(node)
- def construct_python_bytes(self, node):
- try:
- value = self.construct_scalar(node).encode('ascii')
- except UnicodeEncodeError as exc:
- raise ConstructorError(None, None,
- "failed to convert base64 data into ascii: %s" % exc,
- node.start_mark)
- try:
- if hasattr(base64, 'decodebytes'):
- return base64.decodebytes(value)
- else:
- return base64.decodestring(value)
- except binascii.Error as exc:
- raise ConstructorError(None, None,
- "failed to decode base64 data: %s" % exc, node.start_mark)
-
def construct_python_long(self, node):
- return self.construct_yaml_int(node)
+ return long(self.construct_yaml_int(node))
def construct_python_complex(self, node):
return complex(self.construct_scalar(node))
@@ -503,46 +492,54 @@ class Constructor(SafeConstructor):
"expected non-empty name appended to the tag", mark)
try:
__import__(name)
- except ImportError as exc:
+ except ImportError, exc:
raise ConstructorError("while constructing a Python module", mark,
- "cannot find module %r (%s)" % (name, exc), mark)
+ "cannot find module %r (%s)" % (name.encode('utf-8'), exc), mark)
return sys.modules[name]
def find_python_name(self, name, mark):
if not name:
raise ConstructorError("while constructing a Python object", mark,
"expected non-empty name appended to the tag", mark)
- if '.' in name:
- module_name, object_name = name.rsplit('.', 1)
+ if u'.' in name:
+ # Python 2.4 only
+ #module_name, object_name = name.rsplit('.', 1)
+ items = name.split('.')
+ object_name = items.pop()
+ module_name = '.'.join(items)
else:
- module_name = 'builtins'
+ module_name = '__builtin__'
object_name = name
try:
__import__(module_name)
- except ImportError as exc:
+ except ImportError, exc:
raise ConstructorError("while constructing a Python object", mark,
- "cannot find module %r (%s)" % (module_name, exc), mark)
+ "cannot find module %r (%s)" % (module_name.encode('utf-8'), exc), mark)
module = sys.modules[module_name]
if not hasattr(module, object_name):
raise ConstructorError("while constructing a Python object", mark,
- "cannot find %r in the module %r"
- % (object_name, module.__name__), mark)
+ "cannot find %r in the module %r" % (object_name.encode('utf-8'),
+ module.__name__), mark)
return getattr(module, object_name)
def construct_python_name(self, suffix, node):
value = self.construct_scalar(node)
if value:
raise ConstructorError("while constructing a Python name", node.start_mark,
- "expected the empty value, but found %r" % value, node.start_mark)
+ "expected the empty value, but found %r" % value.encode('utf-8'),
+ node.start_mark)
return self.find_python_name(suffix, node.start_mark)
def construct_python_module(self, suffix, node):
value = self.construct_scalar(node)
if value:
raise ConstructorError("while constructing a Python module", node.start_mark,
- "expected the empty value, but found %r" % value, node.start_mark)
+ "expected the empty value, but found %r" % value.encode('utf-8'),
+ node.start_mark)
return self.find_python_module(suffix, node.start_mark)
+ class classobj: pass
+
def make_python_instance(self, suffix, node,
args=None, kwds=None, newobj=False):
if not args:
@@ -550,7 +547,12 @@ class Constructor(SafeConstructor):
if not kwds:
kwds = {}
cls = self.find_python_name(suffix, node.start_mark)
- if newobj and isinstance(cls, type):
+ if newobj and isinstance(cls, type(self.classobj)) \
+ and not args and not kwds:
+ instance = self.classobj()
+ instance.__class__ = cls
+ return instance
+ elif newobj and isinstance(cls, type):
return cls.__new__(cls, *args, **kwds)
else:
return cls(*args, **kwds)
@@ -617,70 +619,66 @@ class Constructor(SafeConstructor):
return self.construct_python_object_apply(suffix, node, newobj=True)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/none',
+ u'tag:yaml.org,2002:python/none',
Constructor.construct_yaml_null)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/bool',
+ u'tag:yaml.org,2002:python/bool',
Constructor.construct_yaml_bool)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/str',
+ u'tag:yaml.org,2002:python/str',
Constructor.construct_python_str)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/unicode',
+ u'tag:yaml.org,2002:python/unicode',
Constructor.construct_python_unicode)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/bytes',
- Constructor.construct_python_bytes)
-
-Constructor.add_constructor(
- 'tag:yaml.org,2002:python/int',
+ u'tag:yaml.org,2002:python/int',
Constructor.construct_yaml_int)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/long',
+ u'tag:yaml.org,2002:python/long',
Constructor.construct_python_long)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/float',
+ u'tag:yaml.org,2002:python/float',
Constructor.construct_yaml_float)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/complex',
+ u'tag:yaml.org,2002:python/complex',
Constructor.construct_python_complex)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/list',
+ u'tag:yaml.org,2002:python/list',
Constructor.construct_yaml_seq)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/tuple',
+ u'tag:yaml.org,2002:python/tuple',
Constructor.construct_python_tuple)
Constructor.add_constructor(
- 'tag:yaml.org,2002:python/dict',
+ u'tag:yaml.org,2002:python/dict',
Constructor.construct_yaml_map)
Constructor.add_multi_constructor(
- 'tag:yaml.org,2002:python/name:',
+ u'tag:yaml.org,2002:python/name:',
Constructor.construct_python_name)
Constructor.add_multi_constructor(
- 'tag:yaml.org,2002:python/module:',
+ u'tag:yaml.org,2002:python/module:',
Constructor.construct_python_module)
Constructor.add_multi_constructor(
- 'tag:yaml.org,2002:python/object:',
+ u'tag:yaml.org,2002:python/object:',
Constructor.construct_python_object)
Constructor.add_multi_constructor(
- 'tag:yaml.org,2002:python/object/apply:',
+ u'tag:yaml.org,2002:python/object/apply:',
Constructor.construct_python_object_apply)
Constructor.add_multi_constructor(
- 'tag:yaml.org,2002:python/object/new:',
+ u'tag:yaml.org,2002:python/object/new:',
Constructor.construct_python_object_new)
diff --git a/tablib/packages/yaml/cyaml.py b/tablib/packages/yaml/cyaml.py
index d5cb87e..68dcd75 100644
--- a/tablib/packages/yaml/cyaml.py
+++ b/tablib/packages/yaml/cyaml.py
@@ -4,12 +4,12 @@ __all__ = ['CBaseLoader', 'CSafeLoader', 'CLoader',
from _yaml import CParser, CEmitter
-from .constructor import *
+from constructor import *
-from .serializer import *
-from .representer import *
+from serializer import *
+from representer import *
-from .resolver import *
+from resolver import *
class CBaseLoader(CParser, BaseConstructor, BaseResolver):
diff --git a/tablib/packages/yaml/dumper.py b/tablib/packages/yaml/dumper.py
index 0b69128..f811d2c 100644
--- a/tablib/packages/yaml/dumper.py
+++ b/tablib/packages/yaml/dumper.py
@@ -1,10 +1,10 @@
__all__ = ['BaseDumper', 'SafeDumper', 'Dumper']
-from .emitter import *
-from .serializer import *
-from .representer import *
-from .resolver import *
+from emitter import *
+from serializer import *
+from representer import *
+from resolver import *
class BaseDumper(Emitter, Serializer, BaseRepresenter, BaseResolver):
diff --git a/tablib/packages/yaml/emitter.py b/tablib/packages/yaml/emitter.py
index 8947d04..4cb2c8a 100644
--- a/tablib/packages/yaml/emitter.py
+++ b/tablib/packages/yaml/emitter.py
@@ -8,13 +8,13 @@
__all__ = ['Emitter', 'EmitterError']
-from .error import YAMLError
-from .events import *
+from error import YAMLError
+from events import *
class EmitterError(YAMLError):
pass
-class ScalarAnalysis:
+class ScalarAnalysis(object):
def __init__(self, scalar, empty, multiline,
allow_flow_plain, allow_block_plain,
allow_single_quoted, allow_double_quoted,
@@ -28,11 +28,11 @@ class ScalarAnalysis:
self.allow_double_quoted = allow_double_quoted
self.allow_block = allow_block
-class Emitter:
+class Emitter(object):
DEFAULT_TAG_PREFIXES = {
- '!' : '!',
- 'tag:yaml.org,2002:' : '!!',
+ u'!' : u'!',
+ u'tag:yaml.org,2002:' : u'!!',
}
def __init__(self, stream, canonical=None, indent=None, width=None,
@@ -88,8 +88,8 @@ class Emitter:
self.best_width = 80
if width and width > self.best_indent*2:
self.best_width = width
- self.best_line_break = '\n'
- if line_break in ['\r', '\n', '\r\n']:
+ self.best_line_break = u'\n'
+ if line_break in [u'\r', u'\n', u'\r\n']:
self.best_line_break = line_break
# Tag prefixes.
@@ -154,7 +154,7 @@ class Emitter:
def expect_stream_start(self):
if isinstance(self.event, StreamStartEvent):
- if self.event.encoding and not hasattr(self.stream, 'encoding'):
+ if self.event.encoding and not getattr(self.stream, 'encoding', None):
self.encoding = self.event.encoding
self.write_stream_start()
self.state = self.expect_first_document_start
@@ -173,14 +173,15 @@ class Emitter:
def expect_document_start(self, first=False):
if isinstance(self.event, DocumentStartEvent):
if (self.event.version or self.event.tags) and self.open_ended:
- self.write_indicator('...', True)
+ self.write_indicator(u'...', True)
self.write_indent()
if self.event.version:
version_text = self.prepare_version(self.event.version)
self.write_version_directive(version_text)
self.tag_prefixes = self.DEFAULT_TAG_PREFIXES.copy()
if self.event.tags:
- handles = sorted(self.event.tags.keys())
+ handles = self.event.tags.keys()
+ handles.sort()
for handle in handles:
prefix = self.event.tags[handle]
self.tag_prefixes[prefix] = handle
@@ -192,13 +193,13 @@ class Emitter:
and not self.check_empty_document())
if not implicit:
self.write_indent()
- self.write_indicator('---', True)
+ self.write_indicator(u'---', True)
if self.canonical:
self.write_indent()
self.state = self.expect_document_root
elif isinstance(self.event, StreamEndEvent):
if self.open_ended:
- self.write_indicator('...', True)
+ self.write_indicator(u'...', True)
self.write_indent()
self.write_stream_end()
self.state = self.expect_nothing
@@ -210,7 +211,7 @@ class Emitter:
if isinstance(self.event, DocumentEndEvent):
self.write_indent()
if self.event.explicit:
- self.write_indicator('...', True)
+ self.write_indicator(u'...', True)
self.write_indent()
self.flush_stream()
self.state = self.expect_document_start
@@ -233,7 +234,7 @@ class Emitter:
if isinstance(self.event, AliasEvent):
self.expect_alias()
elif isinstance(self.event, (ScalarEvent, CollectionStartEvent)):
- self.process_anchor('&')
+ self.process_anchor(u'&')
self.process_tag()
if isinstance(self.event, ScalarEvent):
self.expect_scalar()
@@ -255,7 +256,7 @@ class Emitter:
def expect_alias(self):
if self.event.anchor is None:
raise EmitterError("anchor is not specified for alias")
- self.process_anchor('*')
+ self.process_anchor(u'*')
self.state = self.states.pop()
def expect_scalar(self):
@@ -267,7 +268,7 @@ class Emitter:
# Flow sequence handlers.
def expect_flow_sequence(self):
- self.write_indicator('[', True, whitespace=True)
+ self.write_indicator(u'[', True, whitespace=True)
self.flow_level += 1
self.increase_indent(flow=True)
self.state = self.expect_first_flow_sequence_item
@@ -276,7 +277,7 @@ class Emitter:
if isinstance(self.event, SequenceEndEvent):
self.indent = self.indents.pop()
self.flow_level -= 1
- self.write_indicator(']', False)
+ self.write_indicator(u']', False)
self.state = self.states.pop()
else:
if self.canonical or self.column > self.best_width:
@@ -289,12 +290,12 @@ class Emitter:
self.indent = self.indents.pop()
self.flow_level -= 1
if self.canonical:
- self.write_indicator(',', False)
+ self.write_indicator(u',', False)
self.write_indent()
- self.write_indicator(']', False)
+ self.write_indicator(u']', False)
self.state = self.states.pop()
else:
- self.write_indicator(',', False)
+ self.write_indicator(u',', False)
if self.canonical or self.column > self.best_width:
self.write_indent()
self.states.append(self.expect_flow_sequence_item)
@@ -303,7 +304,7 @@ class Emitter:
# Flow mapping handlers.
def expect_flow_mapping(self):
- self.write_indicator('{', True, whitespace=True)
+ self.write_indicator(u'{', True, whitespace=True)
self.flow_level += 1
self.increase_indent(flow=True)
self.state = self.expect_first_flow_mapping_key
@@ -312,7 +313,7 @@ class Emitter:
if isinstance(self.event, MappingEndEvent):
self.indent = self.indents.pop()
self.flow_level -= 1
- self.write_indicator('}', False)
+ self.write_indicator(u'}', False)
self.state = self.states.pop()
else:
if self.canonical or self.column > self.best_width:
@@ -321,7 +322,7 @@ class Emitter:
self.states.append(self.expect_flow_mapping_simple_value)
self.expect_node(mapping=True, simple_key=True)
else:
- self.write_indicator('?', True)
+ self.write_indicator(u'?', True)
self.states.append(self.expect_flow_mapping_value)
self.expect_node(mapping=True)
@@ -330,31 +331,31 @@ class Emitter:
self.indent = self.indents.pop()
self.flow_level -= 1
if self.canonical:
- self.write_indicator(',', False)
+ self.write_indicator(u',', False)
self.write_indent()
- self.write_indicator('}', False)
+ self.write_indicator(u'}', False)
self.state = self.states.pop()
else:
- self.write_indicator(',', False)
+ self.write_indicator(u',', False)
if self.canonical or self.column > self.best_width:
self.write_indent()
if not self.canonical and self.check_simple_key():
self.states.append(self.expect_flow_mapping_simple_value)
self.expect_node(mapping=True, simple_key=True)
else:
- self.write_indicator('?', True)
+ self.write_indicator(u'?', True)
self.states.append(self.expect_flow_mapping_value)
self.expect_node(mapping=True)
def expect_flow_mapping_simple_value(self):
- self.write_indicator(':', False)
+ self.write_indicator(u':', False)
self.states.append(self.expect_flow_mapping_key)
self.expect_node(mapping=True)
def expect_flow_mapping_value(self):
if self.canonical or self.column > self.best_width:
self.write_indent()
- self.write_indicator(':', True)
+ self.write_indicator(u':', True)
self.states.append(self.expect_flow_mapping_key)
self.expect_node(mapping=True)
@@ -374,7 +375,7 @@ class Emitter:
self.state = self.states.pop()
else:
self.write_indent()
- self.write_indicator('-', True, indention=True)
+ self.write_indicator(u'-', True, indention=True)
self.states.append(self.expect_block_sequence_item)
self.expect_node(sequence=True)
@@ -397,18 +398,18 @@ class Emitter:
self.states.append(self.expect_block_mapping_simple_value)
self.expect_node(mapping=True, simple_key=True)
else:
- self.write_indicator('?', True, indention=True)
+ self.write_indicator(u'?', True, indention=True)
self.states.append(self.expect_block_mapping_value)
self.expect_node(mapping=True)
def expect_block_mapping_simple_value(self):
- self.write_indicator(':', False)
+ self.write_indicator(u':', False)
self.states.append(self.expect_block_mapping_key)
self.expect_node(mapping=True)
def expect_block_mapping_value(self):
self.write_indent()
- self.write_indicator(':', True, indention=True)
+ self.write_indicator(u':', True, indention=True)
self.states.append(self.expect_block_mapping_key)
self.expect_node(mapping=True)
@@ -427,7 +428,7 @@ class Emitter:
return False
event = self.events[0]
return (isinstance(event, ScalarEvent) and event.anchor is None
- and event.tag is None and event.implicit and event.value == '')
+ and event.tag is None and event.implicit and event.value == u'')
def check_simple_key(self):
length = 0
@@ -472,7 +473,7 @@ class Emitter:
self.prepared_tag = None
return
if self.event.implicit[0] and tag is None:
- tag = '!'
+ tag = u'!'
self.prepared_tag = None
else:
if (not self.canonical or tag is None) and self.event.implicit:
@@ -535,18 +536,19 @@ class Emitter:
major, minor = version
if major != 1:
raise EmitterError("unsupported YAML version: %d.%d" % (major, minor))
- return '%d.%d' % (major, minor)
+ return u'%d.%d' % (major, minor)
def prepare_tag_handle(self, handle):
if not handle:
raise EmitterError("tag handle must not be empty")
- if handle[0] != '!' or handle[-1] != '!':
- raise EmitterError("tag handle must start and end with '!': %r" % handle)
+ if handle[0] != u'!' or handle[-1] != u'!':
+ raise EmitterError("tag handle must start and end with '!': %r"
+ % (handle.encode('utf-8')))
for ch in handle[1:-1]:
- if not ('0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-_'):
+ if not (u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-_'):
raise EmitterError("invalid character %r in the tag handle: %r"
- % (ch, handle))
+ % (ch.encode('utf-8'), handle.encode('utf-8')))
return handle
def prepare_tag_prefix(self, prefix):
@@ -554,12 +556,12 @@ class Emitter:
raise EmitterError("tag prefix must not be empty")
chunks = []
start = end = 0
- if prefix[0] == '!':
+ if prefix[0] == u'!':
end = 1
while end < len(prefix):
ch = prefix[end]
- if '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-;/?!:@&=+$,_.~*\'()[]':
+ if u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-;/?!:@&=+$,_.~*\'()[]':
end += 1
else:
if start < end:
@@ -567,31 +569,32 @@ class Emitter:
start = end = end+1
data = ch.encode('utf-8')
for ch in data:
- chunks.append('%%%02X' % ord(ch))
+ chunks.append(u'%%%02X' % ord(ch))
if start < end:
chunks.append(prefix[start:end])
- return ''.join(chunks)
+ return u''.join(chunks)
def prepare_tag(self, tag):
if not tag:
raise EmitterError("tag must not be empty")
- if tag == '!':
+ if tag == u'!':
return tag
handle = None
suffix = tag
- prefixes = sorted(self.tag_prefixes.keys())
+ prefixes = self.tag_prefixes.keys()
+ prefixes.sort()
for prefix in prefixes:
if tag.startswith(prefix) \
- and (prefix == '!' or len(prefix) < len(tag)):
+ and (prefix == u'!' or len(prefix) < len(tag)):
handle = self.tag_prefixes[prefix]
suffix = tag[len(prefix):]
chunks = []
start = end = 0
while end < len(suffix):
ch = suffix[end]
- if '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-;/?:@&=+$,_.~*\'()[]' \
- or (ch == '!' and handle != '!'):
+ if u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-;/?:@&=+$,_.~*\'()[]' \
+ or (ch == u'!' and handle != u'!'):
end += 1
else:
if start < end:
@@ -599,23 +602,23 @@ class Emitter:
start = end = end+1
data = ch.encode('utf-8')
for ch in data:
- chunks.append('%%%02X' % ord(ch))
+ chunks.append(u'%%%02X' % ord(ch))
if start < end:
chunks.append(suffix[start:end])
- suffix_text = ''.join(chunks)
+ suffix_text = u''.join(chunks)
if handle:
- return '%s%s' % (handle, suffix_text)
+ return u'%s%s' % (handle, suffix_text)
else:
- return '!<%s>' % suffix_text
+ return u'!<%s>' % suffix_text
def prepare_anchor(self, anchor):
if not anchor:
raise EmitterError("anchor must not be empty")
for ch in anchor:
- if not ('0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-_'):
+ if not (u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-_'):
raise EmitterError("invalid character %r in the anchor: %r"
- % (ch, anchor))
+ % (ch.encode('utf-8'), anchor.encode('utf-8')))
return anchor
def analyze_scalar(self, scalar):
@@ -642,7 +645,7 @@ class Emitter:
space_break = False
# Check document indicators.
- if scalar.startswith('---') or scalar.startswith('...'):
+ if scalar.startswith(u'---') or scalar.startswith(u'...'):
block_indicators = True
flow_indicators = True
@@ -651,7 +654,7 @@ class Emitter:
# Last character or followed by a whitespace.
followed_by_whitespace = (len(scalar) == 1 or
- scalar[1] in '\0 \t\r\n\x85\u2028\u2029')
+ scalar[1] in u'\0 \t\r\n\x85\u2028\u2029')
# The previous character is a space.
previous_space = False
@@ -666,34 +669,34 @@ class Emitter:
# Check for indicators.
if index == 0:
# Leading indicators are special characters.
- if ch in '#,[]{}&*!|>\'\"%@`':
+ if ch in u'#,[]{}&*!|>\'\"%@`':
flow_indicators = True
block_indicators = True
- if ch in '?:':
+ if ch in u'?:':
flow_indicators = True
if followed_by_whitespace:
block_indicators = True
- if ch == '-' and followed_by_whitespace:
+ if ch == u'-' and followed_by_whitespace:
flow_indicators = True
block_indicators = True
else:
# Some indicators cannot appear within a scalar as well.
- if ch in ',?[]{}':
+ if ch in u',?[]{}':
flow_indicators = True
- if ch == ':':
+ if ch == u':':
flow_indicators = True
if followed_by_whitespace:
block_indicators = True
- if ch == '#' and preceeded_by_whitespace:
+ if ch == u'#' and preceeded_by_whitespace:
flow_indicators = True
block_indicators = True
# Check for line breaks, special, and unicode characters.
- if ch in '\n\x85\u2028\u2029':
+ if ch in u'\n\x85\u2028\u2029':
line_breaks = True
- if not (ch == '\n' or '\x20' <= ch <= '\x7E'):
- if (ch == '\x85' or '\xA0' <= ch <= '\uD7FF'
- or '\uE000' <= ch <= '\uFFFD') and ch != '\uFEFF':
+ if not (ch == u'\n' or u'\x20' <= ch <= u'\x7E'):
+ if (ch == u'\x85' or u'\xA0' <= ch <= u'\uD7FF'
+ or u'\uE000' <= ch <= u'\uFFFD') and ch != u'\uFEFF':
unicode_characters = True
if not self.allow_unicode:
special_characters = True
@@ -701,7 +704,7 @@ class Emitter:
special_characters = True
# Detect important whitespace combinations.
- if ch == ' ':
+ if ch == u' ':
if index == 0:
leading_space = True
if index == len(scalar)-1:
@@ -710,7 +713,7 @@ class Emitter:
break_space = True
previous_space = True
previous_break = False
- elif ch in '\n\x85\u2028\u2029':
+ elif ch in u'\n\x85\u2028\u2029':
if index == 0:
leading_break = True
if index == len(scalar)-1:
@@ -725,9 +728,9 @@ class Emitter:
# Prepare for the next character.
index += 1
- preceeded_by_whitespace = (ch in '\0 \t\r\n\x85\u2028\u2029')
+ preceeded_by_whitespace = (ch in u'\0 \t\r\n\x85\u2028\u2029')
followed_by_whitespace = (index+1 >= len(scalar) or
- scalar[index+1] in '\0 \t\r\n\x85\u2028\u2029')
+ scalar[index+1] in u'\0 \t\r\n\x85\u2028\u2029')
# Let's decide what styles are allowed.
allow_flow_plain = True
@@ -786,7 +789,7 @@ class Emitter:
def write_stream_start(self):
# Write BOM if needed.
if self.encoding and self.encoding.startswith('utf-16'):
- self.stream.write('\uFEFF'.encode(self.encoding))
+ self.stream.write(u'\uFEFF'.encode(self.encoding))
def write_stream_end(self):
self.flush_stream()
@@ -796,7 +799,7 @@ class Emitter:
if self.whitespace or not need_whitespace:
data = indicator
else:
- data = ' '+indicator
+ data = u' '+indicator
self.whitespace = whitespace
self.indention = self.indention and indention
self.column += len(data)
@@ -812,7 +815,7 @@ class Emitter:
self.write_line_break()
if self.column < indent:
self.whitespace = True
- data = ' '*(indent-self.column)
+ data = u' '*(indent-self.column)
self.column = indent
if self.encoding:
data = data.encode(self.encoding)
@@ -830,14 +833,14 @@ class Emitter:
self.stream.write(data)
def write_version_directive(self, version_text):
- data = '%%YAML %s' % version_text
+ data = u'%%YAML %s' % version_text
if self.encoding:
data = data.encode(self.encoding)
self.stream.write(data)
self.write_line_break()
def write_tag_directive(self, handle_text, prefix_text):
- data = '%%TAG %s %s' % (handle_text, prefix_text)
+ data = u'%%TAG %s %s' % (handle_text, prefix_text)
if self.encoding:
data = data.encode(self.encoding)
self.stream.write(data)
@@ -846,7 +849,7 @@ class Emitter:
# Scalar streams.
def write_single_quoted(self, text, split=True):
- self.write_indicator('\'', True)
+ self.write_indicator(u'\'', True)
spaces = False
breaks = False
start = end = 0
@@ -855,7 +858,7 @@ class Emitter:
if end < len(text):
ch = text[end]
if spaces:
- if ch is None or ch != ' ':
+ if ch is None or ch != u' ':
if start+1 == end and self.column > self.best_width and split \
and start != 0 and end != len(text):
self.write_indent()
@@ -867,18 +870,18 @@ class Emitter:
self.stream.write(data)
start = end
elif breaks:
- if ch is None or ch not in '\n\x85\u2028\u2029':
- if text[start] == '\n':
+ if ch is None or ch not in u'\n\x85\u2028\u2029':
+ if text[start] == u'\n':
self.write_line_break()
for br in text[start:end]:
- if br == '\n':
+ if br == u'\n':
self.write_line_break()
else:
self.write_line_break(br)
self.write_indent()
start = end
else:
- if ch is None or ch in ' \n\x85\u2028\u2029' or ch == '\'':
+ if ch is None or ch in u' \n\x85\u2028\u2029' or ch == u'\'':
if start < end:
data = text[start:end]
self.column += len(data)
@@ -886,49 +889,49 @@ class Emitter:
data = data.encode(self.encoding)
self.stream.write(data)
start = end
- if ch == '\'':
- data = '\'\''
+ if ch == u'\'':
+ data = u'\'\''
self.column += 2
if self.encoding:
data = data.encode(self.encoding)
self.stream.write(data)
start = end + 1
if ch is not None:
- spaces = (ch == ' ')
- breaks = (ch in '\n\x85\u2028\u2029')
+ spaces = (ch == u' ')
+ breaks = (ch in u'\n\x85\u2028\u2029')
end += 1
- self.write_indicator('\'', False)
+ self.write_indicator(u'\'', False)
ESCAPE_REPLACEMENTS = {
- '\0': '0',
- '\x07': 'a',
- '\x08': 'b',
- '\x09': 't',
- '\x0A': 'n',
- '\x0B': 'v',
- '\x0C': 'f',
- '\x0D': 'r',
- '\x1B': 'e',
- '\"': '\"',
- '\\': '\\',
- '\x85': 'N',
- '\xA0': '_',
- '\u2028': 'L',
- '\u2029': 'P',
+ u'\0': u'0',
+ u'\x07': u'a',
+ u'\x08': u'b',
+ u'\x09': u't',
+ u'\x0A': u'n',
+ u'\x0B': u'v',
+ u'\x0C': u'f',
+ u'\x0D': u'r',
+ u'\x1B': u'e',
+ u'\"': u'\"',
+ u'\\': u'\\',
+ u'\x85': u'N',
+ u'\xA0': u'_',
+ u'\u2028': u'L',
+ u'\u2029': u'P',
}
def write_double_quoted(self, text, split=True):
- self.write_indicator('"', True)
+ self.write_indicator(u'"', True)
start = end = 0
while end <= len(text):
ch = None
if end < len(text):
ch = text[end]
- if ch is None or ch in '"\\\x85\u2028\u2029\uFEFF' \
- or not ('\x20' <= ch <= '\x7E'
+ if ch is None or ch in u'"\\\x85\u2028\u2029\uFEFF' \
+ or not (u'\x20' <= ch <= u'\x7E'
or (self.allow_unicode
- and ('\xA0' <= ch <= '\uD7FF'
- or '\uE000' <= ch <= '\uFFFD'))):
+ and (u'\xA0' <= ch <= u'\uD7FF'
+ or u'\uE000' <= ch <= u'\uFFFD'))):
if start < end:
data = text[start:end]
self.column += len(data)
@@ -938,21 +941,21 @@ class Emitter:
start = end
if ch is not None:
if ch in self.ESCAPE_REPLACEMENTS:
- data = '\\'+self.ESCAPE_REPLACEMENTS[ch]
- elif ch <= '\xFF':
- data = '\\x%02X' % ord(ch)
- elif ch <= '\uFFFF':
- data = '\\u%04X' % ord(ch)
+ data = u'\\'+self.ESCAPE_REPLACEMENTS[ch]
+ elif ch <= u'\xFF':
+ data = u'\\x%02X' % ord(ch)
+ elif ch <= u'\uFFFF':
+ data = u'\\u%04X' % ord(ch)
else:
- data = '\\U%08X' % ord(ch)
+ data = u'\\U%08X' % ord(ch)
self.column += len(data)
if self.encoding:
data = data.encode(self.encoding)
self.stream.write(data)
start = end+1
- if 0 < end < len(text)-1 and (ch == ' ' or start >= end) \
+ if 0 < end < len(text)-1 and (ch == u' ' or start >= end) \
and self.column+(end-start) > self.best_width and split:
- data = text[start:end]+'\\'
+ data = text[start:end]+u'\\'
if start < end:
start = end
self.column += len(data)
@@ -962,30 +965,30 @@ class Emitter:
self.write_indent()
self.whitespace = False
self.indention = False
- if text[start] == ' ':
- data = '\\'
+ if text[start] == u' ':
+ data = u'\\'
self.column += len(data)
if self.encoding:
data = data.encode(self.encoding)
self.stream.write(data)
end += 1
- self.write_indicator('"', False)
+ self.write_indicator(u'"', False)
def determine_block_hints(self, text):
- hints = ''
+ hints = u''
if text:
- if text[0] in ' \n\x85\u2028\u2029':
- hints += str(self.best_indent)
- if text[-1] not in '\n\x85\u2028\u2029':
- hints += '-'
- elif len(text) == 1 or text[-2] in '\n\x85\u2028\u2029':
- hints += '+'
+ if text[0] in u' \n\x85\u2028\u2029':
+ hints += unicode(self.best_indent)
+ if text[-1] not in u'\n\x85\u2028\u2029':
+ hints += u'-'
+ elif len(text) == 1 or text[-2] in u'\n\x85\u2028\u2029':
+ hints += u'+'
return hints
def write_folded(self, text):
hints = self.determine_block_hints(text)
- self.write_indicator('>'+hints, True)
- if hints[-1:] == '+':
+ self.write_indicator(u'>'+hints, True)
+ if hints[-1:] == u'+':
self.open_ended = True
self.write_line_break()
leading_space = True
@@ -997,13 +1000,13 @@ class Emitter:
if end < len(text):
ch = text[end]
if breaks:
- if ch is None or ch not in '\n\x85\u2028\u2029':
- if not leading_space and ch is not None and ch != ' ' \
- and text[start] == '\n':
+ if ch is None or ch not in u'\n\x85\u2028\u2029':
+ if not leading_space and ch is not None and ch != u' ' \
+ and text[start] == u'\n':
self.write_line_break()
- leading_space = (ch == ' ')
+ leading_space = (ch == u' ')
for br in text[start:end]:
- if br == '\n':
+ if br == u'\n':
self.write_line_break()
else:
self.write_line_break(br)
@@ -1011,7 +1014,7 @@ class Emitter:
self.write_indent()
start = end
elif spaces:
- if ch != ' ':
+ if ch != u' ':
if start+1 == end and self.column > self.best_width:
self.write_indent()
else:
@@ -1022,7 +1025,7 @@ class Emitter:
self.stream.write(data)
start = end
else:
- if ch is None or ch in ' \n\x85\u2028\u2029':
+ if ch is None or ch in u' \n\x85\u2028\u2029':
data = text[start:end]
self.column += len(data)
if self.encoding:
@@ -1032,14 +1035,14 @@ class Emitter:
self.write_line_break()
start = end
if ch is not None:
- breaks = (ch in '\n\x85\u2028\u2029')
- spaces = (ch == ' ')
+ breaks = (ch in u'\n\x85\u2028\u2029')
+ spaces = (ch == u' ')
end += 1
def write_literal(self, text):
hints = self.determine_block_hints(text)
- self.write_indicator('|'+hints, True)
- if hints[-1:] == '+':
+ self.write_indicator(u'|'+hints, True)
+ if hints[-1:] == u'+':
self.open_ended = True
self.write_line_break()
breaks = True
@@ -1049,9 +1052,9 @@ class Emitter:
if end < len(text):
ch = text[end]
if breaks:
- if ch is None or ch not in '\n\x85\u2028\u2029':
+ if ch is None or ch not in u'\n\x85\u2028\u2029':
for br in text[start:end]:
- if br == '\n':
+ if br == u'\n':
self.write_line_break()
else:
self.write_line_break(br)
@@ -1059,7 +1062,7 @@ class Emitter:
self.write_indent()
start = end
else:
- if ch is None or ch in '\n\x85\u2028\u2029':
+ if ch is None or ch in u'\n\x85\u2028\u2029':
data = text[start:end]
if self.encoding:
data = data.encode(self.encoding)
@@ -1068,7 +1071,7 @@ class Emitter:
self.write_line_break()
start = end
if ch is not None:
- breaks = (ch in '\n\x85\u2028\u2029')
+ breaks = (ch in u'\n\x85\u2028\u2029')
end += 1
def write_plain(self, text, split=True):
@@ -1077,7 +1080,7 @@ class Emitter:
if not text:
return
if not self.whitespace:
- data = ' '
+ data = u' '
self.column += len(data)
if self.encoding:
data = data.encode(self.encoding)
@@ -1092,7 +1095,7 @@ class Emitter:
if end < len(text):
ch = text[end]
if spaces:
- if ch != ' ':
+ if ch != u' ':
if start+1 == end and self.column > self.best_width and split:
self.write_indent()
self.whitespace = False
@@ -1105,11 +1108,11 @@ class Emitter:
self.stream.write(data)
start = end
elif breaks:
- if ch not in '\n\x85\u2028\u2029':
- if text[start] == '\n':
+ if ch not in u'\n\x85\u2028\u2029':
+ if text[start] == u'\n':
self.write_line_break()
for br in text[start:end]:
- if br == '\n':
+ if br == u'\n':
self.write_line_break()
else:
self.write_line_break(br)
@@ -1118,7 +1121,7 @@ class Emitter:
self.indention = False
start = end
else:
- if ch is None or ch in ' \n\x85\u2028\u2029':
+ if ch is None or ch in u' \n\x85\u2028\u2029':
data = text[start:end]
self.column += len(data)
if self.encoding:
@@ -1126,7 +1129,7 @@ class Emitter:
self.stream.write(data)
start = end
if ch is not None:
- spaces = (ch == ' ')
- breaks = (ch in '\n\x85\u2028\u2029')
+ spaces = (ch == u' ')
+ breaks = (ch in u'\n\x85\u2028\u2029')
end += 1
diff --git a/tablib/packages/yaml/error.py b/tablib/packages/yaml/error.py
index b796b4d..577686d 100644
--- a/tablib/packages/yaml/error.py
+++ b/tablib/packages/yaml/error.py
@@ -1,7 +1,7 @@
__all__ = ['Mark', 'YAMLError', 'MarkedYAMLError']
-class Mark:
+class Mark(object):
def __init__(self, name, index, line, column, buffer, pointer):
self.name = name
@@ -16,7 +16,7 @@ class Mark:
return None
head = ''
start = self.pointer
- while start > 0 and self.buffer[start-1] not in '\0\r\n\x85\u2028\u2029':
+ while start > 0 and self.buffer[start-1] not in u'\0\r\n\x85\u2028\u2029':
start -= 1
if self.pointer-start > max_length/2-1:
head = ' ... '
@@ -24,13 +24,13 @@ class Mark:
break
tail = ''
end = self.pointer
- while end < len(self.buffer) and self.buffer[end] not in '\0\r\n\x85\u2028\u2029':
+ while end < len(self.buffer) and self.buffer[end] not in u'\0\r\n\x85\u2028\u2029':
end += 1
if end-self.pointer > max_length/2-1:
tail = ' ... '
end -= 5
break
- snippet = self.buffer[start:end]
+ snippet = self.buffer[start:end].encode('utf-8')
return ' '*indent + head + snippet + tail + '\n' \
+ ' '*(indent+self.pointer-start+len(head)) + '^'
diff --git a/tablib/packages/yaml/loader.py b/tablib/packages/yaml/loader.py
index 08c8f01..293ff46 100644
--- a/tablib/packages/yaml/loader.py
+++ b/tablib/packages/yaml/loader.py
@@ -1,12 +1,12 @@
__all__ = ['BaseLoader', 'SafeLoader', 'Loader']
-from .reader import *
-from .scanner import *
-from .parser import *
-from .composer import *
-from .constructor import *
-from .resolver import *
+from reader import *
+from scanner import *
+from parser import *
+from composer import *
+from constructor import *
+from resolver import *
class BaseLoader(Reader, Scanner, Parser, Composer, BaseConstructor, BaseResolver):
diff --git a/tablib/packages/yaml/parser.py b/tablib/packages/yaml/parser.py
index c147dd6..b6a7416 100644
--- a/tablib/packages/yaml/parser.py
+++ b/tablib/packages/yaml/parser.py
@@ -61,21 +61,21 @@
__all__ = ['Parser', 'ParserError']
-from .error import MarkedYAMLError
-from .tokens import *
-from .events import *
-from .scanner import *
+from error import MarkedYAMLError
+from tokens import *
+from events import *
+from scanner import *
class ParserError(MarkedYAMLError):
pass
-class Parser:
+class Parser(object):
# Since writing a recursive-descendant parser is a straightforward task, we
# do not give many comments here.
DEFAULT_TAGS = {
- '!': '!',
- '!!': 'tag:yaml.org,2002:',
+ u'!': u'!',
+ u'!!': u'tag:yaml.org,2002:',
}
def __init__(self):
@@ -214,7 +214,7 @@ class Parser:
self.tag_handles = {}
while self.check_token(DirectiveToken):
token = self.get_token()
- if token.name == 'YAML':
+ if token.name == u'YAML':
if self.yaml_version is not None:
raise ParserError(None, None,
"found duplicate YAML directive", token.start_mark)
@@ -224,11 +224,11 @@ class Parser:
"found incompatible YAML document (version 1.* is required)",
token.start_mark)
self.yaml_version = token.value
- elif token.name == 'TAG':
+ elif token.name == u'TAG':
handle, prefix = token.value
if handle in self.tag_handles:
raise ParserError(None, None,
- "duplicate tag handle %r" % handle,
+ "duplicate tag handle %r" % handle.encode('utf-8'),
token.start_mark)
self.tag_handles[handle] = prefix
if self.tag_handles:
@@ -298,19 +298,19 @@ class Parser:
if handle is not None:
if handle not in self.tag_handles:
raise ParserError("while parsing a node", start_mark,
- "found undefined tag handle %r" % handle,
+ "found undefined tag handle %r" % handle.encode('utf-8'),
tag_mark)
tag = self.tag_handles[handle]+suffix
else:
tag = suffix
- #if tag == '!':
+ #if tag == u'!':
# raise ParserError("while parsing a node", start_mark,
# "found non-specific tag '!'", tag_mark,
# "Please check 'http://pyyaml.org/wiki/YAMLNonSpecificTag' and share your opinion.")
if start_mark is None:
start_mark = end_mark = self.peek_token().start_mark
event = None
- implicit = (tag is None or tag == '!')
+ implicit = (tag is None or tag == u'!')
if indentless_sequence and self.check_token(BlockEntryToken):
end_mark = self.peek_token().end_mark
event = SequenceStartEvent(anchor, tag, implicit,
@@ -320,7 +320,7 @@ class Parser:
if self.check_token(ScalarToken):
token = self.get_token()
end_mark = token.end_mark
- if (token.plain and tag is None) or tag == '!':
+ if (token.plain and tag is None) or tag == u'!':
implicit = (True, False)
elif tag is None:
implicit = (False, True)
@@ -352,7 +352,7 @@ class Parser:
elif anchor is not None or tag is not None:
# Empty scalars are allowed even if a tag or an anchor is
# specified.
- event = ScalarEvent(anchor, tag, (implicit, False), '',
+ event = ScalarEvent(anchor, tag, (implicit, False), u'',
start_mark, end_mark)
self.state = self.states.pop()
else:
@@ -580,5 +580,5 @@ class Parser:
return self.process_empty_scalar(self.peek_token().start_mark)
def process_empty_scalar(self, mark):
- return ScalarEvent(None, None, (True, False), '', mark, mark)
+ return ScalarEvent(None, None, (True, False), u'', mark, mark)
diff --git a/tablib/packages/yaml/reader.py b/tablib/packages/yaml/reader.py
index f70e920..1e7a4db 100644
--- a/tablib/packages/yaml/reader.py
+++ b/tablib/packages/yaml/reader.py
@@ -17,10 +17,45 @@
__all__ = ['Reader', 'ReaderError']
-from .error import YAMLError, Mark
+from error import YAMLError, Mark
import codecs, re
+# Unfortunately, codec functions in Python 2.3 does not support the `finish`
+# arguments, so we have to write our own wrappers.
+
+try:
+ codecs.utf_8_decode('', 'strict', False)
+ from codecs import utf_8_decode, utf_16_le_decode, utf_16_be_decode
+
+except TypeError:
+
+ def utf_16_le_decode(data, errors, finish=False):
+ if not finish and len(data) % 2 == 1:
+ data = data[:-1]
+ return codecs.utf_16_le_decode(data, errors)
+
+ def utf_16_be_decode(data, errors, finish=False):
+ if not finish and len(data) % 2 == 1:
+ data = data[:-1]
+ return codecs.utf_16_be_decode(data, errors)
+
+ def utf_8_decode(data, errors, finish=False):
+ if not finish:
+ # We are trying to remove a possible incomplete multibyte character
+ # from the suffix of the data.
+ # The first byte of a multi-byte sequence is in the range 0xc0 to 0xfd.
+ # All further bytes are in the range 0x80 to 0xbf.
+ # UTF-8 encoded UCS characters may be up to six bytes long.
+ count = 0
+ while count < 5 and count < len(data) \
+ and '\x80' <= data[-count-1] <= '\xBF':
+ count -= 1
+ if count < 5 and count < len(data) \
+ and '\xC0' <= data[-count-1] <= '\xFD':
+ data = data[:-count-1]
+ return codecs.utf_8_decode(data, errors)
+
class ReaderError(YAMLError):
def __init__(self, name, position, character, encoding, reason):
@@ -31,7 +66,7 @@ class ReaderError(YAMLError):
self.reason = reason
def __str__(self):
- if isinstance(self.character, bytes):
+ if isinstance(self.character, str):
return "'%s' codec can't decode byte #x%02x: %s\n" \
" in \"%s\", position %d" \
% (self.encoding, ord(self.character), self.reason,
@@ -44,13 +79,13 @@ class ReaderError(YAMLError):
class Reader(object):
# Reader:
- # - determines the data encoding and converts it to a unicode string,
+ # - determines the data encoding and converts it to unicode,
# - checks if characters are in allowed range,
# - adds '\0' to the end.
# Reader accepts
- # - a `bytes` object,
# - a `str` object,
+ # - a `unicode` object,
# - a file-like object with its `read` method returning `str`,
# - a file-like object with its `read` method returning `unicode`.
@@ -61,7 +96,7 @@ class Reader(object):
self.stream = None
self.stream_pointer = 0
self.eof = True
- self.buffer = ''
+ self.buffer = u''
self.pointer = 0
self.raw_buffer = None
self.raw_decode = None
@@ -69,19 +104,19 @@ class Reader(object):
self.index = 0
self.line = 0
self.column = 0
- if isinstance(stream, str):
+ if isinstance(stream, unicode):
self.name = "<unicode string>"
self.check_printable(stream)
- self.buffer = stream+'\0'
- elif isinstance(stream, bytes):
- self.name = "<byte string>"
+ self.buffer = stream+u'\0'
+ elif isinstance(stream, str):
+ self.name = "<string>"
self.raw_buffer = stream
self.determine_encoding()
else:
self.stream = stream
self.name = getattr(stream, 'name', "<file>")
self.eof = False
- self.raw_buffer = None
+ self.raw_buffer = ''
self.determine_encoding()
def peek(self, index=0):
@@ -103,11 +138,11 @@ class Reader(object):
ch = self.buffer[self.pointer]
self.pointer += 1
self.index += 1
- if ch in '\n\x85\u2028\u2029' \
- or (ch == '\r' and self.buffer[self.pointer] != '\n'):
+ if ch in u'\n\x85\u2028\u2029' \
+ or (ch == u'\r' and self.buffer[self.pointer] != u'\n'):
self.line += 1
self.column = 0
- elif ch != '\uFEFF':
+ elif ch != u'\uFEFF':
self.column += 1
length -= 1
@@ -120,21 +155,21 @@ class Reader(object):
None, None)
def determine_encoding(self):
- while not self.eof and (self.raw_buffer is None or len(self.raw_buffer) < 2):
+ while not self.eof and len(self.raw_buffer) < 2:
self.update_raw()
- if isinstance(self.raw_buffer, bytes):
+ if not isinstance(self.raw_buffer, unicode):
if self.raw_buffer.startswith(codecs.BOM_UTF16_LE):
- self.raw_decode = codecs.utf_16_le_decode
+ self.raw_decode = utf_16_le_decode
self.encoding = 'utf-16-le'
elif self.raw_buffer.startswith(codecs.BOM_UTF16_BE):
- self.raw_decode = codecs.utf_16_be_decode
+ self.raw_decode = utf_16_be_decode
self.encoding = 'utf-16-be'
else:
- self.raw_decode = codecs.utf_8_decode
+ self.raw_decode = utf_8_decode
self.encoding = 'utf-8'
self.update(1)
- NON_PRINTABLE = re.compile('[^\x09\x0A\x0D\x20-\x7E\x85\xA0-\uD7FF\uE000-\uFFFD]')
+ NON_PRINTABLE = re.compile(u'[^\x09\x0A\x0D\x20-\x7E\x85\xA0-\uD7FF\uE000-\uFFFD]')
def check_printable(self, data):
match = self.NON_PRINTABLE.search(data)
if match:
@@ -155,8 +190,8 @@ class Reader(object):
try:
data, converted = self.raw_decode(self.raw_buffer,
'strict', self.eof)
- except UnicodeDecodeError as exc:
- character = self.raw_buffer[exc.start]
+ except UnicodeDecodeError, exc:
+ character = exc.object[exc.start]
if self.stream is not None:
position = self.stream_pointer-len(self.raw_buffer)+exc.start
else:
@@ -170,18 +205,16 @@ class Reader(object):
self.buffer += data
self.raw_buffer = self.raw_buffer[converted:]
if self.eof:
- self.buffer += '\0'
+ self.buffer += u'\0'
self.raw_buffer = None
break
- def update_raw(self, size=4096):
+ def update_raw(self, size=1024):
data = self.stream.read(size)
- if self.raw_buffer is None:
- self.raw_buffer = data
- else:
+ if data:
self.raw_buffer += data
- self.stream_pointer += len(data)
- if not data:
+ self.stream_pointer += len(data)
+ else:
self.eof = True
#try:
diff --git a/tablib/packages/yaml/representer.py b/tablib/packages/yaml/representer.py
index 67cd6fd..f5606ec 100644
--- a/tablib/packages/yaml/representer.py
+++ b/tablib/packages/yaml/representer.py
@@ -2,15 +2,22 @@
__all__ = ['BaseRepresenter', 'SafeRepresenter', 'Representer',
'RepresenterError']
-from .error import *
-from .nodes import *
+from error import *
+from nodes import *
-import datetime, sys, copyreg, types, base64
+import datetime
+
+try:
+ set
+except NameError:
+ from sets import Set as set
+
+import sys, copy_reg, types
class RepresenterError(YAMLError):
pass
-class BaseRepresenter:
+class BaseRepresenter(object):
yaml_representers = {}
yaml_multi_representers = {}
@@ -29,6 +36,12 @@ class BaseRepresenter:
self.object_keeper = []
self.alias_key = None
+ def get_classobj_bases(self, cls):
+ bases = [cls]
+ for base in cls.__bases__:
+ bases.extend(self.get_classobj_bases(base))
+ return bases
+
def represent_data(self, data):
if self.ignore_aliases(data):
self.alias_key = None
@@ -43,6 +56,8 @@ class BaseRepresenter:
#self.represented_objects[alias_key] = None
self.object_keeper.append(data)
data_types = type(data).__mro__
+ if type(data) is types.InstanceType:
+ data_types = self.get_classobj_bases(data.__class__)+list(data_types)
if data_types[0] in self.yaml_representers:
node = self.yaml_representers[data_types[0]](self, data)
else:
@@ -56,22 +71,22 @@ class BaseRepresenter:
elif None in self.yaml_representers:
node = self.yaml_representers[None](self, data)
else:
- node = ScalarNode(None, str(data))
+ node = ScalarNode(None, unicode(data))
#if alias_key is not None:
# self.represented_objects[alias_key] = node
return node
- @classmethod
def add_representer(cls, data_type, representer):
if not 'yaml_representers' in cls.__dict__:
cls.yaml_representers = cls.yaml_representers.copy()
cls.yaml_representers[data_type] = representer
+ add_representer = classmethod(add_representer)
- @classmethod
def add_multi_representer(cls, data_type, representer):
if not 'yaml_multi_representers' in cls.__dict__:
cls.yaml_multi_representers = cls.yaml_multi_representers.copy()
cls.yaml_multi_representers[data_type] = representer
+ add_multi_representer = classmethod(add_multi_representer)
def represent_scalar(self, tag, value, style=None):
if style is None:
@@ -106,11 +121,8 @@ class BaseRepresenter:
self.represented_objects[self.alias_key] = node
best_style = True
if hasattr(mapping, 'items'):
- mapping = list(mapping.items())
- try:
- mapping = sorted(mapping)
- except TypeError:
- pass
+ mapping = mapping.items()
+ mapping.sort()
for item_key, item_value in mapping:
node_key = self.represent_data(item_key)
node_value = self.represent_data(item_value)
@@ -134,31 +146,44 @@ class SafeRepresenter(BaseRepresenter):
def ignore_aliases(self, data):
if data in [None, ()]:
return True
- if isinstance(data, (str, bytes, bool, int, float)):
+ if isinstance(data, (str, unicode, bool, int, float)):
return True
def represent_none(self, data):
- return self.represent_scalar('tag:yaml.org,2002:null', 'null')
+ return self.represent_scalar(u'tag:yaml.org,2002:null',
+ u'null')
def represent_str(self, data):
- return self.represent_scalar('tag:yaml.org,2002:str', data)
+ tag = None
+ style = None
+ try:
+ data = unicode(data, 'ascii')
+ tag = u'tag:yaml.org,2002:str'
+ except UnicodeDecodeError:
+ try:
+ data = unicode(data, 'utf-8')
+ tag = u'tag:yaml.org,2002:str'
+ except UnicodeDecodeError:
+ data = data.encode('base64')
+ tag = u'tag:yaml.org,2002:binary'
+ style = '|'
+ return self.represent_scalar(tag, data, style=style)
- def represent_binary(self, data):
- if hasattr(base64, 'encodebytes'):
- data = base64.encodebytes(data).decode('ascii')
- else:
- data = base64.encodestring(data).decode('ascii')
- return self.represent_scalar('tag:yaml.org,2002:binary', data, style='|')
+ def represent_unicode(self, data):
+ return self.represent_scalar(u'tag:yaml.org,2002:str', data)
def represent_bool(self, data):
if data:
- value = 'true'
+ value = u'true'
else:
- value = 'false'
- return self.represent_scalar('tag:yaml.org,2002:bool', value)
+ value = u'false'
+ return self.represent_scalar(u'tag:yaml.org,2002:bool', value)
def represent_int(self, data):
- return self.represent_scalar('tag:yaml.org,2002:int', str(data))
+ return self.represent_scalar(u'tag:yaml.org,2002:int', unicode(data))
+
+ def represent_long(self, data):
+ return self.represent_scalar(u'tag:yaml.org,2002:int', unicode(data))
inf_value = 1e300
while repr(inf_value) != repr(inf_value*inf_value):
@@ -166,13 +191,13 @@ class SafeRepresenter(BaseRepresenter):
def represent_float(self, data):
if data != data or (data == 0.0 and data == 1.0):
- value = '.nan'
+ value = u'.nan'
elif data == self.inf_value:
- value = '.inf'
+ value = u'.inf'
elif data == -self.inf_value:
- value = '-.inf'
+ value = u'-.inf'
else:
- value = repr(data).lower()
+ value = unicode(repr(data)).lower()
# Note that in some cases `repr(data)` represents a float number
# without the decimal parts. For instance:
# >>> repr(1e17)
@@ -180,9 +205,9 @@ class SafeRepresenter(BaseRepresenter):
# Unfortunately, this is not a valid float representation according
# to the definition of the `!!float` tag. We fix this by adding
# '.0' before the 'e' symbol.
- if '.' not in value and 'e' in value:
- value = value.replace('e', '.0e', 1)
- return self.represent_scalar('tag:yaml.org,2002:float', value)
+ if u'.' not in value and u'e' in value:
+ value = value.replace(u'e', u'.0e', 1)
+ return self.represent_scalar(u'tag:yaml.org,2002:float', value)
def represent_list(self, data):
#pairs = (len(data) > 0 and isinstance(data, list))
@@ -192,7 +217,7 @@ class SafeRepresenter(BaseRepresenter):
# pairs = False
# break
#if not pairs:
- return self.represent_sequence('tag:yaml.org,2002:seq', data)
+ return self.represent_sequence(u'tag:yaml.org,2002:seq', data)
#value = []
#for item_key, item_value in data:
# value.append(self.represent_mapping(u'tag:yaml.org,2002:map',
@@ -200,21 +225,21 @@ class SafeRepresenter(BaseRepresenter):
#return SequenceNode(u'tag:yaml.org,2002:pairs', value)
def represent_dict(self, data):
- return self.represent_mapping('tag:yaml.org,2002:map', data)
+ return self.represent_mapping(u'tag:yaml.org,2002:map', data)
def represent_set(self, data):
value = {}
for key in data:
value[key] = None
- return self.represent_mapping('tag:yaml.org,2002:set', value)
+ return self.represent_mapping(u'tag:yaml.org,2002:set', value)
def represent_date(self, data):
- value = data.isoformat()
- return self.represent_scalar('tag:yaml.org,2002:timestamp', value)
+ value = unicode(data.isoformat())
+ return self.represent_scalar(u'tag:yaml.org,2002:timestamp', value)
def represent_datetime(self, data):
- value = data.isoformat(' ')
- return self.represent_scalar('tag:yaml.org,2002:timestamp', value)
+ value = unicode(data.isoformat(' '))
+ return self.represent_scalar(u'tag:yaml.org,2002:timestamp', value)
def represent_yaml_object(self, tag, data, cls, flow_style=None):
if hasattr(data, '__getstate__'):
@@ -232,8 +257,8 @@ SafeRepresenter.add_representer(type(None),
SafeRepresenter.add_representer(str,
SafeRepresenter.represent_str)
-SafeRepresenter.add_representer(bytes,
- SafeRepresenter.represent_binary)
+SafeRepresenter.add_representer(unicode,
+ SafeRepresenter.represent_unicode)
SafeRepresenter.add_representer(bool,
SafeRepresenter.represent_bool)
@@ -241,6 +266,9 @@ SafeRepresenter.add_representer(bool,
SafeRepresenter.add_representer(int,
SafeRepresenter.represent_int)
+SafeRepresenter.add_representer(long,
+ SafeRepresenter.represent_long)
+
SafeRepresenter.add_representer(float,
SafeRepresenter.represent_float)
@@ -267,27 +295,99 @@ SafeRepresenter.add_representer(None,
class Representer(SafeRepresenter):
+ def represent_str(self, data):
+ tag = None
+ style = None
+ try:
+ data = unicode(data, 'ascii')
+ tag = u'tag:yaml.org,2002:str'
+ except UnicodeDecodeError:
+ try:
+ data = unicode(data, 'utf-8')
+ tag = u'tag:yaml.org,2002:python/str'
+ except UnicodeDecodeError:
+ data = data.encode('base64')
+ tag = u'tag:yaml.org,2002:binary'
+ style = '|'
+ return self.represent_scalar(tag, data, style=style)
+
+ def represent_unicode(self, data):
+ tag = None
+ try:
+ data.encode('ascii')
+ tag = u'tag:yaml.org,2002:python/unicode'
+ except UnicodeEncodeError:
+ tag = u'tag:yaml.org,2002:str'
+ return self.represent_scalar(tag, data)
+
+ def represent_long(self, data):
+ tag = u'tag:yaml.org,2002:int'
+ if int(data) is not data:
+ tag = u'tag:yaml.org,2002:python/long'
+ return self.represent_scalar(tag, unicode(data))
+
def represent_complex(self, data):
if data.imag == 0.0:
- data = '%r' % data.real
+ data = u'%r' % data.real
elif data.real == 0.0:
- data = '%rj' % data.imag
+ data = u'%rj' % data.imag
elif data.imag > 0:
- data = '%r+%rj' % (data.real, data.imag)
+ data = u'%r+%rj' % (data.real, data.imag)
else:
- data = '%r%rj' % (data.real, data.imag)
- return self.represent_scalar('tag:yaml.org,2002:python/complex', data)
+ data = u'%r%rj' % (data.real, data.imag)
+ return self.represent_scalar(u'tag:yaml.org,2002:python/complex', data)
def represent_tuple(self, data):
- return self.represent_sequence('tag:yaml.org,2002:python/tuple', data)
+ return self.represent_sequence(u'tag:yaml.org,2002:python/tuple', data)
def represent_name(self, data):
- name = '%s.%s' % (data.__module__, data.__name__)
- return self.represent_scalar('tag:yaml.org,2002:python/name:'+name, '')
+ name = u'%s.%s' % (data.__module__, data.__name__)
+ return self.represent_scalar(u'tag:yaml.org,2002:python/name:'+name, u'')
def represent_module(self, data):
return self.represent_scalar(
- 'tag:yaml.org,2002:python/module:'+data.__name__, '')
+ u'tag:yaml.org,2002:python/module:'+data.__name__, u'')
+
+ def represent_instance(self, data):
+ # For instances of classic classes, we use __getinitargs__ and
+ # __getstate__ to serialize the data.
+
+ # If data.__getinitargs__ exists, the object must be reconstructed by
+ # calling cls(**args), where args is a tuple returned by
+ # __getinitargs__. Otherwise, the cls.__init__ method should never be
+ # called and the class instance is created by instantiating a trivial
+ # class and assigning to the instance's __class__ variable.
+
+ # If data.__getstate__ exists, it returns the state of the object.
+ # Otherwise, the state of the object is data.__dict__.
+
+ # We produce either a !!python/object or !!python/object/new node.
+ # If data.__getinitargs__ does not exist and state is a dictionary, we
+ # produce a !!python/object node . Otherwise we produce a
+ # !!python/object/new node.
+
+ cls = data.__class__
+ class_name = u'%s.%s' % (cls.__module__, cls.__name__)
+ args = None
+ state = None
+ if hasattr(data, '__getinitargs__'):
+ args = list(data.__getinitargs__())
+ if hasattr(data, '__getstate__'):
+ state = data.__getstate__()
+ else:
+ state = data.__dict__
+ if args is None and isinstance(state, dict):
+ return self.represent_mapping(
+ u'tag:yaml.org,2002:python/object:'+class_name, state)
+ if isinstance(state, dict) and not state:
+ return self.represent_sequence(
+ u'tag:yaml.org,2002:python/object/new:'+class_name, args)
+ value = {}
+ if args:
+ value['args'] = args
+ value['state'] = state
+ return self.represent_mapping(
+ u'tag:yaml.org,2002:python/object/new:'+class_name, value)
def represent_object(self, data):
# We use __reduce__ API to save the data. data.__reduce__ returns
@@ -307,8 +407,8 @@ class Representer(SafeRepresenter):
# !!python/object/apply node.
cls = type(data)
- if cls in copyreg.dispatch_table:
- reduce = copyreg.dispatch_table[cls](data)
+ if cls in copy_reg.dispatch_table:
+ reduce = copy_reg.dispatch_table[cls](data)
elif hasattr(data, '__reduce_ex__'):
reduce = data.__reduce_ex__(2)
elif hasattr(data, '__reduce__'):
@@ -327,16 +427,16 @@ class Representer(SafeRepresenter):
if function.__name__ == '__newobj__':
function = args[0]
args = args[1:]
- tag = 'tag:yaml.org,2002:python/object/new:'
+ tag = u'tag:yaml.org,2002:python/object/new:'
newobj = True
else:
- tag = 'tag:yaml.org,2002:python/object/apply:'
+ tag = u'tag:yaml.org,2002:python/object/apply:'
newobj = False
- function_name = '%s.%s' % (function.__module__, function.__name__)
+ function_name = u'%s.%s' % (function.__module__, function.__name__)
if not args and not listitems and not dictitems \
and isinstance(state, dict) and newobj:
return self.represent_mapping(
- 'tag:yaml.org,2002:python/object:'+function_name, state)
+ u'tag:yaml.org,2002:python/object:'+function_name, state)
if not listitems and not dictitems \
and isinstance(state, dict) and not state:
return self.represent_sequence(tag+function_name, args)
@@ -351,6 +451,15 @@ class Representer(SafeRepresenter):
value['dictitems'] = dictitems
return self.represent_mapping(tag+function_name, value)
+Representer.add_representer(str,
+ Representer.represent_str)
+
+Representer.add_representer(unicode,
+ Representer.represent_unicode)
+
+Representer.add_representer(long,
+ Representer.represent_long)
+
Representer.add_representer(complex,
Representer.represent_complex)
@@ -360,6 +469,9 @@ Representer.add_representer(tuple,
Representer.add_representer(type,
Representer.represent_name)
+Representer.add_representer(types.ClassType,
+ Representer.represent_name)
+
Representer.add_representer(types.FunctionType,
Representer.represent_name)
@@ -369,6 +481,9 @@ Representer.add_representer(types.BuiltinFunctionType,
Representer.add_representer(types.ModuleType,
Representer.represent_module)
+Representer.add_multi_representer(types.InstanceType,
+ Representer.represent_instance)
+
Representer.add_multi_representer(object,
Representer.represent_object)
diff --git a/tablib/packages/yaml/resolver.py b/tablib/packages/yaml/resolver.py
index 0eece25..6b5ab87 100644
--- a/tablib/packages/yaml/resolver.py
+++ b/tablib/packages/yaml/resolver.py
@@ -1,19 +1,19 @@
__all__ = ['BaseResolver', 'Resolver']
-from .error import *
-from .nodes import *
+from error import *
+from nodes import *
import re
class ResolverError(YAMLError):
pass
-class BaseResolver:
+class BaseResolver(object):
- DEFAULT_SCALAR_TAG = 'tag:yaml.org,2002:str'
- DEFAULT_SEQUENCE_TAG = 'tag:yaml.org,2002:seq'
- DEFAULT_MAPPING_TAG = 'tag:yaml.org,2002:map'
+ DEFAULT_SCALAR_TAG = u'tag:yaml.org,2002:str'
+ DEFAULT_SEQUENCE_TAG = u'tag:yaml.org,2002:seq'
+ DEFAULT_MAPPING_TAG = u'tag:yaml.org,2002:map'
yaml_implicit_resolvers = {}
yaml_path_resolvers = {}
@@ -22,7 +22,6 @@ class BaseResolver:
self.resolver_exact_paths = []
self.resolver_prefix_paths = []
- @classmethod
def add_implicit_resolver(cls, tag, regexp, first):
if not 'yaml_implicit_resolvers' in cls.__dict__:
cls.yaml_implicit_resolvers = cls.yaml_implicit_resolvers.copy()
@@ -30,8 +29,8 @@ class BaseResolver:
first = [None]
for ch in first:
cls.yaml_implicit_resolvers.setdefault(ch, []).append((tag, regexp))
+ add_implicit_resolver = classmethod(add_implicit_resolver)
- @classmethod
def add_path_resolver(cls, tag, path, kind=None):
# Note: `add_path_resolver` is experimental. The API could be changed.
# `new_path` is a pattern that is matched against the path from the
@@ -67,10 +66,10 @@ class BaseResolver:
elif node_check is dict:
node_check = MappingNode
elif node_check not in [ScalarNode, SequenceNode, MappingNode] \
- and not isinstance(node_check, str) \
+ and not isinstance(node_check, basestring) \
and node_check is not None:
raise ResolverError("Invalid node checker: %s" % node_check)
- if not isinstance(index_check, (str, int)) \
+ if not isinstance(index_check, (basestring, int)) \
and index_check is not None:
raise ResolverError("Invalid index checker: %s" % index_check)
new_path.append((node_check, index_check))
@@ -84,6 +83,7 @@ class BaseResolver:
and kind is not None:
raise ResolverError("Invalid node kind: %s" % kind)
cls.yaml_path_resolvers[tuple(new_path), kind] = tag
+ add_path_resolver = classmethod(add_path_resolver)
def descend_resolver(self, current_node, current_index):
if not self.yaml_path_resolvers:
@@ -117,7 +117,7 @@ class BaseResolver:
def check_resolver_prefix(self, depth, path, kind,
current_node, current_index):
node_check, index_check = path[depth-1]
- if isinstance(node_check, str):
+ if isinstance(node_check, basestring):
if current_node.tag != node_check:
return
elif node_check is not None:
@@ -128,7 +128,7 @@ class BaseResolver:
if (index_check is False or index_check is None) \
and current_index is None:
return
- if isinstance(index_check, str):
+ if isinstance(index_check, basestring):
if not (isinstance(current_index, ScalarNode)
and index_check == current_index.value):
return
@@ -139,8 +139,8 @@ class BaseResolver:
def resolve(self, kind, value, implicit):
if kind is ScalarNode and implicit[0]:
- if value == '':
- resolvers = self.yaml_implicit_resolvers.get('', [])
+ if value == u'':
+ resolvers = self.yaml_implicit_resolvers.get(u'', [])
else:
resolvers = self.yaml_implicit_resolvers.get(value[0], [])
resolvers += self.yaml_implicit_resolvers.get(None, [])
@@ -165,60 +165,60 @@ class Resolver(BaseResolver):
pass
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:bool',
- re.compile(r'''^(?:yes|Yes|YES|no|No|NO
+ u'tag:yaml.org,2002:bool',
+ re.compile(ur'''^(?:yes|Yes|YES|no|No|NO
|true|True|TRUE|false|False|FALSE
|on|On|ON|off|Off|OFF)$''', re.X),
- list('yYnNtTfFoO'))
+ list(u'yYnNtTfFoO'))
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:float',
- re.compile(r'''^(?:[-+]?(?:[0-9][0-9_]*)\.[0-9_]*(?:[eE][-+][0-9]+)?
+ u'tag:yaml.org,2002:float',
+ re.compile(ur'''^(?:[-+]?(?:[0-9][0-9_]*)\.[0-9_]*(?:[eE][-+][0-9]+)?
|\.[0-9_]+(?:[eE][-+][0-9]+)?
|[-+]?[0-9][0-9_]*(?::[0-5]?[0-9])+\.[0-9_]*
|[-+]?\.(?:inf|Inf|INF)
|\.(?:nan|NaN|NAN))$''', re.X),
- list('-+0123456789.'))
+ list(u'-+0123456789.'))
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:int',
- re.compile(r'''^(?:[-+]?0b[0-1_]+
+ u'tag:yaml.org,2002:int',
+ re.compile(ur'''^(?:[-+]?0b[0-1_]+
|[-+]?0[0-7_]+
|[-+]?(?:0|[1-9][0-9_]*)
|[-+]?0x[0-9a-fA-F_]+
|[-+]?[1-9][0-9_]*(?::[0-5]?[0-9])+)$''', re.X),
- list('-+0123456789'))
+ list(u'-+0123456789'))
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:merge',
- re.compile(r'^(?:<<)$'),
- ['<'])
+ u'tag:yaml.org,2002:merge',
+ re.compile(ur'^(?:<<)$'),
+ [u'<'])
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:null',
- re.compile(r'''^(?: ~
+ u'tag:yaml.org,2002:null',
+ re.compile(ur'''^(?: ~
|null|Null|NULL
| )$''', re.X),
- ['~', 'n', 'N', ''])
+ [u'~', u'n', u'N', u''])
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:timestamp',
- re.compile(r'''^(?:[0-9][0-9][0-9][0-9]-[0-9][0-9]-[0-9][0-9]
+ u'tag:yaml.org,2002:timestamp',
+ re.compile(ur'''^(?:[0-9][0-9][0-9][0-9]-[0-9][0-9]-[0-9][0-9]
|[0-9][0-9][0-9][0-9] -[0-9][0-9]? -[0-9][0-9]?
(?:[Tt]|[ \t]+)[0-9][0-9]?
:[0-9][0-9] :[0-9][0-9] (?:\.[0-9]*)?
(?:[ \t]*(?:Z|[-+][0-9][0-9]?(?::[0-9][0-9])?))?)$''', re.X),
- list('0123456789'))
+ list(u'0123456789'))
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:value',
- re.compile(r'^(?:=)$'),
- ['='])
+ u'tag:yaml.org,2002:value',
+ re.compile(ur'^(?:=)$'),
+ [u'='])
# The following resolver is only for documentation purposes. It cannot work
# because plain scalars cannot start with '!', '&', or '*'.
Resolver.add_implicit_resolver(
- 'tag:yaml.org,2002:yaml',
- re.compile(r'^(?:!|&|\*)$'),
- list('!&*'))
+ u'tag:yaml.org,2002:yaml',
+ re.compile(ur'^(?:!|&|\*)$'),
+ list(u'!&*'))
diff --git a/tablib/packages/yaml/scanner.py b/tablib/packages/yaml/scanner.py
index 494d975..5228fad 100644
--- a/tablib/packages/yaml/scanner.py
+++ b/tablib/packages/yaml/scanner.py
@@ -26,13 +26,13 @@
__all__ = ['Scanner', 'ScannerError']
-from .error import MarkedYAMLError
-from .tokens import *
+from error import MarkedYAMLError
+from tokens import *
class ScannerError(MarkedYAMLError):
pass
-class SimpleKey:
+class SimpleKey(object):
# See below simple keys treatment.
def __init__(self, token_number, required, index, line, column, mark):
@@ -43,7 +43,7 @@ class SimpleKey:
self.column = column
self.mark = mark
-class Scanner:
+class Scanner(object):
def __init__(self):
"""Initialize the scanner."""
@@ -166,85 +166,85 @@ class Scanner:
ch = self.peek()
# Is it the end of stream?
- if ch == '\0':
+ if ch == u'\0':
return self.fetch_stream_end()
# Is it a directive?
- if ch == '%' and self.check_directive():
+ if ch == u'%' and self.check_directive():
return self.fetch_directive()
# Is it the document start?
- if ch == '-' and self.check_document_start():
+ if ch == u'-' and self.check_document_start():
return self.fetch_document_start()
# Is it the document end?
- if ch == '.' and self.check_document_end():
+ if ch == u'.' and self.check_document_end():
return self.fetch_document_end()
# TODO: support for BOM within a stream.
- #if ch == '\uFEFF':
+ #if ch == u'\uFEFF':
# return self.fetch_bom() <-- issue BOMToken
# Note: the order of the following checks is NOT significant.
# Is it the flow sequence start indicator?
- if ch == '[':
+ if ch == u'[':
return self.fetch_flow_sequence_start()
# Is it the flow mapping start indicator?
- if ch == '{':
+ if ch == u'{':
return self.fetch_flow_mapping_start()
# Is it the flow sequence end indicator?
- if ch == ']':
+ if ch == u']':
return self.fetch_flow_sequence_end()
# Is it the flow mapping end indicator?
- if ch == '}':
+ if ch == u'}':
return self.fetch_flow_mapping_end()
# Is it the flow entry indicator?
- if ch == ',':
+ if ch == u',':
return self.fetch_flow_entry()
# Is it the block entry indicator?
- if ch == '-' and self.check_block_entry():
+ if ch == u'-' and self.check_block_entry():
return self.fetch_block_entry()
# Is it the key indicator?
- if ch == '?' and self.check_key():
+ if ch == u'?' and self.check_key():
return self.fetch_key()
# Is it the value indicator?
- if ch == ':' and self.check_value():
+ if ch == u':' and self.check_value():
return self.fetch_value()
# Is it an alias?
- if ch == '*':
+ if ch == u'*':
return self.fetch_alias()
# Is it an anchor?
- if ch == '&':
+ if ch == u'&':
return self.fetch_anchor()
# Is it a tag?
- if ch == '!':
+ if ch == u'!':
return self.fetch_tag()
# Is it a literal scalar?
- if ch == '|' and not self.flow_level:
+ if ch == u'|' and not self.flow_level:
return self.fetch_literal()
# Is it a folded scalar?
- if ch == '>' and not self.flow_level:
+ if ch == u'>' and not self.flow_level:
return self.fetch_folded()
# Is it a single quoted scalar?
- if ch == '\'':
+ if ch == u'\'':
return self.fetch_single()
# Is it a double quoted scalar?
- if ch == '\"':
+ if ch == u'\"':
return self.fetch_double()
# It must be a plain scalar then.
@@ -253,8 +253,8 @@ class Scanner:
# No? It's an error. Let's produce a nice error message.
raise ScannerError("while scanning for the next token", None,
- "found character %r that cannot start any token" % ch,
- self.get_mark())
+ "found character %r that cannot start any token"
+ % ch.encode('utf-8'), self.get_mark())
# Simple keys treatment.
@@ -280,7 +280,7 @@ class Scanner:
# - should be no longer than 1024 characters.
# Disabling this procedure will allow simple keys of any length and
# height (may cause problems if indentation is broken though).
- for level in list(self.possible_simple_keys):
+ for level in self.possible_simple_keys.keys():
key = self.possible_simple_keys[level]
if key.line != self.line \
or self.index-key.index > 1024:
@@ -692,22 +692,22 @@ class Scanner:
# DOCUMENT-START: ^ '---' (' '|'\n')
if self.column == 0:
- if self.prefix(3) == '---' \
- and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ if self.prefix(3) == u'---' \
+ and self.peek(3) in u'\0 \t\r\n\x85\u2028\u2029':
return True
def check_document_end(self):
# DOCUMENT-END: ^ '...' (' '|'\n')
if self.column == 0:
- if self.prefix(3) == '...' \
- and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ if self.prefix(3) == u'...' \
+ and self.peek(3) in u'\0 \t\r\n\x85\u2028\u2029':
return True
def check_block_entry(self):
# BLOCK-ENTRY: '-' (' '|'\n')
- return self.peek(1) in '\0 \t\r\n\x85\u2028\u2029'
+ return self.peek(1) in u'\0 \t\r\n\x85\u2028\u2029'
def check_key(self):
@@ -717,7 +717,7 @@ class Scanner:
# KEY(block context): '?' (' '|'\n')
else:
- return self.peek(1) in '\0 \t\r\n\x85\u2028\u2029'
+ return self.peek(1) in u'\0 \t\r\n\x85\u2028\u2029'
def check_value(self):
@@ -727,7 +727,7 @@ class Scanner:
# VALUE(block context): ':' (' '|'\n')
else:
- return self.peek(1) in '\0 \t\r\n\x85\u2028\u2029'
+ return self.peek(1) in u'\0 \t\r\n\x85\u2028\u2029'
def check_plain(self):
@@ -744,9 +744,9 @@ class Scanner:
# '-' character) because we want the flow context to be space
# independent.
ch = self.peek()
- return ch not in '\0 \t\r\n\x85\u2028\u2029-?:,[]{}#&*!|>\'\"%@`' \
- or (self.peek(1) not in '\0 \t\r\n\x85\u2028\u2029'
- and (ch == '-' or (not self.flow_level and ch in '?:')))
+ return ch not in u'\0 \t\r\n\x85\u2028\u2029-?:,[]{}#&*!|>\'\"%@`' \
+ or (self.peek(1) not in u'\0 \t\r\n\x85\u2028\u2029'
+ and (ch == u'-' or (not self.flow_level and ch in u'?:')))
# Scanners.
@@ -770,14 +770,14 @@ class Scanner:
# `unwind_indent` before issuing BLOCK-END.
# Scanners for block, flow, and plain scalars need to be modified.
- if self.index == 0 and self.peek() == '\uFEFF':
+ if self.index == 0 and self.peek() == u'\uFEFF':
self.forward()
found = False
while not found:
- while self.peek() == ' ':
+ while self.peek() == u' ':
self.forward()
- if self.peek() == '#':
- while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ if self.peek() == u'#':
+ while self.peek() not in u'\0\r\n\x85\u2028\u2029':
self.forward()
if self.scan_line_break():
if not self.flow_level:
@@ -791,15 +791,15 @@ class Scanner:
self.forward()
name = self.scan_directive_name(start_mark)
value = None
- if name == 'YAML':
+ if name == u'YAML':
value = self.scan_yaml_directive_value(start_mark)
end_mark = self.get_mark()
- elif name == 'TAG':
+ elif name == u'TAG':
value = self.scan_tag_directive_value(start_mark)
end_mark = self.get_mark()
else:
end_mark = self.get_mark()
- while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ while self.peek() not in u'\0\r\n\x85\u2028\u2029':
self.forward()
self.scan_directive_ignored_line(start_mark)
return DirectiveToken(name, value, start_mark, end_mark)
@@ -808,48 +808,51 @@ class Scanner:
# See the specification for details.
length = 0
ch = self.peek(length)
- while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-_':
+ while u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-_':
length += 1
ch = self.peek(length)
if not length:
raise ScannerError("while scanning a directive", start_mark,
"expected alphabetic or numeric character, but found %r"
- % ch, self.get_mark())
+ % ch.encode('utf-8'), self.get_mark())
value = self.prefix(length)
self.forward(length)
ch = self.peek()
- if ch not in '\0 \r\n\x85\u2028\u2029':
+ if ch not in u'\0 \r\n\x85\u2028\u2029':
raise ScannerError("while scanning a directive", start_mark,
"expected alphabetic or numeric character, but found %r"
- % ch, self.get_mark())
+ % ch.encode('utf-8'), self.get_mark())
return value
def scan_yaml_directive_value(self, start_mark):
# See the specification for details.
- while self.peek() == ' ':
+ while self.peek() == u' ':
self.forward()
major = self.scan_yaml_directive_number(start_mark)
if self.peek() != '.':
raise ScannerError("while scanning a directive", start_mark,
- "expected a digit or '.', but found %r" % self.peek(),
+ "expected a digit or '.', but found %r"
+ % self.peek().encode('utf-8'),
self.get_mark())
self.forward()
minor = self.scan_yaml_directive_number(start_mark)
- if self.peek() not in '\0 \r\n\x85\u2028\u2029':
+ if self.peek() not in u'\0 \r\n\x85\u2028\u2029':
raise ScannerError("while scanning a directive", start_mark,
- "expected a digit or ' ', but found %r" % self.peek(),
+ "expected a digit or ' ', but found %r"
+ % self.peek().encode('utf-8'),
self.get_mark())
return (major, minor)
def scan_yaml_directive_number(self, start_mark):
# See the specification for details.
ch = self.peek()
- if not ('0' <= ch <= '9'):
+ if not (u'0' <= ch <= u'9'):
raise ScannerError("while scanning a directive", start_mark,
- "expected a digit, but found %r" % ch, self.get_mark())
+ "expected a digit, but found %r" % ch.encode('utf-8'),
+ self.get_mark())
length = 0
- while '0' <= self.peek(length) <= '9':
+ while u'0' <= self.peek(length) <= u'9':
length += 1
value = int(self.prefix(length))
self.forward(length)
@@ -857,10 +860,10 @@ class Scanner:
def scan_tag_directive_value(self, start_mark):
# See the specification for details.
- while self.peek() == ' ':
+ while self.peek() == u' ':
self.forward()
handle = self.scan_tag_directive_handle(start_mark)
- while self.peek() == ' ':
+ while self.peek() == u' ':
self.forward()
prefix = self.scan_tag_directive_prefix(start_mark)
return (handle, prefix)
@@ -869,32 +872,34 @@ class Scanner:
# See the specification for details.
value = self.scan_tag_handle('directive', start_mark)
ch = self.peek()
- if ch != ' ':
+ if ch != u' ':
raise ScannerError("while scanning a directive", start_mark,
- "expected ' ', but found %r" % ch, self.get_mark())
+ "expected ' ', but found %r" % ch.encode('utf-8'),
+ self.get_mark())
return value
def scan_tag_directive_prefix(self, start_mark):
# See the specification for details.
value = self.scan_tag_uri('directive', start_mark)
ch = self.peek()
- if ch not in '\0 \r\n\x85\u2028\u2029':
+ if ch not in u'\0 \r\n\x85\u2028\u2029':
raise ScannerError("while scanning a directive", start_mark,
- "expected ' ', but found %r" % ch, self.get_mark())
+ "expected ' ', but found %r" % ch.encode('utf-8'),
+ self.get_mark())
return value
def scan_directive_ignored_line(self, start_mark):
# See the specification for details.
- while self.peek() == ' ':
+ while self.peek() == u' ':
self.forward()
- if self.peek() == '#':
- while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ if self.peek() == u'#':
+ while self.peek() not in u'\0\r\n\x85\u2028\u2029':
self.forward()
ch = self.peek()
- if ch not in '\0\r\n\x85\u2028\u2029':
+ if ch not in u'\0\r\n\x85\u2028\u2029':
raise ScannerError("while scanning a directive", start_mark,
"expected a comment or a line break, but found %r"
- % ch, self.get_mark())
+ % ch.encode('utf-8'), self.get_mark())
self.scan_line_break()
def scan_anchor(self, TokenClass):
@@ -908,28 +913,28 @@ class Scanner:
# Therefore we restrict aliases to numbers and ASCII letters.
start_mark = self.get_mark()
indicator = self.peek()
- if indicator == '*':
+ if indicator == u'*':
name = 'alias'
else:
name = 'anchor'
self.forward()
length = 0
ch = self.peek(length)
- while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-_':
+ while u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-_':
length += 1
ch = self.peek(length)
if not length:
raise ScannerError("while scanning an %s" % name, start_mark,
"expected alphabetic or numeric character, but found %r"
- % ch, self.get_mark())
+ % ch.encode('utf-8'), self.get_mark())
value = self.prefix(length)
self.forward(length)
ch = self.peek()
- if ch not in '\0 \t\r\n\x85\u2028\u2029?:,]}%@`':
+ if ch not in u'\0 \t\r\n\x85\u2028\u2029?:,]}%@`':
raise ScannerError("while scanning an %s" % name, start_mark,
"expected alphabetic or numeric character, but found %r"
- % ch, self.get_mark())
+ % ch.encode('utf-8'), self.get_mark())
end_mark = self.get_mark()
return TokenClass(value, start_mark, end_mark)
@@ -937,39 +942,40 @@ class Scanner:
# See the specification for details.
start_mark = self.get_mark()
ch = self.peek(1)
- if ch == '<':
+ if ch == u'<':
handle = None
self.forward(2)
suffix = self.scan_tag_uri('tag', start_mark)
- if self.peek() != '>':
+ if self.peek() != u'>':
raise ScannerError("while parsing a tag", start_mark,
- "expected '>', but found %r" % self.peek(),
+ "expected '>', but found %r" % self.peek().encode('utf-8'),
self.get_mark())
self.forward()
- elif ch in '\0 \t\r\n\x85\u2028\u2029':
+ elif ch in u'\0 \t\r\n\x85\u2028\u2029':
handle = None
- suffix = '!'
+ suffix = u'!'
self.forward()
else:
length = 1
use_handle = False
- while ch not in '\0 \r\n\x85\u2028\u2029':
- if ch == '!':
+ while ch not in u'\0 \r\n\x85\u2028\u2029':
+ if ch == u'!':
use_handle = True
break
length += 1
ch = self.peek(length)
- handle = '!'
+ handle = u'!'
if use_handle:
handle = self.scan_tag_handle('tag', start_mark)
else:
- handle = '!'
+ handle = u'!'
self.forward()
suffix = self.scan_tag_uri('tag', start_mark)
ch = self.peek()
- if ch not in '\0 \r\n\x85\u2028\u2029':
+ if ch not in u'\0 \r\n\x85\u2028\u2029':
raise ScannerError("while scanning a tag", start_mark,
- "expected ' ', but found %r" % ch, self.get_mark())
+ "expected ' ', but found %r" % ch.encode('utf-8'),
+ self.get_mark())
value = (handle, suffix)
end_mark = self.get_mark()
return TagToken(value, start_mark, end_mark)
@@ -1000,39 +1006,39 @@ class Scanner:
else:
indent = min_indent+increment-1
breaks, end_mark = self.scan_block_scalar_breaks(indent)
- line_break = ''
+ line_break = u''
# Scan the inner part of the block scalar.
- while self.column == indent and self.peek() != '\0':
+ while self.column == indent and self.peek() != u'\0':
chunks.extend(breaks)
- leading_non_space = self.peek() not in ' \t'
+ leading_non_space = self.peek() not in u' \t'
length = 0
- while self.peek(length) not in '\0\r\n\x85\u2028\u2029':
+ while self.peek(length) not in u'\0\r\n\x85\u2028\u2029':
length += 1
chunks.append(self.prefix(length))
self.forward(length)
line_break = self.scan_line_break()
breaks, end_mark = self.scan_block_scalar_breaks(indent)
- if self.column == indent and self.peek() != '\0':
+ if self.column == indent and self.peek() != u'\0':
# Unfortunately, folding rules are ambiguous.
#
# This is the folding according to the specification:
- if folded and line_break == '\n' \
- and leading_non_space and self.peek() not in ' \t':
+ if folded and line_break == u'\n' \
+ and leading_non_space and self.peek() not in u' \t':
if not breaks:
- chunks.append(' ')
+ chunks.append(u' ')
else:
chunks.append(line_break)
# This is Clark Evans's interpretation (also in the spec
# examples):
#
- #if folded and line_break == '\n':
+ #if folded and line_break == u'\n':
# if not breaks:
# if self.peek() not in ' \t':
- # chunks.append(' ')
+ # chunks.append(u' ')
# else:
# chunks.append(line_break)
#else:
@@ -1047,7 +1053,7 @@ class Scanner:
chunks.extend(breaks)
# We are done.
- return ScalarToken(''.join(chunks), False, start_mark, end_mark,
+ return ScalarToken(u''.join(chunks), False, start_mark, end_mark,
style)
def scan_block_scalar_indicators(self, start_mark):
@@ -1055,21 +1061,21 @@ class Scanner:
chomping = None
increment = None
ch = self.peek()
- if ch in '+-':
+ if ch in u'+-':
if ch == '+':
chomping = True
else:
chomping = False
self.forward()
ch = self.peek()
- if ch in '0123456789':
+ if ch in u'0123456789':
increment = int(ch)
if increment == 0:
raise ScannerError("while scanning a block scalar", start_mark,
"expected indentation indicator in the range 1-9, but found 0",
self.get_mark())
self.forward()
- elif ch in '0123456789':
+ elif ch in u'0123456789':
increment = int(ch)
if increment == 0:
raise ScannerError("while scanning a block scalar", start_mark,
@@ -1077,31 +1083,31 @@ class Scanner:
self.get_mark())
self.forward()
ch = self.peek()
- if ch in '+-':
+ if ch in u'+-':
if ch == '+':
chomping = True
else:
chomping = False
self.forward()
ch = self.peek()
- if ch not in '\0 \r\n\x85\u2028\u2029':
+ if ch not in u'\0 \r\n\x85\u2028\u2029':
raise ScannerError("while scanning a block scalar", start_mark,
"expected chomping or indentation indicators, but found %r"
- % ch, self.get_mark())
+ % ch.encode('utf-8'), self.get_mark())
return chomping, increment
def scan_block_scalar_ignored_line(self, start_mark):
# See the specification for details.
- while self.peek() == ' ':
+ while self.peek() == u' ':
self.forward()
- if self.peek() == '#':
- while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ if self.peek() == u'#':
+ while self.peek() not in u'\0\r\n\x85\u2028\u2029':
self.forward()
ch = self.peek()
- if ch not in '\0\r\n\x85\u2028\u2029':
+ if ch not in u'\0\r\n\x85\u2028\u2029':
raise ScannerError("while scanning a block scalar", start_mark,
- "expected a comment or a line break, but found %r" % ch,
- self.get_mark())
+ "expected a comment or a line break, but found %r"
+ % ch.encode('utf-8'), self.get_mark())
self.scan_line_break()
def scan_block_scalar_indentation(self):
@@ -1109,8 +1115,8 @@ class Scanner:
chunks = []
max_indent = 0
end_mark = self.get_mark()
- while self.peek() in ' \r\n\x85\u2028\u2029':
- if self.peek() != ' ':
+ while self.peek() in u' \r\n\x85\u2028\u2029':
+ if self.peek() != u' ':
chunks.append(self.scan_line_break())
end_mark = self.get_mark()
else:
@@ -1123,12 +1129,12 @@ class Scanner:
# See the specification for details.
chunks = []
end_mark = self.get_mark()
- while self.column < indent and self.peek() == ' ':
+ while self.column < indent and self.peek() == u' ':
self.forward()
- while self.peek() in '\r\n\x85\u2028\u2029':
+ while self.peek() in u'\r\n\x85\u2028\u2029':
chunks.append(self.scan_line_break())
end_mark = self.get_mark()
- while self.column < indent and self.peek() == ' ':
+ while self.column < indent and self.peek() == u' ':
self.forward()
return chunks, end_mark
@@ -1153,33 +1159,33 @@ class Scanner:
chunks.extend(self.scan_flow_scalar_non_spaces(double, start_mark))
self.forward()
end_mark = self.get_mark()
- return ScalarToken(''.join(chunks), False, start_mark, end_mark,
+ return ScalarToken(u''.join(chunks), False, start_mark, end_mark,
style)
ESCAPE_REPLACEMENTS = {
- '0': '\0',
- 'a': '\x07',
- 'b': '\x08',
- 't': '\x09',
- '\t': '\x09',
- 'n': '\x0A',
- 'v': '\x0B',
- 'f': '\x0C',
- 'r': '\x0D',
- 'e': '\x1B',
- ' ': '\x20',
- '\"': '\"',
- '\\': '\\',
- 'N': '\x85',
- '_': '\xA0',
- 'L': '\u2028',
- 'P': '\u2029',
+ u'0': u'\0',
+ u'a': u'\x07',
+ u'b': u'\x08',
+ u't': u'\x09',
+ u'\t': u'\x09',
+ u'n': u'\x0A',
+ u'v': u'\x0B',
+ u'f': u'\x0C',
+ u'r': u'\x0D',
+ u'e': u'\x1B',
+ u' ': u'\x20',
+ u'\"': u'\"',
+ u'\\': u'\\',
+ u'N': u'\x85',
+ u'_': u'\xA0',
+ u'L': u'\u2028',
+ u'P': u'\u2029',
}
ESCAPE_CODES = {
- 'x': 2,
- 'u': 4,
- 'U': 8,
+ u'x': 2,
+ u'u': 4,
+ u'U': 8,
}
def scan_flow_scalar_non_spaces(self, double, start_mark):
@@ -1187,19 +1193,19 @@ class Scanner:
chunks = []
while True:
length = 0
- while self.peek(length) not in '\'\"\\\0 \t\r\n\x85\u2028\u2029':
+ while self.peek(length) not in u'\'\"\\\0 \t\r\n\x85\u2028\u2029':
length += 1
if length:
chunks.append(self.prefix(length))
self.forward(length)
ch = self.peek()
- if not double and ch == '\'' and self.peek(1) == '\'':
- chunks.append('\'')
+ if not double and ch == u'\'' and self.peek(1) == u'\'':
+ chunks.append(u'\'')
self.forward(2)
- elif (double and ch == '\'') or (not double and ch in '\"\\'):
+ elif (double and ch == u'\'') or (not double and ch in u'\"\\'):
chunks.append(ch)
self.forward()
- elif double and ch == '\\':
+ elif double and ch == u'\\':
self.forward()
ch = self.peek()
if ch in self.ESCAPE_REPLACEMENTS:
@@ -1209,19 +1215,19 @@ class Scanner:
length = self.ESCAPE_CODES[ch]
self.forward()
for k in range(length):
- if self.peek(k) not in '0123456789ABCDEFabcdef':
+ if self.peek(k) not in u'0123456789ABCDEFabcdef':
raise ScannerError("while scanning a double-quoted scalar", start_mark,
"expected escape sequence of %d hexdecimal numbers, but found %r" %
- (length, self.peek(k)), self.get_mark())
+ (length, self.peek(k).encode('utf-8')), self.get_mark())
code = int(self.prefix(length), 16)
- chunks.append(chr(code))
+ chunks.append(unichr(code))
self.forward(length)
- elif ch in '\r\n\x85\u2028\u2029':
+ elif ch in u'\r\n\x85\u2028\u2029':
self.scan_line_break()
chunks.extend(self.scan_flow_scalar_breaks(double, start_mark))
else:
raise ScannerError("while scanning a double-quoted scalar", start_mark,
- "found unknown escape character %r" % ch, self.get_mark())
+ "found unknown escape character %r" % ch.encode('utf-8'), self.get_mark())
else:
return chunks
@@ -1229,21 +1235,21 @@ class Scanner:
# See the specification for details.
chunks = []
length = 0
- while self.peek(length) in ' \t':
+ while self.peek(length) in u' \t':
length += 1
whitespaces = self.prefix(length)
self.forward(length)
ch = self.peek()
- if ch == '\0':
+ if ch == u'\0':
raise ScannerError("while scanning a quoted scalar", start_mark,
"found unexpected end of stream", self.get_mark())
- elif ch in '\r\n\x85\u2028\u2029':
+ elif ch in u'\r\n\x85\u2028\u2029':
line_break = self.scan_line_break()
breaks = self.scan_flow_scalar_breaks(double, start_mark)
- if line_break != '\n':
+ if line_break != u'\n':
chunks.append(line_break)
elif not breaks:
- chunks.append(' ')
+ chunks.append(u' ')
chunks.extend(breaks)
else:
chunks.append(whitespaces)
@@ -1256,13 +1262,13 @@ class Scanner:
# Instead of checking indentation, we check for document
# separators.
prefix = self.prefix(3)
- if (prefix == '---' or prefix == '...') \
- and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ if (prefix == u'---' or prefix == u'...') \
+ and self.peek(3) in u'\0 \t\r\n\x85\u2028\u2029':
raise ScannerError("while scanning a quoted scalar", start_mark,
"found unexpected document separator", self.get_mark())
- while self.peek() in ' \t':
+ while self.peek() in u' \t':
self.forward()
- if self.peek() in '\r\n\x85\u2028\u2029':
+ if self.peek() in u'\r\n\x85\u2028\u2029':
chunks.append(self.scan_line_break())
else:
return chunks
@@ -1284,19 +1290,19 @@ class Scanner:
spaces = []
while True:
length = 0
- if self.peek() == '#':
+ if self.peek() == u'#':
break
while True:
ch = self.peek(length)
- if ch in '\0 \t\r\n\x85\u2028\u2029' \
- or (not self.flow_level and ch == ':' and
- self.peek(length+1) in '\0 \t\r\n\x85\u2028\u2029') \
- or (self.flow_level and ch in ',:?[]{}'):
+ if ch in u'\0 \t\r\n\x85\u2028\u2029' \
+ or (not self.flow_level and ch == u':' and
+ self.peek(length+1) in u'\0 \t\r\n\x85\u2028\u2029') \
+ or (self.flow_level and ch in u',:?[]{}'):
break
length += 1
# It's not clear what we should do with ':' in the flow context.
- if (self.flow_level and ch == ':'
- and self.peek(length+1) not in '\0 \t\r\n\x85\u2028\u2029,[]{}'):
+ if (self.flow_level and ch == u':'
+ and self.peek(length+1) not in u'\0 \t\r\n\x85\u2028\u2029,[]{}'):
self.forward(length)
raise ScannerError("while scanning a plain scalar", start_mark,
"found unexpected ':'", self.get_mark(),
@@ -1309,10 +1315,10 @@ class Scanner:
self.forward(length)
end_mark = self.get_mark()
spaces = self.scan_plain_spaces(indent, start_mark)
- if not spaces or self.peek() == '#' \
+ if not spaces or self.peek() == u'#' \
or (not self.flow_level and self.column < indent):
break
- return ScalarToken(''.join(chunks), True, start_mark, end_mark)
+ return ScalarToken(u''.join(chunks), True, start_mark, end_mark)
def scan_plain_spaces(self, indent, start_mark):
# See the specification for details.
@@ -1320,32 +1326,32 @@ class Scanner:
# We just forbid them completely. Do not use tabs in YAML!
chunks = []
length = 0
- while self.peek(length) in ' ':
+ while self.peek(length) in u' ':
length += 1
whitespaces = self.prefix(length)
self.forward(length)
ch = self.peek()
- if ch in '\r\n\x85\u2028\u2029':
+ if ch in u'\r\n\x85\u2028\u2029':
line_break = self.scan_line_break()
self.allow_simple_key = True
prefix = self.prefix(3)
- if (prefix == '---' or prefix == '...') \
- and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ if (prefix == u'---' or prefix == u'...') \
+ and self.peek(3) in u'\0 \t\r\n\x85\u2028\u2029':
return
breaks = []
- while self.peek() in ' \r\n\x85\u2028\u2029':
+ while self.peek() in u' \r\n\x85\u2028\u2029':
if self.peek() == ' ':
self.forward()
else:
breaks.append(self.scan_line_break())
prefix = self.prefix(3)
- if (prefix == '---' or prefix == '...') \
- and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ if (prefix == u'---' or prefix == u'...') \
+ and self.peek(3) in u'\0 \t\r\n\x85\u2028\u2029':
return
- if line_break != '\n':
+ if line_break != u'\n':
chunks.append(line_break)
elif not breaks:
- chunks.append(' ')
+ chunks.append(u' ')
chunks.extend(breaks)
elif whitespaces:
chunks.append(whitespaces)
@@ -1356,20 +1362,22 @@ class Scanner:
# For some strange reasons, the specification does not allow '_' in
# tag handles. I have allowed it anyway.
ch = self.peek()
- if ch != '!':
+ if ch != u'!':
raise ScannerError("while scanning a %s" % name, start_mark,
- "expected '!', but found %r" % ch, self.get_mark())
+ "expected '!', but found %r" % ch.encode('utf-8'),
+ self.get_mark())
length = 1
ch = self.peek(length)
- if ch != ' ':
- while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-_':
+ if ch != u' ':
+ while u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-_':
length += 1
ch = self.peek(length)
- if ch != '!':
+ if ch != u'!':
self.forward(length)
raise ScannerError("while scanning a %s" % name, start_mark,
- "expected '!', but found %r" % ch, self.get_mark())
+ "expected '!', but found %r" % ch.encode('utf-8'),
+ self.get_mark())
length += 1
value = self.prefix(length)
self.forward(length)
@@ -1381,9 +1389,9 @@ class Scanner:
chunks = []
length = 0
ch = self.peek(length)
- while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
- or ch in '-;/?:@&=+$,_.!~*\'()[]%':
- if ch == '%':
+ while u'0' <= ch <= u'9' or u'A' <= ch <= u'Z' or u'a' <= ch <= u'z' \
+ or ch in u'-;/?:@&=+$,_.!~*\'()[]%':
+ if ch == u'%':
chunks.append(self.prefix(length))
self.forward(length)
length = 0
@@ -1397,25 +1405,26 @@ class Scanner:
length = 0
if not chunks:
raise ScannerError("while parsing a %s" % name, start_mark,
- "expected URI, but found %r" % ch, self.get_mark())
- return ''.join(chunks)
+ "expected URI, but found %r" % ch.encode('utf-8'),
+ self.get_mark())
+ return u''.join(chunks)
def scan_uri_escapes(self, name, start_mark):
# See the specification for details.
- codes = []
+ bytes = []
mark = self.get_mark()
- while self.peek() == '%':
+ while self.peek() == u'%':
self.forward()
for k in range(2):
- if self.peek(k) not in '0123456789ABCDEFabcdef':
+ if self.peek(k) not in u'0123456789ABCDEFabcdef':
raise ScannerError("while scanning a %s" % name, start_mark,
- "expected URI escape sequence of 2 hexdecimal numbers, but found %r"
- % self.peek(k), self.get_mark())
- codes.append(int(self.prefix(2), 16))
+ "expected URI escape sequence of 2 hexdecimal numbers, but found %r" %
+ (self.peek(k).encode('utf-8')), self.get_mark())
+ bytes.append(chr(int(self.prefix(2), 16)))
self.forward(2)
try:
- value = bytes(codes).decode('utf-8')
- except UnicodeDecodeError as exc:
+ value = unicode(''.join(bytes), 'utf-8')
+ except UnicodeDecodeError, exc:
raise ScannerError("while scanning a %s" % name, start_mark, str(exc), mark)
return value
@@ -1429,16 +1438,16 @@ class Scanner:
# '\u2029 : '\u2029'
# default : ''
ch = self.peek()
- if ch in '\r\n\x85':
- if self.prefix(2) == '\r\n':
+ if ch in u'\r\n\x85':
+ if self.prefix(2) == u'\r\n':
self.forward(2)
else:
self.forward()
- return '\n'
- elif ch in '\u2028\u2029':
+ return u'\n'
+ elif ch in u'\u2028\u2029':
self.forward()
return ch
- return ''
+ return u''
#try:
# import psyco
diff --git a/tablib/packages/yaml/serializer.py b/tablib/packages/yaml/serializer.py
index fe911e6..0bf1e96 100644
--- a/tablib/packages/yaml/serializer.py
+++ b/tablib/packages/yaml/serializer.py
@@ -1,16 +1,16 @@
__all__ = ['Serializer', 'SerializerError']
-from .error import YAMLError
-from .events import *
-from .nodes import *
+from error import YAMLError
+from events import *
+from nodes import *
class SerializerError(YAMLError):
pass
-class Serializer:
+class Serializer(object):
- ANCHOR_TEMPLATE = 'id%03d'
+ ANCHOR_TEMPLATE = u'id%03d'
def __init__(self, encoding=None,
explicit_start=None, explicit_end=None, version=None, tags=None):
diff --git a/tablib/packages/yaml3/__init__.py b/tablib/packages/yaml3/__init__.py
new file mode 100644
index 0000000..f36267a
--- /dev/null
+++ b/tablib/packages/yaml3/__init__.py
@@ -0,0 +1,288 @@
+
+from .error import *
+
+from .tokens import *
+from .events import *
+from .nodes import *
+
+from .loader import *
+from .dumper import *
+
+__version__ = '3.09'
+
+try:
+ from cyaml import *
+ __with_libyaml__ = True
+except ImportError:
+ __with_libyaml__ = False
+
+def scan(stream, Loader=Loader):
+ """
+ Scan a YAML stream and produce scanning tokens.
+ """
+ loader = Loader(stream)
+ while loader.check_token():
+ yield loader.get_token()
+
+def parse(stream, Loader=Loader):
+ """
+ Parse a YAML stream and produce parsing events.
+ """
+ loader = Loader(stream)
+ while loader.check_event():
+ yield loader.get_event()
+
+def compose(stream, Loader=Loader):
+ """
+ Parse the first YAML document in a stream
+ and produce the corresponding representation tree.
+ """
+ loader = Loader(stream)
+ return loader.get_single_node()
+
+def compose_all(stream, Loader=Loader):
+ """
+ Parse all YAML documents in a stream
+ and produce corresponding representation trees.
+ """
+ loader = Loader(stream)
+ while loader.check_node():
+ yield loader.get_node()
+
+def load(stream, Loader=Loader):
+ """
+ Parse the first YAML document in a stream
+ and produce the corresponding Python object.
+ """
+ loader = Loader(stream)
+ return loader.get_single_data()
+
+def load_all(stream, Loader=Loader):
+ """
+ Parse all YAML documents in a stream
+ and produce corresponding Python objects.
+ """
+ loader = Loader(stream)
+ while loader.check_data():
+ yield loader.get_data()
+
+def safe_load(stream):
+ """
+ Parse the first YAML document in a stream
+ and produce the corresponding Python object.
+ Resolve only basic YAML tags.
+ """
+ return load(stream, SafeLoader)
+
+def safe_load_all(stream):
+ """
+ Parse all YAML documents in a stream
+ and produce corresponding Python objects.
+ Resolve only basic YAML tags.
+ """
+ return load_all(stream, SafeLoader)
+
+def emit(events, stream=None, Dumper=Dumper,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None):
+ """
+ Emit YAML parsing events into a stream.
+ If stream is None, return the produced string instead.
+ """
+ getvalue = None
+ if stream is None:
+ from StringIO import StringIO
+ stream = StringIO()
+ getvalue = stream.getvalue
+ dumper = Dumper(stream, canonical=canonical, indent=indent, width=width,
+ allow_unicode=allow_unicode, line_break=line_break)
+ for event in events:
+ dumper.emit(event)
+ if getvalue:
+ return getvalue()
+
+def serialize_all(nodes, stream=None, Dumper=Dumper,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding='utf-8', explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ """
+ Serialize a sequence of representation trees into a YAML stream.
+ If stream is None, return the produced string instead.
+ """
+ getvalue = None
+ if stream is None:
+ if encoding is None:
+ from StringIO import StringIO
+ else:
+ from cStringIO import StringIO
+ stream = StringIO()
+ getvalue = stream.getvalue
+ dumper = Dumper(stream, canonical=canonical, indent=indent, width=width,
+ allow_unicode=allow_unicode, line_break=line_break,
+ encoding=encoding, version=version, tags=tags,
+ explicit_start=explicit_start, explicit_end=explicit_end)
+ dumper.open()
+ for node in nodes:
+ dumper.serialize(node)
+ dumper.close()
+ if getvalue:
+ return getvalue()
+
+def serialize(node, stream=None, Dumper=Dumper, **kwds):
+ """
+ Serialize a representation tree into a YAML stream.
+ If stream is None, return the produced string instead.
+ """
+ return serialize_all([node], stream, Dumper=Dumper, **kwds)
+
+def dump_all(documents, stream=None, Dumper=Dumper,
+ default_style=None, default_flow_style=None,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding='utf-8', explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ """
+ Serialize a sequence of Python objects into a YAML stream.
+ If stream is None, return the produced string instead.
+ """
+ getvalue = None
+ if stream is None:
+ if encoding is None:
+ from io import StringIO
+ else:
+ from io import StringIO
+ stream = StringIO()
+ getvalue = stream.getvalue
+ dumper = Dumper(stream, default_style=default_style,
+ default_flow_style=default_flow_style,
+ canonical=canonical, indent=indent, width=width,
+ allow_unicode=allow_unicode, line_break=line_break,
+ encoding=encoding, version=version, tags=tags,
+ explicit_start=explicit_start, explicit_end=explicit_end)
+ dumper.open()
+ for data in documents:
+ dumper.represent(data)
+ dumper.close()
+ if getvalue:
+ return getvalue()
+
+def dump(data, stream=None, Dumper=Dumper, **kwds):
+ """
+ Serialize a Python object into a YAML stream.
+ If stream is None, return the produced string instead.
+ """
+ return dump_all([data], stream, Dumper=Dumper, **kwds)
+
+def safe_dump_all(documents, stream=None, **kwds):
+ """
+ Serialize a sequence of Python objects into a YAML stream.
+ Produce only basic YAML tags.
+ If stream is None, return the produced string instead.
+ """
+ return dump_all(documents, stream, Dumper=SafeDumper, **kwds)
+
+def safe_dump(data, stream=None, **kwds):
+ """
+ Serialize a Python object into a YAML stream.
+ Produce only basic YAML tags.
+ If stream is None, return the produced string instead.
+ """
+ return dump_all([data], stream, Dumper=SafeDumper, **kwds)
+
+def add_implicit_resolver(tag, regexp, first=None,
+ Loader=Loader, Dumper=Dumper):
+ """
+ Add an implicit scalar detector.
+ If an implicit scalar value matches the given regexp,
+ the corresponding tag is assigned to the scalar.
+ first is a sequence of possible initial characters or None.
+ """
+ Loader.add_implicit_resolver(tag, regexp, first)
+ Dumper.add_implicit_resolver(tag, regexp, first)
+
+def add_path_resolver(tag, path, kind=None, Loader=Loader, Dumper=Dumper):
+ """
+ Add a path based resolver for the given tag.
+ A path is a list of keys that forms a path
+ to a node in the representation tree.
+ Keys can be string values, integers, or None.
+ """
+ Loader.add_path_resolver(tag, path, kind)
+ Dumper.add_path_resolver(tag, path, kind)
+
+def add_constructor(tag, constructor, Loader=Loader):
+ """
+ Add a constructor for the given tag.
+ Constructor is a function that accepts a Loader instance
+ and a node object and produces the corresponding Python object.
+ """
+ Loader.add_constructor(tag, constructor)
+
+def add_multi_constructor(tag_prefix, multi_constructor, Loader=Loader):
+ """
+ Add a multi-constructor for the given tag prefix.
+ Multi-constructor is called for a node if its tag starts with tag_prefix.
+ Multi-constructor accepts a Loader instance, a tag suffix,
+ and a node object and produces the corresponding Python object.
+ """
+ Loader.add_multi_constructor(tag_prefix, multi_constructor)
+
+def add_representer(data_type, representer, Dumper=Dumper):
+ """
+ Add a representer for the given type.
+ Representer is a function accepting a Dumper instance
+ and an instance of the given data type
+ and producing the corresponding representation node.
+ """
+ Dumper.add_representer(data_type, representer)
+
+def add_multi_representer(data_type, multi_representer, Dumper=Dumper):
+ """
+ Add a representer for the given type.
+ Multi-representer is a function accepting a Dumper instance
+ and an instance of the given data type or subtype
+ and producing the corresponding representation node.
+ """
+ Dumper.add_multi_representer(data_type, multi_representer)
+
+class YAMLObjectMetaclass(type):
+ """
+ The metaclass for YAMLObject.
+ """
+ def __init__(cls, name, bases, kwds):
+ super(YAMLObjectMetaclass, cls).__init__(name, bases, kwds)
+ if 'yaml_tag' in kwds and kwds['yaml_tag'] is not None:
+ cls.yaml_loader.add_constructor(cls.yaml_tag, cls.from_yaml)
+ cls.yaml_dumper.add_representer(cls, cls.to_yaml)
+
+class YAMLObject(object):
+ """
+ An object that can dump itself to a YAML stream
+ and load itself from a YAML stream.
+ """
+
+ __metaclass__ = YAMLObjectMetaclass
+ __slots__ = () # no direct instantiation, so allow immutable subclasses
+
+ yaml_loader = Loader
+ yaml_dumper = Dumper
+
+ yaml_tag = None
+ yaml_flow_style = None
+
+ def from_yaml(cls, loader, node):
+ """
+ Convert a representation node to a Python object.
+ """
+ return loader.construct_yaml_object(node, cls)
+ from_yaml = classmethod(from_yaml)
+
+ def to_yaml(cls, dumper, data):
+ """
+ Convert a Python object to a representation node.
+ """
+ return dumper.represent_yaml_object(cls.yaml_tag, data, cls,
+ flow_style=cls.yaml_flow_style)
+ to_yaml = classmethod(to_yaml)
+
diff --git a/tablib/packages/yaml3/composer.py b/tablib/packages/yaml3/composer.py
new file mode 100644
index 0000000..d5c6a7a
--- /dev/null
+++ b/tablib/packages/yaml3/composer.py
@@ -0,0 +1,139 @@
+
+__all__ = ['Composer', 'ComposerError']
+
+from .error import MarkedYAMLError
+from .events import *
+from .nodes import *
+
+class ComposerError(MarkedYAMLError):
+ pass
+
+class Composer:
+
+ def __init__(self):
+ self.anchors = {}
+
+ def check_node(self):
+ # Drop the STREAM-START event.
+ if self.check_event(StreamStartEvent):
+ self.get_event()
+
+ # If there are more documents available?
+ return not self.check_event(StreamEndEvent)
+
+ def get_node(self):
+ # Get the root node of the next document.
+ if not self.check_event(StreamEndEvent):
+ return self.compose_document()
+
+ def get_single_node(self):
+ # Drop the STREAM-START event.
+ self.get_event()
+
+ # Compose a document if the stream is not empty.
+ document = None
+ if not self.check_event(StreamEndEvent):
+ document = self.compose_document()
+
+ # Ensure that the stream contains no more documents.
+ if not self.check_event(StreamEndEvent):
+ event = self.get_event()
+ raise ComposerError("expected a single document in the stream",
+ document.start_mark, "but found another document",
+ event.start_mark)
+
+ # Drop the STREAM-END event.
+ self.get_event()
+
+ return document
+
+ def compose_document(self):
+ # Drop the DOCUMENT-START event.
+ self.get_event()
+
+ # Compose the root node.
+ node = self.compose_node(None, None)
+
+ # Drop the DOCUMENT-END event.
+ self.get_event()
+
+ self.anchors = {}
+ return node
+
+ def compose_node(self, parent, index):
+ if self.check_event(AliasEvent):
+ event = self.get_event()
+ anchor = event.anchor
+ if anchor not in self.anchors:
+ raise ComposerError(None, None, "found undefined alias %r"
+ % anchor, event.start_mark)
+ return self.anchors[anchor]
+ event = self.peek_event()
+ anchor = event.anchor
+ if anchor is not None:
+ if anchor in self.anchors:
+ raise ComposerError("found duplicate anchor %r; first occurence"
+ % anchor, self.anchors[anchor].start_mark,
+ "second occurence", event.start_mark)
+ self.descend_resolver(parent, index)
+ if self.check_event(ScalarEvent):
+ node = self.compose_scalar_node(anchor)
+ elif self.check_event(SequenceStartEvent):
+ node = self.compose_sequence_node(anchor)
+ elif self.check_event(MappingStartEvent):
+ node = self.compose_mapping_node(anchor)
+ self.ascend_resolver()
+ return node
+
+ def compose_scalar_node(self, anchor):
+ event = self.get_event()
+ tag = event.tag
+ if tag is None or tag == '!':
+ tag = self.resolve(ScalarNode, event.value, event.implicit)
+ node = ScalarNode(tag, event.value,
+ event.start_mark, event.end_mark, style=event.style)
+ if anchor is not None:
+ self.anchors[anchor] = node
+ return node
+
+ def compose_sequence_node(self, anchor):
+ start_event = self.get_event()
+ tag = start_event.tag
+ if tag is None or tag == '!':
+ tag = self.resolve(SequenceNode, None, start_event.implicit)
+ node = SequenceNode(tag, [],
+ start_event.start_mark, None,
+ flow_style=start_event.flow_style)
+ if anchor is not None:
+ self.anchors[anchor] = node
+ index = 0
+ while not self.check_event(SequenceEndEvent):
+ node.value.append(self.compose_node(node, index))
+ index += 1
+ end_event = self.get_event()
+ node.end_mark = end_event.end_mark
+ return node
+
+ def compose_mapping_node(self, anchor):
+ start_event = self.get_event()
+ tag = start_event.tag
+ if tag is None or tag == '!':
+ tag = self.resolve(MappingNode, None, start_event.implicit)
+ node = MappingNode(tag, [],
+ start_event.start_mark, None,
+ flow_style=start_event.flow_style)
+ if anchor is not None:
+ self.anchors[anchor] = node
+ while not self.check_event(MappingEndEvent):
+ #key_event = self.peek_event()
+ item_key = self.compose_node(node, None)
+ #if item_key in node.value:
+ # raise ComposerError("while composing a mapping", start_event.start_mark,
+ # "found duplicate key", key_event.start_mark)
+ item_value = self.compose_node(node, item_key)
+ #node.value[item_key] = item_value
+ node.value.append((item_key, item_value))
+ end_event = self.get_event()
+ node.end_mark = end_event.end_mark
+ return node
+
diff --git a/tablib/packages/yaml3/constructor.py b/tablib/packages/yaml3/constructor.py
new file mode 100644
index 0000000..bd25b79
--- /dev/null
+++ b/tablib/packages/yaml3/constructor.py
@@ -0,0 +1,686 @@
+
+__all__ = ['BaseConstructor', 'SafeConstructor', 'Constructor',
+ 'ConstructorError']
+
+from .error import *
+from .nodes import *
+
+import collections, datetime, base64, binascii, re, sys, types
+
+class ConstructorError(MarkedYAMLError):
+ pass
+
+class BaseConstructor:
+
+ yaml_constructors = {}
+ yaml_multi_constructors = {}
+
+ def __init__(self):
+ self.constructed_objects = {}
+ self.recursive_objects = {}
+ self.state_generators = []
+ self.deep_construct = False
+
+ def check_data(self):
+ # If there are more documents available?
+ return self.check_node()
+
+ def get_data(self):
+ # Construct and return the next document.
+ if self.check_node():
+ return self.construct_document(self.get_node())
+
+ def get_single_data(self):
+ # Ensure that the stream contains a single document and construct it.
+ node = self.get_single_node()
+ if node is not None:
+ return self.construct_document(node)
+ return None
+
+ def construct_document(self, node):
+ data = self.construct_object(node)
+ while self.state_generators:
+ state_generators = self.state_generators
+ self.state_generators = []
+ for generator in state_generators:
+ for dummy in generator:
+ pass
+ self.constructed_objects = {}
+ self.recursive_objects = {}
+ self.deep_construct = False
+ return data
+
+ def construct_object(self, node, deep=False):
+ if deep:
+ old_deep = self.deep_construct
+ self.deep_construct = True
+ if node in self.constructed_objects:
+ return self.constructed_objects[node]
+ if node in self.recursive_objects:
+ raise ConstructorError(None, None,
+ "found unconstructable recursive node", node.start_mark)
+ self.recursive_objects[node] = None
+ constructor = None
+ tag_suffix = None
+ if node.tag in self.yaml_constructors:
+ constructor = self.yaml_constructors[node.tag]
+ else:
+ for tag_prefix in self.yaml_multi_constructors:
+ if node.tag.startswith(tag_prefix):
+ tag_suffix = node.tag[len(tag_prefix):]
+ constructor = self.yaml_multi_constructors[tag_prefix]
+ break
+ else:
+ if None in self.yaml_multi_constructors:
+ tag_suffix = node.tag
+ constructor = self.yaml_multi_constructors[None]
+ elif None in self.yaml_constructors:
+ constructor = self.yaml_constructors[None]
+ elif isinstance(node, ScalarNode):
+ constructor = self.__class__.construct_scalar
+ elif isinstance(node, SequenceNode):
+ constructor = self.__class__.construct_sequence
+ elif isinstance(node, MappingNode):
+ constructor = self.__class__.construct_mapping
+ if tag_suffix is None:
+ data = constructor(self, node)
+ else:
+ data = constructor(self, tag_suffix, node)
+ if isinstance(data, types.GeneratorType):
+ generator = data
+ data = next(generator)
+ if self.deep_construct:
+ for dummy in generator:
+ pass
+ else:
+ self.state_generators.append(generator)
+ self.constructed_objects[node] = data
+ del self.recursive_objects[node]
+ if deep:
+ self.deep_construct = old_deep
+ return data
+
+ def construct_scalar(self, node):
+ if not isinstance(node, ScalarNode):
+ raise ConstructorError(None, None,
+ "expected a scalar node, but found %s" % node.id,
+ node.start_mark)
+ return node.value
+
+ def construct_sequence(self, node, deep=False):
+ if not isinstance(node, SequenceNode):
+ raise ConstructorError(None, None,
+ "expected a sequence node, but found %s" % node.id,
+ node.start_mark)
+ return [self.construct_object(child, deep=deep)
+ for child in node.value]
+
+ def construct_mapping(self, node, deep=False):
+ if not isinstance(node, MappingNode):
+ raise ConstructorError(None, None,
+ "expected a mapping node, but found %s" % node.id,
+ node.start_mark)
+ mapping = {}
+ for key_node, value_node in node.value:
+ key = self.construct_object(key_node, deep=deep)
+ if not isinstance(key, collections.Hashable):
+ raise ConstructorError("while constructing a mapping", node.start_mark,
+ "found unhashable key", key_node.start_mark)
+ value = self.construct_object(value_node, deep=deep)
+ mapping[key] = value
+ return mapping
+
+ def construct_pairs(self, node, deep=False):
+ if not isinstance(node, MappingNode):
+ raise ConstructorError(None, None,
+ "expected a mapping node, but found %s" % node.id,
+ node.start_mark)
+ pairs = []
+ for key_node, value_node in node.value:
+ key = self.construct_object(key_node, deep=deep)
+ value = self.construct_object(value_node, deep=deep)
+ pairs.append((key, value))
+ return pairs
+
+ @classmethod
+ def add_constructor(cls, tag, constructor):
+ if not 'yaml_constructors' in cls.__dict__:
+ cls.yaml_constructors = cls.yaml_constructors.copy()
+ cls.yaml_constructors[tag] = constructor
+
+ @classmethod
+ def add_multi_constructor(cls, tag_prefix, multi_constructor):
+ if not 'yaml_multi_constructors' in cls.__dict__:
+ cls.yaml_multi_constructors = cls.yaml_multi_constructors.copy()
+ cls.yaml_multi_constructors[tag_prefix] = multi_constructor
+
+class SafeConstructor(BaseConstructor):
+
+ def construct_scalar(self, node):
+ if isinstance(node, MappingNode):
+ for key_node, value_node in node.value:
+ if key_node.tag == 'tag:yaml.org,2002:value':
+ return self.construct_scalar(value_node)
+ return super().construct_scalar(node)
+
+ def flatten_mapping(self, node):
+ merge = []
+ index = 0
+ while index < len(node.value):
+ key_node, value_node = node.value[index]
+ if key_node.tag == 'tag:yaml.org,2002:merge':
+ del node.value[index]
+ if isinstance(value_node, MappingNode):
+ self.flatten_mapping(value_node)
+ merge.extend(value_node.value)
+ elif isinstance(value_node, SequenceNode):
+ submerge = []
+ for subnode in value_node.value:
+ if not isinstance(subnode, MappingNode):
+ raise ConstructorError("while constructing a mapping",
+ node.start_mark,
+ "expected a mapping for merging, but found %s"
+ % subnode.id, subnode.start_mark)
+ self.flatten_mapping(subnode)
+ submerge.append(subnode.value)
+ submerge.reverse()
+ for value in submerge:
+ merge.extend(value)
+ else:
+ raise ConstructorError("while constructing a mapping", node.start_mark,
+ "expected a mapping or list of mappings for merging, but found %s"
+ % value_node.id, value_node.start_mark)
+ elif key_node.tag == 'tag:yaml.org,2002:value':
+ key_node.tag = 'tag:yaml.org,2002:str'
+ index += 1
+ else:
+ index += 1
+ if merge:
+ node.value = merge + node.value
+
+ def construct_mapping(self, node, deep=False):
+ if isinstance(node, MappingNode):
+ self.flatten_mapping(node)
+ return super().construct_mapping(node, deep=deep)
+
+ def construct_yaml_null(self, node):
+ self.construct_scalar(node)
+ return None
+
+ bool_values = {
+ 'yes': True,
+ 'no': False,
+ 'true': True,
+ 'false': False,
+ 'on': True,
+ 'off': False,
+ }
+
+ def construct_yaml_bool(self, node):
+ value = self.construct_scalar(node)
+ return self.bool_values[value.lower()]
+
+ def construct_yaml_int(self, node):
+ value = self.construct_scalar(node)
+ value = value.replace('_', '')
+ sign = +1
+ if value[0] == '-':
+ sign = -1
+ if value[0] in '+-':
+ value = value[1:]
+ if value == '0':
+ return 0
+ elif value.startswith('0b'):
+ return sign*int(value[2:], 2)
+ elif value.startswith('0x'):
+ return sign*int(value[2:], 16)
+ elif value[0] == '0':
+ return sign*int(value, 8)
+ elif ':' in value:
+ digits = [int(part) for part in value.split(':')]
+ digits.reverse()
+ base = 1
+ value = 0
+ for digit in digits:
+ value += digit*base
+ base *= 60
+ return sign*value
+ else:
+ return sign*int(value)
+
+ inf_value = 1e300
+ while inf_value != inf_value*inf_value:
+ inf_value *= inf_value
+ nan_value = -inf_value/inf_value # Trying to make a quiet NaN (like C99).
+
+ def construct_yaml_float(self, node):
+ value = self.construct_scalar(node)
+ value = value.replace('_', '').lower()
+ sign = +1
+ if value[0] == '-':
+ sign = -1
+ if value[0] in '+-':
+ value = value[1:]
+ if value == '.inf':
+ return sign*self.inf_value
+ elif value == '.nan':
+ return self.nan_value
+ elif ':' in value:
+ digits = [float(part) for part in value.split(':')]
+ digits.reverse()
+ base = 1
+ value = 0.0
+ for digit in digits:
+ value += digit*base
+ base *= 60
+ return sign*value
+ else:
+ return sign*float(value)
+
+ def construct_yaml_binary(self, node):
+ try:
+ value = self.construct_scalar(node).encode('ascii')
+ except UnicodeEncodeError as exc:
+ raise ConstructorError(None, None,
+ "failed to convert base64 data into ascii: %s" % exc,
+ node.start_mark)
+ try:
+ if hasattr(base64, 'decodebytes'):
+ return base64.decodebytes(value)
+ else:
+ return base64.decodestring(value)
+ except binascii.Error as exc:
+ raise ConstructorError(None, None,
+ "failed to decode base64 data: %s" % exc, node.start_mark)
+
+ timestamp_regexp = re.compile(
+ r'''^(?P<year>[0-9][0-9][0-9][0-9])
+ -(?P<month>[0-9][0-9]?)
+ -(?P<day>[0-9][0-9]?)
+ (?:(?:[Tt]|[ \t]+)
+ (?P<hour>[0-9][0-9]?)
+ :(?P<minute>[0-9][0-9])
+ :(?P<second>[0-9][0-9])
+ (?:\.(?P<fraction>[0-9]*))?
+ (?:[ \t]*(?P<tz>Z|(?P<tz_sign>[-+])(?P<tz_hour>[0-9][0-9]?)
+ (?::(?P<tz_minute>[0-9][0-9]))?))?)?$''', re.X)
+
+ def construct_yaml_timestamp(self, node):
+ value = self.construct_scalar(node)
+ match = self.timestamp_regexp.match(node.value)
+ values = match.groupdict()
+ year = int(values['year'])
+ month = int(values['month'])
+ day = int(values['day'])
+ if not values['hour']:
+ return datetime.date(year, month, day)
+ hour = int(values['hour'])
+ minute = int(values['minute'])
+ second = int(values['second'])
+ fraction = 0
+ if values['fraction']:
+ fraction = values['fraction'][:6]
+ while len(fraction) < 6:
+ fraction += '0'
+ fraction = int(fraction)
+ delta = None
+ if values['tz_sign']:
+ tz_hour = int(values['tz_hour'])
+ tz_minute = int(values['tz_minute'] or 0)
+ delta = datetime.timedelta(hours=tz_hour, minutes=tz_minute)
+ if values['tz_sign'] == '-':
+ delta = -delta
+ data = datetime.datetime(year, month, day, hour, minute, second, fraction)
+ if delta:
+ data -= delta
+ return data
+
+ def construct_yaml_omap(self, node):
+ # Note: we do not check for duplicate keys, because it's too
+ # CPU-expensive.
+ omap = []
+ yield omap
+ if not isinstance(node, SequenceNode):
+ raise ConstructorError("while constructing an ordered map", node.start_mark,
+ "expected a sequence, but found %s" % node.id, node.start_mark)
+ for subnode in node.value:
+ if not isinstance(subnode, MappingNode):
+ raise ConstructorError("while constructing an ordered map", node.start_mark,
+ "expected a mapping of length 1, but found %s" % subnode.id,
+ subnode.start_mark)
+ if len(subnode.value) != 1:
+ raise ConstructorError("while constructing an ordered map", node.start_mark,
+ "expected a single mapping item, but found %d items" % len(subnode.value),
+ subnode.start_mark)
+ key_node, value_node = subnode.value[0]
+ key = self.construct_object(key_node)
+ value = self.construct_object(value_node)
+ omap.append((key, value))
+
+ def construct_yaml_pairs(self, node):
+ # Note: the same code as `construct_yaml_omap`.
+ pairs = []
+ yield pairs
+ if not isinstance(node, SequenceNode):
+ raise ConstructorError("while constructing pairs", node.start_mark,
+ "expected a sequence, but found %s" % node.id, node.start_mark)
+ for subnode in node.value:
+ if not isinstance(subnode, MappingNode):
+ raise ConstructorError("while constructing pairs", node.start_mark,
+ "expected a mapping of length 1, but found %s" % subnode.id,
+ subnode.start_mark)
+ if len(subnode.value) != 1:
+ raise ConstructorError("while constructing pairs", node.start_mark,
+ "expected a single mapping item, but found %d items" % len(subnode.value),
+ subnode.start_mark)
+ key_node, value_node = subnode.value[0]
+ key = self.construct_object(key_node)
+ value = self.construct_object(value_node)
+ pairs.append((key, value))
+
+ def construct_yaml_set(self, node):
+ data = set()
+ yield data
+ value = self.construct_mapping(node)
+ data.update(value)
+
+ def construct_yaml_str(self, node):
+ return self.construct_scalar(node)
+
+ def construct_yaml_seq(self, node):
+ data = []
+ yield data
+ data.extend(self.construct_sequence(node))
+
+ def construct_yaml_map(self, node):
+ data = {}
+ yield data
+ value = self.construct_mapping(node)
+ data.update(value)
+
+ def construct_yaml_object(self, node, cls):
+ data = cls.__new__(cls)
+ yield data
+ if hasattr(data, '__setstate__'):
+ state = self.construct_mapping(node, deep=True)
+ data.__setstate__(state)
+ else:
+ state = self.construct_mapping(node)
+ data.__dict__.update(state)
+
+ def construct_undefined(self, node):
+ raise ConstructorError(None, None,
+ "could not determine a constructor for the tag %r" % node.tag,
+ node.start_mark)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:null',
+ SafeConstructor.construct_yaml_null)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:bool',
+ SafeConstructor.construct_yaml_bool)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:int',
+ SafeConstructor.construct_yaml_int)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:float',
+ SafeConstructor.construct_yaml_float)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:binary',
+ SafeConstructor.construct_yaml_binary)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:timestamp',
+ SafeConstructor.construct_yaml_timestamp)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:omap',
+ SafeConstructor.construct_yaml_omap)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:pairs',
+ SafeConstructor.construct_yaml_pairs)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:set',
+ SafeConstructor.construct_yaml_set)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:str',
+ SafeConstructor.construct_yaml_str)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:seq',
+ SafeConstructor.construct_yaml_seq)
+
+SafeConstructor.add_constructor(
+ 'tag:yaml.org,2002:map',
+ SafeConstructor.construct_yaml_map)
+
+SafeConstructor.add_constructor(None,
+ SafeConstructor.construct_undefined)
+
+class Constructor(SafeConstructor):
+
+ def construct_python_str(self, node):
+ return self.construct_scalar(node)
+
+ def construct_python_unicode(self, node):
+ return self.construct_scalar(node)
+
+ def construct_python_bytes(self, node):
+ try:
+ value = self.construct_scalar(node).encode('ascii')
+ except UnicodeEncodeError as exc:
+ raise ConstructorError(None, None,
+ "failed to convert base64 data into ascii: %s" % exc,
+ node.start_mark)
+ try:
+ if hasattr(base64, 'decodebytes'):
+ return base64.decodebytes(value)
+ else:
+ return base64.decodestring(value)
+ except binascii.Error as exc:
+ raise ConstructorError(None, None,
+ "failed to decode base64 data: %s" % exc, node.start_mark)
+
+ def construct_python_long(self, node):
+ return self.construct_yaml_int(node)
+
+ def construct_python_complex(self, node):
+ return complex(self.construct_scalar(node))
+
+ def construct_python_tuple(self, node):
+ return tuple(self.construct_sequence(node))
+
+ def find_python_module(self, name, mark):
+ if not name:
+ raise ConstructorError("while constructing a Python module", mark,
+ "expected non-empty name appended to the tag", mark)
+ try:
+ __import__(name)
+ except ImportError as exc:
+ raise ConstructorError("while constructing a Python module", mark,
+ "cannot find module %r (%s)" % (name, exc), mark)
+ return sys.modules[name]
+
+ def find_python_name(self, name, mark):
+ if not name:
+ raise ConstructorError("while constructing a Python object", mark,
+ "expected non-empty name appended to the tag", mark)
+ if '.' in name:
+ module_name, object_name = name.rsplit('.', 1)
+ else:
+ module_name = 'builtins'
+ object_name = name
+ try:
+ __import__(module_name)
+ except ImportError as exc:
+ raise ConstructorError("while constructing a Python object", mark,
+ "cannot find module %r (%s)" % (module_name, exc), mark)
+ module = sys.modules[module_name]
+ if not hasattr(module, object_name):
+ raise ConstructorError("while constructing a Python object", mark,
+ "cannot find %r in the module %r"
+ % (object_name, module.__name__), mark)
+ return getattr(module, object_name)
+
+ def construct_python_name(self, suffix, node):
+ value = self.construct_scalar(node)
+ if value:
+ raise ConstructorError("while constructing a Python name", node.start_mark,
+ "expected the empty value, but found %r" % value, node.start_mark)
+ return self.find_python_name(suffix, node.start_mark)
+
+ def construct_python_module(self, suffix, node):
+ value = self.construct_scalar(node)
+ if value:
+ raise ConstructorError("while constructing a Python module", node.start_mark,
+ "expected the empty value, but found %r" % value, node.start_mark)
+ return self.find_python_module(suffix, node.start_mark)
+
+ def make_python_instance(self, suffix, node,
+ args=None, kwds=None, newobj=False):
+ if not args:
+ args = []
+ if not kwds:
+ kwds = {}
+ cls = self.find_python_name(suffix, node.start_mark)
+ if newobj and isinstance(cls, type):
+ return cls.__new__(cls, *args, **kwds)
+ else:
+ return cls(*args, **kwds)
+
+ def set_python_instance_state(self, instance, state):
+ if hasattr(instance, '__setstate__'):
+ instance.__setstate__(state)
+ else:
+ slotstate = {}
+ if isinstance(state, tuple) and len(state) == 2:
+ state, slotstate = state
+ if hasattr(instance, '__dict__'):
+ instance.__dict__.update(state)
+ elif state:
+ slotstate.update(state)
+ for key, value in slotstate.items():
+ setattr(object, key, value)
+
+ def construct_python_object(self, suffix, node):
+ # Format:
+ # !!python/object:module.name { ... state ... }
+ instance = self.make_python_instance(suffix, node, newobj=True)
+ yield instance
+ deep = hasattr(instance, '__setstate__')
+ state = self.construct_mapping(node, deep=deep)
+ self.set_python_instance_state(instance, state)
+
+ def construct_python_object_apply(self, suffix, node, newobj=False):
+ # Format:
+ # !!python/object/apply # (or !!python/object/new)
+ # args: [ ... arguments ... ]
+ # kwds: { ... keywords ... }
+ # state: ... state ...
+ # listitems: [ ... listitems ... ]
+ # dictitems: { ... dictitems ... }
+ # or short format:
+ # !!python/object/apply [ ... arguments ... ]
+ # The difference between !!python/object/apply and !!python/object/new
+ # is how an object is created, check make_python_instance for details.
+ if isinstance(node, SequenceNode):
+ args = self.construct_sequence(node, deep=True)
+ kwds = {}
+ state = {}
+ listitems = []
+ dictitems = {}
+ else:
+ value = self.construct_mapping(node, deep=True)
+ args = value.get('args', [])
+ kwds = value.get('kwds', {})
+ state = value.get('state', {})
+ listitems = value.get('listitems', [])
+ dictitems = value.get('dictitems', {})
+ instance = self.make_python_instance(suffix, node, args, kwds, newobj)
+ if state:
+ self.set_python_instance_state(instance, state)
+ if listitems:
+ instance.extend(listitems)
+ if dictitems:
+ for key in dictitems:
+ instance[key] = dictitems[key]
+ return instance
+
+ def construct_python_object_new(self, suffix, node):
+ return self.construct_python_object_apply(suffix, node, newobj=True)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/none',
+ Constructor.construct_yaml_null)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/bool',
+ Constructor.construct_yaml_bool)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/str',
+ Constructor.construct_python_str)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/unicode',
+ Constructor.construct_python_unicode)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/bytes',
+ Constructor.construct_python_bytes)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/int',
+ Constructor.construct_yaml_int)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/long',
+ Constructor.construct_python_long)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/float',
+ Constructor.construct_yaml_float)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/complex',
+ Constructor.construct_python_complex)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/list',
+ Constructor.construct_yaml_seq)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/tuple',
+ Constructor.construct_python_tuple)
+
+Constructor.add_constructor(
+ 'tag:yaml.org,2002:python/dict',
+ Constructor.construct_yaml_map)
+
+Constructor.add_multi_constructor(
+ 'tag:yaml.org,2002:python/name:',
+ Constructor.construct_python_name)
+
+Constructor.add_multi_constructor(
+ 'tag:yaml.org,2002:python/module:',
+ Constructor.construct_python_module)
+
+Constructor.add_multi_constructor(
+ 'tag:yaml.org,2002:python/object:',
+ Constructor.construct_python_object)
+
+Constructor.add_multi_constructor(
+ 'tag:yaml.org,2002:python/object/apply:',
+ Constructor.construct_python_object_apply)
+
+Constructor.add_multi_constructor(
+ 'tag:yaml.org,2002:python/object/new:',
+ Constructor.construct_python_object_new)
+
diff --git a/tablib/packages/yaml3/cyaml.py b/tablib/packages/yaml3/cyaml.py
new file mode 100644
index 0000000..d5cb87e
--- /dev/null
+++ b/tablib/packages/yaml3/cyaml.py
@@ -0,0 +1,85 @@
+
+__all__ = ['CBaseLoader', 'CSafeLoader', 'CLoader',
+ 'CBaseDumper', 'CSafeDumper', 'CDumper']
+
+from _yaml import CParser, CEmitter
+
+from .constructor import *
+
+from .serializer import *
+from .representer import *
+
+from .resolver import *
+
+class CBaseLoader(CParser, BaseConstructor, BaseResolver):
+
+ def __init__(self, stream):
+ CParser.__init__(self, stream)
+ BaseConstructor.__init__(self)
+ BaseResolver.__init__(self)
+
+class CSafeLoader(CParser, SafeConstructor, Resolver):
+
+ def __init__(self, stream):
+ CParser.__init__(self, stream)
+ SafeConstructor.__init__(self)
+ Resolver.__init__(self)
+
+class CLoader(CParser, Constructor, Resolver):
+
+ def __init__(self, stream):
+ CParser.__init__(self, stream)
+ Constructor.__init__(self)
+ Resolver.__init__(self)
+
+class CBaseDumper(CEmitter, BaseRepresenter, BaseResolver):
+
+ def __init__(self, stream,
+ default_style=None, default_flow_style=None,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding=None, explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ CEmitter.__init__(self, stream, canonical=canonical,
+ indent=indent, width=width, encoding=encoding,
+ allow_unicode=allow_unicode, line_break=line_break,
+ explicit_start=explicit_start, explicit_end=explicit_end,
+ version=version, tags=tags)
+ Representer.__init__(self, default_style=default_style,
+ default_flow_style=default_flow_style)
+ Resolver.__init__(self)
+
+class CSafeDumper(CEmitter, SafeRepresenter, Resolver):
+
+ def __init__(self, stream,
+ default_style=None, default_flow_style=None,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding=None, explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ CEmitter.__init__(self, stream, canonical=canonical,
+ indent=indent, width=width, encoding=encoding,
+ allow_unicode=allow_unicode, line_break=line_break,
+ explicit_start=explicit_start, explicit_end=explicit_end,
+ version=version, tags=tags)
+ SafeRepresenter.__init__(self, default_style=default_style,
+ default_flow_style=default_flow_style)
+ Resolver.__init__(self)
+
+class CDumper(CEmitter, Serializer, Representer, Resolver):
+
+ def __init__(self, stream,
+ default_style=None, default_flow_style=None,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding=None, explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ CEmitter.__init__(self, stream, canonical=canonical,
+ indent=indent, width=width, encoding=encoding,
+ allow_unicode=allow_unicode, line_break=line_break,
+ explicit_start=explicit_start, explicit_end=explicit_end,
+ version=version, tags=tags)
+ Representer.__init__(self, default_style=default_style,
+ default_flow_style=default_flow_style)
+ Resolver.__init__(self)
+
diff --git a/tablib/packages/yaml3/dumper.py b/tablib/packages/yaml3/dumper.py
new file mode 100644
index 0000000..0b69128
--- /dev/null
+++ b/tablib/packages/yaml3/dumper.py
@@ -0,0 +1,62 @@
+
+__all__ = ['BaseDumper', 'SafeDumper', 'Dumper']
+
+from .emitter import *
+from .serializer import *
+from .representer import *
+from .resolver import *
+
+class BaseDumper(Emitter, Serializer, BaseRepresenter, BaseResolver):
+
+ def __init__(self, stream,
+ default_style=None, default_flow_style=None,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding=None, explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ Emitter.__init__(self, stream, canonical=canonical,
+ indent=indent, width=width,
+ allow_unicode=allow_unicode, line_break=line_break)
+ Serializer.__init__(self, encoding=encoding,
+ explicit_start=explicit_start, explicit_end=explicit_end,
+ version=version, tags=tags)
+ Representer.__init__(self, default_style=default_style,
+ default_flow_style=default_flow_style)
+ Resolver.__init__(self)
+
+class SafeDumper(Emitter, Serializer, SafeRepresenter, Resolver):
+
+ def __init__(self, stream,
+ default_style=None, default_flow_style=None,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding=None, explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ Emitter.__init__(self, stream, canonical=canonical,
+ indent=indent, width=width,
+ allow_unicode=allow_unicode, line_break=line_break)
+ Serializer.__init__(self, encoding=encoding,
+ explicit_start=explicit_start, explicit_end=explicit_end,
+ version=version, tags=tags)
+ SafeRepresenter.__init__(self, default_style=default_style,
+ default_flow_style=default_flow_style)
+ Resolver.__init__(self)
+
+class Dumper(Emitter, Serializer, Representer, Resolver):
+
+ def __init__(self, stream,
+ default_style=None, default_flow_style=None,
+ canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None,
+ encoding=None, explicit_start=None, explicit_end=None,
+ version=None, tags=None):
+ Emitter.__init__(self, stream, canonical=canonical,
+ indent=indent, width=width,
+ allow_unicode=allow_unicode, line_break=line_break)
+ Serializer.__init__(self, encoding=encoding,
+ explicit_start=explicit_start, explicit_end=explicit_end,
+ version=version, tags=tags)
+ Representer.__init__(self, default_style=default_style,
+ default_flow_style=default_flow_style)
+ Resolver.__init__(self)
+
diff --git a/tablib/packages/yaml3/emitter.py b/tablib/packages/yaml3/emitter.py
new file mode 100644
index 0000000..8947d04
--- /dev/null
+++ b/tablib/packages/yaml3/emitter.py
@@ -0,0 +1,1132 @@
+
+# Emitter expects events obeying the following grammar:
+# stream ::= STREAM-START document* STREAM-END
+# document ::= DOCUMENT-START node DOCUMENT-END
+# node ::= SCALAR | sequence | mapping
+# sequence ::= SEQUENCE-START node* SEQUENCE-END
+# mapping ::= MAPPING-START (node node)* MAPPING-END
+
+__all__ = ['Emitter', 'EmitterError']
+
+from .error import YAMLError
+from .events import *
+
+class EmitterError(YAMLError):
+ pass
+
+class ScalarAnalysis:
+ def __init__(self, scalar, empty, multiline,
+ allow_flow_plain, allow_block_plain,
+ allow_single_quoted, allow_double_quoted,
+ allow_block):
+ self.scalar = scalar
+ self.empty = empty
+ self.multiline = multiline
+ self.allow_flow_plain = allow_flow_plain
+ self.allow_block_plain = allow_block_plain
+ self.allow_single_quoted = allow_single_quoted
+ self.allow_double_quoted = allow_double_quoted
+ self.allow_block = allow_block
+
+class Emitter:
+
+ DEFAULT_TAG_PREFIXES = {
+ '!' : '!',
+ 'tag:yaml.org,2002:' : '!!',
+ }
+
+ def __init__(self, stream, canonical=None, indent=None, width=None,
+ allow_unicode=None, line_break=None):
+
+ # The stream should have the methods `write` and possibly `flush`.
+ self.stream = stream
+
+ # Encoding can be overriden by STREAM-START.
+ self.encoding = None
+
+ # Emitter is a state machine with a stack of states to handle nested
+ # structures.
+ self.states = []
+ self.state = self.expect_stream_start
+
+ # Current event and the event queue.
+ self.events = []
+ self.event = None
+
+ # The current indentation level and the stack of previous indents.
+ self.indents = []
+ self.indent = None
+
+ # Flow level.
+ self.flow_level = 0
+
+ # Contexts.
+ self.root_context = False
+ self.sequence_context = False
+ self.mapping_context = False
+ self.simple_key_context = False
+
+ # Characteristics of the last emitted character:
+ # - current position.
+ # - is it a whitespace?
+ # - is it an indention character
+ # (indentation space, '-', '?', or ':')?
+ self.line = 0
+ self.column = 0
+ self.whitespace = True
+ self.indention = True
+
+ # Whether the document requires an explicit document indicator
+ self.open_ended = False
+
+ # Formatting details.
+ self.canonical = canonical
+ self.allow_unicode = allow_unicode
+ self.best_indent = 2
+ if indent and 1 < indent < 10:
+ self.best_indent = indent
+ self.best_width = 80
+ if width and width > self.best_indent*2:
+ self.best_width = width
+ self.best_line_break = '\n'
+ if line_break in ['\r', '\n', '\r\n']:
+ self.best_line_break = line_break
+
+ # Tag prefixes.
+ self.tag_prefixes = None
+
+ # Prepared anchor and tag.
+ self.prepared_anchor = None
+ self.prepared_tag = None
+
+ # Scalar analysis and style.
+ self.analysis = None
+ self.style = None
+
+ def emit(self, event):
+ self.events.append(event)
+ while not self.need_more_events():
+ self.event = self.events.pop(0)
+ self.state()
+ self.event = None
+
+ # In some cases, we wait for a few next events before emitting.
+
+ def need_more_events(self):
+ if not self.events:
+ return True
+ event = self.events[0]
+ if isinstance(event, DocumentStartEvent):
+ return self.need_events(1)
+ elif isinstance(event, SequenceStartEvent):
+ return self.need_events(2)
+ elif isinstance(event, MappingStartEvent):
+ return self.need_events(3)
+ else:
+ return False
+
+ def need_events(self, count):
+ level = 0
+ for event in self.events[1:]:
+ if isinstance(event, (DocumentStartEvent, CollectionStartEvent)):
+ level += 1
+ elif isinstance(event, (DocumentEndEvent, CollectionEndEvent)):
+ level -= 1
+ elif isinstance(event, StreamEndEvent):
+ level = -1
+ if level < 0:
+ return False
+ return (len(self.events) < count+1)
+
+ def increase_indent(self, flow=False, indentless=False):
+ self.indents.append(self.indent)
+ if self.indent is None:
+ if flow:
+ self.indent = self.best_indent
+ else:
+ self.indent = 0
+ elif not indentless:
+ self.indent += self.best_indent
+
+ # States.
+
+ # Stream handlers.
+
+ def expect_stream_start(self):
+ if isinstance(self.event, StreamStartEvent):
+ if self.event.encoding and not hasattr(self.stream, 'encoding'):
+ self.encoding = self.event.encoding
+ self.write_stream_start()
+ self.state = self.expect_first_document_start
+ else:
+ raise EmitterError("expected StreamStartEvent, but got %s"
+ % self.event)
+
+ def expect_nothing(self):
+ raise EmitterError("expected nothing, but got %s" % self.event)
+
+ # Document handlers.
+
+ def expect_first_document_start(self):
+ return self.expect_document_start(first=True)
+
+ def expect_document_start(self, first=False):
+ if isinstance(self.event, DocumentStartEvent):
+ if (self.event.version or self.event.tags) and self.open_ended:
+ self.write_indicator('...', True)
+ self.write_indent()
+ if self.event.version:
+ version_text = self.prepare_version(self.event.version)
+ self.write_version_directive(version_text)
+ self.tag_prefixes = self.DEFAULT_TAG_PREFIXES.copy()
+ if self.event.tags:
+ handles = sorted(self.event.tags.keys())
+ for handle in handles:
+ prefix = self.event.tags[handle]
+ self.tag_prefixes[prefix] = handle
+ handle_text = self.prepare_tag_handle(handle)
+ prefix_text = self.prepare_tag_prefix(prefix)
+ self.write_tag_directive(handle_text, prefix_text)
+ implicit = (first and not self.event.explicit and not self.canonical
+ and not self.event.version and not self.event.tags
+ and not self.check_empty_document())
+ if not implicit:
+ self.write_indent()
+ self.write_indicator('---', True)
+ if self.canonical:
+ self.write_indent()
+ self.state = self.expect_document_root
+ elif isinstance(self.event, StreamEndEvent):
+ if self.open_ended:
+ self.write_indicator('...', True)
+ self.write_indent()
+ self.write_stream_end()
+ self.state = self.expect_nothing
+ else:
+ raise EmitterError("expected DocumentStartEvent, but got %s"
+ % self.event)
+
+ def expect_document_end(self):
+ if isinstance(self.event, DocumentEndEvent):
+ self.write_indent()
+ if self.event.explicit:
+ self.write_indicator('...', True)
+ self.write_indent()
+ self.flush_stream()
+ self.state = self.expect_document_start
+ else:
+ raise EmitterError("expected DocumentEndEvent, but got %s"
+ % self.event)
+
+ def expect_document_root(self):
+ self.states.append(self.expect_document_end)
+ self.expect_node(root=True)
+
+ # Node handlers.
+
+ def expect_node(self, root=False, sequence=False, mapping=False,
+ simple_key=False):
+ self.root_context = root
+ self.sequence_context = sequence
+ self.mapping_context = mapping
+ self.simple_key_context = simple_key
+ if isinstance(self.event, AliasEvent):
+ self.expect_alias()
+ elif isinstance(self.event, (ScalarEvent, CollectionStartEvent)):
+ self.process_anchor('&')
+ self.process_tag()
+ if isinstance(self.event, ScalarEvent):
+ self.expect_scalar()
+ elif isinstance(self.event, SequenceStartEvent):
+ if self.flow_level or self.canonical or self.event.flow_style \
+ or self.check_empty_sequence():
+ self.expect_flow_sequence()
+ else:
+ self.expect_block_sequence()
+ elif isinstance(self.event, MappingStartEvent):
+ if self.flow_level or self.canonical or self.event.flow_style \
+ or self.check_empty_mapping():
+ self.expect_flow_mapping()
+ else:
+ self.expect_block_mapping()
+ else:
+ raise EmitterError("expected NodeEvent, but got %s" % self.event)
+
+ def expect_alias(self):
+ if self.event.anchor is None:
+ raise EmitterError("anchor is not specified for alias")
+ self.process_anchor('*')
+ self.state = self.states.pop()
+
+ def expect_scalar(self):
+ self.increase_indent(flow=True)
+ self.process_scalar()
+ self.indent = self.indents.pop()
+ self.state = self.states.pop()
+
+ # Flow sequence handlers.
+
+ def expect_flow_sequence(self):
+ self.write_indicator('[', True, whitespace=True)
+ self.flow_level += 1
+ self.increase_indent(flow=True)
+ self.state = self.expect_first_flow_sequence_item
+
+ def expect_first_flow_sequence_item(self):
+ if isinstance(self.event, SequenceEndEvent):
+ self.indent = self.indents.pop()
+ self.flow_level -= 1
+ self.write_indicator(']', False)
+ self.state = self.states.pop()
+ else:
+ if self.canonical or self.column > self.best_width:
+ self.write_indent()
+ self.states.append(self.expect_flow_sequence_item)
+ self.expect_node(sequence=True)
+
+ def expect_flow_sequence_item(self):
+ if isinstance(self.event, SequenceEndEvent):
+ self.indent = self.indents.pop()
+ self.flow_level -= 1
+ if self.canonical:
+ self.write_indicator(',', False)
+ self.write_indent()
+ self.write_indicator(']', False)
+ self.state = self.states.pop()
+ else:
+ self.write_indicator(',', False)
+ if self.canonical or self.column > self.best_width:
+ self.write_indent()
+ self.states.append(self.expect_flow_sequence_item)
+ self.expect_node(sequence=True)
+
+ # Flow mapping handlers.
+
+ def expect_flow_mapping(self):
+ self.write_indicator('{', True, whitespace=True)
+ self.flow_level += 1
+ self.increase_indent(flow=True)
+ self.state = self.expect_first_flow_mapping_key
+
+ def expect_first_flow_mapping_key(self):
+ if isinstance(self.event, MappingEndEvent):
+ self.indent = self.indents.pop()
+ self.flow_level -= 1
+ self.write_indicator('}', False)
+ self.state = self.states.pop()
+ else:
+ if self.canonical or self.column > self.best_width:
+ self.write_indent()
+ if not self.canonical and self.check_simple_key():
+ self.states.append(self.expect_flow_mapping_simple_value)
+ self.expect_node(mapping=True, simple_key=True)
+ else:
+ self.write_indicator('?', True)
+ self.states.append(self.expect_flow_mapping_value)
+ self.expect_node(mapping=True)
+
+ def expect_flow_mapping_key(self):
+ if isinstance(self.event, MappingEndEvent):
+ self.indent = self.indents.pop()
+ self.flow_level -= 1
+ if self.canonical:
+ self.write_indicator(',', False)
+ self.write_indent()
+ self.write_indicator('}', False)
+ self.state = self.states.pop()
+ else:
+ self.write_indicator(',', False)
+ if self.canonical or self.column > self.best_width:
+ self.write_indent()
+ if not self.canonical and self.check_simple_key():
+ self.states.append(self.expect_flow_mapping_simple_value)
+ self.expect_node(mapping=True, simple_key=True)
+ else:
+ self.write_indicator('?', True)
+ self.states.append(self.expect_flow_mapping_value)
+ self.expect_node(mapping=True)
+
+ def expect_flow_mapping_simple_value(self):
+ self.write_indicator(':', False)
+ self.states.append(self.expect_flow_mapping_key)
+ self.expect_node(mapping=True)
+
+ def expect_flow_mapping_value(self):
+ if self.canonical or self.column > self.best_width:
+ self.write_indent()
+ self.write_indicator(':', True)
+ self.states.append(self.expect_flow_mapping_key)
+ self.expect_node(mapping=True)
+
+ # Block sequence handlers.
+
+ def expect_block_sequence(self):
+ indentless = (self.mapping_context and not self.indention)
+ self.increase_indent(flow=False, indentless=indentless)
+ self.state = self.expect_first_block_sequence_item
+
+ def expect_first_block_sequence_item(self):
+ return self.expect_block_sequence_item(first=True)
+
+ def expect_block_sequence_item(self, first=False):
+ if not first and isinstance(self.event, SequenceEndEvent):
+ self.indent = self.indents.pop()
+ self.state = self.states.pop()
+ else:
+ self.write_indent()
+ self.write_indicator('-', True, indention=True)
+ self.states.append(self.expect_block_sequence_item)
+ self.expect_node(sequence=True)
+
+ # Block mapping handlers.
+
+ def expect_block_mapping(self):
+ self.increase_indent(flow=False)
+ self.state = self.expect_first_block_mapping_key
+
+ def expect_first_block_mapping_key(self):
+ return self.expect_block_mapping_key(first=True)
+
+ def expect_block_mapping_key(self, first=False):
+ if not first and isinstance(self.event, MappingEndEvent):
+ self.indent = self.indents.pop()
+ self.state = self.states.pop()
+ else:
+ self.write_indent()
+ if self.check_simple_key():
+ self.states.append(self.expect_block_mapping_simple_value)
+ self.expect_node(mapping=True, simple_key=True)
+ else:
+ self.write_indicator('?', True, indention=True)
+ self.states.append(self.expect_block_mapping_value)
+ self.expect_node(mapping=True)
+
+ def expect_block_mapping_simple_value(self):
+ self.write_indicator(':', False)
+ self.states.append(self.expect_block_mapping_key)
+ self.expect_node(mapping=True)
+
+ def expect_block_mapping_value(self):
+ self.write_indent()
+ self.write_indicator(':', True, indention=True)
+ self.states.append(self.expect_block_mapping_key)
+ self.expect_node(mapping=True)
+
+ # Checkers.
+
+ def check_empty_sequence(self):
+ return (isinstance(self.event, SequenceStartEvent) and self.events
+ and isinstance(self.events[0], SequenceEndEvent))
+
+ def check_empty_mapping(self):
+ return (isinstance(self.event, MappingStartEvent) and self.events
+ and isinstance(self.events[0], MappingEndEvent))
+
+ def check_empty_document(self):
+ if not isinstance(self.event, DocumentStartEvent) or not self.events:
+ return False
+ event = self.events[0]
+ return (isinstance(event, ScalarEvent) and event.anchor is None
+ and event.tag is None and event.implicit and event.value == '')
+
+ def check_simple_key(self):
+ length = 0
+ if isinstance(self.event, NodeEvent) and self.event.anchor is not None:
+ if self.prepared_anchor is None:
+ self.prepared_anchor = self.prepare_anchor(self.event.anchor)
+ length += len(self.prepared_anchor)
+ if isinstance(self.event, (ScalarEvent, CollectionStartEvent)) \
+ and self.event.tag is not None:
+ if self.prepared_tag is None:
+ self.prepared_tag = self.prepare_tag(self.event.tag)
+ length += len(self.prepared_tag)
+ if isinstance(self.event, ScalarEvent):
+ if self.analysis is None:
+ self.analysis = self.analyze_scalar(self.event.value)
+ length += len(self.analysis.scalar)
+ return (length < 128 and (isinstance(self.event, AliasEvent)
+ or (isinstance(self.event, ScalarEvent)
+ and not self.analysis.empty and not self.analysis.multiline)
+ or self.check_empty_sequence() or self.check_empty_mapping()))
+
+ # Anchor, Tag, and Scalar processors.
+
+ def process_anchor(self, indicator):
+ if self.event.anchor is None:
+ self.prepared_anchor = None
+ return
+ if self.prepared_anchor is None:
+ self.prepared_anchor = self.prepare_anchor(self.event.anchor)
+ if self.prepared_anchor:
+ self.write_indicator(indicator+self.prepared_anchor, True)
+ self.prepared_anchor = None
+
+ def process_tag(self):
+ tag = self.event.tag
+ if isinstance(self.event, ScalarEvent):
+ if self.style is None:
+ self.style = self.choose_scalar_style()
+ if ((not self.canonical or tag is None) and
+ ((self.style == '' and self.event.implicit[0])
+ or (self.style != '' and self.event.implicit[1]))):
+ self.prepared_tag = None
+ return
+ if self.event.implicit[0] and tag is None:
+ tag = '!'
+ self.prepared_tag = None
+ else:
+ if (not self.canonical or tag is None) and self.event.implicit:
+ self.prepared_tag = None
+ return
+ if tag is None:
+ raise EmitterError("tag is not specified")
+ if self.prepared_tag is None:
+ self.prepared_tag = self.prepare_tag(tag)
+ if self.prepared_tag:
+ self.write_indicator(self.prepared_tag, True)
+ self.prepared_tag = None
+
+ def choose_scalar_style(self):
+ if self.analysis is None:
+ self.analysis = self.analyze_scalar(self.event.value)
+ if self.event.style == '"' or self.canonical:
+ return '"'
+ if not self.event.style and self.event.implicit[0]:
+ if (not (self.simple_key_context and
+ (self.analysis.empty or self.analysis.multiline))
+ and (self.flow_level and self.analysis.allow_flow_plain
+ or (not self.flow_level and self.analysis.allow_block_plain))):
+ return ''
+ if self.event.style and self.event.style in '|>':
+ if (not self.flow_level and not self.simple_key_context
+ and self.analysis.allow_block):
+ return self.event.style
+ if not self.event.style or self.event.style == '\'':
+ if (self.analysis.allow_single_quoted and
+ not (self.simple_key_context and self.analysis.multiline)):
+ return '\''
+ return '"'
+
+ def process_scalar(self):
+ if self.analysis is None:
+ self.analysis = self.analyze_scalar(self.event.value)
+ if self.style is None:
+ self.style = self.choose_scalar_style()
+ split = (not self.simple_key_context)
+ #if self.analysis.multiline and split \
+ # and (not self.style or self.style in '\'\"'):
+ # self.write_indent()
+ if self.style == '"':
+ self.write_double_quoted(self.analysis.scalar, split)
+ elif self.style == '\'':
+ self.write_single_quoted(self.analysis.scalar, split)
+ elif self.style == '>':
+ self.write_folded(self.analysis.scalar)
+ elif self.style == '|':
+ self.write_literal(self.analysis.scalar)
+ else:
+ self.write_plain(self.analysis.scalar, split)
+ self.analysis = None
+ self.style = None
+
+ # Analyzers.
+
+ def prepare_version(self, version):
+ major, minor = version
+ if major != 1:
+ raise EmitterError("unsupported YAML version: %d.%d" % (major, minor))
+ return '%d.%d' % (major, minor)
+
+ def prepare_tag_handle(self, handle):
+ if not handle:
+ raise EmitterError("tag handle must not be empty")
+ if handle[0] != '!' or handle[-1] != '!':
+ raise EmitterError("tag handle must start and end with '!': %r" % handle)
+ for ch in handle[1:-1]:
+ if not ('0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-_'):
+ raise EmitterError("invalid character %r in the tag handle: %r"
+ % (ch, handle))
+ return handle
+
+ def prepare_tag_prefix(self, prefix):
+ if not prefix:
+ raise EmitterError("tag prefix must not be empty")
+ chunks = []
+ start = end = 0
+ if prefix[0] == '!':
+ end = 1
+ while end < len(prefix):
+ ch = prefix[end]
+ if '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-;/?!:@&=+$,_.~*\'()[]':
+ end += 1
+ else:
+ if start < end:
+ chunks.append(prefix[start:end])
+ start = end = end+1
+ data = ch.encode('utf-8')
+ for ch in data:
+ chunks.append('%%%02X' % ord(ch))
+ if start < end:
+ chunks.append(prefix[start:end])
+ return ''.join(chunks)
+
+ def prepare_tag(self, tag):
+ if not tag:
+ raise EmitterError("tag must not be empty")
+ if tag == '!':
+ return tag
+ handle = None
+ suffix = tag
+ prefixes = sorted(self.tag_prefixes.keys())
+ for prefix in prefixes:
+ if tag.startswith(prefix) \
+ and (prefix == '!' or len(prefix) < len(tag)):
+ handle = self.tag_prefixes[prefix]
+ suffix = tag[len(prefix):]
+ chunks = []
+ start = end = 0
+ while end < len(suffix):
+ ch = suffix[end]
+ if '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-;/?:@&=+$,_.~*\'()[]' \
+ or (ch == '!' and handle != '!'):
+ end += 1
+ else:
+ if start < end:
+ chunks.append(suffix[start:end])
+ start = end = end+1
+ data = ch.encode('utf-8')
+ for ch in data:
+ chunks.append('%%%02X' % ord(ch))
+ if start < end:
+ chunks.append(suffix[start:end])
+ suffix_text = ''.join(chunks)
+ if handle:
+ return '%s%s' % (handle, suffix_text)
+ else:
+ return '!<%s>' % suffix_text
+
+ def prepare_anchor(self, anchor):
+ if not anchor:
+ raise EmitterError("anchor must not be empty")
+ for ch in anchor:
+ if not ('0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-_'):
+ raise EmitterError("invalid character %r in the anchor: %r"
+ % (ch, anchor))
+ return anchor
+
+ def analyze_scalar(self, scalar):
+
+ # Empty scalar is a special case.
+ if not scalar:
+ return ScalarAnalysis(scalar=scalar, empty=True, multiline=False,
+ allow_flow_plain=False, allow_block_plain=True,
+ allow_single_quoted=True, allow_double_quoted=True,
+ allow_block=False)
+
+ # Indicators and special characters.
+ block_indicators = False
+ flow_indicators = False
+ line_breaks = False
+ special_characters = False
+
+ # Important whitespace combinations.
+ leading_space = False
+ leading_break = False
+ trailing_space = False
+ trailing_break = False
+ break_space = False
+ space_break = False
+
+ # Check document indicators.
+ if scalar.startswith('---') or scalar.startswith('...'):
+ block_indicators = True
+ flow_indicators = True
+
+ # First character or preceded by a whitespace.
+ preceeded_by_whitespace = True
+
+ # Last character or followed by a whitespace.
+ followed_by_whitespace = (len(scalar) == 1 or
+ scalar[1] in '\0 \t\r\n\x85\u2028\u2029')
+
+ # The previous character is a space.
+ previous_space = False
+
+ # The previous character is a break.
+ previous_break = False
+
+ index = 0
+ while index < len(scalar):
+ ch = scalar[index]
+
+ # Check for indicators.
+ if index == 0:
+ # Leading indicators are special characters.
+ if ch in '#,[]{}&*!|>\'\"%@`':
+ flow_indicators = True
+ block_indicators = True
+ if ch in '?:':
+ flow_indicators = True
+ if followed_by_whitespace:
+ block_indicators = True
+ if ch == '-' and followed_by_whitespace:
+ flow_indicators = True
+ block_indicators = True
+ else:
+ # Some indicators cannot appear within a scalar as well.
+ if ch in ',?[]{}':
+ flow_indicators = True
+ if ch == ':':
+ flow_indicators = True
+ if followed_by_whitespace:
+ block_indicators = True
+ if ch == '#' and preceeded_by_whitespace:
+ flow_indicators = True
+ block_indicators = True
+
+ # Check for line breaks, special, and unicode characters.
+ if ch in '\n\x85\u2028\u2029':
+ line_breaks = True
+ if not (ch == '\n' or '\x20' <= ch <= '\x7E'):
+ if (ch == '\x85' or '\xA0' <= ch <= '\uD7FF'
+ or '\uE000' <= ch <= '\uFFFD') and ch != '\uFEFF':
+ unicode_characters = True
+ if not self.allow_unicode:
+ special_characters = True
+ else:
+ special_characters = True
+
+ # Detect important whitespace combinations.
+ if ch == ' ':
+ if index == 0:
+ leading_space = True
+ if index == len(scalar)-1:
+ trailing_space = True
+ if previous_break:
+ break_space = True
+ previous_space = True
+ previous_break = False
+ elif ch in '\n\x85\u2028\u2029':
+ if index == 0:
+ leading_break = True
+ if index == len(scalar)-1:
+ trailing_break = True
+ if previous_space:
+ space_break = True
+ previous_space = False
+ previous_break = True
+ else:
+ previous_space = False
+ previous_break = False
+
+ # Prepare for the next character.
+ index += 1
+ preceeded_by_whitespace = (ch in '\0 \t\r\n\x85\u2028\u2029')
+ followed_by_whitespace = (index+1 >= len(scalar) or
+ scalar[index+1] in '\0 \t\r\n\x85\u2028\u2029')
+
+ # Let's decide what styles are allowed.
+ allow_flow_plain = True
+ allow_block_plain = True
+ allow_single_quoted = True
+ allow_double_quoted = True
+ allow_block = True
+
+ # Leading and trailing whitespaces are bad for plain scalars.
+ if (leading_space or leading_break
+ or trailing_space or trailing_break):
+ allow_flow_plain = allow_block_plain = False
+
+ # We do not permit trailing spaces for block scalars.
+ if trailing_space:
+ allow_block = False
+
+ # Spaces at the beginning of a new line are only acceptable for block
+ # scalars.
+ if break_space:
+ allow_flow_plain = allow_block_plain = allow_single_quoted = False
+
+ # Spaces followed by breaks, as well as special character are only
+ # allowed for double quoted scalars.
+ if space_break or special_characters:
+ allow_flow_plain = allow_block_plain = \
+ allow_single_quoted = allow_block = False
+
+ # Although the plain scalar writer supports breaks, we never emit
+ # multiline plain scalars.
+ if line_breaks:
+ allow_flow_plain = allow_block_plain = False
+
+ # Flow indicators are forbidden for flow plain scalars.
+ if flow_indicators:
+ allow_flow_plain = False
+
+ # Block indicators are forbidden for block plain scalars.
+ if block_indicators:
+ allow_block_plain = False
+
+ return ScalarAnalysis(scalar=scalar,
+ empty=False, multiline=line_breaks,
+ allow_flow_plain=allow_flow_plain,
+ allow_block_plain=allow_block_plain,
+ allow_single_quoted=allow_single_quoted,
+ allow_double_quoted=allow_double_quoted,
+ allow_block=allow_block)
+
+ # Writers.
+
+ def flush_stream(self):
+ if hasattr(self.stream, 'flush'):
+ self.stream.flush()
+
+ def write_stream_start(self):
+ # Write BOM if needed.
+ if self.encoding and self.encoding.startswith('utf-16'):
+ self.stream.write('\uFEFF'.encode(self.encoding))
+
+ def write_stream_end(self):
+ self.flush_stream()
+
+ def write_indicator(self, indicator, need_whitespace,
+ whitespace=False, indention=False):
+ if self.whitespace or not need_whitespace:
+ data = indicator
+ else:
+ data = ' '+indicator
+ self.whitespace = whitespace
+ self.indention = self.indention and indention
+ self.column += len(data)
+ self.open_ended = False
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+
+ def write_indent(self):
+ indent = self.indent or 0
+ if not self.indention or self.column > indent \
+ or (self.column == indent and not self.whitespace):
+ self.write_line_break()
+ if self.column < indent:
+ self.whitespace = True
+ data = ' '*(indent-self.column)
+ self.column = indent
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+
+ def write_line_break(self, data=None):
+ if data is None:
+ data = self.best_line_break
+ self.whitespace = True
+ self.indention = True
+ self.line += 1
+ self.column = 0
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+
+ def write_version_directive(self, version_text):
+ data = '%%YAML %s' % version_text
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ self.write_line_break()
+
+ def write_tag_directive(self, handle_text, prefix_text):
+ data = '%%TAG %s %s' % (handle_text, prefix_text)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ self.write_line_break()
+
+ # Scalar streams.
+
+ def write_single_quoted(self, text, split=True):
+ self.write_indicator('\'', True)
+ spaces = False
+ breaks = False
+ start = end = 0
+ while end <= len(text):
+ ch = None
+ if end < len(text):
+ ch = text[end]
+ if spaces:
+ if ch is None or ch != ' ':
+ if start+1 == end and self.column > self.best_width and split \
+ and start != 0 and end != len(text):
+ self.write_indent()
+ else:
+ data = text[start:end]
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end
+ elif breaks:
+ if ch is None or ch not in '\n\x85\u2028\u2029':
+ if text[start] == '\n':
+ self.write_line_break()
+ for br in text[start:end]:
+ if br == '\n':
+ self.write_line_break()
+ else:
+ self.write_line_break(br)
+ self.write_indent()
+ start = end
+ else:
+ if ch is None or ch in ' \n\x85\u2028\u2029' or ch == '\'':
+ if start < end:
+ data = text[start:end]
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end
+ if ch == '\'':
+ data = '\'\''
+ self.column += 2
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end + 1
+ if ch is not None:
+ spaces = (ch == ' ')
+ breaks = (ch in '\n\x85\u2028\u2029')
+ end += 1
+ self.write_indicator('\'', False)
+
+ ESCAPE_REPLACEMENTS = {
+ '\0': '0',
+ '\x07': 'a',
+ '\x08': 'b',
+ '\x09': 't',
+ '\x0A': 'n',
+ '\x0B': 'v',
+ '\x0C': 'f',
+ '\x0D': 'r',
+ '\x1B': 'e',
+ '\"': '\"',
+ '\\': '\\',
+ '\x85': 'N',
+ '\xA0': '_',
+ '\u2028': 'L',
+ '\u2029': 'P',
+ }
+
+ def write_double_quoted(self, text, split=True):
+ self.write_indicator('"', True)
+ start = end = 0
+ while end <= len(text):
+ ch = None
+ if end < len(text):
+ ch = text[end]
+ if ch is None or ch in '"\\\x85\u2028\u2029\uFEFF' \
+ or not ('\x20' <= ch <= '\x7E'
+ or (self.allow_unicode
+ and ('\xA0' <= ch <= '\uD7FF'
+ or '\uE000' <= ch <= '\uFFFD'))):
+ if start < end:
+ data = text[start:end]
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end
+ if ch is not None:
+ if ch in self.ESCAPE_REPLACEMENTS:
+ data = '\\'+self.ESCAPE_REPLACEMENTS[ch]
+ elif ch <= '\xFF':
+ data = '\\x%02X' % ord(ch)
+ elif ch <= '\uFFFF':
+ data = '\\u%04X' % ord(ch)
+ else:
+ data = '\\U%08X' % ord(ch)
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end+1
+ if 0 < end < len(text)-1 and (ch == ' ' or start >= end) \
+ and self.column+(end-start) > self.best_width and split:
+ data = text[start:end]+'\\'
+ if start < end:
+ start = end
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ self.write_indent()
+ self.whitespace = False
+ self.indention = False
+ if text[start] == ' ':
+ data = '\\'
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ end += 1
+ self.write_indicator('"', False)
+
+ def determine_block_hints(self, text):
+ hints = ''
+ if text:
+ if text[0] in ' \n\x85\u2028\u2029':
+ hints += str(self.best_indent)
+ if text[-1] not in '\n\x85\u2028\u2029':
+ hints += '-'
+ elif len(text) == 1 or text[-2] in '\n\x85\u2028\u2029':
+ hints += '+'
+ return hints
+
+ def write_folded(self, text):
+ hints = self.determine_block_hints(text)
+ self.write_indicator('>'+hints, True)
+ if hints[-1:] == '+':
+ self.open_ended = True
+ self.write_line_break()
+ leading_space = True
+ spaces = False
+ breaks = True
+ start = end = 0
+ while end <= len(text):
+ ch = None
+ if end < len(text):
+ ch = text[end]
+ if breaks:
+ if ch is None or ch not in '\n\x85\u2028\u2029':
+ if not leading_space and ch is not None and ch != ' ' \
+ and text[start] == '\n':
+ self.write_line_break()
+ leading_space = (ch == ' ')
+ for br in text[start:end]:
+ if br == '\n':
+ self.write_line_break()
+ else:
+ self.write_line_break(br)
+ if ch is not None:
+ self.write_indent()
+ start = end
+ elif spaces:
+ if ch != ' ':
+ if start+1 == end and self.column > self.best_width:
+ self.write_indent()
+ else:
+ data = text[start:end]
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end
+ else:
+ if ch is None or ch in ' \n\x85\u2028\u2029':
+ data = text[start:end]
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ if ch is None:
+ self.write_line_break()
+ start = end
+ if ch is not None:
+ breaks = (ch in '\n\x85\u2028\u2029')
+ spaces = (ch == ' ')
+ end += 1
+
+ def write_literal(self, text):
+ hints = self.determine_block_hints(text)
+ self.write_indicator('|'+hints, True)
+ if hints[-1:] == '+':
+ self.open_ended = True
+ self.write_line_break()
+ breaks = True
+ start = end = 0
+ while end <= len(text):
+ ch = None
+ if end < len(text):
+ ch = text[end]
+ if breaks:
+ if ch is None or ch not in '\n\x85\u2028\u2029':
+ for br in text[start:end]:
+ if br == '\n':
+ self.write_line_break()
+ else:
+ self.write_line_break(br)
+ if ch is not None:
+ self.write_indent()
+ start = end
+ else:
+ if ch is None or ch in '\n\x85\u2028\u2029':
+ data = text[start:end]
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ if ch is None:
+ self.write_line_break()
+ start = end
+ if ch is not None:
+ breaks = (ch in '\n\x85\u2028\u2029')
+ end += 1
+
+ def write_plain(self, text, split=True):
+ if self.root_context:
+ self.open_ended = True
+ if not text:
+ return
+ if not self.whitespace:
+ data = ' '
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ self.whitespace = False
+ self.indention = False
+ spaces = False
+ breaks = False
+ start = end = 0
+ while end <= len(text):
+ ch = None
+ if end < len(text):
+ ch = text[end]
+ if spaces:
+ if ch != ' ':
+ if start+1 == end and self.column > self.best_width and split:
+ self.write_indent()
+ self.whitespace = False
+ self.indention = False
+ else:
+ data = text[start:end]
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end
+ elif breaks:
+ if ch not in '\n\x85\u2028\u2029':
+ if text[start] == '\n':
+ self.write_line_break()
+ for br in text[start:end]:
+ if br == '\n':
+ self.write_line_break()
+ else:
+ self.write_line_break(br)
+ self.write_indent()
+ self.whitespace = False
+ self.indention = False
+ start = end
+ else:
+ if ch is None or ch in ' \n\x85\u2028\u2029':
+ data = text[start:end]
+ self.column += len(data)
+ if self.encoding:
+ data = data.encode(self.encoding)
+ self.stream.write(data)
+ start = end
+ if ch is not None:
+ spaces = (ch == ' ')
+ breaks = (ch in '\n\x85\u2028\u2029')
+ end += 1
+
diff --git a/tablib/packages/yaml3/error.py b/tablib/packages/yaml3/error.py
new file mode 100644
index 0000000..b796b4d
--- /dev/null
+++ b/tablib/packages/yaml3/error.py
@@ -0,0 +1,75 @@
+
+__all__ = ['Mark', 'YAMLError', 'MarkedYAMLError']
+
+class Mark:
+
+ def __init__(self, name, index, line, column, buffer, pointer):
+ self.name = name
+ self.index = index
+ self.line = line
+ self.column = column
+ self.buffer = buffer
+ self.pointer = pointer
+
+ def get_snippet(self, indent=4, max_length=75):
+ if self.buffer is None:
+ return None
+ head = ''
+ start = self.pointer
+ while start > 0 and self.buffer[start-1] not in '\0\r\n\x85\u2028\u2029':
+ start -= 1
+ if self.pointer-start > max_length/2-1:
+ head = ' ... '
+ start += 5
+ break
+ tail = ''
+ end = self.pointer
+ while end < len(self.buffer) and self.buffer[end] not in '\0\r\n\x85\u2028\u2029':
+ end += 1
+ if end-self.pointer > max_length/2-1:
+ tail = ' ... '
+ end -= 5
+ break
+ snippet = self.buffer[start:end]
+ return ' '*indent + head + snippet + tail + '\n' \
+ + ' '*(indent+self.pointer-start+len(head)) + '^'
+
+ def __str__(self):
+ snippet = self.get_snippet()
+ where = " in \"%s\", line %d, column %d" \
+ % (self.name, self.line+1, self.column+1)
+ if snippet is not None:
+ where += ":\n"+snippet
+ return where
+
+class YAMLError(Exception):
+ pass
+
+class MarkedYAMLError(YAMLError):
+
+ def __init__(self, context=None, context_mark=None,
+ problem=None, problem_mark=None, note=None):
+ self.context = context
+ self.context_mark = context_mark
+ self.problem = problem
+ self.problem_mark = problem_mark
+ self.note = note
+
+ def __str__(self):
+ lines = []
+ if self.context is not None:
+ lines.append(self.context)
+ if self.context_mark is not None \
+ and (self.problem is None or self.problem_mark is None
+ or self.context_mark.name != self.problem_mark.name
+ or self.context_mark.line != self.problem_mark.line
+ or self.context_mark.column != self.problem_mark.column):
+ lines.append(str(self.context_mark))
+ if self.problem is not None:
+ lines.append(self.problem)
+ if self.problem_mark is not None:
+ lines.append(str(self.problem_mark))
+ if self.note is not None:
+ lines.append(self.note)
+ return '\n'.join(lines)
+
diff --git a/tablib/packages/yaml3/events.py b/tablib/packages/yaml3/events.py
new file mode 100644
index 0000000..f79ad38
--- /dev/null
+++ b/tablib/packages/yaml3/events.py
@@ -0,0 +1,86 @@
+
+# Abstract classes.
+
+class Event(object):
+ def __init__(self, start_mark=None, end_mark=None):
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ def __repr__(self):
+ attributes = [key for key in ['anchor', 'tag', 'implicit', 'value']
+ if hasattr(self, key)]
+ arguments = ', '.join(['%s=%r' % (key, getattr(self, key))
+ for key in attributes])
+ return '%s(%s)' % (self.__class__.__name__, arguments)
+
+class NodeEvent(Event):
+ def __init__(self, anchor, start_mark=None, end_mark=None):
+ self.anchor = anchor
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+
+class CollectionStartEvent(NodeEvent):
+ def __init__(self, anchor, tag, implicit, start_mark=None, end_mark=None,
+ flow_style=None):
+ self.anchor = anchor
+ self.tag = tag
+ self.implicit = implicit
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.flow_style = flow_style
+
+class CollectionEndEvent(Event):
+ pass
+
+# Implementations.
+
+class StreamStartEvent(Event):
+ def __init__(self, start_mark=None, end_mark=None, encoding=None):
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.encoding = encoding
+
+class StreamEndEvent(Event):
+ pass
+
+class DocumentStartEvent(Event):
+ def __init__(self, start_mark=None, end_mark=None,
+ explicit=None, version=None, tags=None):
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.explicit = explicit
+ self.version = version
+ self.tags = tags
+
+class DocumentEndEvent(Event):
+ def __init__(self, start_mark=None, end_mark=None,
+ explicit=None):
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.explicit = explicit
+
+class AliasEvent(NodeEvent):
+ pass
+
+class ScalarEvent(NodeEvent):
+ def __init__(self, anchor, tag, implicit, value,
+ start_mark=None, end_mark=None, style=None):
+ self.anchor = anchor
+ self.tag = tag
+ self.implicit = implicit
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.style = style
+
+class SequenceStartEvent(CollectionStartEvent):
+ pass
+
+class SequenceEndEvent(CollectionEndEvent):
+ pass
+
+class MappingStartEvent(CollectionStartEvent):
+ pass
+
+class MappingEndEvent(CollectionEndEvent):
+ pass
+
diff --git a/tablib/packages/yaml3/loader.py b/tablib/packages/yaml3/loader.py
new file mode 100644
index 0000000..08c8f01
--- /dev/null
+++ b/tablib/packages/yaml3/loader.py
@@ -0,0 +1,40 @@
+
+__all__ = ['BaseLoader', 'SafeLoader', 'Loader']
+
+from .reader import *
+from .scanner import *
+from .parser import *
+from .composer import *
+from .constructor import *
+from .resolver import *
+
+class BaseLoader(Reader, Scanner, Parser, Composer, BaseConstructor, BaseResolver):
+
+ def __init__(self, stream):
+ Reader.__init__(self, stream)
+ Scanner.__init__(self)
+ Parser.__init__(self)
+ Composer.__init__(self)
+ BaseConstructor.__init__(self)
+ BaseResolver.__init__(self)
+
+class SafeLoader(Reader, Scanner, Parser, Composer, SafeConstructor, Resolver):
+
+ def __init__(self, stream):
+ Reader.__init__(self, stream)
+ Scanner.__init__(self)
+ Parser.__init__(self)
+ Composer.__init__(self)
+ SafeConstructor.__init__(self)
+ Resolver.__init__(self)
+
+class Loader(Reader, Scanner, Parser, Composer, Constructor, Resolver):
+
+ def __init__(self, stream):
+ Reader.__init__(self, stream)
+ Scanner.__init__(self)
+ Parser.__init__(self)
+ Composer.__init__(self)
+ Constructor.__init__(self)
+ Resolver.__init__(self)
+
diff --git a/tablib/packages/yaml3/nodes.py b/tablib/packages/yaml3/nodes.py
new file mode 100644
index 0000000..c4f070c
--- /dev/null
+++ b/tablib/packages/yaml3/nodes.py
@@ -0,0 +1,49 @@
+
+class Node(object):
+ def __init__(self, tag, value, start_mark, end_mark):
+ self.tag = tag
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ def __repr__(self):
+ value = self.value
+ #if isinstance(value, list):
+ # if len(value) == 0:
+ # value = '<empty>'
+ # elif len(value) == 1:
+ # value = '<1 item>'
+ # else:
+ # value = '<%d items>' % len(value)
+ #else:
+ # if len(value) > 75:
+ # value = repr(value[:70]+u' ... ')
+ # else:
+ # value = repr(value)
+ value = repr(value)
+ return '%s(tag=%r, value=%s)' % (self.__class__.__name__, self.tag, value)
+
+class ScalarNode(Node):
+ id = 'scalar'
+ def __init__(self, tag, value,
+ start_mark=None, end_mark=None, style=None):
+ self.tag = tag
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.style = style
+
+class CollectionNode(Node):
+ def __init__(self, tag, value,
+ start_mark=None, end_mark=None, flow_style=None):
+ self.tag = tag
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.flow_style = flow_style
+
+class SequenceNode(CollectionNode):
+ id = 'sequence'
+
+class MappingNode(CollectionNode):
+ id = 'mapping'
+
diff --git a/tablib/packages/yaml3/parser.py b/tablib/packages/yaml3/parser.py
new file mode 100644
index 0000000..c147dd6
--- /dev/null
+++ b/tablib/packages/yaml3/parser.py
@@ -0,0 +1,584 @@
+
+# The following YAML grammar is LL(1) and is parsed by a recursive descent
+# parser.
+#
+# stream ::= STREAM-START implicit_document? explicit_document* STREAM-END
+# implicit_document ::= block_node DOCUMENT-END*
+# explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END*
+# block_node_or_indentless_sequence ::=
+# ALIAS
+# | properties (block_content | indentless_block_sequence)?
+# | block_content
+# | indentless_block_sequence
+# block_node ::= ALIAS
+# | properties block_content?
+# | block_content
+# flow_node ::= ALIAS
+# | properties flow_content?
+# | flow_content
+# properties ::= TAG ANCHOR? | ANCHOR TAG?
+# block_content ::= block_collection | flow_collection | SCALAR
+# flow_content ::= flow_collection | SCALAR
+# block_collection ::= block_sequence | block_mapping
+# flow_collection ::= flow_sequence | flow_mapping
+# block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END
+# indentless_sequence ::= (BLOCK-ENTRY block_node?)+
+# block_mapping ::= BLOCK-MAPPING_START
+# ((KEY block_node_or_indentless_sequence?)?
+# (VALUE block_node_or_indentless_sequence?)?)*
+# BLOCK-END
+# flow_sequence ::= FLOW-SEQUENCE-START
+# (flow_sequence_entry FLOW-ENTRY)*
+# flow_sequence_entry?
+# FLOW-SEQUENCE-END
+# flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?
+# flow_mapping ::= FLOW-MAPPING-START
+# (flow_mapping_entry FLOW-ENTRY)*
+# flow_mapping_entry?
+# FLOW-MAPPING-END
+# flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?
+#
+# FIRST sets:
+#
+# stream: { STREAM-START }
+# explicit_document: { DIRECTIVE DOCUMENT-START }
+# implicit_document: FIRST(block_node)
+# block_node: { ALIAS TAG ANCHOR SCALAR BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START }
+# flow_node: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START }
+# block_content: { BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START SCALAR }
+# flow_content: { FLOW-SEQUENCE-START FLOW-MAPPING-START SCALAR }
+# block_collection: { BLOCK-SEQUENCE-START BLOCK-MAPPING-START }
+# flow_collection: { FLOW-SEQUENCE-START FLOW-MAPPING-START }
+# block_sequence: { BLOCK-SEQUENCE-START }
+# block_mapping: { BLOCK-MAPPING-START }
+# block_node_or_indentless_sequence: { ALIAS ANCHOR TAG SCALAR BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START BLOCK-ENTRY }
+# indentless_sequence: { ENTRY }
+# flow_collection: { FLOW-SEQUENCE-START FLOW-MAPPING-START }
+# flow_sequence: { FLOW-SEQUENCE-START }
+# flow_mapping: { FLOW-MAPPING-START }
+# flow_sequence_entry: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START KEY }
+# flow_mapping_entry: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START KEY }
+
+__all__ = ['Parser', 'ParserError']
+
+from .error import MarkedYAMLError
+from .tokens import *
+from .events import *
+from .scanner import *
+
+class ParserError(MarkedYAMLError):
+ pass
+
+class Parser:
+ # Since writing a recursive-descendant parser is a straightforward task, we
+ # do not give many comments here.
+
+ DEFAULT_TAGS = {
+ '!': '!',
+ '!!': 'tag:yaml.org,2002:',
+ }
+
+ def __init__(self):
+ self.current_event = None
+ self.yaml_version = None
+ self.tag_handles = {}
+ self.states = []
+ self.marks = []
+ self.state = self.parse_stream_start
+
+ def check_event(self, *choices):
+ # Check the type of the next event.
+ if self.current_event is None:
+ if self.state:
+ self.current_event = self.state()
+ if self.current_event is not None:
+ if not choices:
+ return True
+ for choice in choices:
+ if isinstance(self.current_event, choice):
+ return True
+ return False
+
+ def peek_event(self):
+ # Get the next event.
+ if self.current_event is None:
+ if self.state:
+ self.current_event = self.state()
+ return self.current_event
+
+ def get_event(self):
+ # Get the next event and proceed further.
+ if self.current_event is None:
+ if self.state:
+ self.current_event = self.state()
+ value = self.current_event
+ self.current_event = None
+ return value
+
+ # stream ::= STREAM-START implicit_document? explicit_document* STREAM-END
+ # implicit_document ::= block_node DOCUMENT-END*
+ # explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END*
+
+ def parse_stream_start(self):
+
+ # Parse the stream start.
+ token = self.get_token()
+ event = StreamStartEvent(token.start_mark, token.end_mark,
+ encoding=token.encoding)
+
+ # Prepare the next state.
+ self.state = self.parse_implicit_document_start
+
+ return event
+
+ def parse_implicit_document_start(self):
+
+ # Parse an implicit document.
+ if not self.check_token(DirectiveToken, DocumentStartToken,
+ StreamEndToken):
+ self.tag_handles = self.DEFAULT_TAGS
+ token = self.peek_token()
+ start_mark = end_mark = token.start_mark
+ event = DocumentStartEvent(start_mark, end_mark,
+ explicit=False)
+
+ # Prepare the next state.
+ self.states.append(self.parse_document_end)
+ self.state = self.parse_block_node
+
+ return event
+
+ else:
+ return self.parse_document_start()
+
+ def parse_document_start(self):
+
+ # Parse any extra document end indicators.
+ while self.check_token(DocumentEndToken):
+ self.get_token()
+
+ # Parse an explicit document.
+ if not self.check_token(StreamEndToken):
+ token = self.peek_token()
+ start_mark = token.start_mark
+ version, tags = self.process_directives()
+ if not self.check_token(DocumentStartToken):
+ raise ParserError(None, None,
+ "expected '<document start>', but found %r"
+ % self.peek_token().id,
+ self.peek_token().start_mark)
+ token = self.get_token()
+ end_mark = token.end_mark
+ event = DocumentStartEvent(start_mark, end_mark,
+ explicit=True, version=version, tags=tags)
+ self.states.append(self.parse_document_end)
+ self.state = self.parse_document_content
+ else:
+ # Parse the end of the stream.
+ token = self.get_token()
+ event = StreamEndEvent(token.start_mark, token.end_mark)
+ assert not self.states
+ assert not self.marks
+ self.state = None
+ return event
+
+ def parse_document_end(self):
+
+ # Parse the document end.
+ token = self.peek_token()
+ start_mark = end_mark = token.start_mark
+ explicit = False
+ if self.check_token(DocumentEndToken):
+ token = self.get_token()
+ end_mark = token.end_mark
+ explicit = True
+ event = DocumentEndEvent(start_mark, end_mark,
+ explicit=explicit)
+
+ # Prepare the next state.
+ self.state = self.parse_document_start
+
+ return event
+
+ def parse_document_content(self):
+ if self.check_token(DirectiveToken,
+ DocumentStartToken, DocumentEndToken, StreamEndToken):
+ event = self.process_empty_scalar(self.peek_token().start_mark)
+ self.state = self.states.pop()
+ return event
+ else:
+ return self.parse_block_node()
+
+ def process_directives(self):
+ self.yaml_version = None
+ self.tag_handles = {}
+ while self.check_token(DirectiveToken):
+ token = self.get_token()
+ if token.name == 'YAML':
+ if self.yaml_version is not None:
+ raise ParserError(None, None,
+ "found duplicate YAML directive", token.start_mark)
+ major, minor = token.value
+ if major != 1:
+ raise ParserError(None, None,
+ "found incompatible YAML document (version 1.* is required)",
+ token.start_mark)
+ self.yaml_version = token.value
+ elif token.name == 'TAG':
+ handle, prefix = token.value
+ if handle in self.tag_handles:
+ raise ParserError(None, None,
+ "duplicate tag handle %r" % handle,
+ token.start_mark)
+ self.tag_handles[handle] = prefix
+ if self.tag_handles:
+ value = self.yaml_version, self.tag_handles.copy()
+ else:
+ value = self.yaml_version, None
+ for key in self.DEFAULT_TAGS:
+ if key not in self.tag_handles:
+ self.tag_handles[key] = self.DEFAULT_TAGS[key]
+ return value
+
+ # block_node_or_indentless_sequence ::= ALIAS
+ # | properties (block_content | indentless_block_sequence)?
+ # | block_content
+ # | indentless_block_sequence
+ # block_node ::= ALIAS
+ # | properties block_content?
+ # | block_content
+ # flow_node ::= ALIAS
+ # | properties flow_content?
+ # | flow_content
+ # properties ::= TAG ANCHOR? | ANCHOR TAG?
+ # block_content ::= block_collection | flow_collection | SCALAR
+ # flow_content ::= flow_collection | SCALAR
+ # block_collection ::= block_sequence | block_mapping
+ # flow_collection ::= flow_sequence | flow_mapping
+
+ def parse_block_node(self):
+ return self.parse_node(block=True)
+
+ def parse_flow_node(self):
+ return self.parse_node()
+
+ def parse_block_node_or_indentless_sequence(self):
+ return self.parse_node(block=True, indentless_sequence=True)
+
+ def parse_node(self, block=False, indentless_sequence=False):
+ if self.check_token(AliasToken):
+ token = self.get_token()
+ event = AliasEvent(token.value, token.start_mark, token.end_mark)
+ self.state = self.states.pop()
+ else:
+ anchor = None
+ tag = None
+ start_mark = end_mark = tag_mark = None
+ if self.check_token(AnchorToken):
+ token = self.get_token()
+ start_mark = token.start_mark
+ end_mark = token.end_mark
+ anchor = token.value
+ if self.check_token(TagToken):
+ token = self.get_token()
+ tag_mark = token.start_mark
+ end_mark = token.end_mark
+ tag = token.value
+ elif self.check_token(TagToken):
+ token = self.get_token()
+ start_mark = tag_mark = token.start_mark
+ end_mark = token.end_mark
+ tag = token.value
+ if self.check_token(AnchorToken):
+ token = self.get_token()
+ end_mark = token.end_mark
+ anchor = token.value
+ if tag is not None:
+ handle, suffix = tag
+ if handle is not None:
+ if handle not in self.tag_handles:
+ raise ParserError("while parsing a node", start_mark,
+ "found undefined tag handle %r" % handle,
+ tag_mark)
+ tag = self.tag_handles[handle]+suffix
+ else:
+ tag = suffix
+ #if tag == '!':
+ # raise ParserError("while parsing a node", start_mark,
+ # "found non-specific tag '!'", tag_mark,
+ # "Please check 'http://pyyaml.org/wiki/YAMLNonSpecificTag' and share your opinion.")
+ if start_mark is None:
+ start_mark = end_mark = self.peek_token().start_mark
+ event = None
+ implicit = (tag is None or tag == '!')
+ if indentless_sequence and self.check_token(BlockEntryToken):
+ end_mark = self.peek_token().end_mark
+ event = SequenceStartEvent(anchor, tag, implicit,
+ start_mark, end_mark)
+ self.state = self.parse_indentless_sequence_entry
+ else:
+ if self.check_token(ScalarToken):
+ token = self.get_token()
+ end_mark = token.end_mark
+ if (token.plain and tag is None) or tag == '!':
+ implicit = (True, False)
+ elif tag is None:
+ implicit = (False, True)
+ else:
+ implicit = (False, False)
+ event = ScalarEvent(anchor, tag, implicit, token.value,
+ start_mark, end_mark, style=token.style)
+ self.state = self.states.pop()
+ elif self.check_token(FlowSequenceStartToken):
+ end_mark = self.peek_token().end_mark
+ event = SequenceStartEvent(anchor, tag, implicit,
+ start_mark, end_mark, flow_style=True)
+ self.state = self.parse_flow_sequence_first_entry
+ elif self.check_token(FlowMappingStartToken):
+ end_mark = self.peek_token().end_mark
+ event = MappingStartEvent(anchor, tag, implicit,
+ start_mark, end_mark, flow_style=True)
+ self.state = self.parse_flow_mapping_first_key
+ elif block and self.check_token(BlockSequenceStartToken):
+ end_mark = self.peek_token().start_mark
+ event = SequenceStartEvent(anchor, tag, implicit,
+ start_mark, end_mark, flow_style=False)
+ self.state = self.parse_block_sequence_first_entry
+ elif block and self.check_token(BlockMappingStartToken):
+ end_mark = self.peek_token().start_mark
+ event = MappingStartEvent(anchor, tag, implicit,
+ start_mark, end_mark, flow_style=False)
+ self.state = self.parse_block_mapping_first_key
+ elif anchor is not None or tag is not None:
+ # Empty scalars are allowed even if a tag or an anchor is
+ # specified.
+ event = ScalarEvent(anchor, tag, (implicit, False), '',
+ start_mark, end_mark)
+ self.state = self.states.pop()
+ else:
+ if block:
+ node = 'block'
+ else:
+ node = 'flow'
+ token = self.peek_token()
+ raise ParserError("while parsing a %s node" % node, start_mark,
+ "expected the node content, but found %r" % token.id,
+ token.start_mark)
+ return event
+
+ # block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END
+
+ def parse_block_sequence_first_entry(self):
+ token = self.get_token()
+ self.marks.append(token.start_mark)
+ return self.parse_block_sequence_entry()
+
+ def parse_block_sequence_entry(self):
+ if self.check_token(BlockEntryToken):
+ token = self.get_token()
+ if not self.check_token(BlockEntryToken, BlockEndToken):
+ self.states.append(self.parse_block_sequence_entry)
+ return self.parse_block_node()
+ else:
+ self.state = self.parse_block_sequence_entry
+ return self.process_empty_scalar(token.end_mark)
+ if not self.check_token(BlockEndToken):
+ token = self.peek_token()
+ raise ParserError("while parsing a block collection", self.marks[-1],
+ "expected <block end>, but found %r" % token.id, token.start_mark)
+ token = self.get_token()
+ event = SequenceEndEvent(token.start_mark, token.end_mark)
+ self.state = self.states.pop()
+ self.marks.pop()
+ return event
+
+ # indentless_sequence ::= (BLOCK-ENTRY block_node?)+
+
+ def parse_indentless_sequence_entry(self):
+ if self.check_token(BlockEntryToken):
+ token = self.get_token()
+ if not self.check_token(BlockEntryToken,
+ KeyToken, ValueToken, BlockEndToken):
+ self.states.append(self.parse_indentless_sequence_entry)
+ return self.parse_block_node()
+ else:
+ self.state = self.parse_indentless_sequence_entry
+ return self.process_empty_scalar(token.end_mark)
+ token = self.peek_token()
+ event = SequenceEndEvent(token.start_mark, token.start_mark)
+ self.state = self.states.pop()
+ return event
+
+ # block_mapping ::= BLOCK-MAPPING_START
+ # ((KEY block_node_or_indentless_sequence?)?
+ # (VALUE block_node_or_indentless_sequence?)?)*
+ # BLOCK-END
+
+ def parse_block_mapping_first_key(self):
+ token = self.get_token()
+ self.marks.append(token.start_mark)
+ return self.parse_block_mapping_key()
+
+ def parse_block_mapping_key(self):
+ if self.check_token(KeyToken):
+ token = self.get_token()
+ if not self.check_token(KeyToken, ValueToken, BlockEndToken):
+ self.states.append(self.parse_block_mapping_value)
+ return self.parse_block_node_or_indentless_sequence()
+ else:
+ self.state = self.parse_block_mapping_value
+ return self.process_empty_scalar(token.end_mark)
+ if not self.check_token(BlockEndToken):
+ token = self.peek_token()
+ raise ParserError("while parsing a block mapping", self.marks[-1],
+ "expected <block end>, but found %r" % token.id, token.start_mark)
+ token = self.get_token()
+ event = MappingEndEvent(token.start_mark, token.end_mark)
+ self.state = self.states.pop()
+ self.marks.pop()
+ return event
+
+ def parse_block_mapping_value(self):
+ if self.check_token(ValueToken):
+ token = self.get_token()
+ if not self.check_token(KeyToken, ValueToken, BlockEndToken):
+ self.states.append(self.parse_block_mapping_key)
+ return self.parse_block_node_or_indentless_sequence()
+ else:
+ self.state = self.parse_block_mapping_key
+ return self.process_empty_scalar(token.end_mark)
+ else:
+ self.state = self.parse_block_mapping_key
+ token = self.peek_token()
+ return self.process_empty_scalar(token.start_mark)
+
+ # flow_sequence ::= FLOW-SEQUENCE-START
+ # (flow_sequence_entry FLOW-ENTRY)*
+ # flow_sequence_entry?
+ # FLOW-SEQUENCE-END
+ # flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?
+ #
+ # Note that while production rules for both flow_sequence_entry and
+ # flow_mapping_entry are equal, their interpretations are different.
+ # For `flow_sequence_entry`, the part `KEY flow_node? (VALUE flow_node?)?`
+ # generate an inline mapping (set syntax).
+
+ def parse_flow_sequence_first_entry(self):
+ token = self.get_token()
+ self.marks.append(token.start_mark)
+ return self.parse_flow_sequence_entry(first=True)
+
+ def parse_flow_sequence_entry(self, first=False):
+ if not self.check_token(FlowSequenceEndToken):
+ if not first:
+ if self.check_token(FlowEntryToken):
+ self.get_token()
+ else:
+ token = self.peek_token()
+ raise ParserError("while parsing a flow sequence", self.marks[-1],
+ "expected ',' or ']', but got %r" % token.id, token.start_mark)
+
+ if self.check_token(KeyToken):
+ token = self.peek_token()
+ event = MappingStartEvent(None, None, True,
+ token.start_mark, token.end_mark,
+ flow_style=True)
+ self.state = self.parse_flow_sequence_entry_mapping_key
+ return event
+ elif not self.check_token(FlowSequenceEndToken):
+ self.states.append(self.parse_flow_sequence_entry)
+ return self.parse_flow_node()
+ token = self.get_token()
+ event = SequenceEndEvent(token.start_mark, token.end_mark)
+ self.state = self.states.pop()
+ self.marks.pop()
+ return event
+
+ def parse_flow_sequence_entry_mapping_key(self):
+ token = self.get_token()
+ if not self.check_token(ValueToken,
+ FlowEntryToken, FlowSequenceEndToken):
+ self.states.append(self.parse_flow_sequence_entry_mapping_value)
+ return self.parse_flow_node()
+ else:
+ self.state = self.parse_flow_sequence_entry_mapping_value
+ return self.process_empty_scalar(token.end_mark)
+
+ def parse_flow_sequence_entry_mapping_value(self):
+ if self.check_token(ValueToken):
+ token = self.get_token()
+ if not self.check_token(FlowEntryToken, FlowSequenceEndToken):
+ self.states.append(self.parse_flow_sequence_entry_mapping_end)
+ return self.parse_flow_node()
+ else:
+ self.state = self.parse_flow_sequence_entry_mapping_end
+ return self.process_empty_scalar(token.end_mark)
+ else:
+ self.state = self.parse_flow_sequence_entry_mapping_end
+ token = self.peek_token()
+ return self.process_empty_scalar(token.start_mark)
+
+ def parse_flow_sequence_entry_mapping_end(self):
+ self.state = self.parse_flow_sequence_entry
+ token = self.peek_token()
+ return MappingEndEvent(token.start_mark, token.start_mark)
+
+ # flow_mapping ::= FLOW-MAPPING-START
+ # (flow_mapping_entry FLOW-ENTRY)*
+ # flow_mapping_entry?
+ # FLOW-MAPPING-END
+ # flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?
+
+ def parse_flow_mapping_first_key(self):
+ token = self.get_token()
+ self.marks.append(token.start_mark)
+ return self.parse_flow_mapping_key(first=True)
+
+ def parse_flow_mapping_key(self, first=False):
+ if not self.check_token(FlowMappingEndToken):
+ if not first:
+ if self.check_token(FlowEntryToken):
+ self.get_token()
+ else:
+ token = self.peek_token()
+ raise ParserError("while parsing a flow mapping", self.marks[-1],
+ "expected ',' or '}', but got %r" % token.id, token.start_mark)
+ if self.check_token(KeyToken):
+ token = self.get_token()
+ if not self.check_token(ValueToken,
+ FlowEntryToken, FlowMappingEndToken):
+ self.states.append(self.parse_flow_mapping_value)
+ return self.parse_flow_node()
+ else:
+ self.state = self.parse_flow_mapping_value
+ return self.process_empty_scalar(token.end_mark)
+ elif not self.check_token(FlowMappingEndToken):
+ self.states.append(self.parse_flow_mapping_empty_value)
+ return self.parse_flow_node()
+ token = self.get_token()
+ event = MappingEndEvent(token.start_mark, token.end_mark)
+ self.state = self.states.pop()
+ self.marks.pop()
+ return event
+
+ def parse_flow_mapping_value(self):
+ if self.check_token(ValueToken):
+ token = self.get_token()
+ if not self.check_token(FlowEntryToken, FlowMappingEndToken):
+ self.states.append(self.parse_flow_mapping_key)
+ return self.parse_flow_node()
+ else:
+ self.state = self.parse_flow_mapping_key
+ return self.process_empty_scalar(token.end_mark)
+ else:
+ self.state = self.parse_flow_mapping_key
+ token = self.peek_token()
+ return self.process_empty_scalar(token.start_mark)
+
+ def parse_flow_mapping_empty_value(self):
+ self.state = self.parse_flow_mapping_key
+ return self.process_empty_scalar(self.peek_token().start_mark)
+
+ def process_empty_scalar(self, mark):
+ return ScalarEvent(None, None, (True, False), '', mark, mark)
+
diff --git a/tablib/packages/yaml3/reader.py b/tablib/packages/yaml3/reader.py
new file mode 100644
index 0000000..f70e920
--- /dev/null
+++ b/tablib/packages/yaml3/reader.py
@@ -0,0 +1,192 @@
+# This module contains abstractions for the input stream. You don't have to
+# looks further, there are no pretty code.
+#
+# We define two classes here.
+#
+# Mark(source, line, column)
+# It's just a record and its only use is producing nice error messages.
+# Parser does not use it for any other purposes.
+#
+# Reader(source, data)
+# Reader determines the encoding of `data` and converts it to unicode.
+# Reader provides the following methods and attributes:
+# reader.peek(length=1) - return the next `length` characters
+# reader.forward(length=1) - move the current position to `length` characters.
+# reader.index - the number of the current character.
+# reader.line, stream.column - the line and the column of the current character.
+
+__all__ = ['Reader', 'ReaderError']
+
+from .error import YAMLError, Mark
+
+import codecs, re
+
+class ReaderError(YAMLError):
+
+ def __init__(self, name, position, character, encoding, reason):
+ self.name = name
+ self.character = character
+ self.position = position
+ self.encoding = encoding
+ self.reason = reason
+
+ def __str__(self):
+ if isinstance(self.character, bytes):
+ return "'%s' codec can't decode byte #x%02x: %s\n" \
+ " in \"%s\", position %d" \
+ % (self.encoding, ord(self.character), self.reason,
+ self.name, self.position)
+ else:
+ return "unacceptable character #x%04x: %s\n" \
+ " in \"%s\", position %d" \
+ % (self.character, self.reason,
+ self.name, self.position)
+
+class Reader(object):
+ # Reader:
+ # - determines the data encoding and converts it to a unicode string,
+ # - checks if characters are in allowed range,
+ # - adds '\0' to the end.
+
+ # Reader accepts
+ # - a `bytes` object,
+ # - a `str` object,
+ # - a file-like object with its `read` method returning `str`,
+ # - a file-like object with its `read` method returning `unicode`.
+
+ # Yeah, it's ugly and slow.
+
+ def __init__(self, stream):
+ self.name = None
+ self.stream = None
+ self.stream_pointer = 0
+ self.eof = True
+ self.buffer = ''
+ self.pointer = 0
+ self.raw_buffer = None
+ self.raw_decode = None
+ self.encoding = None
+ self.index = 0
+ self.line = 0
+ self.column = 0
+ if isinstance(stream, str):
+ self.name = "<unicode string>"
+ self.check_printable(stream)
+ self.buffer = stream+'\0'
+ elif isinstance(stream, bytes):
+ self.name = "<byte string>"
+ self.raw_buffer = stream
+ self.determine_encoding()
+ else:
+ self.stream = stream
+ self.name = getattr(stream, 'name', "<file>")
+ self.eof = False
+ self.raw_buffer = None
+ self.determine_encoding()
+
+ def peek(self, index=0):
+ try:
+ return self.buffer[self.pointer+index]
+ except IndexError:
+ self.update(index+1)
+ return self.buffer[self.pointer+index]
+
+ def prefix(self, length=1):
+ if self.pointer+length >= len(self.buffer):
+ self.update(length)
+ return self.buffer[self.pointer:self.pointer+length]
+
+ def forward(self, length=1):
+ if self.pointer+length+1 >= len(self.buffer):
+ self.update(length+1)
+ while length:
+ ch = self.buffer[self.pointer]
+ self.pointer += 1
+ self.index += 1
+ if ch in '\n\x85\u2028\u2029' \
+ or (ch == '\r' and self.buffer[self.pointer] != '\n'):
+ self.line += 1
+ self.column = 0
+ elif ch != '\uFEFF':
+ self.column += 1
+ length -= 1
+
+ def get_mark(self):
+ if self.stream is None:
+ return Mark(self.name, self.index, self.line, self.column,
+ self.buffer, self.pointer)
+ else:
+ return Mark(self.name, self.index, self.line, self.column,
+ None, None)
+
+ def determine_encoding(self):
+ while not self.eof and (self.raw_buffer is None or len(self.raw_buffer) < 2):
+ self.update_raw()
+ if isinstance(self.raw_buffer, bytes):
+ if self.raw_buffer.startswith(codecs.BOM_UTF16_LE):
+ self.raw_decode = codecs.utf_16_le_decode
+ self.encoding = 'utf-16-le'
+ elif self.raw_buffer.startswith(codecs.BOM_UTF16_BE):
+ self.raw_decode = codecs.utf_16_be_decode
+ self.encoding = 'utf-16-be'
+ else:
+ self.raw_decode = codecs.utf_8_decode
+ self.encoding = 'utf-8'
+ self.update(1)
+
+ NON_PRINTABLE = re.compile('[^\x09\x0A\x0D\x20-\x7E\x85\xA0-\uD7FF\uE000-\uFFFD]')
+ def check_printable(self, data):
+ match = self.NON_PRINTABLE.search(data)
+ if match:
+ character = match.group()
+ position = self.index+(len(self.buffer)-self.pointer)+match.start()
+ raise ReaderError(self.name, position, ord(character),
+ 'unicode', "special characters are not allowed")
+
+ def update(self, length):
+ if self.raw_buffer is None:
+ return
+ self.buffer = self.buffer[self.pointer:]
+ self.pointer = 0
+ while len(self.buffer) < length:
+ if not self.eof:
+ self.update_raw()
+ if self.raw_decode is not None:
+ try:
+ data, converted = self.raw_decode(self.raw_buffer,
+ 'strict', self.eof)
+ except UnicodeDecodeError as exc:
+ character = self.raw_buffer[exc.start]
+ if self.stream is not None:
+ position = self.stream_pointer-len(self.raw_buffer)+exc.start
+ else:
+ position = exc.start
+ raise ReaderError(self.name, position, character,
+ exc.encoding, exc.reason)
+ else:
+ data = self.raw_buffer
+ converted = len(data)
+ self.check_printable(data)
+ self.buffer += data
+ self.raw_buffer = self.raw_buffer[converted:]
+ if self.eof:
+ self.buffer += '\0'
+ self.raw_buffer = None
+ break
+
+ def update_raw(self, size=4096):
+ data = self.stream.read(size)
+ if self.raw_buffer is None:
+ self.raw_buffer = data
+ else:
+ self.raw_buffer += data
+ self.stream_pointer += len(data)
+ if not data:
+ self.eof = True
+
+#try:
+# import psyco
+# psyco.bind(Reader)
+#except ImportError:
+# pass
+
diff --git a/tablib/packages/yaml3/representer.py b/tablib/packages/yaml3/representer.py
new file mode 100644
index 0000000..67cd6fd
--- /dev/null
+++ b/tablib/packages/yaml3/representer.py
@@ -0,0 +1,374 @@
+
+__all__ = ['BaseRepresenter', 'SafeRepresenter', 'Representer',
+ 'RepresenterError']
+
+from .error import *
+from .nodes import *
+
+import datetime, sys, copyreg, types, base64
+
+class RepresenterError(YAMLError):
+ pass
+
+class BaseRepresenter:
+
+ yaml_representers = {}
+ yaml_multi_representers = {}
+
+ def __init__(self, default_style=None, default_flow_style=None):
+ self.default_style = default_style
+ self.default_flow_style = default_flow_style
+ self.represented_objects = {}
+ self.object_keeper = []
+ self.alias_key = None
+
+ def represent(self, data):
+ node = self.represent_data(data)
+ self.serialize(node)
+ self.represented_objects = {}
+ self.object_keeper = []
+ self.alias_key = None
+
+ def represent_data(self, data):
+ if self.ignore_aliases(data):
+ self.alias_key = None
+ else:
+ self.alias_key = id(data)
+ if self.alias_key is not None:
+ if self.alias_key in self.represented_objects:
+ node = self.represented_objects[self.alias_key]
+ #if node is None:
+ # raise RepresenterError("recursive objects are not allowed: %r" % data)
+ return node
+ #self.represented_objects[alias_key] = None
+ self.object_keeper.append(data)
+ data_types = type(data).__mro__
+ if data_types[0] in self.yaml_representers:
+ node = self.yaml_representers[data_types[0]](self, data)
+ else:
+ for data_type in data_types:
+ if data_type in self.yaml_multi_representers:
+ node = self.yaml_multi_representers[data_type](self, data)
+ break
+ else:
+ if None in self.yaml_multi_representers:
+ node = self.yaml_multi_representers[None](self, data)
+ elif None in self.yaml_representers:
+ node = self.yaml_representers[None](self, data)
+ else:
+ node = ScalarNode(None, str(data))
+ #if alias_key is not None:
+ # self.represented_objects[alias_key] = node
+ return node
+
+ @classmethod
+ def add_representer(cls, data_type, representer):
+ if not 'yaml_representers' in cls.__dict__:
+ cls.yaml_representers = cls.yaml_representers.copy()
+ cls.yaml_representers[data_type] = representer
+
+ @classmethod
+ def add_multi_representer(cls, data_type, representer):
+ if not 'yaml_multi_representers' in cls.__dict__:
+ cls.yaml_multi_representers = cls.yaml_multi_representers.copy()
+ cls.yaml_multi_representers[data_type] = representer
+
+ def represent_scalar(self, tag, value, style=None):
+ if style is None:
+ style = self.default_style
+ node = ScalarNode(tag, value, style=style)
+ if self.alias_key is not None:
+ self.represented_objects[self.alias_key] = node
+ return node
+
+ def represent_sequence(self, tag, sequence, flow_style=None):
+ value = []
+ node = SequenceNode(tag, value, flow_style=flow_style)
+ if self.alias_key is not None:
+ self.represented_objects[self.alias_key] = node
+ best_style = True
+ for item in sequence:
+ node_item = self.represent_data(item)
+ if not (isinstance(node_item, ScalarNode) and not node_item.style):
+ best_style = False
+ value.append(node_item)
+ if flow_style is None:
+ if self.default_flow_style is not None:
+ node.flow_style = self.default_flow_style
+ else:
+ node.flow_style = best_style
+ return node
+
+ def represent_mapping(self, tag, mapping, flow_style=None):
+ value = []
+ node = MappingNode(tag, value, flow_style=flow_style)
+ if self.alias_key is not None:
+ self.represented_objects[self.alias_key] = node
+ best_style = True
+ if hasattr(mapping, 'items'):
+ mapping = list(mapping.items())
+ try:
+ mapping = sorted(mapping)
+ except TypeError:
+ pass
+ for item_key, item_value in mapping:
+ node_key = self.represent_data(item_key)
+ node_value = self.represent_data(item_value)
+ if not (isinstance(node_key, ScalarNode) and not node_key.style):
+ best_style = False
+ if not (isinstance(node_value, ScalarNode) and not node_value.style):
+ best_style = False
+ value.append((node_key, node_value))
+ if flow_style is None:
+ if self.default_flow_style is not None:
+ node.flow_style = self.default_flow_style
+ else:
+ node.flow_style = best_style
+ return node
+
+ def ignore_aliases(self, data):
+ return False
+
+class SafeRepresenter(BaseRepresenter):
+
+ def ignore_aliases(self, data):
+ if data in [None, ()]:
+ return True
+ if isinstance(data, (str, bytes, bool, int, float)):
+ return True
+
+ def represent_none(self, data):
+ return self.represent_scalar('tag:yaml.org,2002:null', 'null')
+
+ def represent_str(self, data):
+ return self.represent_scalar('tag:yaml.org,2002:str', data)
+
+ def represent_binary(self, data):
+ if hasattr(base64, 'encodebytes'):
+ data = base64.encodebytes(data).decode('ascii')
+ else:
+ data = base64.encodestring(data).decode('ascii')
+ return self.represent_scalar('tag:yaml.org,2002:binary', data, style='|')
+
+ def represent_bool(self, data):
+ if data:
+ value = 'true'
+ else:
+ value = 'false'
+ return self.represent_scalar('tag:yaml.org,2002:bool', value)
+
+ def represent_int(self, data):
+ return self.represent_scalar('tag:yaml.org,2002:int', str(data))
+
+ inf_value = 1e300
+ while repr(inf_value) != repr(inf_value*inf_value):
+ inf_value *= inf_value
+
+ def represent_float(self, data):
+ if data != data or (data == 0.0 and data == 1.0):
+ value = '.nan'
+ elif data == self.inf_value:
+ value = '.inf'
+ elif data == -self.inf_value:
+ value = '-.inf'
+ else:
+ value = repr(data).lower()
+ # Note that in some cases `repr(data)` represents a float number
+ # without the decimal parts. For instance:
+ # >>> repr(1e17)
+ # '1e17'
+ # Unfortunately, this is not a valid float representation according
+ # to the definition of the `!!float` tag. We fix this by adding
+ # '.0' before the 'e' symbol.
+ if '.' not in value and 'e' in value:
+ value = value.replace('e', '.0e', 1)
+ return self.represent_scalar('tag:yaml.org,2002:float', value)
+
+ def represent_list(self, data):
+ #pairs = (len(data) > 0 and isinstance(data, list))
+ #if pairs:
+ # for item in data:
+ # if not isinstance(item, tuple) or len(item) != 2:
+ # pairs = False
+ # break
+ #if not pairs:
+ return self.represent_sequence('tag:yaml.org,2002:seq', data)
+ #value = []
+ #for item_key, item_value in data:
+ # value.append(self.represent_mapping(u'tag:yaml.org,2002:map',
+ # [(item_key, item_value)]))
+ #return SequenceNode(u'tag:yaml.org,2002:pairs', value)
+
+ def represent_dict(self, data):
+ return self.represent_mapping('tag:yaml.org,2002:map', data)
+
+ def represent_set(self, data):
+ value = {}
+ for key in data:
+ value[key] = None
+ return self.represent_mapping('tag:yaml.org,2002:set', value)
+
+ def represent_date(self, data):
+ value = data.isoformat()
+ return self.represent_scalar('tag:yaml.org,2002:timestamp', value)
+
+ def represent_datetime(self, data):
+ value = data.isoformat(' ')
+ return self.represent_scalar('tag:yaml.org,2002:timestamp', value)
+
+ def represent_yaml_object(self, tag, data, cls, flow_style=None):
+ if hasattr(data, '__getstate__'):
+ state = data.__getstate__()
+ else:
+ state = data.__dict__.copy()
+ return self.represent_mapping(tag, state, flow_style=flow_style)
+
+ def represent_undefined(self, data):
+ raise RepresenterError("cannot represent an object: %s" % data)
+
+SafeRepresenter.add_representer(type(None),
+ SafeRepresenter.represent_none)
+
+SafeRepresenter.add_representer(str,
+ SafeRepresenter.represent_str)
+
+SafeRepresenter.add_representer(bytes,
+ SafeRepresenter.represent_binary)
+
+SafeRepresenter.add_representer(bool,
+ SafeRepresenter.represent_bool)
+
+SafeRepresenter.add_representer(int,
+ SafeRepresenter.represent_int)
+
+SafeRepresenter.add_representer(float,
+ SafeRepresenter.represent_float)
+
+SafeRepresenter.add_representer(list,
+ SafeRepresenter.represent_list)
+
+SafeRepresenter.add_representer(tuple,
+ SafeRepresenter.represent_list)
+
+SafeRepresenter.add_representer(dict,
+ SafeRepresenter.represent_dict)
+
+SafeRepresenter.add_representer(set,
+ SafeRepresenter.represent_set)
+
+SafeRepresenter.add_representer(datetime.date,
+ SafeRepresenter.represent_date)
+
+SafeRepresenter.add_representer(datetime.datetime,
+ SafeRepresenter.represent_datetime)
+
+SafeRepresenter.add_representer(None,
+ SafeRepresenter.represent_undefined)
+
+class Representer(SafeRepresenter):
+
+ def represent_complex(self, data):
+ if data.imag == 0.0:
+ data = '%r' % data.real
+ elif data.real == 0.0:
+ data = '%rj' % data.imag
+ elif data.imag > 0:
+ data = '%r+%rj' % (data.real, data.imag)
+ else:
+ data = '%r%rj' % (data.real, data.imag)
+ return self.represent_scalar('tag:yaml.org,2002:python/complex', data)
+
+ def represent_tuple(self, data):
+ return self.represent_sequence('tag:yaml.org,2002:python/tuple', data)
+
+ def represent_name(self, data):
+ name = '%s.%s' % (data.__module__, data.__name__)
+ return self.represent_scalar('tag:yaml.org,2002:python/name:'+name, '')
+
+ def represent_module(self, data):
+ return self.represent_scalar(
+ 'tag:yaml.org,2002:python/module:'+data.__name__, '')
+
+ def represent_object(self, data):
+ # We use __reduce__ API to save the data. data.__reduce__ returns
+ # a tuple of length 2-5:
+ # (function, args, state, listitems, dictitems)
+
+ # For reconstructing, we calls function(*args), then set its state,
+ # listitems, and dictitems if they are not None.
+
+ # A special case is when function.__name__ == '__newobj__'. In this
+ # case we create the object with args[0].__new__(*args).
+
+ # Another special case is when __reduce__ returns a string - we don't
+ # support it.
+
+ # We produce a !!python/object, !!python/object/new or
+ # !!python/object/apply node.
+
+ cls = type(data)
+ if cls in copyreg.dispatch_table:
+ reduce = copyreg.dispatch_table[cls](data)
+ elif hasattr(data, '__reduce_ex__'):
+ reduce = data.__reduce_ex__(2)
+ elif hasattr(data, '__reduce__'):
+ reduce = data.__reduce__()
+ else:
+ raise RepresenterError("cannot represent object: %r" % data)
+ reduce = (list(reduce)+[None]*5)[:5]
+ function, args, state, listitems, dictitems = reduce
+ args = list(args)
+ if state is None:
+ state = {}
+ if listitems is not None:
+ listitems = list(listitems)
+ if dictitems is not None:
+ dictitems = dict(dictitems)
+ if function.__name__ == '__newobj__':
+ function = args[0]
+ args = args[1:]
+ tag = 'tag:yaml.org,2002:python/object/new:'
+ newobj = True
+ else:
+ tag = 'tag:yaml.org,2002:python/object/apply:'
+ newobj = False
+ function_name = '%s.%s' % (function.__module__, function.__name__)
+ if not args and not listitems and not dictitems \
+ and isinstance(state, dict) and newobj:
+ return self.represent_mapping(
+ 'tag:yaml.org,2002:python/object:'+function_name, state)
+ if not listitems and not dictitems \
+ and isinstance(state, dict) and not state:
+ return self.represent_sequence(tag+function_name, args)
+ value = {}
+ if args:
+ value['args'] = args
+ if state or not isinstance(state, dict):
+ value['state'] = state
+ if listitems:
+ value['listitems'] = listitems
+ if dictitems:
+ value['dictitems'] = dictitems
+ return self.represent_mapping(tag+function_name, value)
+
+Representer.add_representer(complex,
+ Representer.represent_complex)
+
+Representer.add_representer(tuple,
+ Representer.represent_tuple)
+
+Representer.add_representer(type,
+ Representer.represent_name)
+
+Representer.add_representer(types.FunctionType,
+ Representer.represent_name)
+
+Representer.add_representer(types.BuiltinFunctionType,
+ Representer.represent_name)
+
+Representer.add_representer(types.ModuleType,
+ Representer.represent_module)
+
+Representer.add_multi_representer(object,
+ Representer.represent_object)
+
diff --git a/tablib/packages/yaml3/resolver.py b/tablib/packages/yaml3/resolver.py
new file mode 100644
index 0000000..0eece25
--- /dev/null
+++ b/tablib/packages/yaml3/resolver.py
@@ -0,0 +1,224 @@
+
+__all__ = ['BaseResolver', 'Resolver']
+
+from .error import *
+from .nodes import *
+
+import re
+
+class ResolverError(YAMLError):
+ pass
+
+class BaseResolver:
+
+ DEFAULT_SCALAR_TAG = 'tag:yaml.org,2002:str'
+ DEFAULT_SEQUENCE_TAG = 'tag:yaml.org,2002:seq'
+ DEFAULT_MAPPING_TAG = 'tag:yaml.org,2002:map'
+
+ yaml_implicit_resolvers = {}
+ yaml_path_resolvers = {}
+
+ def __init__(self):
+ self.resolver_exact_paths = []
+ self.resolver_prefix_paths = []
+
+ @classmethod
+ def add_implicit_resolver(cls, tag, regexp, first):
+ if not 'yaml_implicit_resolvers' in cls.__dict__:
+ cls.yaml_implicit_resolvers = cls.yaml_implicit_resolvers.copy()
+ if first is None:
+ first = [None]
+ for ch in first:
+ cls.yaml_implicit_resolvers.setdefault(ch, []).append((tag, regexp))
+
+ @classmethod
+ def add_path_resolver(cls, tag, path, kind=None):
+ # Note: `add_path_resolver` is experimental. The API could be changed.
+ # `new_path` is a pattern that is matched against the path from the
+ # root to the node that is being considered. `node_path` elements are
+ # tuples `(node_check, index_check)`. `node_check` is a node class:
+ # `ScalarNode`, `SequenceNode`, `MappingNode` or `None`. `None`
+ # matches any kind of a node. `index_check` could be `None`, a boolean
+ # value, a string value, or a number. `None` and `False` match against
+ # any _value_ of sequence and mapping nodes. `True` matches against
+ # any _key_ of a mapping node. A string `index_check` matches against
+ # a mapping value that corresponds to a scalar key which content is
+ # equal to the `index_check` value. An integer `index_check` matches
+ # against a sequence value with the index equal to `index_check`.
+ if not 'yaml_path_resolvers' in cls.__dict__:
+ cls.yaml_path_resolvers = cls.yaml_path_resolvers.copy()
+ new_path = []
+ for element in path:
+ if isinstance(element, (list, tuple)):
+ if len(element) == 2:
+ node_check, index_check = element
+ elif len(element) == 1:
+ node_check = element[0]
+ index_check = True
+ else:
+ raise ResolverError("Invalid path element: %s" % element)
+ else:
+ node_check = None
+ index_check = element
+ if node_check is str:
+ node_check = ScalarNode
+ elif node_check is list:
+ node_check = SequenceNode
+ elif node_check is dict:
+ node_check = MappingNode
+ elif node_check not in [ScalarNode, SequenceNode, MappingNode] \
+ and not isinstance(node_check, str) \
+ and node_check is not None:
+ raise ResolverError("Invalid node checker: %s" % node_check)
+ if not isinstance(index_check, (str, int)) \
+ and index_check is not None:
+ raise ResolverError("Invalid index checker: %s" % index_check)
+ new_path.append((node_check, index_check))
+ if kind is str:
+ kind = ScalarNode
+ elif kind is list:
+ kind = SequenceNode
+ elif kind is dict:
+ kind = MappingNode
+ elif kind not in [ScalarNode, SequenceNode, MappingNode] \
+ and kind is not None:
+ raise ResolverError("Invalid node kind: %s" % kind)
+ cls.yaml_path_resolvers[tuple(new_path), kind] = tag
+
+ def descend_resolver(self, current_node, current_index):
+ if not self.yaml_path_resolvers:
+ return
+ exact_paths = {}
+ prefix_paths = []
+ if current_node:
+ depth = len(self.resolver_prefix_paths)
+ for path, kind in self.resolver_prefix_paths[-1]:
+ if self.check_resolver_prefix(depth, path, kind,
+ current_node, current_index):
+ if len(path) > depth:
+ prefix_paths.append((path, kind))
+ else:
+ exact_paths[kind] = self.yaml_path_resolvers[path, kind]
+ else:
+ for path, kind in self.yaml_path_resolvers:
+ if not path:
+ exact_paths[kind] = self.yaml_path_resolvers[path, kind]
+ else:
+ prefix_paths.append((path, kind))
+ self.resolver_exact_paths.append(exact_paths)
+ self.resolver_prefix_paths.append(prefix_paths)
+
+ def ascend_resolver(self):
+ if not self.yaml_path_resolvers:
+ return
+ self.resolver_exact_paths.pop()
+ self.resolver_prefix_paths.pop()
+
+ def check_resolver_prefix(self, depth, path, kind,
+ current_node, current_index):
+ node_check, index_check = path[depth-1]
+ if isinstance(node_check, str):
+ if current_node.tag != node_check:
+ return
+ elif node_check is not None:
+ if not isinstance(current_node, node_check):
+ return
+ if index_check is True and current_index is not None:
+ return
+ if (index_check is False or index_check is None) \
+ and current_index is None:
+ return
+ if isinstance(index_check, str):
+ if not (isinstance(current_index, ScalarNode)
+ and index_check == current_index.value):
+ return
+ elif isinstance(index_check, int) and not isinstance(index_check, bool):
+ if index_check != current_index:
+ return
+ return True
+
+ def resolve(self, kind, value, implicit):
+ if kind is ScalarNode and implicit[0]:
+ if value == '':
+ resolvers = self.yaml_implicit_resolvers.get('', [])
+ else:
+ resolvers = self.yaml_implicit_resolvers.get(value[0], [])
+ resolvers += self.yaml_implicit_resolvers.get(None, [])
+ for tag, regexp in resolvers:
+ if regexp.match(value):
+ return tag
+ implicit = implicit[1]
+ if self.yaml_path_resolvers:
+ exact_paths = self.resolver_exact_paths[-1]
+ if kind in exact_paths:
+ return exact_paths[kind]
+ if None in exact_paths:
+ return exact_paths[None]
+ if kind is ScalarNode:
+ return self.DEFAULT_SCALAR_TAG
+ elif kind is SequenceNode:
+ return self.DEFAULT_SEQUENCE_TAG
+ elif kind is MappingNode:
+ return self.DEFAULT_MAPPING_TAG
+
+class Resolver(BaseResolver):
+ pass
+
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:bool',
+ re.compile(r'''^(?:yes|Yes|YES|no|No|NO
+ |true|True|TRUE|false|False|FALSE
+ |on|On|ON|off|Off|OFF)$''', re.X),
+ list('yYnNtTfFoO'))
+
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:float',
+ re.compile(r'''^(?:[-+]?(?:[0-9][0-9_]*)\.[0-9_]*(?:[eE][-+][0-9]+)?
+ |\.[0-9_]+(?:[eE][-+][0-9]+)?
+ |[-+]?[0-9][0-9_]*(?::[0-5]?[0-9])+\.[0-9_]*
+ |[-+]?\.(?:inf|Inf|INF)
+ |\.(?:nan|NaN|NAN))$''', re.X),
+ list('-+0123456789.'))
+
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:int',
+ re.compile(r'''^(?:[-+]?0b[0-1_]+
+ |[-+]?0[0-7_]+
+ |[-+]?(?:0|[1-9][0-9_]*)
+ |[-+]?0x[0-9a-fA-F_]+
+ |[-+]?[1-9][0-9_]*(?::[0-5]?[0-9])+)$''', re.X),
+ list('-+0123456789'))
+
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:merge',
+ re.compile(r'^(?:<<)$'),
+ ['<'])
+
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:null',
+ re.compile(r'''^(?: ~
+ |null|Null|NULL
+ | )$''', re.X),
+ ['~', 'n', 'N', ''])
+
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:timestamp',
+ re.compile(r'''^(?:[0-9][0-9][0-9][0-9]-[0-9][0-9]-[0-9][0-9]
+ |[0-9][0-9][0-9][0-9] -[0-9][0-9]? -[0-9][0-9]?
+ (?:[Tt]|[ \t]+)[0-9][0-9]?
+ :[0-9][0-9] :[0-9][0-9] (?:\.[0-9]*)?
+ (?:[ \t]*(?:Z|[-+][0-9][0-9]?(?::[0-9][0-9])?))?)$''', re.X),
+ list('0123456789'))
+
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:value',
+ re.compile(r'^(?:=)$'),
+ ['='])
+
+# The following resolver is only for documentation purposes. It cannot work
+# because plain scalars cannot start with '!', '&', or '*'.
+Resolver.add_implicit_resolver(
+ 'tag:yaml.org,2002:yaml',
+ re.compile(r'^(?:!|&|\*)$'),
+ list('!&*'))
+
diff --git a/tablib/packages/yaml3/scanner.py b/tablib/packages/yaml3/scanner.py
new file mode 100644
index 0000000..494d975
--- /dev/null
+++ b/tablib/packages/yaml3/scanner.py
@@ -0,0 +1,1448 @@
+
+# Scanner produces tokens of the following types:
+# STREAM-START
+# STREAM-END
+# DIRECTIVE(name, value)
+# DOCUMENT-START
+# DOCUMENT-END
+# BLOCK-SEQUENCE-START
+# BLOCK-MAPPING-START
+# BLOCK-END
+# FLOW-SEQUENCE-START
+# FLOW-MAPPING-START
+# FLOW-SEQUENCE-END
+# FLOW-MAPPING-END
+# BLOCK-ENTRY
+# FLOW-ENTRY
+# KEY
+# VALUE
+# ALIAS(value)
+# ANCHOR(value)
+# TAG(value)
+# SCALAR(value, plain, style)
+#
+# Read comments in the Scanner code for more details.
+#
+
+__all__ = ['Scanner', 'ScannerError']
+
+from .error import MarkedYAMLError
+from .tokens import *
+
+class ScannerError(MarkedYAMLError):
+ pass
+
+class SimpleKey:
+ # See below simple keys treatment.
+
+ def __init__(self, token_number, required, index, line, column, mark):
+ self.token_number = token_number
+ self.required = required
+ self.index = index
+ self.line = line
+ self.column = column
+ self.mark = mark
+
+class Scanner:
+
+ def __init__(self):
+ """Initialize the scanner."""
+ # It is assumed that Scanner and Reader will have a common descendant.
+ # Reader do the dirty work of checking for BOM and converting the
+ # input data to Unicode. It also adds NUL to the end.
+ #
+ # Reader supports the following methods
+ # self.peek(i=0) # peek the next i-th character
+ # self.prefix(l=1) # peek the next l characters
+ # self.forward(l=1) # read the next l characters and move the pointer.
+
+ # Had we reached the end of the stream?
+ self.done = False
+
+ # The number of unclosed '{' and '['. `flow_level == 0` means block
+ # context.
+ self.flow_level = 0
+
+ # List of processed tokens that are not yet emitted.
+ self.tokens = []
+
+ # Add the STREAM-START token.
+ self.fetch_stream_start()
+
+ # Number of tokens that were emitted through the `get_token` method.
+ self.tokens_taken = 0
+
+ # The current indentation level.
+ self.indent = -1
+
+ # Past indentation levels.
+ self.indents = []
+
+ # Variables related to simple keys treatment.
+
+ # A simple key is a key that is not denoted by the '?' indicator.
+ # Example of simple keys:
+ # ---
+ # block simple key: value
+ # ? not a simple key:
+ # : { flow simple key: value }
+ # We emit the KEY token before all keys, so when we find a potential
+ # simple key, we try to locate the corresponding ':' indicator.
+ # Simple keys should be limited to a single line and 1024 characters.
+
+ # Can a simple key start at the current position? A simple key may
+ # start:
+ # - at the beginning of the line, not counting indentation spaces
+ # (in block context),
+ # - after '{', '[', ',' (in the flow context),
+ # - after '?', ':', '-' (in the block context).
+ # In the block context, this flag also signifies if a block collection
+ # may start at the current position.
+ self.allow_simple_key = True
+
+ # Keep track of possible simple keys. This is a dictionary. The key
+ # is `flow_level`; there can be no more that one possible simple key
+ # for each level. The value is a SimpleKey record:
+ # (token_number, required, index, line, column, mark)
+ # A simple key may start with ALIAS, ANCHOR, TAG, SCALAR(flow),
+ # '[', or '{' tokens.
+ self.possible_simple_keys = {}
+
+ # Public methods.
+
+ def check_token(self, *choices):
+ # Check if the next token is one of the given types.
+ while self.need_more_tokens():
+ self.fetch_more_tokens()
+ if self.tokens:
+ if not choices:
+ return True
+ for choice in choices:
+ if isinstance(self.tokens[0], choice):
+ return True
+ return False
+
+ def peek_token(self):
+ # Return the next token, but do not delete if from the queue.
+ while self.need_more_tokens():
+ self.fetch_more_tokens()
+ if self.tokens:
+ return self.tokens[0]
+
+ def get_token(self):
+ # Return the next token.
+ while self.need_more_tokens():
+ self.fetch_more_tokens()
+ if self.tokens:
+ self.tokens_taken += 1
+ return self.tokens.pop(0)
+
+ # Private methods.
+
+ def need_more_tokens(self):
+ if self.done:
+ return False
+ if not self.tokens:
+ return True
+ # The current token may be a potential simple key, so we
+ # need to look further.
+ self.stale_possible_simple_keys()
+ if self.next_possible_simple_key() == self.tokens_taken:
+ return True
+
+ def fetch_more_tokens(self):
+
+ # Eat whitespaces and comments until we reach the next token.
+ self.scan_to_next_token()
+
+ # Remove obsolete possible simple keys.
+ self.stale_possible_simple_keys()
+
+ # Compare the current indentation and column. It may add some tokens
+ # and decrease the current indentation level.
+ self.unwind_indent(self.column)
+
+ # Peek the next character.
+ ch = self.peek()
+
+ # Is it the end of stream?
+ if ch == '\0':
+ return self.fetch_stream_end()
+
+ # Is it a directive?
+ if ch == '%' and self.check_directive():
+ return self.fetch_directive()
+
+ # Is it the document start?
+ if ch == '-' and self.check_document_start():
+ return self.fetch_document_start()
+
+ # Is it the document end?
+ if ch == '.' and self.check_document_end():
+ return self.fetch_document_end()
+
+ # TODO: support for BOM within a stream.
+ #if ch == '\uFEFF':
+ # return self.fetch_bom() <-- issue BOMToken
+
+ # Note: the order of the following checks is NOT significant.
+
+ # Is it the flow sequence start indicator?
+ if ch == '[':
+ return self.fetch_flow_sequence_start()
+
+ # Is it the flow mapping start indicator?
+ if ch == '{':
+ return self.fetch_flow_mapping_start()
+
+ # Is it the flow sequence end indicator?
+ if ch == ']':
+ return self.fetch_flow_sequence_end()
+
+ # Is it the flow mapping end indicator?
+ if ch == '}':
+ return self.fetch_flow_mapping_end()
+
+ # Is it the flow entry indicator?
+ if ch == ',':
+ return self.fetch_flow_entry()
+
+ # Is it the block entry indicator?
+ if ch == '-' and self.check_block_entry():
+ return self.fetch_block_entry()
+
+ # Is it the key indicator?
+ if ch == '?' and self.check_key():
+ return self.fetch_key()
+
+ # Is it the value indicator?
+ if ch == ':' and self.check_value():
+ return self.fetch_value()
+
+ # Is it an alias?
+ if ch == '*':
+ return self.fetch_alias()
+
+ # Is it an anchor?
+ if ch == '&':
+ return self.fetch_anchor()
+
+ # Is it a tag?
+ if ch == '!':
+ return self.fetch_tag()
+
+ # Is it a literal scalar?
+ if ch == '|' and not self.flow_level:
+ return self.fetch_literal()
+
+ # Is it a folded scalar?
+ if ch == '>' and not self.flow_level:
+ return self.fetch_folded()
+
+ # Is it a single quoted scalar?
+ if ch == '\'':
+ return self.fetch_single()
+
+ # Is it a double quoted scalar?
+ if ch == '\"':
+ return self.fetch_double()
+
+ # It must be a plain scalar then.
+ if self.check_plain():
+ return self.fetch_plain()
+
+ # No? It's an error. Let's produce a nice error message.
+ raise ScannerError("while scanning for the next token", None,
+ "found character %r that cannot start any token" % ch,
+ self.get_mark())
+
+ # Simple keys treatment.
+
+ def next_possible_simple_key(self):
+ # Return the number of the nearest possible simple key. Actually we
+ # don't need to loop through the whole dictionary. We may replace it
+ # with the following code:
+ # if not self.possible_simple_keys:
+ # return None
+ # return self.possible_simple_keys[
+ # min(self.possible_simple_keys.keys())].token_number
+ min_token_number = None
+ for level in self.possible_simple_keys:
+ key = self.possible_simple_keys[level]
+ if min_token_number is None or key.token_number < min_token_number:
+ min_token_number = key.token_number
+ return min_token_number
+
+ def stale_possible_simple_keys(self):
+ # Remove entries that are no longer possible simple keys. According to
+ # the YAML specification, simple keys
+ # - should be limited to a single line,
+ # - should be no longer than 1024 characters.
+ # Disabling this procedure will allow simple keys of any length and
+ # height (may cause problems if indentation is broken though).
+ for level in list(self.possible_simple_keys):
+ key = self.possible_simple_keys[level]
+ if key.line != self.line \
+ or self.index-key.index > 1024:
+ if key.required:
+ raise ScannerError("while scanning a simple key", key.mark,
+ "could not found expected ':'", self.get_mark())
+ del self.possible_simple_keys[level]
+
+ def save_possible_simple_key(self):
+ # The next token may start a simple key. We check if it's possible
+ # and save its position. This function is called for
+ # ALIAS, ANCHOR, TAG, SCALAR(flow), '[', and '{'.
+
+ # Check if a simple key is required at the current position.
+ required = not self.flow_level and self.indent == self.column
+
+ # A simple key is required only if it is the first token in the current
+ # line. Therefore it is always allowed.
+ assert self.allow_simple_key or not required
+
+ # The next token might be a simple key. Let's save it's number and
+ # position.
+ if self.allow_simple_key:
+ self.remove_possible_simple_key()
+ token_number = self.tokens_taken+len(self.tokens)
+ key = SimpleKey(token_number, required,
+ self.index, self.line, self.column, self.get_mark())
+ self.possible_simple_keys[self.flow_level] = key
+
+ def remove_possible_simple_key(self):
+ # Remove the saved possible key position at the current flow level.
+ if self.flow_level in self.possible_simple_keys:
+ key = self.possible_simple_keys[self.flow_level]
+
+ if key.required:
+ raise ScannerError("while scanning a simple key", key.mark,
+ "could not found expected ':'", self.get_mark())
+
+ del self.possible_simple_keys[self.flow_level]
+
+ # Indentation functions.
+
+ def unwind_indent(self, column):
+
+ ## In flow context, tokens should respect indentation.
+ ## Actually the condition should be `self.indent >= column` according to
+ ## the spec. But this condition will prohibit intuitively correct
+ ## constructions such as
+ ## key : {
+ ## }
+ #if self.flow_level and self.indent > column:
+ # raise ScannerError(None, None,
+ # "invalid intendation or unclosed '[' or '{'",
+ # self.get_mark())
+
+ # In the flow context, indentation is ignored. We make the scanner less
+ # restrictive then specification requires.
+ if self.flow_level:
+ return
+
+ # In block context, we may need to issue the BLOCK-END tokens.
+ while self.indent > column:
+ mark = self.get_mark()
+ self.indent = self.indents.pop()
+ self.tokens.append(BlockEndToken(mark, mark))
+
+ def add_indent(self, column):
+ # Check if we need to increase indentation.
+ if self.indent < column:
+ self.indents.append(self.indent)
+ self.indent = column
+ return True
+ return False
+
+ # Fetchers.
+
+ def fetch_stream_start(self):
+ # We always add STREAM-START as the first token and STREAM-END as the
+ # last token.
+
+ # Read the token.
+ mark = self.get_mark()
+
+ # Add STREAM-START.
+ self.tokens.append(StreamStartToken(mark, mark,
+ encoding=self.encoding))
+
+
+ def fetch_stream_end(self):
+
+ # Set the current intendation to -1.
+ self.unwind_indent(-1)
+
+ # Reset simple keys.
+ self.remove_possible_simple_key()
+ self.allow_simple_key = False
+ self.possible_simple_keys = {}
+
+ # Read the token.
+ mark = self.get_mark()
+
+ # Add STREAM-END.
+ self.tokens.append(StreamEndToken(mark, mark))
+
+ # The steam is finished.
+ self.done = True
+
+ def fetch_directive(self):
+
+ # Set the current intendation to -1.
+ self.unwind_indent(-1)
+
+ # Reset simple keys.
+ self.remove_possible_simple_key()
+ self.allow_simple_key = False
+
+ # Scan and add DIRECTIVE.
+ self.tokens.append(self.scan_directive())
+
+ def fetch_document_start(self):
+ self.fetch_document_indicator(DocumentStartToken)
+
+ def fetch_document_end(self):
+ self.fetch_document_indicator(DocumentEndToken)
+
+ def fetch_document_indicator(self, TokenClass):
+
+ # Set the current intendation to -1.
+ self.unwind_indent(-1)
+
+ # Reset simple keys. Note that there could not be a block collection
+ # after '---'.
+ self.remove_possible_simple_key()
+ self.allow_simple_key = False
+
+ # Add DOCUMENT-START or DOCUMENT-END.
+ start_mark = self.get_mark()
+ self.forward(3)
+ end_mark = self.get_mark()
+ self.tokens.append(TokenClass(start_mark, end_mark))
+
+ def fetch_flow_sequence_start(self):
+ self.fetch_flow_collection_start(FlowSequenceStartToken)
+
+ def fetch_flow_mapping_start(self):
+ self.fetch_flow_collection_start(FlowMappingStartToken)
+
+ def fetch_flow_collection_start(self, TokenClass):
+
+ # '[' and '{' may start a simple key.
+ self.save_possible_simple_key()
+
+ # Increase the flow level.
+ self.flow_level += 1
+
+ # Simple keys are allowed after '[' and '{'.
+ self.allow_simple_key = True
+
+ # Add FLOW-SEQUENCE-START or FLOW-MAPPING-START.
+ start_mark = self.get_mark()
+ self.forward()
+ end_mark = self.get_mark()
+ self.tokens.append(TokenClass(start_mark, end_mark))
+
+ def fetch_flow_sequence_end(self):
+ self.fetch_flow_collection_end(FlowSequenceEndToken)
+
+ def fetch_flow_mapping_end(self):
+ self.fetch_flow_collection_end(FlowMappingEndToken)
+
+ def fetch_flow_collection_end(self, TokenClass):
+
+ # Reset possible simple key on the current level.
+ self.remove_possible_simple_key()
+
+ # Decrease the flow level.
+ self.flow_level -= 1
+
+ # No simple keys after ']' or '}'.
+ self.allow_simple_key = False
+
+ # Add FLOW-SEQUENCE-END or FLOW-MAPPING-END.
+ start_mark = self.get_mark()
+ self.forward()
+ end_mark = self.get_mark()
+ self.tokens.append(TokenClass(start_mark, end_mark))
+
+ def fetch_flow_entry(self):
+
+ # Simple keys are allowed after ','.
+ self.allow_simple_key = True
+
+ # Reset possible simple key on the current level.
+ self.remove_possible_simple_key()
+
+ # Add FLOW-ENTRY.
+ start_mark = self.get_mark()
+ self.forward()
+ end_mark = self.get_mark()
+ self.tokens.append(FlowEntryToken(start_mark, end_mark))
+
+ def fetch_block_entry(self):
+
+ # Block context needs additional checks.
+ if not self.flow_level:
+
+ # Are we allowed to start a new entry?
+ if not self.allow_simple_key:
+ raise ScannerError(None, None,
+ "sequence entries are not allowed here",
+ self.get_mark())
+
+ # We may need to add BLOCK-SEQUENCE-START.
+ if self.add_indent(self.column):
+ mark = self.get_mark()
+ self.tokens.append(BlockSequenceStartToken(mark, mark))
+
+ # It's an error for the block entry to occur in the flow context,
+ # but we let the parser detect this.
+ else:
+ pass
+
+ # Simple keys are allowed after '-'.
+ self.allow_simple_key = True
+
+ # Reset possible simple key on the current level.
+ self.remove_possible_simple_key()
+
+ # Add BLOCK-ENTRY.
+ start_mark = self.get_mark()
+ self.forward()
+ end_mark = self.get_mark()
+ self.tokens.append(BlockEntryToken(start_mark, end_mark))
+
+ def fetch_key(self):
+
+ # Block context needs additional checks.
+ if not self.flow_level:
+
+ # Are we allowed to start a key (not nessesary a simple)?
+ if not self.allow_simple_key:
+ raise ScannerError(None, None,
+ "mapping keys are not allowed here",
+ self.get_mark())
+
+ # We may need to add BLOCK-MAPPING-START.
+ if self.add_indent(self.column):
+ mark = self.get_mark()
+ self.tokens.append(BlockMappingStartToken(mark, mark))
+
+ # Simple keys are allowed after '?' in the block context.
+ self.allow_simple_key = not self.flow_level
+
+ # Reset possible simple key on the current level.
+ self.remove_possible_simple_key()
+
+ # Add KEY.
+ start_mark = self.get_mark()
+ self.forward()
+ end_mark = self.get_mark()
+ self.tokens.append(KeyToken(start_mark, end_mark))
+
+ def fetch_value(self):
+
+ # Do we determine a simple key?
+ if self.flow_level in self.possible_simple_keys:
+
+ # Add KEY.
+ key = self.possible_simple_keys[self.flow_level]
+ del self.possible_simple_keys[self.flow_level]
+ self.tokens.insert(key.token_number-self.tokens_taken,
+ KeyToken(key.mark, key.mark))
+
+ # If this key starts a new block mapping, we need to add
+ # BLOCK-MAPPING-START.
+ if not self.flow_level:
+ if self.add_indent(key.column):
+ self.tokens.insert(key.token_number-self.tokens_taken,
+ BlockMappingStartToken(key.mark, key.mark))
+
+ # There cannot be two simple keys one after another.
+ self.allow_simple_key = False
+
+ # It must be a part of a complex key.
+ else:
+
+ # Block context needs additional checks.
+ # (Do we really need them? They will be catched by the parser
+ # anyway.)
+ if not self.flow_level:
+
+ # We are allowed to start a complex value if and only if
+ # we can start a simple key.
+ if not self.allow_simple_key:
+ raise ScannerError(None, None,
+ "mapping values are not allowed here",
+ self.get_mark())
+
+ # If this value starts a new block mapping, we need to add
+ # BLOCK-MAPPING-START. It will be detected as an error later by
+ # the parser.
+ if not self.flow_level:
+ if self.add_indent(self.column):
+ mark = self.get_mark()
+ self.tokens.append(BlockMappingStartToken(mark, mark))
+
+ # Simple keys are allowed after ':' in the block context.
+ self.allow_simple_key = not self.flow_level
+
+ # Reset possible simple key on the current level.
+ self.remove_possible_simple_key()
+
+ # Add VALUE.
+ start_mark = self.get_mark()
+ self.forward()
+ end_mark = self.get_mark()
+ self.tokens.append(ValueToken(start_mark, end_mark))
+
+ def fetch_alias(self):
+
+ # ALIAS could be a simple key.
+ self.save_possible_simple_key()
+
+ # No simple keys after ALIAS.
+ self.allow_simple_key = False
+
+ # Scan and add ALIAS.
+ self.tokens.append(self.scan_anchor(AliasToken))
+
+ def fetch_anchor(self):
+
+ # ANCHOR could start a simple key.
+ self.save_possible_simple_key()
+
+ # No simple keys after ANCHOR.
+ self.allow_simple_key = False
+
+ # Scan and add ANCHOR.
+ self.tokens.append(self.scan_anchor(AnchorToken))
+
+ def fetch_tag(self):
+
+ # TAG could start a simple key.
+ self.save_possible_simple_key()
+
+ # No simple keys after TAG.
+ self.allow_simple_key = False
+
+ # Scan and add TAG.
+ self.tokens.append(self.scan_tag())
+
+ def fetch_literal(self):
+ self.fetch_block_scalar(style='|')
+
+ def fetch_folded(self):
+ self.fetch_block_scalar(style='>')
+
+ def fetch_block_scalar(self, style):
+
+ # A simple key may follow a block scalar.
+ self.allow_simple_key = True
+
+ # Reset possible simple key on the current level.
+ self.remove_possible_simple_key()
+
+ # Scan and add SCALAR.
+ self.tokens.append(self.scan_block_scalar(style))
+
+ def fetch_single(self):
+ self.fetch_flow_scalar(style='\'')
+
+ def fetch_double(self):
+ self.fetch_flow_scalar(style='"')
+
+ def fetch_flow_scalar(self, style):
+
+ # A flow scalar could be a simple key.
+ self.save_possible_simple_key()
+
+ # No simple keys after flow scalars.
+ self.allow_simple_key = False
+
+ # Scan and add SCALAR.
+ self.tokens.append(self.scan_flow_scalar(style))
+
+ def fetch_plain(self):
+
+ # A plain scalar could be a simple key.
+ self.save_possible_simple_key()
+
+ # No simple keys after plain scalars. But note that `scan_plain` will
+ # change this flag if the scan is finished at the beginning of the
+ # line.
+ self.allow_simple_key = False
+
+ # Scan and add SCALAR. May change `allow_simple_key`.
+ self.tokens.append(self.scan_plain())
+
+ # Checkers.
+
+ def check_directive(self):
+
+ # DIRECTIVE: ^ '%' ...
+ # The '%' indicator is already checked.
+ if self.column == 0:
+ return True
+
+ def check_document_start(self):
+
+ # DOCUMENT-START: ^ '---' (' '|'\n')
+ if self.column == 0:
+ if self.prefix(3) == '---' \
+ and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ return True
+
+ def check_document_end(self):
+
+ # DOCUMENT-END: ^ '...' (' '|'\n')
+ if self.column == 0:
+ if self.prefix(3) == '...' \
+ and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ return True
+
+ def check_block_entry(self):
+
+ # BLOCK-ENTRY: '-' (' '|'\n')
+ return self.peek(1) in '\0 \t\r\n\x85\u2028\u2029'
+
+ def check_key(self):
+
+ # KEY(flow context): '?'
+ if self.flow_level:
+ return True
+
+ # KEY(block context): '?' (' '|'\n')
+ else:
+ return self.peek(1) in '\0 \t\r\n\x85\u2028\u2029'
+
+ def check_value(self):
+
+ # VALUE(flow context): ':'
+ if self.flow_level:
+ return True
+
+ # VALUE(block context): ':' (' '|'\n')
+ else:
+ return self.peek(1) in '\0 \t\r\n\x85\u2028\u2029'
+
+ def check_plain(self):
+
+ # A plain scalar may start with any non-space character except:
+ # '-', '?', ':', ',', '[', ']', '{', '}',
+ # '#', '&', '*', '!', '|', '>', '\'', '\"',
+ # '%', '@', '`'.
+ #
+ # It may also start with
+ # '-', '?', ':'
+ # if it is followed by a non-space character.
+ #
+ # Note that we limit the last rule to the block context (except the
+ # '-' character) because we want the flow context to be space
+ # independent.
+ ch = self.peek()
+ return ch not in '\0 \t\r\n\x85\u2028\u2029-?:,[]{}#&*!|>\'\"%@`' \
+ or (self.peek(1) not in '\0 \t\r\n\x85\u2028\u2029'
+ and (ch == '-' or (not self.flow_level and ch in '?:')))
+
+ # Scanners.
+
+ def scan_to_next_token(self):
+ # We ignore spaces, line breaks and comments.
+ # If we find a line break in the block context, we set the flag
+ # `allow_simple_key` on.
+ # The byte order mark is stripped if it's the first character in the
+ # stream. We do not yet support BOM inside the stream as the
+ # specification requires. Any such mark will be considered as a part
+ # of the document.
+ #
+ # TODO: We need to make tab handling rules more sane. A good rule is
+ # Tabs cannot precede tokens
+ # BLOCK-SEQUENCE-START, BLOCK-MAPPING-START, BLOCK-END,
+ # KEY(block), VALUE(block), BLOCK-ENTRY
+ # So the checking code is
+ # if <TAB>:
+ # self.allow_simple_keys = False
+ # We also need to add the check for `allow_simple_keys == True` to
+ # `unwind_indent` before issuing BLOCK-END.
+ # Scanners for block, flow, and plain scalars need to be modified.
+
+ if self.index == 0 and self.peek() == '\uFEFF':
+ self.forward()
+ found = False
+ while not found:
+ while self.peek() == ' ':
+ self.forward()
+ if self.peek() == '#':
+ while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ self.forward()
+ if self.scan_line_break():
+ if not self.flow_level:
+ self.allow_simple_key = True
+ else:
+ found = True
+
+ def scan_directive(self):
+ # See the specification for details.
+ start_mark = self.get_mark()
+ self.forward()
+ name = self.scan_directive_name(start_mark)
+ value = None
+ if name == 'YAML':
+ value = self.scan_yaml_directive_value(start_mark)
+ end_mark = self.get_mark()
+ elif name == 'TAG':
+ value = self.scan_tag_directive_value(start_mark)
+ end_mark = self.get_mark()
+ else:
+ end_mark = self.get_mark()
+ while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ self.forward()
+ self.scan_directive_ignored_line(start_mark)
+ return DirectiveToken(name, value, start_mark, end_mark)
+
+ def scan_directive_name(self, start_mark):
+ # See the specification for details.
+ length = 0
+ ch = self.peek(length)
+ while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-_':
+ length += 1
+ ch = self.peek(length)
+ if not length:
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected alphabetic or numeric character, but found %r"
+ % ch, self.get_mark())
+ value = self.prefix(length)
+ self.forward(length)
+ ch = self.peek()
+ if ch not in '\0 \r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected alphabetic or numeric character, but found %r"
+ % ch, self.get_mark())
+ return value
+
+ def scan_yaml_directive_value(self, start_mark):
+ # See the specification for details.
+ while self.peek() == ' ':
+ self.forward()
+ major = self.scan_yaml_directive_number(start_mark)
+ if self.peek() != '.':
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected a digit or '.', but found %r" % self.peek(),
+ self.get_mark())
+ self.forward()
+ minor = self.scan_yaml_directive_number(start_mark)
+ if self.peek() not in '\0 \r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected a digit or ' ', but found %r" % self.peek(),
+ self.get_mark())
+ return (major, minor)
+
+ def scan_yaml_directive_number(self, start_mark):
+ # See the specification for details.
+ ch = self.peek()
+ if not ('0' <= ch <= '9'):
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected a digit, but found %r" % ch, self.get_mark())
+ length = 0
+ while '0' <= self.peek(length) <= '9':
+ length += 1
+ value = int(self.prefix(length))
+ self.forward(length)
+ return value
+
+ def scan_tag_directive_value(self, start_mark):
+ # See the specification for details.
+ while self.peek() == ' ':
+ self.forward()
+ handle = self.scan_tag_directive_handle(start_mark)
+ while self.peek() == ' ':
+ self.forward()
+ prefix = self.scan_tag_directive_prefix(start_mark)
+ return (handle, prefix)
+
+ def scan_tag_directive_handle(self, start_mark):
+ # See the specification for details.
+ value = self.scan_tag_handle('directive', start_mark)
+ ch = self.peek()
+ if ch != ' ':
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected ' ', but found %r" % ch, self.get_mark())
+ return value
+
+ def scan_tag_directive_prefix(self, start_mark):
+ # See the specification for details.
+ value = self.scan_tag_uri('directive', start_mark)
+ ch = self.peek()
+ if ch not in '\0 \r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected ' ', but found %r" % ch, self.get_mark())
+ return value
+
+ def scan_directive_ignored_line(self, start_mark):
+ # See the specification for details.
+ while self.peek() == ' ':
+ self.forward()
+ if self.peek() == '#':
+ while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ self.forward()
+ ch = self.peek()
+ if ch not in '\0\r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a directive", start_mark,
+ "expected a comment or a line break, but found %r"
+ % ch, self.get_mark())
+ self.scan_line_break()
+
+ def scan_anchor(self, TokenClass):
+ # The specification does not restrict characters for anchors and
+ # aliases. This may lead to problems, for instance, the document:
+ # [ *alias, value ]
+ # can be interpteted in two ways, as
+ # [ "value" ]
+ # and
+ # [ *alias , "value" ]
+ # Therefore we restrict aliases to numbers and ASCII letters.
+ start_mark = self.get_mark()
+ indicator = self.peek()
+ if indicator == '*':
+ name = 'alias'
+ else:
+ name = 'anchor'
+ self.forward()
+ length = 0
+ ch = self.peek(length)
+ while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-_':
+ length += 1
+ ch = self.peek(length)
+ if not length:
+ raise ScannerError("while scanning an %s" % name, start_mark,
+ "expected alphabetic or numeric character, but found %r"
+ % ch, self.get_mark())
+ value = self.prefix(length)
+ self.forward(length)
+ ch = self.peek()
+ if ch not in '\0 \t\r\n\x85\u2028\u2029?:,]}%@`':
+ raise ScannerError("while scanning an %s" % name, start_mark,
+ "expected alphabetic or numeric character, but found %r"
+ % ch, self.get_mark())
+ end_mark = self.get_mark()
+ return TokenClass(value, start_mark, end_mark)
+
+ def scan_tag(self):
+ # See the specification for details.
+ start_mark = self.get_mark()
+ ch = self.peek(1)
+ if ch == '<':
+ handle = None
+ self.forward(2)
+ suffix = self.scan_tag_uri('tag', start_mark)
+ if self.peek() != '>':
+ raise ScannerError("while parsing a tag", start_mark,
+ "expected '>', but found %r" % self.peek(),
+ self.get_mark())
+ self.forward()
+ elif ch in '\0 \t\r\n\x85\u2028\u2029':
+ handle = None
+ suffix = '!'
+ self.forward()
+ else:
+ length = 1
+ use_handle = False
+ while ch not in '\0 \r\n\x85\u2028\u2029':
+ if ch == '!':
+ use_handle = True
+ break
+ length += 1
+ ch = self.peek(length)
+ handle = '!'
+ if use_handle:
+ handle = self.scan_tag_handle('tag', start_mark)
+ else:
+ handle = '!'
+ self.forward()
+ suffix = self.scan_tag_uri('tag', start_mark)
+ ch = self.peek()
+ if ch not in '\0 \r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a tag", start_mark,
+ "expected ' ', but found %r" % ch, self.get_mark())
+ value = (handle, suffix)
+ end_mark = self.get_mark()
+ return TagToken(value, start_mark, end_mark)
+
+ def scan_block_scalar(self, style):
+ # See the specification for details.
+
+ if style == '>':
+ folded = True
+ else:
+ folded = False
+
+ chunks = []
+ start_mark = self.get_mark()
+
+ # Scan the header.
+ self.forward()
+ chomping, increment = self.scan_block_scalar_indicators(start_mark)
+ self.scan_block_scalar_ignored_line(start_mark)
+
+ # Determine the indentation level and go to the first non-empty line.
+ min_indent = self.indent+1
+ if min_indent < 1:
+ min_indent = 1
+ if increment is None:
+ breaks, max_indent, end_mark = self.scan_block_scalar_indentation()
+ indent = max(min_indent, max_indent)
+ else:
+ indent = min_indent+increment-1
+ breaks, end_mark = self.scan_block_scalar_breaks(indent)
+ line_break = ''
+
+ # Scan the inner part of the block scalar.
+ while self.column == indent and self.peek() != '\0':
+ chunks.extend(breaks)
+ leading_non_space = self.peek() not in ' \t'
+ length = 0
+ while self.peek(length) not in '\0\r\n\x85\u2028\u2029':
+ length += 1
+ chunks.append(self.prefix(length))
+ self.forward(length)
+ line_break = self.scan_line_break()
+ breaks, end_mark = self.scan_block_scalar_breaks(indent)
+ if self.column == indent and self.peek() != '\0':
+
+ # Unfortunately, folding rules are ambiguous.
+ #
+ # This is the folding according to the specification:
+
+ if folded and line_break == '\n' \
+ and leading_non_space and self.peek() not in ' \t':
+ if not breaks:
+ chunks.append(' ')
+ else:
+ chunks.append(line_break)
+
+ # This is Clark Evans's interpretation (also in the spec
+ # examples):
+ #
+ #if folded and line_break == '\n':
+ # if not breaks:
+ # if self.peek() not in ' \t':
+ # chunks.append(' ')
+ # else:
+ # chunks.append(line_break)
+ #else:
+ # chunks.append(line_break)
+ else:
+ break
+
+ # Chomp the tail.
+ if chomping is not False:
+ chunks.append(line_break)
+ if chomping is True:
+ chunks.extend(breaks)
+
+ # We are done.
+ return ScalarToken(''.join(chunks), False, start_mark, end_mark,
+ style)
+
+ def scan_block_scalar_indicators(self, start_mark):
+ # See the specification for details.
+ chomping = None
+ increment = None
+ ch = self.peek()
+ if ch in '+-':
+ if ch == '+':
+ chomping = True
+ else:
+ chomping = False
+ self.forward()
+ ch = self.peek()
+ if ch in '0123456789':
+ increment = int(ch)
+ if increment == 0:
+ raise ScannerError("while scanning a block scalar", start_mark,
+ "expected indentation indicator in the range 1-9, but found 0",
+ self.get_mark())
+ self.forward()
+ elif ch in '0123456789':
+ increment = int(ch)
+ if increment == 0:
+ raise ScannerError("while scanning a block scalar", start_mark,
+ "expected indentation indicator in the range 1-9, but found 0",
+ self.get_mark())
+ self.forward()
+ ch = self.peek()
+ if ch in '+-':
+ if ch == '+':
+ chomping = True
+ else:
+ chomping = False
+ self.forward()
+ ch = self.peek()
+ if ch not in '\0 \r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a block scalar", start_mark,
+ "expected chomping or indentation indicators, but found %r"
+ % ch, self.get_mark())
+ return chomping, increment
+
+ def scan_block_scalar_ignored_line(self, start_mark):
+ # See the specification for details.
+ while self.peek() == ' ':
+ self.forward()
+ if self.peek() == '#':
+ while self.peek() not in '\0\r\n\x85\u2028\u2029':
+ self.forward()
+ ch = self.peek()
+ if ch not in '\0\r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a block scalar", start_mark,
+ "expected a comment or a line break, but found %r" % ch,
+ self.get_mark())
+ self.scan_line_break()
+
+ def scan_block_scalar_indentation(self):
+ # See the specification for details.
+ chunks = []
+ max_indent = 0
+ end_mark = self.get_mark()
+ while self.peek() in ' \r\n\x85\u2028\u2029':
+ if self.peek() != ' ':
+ chunks.append(self.scan_line_break())
+ end_mark = self.get_mark()
+ else:
+ self.forward()
+ if self.column > max_indent:
+ max_indent = self.column
+ return chunks, max_indent, end_mark
+
+ def scan_block_scalar_breaks(self, indent):
+ # See the specification for details.
+ chunks = []
+ end_mark = self.get_mark()
+ while self.column < indent and self.peek() == ' ':
+ self.forward()
+ while self.peek() in '\r\n\x85\u2028\u2029':
+ chunks.append(self.scan_line_break())
+ end_mark = self.get_mark()
+ while self.column < indent and self.peek() == ' ':
+ self.forward()
+ return chunks, end_mark
+
+ def scan_flow_scalar(self, style):
+ # See the specification for details.
+ # Note that we loose indentation rules for quoted scalars. Quoted
+ # scalars don't need to adhere indentation because " and ' clearly
+ # mark the beginning and the end of them. Therefore we are less
+ # restrictive then the specification requires. We only need to check
+ # that document separators are not included in scalars.
+ if style == '"':
+ double = True
+ else:
+ double = False
+ chunks = []
+ start_mark = self.get_mark()
+ quote = self.peek()
+ self.forward()
+ chunks.extend(self.scan_flow_scalar_non_spaces(double, start_mark))
+ while self.peek() != quote:
+ chunks.extend(self.scan_flow_scalar_spaces(double, start_mark))
+ chunks.extend(self.scan_flow_scalar_non_spaces(double, start_mark))
+ self.forward()
+ end_mark = self.get_mark()
+ return ScalarToken(''.join(chunks), False, start_mark, end_mark,
+ style)
+
+ ESCAPE_REPLACEMENTS = {
+ '0': '\0',
+ 'a': '\x07',
+ 'b': '\x08',
+ 't': '\x09',
+ '\t': '\x09',
+ 'n': '\x0A',
+ 'v': '\x0B',
+ 'f': '\x0C',
+ 'r': '\x0D',
+ 'e': '\x1B',
+ ' ': '\x20',
+ '\"': '\"',
+ '\\': '\\',
+ 'N': '\x85',
+ '_': '\xA0',
+ 'L': '\u2028',
+ 'P': '\u2029',
+ }
+
+ ESCAPE_CODES = {
+ 'x': 2,
+ 'u': 4,
+ 'U': 8,
+ }
+
+ def scan_flow_scalar_non_spaces(self, double, start_mark):
+ # See the specification for details.
+ chunks = []
+ while True:
+ length = 0
+ while self.peek(length) not in '\'\"\\\0 \t\r\n\x85\u2028\u2029':
+ length += 1
+ if length:
+ chunks.append(self.prefix(length))
+ self.forward(length)
+ ch = self.peek()
+ if not double and ch == '\'' and self.peek(1) == '\'':
+ chunks.append('\'')
+ self.forward(2)
+ elif (double and ch == '\'') or (not double and ch in '\"\\'):
+ chunks.append(ch)
+ self.forward()
+ elif double and ch == '\\':
+ self.forward()
+ ch = self.peek()
+ if ch in self.ESCAPE_REPLACEMENTS:
+ chunks.append(self.ESCAPE_REPLACEMENTS[ch])
+ self.forward()
+ elif ch in self.ESCAPE_CODES:
+ length = self.ESCAPE_CODES[ch]
+ self.forward()
+ for k in range(length):
+ if self.peek(k) not in '0123456789ABCDEFabcdef':
+ raise ScannerError("while scanning a double-quoted scalar", start_mark,
+ "expected escape sequence of %d hexdecimal numbers, but found %r" %
+ (length, self.peek(k)), self.get_mark())
+ code = int(self.prefix(length), 16)
+ chunks.append(chr(code))
+ self.forward(length)
+ elif ch in '\r\n\x85\u2028\u2029':
+ self.scan_line_break()
+ chunks.extend(self.scan_flow_scalar_breaks(double, start_mark))
+ else:
+ raise ScannerError("while scanning a double-quoted scalar", start_mark,
+ "found unknown escape character %r" % ch, self.get_mark())
+ else:
+ return chunks
+
+ def scan_flow_scalar_spaces(self, double, start_mark):
+ # See the specification for details.
+ chunks = []
+ length = 0
+ while self.peek(length) in ' \t':
+ length += 1
+ whitespaces = self.prefix(length)
+ self.forward(length)
+ ch = self.peek()
+ if ch == '\0':
+ raise ScannerError("while scanning a quoted scalar", start_mark,
+ "found unexpected end of stream", self.get_mark())
+ elif ch in '\r\n\x85\u2028\u2029':
+ line_break = self.scan_line_break()
+ breaks = self.scan_flow_scalar_breaks(double, start_mark)
+ if line_break != '\n':
+ chunks.append(line_break)
+ elif not breaks:
+ chunks.append(' ')
+ chunks.extend(breaks)
+ else:
+ chunks.append(whitespaces)
+ return chunks
+
+ def scan_flow_scalar_breaks(self, double, start_mark):
+ # See the specification for details.
+ chunks = []
+ while True:
+ # Instead of checking indentation, we check for document
+ # separators.
+ prefix = self.prefix(3)
+ if (prefix == '---' or prefix == '...') \
+ and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ raise ScannerError("while scanning a quoted scalar", start_mark,
+ "found unexpected document separator", self.get_mark())
+ while self.peek() in ' \t':
+ self.forward()
+ if self.peek() in '\r\n\x85\u2028\u2029':
+ chunks.append(self.scan_line_break())
+ else:
+ return chunks
+
+ def scan_plain(self):
+ # See the specification for details.
+ # We add an additional restriction for the flow context:
+ # plain scalars in the flow context cannot contain ',', ':' and '?'.
+ # We also keep track of the `allow_simple_key` flag here.
+ # Indentation rules are loosed for the flow context.
+ chunks = []
+ start_mark = self.get_mark()
+ end_mark = start_mark
+ indent = self.indent+1
+ # We allow zero indentation for scalars, but then we need to check for
+ # document separators at the beginning of the line.
+ #if indent == 0:
+ # indent = 1
+ spaces = []
+ while True:
+ length = 0
+ if self.peek() == '#':
+ break
+ while True:
+ ch = self.peek(length)
+ if ch in '\0 \t\r\n\x85\u2028\u2029' \
+ or (not self.flow_level and ch == ':' and
+ self.peek(length+1) in '\0 \t\r\n\x85\u2028\u2029') \
+ or (self.flow_level and ch in ',:?[]{}'):
+ break
+ length += 1
+ # It's not clear what we should do with ':' in the flow context.
+ if (self.flow_level and ch == ':'
+ and self.peek(length+1) not in '\0 \t\r\n\x85\u2028\u2029,[]{}'):
+ self.forward(length)
+ raise ScannerError("while scanning a plain scalar", start_mark,
+ "found unexpected ':'", self.get_mark(),
+ "Please check http://pyyaml.org/wiki/YAMLColonInFlowContext for details.")
+ if length == 0:
+ break
+ self.allow_simple_key = False
+ chunks.extend(spaces)
+ chunks.append(self.prefix(length))
+ self.forward(length)
+ end_mark = self.get_mark()
+ spaces = self.scan_plain_spaces(indent, start_mark)
+ if not spaces or self.peek() == '#' \
+ or (not self.flow_level and self.column < indent):
+ break
+ return ScalarToken(''.join(chunks), True, start_mark, end_mark)
+
+ def scan_plain_spaces(self, indent, start_mark):
+ # See the specification for details.
+ # The specification is really confusing about tabs in plain scalars.
+ # We just forbid them completely. Do not use tabs in YAML!
+ chunks = []
+ length = 0
+ while self.peek(length) in ' ':
+ length += 1
+ whitespaces = self.prefix(length)
+ self.forward(length)
+ ch = self.peek()
+ if ch in '\r\n\x85\u2028\u2029':
+ line_break = self.scan_line_break()
+ self.allow_simple_key = True
+ prefix = self.prefix(3)
+ if (prefix == '---' or prefix == '...') \
+ and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ return
+ breaks = []
+ while self.peek() in ' \r\n\x85\u2028\u2029':
+ if self.peek() == ' ':
+ self.forward()
+ else:
+ breaks.append(self.scan_line_break())
+ prefix = self.prefix(3)
+ if (prefix == '---' or prefix == '...') \
+ and self.peek(3) in '\0 \t\r\n\x85\u2028\u2029':
+ return
+ if line_break != '\n':
+ chunks.append(line_break)
+ elif not breaks:
+ chunks.append(' ')
+ chunks.extend(breaks)
+ elif whitespaces:
+ chunks.append(whitespaces)
+ return chunks
+
+ def scan_tag_handle(self, name, start_mark):
+ # See the specification for details.
+ # For some strange reasons, the specification does not allow '_' in
+ # tag handles. I have allowed it anyway.
+ ch = self.peek()
+ if ch != '!':
+ raise ScannerError("while scanning a %s" % name, start_mark,
+ "expected '!', but found %r" % ch, self.get_mark())
+ length = 1
+ ch = self.peek(length)
+ if ch != ' ':
+ while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-_':
+ length += 1
+ ch = self.peek(length)
+ if ch != '!':
+ self.forward(length)
+ raise ScannerError("while scanning a %s" % name, start_mark,
+ "expected '!', but found %r" % ch, self.get_mark())
+ length += 1
+ value = self.prefix(length)
+ self.forward(length)
+ return value
+
+ def scan_tag_uri(self, name, start_mark):
+ # See the specification for details.
+ # Note: we do not check if URI is well-formed.
+ chunks = []
+ length = 0
+ ch = self.peek(length)
+ while '0' <= ch <= '9' or 'A' <= ch <= 'Z' or 'a' <= ch <= 'z' \
+ or ch in '-;/?:@&=+$,_.!~*\'()[]%':
+ if ch == '%':
+ chunks.append(self.prefix(length))
+ self.forward(length)
+ length = 0
+ chunks.append(self.scan_uri_escapes(name, start_mark))
+ else:
+ length += 1
+ ch = self.peek(length)
+ if length:
+ chunks.append(self.prefix(length))
+ self.forward(length)
+ length = 0
+ if not chunks:
+ raise ScannerError("while parsing a %s" % name, start_mark,
+ "expected URI, but found %r" % ch, self.get_mark())
+ return ''.join(chunks)
+
+ def scan_uri_escapes(self, name, start_mark):
+ # See the specification for details.
+ codes = []
+ mark = self.get_mark()
+ while self.peek() == '%':
+ self.forward()
+ for k in range(2):
+ if self.peek(k) not in '0123456789ABCDEFabcdef':
+ raise ScannerError("while scanning a %s" % name, start_mark,
+ "expected URI escape sequence of 2 hexdecimal numbers, but found %r"
+ % self.peek(k), self.get_mark())
+ codes.append(int(self.prefix(2), 16))
+ self.forward(2)
+ try:
+ value = bytes(codes).decode('utf-8')
+ except UnicodeDecodeError as exc:
+ raise ScannerError("while scanning a %s" % name, start_mark, str(exc), mark)
+ return value
+
+ def scan_line_break(self):
+ # Transforms:
+ # '\r\n' : '\n'
+ # '\r' : '\n'
+ # '\n' : '\n'
+ # '\x85' : '\n'
+ # '\u2028' : '\u2028'
+ # '\u2029 : '\u2029'
+ # default : ''
+ ch = self.peek()
+ if ch in '\r\n\x85':
+ if self.prefix(2) == '\r\n':
+ self.forward(2)
+ else:
+ self.forward()
+ return '\n'
+ elif ch in '\u2028\u2029':
+ self.forward()
+ return ch
+ return ''
+
+#try:
+# import psyco
+# psyco.bind(Scanner)
+#except ImportError:
+# pass
+
diff --git a/tablib/packages/yaml3/serializer.py b/tablib/packages/yaml3/serializer.py
new file mode 100644
index 0000000..fe911e6
--- /dev/null
+++ b/tablib/packages/yaml3/serializer.py
@@ -0,0 +1,111 @@
+
+__all__ = ['Serializer', 'SerializerError']
+
+from .error import YAMLError
+from .events import *
+from .nodes import *
+
+class SerializerError(YAMLError):
+ pass
+
+class Serializer:
+
+ ANCHOR_TEMPLATE = 'id%03d'
+
+ def __init__(self, encoding=None,
+ explicit_start=None, explicit_end=None, version=None, tags=None):
+ self.use_encoding = encoding
+ self.use_explicit_start = explicit_start
+ self.use_explicit_end = explicit_end
+ self.use_version = version
+ self.use_tags = tags
+ self.serialized_nodes = {}
+ self.anchors = {}
+ self.last_anchor_id = 0
+ self.closed = None
+
+ def open(self):
+ if self.closed is None:
+ self.emit(StreamStartEvent(encoding=self.use_encoding))
+ self.closed = False
+ elif self.closed:
+ raise SerializerError("serializer is closed")
+ else:
+ raise SerializerError("serializer is already opened")
+
+ def close(self):
+ if self.closed is None:
+ raise SerializerError("serializer is not opened")
+ elif not self.closed:
+ self.emit(StreamEndEvent())
+ self.closed = True
+
+ #def __del__(self):
+ # self.close()
+
+ def serialize(self, node):
+ if self.closed is None:
+ raise SerializerError("serializer is not opened")
+ elif self.closed:
+ raise SerializerError("serializer is closed")
+ self.emit(DocumentStartEvent(explicit=self.use_explicit_start,
+ version=self.use_version, tags=self.use_tags))
+ self.anchor_node(node)
+ self.serialize_node(node, None, None)
+ self.emit(DocumentEndEvent(explicit=self.use_explicit_end))
+ self.serialized_nodes = {}
+ self.anchors = {}
+ self.last_anchor_id = 0
+
+ def anchor_node(self, node):
+ if node in self.anchors:
+ if self.anchors[node] is None:
+ self.anchors[node] = self.generate_anchor(node)
+ else:
+ self.anchors[node] = None
+ if isinstance(node, SequenceNode):
+ for item in node.value:
+ self.anchor_node(item)
+ elif isinstance(node, MappingNode):
+ for key, value in node.value:
+ self.anchor_node(key)
+ self.anchor_node(value)
+
+ def generate_anchor(self, node):
+ self.last_anchor_id += 1
+ return self.ANCHOR_TEMPLATE % self.last_anchor_id
+
+ def serialize_node(self, node, parent, index):
+ alias = self.anchors[node]
+ if node in self.serialized_nodes:
+ self.emit(AliasEvent(alias))
+ else:
+ self.serialized_nodes[node] = True
+ self.descend_resolver(parent, index)
+ if isinstance(node, ScalarNode):
+ detected_tag = self.resolve(ScalarNode, node.value, (True, False))
+ default_tag = self.resolve(ScalarNode, node.value, (False, True))
+ implicit = (node.tag == detected_tag), (node.tag == default_tag)
+ self.emit(ScalarEvent(alias, node.tag, implicit, node.value,
+ style=node.style))
+ elif isinstance(node, SequenceNode):
+ implicit = (node.tag
+ == self.resolve(SequenceNode, node.value, True))
+ self.emit(SequenceStartEvent(alias, node.tag, implicit,
+ flow_style=node.flow_style))
+ index = 0
+ for item in node.value:
+ self.serialize_node(item, node, index)
+ index += 1
+ self.emit(SequenceEndEvent())
+ elif isinstance(node, MappingNode):
+ implicit = (node.tag
+ == self.resolve(MappingNode, node.value, True))
+ self.emit(MappingStartEvent(alias, node.tag, implicit,
+ flow_style=node.flow_style))
+ for key, value in node.value:
+ self.serialize_node(key, node, None)
+ self.serialize_node(value, node, key)
+ self.emit(MappingEndEvent())
+ self.ascend_resolver()
+
diff --git a/tablib/packages/yaml3/tokens.py b/tablib/packages/yaml3/tokens.py
new file mode 100644
index 0000000..4d0b48a
--- /dev/null
+++ b/tablib/packages/yaml3/tokens.py
@@ -0,0 +1,104 @@
+
+class Token(object):
+ def __init__(self, start_mark, end_mark):
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ def __repr__(self):
+ attributes = [key for key in self.__dict__
+ if not key.endswith('_mark')]
+ attributes.sort()
+ arguments = ', '.join(['%s=%r' % (key, getattr(self, key))
+ for key in attributes])
+ return '%s(%s)' % (self.__class__.__name__, arguments)
+
+#class BOMToken(Token):
+# id = '<byte order mark>'
+
+class DirectiveToken(Token):
+ id = '<directive>'
+ def __init__(self, name, value, start_mark, end_mark):
+ self.name = name
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+
+class DocumentStartToken(Token):
+ id = '<document start>'
+
+class DocumentEndToken(Token):
+ id = '<document end>'
+
+class StreamStartToken(Token):
+ id = '<stream start>'
+ def __init__(self, start_mark=None, end_mark=None,
+ encoding=None):
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.encoding = encoding
+
+class StreamEndToken(Token):
+ id = '<stream end>'
+
+class BlockSequenceStartToken(Token):
+ id = '<block sequence start>'
+
+class BlockMappingStartToken(Token):
+ id = '<block mapping start>'
+
+class BlockEndToken(Token):
+ id = '<block end>'
+
+class FlowSequenceStartToken(Token):
+ id = '['
+
+class FlowMappingStartToken(Token):
+ id = '{'
+
+class FlowSequenceEndToken(Token):
+ id = ']'
+
+class FlowMappingEndToken(Token):
+ id = '}'
+
+class KeyToken(Token):
+ id = '?'
+
+class ValueToken(Token):
+ id = ':'
+
+class BlockEntryToken(Token):
+ id = '-'
+
+class FlowEntryToken(Token):
+ id = ','
+
+class AliasToken(Token):
+ id = '<alias>'
+ def __init__(self, value, start_mark, end_mark):
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+
+class AnchorToken(Token):
+ id = '<anchor>'
+ def __init__(self, value, start_mark, end_mark):
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+
+class TagToken(Token):
+ id = '<tag>'
+ def __init__(self, value, start_mark, end_mark):
+ self.value = value
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+
+class ScalarToken(Token):
+ id = '<scalar>'
+ def __init__(self, value, plain, start_mark, end_mark, style=None):
+ self.value = value
+ self.plain = plain
+ self.start_mark = start_mark
+ self.end_mark = end_mark
+ self.style = style
+